Imatinib Mesylate
(KTUFNOKKBVMGRW-UHFFFAOYSA-N)
Structure
- SMILES
- CN1CCN(CC1)Cc1ccc(cc1)C(=O)Nc1ccc(c(c1)Nc1nccc(n1)c1cccnc1)C
- Type(s)
- Approved
- ATC code(s)
- L01XE01
- Molecular Formula:
- C29H31N7O
- Molecular Weight:
- 493.603
- Log P:
- 4.6121
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 86.28
- CAS Number(s):
- 152459-95-5
Synonym(s)
1.
Imatinib Mesylate
2.
Alpha-(4-methyl-1-piperazinyl)-3'-((4-(3-pyridyl)-2-pyrimidinyl)amino)-p-tolu-p-toluidide
3.
CGP 57148
4.
CGP-57148
5.
CGP57148B
6.
Gleevec
7.
Glivec
8.
Imatinib
9.
Imatinib Methanesulfonate
10.
ST 1571
11.
ST1571
12.
STI 571
13.
STI-571
14.
STI571
15.
CGP57148
16.
Mesylate, Imatinib
17.
Methanesulfonate, Imatinib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 251 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Nausea | FAERS: 166 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Drug resistance | FAERS: 163 Canada Vigilance: 7 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Drug ineffective | FAERS: 129 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 5 | Fatigue | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 6 | Vomiting | FAERS: 93 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Thrombocytopenia | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Pancytopenia | FAERS: 76 | SIDER US FAERS | |
| 9 | Disease Progression | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Neutropenia | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Abdominal Pain | FAERS: 62 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Pneumonia | FAERS: 62 | SIDER US FAERS | |
| 13 | Sepsis | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | treatment failure | FAERS: 57 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 15 | Product substitution issue | FAERS: 56 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 16 | Malaise | FAERS: 49 | SIDER US FAERS | |
| 17 | Headache | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Infection | FAERS: 45 | OFFSIDES SIDER US FAERS | |
| 19 | Toxicity to various agents | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | General physical health deterioration | FAERS: 42 | OFFSIDES US FAERS | |
| 21 | Arthralgia | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Metastasis | FAERS: 38 | US FAERS | |
| 23 | Pruritus | FAERS: 37 | SIDER US FAERS | |
| 24 | Asthenia | FAERS: 36 | SIDER US FAERS | |
| 25 | Pain | FAERS: 36 | SIDER US FAERS | |
| 26 | Gastric Antral Vascular Ectasia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Myalgia | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 28 | Product use in unapproved indication | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 29 | MYELODYSPLASTIC SYNDROME | FAERS: 31 | US FAERS | |
| 30 | Weight decreased | FAERS: 30 | SIDER US FAERS | |
| 31 | Cerebrovascular accident | FAERS: 29 | US FAERS | |
| 32 | Disease recurrence | FAERS: 29 | US FAERS | |
| 33 | Splenomegaly | FAERS: 28 | US FAERS | |
| 34 | Leukopenia | FAERS: 27 | SIDER US FAERS | |
| 35 | Abdominal discomfort | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 36 | Dizziness | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | White blood cell count decreased | FAERS: 25 | SIDER US FAERS | |
| 38 | Ascites | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 39 | Haematotoxicity | FAERS: 24 | US FAERS | |
| 40 | Maternal exposure during pregnancy | FAERS: 24 | US FAERS | |
| 41 | Myocardial Infarction | FAERS: 24 | SIDER US FAERS | |
| 42 | Septic Shock | FAERS: 24 | US FAERS | |
| 43 | Therapy non-responder | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 44 | Respiratory Failure | FAERS: 23 | US FAERS | |
| 45 | Bone pain | FAERS: 21 | SIDER US FAERS | |
| 46 | Exposure via father | FAERS: 21 | US FAERS | |
| 47 | Hypersensitivity | FAERS: 21 | SIDER US FAERS | |
| 48 | Myelofibrosis | FAERS: 20 | US FAERS | |
| 49 | No adverse event | FAERS: 20 | US FAERS | |
| 50 | Pseudoporphyria | FAERS: 20 | US FAERS | |
| 51 | Alopecia | FAERS: 19 | SIDER US FAERS | |
| 52 | Drug level increased | FAERS: 19 | US FAERS | |
| 53 | Gene Mutation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Lymphadenopathy | FAERS: 19 | SIDER US FAERS | |
| 55 | Philadelphia chromosome positive | FAERS: 19 | US FAERS | |
| 56 | Swelling | FAERS: 19 | US FAERS | |
| 57 | Chest Pain | FAERS: 18 | SIDER US FAERS | |
| 58 | Drug effect incomplete | FAERS: 18 | US FAERS | |
| 59 | Dyspepsia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Back Pain | FAERS: 17 | SIDER US FAERS | |
| 61 | Constipation | FAERS: 17 | SIDER US FAERS | |
| 62 | Drug exposure during pregnancy | FAERS: 17 | US FAERS | |
| 63 | Peripheral swelling | FAERS: 17 | US FAERS | |
| 64 | Blood creatinine increased | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 65 | Dehydration | FAERS: 16 | SIDER US FAERS | |
| 66 | Leukocytosis | FAERS: 16 | US FAERS | |
| 67 | Product physical issue | FAERS: 16 | US FAERS | |
| 68 | Blood blister | FAERS: 15 | US FAERS | |
| 69 | Cerebral Infarction | FAERS: 15 | US FAERS | |
| 70 | Hepatotoxicity | FAERS: 15 | SIDER US FAERS | |
| 71 | Malaria | FAERS: 15 | US FAERS | |
| 72 | Pericardial effusion | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 73 | Skin lesion | FAERS: 15 | US FAERS | |
| 74 | Therapy cessation | FAERS: 15 | US FAERS | |
| 75 | Dry skin | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 76 | Dysgeusia | FAERS: 14 | SIDER US FAERS | |
| 77 | Febrile Neutropenia | FAERS: 14 | SIDER US FAERS | |
| 78 | Joint swelling | FAERS: 14 | SIDER US FAERS | |
| 79 | Night sweats | FAERS: 14 | SIDER US FAERS | |
| 80 | Peripheral arterial occlusive disease | FAERS: 14 | US FAERS | |
| 81 | Stem cell transplant | FAERS: 14 | OFFSIDES US FAERS | |
| 82 | jaundice | FAERS: 14 | SIDER US FAERS | |
| 83 | Alanine Aminotransferase Increased | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 84 | Blindness | FAERS: 13 | US FAERS | |
| 85 | Ejection Fraction Decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 86 | Growth retardation | FAERS: 13 | SIDER US FAERS | |
| 87 | Aspartate Aminotransferase Increased | FAERS: 12 | SIDER US FAERS | |
| 88 | Complications of transplant surgery | FAERS: 12 | US FAERS | |
| 89 | Concomitant disease progression | FAERS: 12 | OFFSIDES US FAERS | |
| 90 | Low birth weight baby | FAERS: 12 | US FAERS | |
| 91 | Rash erythematous | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Blood lactate dehydrogenase increased | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 93 | Chills | FAERS: 11 | SIDER US FAERS | |
| 94 | Erythema | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 95 | Intestinal Obstruction | FAERS: 11 | SIDER US FAERS | |
| 96 | Musculoskeletal Pain | FAERS: 11 | SIDER US FAERS | |
| 97 | Accidental exposure to product | FAERS: 10 | US FAERS | |
| 98 | Acquired gene mutation | FAERS: 10 | US FAERS | |
| 99 | Circumstance or information capable of leading to medication error | FAERS: 10 | US FAERS | |
| 100 | Cytogenetic analysis abnormal | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 101 | Gene mutation identification test positive | FAERS: 10 | US FAERS | |
| 102 | Hepatomegaly | FAERS: 10 | US FAERS | |
| 103 | Pallor | FAERS: 10 | US FAERS | |
| 104 | Pancreatitis | FAERS: 10 | SIDER US FAERS | |
| 105 | Productive Cough | FAERS: 10 | US FAERS | |
| 106 | Scab | FAERS: 10 | OFFSIDES US FAERS | |
| 107 | Skin Erosion | FAERS: 10 | OFFSIDES US FAERS | |
| 108 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 109 | Agranulocytosis | FAERS: 9 | SIDER US FAERS | |
| 110 | Bone density decreased | FAERS: 9 | US FAERS | |
| 111 | Cardiotoxicity | FAERS: 9 | US FAERS | |
| 112 | Eosinophilia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 113 | Invasive Ductal Breast Carcinoma | FAERS: 9 | US FAERS | |
| 114 | Somnolence | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 115 | Cardiac Arrest | FAERS: 8 | SIDER US FAERS | |
| 116 | Disease complication | FAERS: 8 | US FAERS | |
| 117 | Disseminated Intravascular Coagulation | FAERS: 8 | OFFSIDES US FAERS | |
| 118 | Feeling abnormal | FAERS: 8 | SIDER US FAERS | |
| 119 | Hepatitis | FAERS: 8 | SIDER US FAERS | |
| 120 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 121 | Therapy change | FAERS: 8 | US FAERS | |
| 122 | Transaminases increased | FAERS: 8 | OFFSIDES US FAERS | |
| 123 | Cachexia | FAERS: 7 | US FAERS | |
| 124 | Chest discomfort | FAERS: 7 | US FAERS | |
| 125 | Concomitant disease aggravated | FAERS: 7 | OFFSIDES US FAERS | |
| 126 | Diabetes Mellitus | FAERS: 7 | US FAERS | |
| 127 | Full blood count decreased | FAERS: 7 | US FAERS | |
| 128 | Gastrointestinal toxicity | FAERS: 7 | US FAERS | |
| 129 | Hepatitis B | FAERS: 7 | OFFSIDES US FAERS | |
| 130 | Inflammation | FAERS: 7 | US FAERS | |
| 131 | Oropharyngeal pain | FAERS: 7 | SIDER US FAERS | |
| 132 | Pancreatic carcinoma | FAERS: 7 | US FAERS | |
| 133 | Tuberculosis | FAERS: 7 | US FAERS | |
| 134 | Visual Impairment | FAERS: 7 | US FAERS | |
| 135 | Abasia | FAERS: 6 | OFFSIDES US FAERS | |
| 136 | Adverse event | FAERS: 6 | US FAERS | |
| 137 | Anxiety | FAERS: 6 | SIDER US FAERS | |
| 138 | Atrial Fibrillation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 139 | Blast cells present | FAERS: 6 | OFFSIDES US FAERS | |
| 140 | Blood alkaline phosphatase increased | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 141 | Blood creatine phosphokinase increased | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 142 | Bone marrow depression | FAERS: 6 | SIDER US FAERS | |
| 143 | Bronchopneumonia | FAERS: 6 | US FAERS | |
| 144 | Chordoma | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 145 | Cytopenia | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 146 | Dermatitis | FAERS: 6 | SIDER US FAERS | |
| 147 | Epistaxis | FAERS: 6 | SIDER US FAERS | |
| 148 | Flank Pain | FAERS: 6 | US FAERS | |
| 149 | Hepatitis C | FAERS: 6 | US FAERS | |
| 150 | Hydronephrosis | FAERS: 6 | OFFSIDES US FAERS | |
| 151 | Nasopharyngitis | FAERS: 6 | SIDER US FAERS | |
| 152 | Palpitations | FAERS: 6 | SIDER US FAERS | |
| 153 | Pneumatosis intestinalis | FAERS: 6 | US FAERS | |
| 154 | Product dose omission | FAERS: 6 | US FAERS | |
| 155 | Product storage error | FAERS: 6 | US FAERS | |
| 156 | Product use issue | FAERS: 6 | US FAERS | |
| 157 | Skin necrosis | FAERS: 6 | US FAERS | |
| 158 | Stomatitis | FAERS: 6 | SIDER US FAERS | |
| 159 | Urinary tract infection | FAERS: 6 | SIDER US FAERS | |
| 160 | Amnesia | FAERS: 5 | OFFSIDES US FAERS | |
| 161 | Arthritis | FAERS: 5 | SIDER US FAERS | |
| 162 | Benign Neoplasm | FAERS: 5 | US FAERS | |
| 163 | Blood urea increased | FAERS: 5 | OFFSIDES US FAERS | |
| 164 | Bone marrow necrosis | FAERS: 5 | US FAERS | |
| 165 | Bone marrow reticulin fibrosis | FAERS: 5 | US FAERS | |
| 166 | Coronary Artery Disease | FAERS: 5 | US FAERS | |
| 167 | Craniosynostosis | FAERS: 5 | US FAERS | |
| 168 | Diplopia | FAERS: 5 | US FAERS | |
| 169 | Drug dose omission | FAERS: 5 | US FAERS | |
| 170 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 171 | Dysarthria | FAERS: 5 | US FAERS | |
| 172 | Ecchymosis | FAERS: 5 | SIDER US FAERS | |
| 173 | Eructation | FAERS: 5 | SIDER US FAERS | |
| 174 | Graft versus host disease in skin | FAERS: 5 | US FAERS | |
| 175 | Hepatosplenomegaly | FAERS: 5 | US FAERS | |
| 176 | Hypertrichosis | FAERS: 5 | US FAERS | |
| 177 | Hypotension | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 178 | Hypoxia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 179 | Keratitis | FAERS: 5 | US FAERS | |
| 180 | Lethargy | FAERS: 5 | SIDER US FAERS | |
| 181 | Neutrophil count decreased | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 182 | Nodule | FAERS: 5 | US FAERS | |
| 183 | Onychoclasis | FAERS: 5 | SIDER US FAERS | |
| 184 | Peritonitis | FAERS: 5 | US FAERS | |
| 185 | Post procedural complication | FAERS: 5 | US FAERS | |
| 186 | Pregnancy | FAERS: 5 | US FAERS | |
| 187 | Psoriasis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 188 | Scleroderma | FAERS: 5 | US FAERS | |
| 189 | Shock | FAERS: 5 | SIDER US FAERS | |
| 190 | Transmission of drug via semen | FAERS: 5 | US FAERS | |
| 191 | Tremor | FAERS: 5 | SIDER US FAERS | |
| 192 | Vertigo | FAERS: 5 | SIDER US FAERS | |
| 193 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 194 | Angina Pectoris | FAERS: 4 | SIDER US FAERS | |
| 195 | Autoimmune hepatitis | FAERS: 4 | US FAERS | |
| 196 | Burning sensation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 198 | Cholestasis | FAERS: 4 | US FAERS | |
| 199 | Deafness | FAERS: 4 | SIDER US FAERS | |
| 200 | Dental caries | FAERS: 4 | OFFSIDES US FAERS | |
| 201 | Depressed Level of Consciousness | FAERS: 4 | OFFSIDES US FAERS | |
| 202 | Hepatic Encephalopathy | FAERS: 4 | US FAERS | |
| 203 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 204 | Immunosuppression | FAERS: 4 | US FAERS | |
| 205 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 206 | Liver Abscess | FAERS: 4 | OFFSIDES US FAERS | |
| 207 | Meningioma | FAERS: 4 | US FAERS | |
| 208 | Myositis | FAERS: 4 | US FAERS | |
| 209 | Neuroblastoma | FAERS: 4 | US FAERS | |
| 210 | Neutropenic sepsis | FAERS: 4 | US FAERS | |
| 211 | Optic Neuritis | FAERS: 4 | SIDER US FAERS | |
| 212 | Pain of skin | FAERS: 4 | US FAERS | |
| 213 | Product quality issue | FAERS: 4 | US FAERS | |
| 214 | Pyogenic granuloma | FAERS: 4 | US FAERS | |
| 215 | Renal Cell Carcinoma | FAERS: 4 | US FAERS | |
| 216 | Respiratory distress | FAERS: 4 | US FAERS | |
| 217 | Retroperitoneal fibrosis | FAERS: 4 | US FAERS | |
| 218 | Sciatica | FAERS: 4 | SIDER US FAERS | |
| 219 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 220 | Sudden death | FAERS: 4 | US FAERS | |
| 221 | Swelling of eyelid | FAERS: 4 | US FAERS | |
| 222 | Unevaluable event | FAERS: 4 | US FAERS | |
| 223 | Ureteral stent insertion | FAERS: 4 | US FAERS | |
| 224 | Urticaria | FAERS: 4 | SIDER US FAERS | |
| 225 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 226 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 227 | Abscess | FAERS: 3 | US FAERS | |
| 228 | Acute Coronary Syndrome | FAERS: 3 | SIDER US FAERS | |
| 229 | Alveolitis | FAERS: 3 | OFFSIDES US FAERS | |
| 230 | Aphagia | FAERS: 3 | US FAERS | |
| 231 | Asthma | FAERS: 3 | US FAERS | |
| 232 | Autoantibody positive | FAERS: 3 | US FAERS | |
| 233 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 234 | Blast cell proliferation | FAERS: 3 | US FAERS | |
| 235 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 236 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 237 | Blood iron decreased | FAERS: 3 | US FAERS | |
| 238 | Blood parathyroid hormone increased | FAERS: 3 | US FAERS | |
| 239 | Blood phosphorus decreased | FAERS: 3 | US FAERS | |
| 240 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 241 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 242 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 243 | Cataract | FAERS: 3 | SIDER US FAERS | |
| 244 | Cholangiocarcinoma | FAERS: 3 | US FAERS | |
| 245 | Cholangitis | FAERS: 3 | US FAERS | |
| 246 | Conjunctivitis | FAERS: 3 | SIDER US FAERS | |
| 247 | Diffuse Large B-Cell Lymphoma | FAERS: 3 | US FAERS | |
| 248 | Discomfort | FAERS: 3 | SIDER US FAERS | |
| 249 | Dropped head syndrome | FAERS: 3 | US FAERS | |
| 250 | Drug administration error | FAERS: 3 | US FAERS | |
| 251 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 252 | Embolism | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 253 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 3 | US FAERS | |
| 254 | Exfoliative rash | FAERS: 3 | US FAERS | |
| 255 | Eye irritation | FAERS: 3 | SIDER US FAERS | |
| 256 | Eye pain | FAERS: 3 | SIDER US FAERS | |
| 257 | Feeling Cold | FAERS: 3 | US FAERS | |
| 258 | Flatulence | FAERS: 3 | SIDER US FAERS | |
| 259 | Flushing | FAERS: 3 | SIDER US FAERS | |
| 260 | Gastrectomy | FAERS: 3 | OFFSIDES US FAERS | |
| 261 | Gastritis | FAERS: 3 | SIDER US FAERS | |
| 262 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 263 | General symptom | FAERS: 3 | US FAERS | |
| 264 | Head discomfort | FAERS: 3 | US FAERS | |
| 265 | Hyperemesis Gravidarum | FAERS: 3 | US FAERS | |
| 266 | Hypophagia | FAERS: 3 | US FAERS | |
| 267 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 268 | Ileus | FAERS: 3 | SIDER US FAERS | |
| 269 | Iron deficiency | FAERS: 3 | US FAERS | |
| 270 | Joint stiffness | FAERS: 3 | US FAERS | |
| 271 | Laceration | FAERS: 3 | US FAERS | |
| 272 | Limb discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 273 | Lipase increased | FAERS: 3 | US FAERS | |
| 274 | Lower respiratory tract infection | FAERS: 3 | SIDER US FAERS | |
| 275 | Memory impairment | FAERS: 3 | SIDER US FAERS | |
| 276 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 277 | Mood swings | FAERS: 3 | US FAERS | |
| 278 | Myasthenia Gravis | FAERS: 3 | US FAERS | |
| 279 | Necrosis | FAERS: 3 | SIDER US FAERS | |
| 280 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 281 | Oncologic complication | FAERS: 3 | US FAERS | |
| 282 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 283 | Parakeratosis | FAERS: 3 | US FAERS | |
| 284 | Philadelphia chromosome negative | FAERS: 3 | US FAERS | |
| 285 | Pneumonitis | FAERS: 3 | US FAERS | |
| 286 | Pneumothorax | FAERS: 3 | US FAERS | |
| 287 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 288 | Pulmonary Eosinophilia | FAERS: 3 | US FAERS | |
| 289 | Pulmonary Fibrosis | FAERS: 3 | SIDER US FAERS | |
| 290 | Pyoderma Gangrenosum | FAERS: 3 | US FAERS | |
| 291 | Retinal Vascular Disorder | FAERS: 3 | US FAERS | |
| 292 | Skin reaction | FAERS: 3 | US FAERS | |
| 293 | Skin toxicity | FAERS: 3 | SIDER US FAERS | |
| 294 | Stillbirth | FAERS: 3 | US FAERS | |
| 295 | Tachycardia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 296 | Thrombocytosis | FAERS: 3 | SIDER US FAERS | |
| 297 | Ulcer | FAERS: 3 | SIDER US FAERS | |
| 298 | Wheezing | FAERS: 3 | US FAERS | |
| 299 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 300 | Actinomycosis | FAERS: 2 | US FAERS | |
| 301 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 302 | Acute respiratory failure | FAERS: 2 | SIDER US FAERS | |
| 303 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 304 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 305 | Anal Fissure | FAERS: 2 | US FAERS | |
| 306 | Angioedema | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 307 | Anosmia | FAERS: 2 | US FAERS | |
| 308 | Aphasia | FAERS: 2 | US FAERS | |
| 309 | Azoospermia | FAERS: 2 | US FAERS | |
| 310 | BRAF gene mutation | FAERS: 2 | US FAERS | |
| 311 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 312 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 313 | Biopsy bone marrow abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 314 | Bladder discomfort | FAERS: 2 | US FAERS | |
| 315 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 316 | Blood follicle stimulating hormone increased | FAERS: 2 | US FAERS | |
| 317 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 318 | Blood testosterone increased | FAERS: 2 | US FAERS | |
| 319 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 320 | Bone formation decreased | FAERS: 2 | US FAERS | |
| 321 | Bone marrow harvest failure | FAERS: 2 | US FAERS | |
| 322 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 323 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 324 | Cell Death | FAERS: 2 | US FAERS | |
| 325 | Cell marker decreased | FAERS: 2 | US FAERS | |
| 326 | Cholecystitis | FAERS: 2 | US FAERS | |
| 327 | Clinodactyly | FAERS: 2 | US FAERS | |
| 328 | Colitis | FAERS: 2 | SIDER US FAERS | |
| 329 | Completed Suicide | FAERS: 2 | US FAERS | |
| 330 | Congenital Hydrocephalus | FAERS: 2 | US FAERS | |
| 331 | Craniectomy | FAERS: 2 | US FAERS | |
| 332 | Cytomegalovirus test positive | FAERS: 2 | US FAERS | |
| 333 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 334 | Delirium | FAERS: 2 | US FAERS | |
| 335 | Dengue Fever | FAERS: 2 | OFFSIDES US FAERS | |
| 336 | Depressed mood | FAERS: 2 | OFFSIDES US FAERS | |
| 337 | Device related infection | FAERS: 2 | US FAERS | |
| 338 | Dextrocardia | FAERS: 2 | US FAERS | |
| 339 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 340 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 341 | Drug toxicity | FAERS: 2 | US FAERS | |
| 342 | Dysuria | FAERS: 2 | US FAERS | |
| 343 | Eclampsia | FAERS: 2 | US FAERS | |
| 344 | Economic problem | FAERS: 2 | US FAERS | |
| 345 | Eczema | FAERS: 2 | SIDER US FAERS | |
| 346 | Empyema | FAERS: 2 | US FAERS | |
| 347 | Epilepsy | FAERS: 2 | US FAERS | |
| 348 | Erectile dysfunction | FAERS: 2 | SIDER US FAERS | |
| 349 | Erythema Multiforme | FAERS: 2 | SIDER US FAERS | |
| 350 | Escherichia infection | FAERS: 2 | US FAERS | |
| 351 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 352 | Failure to Thrive | FAERS: 2 | OFFSIDES US FAERS | |
| 353 | Fasciitis | FAERS: 2 | US FAERS | |
| 354 | Fibrosis | FAERS: 2 | US FAERS | |
| 355 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 356 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 357 | Gastrointestinal angiectasia | FAERS: 2 | US FAERS | |
| 358 | Gastrointestinal erosion | FAERS: 2 | US FAERS | |
| 359 | Genital abscess | FAERS: 2 | US FAERS | |
| 360 | Gout | FAERS: 2 | SIDER US FAERS | |
| 361 | Graft versus host disease in lung | FAERS: 2 | US FAERS | |
| 362 | Growth failure | FAERS: 2 | US FAERS | |
| 363 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 364 | Hemiplegia | FAERS: 2 | US FAERS | |
| 365 | Hepatic necrosis | FAERS: 2 | SIDER US FAERS | |
| 366 | Hip surgery | FAERS: 2 | US FAERS | |
| 367 | Histiocytosis haematophagic | FAERS: 2 | OFFSIDES US FAERS | |
| 368 | Hunger | FAERS: 2 | US FAERS | |
| 369 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 370 | Hypersomnia | FAERS: 2 | US FAERS | |
| 371 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 372 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 373 | Impaired work ability | FAERS: 2 | US FAERS | |
| 374 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 375 | Infarction | FAERS: 2 | US FAERS | |
| 376 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 377 | Insurance issue | FAERS: 2 | US FAERS | |
| 378 | Intramedullary rod insertion | FAERS: 2 | US FAERS | |
| 379 | Lactose Intolerance | FAERS: 2 | OFFSIDES US FAERS | |
| 380 | Lichen Planus | FAERS: 2 | SIDER US FAERS | |
| 381 | Lip swelling | FAERS: 2 | US FAERS | |
| 382 | Live Birth | FAERS: 2 | US FAERS | |
| 383 | Lymphadenitis | FAERS: 2 | US FAERS | |
| 384 | Malabsorption | FAERS: 2 | US FAERS | |
| 385 | Malignant tumour excision | FAERS: 2 | US FAERS | |
| 386 | Maternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 387 | Metastases to pelvis | FAERS: 2 | US FAERS | |
| 388 | Necrotising myositis | FAERS: 2 | US FAERS | |
| 389 | Osteocalcin decreased | FAERS: 2 | US FAERS | |
| 390 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 391 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 392 | Papule | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 393 | Peripheral artery occlusion | FAERS: 2 | US FAERS | |
| 394 | Plasmacytoma | FAERS: 2 | US FAERS | |
| 395 | Pleurocutaneous fistula | FAERS: 2 | US FAERS | |
| 396 | Priapism | FAERS: 2 | US FAERS | |
| 397 | Product dispensing error | FAERS: 2 | US FAERS | |
| 398 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 399 | Proteinuria | FAERS: 2 | US FAERS | |
| 400 | Pseudomonal sepsis | FAERS: 2 | US FAERS | |
| 401 | Pulmonary congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 402 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 403 | Purulent discharge | FAERS: 2 | US FAERS | |
| 404 | Pyelonephritis | FAERS: 2 | OFFSIDES US FAERS | |
| 405 | Pyomyositis | FAERS: 2 | US FAERS | |
| 406 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 407 | Rales | FAERS: 2 | OFFSIDES US FAERS | |
| 408 | Refractory cancer | FAERS: 2 | US FAERS | |
| 409 | Renal Colic | FAERS: 2 | US FAERS | |
| 410 | Renal cancer metastatic | FAERS: 2 | US FAERS | |
| 411 | Renal pain | FAERS: 2 | SIDER US FAERS | |
| 412 | Restlessness | FAERS: 2 | US FAERS | |
| 413 | Restrictive cardiomyopathy | FAERS: 2 | US FAERS | |
| 414 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 415 | Rosacea | FAERS: 2 | US FAERS | |
| 416 | Scedosporium infection | FAERS: 2 | US FAERS | |
| 417 | Secretion discharge | FAERS: 2 | US FAERS | |
| 418 | Sinusitis | FAERS: 2 | SIDER US FAERS | |
| 419 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 420 | Skin laceration | FAERS: 2 | US FAERS | |
| 421 | Skin nodule | FAERS: 2 | US FAERS | |
| 422 | Skin tightness | FAERS: 2 | US FAERS | |
| 423 | Sluggishness | FAERS: 2 | US FAERS | |
| 424 | Sodium retention | FAERS: 2 | US FAERS | |
| 425 | Spina Bifida Occulta | FAERS: 2 | US FAERS | |
| 426 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 427 | Squamous cell carcinoma of lung | FAERS: 2 | US FAERS | |
| 428 | Suicide attempt | FAERS: 2 | US FAERS | |
| 429 | Suture related complication | FAERS: 2 | US FAERS | |
| 430 | Syncope | FAERS: 2 | SIDER US FAERS | |
| 431 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 432 | Therapy partial responder | FAERS: 2 | US FAERS | |
| 433 | Thrombosis | FAERS: 2 | SIDER US FAERS | |
| 434 | Tooth Loss | FAERS: 2 | US FAERS | |
| 435 | Transfusion related complication | FAERS: 2 | US FAERS | |
| 436 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 437 | Uterine Cancer | FAERS: 2 | US FAERS | |
| 438 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 439 | Vitiligo | FAERS: 2 | US FAERS | |
| 440 | Vitreous Detachment | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | neurofibroma | FAERS: 2 | US FAERS | |
| 442 | ATRIAL ENLARGEMENT | FAERS: 1 | US FAERS | |
| 443 | Accidental underdose | FAERS: 1 | US FAERS | |
| 444 | Acid fast bacilli infection | FAERS: 1 | US FAERS | |
| 445 | Acne | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 446 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 447 | Acquired hydrocele | FAERS: 1 | US FAERS | |
| 448 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 449 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 450 | Ageusia | FAERS: 1 | US FAERS | |
| 451 | Agitation | FAERS: 1 | US FAERS | |
| 452 | Agraphia | FAERS: 1 | US FAERS | |
| 453 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 454 | Albinism | FAERS: 1 | US FAERS | |
| 455 | Albuminuria | FAERS: 1 | US FAERS | |
| 456 | Allogenic bone marrow transplantation therapy | FAERS: 1 | OFFSIDES US FAERS | |
| 457 | Alpha 2 globulin increased | FAERS: 1 | US FAERS | |
| 458 | Amylase increased | FAERS: 1 | SIDER US FAERS | |
| 459 | Anal Fistula | FAERS: 1 | US FAERS | |
| 460 | Anal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 461 | Anastomotic Leak | FAERS: 1 | US FAERS | |
| 462 | Anger | FAERS: 1 | US FAERS | |
| 463 | Angioimmunoblastic T-cell lymphoma recurrent | FAERS: 1 | US FAERS | |
| 464 | Anisocytosis | FAERS: 1 | US FAERS | |
| 465 | Anorexia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 466 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 467 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 468 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 469 | Appendicitis | FAERS: 1 | US FAERS | |
| 470 | Asphyxia | FAERS: 1 | OFFSIDES US FAERS | |
| 471 | Astrocytoma | FAERS: 1 | US FAERS | |
| 472 | Ataxia | FAERS: 1 | US FAERS | |
| 473 | Atrial Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 474 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 475 | B-cell small lymphocytic lymphoma stage III | FAERS: 1 | US FAERS | |
| 476 | Basilar Artery Stenosis | FAERS: 1 | US FAERS | |
| 477 | Bedridden | FAERS: 1 | US FAERS | |
| 478 | Bicytopenia | FAERS: 1 | US FAERS | |
| 479 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 480 | Biliary dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 481 | Bladder adenocarcinoma stage unspecified | FAERS: 1 | US FAERS | |
| 482 | Blepharochalasis | FAERS: 1 | US FAERS | |
| 483 | Blood bilirubin abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 484 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 485 | Blood glucagon decreased | FAERS: 1 | US FAERS | |
| 486 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 487 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 488 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 489 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 490 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 491 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 492 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 493 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 494 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 495 | Blood urine present | FAERS: 1 | OFFSIDES US FAERS | |
| 496 | Bone erosion | FAERS: 1 | US FAERS | |
| 497 | Bone infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 498 | Bone lesion | FAERS: 1 | US FAERS | |
| 499 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 500 | Bradycardia | FAERS: 1 | US FAERS | |
| 501 | Brain Death | FAERS: 1 | US FAERS | |
| 502 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 503 | Breech Presentation | FAERS: 1 | US FAERS | |
| 504 | Bronchitis | FAERS: 1 | OFFSIDES US FAERS | |
| 505 | Bronchoalveolar Lavage | FAERS: 1 | OFFSIDES US FAERS | |
| 506 | C-kit gene mutation | FAERS: 1 | US FAERS | |
| 507 | Calcinosis | FAERS: 1 | US FAERS | |
| 508 | Cancer Pain | FAERS: 1 | US FAERS | |
| 509 | Cardiac Tamponade | FAERS: 1 | SIDER US FAERS | |
| 510 | Cardiac ventricular thrombosis | FAERS: 1 | US FAERS | |
| 511 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 512 | Cardiomyopathy neonatal | FAERS: 1 | US FAERS | |
| 513 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 514 | Cellulitis | FAERS: 1 | SIDER US FAERS | |
| 515 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 516 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 517 | Cerebral decompression | FAERS: 1 | US FAERS | |
| 518 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 519 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 520 | Chest wall pain | FAERS: 1 | US FAERS | |
| 521 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 522 | Choroiditis | FAERS: 1 | US FAERS | |
| 523 | Chromaturia | FAERS: 1 | US FAERS | |
| 524 | Chromosomal mutation | FAERS: 1 | US FAERS | |
| 525 | Chronic graft versus host disease in skin | FAERS: 1 | US FAERS | |
| 526 | Chylothorax | FAERS: 1 | US FAERS | |
| 527 | Clonal Evolution | FAERS: 1 | US FAERS | |
| 528 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 529 | Cold sweat | FAERS: 1 | OFFSIDES US FAERS | |
| 530 | Complications of bone marrow transplant | FAERS: 1 | US FAERS | |
| 531 | Congenital Hypothyroidism | FAERS: 1 | US FAERS | |
| 532 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 533 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 534 | Craniotomy | FAERS: 1 | US FAERS | |
| 535 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 536 | Cyanosis | FAERS: 1 | US FAERS | |
| 537 | Cyst | FAERS: 1 | SIDER US FAERS | |
| 538 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 539 | Dementia | FAERS: 1 | US FAERS | |
| 540 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 541 | Dermatofibrosarcoma | FAERS: 1 | US FAERS | |
| 542 | Device related sepsis | FAERS: 1 | US FAERS | |
| 543 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 544 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 545 | Dieulafoy's vascular malformation | FAERS: 1 | US FAERS | |
| 546 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 547 | Diplegia | FAERS: 1 | US FAERS | |
| 548 | Disorientation | FAERS: 1 | US FAERS | |
| 549 | Drug Dependence | FAERS: 1 | US FAERS | |
| 550 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 551 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 552 | Drug ineffective for unapproved indication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 553 | Drug level decreased | FAERS: 1 | US FAERS | |
| 554 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 555 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 556 | Duodenitis | FAERS: 1 | US FAERS | |
| 557 | Dyspareunia | FAERS: 1 | US FAERS | |
| 558 | Dysphonia | FAERS: 1 | US FAERS | |
| 559 | Dystrophic calcification | FAERS: 1 | US FAERS | |
| 560 | Early satiety | FAERS: 1 | US FAERS | |
| 561 | Echography abnormal | FAERS: 1 | US FAERS | |
| 562 | Ectopic kidney | FAERS: 1 | US FAERS | |
| 563 | Ectropion | FAERS: 1 | US FAERS | |
| 564 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 565 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 566 | Emotional distress | FAERS: 1 | US FAERS | |
| 567 | Endocarditis fibroplastica | FAERS: 1 | US FAERS | |
| 568 | Endometrial Stromal Sarcoma | FAERS: 1 | US FAERS | |
| 569 | Endometrial adenocarcinoma | FAERS: 1 | US FAERS | |
| 570 | Endoscopy abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 571 | Enteritis | FAERS: 1 | US FAERS | |
| 572 | Enterocolitis | FAERS: 1 | US FAERS | |
| 573 | Eosinophil percentage increased | FAERS: 1 | OFFSIDES US FAERS | |
| 574 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 575 | Epithelioma | FAERS: 1 | US FAERS | |
| 576 | Erysipelas | FAERS: 1 | US FAERS | |
| 577 | Erythroblast count increased | FAERS: 1 | US FAERS | |
| 578 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 579 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 580 | Exophthalmos | FAERS: 1 | US FAERS | |
| 581 | Eye inflammation | FAERS: 1 | US FAERS | |
| 582 | Facial Paresis | FAERS: 1 | US FAERS | |
| 583 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 584 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 585 | Filariasis | FAERS: 1 | US FAERS | |
| 586 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 587 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 588 | Full blood count increased | FAERS: 1 | US FAERS | |
| 589 | Gallop rhythm present | FAERS: 1 | US FAERS | |
| 590 | Gamma-Glutamyltransferase Increased | FAERS: 1 | OFFSIDES US FAERS | |
| 591 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 592 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 593 | Gastrointestinal disorder postoperative | FAERS: 1 | US FAERS | |
| 594 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 595 | Gastrointestinal perforation | FAERS: 1 | SIDER US FAERS | |
| 596 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 597 | Gastrointestinal stromal cancer | FAERS: 1 | US FAERS | |
| 598 | Gastrointestinal wall thinning | FAERS: 1 | US FAERS | |
| 599 | Gelatinous transformation of the bone marrow | FAERS: 1 | US FAERS | |
| 600 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 601 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 602 | Glioblastoma | FAERS: 1 | US FAERS | |
| 603 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 604 | HER-2 positive breast cancer | FAERS: 1 | US FAERS | |
| 605 | Hemiparesis | FAERS: 1 | US FAERS | |
| 606 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 607 | Hepatitis B DNA increased | FAERS: 1 | US FAERS | |
| 608 | Hernia | FAERS: 1 | US FAERS | |
| 609 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 610 | Histiocytosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 611 | Homans' sign positive | FAERS: 1 | US FAERS | |
| 612 | Hordeolum | FAERS: 1 | US FAERS | |
| 613 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 614 | Hospice Care | FAERS: 1 | US FAERS | |
| 615 | Human herpesvirus 8 infection | FAERS: 1 | US FAERS | |
| 616 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 617 | Hyperaldosteronism | FAERS: 1 | US FAERS | |
| 618 | Hyperleukocytosis | FAERS: 1 | US FAERS | |
| 619 | Hyperplasia | FAERS: 1 | US FAERS | |
| 620 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 621 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 622 | Hypertrophic osteoarthropathy | FAERS: 1 | US FAERS | |
| 623 | Hypertrophy | FAERS: 1 | US FAERS | |
| 624 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 625 | Hypokinesia | FAERS: 1 | US FAERS | |
| 626 | Hypospadias | FAERS: 1 | US FAERS | |
| 627 | Hypoventilation | FAERS: 1 | US FAERS | |
| 628 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 629 | Immature respiratory system | FAERS: 1 | US FAERS | |
| 630 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 631 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 632 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 633 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 634 | Infertility | FAERS: 1 | US FAERS | |
| 635 | Injection site pain | FAERS: 1 | US FAERS | |
| 636 | Insulin C-peptide decreased | FAERS: 1 | US FAERS | |
| 637 | Insulin-like growth factor decreased | FAERS: 1 | US FAERS | |
| 638 | Insulin-like growth factor increased | FAERS: 1 | OFFSIDES US FAERS | |
| 639 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 640 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 641 | Intestinal adenocarcinoma | FAERS: 1 | US FAERS | |
| 642 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 643 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 644 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 645 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 646 | Large cell lung cancer stage III | FAERS: 1 | US FAERS | |
| 647 | Laryngeal Squamous Cell Carcinoma | FAERS: 1 | US FAERS | |
| 648 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 649 | Leukaemic infiltration brain | FAERS: 1 | US FAERS | |
| 650 | Leukocytoclastic vasculitis | FAERS: 1 | SIDER US FAERS | |
| 651 | Leukostasis | FAERS: 1 | US FAERS | |
| 652 | Ligament injury | FAERS: 1 | US FAERS | |
| 653 | Light chain analysis increased | FAERS: 1 | US FAERS | |
| 654 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 655 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 656 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 657 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 658 | Loss of personal independence in daily activities | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 659 | Low Cardiac Output Syndrome | FAERS: 1 | US FAERS | |
| 660 | Low set ears | FAERS: 1 | US FAERS | |
| 661 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 662 | Lumbar puncture abnormal | FAERS: 1 | US FAERS | |
| 663 | Lung Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 664 | Lung consolidation | FAERS: 1 | US FAERS | |
| 665 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 666 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 667 | Lymphocyte count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 668 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 669 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 670 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 671 | Lymphoma | FAERS: 1 | US FAERS | |
| 672 | Lymphopenia | FAERS: 1 | SIDER US FAERS | |
| 673 | Macule | FAERS: 1 | US FAERS | |
| 674 | Malignant ascites | FAERS: 1 | US FAERS | |
| 675 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 676 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 677 | Marasmus | FAERS: 1 | US FAERS | |
| 678 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 679 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 680 | Mediastinitis | FAERS: 1 | US FAERS | |
| 681 | Medication residue present | FAERS: 1 | US FAERS | |
| 682 | Metastases to abdominal wall | FAERS: 1 | US FAERS | |
| 683 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 684 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 685 | Microcytosis | FAERS: 1 | US FAERS | |
| 686 | Middle insomnia | FAERS: 1 | US FAERS | |
| 687 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 688 | Monocytosis | FAERS: 1 | US FAERS | |
| 689 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 690 | Monoplegia | FAERS: 1 | US FAERS | |
| 691 | Mouth swelling | FAERS: 1 | US FAERS | |
| 692 | Mucinous adenocarcinoma of appendix | FAERS: 1 | US FAERS | |
| 693 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 694 | Mucosal pigmentation | FAERS: 1 | US FAERS | |
| 695 | Multimorbidity | FAERS: 1 | US FAERS | |
| 696 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 697 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 698 | Muscle tightness | FAERS: 1 | US FAERS | |
| 699 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 700 | Musculoskeletal stiffness | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 701 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 702 | Mydriasis | FAERS: 1 | US FAERS | |
| 703 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 704 | Myocarditis | FAERS: 1 | US FAERS | |
| 705 | Myofascitis | FAERS: 1 | US FAERS | |
| 706 | Myopathy | FAERS: 1 | SIDER US FAERS | |
| 707 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 708 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 709 | Nephrogenic Systemic Fibrosis | FAERS: 1 | US FAERS | |
| 710 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 711 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 712 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 713 | Nervousness | FAERS: 1 | US FAERS | |
| 714 | Neurodermatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 715 | Neurofibrosarcoma | FAERS: 1 | US FAERS | |
| 716 | Neutropenic infection | FAERS: 1 | US FAERS | |
| 717 | Norepinephrine increased | FAERS: 1 | US FAERS | |
| 718 | Ocular icterus | FAERS: 1 | US FAERS | |
| 719 | Oliguria | FAERS: 1 | OFFSIDES US FAERS | |
| 720 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 721 | Orbital cyst | FAERS: 1 | US FAERS | |
| 722 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 723 | Osteoporosis | FAERS: 1 | US FAERS | |
| 724 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 725 | Otitis Media | FAERS: 1 | US FAERS | |
| 726 | Ovarian adenoma | FAERS: 1 | US FAERS | |
| 727 | Ovarian failure | FAERS: 1 | US FAERS | |
| 728 | Overdose | FAERS: 1 | US FAERS | |
| 729 | Paracentesis | FAERS: 1 | OFFSIDES US FAERS | |
| 730 | Paraneoplastic dermatomyositis | FAERS: 1 | US FAERS | |
| 731 | Parathyroid hormone-related protein increased | FAERS: 1 | US FAERS | |
| 732 | Paresis | FAERS: 1 | US FAERS | |
| 733 | Parophthalmia | FAERS: 1 | US FAERS | |
| 734 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 735 | Pelvic mass | FAERS: 1 | OFFSIDES US FAERS | |
| 736 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 737 | Performance status decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 738 | Pericarditis | FAERS: 1 | SIDER US FAERS | |
| 739 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 740 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 741 | Peritoneal lesion | FAERS: 1 | US FAERS | |
| 742 | Peritonsillar Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 743 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 744 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 745 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 746 | Phimosis | FAERS: 1 | US FAERS | |
| 747 | Phlebitis | FAERS: 1 | US FAERS | |
| 748 | Platelet dysfunction | FAERS: 1 | US FAERS | |
| 749 | Pleurectomy | FAERS: 1 | US FAERS | |
| 750 | Pleurisy | FAERS: 1 | US FAERS | |
| 751 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 752 | Poisoning | FAERS: 1 | US FAERS | |
| 753 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 754 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 755 | Porphyrins urine increased | FAERS: 1 | US FAERS | |
| 756 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 757 | Premature baby death | FAERS: 1 | US FAERS | |
| 758 | Prerenal failure | FAERS: 1 | US FAERS | |
| 759 | Procalcitonin increased | FAERS: 1 | US FAERS | |
| 760 | Procedural nausea | FAERS: 1 | US FAERS | |
| 761 | Product coating issue | FAERS: 1 | US FAERS | |
| 762 | Product distribution issue | FAERS: 1 | US FAERS | |
| 763 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 764 | Product use complaint | FAERS: 1 | US FAERS | |
| 765 | Prostatectomy | FAERS: 1 | US FAERS | |
| 766 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 767 | Prostatic calcification | FAERS: 1 | US FAERS | |
| 768 | Protein urine present | FAERS: 1 | US FAERS | |
| 769 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 770 | Pseudomyxoma Peritonei | FAERS: 1 | US FAERS | |
| 771 | Pulmonary Hypertension | FAERS: 1 | SIDER US FAERS | |
| 772 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 773 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 774 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 775 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 776 | Puncture site swelling | FAERS: 1 | US FAERS | |
| 777 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 778 | Pyelitis | FAERS: 1 | US FAERS | |
| 779 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 780 | Quadriplegia | FAERS: 1 | US FAERS | |
| 781 | Renal cyst | FAERS: 1 | US FAERS | |
| 782 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 783 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 784 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 785 | Renin decreased | FAERS: 1 | US FAERS | |
| 786 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 787 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 788 | Respiratory rate | FAERS: 1 | US FAERS | |
| 789 | Restless Legs Syndrome | FAERS: 1 | SIDER US FAERS | |
| 790 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 791 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 792 | Retroperitoneal abscess | FAERS: 1 | US FAERS | |
| 793 | Rhabdomyolysis | FAERS: 1 | SIDER US FAERS | |
| 794 | Rhabdomyosarcoma | FAERS: 1 | US FAERS | |
| 795 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 796 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 797 | Sarcoma | FAERS: 1 | US FAERS | |
| 798 | Scrotal mass | FAERS: 1 | US FAERS | |
| 799 | Semen volume decreased | FAERS: 1 | US FAERS | |
| 800 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 801 | Serous retinal detachment | FAERS: 1 | US FAERS | |
| 802 | Single functional kidney | FAERS: 1 | US FAERS | |
| 803 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 804 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 805 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 806 | Skin indentation | FAERS: 1 | US FAERS | |
| 807 | Skin irritation | FAERS: 1 | US FAERS | |
| 808 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 809 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 810 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 811 | Spinal shock | FAERS: 1 | US FAERS | |
| 812 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 813 | Splenic abscess | FAERS: 1 | US FAERS | |
| 814 | Sputum retention | FAERS: 1 | US FAERS | |
| 815 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 816 | Stevens-Johnson Syndrome | FAERS: 1 | SIDER US FAERS | |
| 817 | Stress | FAERS: 1 | OFFSIDES US FAERS | |
| 818 | Subileus | FAERS: 1 | US FAERS | |
| 819 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 820 | Supraventricular tachyarrhythmia | FAERS: 1 | US FAERS | |
| 821 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 822 | Synovitis | FAERS: 1 | US FAERS | |
| 823 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 824 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 825 | Teeth brittle | FAERS: 1 | US FAERS | |
| 826 | Temperature intolerance | FAERS: 1 | OFFSIDES US FAERS | |
| 827 | Terminal state | FAERS: 1 | US FAERS | |
| 828 | Tetany | FAERS: 1 | US FAERS | |
| 829 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 830 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 831 | Therapy responder | FAERS: 1 | US FAERS | |
| 832 | Thirst | FAERS: 1 | US FAERS | |
| 833 | Thoracotomy | FAERS: 1 | US FAERS | |
| 834 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 835 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 836 | Tinnitus | FAERS: 1 | SIDER US FAERS | |
| 837 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 838 | Toothache | FAERS: 1 | US FAERS | |
| 839 | Total cholesterol/HDL ratio increased | FAERS: 1 | US FAERS | |
| 840 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 841 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 842 | Transplant | FAERS: 1 | US FAERS | |
| 843 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 844 | Troponin increased | FAERS: 1 | US FAERS | |
| 845 | Tumour haemorrhage | FAERS: 1 | SIDER US FAERS | |
| 846 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 847 | Ultrasound ovary abnormal | FAERS: 1 | US FAERS | |
| 848 | Underweight | FAERS: 1 | US FAERS | |
| 849 | Unmasking of previously unidentified disease | FAERS: 1 | US FAERS | |
| 850 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 851 | Urinary Retention | FAERS: 1 | US FAERS | |
| 852 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 853 | Vascular rupture | FAERS: 1 | US FAERS | |
| 854 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 855 | Venoocclusive disease | FAERS: 1 | US FAERS | |
| 856 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 857 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 858 | Vertebrobasilar Insufficiency | FAERS: 1 | US FAERS | |
| 859 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 860 | Visual disturbance | FAERS: 1 | US FAERS | |
| 861 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 862 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 863 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 864 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 865 | Zygomycosis | FAERS: 1 | US FAERS | |
| 866 | muscle injury | FAERS: 1 | US FAERS | |
| 867 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 868 | prostatitis | FAERS: 1 | US FAERS | |
| 869 | Amyloidosis | OFFSIDES | ||
| 870 | Anaphylactic shock | SIDER | ||
| 871 | Antidepressant drug clearance decreased | OFFSIDES | ||
| 872 | Anuria | OFFSIDES | ||
| 873 | Arthropathy | OFFSIDES | ||
| 874 | Biliary tract infection | OFFSIDES | ||
| 875 | Bladder catheter temporary | OFFSIDES | ||
| 876 | Blast cell count increased | OFFSIDES | ||
| 877 | Blepharitis | SIDER | ||
| 878 | Blood Glucose | OFFSIDES | ||
| 879 | Blood amylase increased | SIDER | ||
| 880 | Blood and lymphatic system disorders | SIDER | ||
| 881 | Blood beta-D-glucan increased | OFFSIDES | ||
| 882 | Blood chloride decreased | OFFSIDES | ||
| 883 | Blood fibrinogen | OFFSIDES | ||
| 884 | Blood in stool | SIDER | ||
| 885 | Blood magnesium decreased | OFFSIDES | ||
| 886 | Blood potassium | OFFSIDES | ||
| 887 | Blood sodium | OFFSIDES | ||
| 888 | Blurred vision | OFFSIDES | ||
| 889 | Bronchiectasis | OFFSIDES | ||
| 890 | Bullous eruption | SIDER | ||
| 891 | CYTOMEGALOVIRUS ANTIGEN | OFFSIDES | ||
| 892 | Cardioactive drug level | OFFSIDES | ||
| 893 | Cell marker increased | OFFSIDES | ||
| 894 | Cerebral disorder | OFFSIDES | ||
| 895 | Cerebrovascular Insufficiency | OFFSIDES | ||
| 896 | Cerebrovascular operation | OFFSIDES | ||
| 897 | Cervical laser therapy | OFFSIDES | ||
| 898 | Cheilitis | SIDER | ||
| 899 | Chest wall cyst | OFFSIDES | ||
| 900 | Choking sensation | OFFSIDES | ||
| 901 | Choking | OFFSIDES | ||
| 902 | Cholangiolitis | OFFSIDES | ||
| 903 | Colectomy | OFFSIDES | ||
| 904 | Colon adenoma | OFFSIDES | ||
| 905 | Compression fracture | OFFSIDES | ||
| 906 | Conjunctival deposit | OFFSIDES | ||
| 907 | Creatine Phosphokinase Increased | SIDER | ||
| 908 | Creatinine increased | SIDER | ||
| 909 | Cytolytic hepatitis | OFFSIDES | ||
| 910 | Diarrhea | OFFSIDES | ||
| 911 | Disturbance in sexual arousal | SIDER | ||
| 912 | Diverticulitis | SIDER | ||
| 913 | Drug Tolerance | OFFSIDES | ||
| 914 | Dyslalia | OFFSIDES | ||
| 915 | Ear and labyrinth disorders | SIDER | ||
| 916 | Electrocardiogram ST-T segment abnormal | OFFSIDES | ||
| 917 | Encephalitis | OFFSIDES | ||
| 918 | Endoscopy gastrointestinal abnormal | OFFSIDES | ||
| 919 | Engraftment syndrome | OFFSIDES | ||
| 920 | Enterococcal infection | OFFSIDES | ||
| 921 | Exploratory operation | OFFSIDES | ||
| 922 | Familial Mediterranean Fever | OFFSIDES | ||
| 923 | Fibrin D dimer decreased | OFFSIDES | ||
| 924 | Fibrin decreased | OFFSIDES | ||
| 925 | Folliculitis | SIDER | ||
| 926 | Gas Gangrene | OFFSIDES | ||
| 927 | Gastric ulcer | SIDER | ||
| 928 | Gastroenteritis | SIDER | ||
| 929 | Gastrointestinal mucosal exfoliation | OFFSIDES | ||
| 930 | Gastrointestinal obstruction | SIDER | ||
| 931 | Glaucoma | SIDER | ||
| 932 | Granulocyte count decreased | OFFSIDES | ||
| 933 | Heartburn | SIDER | ||
| 934 | Hepatectomy | OFFSIDES | ||
| 935 | Hepatitis B positive | OFFSIDES | ||
| 936 | High frequency ablation | OFFSIDES | ||
| 937 | Hypercapnia | OFFSIDES | ||
| 938 | Hypereosinophilic syndrome | OFFSIDES | ||
| 939 | Hypotrichosis | SIDER | ||
| 940 | Ileal Stenosis | OFFSIDES | ||
| 941 | Immunosuppressant drug level decreased | OFFSIDES | ||
| 942 | Implant site infection | OFFSIDES | ||
| 943 | Increased tendency to bruise | SIDER | ||
| 944 | Infestation | SIDER | ||
| 945 | Injury asphyxiation | OFFSIDES | ||
| 946 | Intubation | OFFSIDES | ||
| 947 | Lactic dehydrogenase activity increased | SIDER | ||
| 948 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 949 | Left ventricular end-diastolic pressure increased | OFFSIDES | ||
| 950 | Leukoderma | SIDER | ||
| 951 | Leukopenia neonatal | OFFSIDES | ||
| 952 | Lightheadedness | SIDER | ||
| 953 | Macrocytosis | OFFSIDES | ||
| 954 | Mastocytosis | SIDER | ||
| 955 | Mechanical ventilation | OFFSIDES | ||
| 956 | Meningeal disorder | OFFSIDES | ||
| 957 | Menorrhagia | SIDER | ||
| 958 | Mental status changes | OFFSIDES | ||
| 959 | Metamyelocyte count increased | OFFSIDES | ||
| 960 | Mucormycosis | OFFSIDES | ||
| 961 | Muscle Weakness | OFFSIDES | ||
| 962 | Muscle necrosis | OFFSIDES | ||
| 963 | Myelosuppression | SIDER | ||
| 964 | Nail pigmentation | OFFSIDES | ||
| 965 | Nephrectomy | OFFSIDES | ||
| 966 | Nipple pain | SIDER | ||
| 967 | Non-cardiac chest pain | OFFSIDES | ||
| 968 | Oedema aggravated | SIDER | ||
| 969 | Optic Neuropathy | OFFSIDES | ||
| 970 | Oral mucosal exfoliation | OFFSIDES | ||
| 971 | Oropharyngeal discomfort | SIDER | ||
| 972 | Osteopenia | OFFSIDES | ||
| 973 | Panniculitis | OFFSIDES | ||
| 974 | Perirectal abscess | OFFSIDES | ||
| 975 | Pharyngeal Mucositis | SIDER | ||
| 976 | Pharyngolaryngeal Pain | SIDER | ||
| 977 | Platelet Transfusion | OFFSIDES | ||
| 978 | Pleuritic pain | SIDER | ||
| 979 | Pleurodesis | OFFSIDES | ||
| 980 | Polymyositis | OFFSIDES | ||
| 981 | Protein-losing gastroenteropathy | OFFSIDES | ||
| 982 | Prothrombin time abnormal | OFFSIDES | ||
| 983 | Pupillary light reflex tests abnormal | OFFSIDES | ||
| 984 | Reflux gastritis | OFFSIDES | ||
| 985 | Regurgitation | OFFSIDES | ||
| 986 | Rhinitis | SIDER | ||
| 987 | Sequestrectomy | OFFSIDES | ||
| 988 | Sexual Dysfunction | SIDER | ||
| 989 | Sigmoidoscopy abnormal | OFFSIDES | ||
| 990 | Skin carcinoma | SIDER | ||
| 991 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 992 | Stenotrophomonas infection | OFFSIDES | ||
| 993 | Stridor | OFFSIDES | ||
| 994 | Subcutaneous Emphysema | OFFSIDES | ||
| 995 | Sweating | SIDER | ||
| 996 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 997 | Therapeutic response unexpected | OFFSIDES | ||
| 998 | Tooth Extraction | OFFSIDES | ||
| 999 | Vascular purpura | SIDER | ||
| 1000 | Vasculitis | SIDER | ||
| 1001 | Waist circumference increased | OFFSIDES | ||
| 1002 | Weight Gain | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.