Sorafenib
(MLDQJTXFUGDVEO-UHFFFAOYSA-N)
Structure
- SMILES
- CNC(=O)c1nccc(c1)Oc1ccc(cc1)NC(=O)Nc1ccc(c(c1)C(F)(F)F)Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE05
- Molecular Formula:
- C21H16ClF3N4O3
- Molecular Weight:
- 464.825
- Log P:
- 6.0866
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 92.35
- CAS Number(s):
- 100012-18-8; 284461-73-0
Synonym(s)
1.
Sorafenib
2.
4-(4-(3-(4-Chloro-3-trifluoromethylphenyl)ureido)phenoxy)pyridine-2-carboxylic acid methyamide-4-methylbenzenesulfonate
3.
BAY 43-9006
4.
BAY 545-9085
5.
BAY-545-9085
6.
BAY-673472
7.
Nexavar
8.
Sorafenib N-Oxide
9.
Sorafenib Tosylate
10.
BAY 43 9006
11.
BAY 439006
12.
BAY 545 9085
13.
BAY 5459085
14.
BAY 673472
15.
BAY5459085
16.
Sorafenib N Oxide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 877 Canada Vigilance: 10 | 19095497 20082451 20733337 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Nausea | FAERS: 637 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 3 | Asthenia | FAERS: 511 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 4 | Vomiting | FAERS: 452 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 5 | Weight decreased | FAERS: 431 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 6 | Alopecia | FAERS: 421 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Abdominal Pain | FAERS: 398 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Erythema | FAERS: 330 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Ascites | FAERS: 311 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Malaise | FAERS: 305 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 11 | Pruritus | FAERS: 299 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 12 | Hepatic Encephalopathy | FAERS: 276 | 19861429 | CTD US FAERS |
| 13 | Dry skin | FAERS: 254 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Constipation | FAERS: 239 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 15 | Pain | FAERS: 235 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 16 | Dysphonia | FAERS: 232 | OFFSIDES SIDER US FAERS | |
| 17 | Headache | FAERS: 223 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 18 | Stomatitis | FAERS: 197 Canada Vigilance: 3 | 18796127 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Renal Cell Carcinoma | FAERS: 187 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | jaundice | FAERS: 179 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Arthralgia | FAERS: 178 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 22 | Dizziness | FAERS: 171 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Dehydration | FAERS: 161 | OFFSIDES SIDER US FAERS | |
| 24 | Abasia | FAERS: 159 | US FAERS | |
| 25 | General physical health deterioration | FAERS: 156 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 26 | Drug ineffective | FAERS: 152 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 27 | Epistaxis | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Pneumonia | FAERS: 133 | SIDER US FAERS | |
| 29 | Disease Progression | FAERS: 131 Canada Vigilance: 21 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 30 | Chest Pain | FAERS: 130 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 31 | Hyperkeratosis | FAERS: 128 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Pain of skin | FAERS: 115 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Aspartate Aminotransferase Increased | FAERS: 108 | SIDER US FAERS | |
| 34 | Alanine Aminotransferase Increased | FAERS: 104 | OFFSIDES SIDER US FAERS | |
| 35 | Peripheral swelling | FAERS: 104 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Myocardial Infarction | FAERS: 97 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 37 | Ammonia increased | FAERS: 96 | US FAERS | |
| 38 | Aphagia | FAERS: 94 | OFFSIDES US FAERS | |
| 39 | Back Pain | FAERS: 92 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 40 | Malignant neoplasm progression | FAERS: 92 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 41 | Cerebral Infarction | FAERS: 91 | US FAERS | |
| 42 | Oral pain | FAERS: 88 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 43 | Thrombocytopenia | FAERS: 86 | SIDER US FAERS | |
| 44 | Anorexia | FAERS: 84 | OFFSIDES SIDER US FAERS | |
| 45 | Product use in unapproved indication | FAERS: 80 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 46 | Burning sensation | FAERS: 79 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 47 | Lipase increased | FAERS: 79 | SIDER US FAERS | |
| 48 | Skin Ulcer | FAERS: 79 | US FAERS | |
| 49 | Skin lesion | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | White blood cell count decreased | FAERS: 78 | US FAERS | |
| 51 | Cerebrovascular accident | FAERS: 76 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 52 | Sepsis | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Hypotension | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Blood amylase increased | FAERS: 71 | OFFSIDES US FAERS | |
| 55 | Abdominal discomfort | FAERS: 69 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 56 | Atrial Fibrillation | FAERS: 67 | US FAERS | |
| 57 | Blood creatinine increased | FAERS: 66 | OFFSIDES US FAERS | |
| 58 | Drug dose omission | FAERS: 65 | US FAERS | |
| 59 | Myalgia | FAERS: 65 | SIDER US FAERS | |
| 60 | Skin reaction | FAERS: 64 | US FAERS | |
| 61 | Hypophagia | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Oropharyngeal pain | FAERS: 62 | US FAERS | |
| 63 | Dyspepsia | FAERS: 61 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 64 | Feeling abnormal | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Flatulence | FAERS: 60 | US FAERS | |
| 66 | Pancreatitis | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 67 | Unevaluable event | FAERS: 60 | US FAERS | |
| 68 | Chest discomfort | FAERS: 59 | US FAERS | |
| 69 | Pulmonary Embolism | FAERS: 58 | US FAERS | |
| 70 | Gastric ulcer | FAERS: 57 | US FAERS | |
| 71 | Somnolence | FAERS: 56 | US FAERS | |
| 72 | Disorientation | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 73 | Erythema Multiforme | FAERS: 55 | OFFSIDES SIDER US FAERS | |
| 74 | Tremor | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Rash erythematous | FAERS: 54 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 76 | Chills | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Urinary tract infection | FAERS: 52 | US FAERS | |
| 78 | Disseminated Intravascular Coagulation | FAERS: 51 | US FAERS | |
| 79 | Stevens-Johnson Syndrome | FAERS: 49 | 25811541 | CTD SIDER US FAERS |
| 80 | Dysgeusia | FAERS: 48 | SIDER US FAERS | |
| 81 | Lethargy | FAERS: 48 | US FAERS | |
| 82 | Blood glucose increased | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Hypothyroidism | FAERS: 47 | SIDER US FAERS | |
| 84 | Anxiety | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Metastatic Renal Cell Carcinoma | FAERS: 45 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 86 | Thrombosis | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Respiratory Failure | FAERS: 44 | US FAERS | |
| 88 | Joint swelling | FAERS: 43 | US FAERS | |
| 89 | Musculoskeletal Pain | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Pancytopenia | FAERS: 43 | US FAERS | |
| 91 | Product use issue | FAERS: 42 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 92 | Urticaria | FAERS: 41 | SIDER US FAERS | |
| 93 | Acne | FAERS: 40 | US FAERS | |
| 94 | Depressed Level of Consciousness | FAERS: 40 | US FAERS | |
| 95 | Therapy cessation | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 96 | Blood lactate dehydrogenase increased | FAERS: 39 | US FAERS | |
| 97 | Infection | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 98 | Portal Vein Thrombosis | FAERS: 39 | US FAERS | |
| 99 | Syncope | FAERS: 39 | SIDER US FAERS | |
| 100 | Transaminases increased | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 101 | Blood glucose decreased | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 102 | Flushing | FAERS: 36 | SIDER US FAERS | |
| 103 | Adverse event | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Blood albumin decreased | FAERS: 35 | US FAERS | |
| 105 | Cellulitis | FAERS: 35 | US FAERS | |
| 106 | Gamma-Glutamyltransferase Increased | FAERS: 35 | OFFSIDES US FAERS | |
| 107 | Hypersensitivity | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 108 | Memory impairment | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Swelling | FAERS: 35 | US FAERS | |
| 110 | Altered state of consciousness | FAERS: 34 | US FAERS | |
| 111 | Blood potassium increased | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Liver carcinoma ruptured | FAERS: 34 | OFFSIDES US FAERS | |
| 113 | Toxicity to various agents | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Blood pressure fluctuation | FAERS: 33 | US FAERS | |
| 115 | Nephrotic Syndrome | FAERS: 33 | SIDER US FAERS | |
| 116 | Squamous cell carcinoma of skin | FAERS: 33 | SIDER US FAERS | |
| 117 | Skin toxicity | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 118 | Activities of daily living impaired | FAERS: 31 | US FAERS | |
| 119 | Blood sodium decreased | FAERS: 31 | US FAERS | |
| 120 | Hypersomnia | FAERS: 31 | US FAERS | |
| 121 | Amnesia | FAERS: 30 | US FAERS | |
| 122 | Blood count abnormal | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Cardiac Arrest | FAERS: 30 | US FAERS | |
| 124 | Squamous cell carcinoma | FAERS: 30 | SIDER US FAERS | |
| 125 | Tumour haemorrhage | FAERS: 30 | US FAERS | |
| 126 | Gait inability | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Limb discomfort | FAERS: 29 | US FAERS | |
| 128 | Palpitations | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Skin irritation | FAERS: 29 | US FAERS | |
| 130 | Tachycardia | FAERS: 29 | US FAERS | |
| 131 | Bone pain | FAERS: 28 | US FAERS | |
| 132 | Chromaturia | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Deep Vein Thrombosis | FAERS: 27 | US FAERS | |
| 134 | Loss of personal independence in daily activities | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Neutrophil count decreased | FAERS: 27 | US FAERS | |
| 136 | Dysuria | FAERS: 26 | US FAERS | |
| 137 | Proteinuria | FAERS: 26 | SIDER US FAERS | |
| 138 | Deafness | FAERS: 25 | US FAERS | |
| 139 | Delirium | FAERS: 25 | US FAERS | |
| 140 | Dysarthria | FAERS: 25 | US FAERS | |
| 141 | Inflammation | FAERS: 25 | US FAERS | |
| 142 | Lymphadenopathy | FAERS: 25 | US FAERS | |
| 143 | Ejection Fraction Decreased | FAERS: 24 | OFFSIDES US FAERS | |
| 144 | Aphasia | FAERS: 23 | US FAERS | |
| 145 | Blood urine present | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Sudden death | FAERS: 23 | OFFSIDES US FAERS | |
| 147 | Urinary Retention | FAERS: 23 | US FAERS | |
| 148 | Bedridden | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Eczema | FAERS: 22 | SIDER US FAERS | |
| 150 | Febrile Neutropenia | FAERS: 22 | US FAERS | |
| 151 | Hepatitis | FAERS: 22 | 18796127 | CTD US FAERS |
| 152 | Liver Abscess | FAERS: 22 | US FAERS | |
| 153 | Pancreatic enzymes increased | FAERS: 22 | US FAERS | |
| 154 | Acute myocardial infarction | FAERS: 21 | OFFSIDES US FAERS | |
| 155 | Ageusia | FAERS: 21 | US FAERS | |
| 156 | Blood creatine phosphokinase increased | FAERS: 21 | US FAERS | |
| 157 | Cholelithiasis | FAERS: 21 | US FAERS | |
| 158 | Dermatitis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 159 | Gout | FAERS: 21 | US FAERS | |
| 160 | Hyperthyroidism | FAERS: 21 | SIDER US FAERS | |
| 161 | No adverse event | FAERS: 21 | US FAERS | |
| 162 | Depressed mood | FAERS: 20 | US FAERS | |
| 163 | Gastritis | FAERS: 20 | SIDER US FAERS | |
| 164 | Large intestine perforation | FAERS: 20 | OFFSIDES US FAERS | |
| 165 | Neutropenia | FAERS: 20 | SIDER US FAERS | |
| 166 | Oropharyngeal blistering | FAERS: 20 | US FAERS | |
| 167 | Peritonitis | FAERS: 20 | US FAERS | |
| 168 | keratoacanthoma | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 169 | Ileus | FAERS: 19 | US FAERS | |
| 170 | Nasopharyngitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 171 | Pneumothorax | FAERS: 19 | OFFSIDES US FAERS | |
| 172 | Skin hypertrophy | FAERS: 19 | OFFSIDES US FAERS | |
| 173 | furuncle | FAERS: 19 | US FAERS | |
| 174 | Actinic keratosis | FAERS: 18 | US FAERS | |
| 175 | Angina Pectoris | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Blood alkaline phosphatase increased | FAERS: 18 | OFFSIDES US FAERS | |
| 177 | Feeling Cold | FAERS: 18 | US FAERS | |
| 178 | Gastrointestinal perforation | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 179 | Scab | FAERS: 18 | US FAERS | |
| 180 | Skin necrosis | FAERS: 18 | US FAERS | |
| 181 | Cachexia | FAERS: 17 | US FAERS | |
| 182 | Lymphopenia | FAERS: 17 | SIDER US FAERS | |
| 183 | Metastasis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Performance status decreased | FAERS: 17 | OFFSIDES US FAERS | |
| 185 | Thyroid cancer metastatic | FAERS: 17 | US FAERS | |
| 186 | Ulcer | FAERS: 17 | US FAERS | |
| 187 | Acute kidney injury | FAERS: 16 | US FAERS | |
| 188 | Dementia | FAERS: 16 | US FAERS | |
| 189 | Gangrene | FAERS: 16 | US FAERS | |
| 190 | Hepatomegaly | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Leukopenia | FAERS: 16 | SIDER US FAERS | |
| 192 | Mental status changes | FAERS: 16 | US FAERS | |
| 193 | Musculoskeletal stiffness | FAERS: 16 | US FAERS | |
| 194 | Night sweats | FAERS: 16 | US FAERS | |
| 195 | Vasculitis | FAERS: 16 | US FAERS | |
| 196 | Blood potassium decreased | FAERS: 15 | SIDER US FAERS | |
| 197 | Duodenal Ulcer | FAERS: 15 | US FAERS | |
| 198 | Electrolyte imbalance | FAERS: 15 | US FAERS | |
| 199 | Hepatotoxicity | FAERS: 15 | US FAERS | |
| 200 | Influenza | FAERS: 15 | US FAERS | |
| 201 | Lip swelling | FAERS: 15 | US FAERS | |
| 202 | Metabolic acidosis | FAERS: 15 | US FAERS | |
| 203 | Metastases to adrenals | FAERS: 15 | US FAERS | |
| 204 | Neck Pain | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Productive Cough | FAERS: 15 | US FAERS | |
| 206 | Thyroiditis | FAERS: 15 | US FAERS | |
| 207 | Aphonia | FAERS: 14 | US FAERS | |
| 208 | Cholecystitis | FAERS: 14 | SIDER US FAERS | |
| 209 | Cold sweat | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Diabetes Mellitus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Diplopia | FAERS: 14 | OFFSIDES US FAERS | |
| 212 | Discomfort | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | Facial Pain | FAERS: 14 | US FAERS | |
| 214 | Genital rash | FAERS: 14 | US FAERS | |
| 215 | Hypertensive crisis | FAERS: 14 | SIDER US FAERS | |
| 216 | Limb injury | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Musculoskeletal chest pain | FAERS: 14 | US FAERS | |
| 218 | Plantar erythema | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Angioedema | FAERS: 13 | SIDER US FAERS | |
| 220 | Cancer Pain | FAERS: 13 | OFFSIDES US FAERS | |
| 221 | Cholangitis | FAERS: 13 | SIDER US FAERS | |
| 222 | Diverticulitis | FAERS: 13 | US FAERS | |
| 223 | Intra-abdominal fluid collection | FAERS: 13 | US FAERS | |
| 224 | Pericardial effusion | FAERS: 13 | US FAERS | |
| 225 | Pre-existing condition improved | FAERS: 13 | US FAERS | |
| 226 | Retching | FAERS: 13 | US FAERS | |
| 227 | Rhabdomyolysis | FAERS: 13 | SIDER US FAERS | |
| 228 | Septic Shock | FAERS: 13 | US FAERS | |
| 229 | Agitation | FAERS: 12 | US FAERS | |
| 230 | Arthritis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Blindness | FAERS: 12 | US FAERS | |
| 232 | Blood thyroid stimulating hormone increased | FAERS: 12 | SIDER US FAERS | |
| 233 | Blood urea increased | FAERS: 12 | US FAERS | |
| 234 | Colitis | FAERS: 12 | OFFSIDES US FAERS | |
| 235 | Gastric Antral Vascular Ectasia | FAERS: 12 | OFFSIDES US FAERS | |
| 236 | Hepatic cancer metastatic | FAERS: 12 | US FAERS | |
| 237 | Intestinal Obstruction | FAERS: 12 | US FAERS | |
| 238 | Ocular icterus | FAERS: 12 | US FAERS | |
| 239 | Poor quality sleep | FAERS: 12 | US FAERS | |
| 240 | Rhinalgia | FAERS: 12 | US FAERS | |
| 241 | Subcutaneous Abscess | FAERS: 12 | US FAERS | |
| 242 | Urinary Incontinence | FAERS: 12 | US FAERS | |
| 243 | Visual Impairment | FAERS: 12 | US FAERS | |
| 244 | Blood magnesium decreased | FAERS: 11 | US FAERS | |
| 245 | Epilepsy | FAERS: 11 | OFFSIDES US FAERS | |
| 246 | Leukoencephalopathy | FAERS: 11 | SIDER US FAERS | |
| 247 | Medical procedure | FAERS: 11 | US FAERS | |
| 248 | Polyneuropathy | FAERS: 11 | US FAERS | |
| 249 | Tongue blistering | FAERS: 11 | OFFSIDES US FAERS | |
| 250 | Vertigo | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Asterixis | FAERS: 10 | US FAERS | |
| 252 | Bradycardia | FAERS: 10 | US FAERS | |
| 253 | Exfoliative rash | FAERS: 10 | US FAERS | |
| 254 | Gastrointestinal toxicity | FAERS: 10 | OFFSIDES US FAERS | |
| 255 | Hemiplegia | FAERS: 10 | US FAERS | |
| 256 | Intentional product use issue | FAERS: 10 | US FAERS | |
| 257 | Intestinal Perforation | FAERS: 10 | US FAERS | |
| 258 | Menorrhagia | FAERS: 10 | US FAERS | |
| 259 | Muscle Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Product dose omission | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 261 | Psoriasis | FAERS: 10 | US FAERS | |
| 262 | Restlessness | FAERS: 10 | US FAERS | |
| 263 | Sinus Tachycardia | FAERS: 10 | US FAERS | |
| 264 | Tinnitus | FAERS: 10 | SIDER US FAERS | |
| 265 | Unresponsive to stimuli | FAERS: 10 | US FAERS | |
| 266 | Abdominal Abscess | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 267 | Abdominal rigidity | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 268 | Abscess | FAERS: 9 | US FAERS | |
| 269 | Acute respiratory failure | FAERS: 9 | US FAERS | |
| 270 | Anal abscess | FAERS: 9 | US FAERS | |
| 271 | Asthma | FAERS: 9 | US FAERS | |
| 272 | Cystitis | FAERS: 9 | US FAERS | |
| 273 | Drug resistance | FAERS: 9 | OFFSIDES US FAERS | |
| 274 | Enterocolitis | FAERS: 9 | US FAERS | |
| 275 | Eructation | FAERS: 9 | US FAERS | |
| 276 | Eye pain | FAERS: 9 | US FAERS | |
| 277 | Gastrointestinal inflammation | FAERS: 9 | US FAERS | |
| 278 | Hemiparesis | FAERS: 9 | US FAERS | |
| 279 | Impaired work ability | FAERS: 9 | US FAERS | |
| 280 | Inappropriate schedule of drug administration | FAERS: 9 | US FAERS | |
| 281 | Joint stiffness | FAERS: 9 | US FAERS | |
| 282 | MYELODYSPLASTIC SYNDROME | FAERS: 9 | US FAERS | |
| 283 | Mental impairment | FAERS: 9 | US FAERS | |
| 284 | Nephrolithiasis | FAERS: 9 | US FAERS | |
| 285 | Nipple pain | FAERS: 9 | US FAERS | |
| 286 | Pallor | FAERS: 9 | US FAERS | |
| 287 | Pharyngolaryngeal Pain | FAERS: 9 | US FAERS | |
| 288 | Pleuritic pain | FAERS: 9 | US FAERS | |
| 289 | Pneumoperitoneum | FAERS: 9 | US FAERS | |
| 290 | Product availability issue | FAERS: 9 | US FAERS | |
| 291 | Skin Papilloma | FAERS: 9 | US FAERS | |
| 292 | Terminal state | FAERS: 9 | US FAERS | |
| 293 | Therapeutic response unexpected | FAERS: 9 | US FAERS | |
| 294 | Ventricular arrhythmia | FAERS: 9 | US FAERS | |
| 295 | Vulvovaginal discomfort | FAERS: 9 | US FAERS | |
| 296 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 297 | nervous system disorder | FAERS: 9 | SIDER US FAERS | |
| 298 | Anal Fistula | FAERS: 8 | US FAERS | |
| 299 | Appendicitis | FAERS: 8 | US FAERS | |
| 300 | Blood blister | FAERS: 8 | US FAERS | |
| 301 | Blood triglycerides increased | FAERS: 8 | US FAERS | |
| 302 | Bronchitis | FAERS: 8 | US FAERS | |
| 303 | Cardiotoxicity | FAERS: 8 | US FAERS | |
| 304 | Choking | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Completed Suicide | FAERS: 8 | SIDER US FAERS | |
| 306 | Diverticulum | FAERS: 8 | US FAERS | |
| 307 | Eosinophilia | FAERS: 8 | US FAERS | |
| 308 | Flank Pain | FAERS: 8 | US FAERS | |
| 309 | Gastrointestinal ulcer | FAERS: 8 | US FAERS | |
| 310 | Hepatic necrosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 311 | Hyperpyrexia | FAERS: 8 | US FAERS | |
| 312 | Impaired self-care | FAERS: 8 | US FAERS | |
| 313 | Intentional product misuse | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Leukocytoclastic vasculitis | FAERS: 8 | SIDER US FAERS | |
| 315 | Leukocytosis | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 316 | Lymphangiosis carcinomatosa | FAERS: 8 | US FAERS | |
| 317 | Pneumatosis intestinalis | FAERS: 8 | US FAERS | |
| 318 | Renal pain | FAERS: 8 | US FAERS | |
| 319 | Respiratory arrest | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Retinal Vein Occlusion | FAERS: 8 | US FAERS | |
| 321 | Thermal burn | FAERS: 8 | US FAERS | |
| 322 | Toothache | FAERS: 8 | US FAERS | |
| 323 | Vulvovaginal pain | FAERS: 8 | US FAERS | |
| 324 | Acute Coronary Syndrome | FAERS: 7 | SIDER US FAERS | |
| 325 | Anal Ulcer | FAERS: 7 | US FAERS | |
| 326 | Anorectal discomfort | FAERS: 7 | US FAERS | |
| 327 | Anuria | FAERS: 7 | US FAERS | |
| 328 | Arterial thrombosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 329 | Blood cholesterol increased | FAERS: 7 | US FAERS | |
| 330 | Blood glucose fluctuation | FAERS: 7 | US FAERS | |
| 331 | Cyanosis | FAERS: 7 | US FAERS | |
| 332 | Extremity necrosis | FAERS: 7 | US FAERS | |
| 333 | Glossitis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 334 | Hepatic Infarction | FAERS: 7 | US FAERS | |
| 335 | Hepatorenal Syndrome | FAERS: 7 | US FAERS | |
| 336 | Hyperkeratosis palmaris and plantaris | FAERS: 7 | US FAERS | |
| 337 | Hypokinesia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 338 | Hypotrichosis | FAERS: 7 | US FAERS | |
| 339 | Incorrect dose administered | FAERS: 7 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 340 | Increased upper airway secretion | FAERS: 7 | US FAERS | |
| 341 | Laryngitis | FAERS: 7 | US FAERS | |
| 342 | Metastatic Neoplasm | FAERS: 7 | US FAERS | |
| 343 | Monoplegia | FAERS: 7 | US FAERS | |
| 344 | Musculoskeletal discomfort | FAERS: 7 | SIDER US FAERS | |
| 345 | Nervousness | FAERS: 7 | US FAERS | |
| 346 | Oliguria | FAERS: 7 | US FAERS | |
| 347 | Palmar erythema | FAERS: 7 | US FAERS | |
| 348 | Pleurisy | FAERS: 7 | US FAERS | |
| 349 | Purpura | FAERS: 7 | US FAERS | |
| 350 | Respiratory tract congestion | FAERS: 7 | US FAERS | |
| 351 | Retinal Detachment | FAERS: 7 | US FAERS | |
| 352 | Sarcoma | FAERS: 7 | US FAERS | |
| 353 | Scrotal erythema | FAERS: 7 | US FAERS | |
| 354 | Skin Induration | FAERS: 7 | US FAERS | |
| 355 | Supraventricular tachycardia | FAERS: 7 | OFFSIDES US FAERS | |
| 356 | Throat irritation | FAERS: 7 | US FAERS | |
| 357 | Wheezing | FAERS: 7 | US FAERS | |
| 358 | Amylase increased | FAERS: 6 | SIDER US FAERS | |
| 359 | Apathy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 360 | Atrial Flutter | FAERS: 6 | US FAERS | |
| 361 | Basal cell carcinoma | FAERS: 6 | US FAERS | |
| 362 | Blood phosphorus decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 363 | Bone lesion | FAERS: 6 | US FAERS | |
| 364 | Bronchopulmonary Aspergillosis | FAERS: 6 | US FAERS | |
| 365 | Buccal mucosal roughening | FAERS: 6 | US FAERS | |
| 366 | Candidiasis | FAERS: 6 | US FAERS | |
| 367 | Cheilitis | FAERS: 6 | US FAERS | |
| 368 | Cholestasis | FAERS: 6 | US FAERS | |
| 369 | Clostridium difficile colitis | FAERS: 6 | US FAERS | |
| 370 | Coronary Artery Disease | FAERS: 6 | US FAERS | |
| 371 | Empyema | FAERS: 6 | US FAERS | |
| 372 | Fracture | FAERS: 6 | US FAERS | |
| 373 | Gastrointestinal hypermotility | FAERS: 6 | US FAERS | |
| 374 | Gastrointestinal sounds abnormal | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 375 | Haematotoxicity | FAERS: 6 | OFFSIDES US FAERS | |
| 376 | Head discomfort | FAERS: 6 | US FAERS | |
| 377 | Hepatitis B | FAERS: 6 | US FAERS | |
| 378 | Hepatitis C | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Hypoxia | FAERS: 6 | US FAERS | |
| 380 | Incoherent | FAERS: 6 | US FAERS | |
| 381 | Incontinence | FAERS: 6 | US FAERS | |
| 382 | Increased tendency to bruise | FAERS: 6 | US FAERS | |
| 383 | Loose tooth | FAERS: 6 | US FAERS | |
| 384 | Lower respiratory tract infection | FAERS: 6 | US FAERS | |
| 385 | Mouth swelling | FAERS: 6 | US FAERS | |
| 386 | Occult blood positive | FAERS: 6 | US FAERS | |
| 387 | Oncologic complication | FAERS: 6 | US FAERS | |
| 388 | Oral candidiasis | FAERS: 6 | US FAERS | |
| 389 | Petechiae | FAERS: 6 | US FAERS | |
| 390 | Portal Hypertension | FAERS: 6 | US FAERS | |
| 391 | Pulmonary thrombosis | FAERS: 6 | US FAERS | |
| 392 | Radiation skin injury | FAERS: 6 | US FAERS | |
| 393 | Renal abscess | FAERS: 6 | US FAERS | |
| 394 | Renal cancer metastatic | FAERS: 6 | US FAERS | |
| 395 | Respiratory distress | FAERS: 6 | SIDER US FAERS | |
| 396 | Secretion discharge | FAERS: 6 | US FAERS | |
| 397 | Shock | FAERS: 6 | SIDER US FAERS | |
| 398 | Sinusitis | FAERS: 6 | US FAERS | |
| 399 | Therapy non-responder | FAERS: 6 | US FAERS | |
| 400 | Tongue discomfort | FAERS: 6 | US FAERS | |
| 401 | Tooth Infection | FAERS: 6 | US FAERS | |
| 402 | VIIth nerve paralysis | FAERS: 6 | US FAERS | |
| 403 | Vulvovaginal mycotic infection | FAERS: 6 | US FAERS | |
| 404 | Aphthous Stomatitis | FAERS: 5 | SIDER US FAERS | |
| 405 | Asphyxia | FAERS: 5 | US FAERS | |
| 406 | Auricular swelling | FAERS: 5 | US FAERS | |
| 407 | Blood testosterone decreased | FAERS: 5 | US FAERS | |
| 408 | Disease complication | FAERS: 5 | US FAERS | |
| 409 | Drug toxicity | FAERS: 5 | US FAERS | |
| 410 | Ear discomfort | FAERS: 5 | US FAERS | |
| 411 | Ecchymosis | FAERS: 5 | US FAERS | |
| 412 | Electrocardiogram abnormal | FAERS: 5 | US FAERS | |
| 413 | Emotional distress | FAERS: 5 | US FAERS | |
| 414 | Erythema Nodosum | FAERS: 5 | US FAERS | |
| 415 | Folliculitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 416 | Gastroenteritis | FAERS: 5 | US FAERS | |
| 417 | Gastrointestinal Pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 418 | Gingivitis | FAERS: 5 | US FAERS | |
| 419 | Glaucoma | FAERS: 5 | US FAERS | |
| 420 | Hallucinations, mixed | FAERS: 5 | US FAERS | |
| 421 | Hepatic cancer stage IV | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 422 | Hospice Care | FAERS: 5 | US FAERS | |
| 423 | Hydrocephalus | FAERS: 5 | US FAERS | |
| 424 | Hydrothorax | FAERS: 5 | US FAERS | |
| 425 | Immobile | FAERS: 5 | US FAERS | |
| 426 | Liver transplant rejection | FAERS: 5 | US FAERS | |
| 427 | Lung Abscess | FAERS: 5 | US FAERS | |
| 428 | Lymphocyte count decreased | FAERS: 5 | US FAERS | |
| 429 | Malnutrition | FAERS: 5 | SIDER US FAERS | |
| 430 | Meningitis | FAERS: 5 | US FAERS | |
| 431 | Pancreatic carcinoma | FAERS: 5 | US FAERS | |
| 432 | Pathological fracture | FAERS: 5 | US FAERS | |
| 433 | Pelvic Pain | FAERS: 5 | US FAERS | |
| 434 | Portal venous gas | FAERS: 5 | US FAERS | |
| 435 | Post procedural infection | FAERS: 5 | US FAERS | |
| 436 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 437 | Quality of life decreased | FAERS: 5 | US FAERS | |
| 438 | Rectal abscess | FAERS: 5 | US FAERS | |
| 439 | Rheumatoid Arthritis | FAERS: 5 | US FAERS | |
| 440 | Skin Erosion | FAERS: 5 | US FAERS | |
| 441 | Skin discomfort | FAERS: 5 | US FAERS | |
| 442 | Stress | FAERS: 5 | US FAERS | |
| 443 | Tetany | FAERS: 5 | OFFSIDES US FAERS | |
| 444 | Troponin increased | FAERS: 5 | US FAERS | |
| 445 | Tuberculosis | FAERS: 5 | US FAERS | |
| 446 | Urethral Obstruction | FAERS: 5 | US FAERS | |
| 447 | Uveitis | FAERS: 5 | US FAERS | |
| 448 | Ventricular Dysfunction | FAERS: 5 | US FAERS | |
| 449 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 450 | Walking aid user | FAERS: 5 | US FAERS | |
| 451 | Wound dehiscence | FAERS: 5 | OFFSIDES US FAERS | |
| 452 | treatment failure | FAERS: 5 | US FAERS | |
| 453 | Acidosis | FAERS: 4 | US FAERS | |
| 454 | Anal Fissure | FAERS: 4 | US FAERS | |
| 455 | Aneurysm | FAERS: 4 | US FAERS | |
| 456 | Anger | FAERS: 4 | US FAERS | |
| 457 | Atelectasis | FAERS: 4 | US FAERS | |
| 458 | Blister rupture | FAERS: 4 | US FAERS | |
| 459 | Blood iron decreased | FAERS: 4 | US FAERS | |
| 460 | Bruxism | FAERS: 4 | US FAERS | |
| 461 | Cardiac discomfort | FAERS: 4 | US FAERS | |
| 462 | Cataract | FAERS: 4 | US FAERS | |
| 463 | Catheter related infection | FAERS: 4 | OFFSIDES US FAERS | |
| 464 | Diabetes Insipidus | FAERS: 4 | US FAERS | |
| 465 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 466 | Diastolic hypertension | FAERS: 4 | US FAERS | |
| 467 | Diffuse alveolar damage | FAERS: 4 | US FAERS | |
| 468 | Diverticular perforation | FAERS: 4 | US FAERS | |
| 469 | Drug administration error | FAERS: 4 | US FAERS | |
| 470 | Escherichia urinary tract infection | FAERS: 4 | US FAERS | |
| 471 | Euphoric mood | FAERS: 4 | US FAERS | |
| 472 | Expired product administered | FAERS: 4 | US FAERS | |
| 473 | Eye irritation | FAERS: 4 | US FAERS | |
| 474 | Gastric infection | FAERS: 4 | US FAERS | |
| 475 | Gastrointestinal obstruction | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 476 | Genital abscess | FAERS: 4 | US FAERS | |
| 477 | Guillain-Barre Syndrome | FAERS: 4 | US FAERS | |
| 478 | Hepatectomy | FAERS: 4 | US FAERS | |
| 479 | Hepatic Infection | FAERS: 4 | US FAERS | |
| 480 | Infectious pleural effusion | FAERS: 4 | US FAERS | |
| 481 | Limb mass | FAERS: 4 | US FAERS | |
| 482 | Malignant ascites | FAERS: 4 | US FAERS | |
| 483 | Mallory-Weiss Syndrome | FAERS: 4 | US FAERS | |
| 484 | Metastases to abdominal cavity | FAERS: 4 | OFFSIDES US FAERS | |
| 485 | Metastatic pain | FAERS: 4 | US FAERS | |
| 486 | Metrorrhagia | FAERS: 4 | US FAERS | |
| 487 | Myositis | FAERS: 4 | US FAERS | |
| 488 | Necrosis | FAERS: 4 | US FAERS | |
| 489 | Neuralgia | FAERS: 4 | US FAERS | |
| 490 | Nodule | FAERS: 4 | US FAERS | |
| 491 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 492 | Oral infection | FAERS: 4 | US FAERS | |
| 493 | Osteomyelitis | FAERS: 4 | US FAERS | |
| 494 | Osteonecrosis of Jaw | FAERS: 4 | SIDER US FAERS | |
| 495 | Pharyngitis | FAERS: 4 | US FAERS | |
| 496 | Polydipsia | FAERS: 4 | US FAERS | |
| 497 | Post procedural complication | FAERS: 4 | US FAERS | |
| 498 | Proctitis | FAERS: 4 | US FAERS | |
| 499 | Protein urine present | FAERS: 4 | SIDER US FAERS | |
| 500 | Prothrombin level decreased | FAERS: 4 | US FAERS | |
| 501 | Restrictive cardiomyopathy | FAERS: 4 | US FAERS | |
| 502 | Retinal Artery Occlusion | FAERS: 4 | US FAERS | |
| 503 | Sciatica | FAERS: 4 | US FAERS | |
| 504 | Spinal column injury | FAERS: 4 | US FAERS | |
| 505 | Splenomegaly | FAERS: 4 | US FAERS | |
| 506 | Therapeutic product ineffective | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 507 | Therapy change | FAERS: 4 | US FAERS | |
| 508 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 509 | Vulvovaginal pruritus | FAERS: 4 | US FAERS | |
| 510 | Wound Infection | FAERS: 4 | US FAERS | |
| 511 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 512 | pseudomembranous colitis | FAERS: 4 | US FAERS | |
| 513 | Abdominal cavity drainage | FAERS: 3 | US FAERS | |
| 514 | Acute left ventricular failure | FAERS: 3 | US FAERS | |
| 515 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 516 | Alanine aminotransferase abnormal | FAERS: 3 | US FAERS | |
| 517 | Ammonia abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 518 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 519 | Anorectal swelling | FAERS: 3 | US FAERS | |
| 520 | Antibiotic therapy | FAERS: 3 | US FAERS | |
| 521 | Arteriovenous fistula | FAERS: 3 | US FAERS | |
| 522 | Arthropathy | FAERS: 3 | US FAERS | |
| 523 | Aspergillosis | FAERS: 3 | US FAERS | |
| 524 | Axonal neuropathy | FAERS: 3 | US FAERS | |
| 525 | Bile Duct Stenosis | FAERS: 3 | US FAERS | |
| 526 | Blood albumin increased | FAERS: 3 | US FAERS | |
| 527 | Blood electrolytes decreased | FAERS: 3 | US FAERS | |
| 528 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 529 | Catheter site pain | FAERS: 3 | OFFSIDES US FAERS | |
| 530 | Catheter site phlebitis | FAERS: 3 | US FAERS | |
| 531 | Cerebellar infarction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 532 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 533 | Chemotherapy | FAERS: 3 | US FAERS | |
| 534 | Cholecystitis infective | FAERS: 3 | US FAERS | |
| 535 | Clostridium difficile sepsis | FAERS: 3 | US FAERS | |
| 536 | Crying | FAERS: 3 | US FAERS | |
| 537 | Cytopenia | FAERS: 3 | US FAERS | |
| 538 | Dental Leakage | FAERS: 3 | US FAERS | |
| 539 | Dental caries | FAERS: 3 | US FAERS | |
| 540 | Device Failure | FAERS: 3 | US FAERS | |
| 541 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 542 | Disability | FAERS: 3 | US FAERS | |
| 543 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 544 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 545 | Duodenal ulcer perforation | FAERS: 3 | US FAERS | |
| 546 | Ejection fraction abnormal | FAERS: 3 | US FAERS | |
| 547 | Emotional disorder | FAERS: 3 | US FAERS | |
| 548 | Enzyme level increased | FAERS: 3 | US FAERS | |
| 549 | Epidermolysis | FAERS: 3 | OFFSIDES US FAERS | |
| 550 | Erectile dysfunction | FAERS: 3 | SIDER US FAERS | |
| 551 | Exposed bone in jaw | FAERS: 3 | US FAERS | |
| 552 | Febrile infection | FAERS: 3 | US FAERS | |
| 553 | Fluid overload | FAERS: 3 | US FAERS | |
| 554 | Foaming at mouth | FAERS: 3 | US FAERS | |
| 555 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 556 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 557 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 558 | Gastrointestinal stoma complication | FAERS: 3 | US FAERS | |
| 559 | Gastrointestinal stromal cancer | FAERS: 3 | US FAERS | |
| 560 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 561 | Hepatic artery thrombosis | FAERS: 3 | US FAERS | |
| 562 | Hernia pain | FAERS: 3 | US FAERS | |
| 563 | Hernia | FAERS: 3 | US FAERS | |
| 564 | Hilar lymphadenopathy | FAERS: 3 | US FAERS | |
| 565 | Hordeolum | FAERS: 3 | US FAERS | |
| 566 | Hunger | FAERS: 3 | US FAERS | |
| 567 | Hypertensive Encephalopathy | FAERS: 3 | US FAERS | |
| 568 | Hypertransaminasaemia | FAERS: 3 | US FAERS | |
| 569 | Hypogeusia | FAERS: 3 | US FAERS | |
| 570 | Hypoventilation | FAERS: 3 | US FAERS | |
| 571 | Implant site reaction | FAERS: 3 | US FAERS | |
| 572 | Intestinal infarction | FAERS: 3 | US FAERS | |
| 573 | Joint injury | FAERS: 3 | US FAERS | |
| 574 | Liver ablation | FAERS: 3 | US FAERS | |
| 575 | Lymphoma | FAERS: 3 | US FAERS | |
| 576 | Malabsorption | FAERS: 3 | US FAERS | |
| 577 | Medication Error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Metastases to gallbladder | FAERS: 3 | US FAERS | |
| 579 | Mineral supplementation | FAERS: 3 | US FAERS | |
| 580 | Muscle tightness | FAERS: 3 | US FAERS | |
| 581 | Myoclonus | FAERS: 3 | US FAERS | |
| 582 | Myopathy | FAERS: 3 | US FAERS | |
| 583 | Nephrectomy | FAERS: 3 | US FAERS | |
| 584 | Neuropathy | FAERS: 3 | SIDER US FAERS | |
| 585 | Neutropenic sepsis | FAERS: 3 | US FAERS | |
| 586 | Neutrophil count abnormal | FAERS: 3 | US FAERS | |
| 587 | Nocturia | FAERS: 3 | US FAERS | |
| 588 | Onychoclasis | FAERS: 3 | US FAERS | |
| 589 | Oropharyngeal discomfort | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 590 | Osteolysis | FAERS: 3 | US FAERS | |
| 591 | Osteosarcoma | FAERS: 3 | US FAERS | |
| 592 | Pancreatic Pseudocyst | FAERS: 3 | OFFSIDES US FAERS | |
| 593 | Panniculitis | FAERS: 3 | US FAERS | |
| 594 | Paracentesis | FAERS: 3 | US FAERS | |
| 595 | Paresis | FAERS: 3 | US FAERS | |
| 596 | Peptic Ulcer | FAERS: 3 | US FAERS | |
| 597 | Perianal abscess | FAERS: 3 | US FAERS | |
| 598 | Perianal erythema | FAERS: 3 | US FAERS | |
| 599 | Pericarditis | FAERS: 3 | OFFSIDES US FAERS | |
| 600 | Peridiverticular abscess | FAERS: 3 | US FAERS | |
| 601 | Peripheral motor neuropathy | FAERS: 3 | US FAERS | |
| 602 | Peritoneal perforation | FAERS: 3 | US FAERS | |
| 603 | Pleural Infection | FAERS: 3 | US FAERS | |
| 604 | Pneumonitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 605 | Polymyositis | FAERS: 3 | US FAERS | |
| 606 | Polyuria | FAERS: 3 | US FAERS | |
| 607 | Portal hypertensive gastropathy | FAERS: 3 | US FAERS | |
| 608 | Procedural complication | FAERS: 3 | US FAERS | |
| 609 | Prosopagnosia | FAERS: 3 | US FAERS | |
| 610 | Protein total increased | FAERS: 3 | US FAERS | |
| 611 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 612 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 613 | Pulmonary sepsis | FAERS: 3 | US FAERS | |
| 614 | Rales | FAERS: 3 | US FAERS | |
| 615 | Rehabilitation therapy | FAERS: 3 | US FAERS | |
| 616 | Retinal vascular thrombosis | FAERS: 3 | US FAERS | |
| 617 | Scleroderma | FAERS: 3 | US FAERS | |
| 618 | Simple Partial Seizures | FAERS: 3 | US FAERS | |
| 619 | Slow speech | FAERS: 3 | US FAERS | |
| 620 | Sluggishness | FAERS: 3 | US FAERS | |
| 621 | Sneezing | FAERS: 3 | US FAERS | |
| 622 | Suspected counterfeit product | FAERS: 3 | US FAERS | |
| 623 | Thyroid atrophy | FAERS: 3 | US FAERS | |
| 624 | Tooth Loss | FAERS: 3 | US FAERS | |
| 625 | Toxic Epidermal Necrolysis | FAERS: 3 | SIDER US FAERS | |
| 626 | Vascular rupture | FAERS: 3 | US FAERS | |
| 627 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 628 | Visual disturbance | FAERS: 3 | US FAERS | |
| 629 | Wheelchair user | FAERS: 3 | US FAERS | |
| 630 | White blood cell count abnormal | FAERS: 3 | US FAERS | |
| 631 | intensive care | FAERS: 3 | US FAERS | |
| 632 | Acute prerenal failure | FAERS: 2 | US FAERS | |
| 633 | Adrenal mass | FAERS: 2 | US FAERS | |
| 634 | Adrenocortical carcinoma | FAERS: 2 | US FAERS | |
| 635 | Akinesia | FAERS: 2 | US FAERS | |
| 636 | Alpha 1 foetoprotein decreased | FAERS: 2 | US FAERS | |
| 637 | Angiosarcoma recurrent | FAERS: 2 | US FAERS | |
| 638 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 639 | Back disorder | FAERS: 2 | US FAERS | |
| 640 | Balanoposthitis | FAERS: 2 | US FAERS | |
| 641 | Bence Jones protein urine present | FAERS: 2 | US FAERS | |
| 642 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 643 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 644 | Biopsy | FAERS: 2 | US FAERS | |
| 645 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 646 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 647 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 648 | Bone swelling | FAERS: 2 | US FAERS | |
| 649 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 650 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 651 | Bronchospasm | FAERS: 2 | US FAERS | |
| 652 | Capillaritis | FAERS: 2 | US FAERS | |
| 653 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 654 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 655 | Cellulitis of male external genital organ | FAERS: 2 | US FAERS | |
| 656 | Choking sensation | FAERS: 2 | US FAERS | |
| 657 | Chylothorax | FAERS: 2 | US FAERS | |
| 658 | Cytolytic hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 659 | Dacryocystitis | FAERS: 2 | US FAERS | |
| 660 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 661 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 662 | Dermoid Cyst | FAERS: 2 | US FAERS | |
| 663 | Device difficult to use | FAERS: 2 | US FAERS | |
| 664 | Device related infection | FAERS: 2 | US FAERS | |
| 665 | Drooling | FAERS: 2 | US FAERS | |
| 666 | Drowning | FAERS: 2 | US FAERS | |
| 667 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 668 | Drug diversion | FAERS: 2 | US FAERS | |
| 669 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 670 | Dyschezia | FAERS: 2 | US FAERS | |
| 671 | Early satiety | FAERS: 2 | US FAERS | |
| 672 | Electrocardiogram change | FAERS: 2 | OFFSIDES US FAERS | |
| 673 | Embolism | FAERS: 2 | SIDER US FAERS | |
| 674 | Emergency Care | FAERS: 2 | US FAERS | |
| 675 | Enterocutaneous Fistula | FAERS: 2 | US FAERS | |
| 676 | Erythrodermic psoriasis | FAERS: 2 | US FAERS | |
| 677 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 678 | Exophthalmos | FAERS: 2 | US FAERS | |
| 679 | Expired drug administered | FAERS: 2 | US FAERS | |
| 680 | Exposure via body fluid | FAERS: 2 | US FAERS | |
| 681 | Exposure via father | FAERS: 2 | US FAERS | |
| 682 | Exposure via skin contact | FAERS: 2 | US FAERS | |
| 683 | Extra dose administered | FAERS: 2 | US FAERS | |
| 684 | Factor VIII Deficiency | FAERS: 2 | US FAERS | |
| 685 | Feeling jittery | FAERS: 2 | US FAERS | |
| 686 | Femoral artery occlusion | FAERS: 2 | US FAERS | |
| 687 | Fibromatosis | FAERS: 2 | US FAERS | |
| 688 | Fibrosis | FAERS: 2 | US FAERS | |
| 689 | Food Poisoning | FAERS: 2 | US FAERS | |
| 690 | Gastrointestinal stoma output increased | FAERS: 2 | US FAERS | |
| 691 | Granulocyte count decreased | FAERS: 2 | US FAERS | |
| 692 | Heat illness | FAERS: 2 | US FAERS | |
| 693 | Hepatitis B DNA increased | FAERS: 2 | US FAERS | |
| 694 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 695 | Hypercapnia | FAERS: 2 | US FAERS | |
| 696 | Hypereosinophilic syndrome | FAERS: 2 | US FAERS | |
| 697 | Hypersplenism | FAERS: 2 | US FAERS | |
| 698 | Hypertrophic Cardiomyopathy | FAERS: 2 | US FAERS | |
| 699 | Hypogonadism | FAERS: 2 | US FAERS | |
| 700 | Hypoparathyroidism | FAERS: 2 | US FAERS | |
| 701 | Hyposideraemia | FAERS: 2 | US FAERS | |
| 702 | Immunosuppression | FAERS: 2 | US FAERS | |
| 703 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 704 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 705 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 706 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 707 | Increased bronchial secretion | FAERS: 2 | US FAERS | |
| 708 | Infarction | FAERS: 2 | SIDER US FAERS | |
| 709 | Infected dermal cyst | FAERS: 2 | US FAERS | |
| 710 | Initial insomnia | FAERS: 2 | US FAERS | |
| 711 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 712 | Interventional procedure | FAERS: 2 | US FAERS | |
| 713 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 714 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 715 | Jugular vein distension | FAERS: 2 | US FAERS | |
| 716 | Laceration | FAERS: 2 | US FAERS | |
| 717 | Large intestinal stenosis | FAERS: 2 | US FAERS | |
| 718 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 719 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 720 | Lipase abnormal | FAERS: 2 | US FAERS | |
| 721 | Liver function test decreased | FAERS: 2 | US FAERS | |
| 722 | Local reaction | FAERS: 2 | US FAERS | |
| 723 | Lymphangioma | FAERS: 2 | US FAERS | |
| 724 | Mechanical ileus | FAERS: 2 | US FAERS | |
| 725 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 726 | Medical device change | FAERS: 2 | US FAERS | |
| 727 | Metastases to abdominal wall | FAERS: 2 | US FAERS | |
| 728 | Metastases to diaphragm | FAERS: 2 | US FAERS | |
| 729 | Metastases to stomach | FAERS: 2 | US FAERS | |
| 730 | Metastases to thorax | FAERS: 2 | US FAERS | |
| 731 | Middle insomnia | FAERS: 2 | US FAERS | |
| 732 | Monoparesis | FAERS: 2 | US FAERS | |
| 733 | Mood swings | FAERS: 2 | SIDER US FAERS | |
| 734 | Nail pigmentation | FAERS: 2 | OFFSIDES US FAERS | |
| 735 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 736 | Neoplasm swelling | FAERS: 2 | US FAERS | |
| 737 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 738 | Orchitis | FAERS: 2 | US FAERS | |
| 739 | Oropharyngeal spasm | FAERS: 2 | US FAERS | |
| 740 | Osteitis | FAERS: 2 | US FAERS | |
| 741 | Overdose | FAERS: 2 | US FAERS | |
| 742 | Paranoia | FAERS: 2 | US FAERS | |
| 743 | Paraparesis | FAERS: 2 | US FAERS | |
| 744 | Paraplegia | FAERS: 2 | US FAERS | |
| 745 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 746 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 747 | Peritonectomy | FAERS: 2 | US FAERS | |
| 748 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 749 | Phlebitis | FAERS: 2 | US FAERS | |
| 750 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 751 | Pleurodesis | FAERS: 2 | US FAERS | |
| 752 | Pneumocystis jiroveci pneumonia | FAERS: 2 | US FAERS | |
| 753 | Poorly Differentiated Thyroid Carcinoma | FAERS: 2 | US FAERS | |
| 754 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 755 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 756 | Presyncope | FAERS: 2 | US FAERS | |
| 757 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 758 | Pulmonary necrosis | FAERS: 2 | US FAERS | |
| 759 | Pulmonary vasculitis | FAERS: 2 | US FAERS | |
| 760 | Purulent discharge | FAERS: 2 | US FAERS | |
| 761 | Pustular psoriasis | FAERS: 2 | US FAERS | |
| 762 | Pyoderma Gangrenosum | FAERS: 2 | US FAERS | |
| 763 | Radiation injury | FAERS: 2 | US FAERS | |
| 764 | Rash follicular | FAERS: 2 | US FAERS | |
| 765 | Reactive perforating collagenosis | FAERS: 2 | US FAERS | |
| 766 | Recall phenomenon | FAERS: 2 | SIDER US FAERS | |
| 767 | Rectal discharge | FAERS: 2 | US FAERS | |
| 768 | Renal cancer recurrent | FAERS: 2 | US FAERS | |
| 769 | Renal cell carcinoma recurrent | FAERS: 2 | US FAERS | |
| 770 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 771 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 772 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 773 | Retinitis | FAERS: 2 | US FAERS | |
| 774 | Retroperitoneal abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 775 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 776 | Salpingo-oophorectomy unilateral | FAERS: 2 | US FAERS | |
| 777 | Schizophrenia | FAERS: 2 | US FAERS | |
| 778 | Scotoma | FAERS: 2 | US FAERS | |
| 779 | Sensitivity to weather change | FAERS: 2 | US FAERS | |
| 780 | Skeletal injury | FAERS: 2 | US FAERS | |
| 781 | Skin dystrophy | FAERS: 2 | US FAERS | |
| 782 | Skin neoplasm excision | FAERS: 2 | US FAERS | |
| 783 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 784 | Soft tissue mass | FAERS: 2 | US FAERS | |
| 785 | Squamous cell carcinoma of the hypopharynx | FAERS: 2 | US FAERS | |
| 786 | Stem cell transplant | FAERS: 2 | US FAERS | |
| 787 | Systolic hypertension | FAERS: 2 | US FAERS | |
| 788 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 789 | Teeth brittle | FAERS: 2 | US FAERS | |
| 790 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 791 | Thermohyperaesthesia | FAERS: 2 | US FAERS | |
| 792 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 793 | Thrombophlebitis | FAERS: 2 | OFFSIDES US FAERS | |
| 794 | Thyroid cancer stage IV | FAERS: 2 | US FAERS | |
| 795 | Transplant | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 796 | Traumatic fracture | FAERS: 2 | US FAERS | |
| 797 | Tympanoplasty | FAERS: 2 | US FAERS | |
| 798 | Typhoid Fever | FAERS: 2 | US FAERS | |
| 799 | Upper respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 800 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 801 | Vascular calcification | FAERS: 2 | US FAERS | |
| 802 | Vascular pain | FAERS: 2 | US FAERS | |
| 803 | Vascular procedure complication | FAERS: 2 | US FAERS | |
| 804 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 805 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 806 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 807 | Wound Complication | FAERS: 2 | US FAERS | |
| 808 | prostatitis | FAERS: 2 | US FAERS | |
| 809 | skin abrasion | FAERS: 2 | US FAERS | |
| 810 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 811 | Abdominal tenderness | FAERS: 1 | SIDER US FAERS | |
| 812 | Abnormal palmar/plantar creases | FAERS: 1 | US FAERS | |
| 813 | Abscess soft tissue | FAERS: 1 | US FAERS | |
| 814 | Accidental death | FAERS: 1 | US FAERS | |
| 815 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 816 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 817 | Accidental exposure | FAERS: 1 | US FAERS | |
| 818 | Adrenal cortex necrosis | FAERS: 1 | US FAERS | |
| 819 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 820 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 821 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 822 | Amputation | FAERS: 1 | US FAERS | |
| 823 | Amylase abnormal | FAERS: 1 | US FAERS | |
| 824 | Anal infection | FAERS: 1 | US FAERS | |
| 825 | Anal inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 826 | Anal spasm | FAERS: 1 | US FAERS | |
| 827 | Anastomotic Leak | FAERS: 1 | US FAERS | |
| 828 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 829 | Animal scratch | FAERS: 1 | US FAERS | |
| 830 | Anorgasmia | FAERS: 1 | US FAERS | |
| 831 | Anoxia | FAERS: 1 | US FAERS | |
| 832 | Antithrombin III increased | FAERS: 1 | US FAERS | |
| 833 | Apparent death | FAERS: 1 | US FAERS | |
| 834 | Arteriogram | FAERS: 1 | US FAERS | |
| 835 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 836 | Arthropod bite | FAERS: 1 | US FAERS | |
| 837 | Arthropod sting | FAERS: 1 | US FAERS | |
| 838 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 839 | Ataxia | FAERS: 1 | US FAERS | |
| 840 | Atrial tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 841 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 842 | Bed rest | FAERS: 1 | US FAERS | |
| 843 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 844 | Bile output increased | FAERS: 1 | US FAERS | |
| 845 | Biliary Colic | FAERS: 1 | US FAERS | |
| 846 | Biliary tract infection bacterial | FAERS: 1 | US FAERS | |
| 847 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 848 | Biopsy site unspecified abnormal | FAERS: 1 | US FAERS | |
| 849 | Bladder pain | FAERS: 1 | US FAERS | |
| 850 | Blast cells present | FAERS: 1 | US FAERS | |
| 851 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 852 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 853 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 854 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 855 | Blood corticotrophin increased | FAERS: 1 | US FAERS | |
| 856 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 857 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 858 | Blood erythropoietin increased | FAERS: 1 | US FAERS | |
| 859 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 860 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 861 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 862 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 863 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 864 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 865 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 866 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 867 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 868 | Bone callus excessive | FAERS: 1 | US FAERS | |
| 869 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 870 | Brachytherapy to liver | FAERS: 1 | US FAERS | |
| 871 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 872 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 873 | Breast tenderness | FAERS: 1 | US FAERS | |
| 874 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 875 | Bursitis | FAERS: 1 | US FAERS | |
| 876 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 877 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 878 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 879 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 880 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 881 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 882 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 883 | Cardiac sarcoidosis | FAERS: 1 | US FAERS | |
| 884 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 885 | Catheter placement | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 886 | Catheter related complication | FAERS: 1 | US FAERS | |
| 887 | Cell marker increased | FAERS: 1 | US FAERS | |
| 888 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 889 | Central pain syndrome | FAERS: 1 | US FAERS | |
| 890 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 891 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 892 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 893 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 894 | Chemical injury | FAERS: 1 | US FAERS | |
| 895 | Chemotherapeutic drug level decreased | FAERS: 1 | US FAERS | |
| 896 | Child-Pugh-Turcotte score increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 897 | Cholangiolitis | FAERS: 1 | US FAERS | |
| 898 | Cholestatic pruritus | FAERS: 1 | US FAERS | |
| 899 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 900 | Coagulation test | FAERS: 1 | US FAERS | |
| 901 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 902 | Colectomy | FAERS: 1 | US FAERS | |
| 903 | Colon cancer recurrent | FAERS: 1 | US FAERS | |
| 904 | Colonic Stenosis | FAERS: 1 | US FAERS | |
| 905 | Compression fracture | FAERS: 1 | US FAERS | |
| 906 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 907 | Conversion disorder | FAERS: 1 | US FAERS | |
| 908 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 909 | Coronary artery dilatation | FAERS: 1 | US FAERS | |
| 910 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 911 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 912 | Cryotherapy | FAERS: 1 | US FAERS | |
| 913 | Culture urine positive | FAERS: 1 | US FAERS | |
| 914 | Culture wound positive | FAERS: 1 | US FAERS | |
| 915 | Cyst | FAERS: 1 | US FAERS | |
| 916 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 917 | Decreased insulin requirement | FAERS: 1 | US FAERS | |
| 918 | Dependence on oxygen therapy | FAERS: 1 | US FAERS | |
| 919 | Dependence | FAERS: 1 | US FAERS | |
| 920 | Device malfunction | FAERS: 1 | US FAERS | |
| 921 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 922 | Diplegia | FAERS: 1 | US FAERS | |
| 923 | Disease recurrence | FAERS: 1 | US FAERS | |
| 924 | Dissociation | FAERS: 1 | US FAERS | |
| 925 | Diverticular fistula | FAERS: 1 | US FAERS | |
| 926 | Drug effect variable | FAERS: 1 | US FAERS | |
| 927 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 928 | Duodenal Obstruction | FAERS: 1 | US FAERS | |
| 929 | Duodenal perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 930 | Duodenitis | FAERS: 1 | US FAERS | |
| 931 | Dysentery | FAERS: 1 | US FAERS | |
| 932 | Dysgraphia | FAERS: 1 | US FAERS | |
| 933 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 934 | Electrocardiogram | FAERS: 1 | US FAERS | |
| 935 | Endothelial dysfunction | FAERS: 1 | US FAERS | |
| 936 | Enteritis | FAERS: 1 | US FAERS | |
| 937 | Eosinophilic Fasciitis | FAERS: 1 | US FAERS | |
| 938 | Erythroplasia | FAERS: 1 | US FAERS | |
| 939 | Eye Infection | FAERS: 1 | US FAERS | |
| 940 | Eye inflammation | FAERS: 1 | US FAERS | |
| 941 | Facial paralysis | FAERS: 1 | US FAERS | |
| 942 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 943 | Fear of falling | FAERS: 1 | US FAERS | |
| 944 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 945 | Fluid replacement | FAERS: 1 | US FAERS | |
| 946 | Food craving | FAERS: 1 | US FAERS | |
| 947 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 948 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 949 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 950 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 951 | Gallop rhythm present | FAERS: 1 | US FAERS | |
| 952 | Gamma-glutamyltransferase decreased | FAERS: 1 | US FAERS | |
| 953 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 954 | Gastrointestinal angiectasia | FAERS: 1 | US FAERS | |
| 955 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 956 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 957 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 958 | Gastrointestinal stoma output abnormal | FAERS: 1 | US FAERS | |
| 959 | Gastrointestinal telangiectasia | FAERS: 1 | US FAERS | |
| 960 | Gene Mutation | FAERS: 1 | US FAERS | |
| 961 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 962 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 963 | Glioma | FAERS: 1 | US FAERS | |
| 964 | Granulomatous lymphadenitis | FAERS: 1 | US FAERS | |
| 965 | Granuloma | FAERS: 1 | US FAERS | |
| 966 | Groin infection | FAERS: 1 | US FAERS | |
| 967 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 968 | Hemicephalalgia | FAERS: 1 | US FAERS | |
| 969 | Hemiparaesthesia | FAERS: 1 | US FAERS | |
| 970 | Hepatic artery embolism | FAERS: 1 | US FAERS | |
| 971 | Hepatic gas gangrene | FAERS: 1 | US FAERS | |
| 972 | Hepatic hydrothorax | FAERS: 1 | US FAERS | |
| 973 | Hepatic vascular thrombosis | FAERS: 1 | US FAERS | |
| 974 | Hepatitis B DNA assay positive | FAERS: 1 | US FAERS | |
| 975 | Hepatobiliary cancer | FAERS: 1 | US FAERS | |
| 976 | Hepatoblastoma | FAERS: 1 | US FAERS | |
| 977 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 978 | Hip surgery | FAERS: 1 | US FAERS | |
| 979 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 980 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 981 | Hyperdynamic left ventricle | FAERS: 1 | US FAERS | |
| 982 | Hyperleukocytosis | FAERS: 1 | US FAERS | |
| 983 | Hyperphagia | FAERS: 1 | US FAERS | |
| 984 | Hyperplasia | FAERS: 1 | US FAERS | |
| 985 | Hypertrophy | FAERS: 1 | US FAERS | |
| 986 | Hypocoagulable state | FAERS: 1 | US FAERS | |
| 987 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 988 | Impatience | FAERS: 1 | US FAERS | |
| 989 | Implant site irritation | FAERS: 1 | US FAERS | |
| 990 | Inappropriate Prescribing | FAERS: 1 | US FAERS | |
| 991 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 992 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 993 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 994 | Infected neoplasm | FAERS: 1 | US FAERS | |
| 995 | Infective glossitis | FAERS: 1 | US FAERS | |
| 996 | Infective thrombosis | FAERS: 1 | US FAERS | |
| 997 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 998 | Injection site bruising | FAERS: 1 | US FAERS | |
| 999 | Injection site mass | FAERS: 1 | US FAERS | |
| 1000 | Injection site pain | FAERS: 1 | US FAERS | |
| 1001 | Intention tremor | FAERS: 1 | US FAERS | |
| 1002 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 1003 | Intestinal Fistula | FAERS: 1 | OFFSIDES US FAERS | |
| 1004 | Intracranial mass | FAERS: 1 | US FAERS | |
| 1005 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1006 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 1007 | Labile blood pressure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1008 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 1009 | Laser Therapy | FAERS: 1 | US FAERS | |
| 1010 | Lentigo | FAERS: 1 | US FAERS | |
| 1011 | Limb operation | FAERS: 1 | US FAERS | |
| 1012 | Lipoma | FAERS: 1 | US FAERS | |
| 1013 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 1014 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1015 | Lower respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1016 | Lung consolidation | FAERS: 1 | US FAERS | |
| 1017 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 1018 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1019 | Lymphangitis | FAERS: 1 | US FAERS | |
| 1020 | Malaria | FAERS: 1 | US FAERS | |
| 1021 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 1022 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1023 | Measles | FAERS: 1 | US FAERS | |
| 1024 | Medical device pain | FAERS: 1 | US FAERS | |
| 1025 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1026 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1027 | Mesenteric arteriosclerosis | FAERS: 1 | US FAERS | |
| 1028 | Mesenteric vascular insufficiency | FAERS: 1 | US FAERS | |
| 1029 | Mesothelioma | FAERS: 1 | 21787763 | CTD US FAERS |
| 1030 | Metastases to pelvis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1031 | Mini-tracheostomy | FAERS: 1 | US FAERS | |
| 1032 | Moaning | FAERS: 1 | US FAERS | |
| 1033 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 1034 | Mucosal toxicity | FAERS: 1 | US FAERS | |
| 1035 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 1036 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 1037 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 1038 | Muscle strain | FAERS: 1 | US FAERS | |
| 1039 | Mydriasis | FAERS: 1 | US FAERS | |
| 1040 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 1041 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 1042 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 1043 | Necrotic preservation injury of graft | FAERS: 1 | US FAERS | |
| 1044 | Nephritis | FAERS: 1 | US FAERS | |
| 1045 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 1046 | Nerve injury | FAERS: 1 | US FAERS | |
| 1047 | Nerve root lesion | FAERS: 1 | US FAERS | |
| 1048 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 1049 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1050 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1051 | Obstruction | FAERS: 1 | US FAERS | |
| 1052 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 1053 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 1054 | Oligodipsia | FAERS: 1 | US FAERS | |
| 1055 | Onychalgia | FAERS: 1 | US FAERS | |
| 1056 | Open wound | FAERS: 1 | OFFSIDES US FAERS | |
| 1057 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 1058 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 1059 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1060 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1061 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 1062 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 1063 | Osteoporosis | FAERS: 1 | US FAERS | |
| 1064 | Palliative Care | FAERS: 1 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 1065 | Palpable purpura | FAERS: 1 | US FAERS | |
| 1066 | Pancreatic enzymes abnormal | FAERS: 1 | US FAERS | |
| 1067 | Papule | FAERS: 1 | US FAERS | |
| 1068 | Parakeratosis | FAERS: 1 | US FAERS | |
| 1069 | Paraneoplastic dermatomyositis | FAERS: 1 | US FAERS | |
| 1070 | Parasitic gastroenteritis | FAERS: 1 | US FAERS | |
| 1071 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1072 | Pemphigus | FAERS: 1 | US FAERS | |
| 1073 | Penile swelling | FAERS: 1 | US FAERS | |
| 1074 | Periarthritis | FAERS: 1 | US FAERS | |
| 1075 | Perineal erythema | FAERS: 1 | US FAERS | |
| 1076 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 1077 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 1078 | Peripheral pulse decreased | FAERS: 1 | US FAERS | |
| 1079 | Periphlebitis | FAERS: 1 | US FAERS | |
| 1080 | Perirectal abscess | FAERS: 1 | US FAERS | |
| 1081 | Peritoneal fluid analysis abnormal | FAERS: 1 | US FAERS | |
| 1082 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 1083 | Personality Change | FAERS: 1 | US FAERS | |
| 1084 | Pharyngeal erosion | FAERS: 1 | US FAERS | |
| 1085 | Photodermatosis | FAERS: 1 | US FAERS | |
| 1086 | Physical examination abnormal | FAERS: 1 | US FAERS | |
| 1087 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 1088 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 1089 | Pneumopericardium | FAERS: 1 | US FAERS | |
| 1090 | Poisoning | FAERS: 1 | US FAERS | |
| 1091 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1092 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 1093 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 1094 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 1095 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 1096 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 1097 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1098 | Pressure of speech | FAERS: 1 | US FAERS | |
| 1099 | Prevertebral soft tissue swelling of cervical space | FAERS: 1 | US FAERS | |
| 1100 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 1101 | Product contamination | FAERS: 1 | US FAERS | |
| 1102 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 1103 | Product storage error | FAERS: 1 | US FAERS | |
| 1104 | Product substitution issue | FAERS: 1 | US FAERS | |
| 1105 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 1106 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 1107 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 1108 | Pulmonary Fistula | FAERS: 1 | US FAERS | |
| 1109 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1110 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 1111 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1112 | Purulence | FAERS: 1 | US FAERS | |
| 1113 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 1114 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1115 | Radiation Pneumonitis | FAERS: 1 | SIDER US FAERS | |
| 1116 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 1117 | Radiotherapy to liver | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1118 | Rebound psoriasis | FAERS: 1 | US FAERS | |
| 1119 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1120 | Relapsing Fever | FAERS: 1 | US FAERS | |
| 1121 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 1122 | Renal cyst | FAERS: 1 | US FAERS | |
| 1123 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 1124 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 1125 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 1126 | Retroperitoneal lymphadenopathy | FAERS: 1 | US FAERS | |
| 1127 | Rhonchi | FAERS: 1 | US FAERS | |
| 1128 | Root canal infection | FAERS: 1 | US FAERS | |
| 1129 | Sarcoidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 1130 | Scleritis | FAERS: 1 | US FAERS | |
| 1131 | Scrotal irritation | FAERS: 1 | US FAERS | |
| 1132 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 1133 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1134 | Senile dementia | FAERS: 1 | US FAERS | |
| 1135 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 1136 | Seroma | FAERS: 1 | US FAERS | |
| 1137 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 1138 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 1139 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 1140 | Single functional kidney | FAERS: 1 | US FAERS | |
| 1141 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1142 | Skin tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 1143 | Small bowel angioedema | FAERS: 1 | US FAERS | |
| 1144 | Small intestine carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1145 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 1146 | Soliloquy | FAERS: 1 | US FAERS | |
| 1147 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 1148 | Sputum retention | FAERS: 1 | US FAERS | |
| 1149 | Starvation | FAERS: 1 | US FAERS | |
| 1150 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 1151 | Stoma Site Infection | FAERS: 1 | US FAERS | |
| 1152 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 1153 | Subileus | FAERS: 1 | US FAERS | |
| 1154 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 1155 | Suicide attempt | FAERS: 1 | US FAERS | |
| 1156 | Sunburn | FAERS: 1 | US FAERS | |
| 1157 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 1158 | Supine hypertension | FAERS: 1 | US FAERS | |
| 1159 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1160 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 1161 | Tension Headache | FAERS: 1 | US FAERS | |
| 1162 | Tension | FAERS: 1 | US FAERS | |
| 1163 | Testis discomfort | FAERS: 1 | US FAERS | |
| 1164 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 1165 | Thirst | FAERS: 1 | US FAERS | |
| 1166 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1167 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1168 | Thymic cancer metastatic | FAERS: 1 | US FAERS | |
| 1169 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 1170 | Thyroid calcification | FAERS: 1 | US FAERS | |
| 1171 | Tongue erythema | FAERS: 1 | US FAERS | |
| 1172 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 1173 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 1174 | Tonsillitis | FAERS: 1 | US FAERS | |
| 1175 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 1176 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 1177 | Tracheal fistula | FAERS: 1 | US FAERS | |
| 1178 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1179 | Troponin I increased | FAERS: 1 | US FAERS | |
| 1180 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1181 | Underweight | FAERS: 1 | US FAERS | |
| 1182 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 1183 | Urinary tract infection pseudomonal | FAERS: 1 | US FAERS | |
| 1184 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1185 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 1186 | Urine output increased | FAERS: 1 | US FAERS | |
| 1187 | Urobilin urine present | FAERS: 1 | US FAERS | |
| 1188 | Vaginal abscess | FAERS: 1 | US FAERS | |
| 1189 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 1190 | Vasculitis gastrointestinal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1191 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1192 | Venous stenosis | FAERS: 1 | US FAERS | |
| 1193 | Vessel perforation | FAERS: 1 | US FAERS | |
| 1194 | Vessel puncture site pain | FAERS: 1 | US FAERS | |
| 1195 | Vessel puncture site swelling | FAERS: 1 | US FAERS | |
| 1196 | Viral test positive | FAERS: 1 | US FAERS | |
| 1197 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1198 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 1199 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1200 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1201 | Wound healing normal | FAERS: 1 | US FAERS | |
| 1202 | Wound infection pseudomonas | FAERS: 1 | US FAERS | |
| 1203 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1204 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1205 | Xeroderma | FAERS: 1 | US FAERS | |
| 1206 | angiogram | FAERS: 1 | US FAERS | |
| 1207 | Acute interstitial nephritis | SIDER | ||
| 1208 | Adenocarcinoma | OFFSIDES | ||
| 1209 | Angina Pectoris, Variant | 1230800 | CTD | |
| 1210 | Aortic valve sclerosis | OFFSIDES | ||
| 1211 | Aspiration Pneumonia | OFFSIDES | ||
| 1212 | Blood and lymphatic system disorders | SIDER | ||
| 1213 | Bronchial Fistula | OFFSIDES | ||
| 1214 | Burning Mouth Syndrome | SIDER | ||
| 1215 | Carcinoma | SIDER | ||
| 1216 | Cardiomyopathies | 29258954 | CTD | |
| 1217 | Cardiovascular insufficiency | OFFSIDES | ||
| 1218 | Chemical and Drug Induced Liver Injury | 29859236 | CTD | |
| 1219 | Chronic left ventricular failure | OFFSIDES | ||
| 1220 | Colorectal Neoplasms | 18695262 | CTD | |
| 1221 | Confabulation | OFFSIDES | ||
| 1222 | Diarrhea | 18796127 19095497 19496710 | CTD OFFSIDES | |
| 1223 | Drug Eruptions | 19095497 | CTD | |
| 1224 | Ear and labyrinth disorders | SIDER | ||
| 1225 | Endometrial Neoplasms | 20071162 | CTD | |
| 1226 | Eosinophilic cystitis | OFFSIDES | ||
| 1227 | Erosive gastritis | OFFSIDES | ||
| 1228 | Erythema multiforme minor | SIDER | ||
| 1229 | Escherichia infection | OFFSIDES | ||
| 1230 | Exanthema | 18796127 20082451 20733337 | CTD | |
| 1231 | Gastrointestinal Diseases | 21735354 | CTD | |
| 1232 | Gastrointestinal Stromal Tumors | 19139124 | CTD | |
| 1233 | Hoarseness | SIDER | ||
| 1234 | Hypercreatinaemia | OFFSIDES | ||
| 1235 | Hypertrichosis | Canada Vigilance: 1 | Canada Vigilance | |
| 1236 | Hypophosphatemia | 19496710 | CTD | |
| 1237 | Infestation | SIDER | ||
| 1238 | Infusion site mobility decreased | OFFSIDES | ||
| 1239 | Kidney Failure | OFFSIDES | ||
| 1240 | Lactose Intolerance | Canada Vigilance: 1 | Canada Vigilance | |
| 1241 | Leukopenia neonatal | OFFSIDES | ||
| 1242 | Lipase | OFFSIDES | ||
| 1243 | Liver Failure, Acute | 18796127 | CTD | |
| 1244 | Liver Neoplasms, Experimental | CTD | ||
| 1245 | Liver neoplasms | 25489883 28673964 | CTD | |
| 1246 | Medulloblastoma | 19001435 | CTD | |
| 1247 | Neoplasm Invasiveness | 24434019 30187994 | CTD | |
| 1248 | Neoplasm Metastasis | 18796127 21671804 30187994 | CTD | |
| 1249 | Neoplasms, Experimental | CTD | ||
| 1250 | Neoplasms | 21735354 | CTD | |
| 1251 | Pain management | OFFSIDES | ||
| 1252 | Pelvic mass | OFFSIDES | ||
| 1253 | Pelvic venous thrombosis | OFFSIDES | ||
| 1254 | Post procedural discharge | OFFSIDES | ||
| 1255 | Posterior Leukoencephalopathy Syndrome | 17008686 | CTD | |
| 1256 | Potassium low | SIDER | ||
| 1257 | Product closure removal difficult | Canada Vigilance: 1 | Canada Vigilance | |
| 1258 | Product physical consistency issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1259 | Prostate examination abnormal | OFFSIDES | ||
| 1260 | Prothrombin level abnormal | SIDER | ||
| 1261 | Pseudomonal sepsis | OFFSIDES | ||
| 1262 | Rectal tenesmus | OFFSIDES | ||
| 1263 | Semen analysis abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1264 | Sinus headache | OFFSIDES | ||
| 1265 | Soft Tissue Infection | OFFSIDES | ||
| 1266 | Stomach Neoplasms | 18695262 | CTD | |
| 1267 | Suicide | SIDER | ||
| 1268 | Thromboembolism | SIDER | ||
| 1269 | Thyroid cancer, follicular | 18796127 | CTD | |
| 1270 | Urethritis | OFFSIDES | ||
| 1271 | Ventricular Dysfunction, Left | 25370841 | CTD | |
| 1272 | Waist circumference increased | OFFSIDES | ||
| 1273 | leukemia | 17205056 20105315 | CTD | |
| 1274 | liposarcoma | 21610706 | CTD | |
| 1275 | melanoma | 18445842 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.