Leflunomide
(VHOGYURTWQBHIL-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(c1cnoc1C)Nc1ccc(cc1)C(F)(F)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- L04AA13
- Molecular Formula:
- C12H9F3N2O2
- Molecular Weight:
- 270.207
- Log P:
- 3.3271
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 55.13
- CAS Number(s):
- 75706-12-6
Synonym(s)
1.
Leflunomide
2.
Arava
3.
HWA 486
4.
HWA-486
5.
N-(4-Trifluoromethyphenyl)-5-methylisoxazole-4-carboxamide
6.
SU101
7.
HWA486
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug exposure during pregnancy | FAERS: 300 | OFFSIDES US FAERS | |
| 2 | Drug ineffective | FAERS: 103 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 3 | Maternal exposure during pregnancy | FAERS: 84 | US FAERS | |
| 4 | Alanine Aminotransferase Increased | FAERS: 61 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Rheumatoid Arthritis | FAERS: 51 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 6 | Nausea | FAERS: 50 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Aspartate Aminotransferase Increased | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Weight decreased | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Alopecia | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Pain | FAERS: 41 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Fatigue | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 12 | Headache | FAERS: 34 | SIDER US FAERS | |
| 13 | Malaise | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Pruritus | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 15 | Transmission of drug via semen | FAERS: 30 | OFFSIDES US FAERS | |
| 16 | Blood alkaline phosphatase increased | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Transaminases increased | FAERS: 27 | OFFSIDES US FAERS | |
| 18 | Vomiting | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Arthralgia | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 20 | Asthenia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Dizziness | FAERS: 26 | SIDER US FAERS | |
| 22 | Pneumonia | FAERS: 26 | SIDER US FAERS | |
| 23 | Hypersensitivity | FAERS: 25 | SIDER US FAERS | |
| 24 | Pregnancy | FAERS: 24 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 26 | Gamma-Glutamyltransferase Increased | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Hepatotoxicity | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 28 | Exposure via father | FAERS: 19 | US FAERS | |
| 29 | Hepatitis | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 30 | jaundice | FAERS: 19 | SIDER US FAERS | |
| 31 | Drug exposure before pregnancy | FAERS: 18 | OFFSIDES US FAERS | |
| 32 | Thrombocytopenia | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 33 | Cerebrovascular accident | FAERS: 16 | US FAERS | |
| 34 | Infection | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Pulmonary arterial hypertension | FAERS: 16 | OFFSIDES US FAERS | |
| 36 | White blood cell count decreased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Myocardial Infarction | FAERS: 15 | US FAERS | |
| 38 | Abdominal discomfort | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 39 | Colitis | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 40 | Medication Error | FAERS: 14 | US FAERS | |
| 41 | No adverse event | FAERS: 14 | US FAERS | |
| 42 | Sepsis | FAERS: 14 | SIDER US FAERS | |
| 43 | Stevens-Johnson Syndrome | FAERS: 14 Canada Vigilance: 1 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 44 | Tachycardia | FAERS: 14 | SIDER US FAERS | |
| 45 | Chest Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Leukopenia | FAERS: 13 Canada Vigilance: 3 | 17519271 | CTD SIDER Canada Vigilance US FAERS |
| 47 | Neutropenia | FAERS: 13 | SIDER US FAERS | |
| 48 | Unevaluable event | FAERS: 13 | US FAERS | |
| 49 | Dehydration | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Pancytopenia | FAERS: 12 | 16634119 | CTD SIDER US FAERS |
| 51 | Peripheral swelling | FAERS: 12 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 52 | Pulmonary Embolism | FAERS: 11 | US FAERS | |
| 53 | Septic Shock | FAERS: 11 | OFFSIDES US FAERS | |
| 54 | Back Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Dysgeusia | FAERS: 10 | SIDER US FAERS | |
| 56 | Eosinophilia | FAERS: 10 | SIDER US FAERS | |
| 57 | Erythema | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | Feeling abnormal | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 59 | General physical health deterioration | FAERS: 10 | OFFSIDES US FAERS | |
| 60 | Hypotension | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Joint swelling | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 62 | Maternal exposure before pregnancy | FAERS: 10 | US FAERS | |
| 63 | Blood creatinine increased | FAERS: 9 | US FAERS | |
| 64 | Hypertensive crisis | FAERS: 9 | SIDER US FAERS | |
| 65 | Polyneuropathy | FAERS: 9 | OFFSIDES US FAERS | |
| 66 | Respiratory Failure | FAERS: 9 | OFFSIDES US FAERS | |
| 67 | Respiratory distress | FAERS: 9 | US FAERS | |
| 68 | Swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Syncope | FAERS: 9 | US FAERS | |
| 70 | Anxiety | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 71 | Arthritis | FAERS: 8 Canada Vigilance: 1 | 12954536 26640276 | CTD SIDER Canada Vigilance US FAERS |
| 72 | Asthma | FAERS: 8 | SIDER US FAERS | |
| 73 | Cellulitis | FAERS: 8 | OFFSIDES US FAERS | |
| 74 | Lymphadenopathy | FAERS: 8 | SIDER US FAERS | |
| 75 | Macular degeneration | FAERS: 8 | US FAERS | |
| 76 | Pneumonitis | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 77 | Skin Ulcer | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 78 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 79 | Vasculitis | FAERS: 8 | 15468379 19421963 | CTD SIDER US FAERS |
| 80 | Visual Impairment | FAERS: 8 | US FAERS | |
| 81 | Acute kidney injury | FAERS: 7 | US FAERS | |
| 82 | Adverse event | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Ageusia | FAERS: 7 | US FAERS | |
| 84 | Chills | FAERS: 7 | SIDER US FAERS | |
| 85 | Diabetes Mellitus | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 86 | Dyspepsia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 87 | Musculoskeletal stiffness | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 88 | Patent ductus arteriosus | FAERS: 7 | US FAERS | |
| 89 | Pregnancy of partner | FAERS: 7 | OFFSIDES US FAERS | |
| 90 | Product substitution issue | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 91 | Pulmonary Fibrosis | FAERS: 7 | 26699812 | CTD SIDER US FAERS |
| 92 | Rheumatoid Nodule | FAERS: 7 | OFFSIDES US FAERS | |
| 93 | Stomatitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 94 | Toxic Epidermal Necrolysis | FAERS: 7 | SIDER US FAERS | |
| 95 | Urticaria | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 96 | Vertigo | FAERS: 7 | SIDER US FAERS | |
| 97 | Anorexia | FAERS: 6 | SIDER US FAERS | |
| 98 | Blindness | FAERS: 6 | US FAERS | |
| 99 | Burning sensation | FAERS: 6 | US FAERS | |
| 100 | Cytolytic hepatitis | FAERS: 6 | US FAERS | |
| 101 | Diverticulitis | FAERS: 6 | OFFSIDES US FAERS | |
| 102 | Drug dose omission | FAERS: 6 | US FAERS | |
| 103 | Incorrect dose administered | FAERS: 6 | OFFSIDES US FAERS | |
| 104 | Leukocytosis | FAERS: 6 | US FAERS | |
| 105 | Lymphoma | FAERS: 6 | US FAERS | |
| 106 | Myalgia | FAERS: 6 | SIDER US FAERS | |
| 107 | Oropharyngeal pain | FAERS: 6 | SIDER US FAERS | |
| 108 | Palpitations | FAERS: 6 | SIDER US FAERS | |
| 109 | Posterior reversible encephalopathy syndrome | FAERS: 6 | US FAERS | |
| 110 | Product use issue | FAERS: 6 | US FAERS | |
| 111 | Therapeutic response unexpected with drug substitution | FAERS: 6 | OFFSIDES US FAERS | |
| 112 | nervous system disorder | FAERS: 6 | SIDER US FAERS | |
| 113 | Abasia | FAERS: 5 | US FAERS | |
| 114 | Acute respiratory failure | FAERS: 5 | US FAERS | |
| 115 | Ascites | FAERS: 5 | US FAERS | |
| 116 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 117 | Blood lactate dehydrogenase increased | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 118 | Blood urea increased | FAERS: 5 | US FAERS | |
| 119 | Cerebral vasoconstriction | FAERS: 5 | US FAERS | |
| 120 | Cholecystitis | FAERS: 5 | OFFSIDES US FAERS | |
| 121 | Dermatitis | FAERS: 5 | SIDER US FAERS | |
| 122 | Disease Progression | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Duodenal Ulcer | FAERS: 5 | OFFSIDES US FAERS | |
| 124 | Hepatosplenomegaly | FAERS: 5 | OFFSIDES US FAERS | |
| 125 | Hyperthyroidism | FAERS: 5 | SIDER US FAERS | |
| 126 | Inflammation | FAERS: 5 | SIDER US FAERS | |
| 127 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 128 | Intestinal Obstruction | FAERS: 5 | US FAERS | |
| 129 | MYELODYSPLASTIC SYNDROME | FAERS: 5 | US FAERS | |
| 130 | Meningitis | FAERS: 5 | US FAERS | |
| 131 | Mental status changes | FAERS: 5 | US FAERS | |
| 132 | Oral pain | FAERS: 5 | US FAERS | |
| 133 | Pericarditis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Pleurisy | FAERS: 5 | OFFSIDES US FAERS | |
| 135 | Pleuropericarditis | FAERS: 5 | US FAERS | |
| 136 | Proteinuria | FAERS: 5 | US FAERS | |
| 137 | Pulmonary Hypertension | FAERS: 5 | OFFSIDES US FAERS | |
| 138 | Rash erythematous | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 140 | Rheumatoid Factor | FAERS: 5 | US FAERS | |
| 141 | Skin lesion | FAERS: 5 | US FAERS | |
| 142 | Suicide attempt | FAERS: 5 | US FAERS | |
| 143 | Thrombosis | FAERS: 5 | US FAERS | |
| 144 | Abscess | FAERS: 4 | SIDER US FAERS | |
| 145 | Accidental overdose | FAERS: 4 | US FAERS | |
| 146 | Alveolitis | FAERS: 4 | US FAERS | |
| 147 | Aspergillosis | FAERS: 4 | US FAERS | |
| 148 | Bedridden | FAERS: 4 | US FAERS | |
| 149 | Chest discomfort | FAERS: 4 | US FAERS | |
| 150 | Cholelithiasis | FAERS: 4 | SIDER US FAERS | |
| 151 | Cholestasis | FAERS: 4 | SIDER US FAERS | |
| 152 | Deafness Neurosensory | FAERS: 4 | US FAERS | |
| 153 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 154 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 155 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 156 | Dry skin | FAERS: 4 | SIDER US FAERS | |
| 157 | Influenza | FAERS: 4 | SIDER US FAERS | |
| 158 | Lip swelling | FAERS: 4 | US FAERS | |
| 159 | Liver Abscess | FAERS: 4 | US FAERS | |
| 160 | Memory impairment | FAERS: 4 | US FAERS | |
| 161 | Musculoskeletal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Nasopharyngitis | FAERS: 4 | OFFSIDES US FAERS | |
| 163 | No adverse effect | FAERS: 4 | OFFSIDES US FAERS | |
| 164 | No adverse reaction | FAERS: 4 | US FAERS | |
| 165 | Oliguria | FAERS: 4 | US FAERS | |
| 166 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 167 | Pierre Robin Syndrome | FAERS: 4 | US FAERS | |
| 168 | Purpura | FAERS: 4 | US FAERS | |
| 169 | Pyoderma Gangrenosum | FAERS: 4 | OFFSIDES US FAERS | |
| 170 | Sjogren's Syndrome | FAERS: 4 | US FAERS | |
| 171 | Somnolence | FAERS: 4 | US FAERS | |
| 172 | Spina Bifida Occulta | FAERS: 4 | US FAERS | |
| 173 | Subcutaneous Abscess | FAERS: 4 | US FAERS | |
| 174 | Tinnitus | FAERS: 4 | US FAERS | |
| 175 | Ulcer | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 176 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 177 | Uterine Cancer | FAERS: 4 | OFFSIDES US FAERS | |
| 178 | Wound Infection | FAERS: 4 | OFFSIDES US FAERS | |
| 179 | Wound dehiscence | FAERS: 4 | OFFSIDES US FAERS | |
| 180 | treatment failure | FAERS: 4 | US FAERS | |
| 181 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 182 | Agitation | FAERS: 3 | US FAERS | |
| 183 | Amnesia | FAERS: 3 | US FAERS | |
| 184 | Anosmia | FAERS: 3 | US FAERS | |
| 185 | Atelectasis | FAERS: 3 | US FAERS | |
| 186 | Autoimmune hepatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 187 | Biopsy chorionic villous abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 188 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 189 | Cardiotoxicity | FAERS: 3 | US FAERS | |
| 190 | Constipation | FAERS: 3 | SIDER US FAERS | |
| 191 | Cyst | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 192 | Cytopenia | FAERS: 3 | US FAERS | |
| 193 | Dementia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Drug Dependence | FAERS: 3 | US FAERS | |
| 195 | Dysarthria | FAERS: 3 | US FAERS | |
| 196 | Dysmorphism | FAERS: 3 | US FAERS | |
| 197 | Dysphonia | FAERS: 3 | US FAERS | |
| 198 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 199 | Epilepsy | FAERS: 3 | US FAERS | |
| 200 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 201 | Erectile dysfunction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | Erythema Multiforme | FAERS: 3 | 19421963 | CTD SIDER US FAERS |
| 203 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 204 | Histiocytosis haematophagic | FAERS: 3 | OFFSIDES US FAERS | |
| 205 | Hypophagia | FAERS: 3 | US FAERS | |
| 206 | Hypoxia | FAERS: 3 | US FAERS | |
| 207 | Lung Abscess | FAERS: 3 | OFFSIDES US FAERS | |
| 208 | Malignant Hypertension | FAERS: 3 | SIDER US FAERS | |
| 209 | Metrorrhagia | FAERS: 3 | US FAERS | |
| 210 | Neutrophil count decreased | FAERS: 3 | US FAERS | |
| 211 | Night sweats | FAERS: 3 | US FAERS | |
| 212 | Occupational exposure to product | FAERS: 3 | US FAERS | |
| 213 | Oligohydramnios | FAERS: 3 | US FAERS | |
| 214 | Pallor | FAERS: 3 | SIDER US FAERS | |
| 215 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 216 | Peritonitis | FAERS: 3 | US FAERS | |
| 217 | Productive Cough | FAERS: 3 | OFFSIDES US FAERS | |
| 218 | Quadriplegia | FAERS: 3 | US FAERS | |
| 219 | Shock | FAERS: 3 | US FAERS | |
| 220 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 221 | Tremor | FAERS: 3 | US FAERS | |
| 222 | Tuberculosis | FAERS: 3 | SIDER US FAERS | |
| 223 | Zinc deficiency | FAERS: 3 | US FAERS | |
| 224 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 225 | Accidental exposure | FAERS: 2 | US FAERS | |
| 226 | Acidosis | FAERS: 2 | US FAERS | |
| 227 | Acne | FAERS: 2 | SIDER US FAERS | |
| 228 | Agranulocytosis | FAERS: 2 | SIDER US FAERS | |
| 229 | Amyloidosis | FAERS: 2 | US FAERS | |
| 230 | Anuria | FAERS: 2 | US FAERS | |
| 231 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 232 | Atrial thrombosis | FAERS: 2 | US FAERS | |
| 233 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 234 | Blood albumin decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 235 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 236 | Blood creatine phosphokinase increased | FAERS: 2 | SIDER US FAERS | |
| 237 | Blood urine present | FAERS: 2 | US FAERS | |
| 238 | Bone abscess | FAERS: 2 | US FAERS | |
| 239 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 240 | Brain Death | FAERS: 2 | US FAERS | |
| 241 | Breast cancer recurrent | FAERS: 2 | US FAERS | |
| 242 | Bronchitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 243 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 244 | Bursitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 245 | Butterfly rash | FAERS: 2 | US FAERS | |
| 246 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 247 | Cheilitis | FAERS: 2 | US FAERS | |
| 248 | Chromaturia | FAERS: 2 | OFFSIDES US FAERS | |
| 249 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 250 | Congenital cystic kidney disease | FAERS: 2 | OFFSIDES US FAERS | |
| 251 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 252 | Creutzfeldt-Jakob disease | FAERS: 2 | OFFSIDES US FAERS | |
| 253 | Deafness | FAERS: 2 | US FAERS | |
| 254 | Demyelination | FAERS: 2 | US FAERS | |
| 255 | Dermo-hypodermitis | FAERS: 2 | US FAERS | |
| 256 | Diabetic Foot | FAERS: 2 | US FAERS | |
| 257 | Diffuse Large B-Cell Lymphoma | FAERS: 2 | OFFSIDES US FAERS | |
| 258 | Diplopia | FAERS: 2 | US FAERS | |
| 259 | Disability | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 260 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 261 | Disease recurrence | FAERS: 2 | US FAERS | |
| 262 | Disorientation | FAERS: 2 | US FAERS | |
| 263 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 264 | Diverticular perforation | FAERS: 2 | OFFSIDES US FAERS | |
| 265 | Drug level increased | FAERS: 2 | US FAERS | |
| 266 | Drug toxicity | FAERS: 2 | US FAERS | |
| 267 | Dysplasia | FAERS: 2 | US FAERS | |
| 268 | Ear discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 269 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 270 | Eczema | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 271 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 272 | Epiduritis | FAERS: 2 | OFFSIDES US FAERS | |
| 273 | Erysipelas | FAERS: 2 | OFFSIDES US FAERS | |
| 274 | Erythema Nodosum | FAERS: 2 | OFFSIDES US FAERS | |
| 275 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 276 | Flatulence | FAERS: 2 | SIDER US FAERS | |
| 277 | Fontanelle depressed | FAERS: 2 | US FAERS | |
| 278 | Food aversion | FAERS: 2 | OFFSIDES US FAERS | |
| 279 | Fracture | FAERS: 2 | US FAERS | |
| 280 | Gingival blister | FAERS: 2 | US FAERS | |
| 281 | Glaucoma | FAERS: 2 | US FAERS | |
| 282 | Granulomatous liver disease | FAERS: 2 | US FAERS | |
| 283 | Granuloma | FAERS: 2 | OFFSIDES US FAERS | |
| 284 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 285 | Hemiparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 286 | Hemiplegia | FAERS: 2 | US FAERS | |
| 287 | Hernia | FAERS: 2 | SIDER US FAERS | |
| 288 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 289 | Hypogeusia | FAERS: 2 | US FAERS | |
| 290 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 291 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 292 | Immunosuppression | FAERS: 2 | US FAERS | |
| 293 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 294 | Impaired work ability | FAERS: 2 | US FAERS | |
| 295 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 296 | Iritis | FAERS: 2 | US FAERS | |
| 297 | Jugular vein distension | FAERS: 2 | US FAERS | |
| 298 | Keratitis | FAERS: 2 | US FAERS | |
| 299 | Lymphangioma | FAERS: 2 | US FAERS | |
| 300 | Monocytopenia | FAERS: 2 | OFFSIDES US FAERS | |
| 301 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 302 | Myositis | FAERS: 2 | US FAERS | |
| 303 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 304 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 305 | Neuralgia | FAERS: 2 | SIDER US FAERS | |
| 306 | Nodule | FAERS: 2 | OFFSIDES US FAERS | |
| 307 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 308 | Overdose | FAERS: 2 | SIDER US FAERS | |
| 309 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 310 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 311 | Paraparesis | FAERS: 2 | US FAERS | |
| 312 | Pharyngolaryngeal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 313 | Phlebitis | FAERS: 2 | US FAERS | |
| 314 | Pneumothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 315 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 316 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 317 | Product outer packaging issue | FAERS: 2 | US FAERS | |
| 318 | Psoriasis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 319 | Pulmonary artery thrombosis | FAERS: 2 | US FAERS | |
| 320 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 321 | Pustular psoriasis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 322 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 323 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 324 | Retroperitoneal abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 325 | Scab | FAERS: 2 | US FAERS | |
| 326 | Sciatica | FAERS: 2 | US FAERS | |
| 327 | Sinusitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 328 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 329 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 330 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 331 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 332 | Thermal burn | FAERS: 2 | US FAERS | |
| 333 | Tooth Infection | FAERS: 2 | US FAERS | |
| 334 | Toothache | FAERS: 2 | US FAERS | |
| 335 | Tubo-ovarian abscess | FAERS: 2 | US FAERS | |
| 336 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 337 | Varicophlebitis | FAERS: 2 | OFFSIDES US FAERS | |
| 338 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 339 | Vestibular Neuronitis | FAERS: 2 | US FAERS | |
| 340 | Visual disturbance | FAERS: 2 | US FAERS | |
| 341 | Wheezing | FAERS: 2 | US FAERS | |
| 342 | keratoacanthoma | FAERS: 2 | US FAERS | |
| 343 | Abortion early | FAERS: 1 | US FAERS | |
| 344 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 345 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 346 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 347 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 348 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 349 | Alpha 1 globulin abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 350 | Alpha 2 globulin abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 351 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 352 | Ammonia increased | FAERS: 1 | US FAERS | |
| 353 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 354 | Amylase increased | FAERS: 1 | US FAERS | |
| 355 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 356 | Anencephaly | FAERS: 1 | US FAERS | |
| 357 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 358 | Angioedema | FAERS: 1 | SIDER US FAERS | |
| 359 | Angiomyolipoma | FAERS: 1 | OFFSIDES US FAERS | |
| 360 | Aphagia | FAERS: 1 | US FAERS | |
| 361 | Aplasia Cutis Congenita | FAERS: 1 | US FAERS | |
| 362 | Arthropathy | FAERS: 1 | SIDER US FAERS | |
| 363 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 364 | Ataxia | FAERS: 1 | US FAERS | |
| 365 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 366 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 367 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 368 | Back disorder | FAERS: 1 | US FAERS | |
| 369 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 370 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 371 | Bilirubin conjugated increased | FAERS: 1 | OFFSIDES US FAERS | |
| 372 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 373 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 374 | Blepharitis | FAERS: 1 | US FAERS | |
| 375 | Blood albumin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 376 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 377 | Blood blister | FAERS: 1 | US FAERS | |
| 378 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 379 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 380 | Blood immunoglobulin A increased | FAERS: 1 | OFFSIDES US FAERS | |
| 381 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 382 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 383 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 384 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 385 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 386 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 387 | Blood uric acid decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 388 | Bone erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 389 | Bone marrow depression | FAERS: 1 | OFFSIDES US FAERS | |
| 390 | Bone pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 391 | Bronchiectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 392 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 393 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 394 | Cachexia | FAERS: 1 | US FAERS | |
| 395 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 396 | Cataract operation | FAERS: 1 | US FAERS | |
| 397 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 398 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 399 | Chloracne | FAERS: 1 | US FAERS | |
| 400 | Cholangitis | FAERS: 1 | US FAERS | |
| 401 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 402 | Cleft Palate | FAERS: 1 | 17604599 | CTD US FAERS |
| 403 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 404 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 405 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 406 | Cold sweat | FAERS: 1 | US FAERS | |
| 407 | Congenital choroid plexus cyst | FAERS: 1 | US FAERS | |
| 408 | Conjunctivitis | FAERS: 1 | SIDER US FAERS | |
| 409 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 410 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 411 | Crying | FAERS: 1 | US FAERS | |
| 412 | Culture wound positive | FAERS: 1 | US FAERS | |
| 413 | Cytomegalovirus myocarditis | FAERS: 1 | US FAERS | |
| 414 | Delirium | FAERS: 1 | US FAERS | |
| 415 | Dental caries | FAERS: 1 | US FAERS | |
| 416 | Depressed mood | FAERS: 1 | US FAERS | |
| 417 | Dermatomyositis | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Disease complication | FAERS: 1 | US FAERS | |
| 419 | Diverticulum | FAERS: 1 | US FAERS | |
| 420 | Drowning | FAERS: 1 | US FAERS | |
| 421 | Drug Tolerance | FAERS: 1 | OFFSIDES US FAERS | |
| 422 | Drug abuse | FAERS: 1 | SIDER US FAERS | |
| 423 | Drug administration error | FAERS: 1 | US FAERS | |
| 424 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 425 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 426 | Drug screen positive | FAERS: 1 | US FAERS | |
| 427 | Dyscalculia | FAERS: 1 | US FAERS | |
| 428 | Dysentery | FAERS: 1 | US FAERS | |
| 429 | Dyspareunia | FAERS: 1 | US FAERS | |
| 430 | Elbow operation | FAERS: 1 | OFFSIDES US FAERS | |
| 431 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 432 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 433 | Eosinophil percentage increased | FAERS: 1 | OFFSIDES US FAERS | |
| 434 | Eosinophilic Pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 435 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 436 | Eschar | FAERS: 1 | US FAERS | |
| 437 | Escherichia infection | FAERS: 1 | US FAERS | |
| 438 | Exposure via partner | FAERS: 1 | US FAERS | |
| 439 | Feeling Cold | FAERS: 1 | US FAERS | |
| 440 | Feeling jittery | FAERS: 1 | US FAERS | |
| 441 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 442 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 443 | Gangrene | FAERS: 1 | OFFSIDES US FAERS | |
| 444 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 445 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 446 | Gastroenteritis | FAERS: 1 | SIDER US FAERS | |
| 447 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 448 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 449 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 450 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 451 | Genotype drug resistance test positive | FAERS: 1 | US FAERS | |
| 452 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 453 | Gingivitis | FAERS: 1 | SIDER US FAERS | |
| 454 | Glomerulonephritis | FAERS: 1 | OFFSIDES US FAERS | |
| 455 | Glutamate dehydrogenase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 456 | Granulomatosis with polyangiitis | FAERS: 1 | 17519271 19184066 | CTD US FAERS |
| 457 | Head deformity | FAERS: 1 | US FAERS | |
| 458 | Head discomfort | FAERS: 1 | US FAERS | |
| 459 | Heat Stroke | FAERS: 1 | US FAERS | |
| 460 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 461 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 462 | Hepatitis B | FAERS: 1 | US FAERS | |
| 463 | Hepatitis C positive | FAERS: 1 | US FAERS | |
| 464 | Hepatitis C | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 465 | Hepatojugular reflux | FAERS: 1 | US FAERS | |
| 466 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 467 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 468 | Human herpes virus 8 test positive | FAERS: 1 | US FAERS | |
| 469 | Hypereosinophilic syndrome | FAERS: 1 | US FAERS | |
| 470 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 471 | Hypokinesia | FAERS: 1 | US FAERS | |
| 472 | Hypospadias | FAERS: 1 | US FAERS | |
| 473 | Immunoglobulins abnormal | FAERS: 1 | US FAERS | |
| 474 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 475 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 476 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 477 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 478 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 479 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 480 | Joint injury | FAERS: 1 | US FAERS | |
| 481 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 482 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 483 | Laryngitis | FAERS: 1 | US FAERS | |
| 484 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 485 | Leukoencephalopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 486 | Lichen Planus | FAERS: 1 | US FAERS | |
| 487 | Lip neoplasm malignant stage unspecified | FAERS: 1 | OFFSIDES US FAERS | |
| 488 | Lipase decreased | FAERS: 1 | US FAERS | |
| 489 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 490 | Loss of personal independence in daily activities | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 491 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 492 | Lupus-like syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 493 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 494 | Lymphopenia | FAERS: 1 | US FAERS | |
| 495 | Macroglossia | FAERS: 1 | US FAERS | |
| 496 | Macule | FAERS: 1 | US FAERS | |
| 497 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 498 | Mediastinitis | FAERS: 1 | US FAERS | |
| 499 | Melanosis | FAERS: 1 | OFFSIDES US FAERS | |
| 500 | Menorrhagia | FAERS: 1 | US FAERS | |
| 501 | Mental impairment | FAERS: 1 | US FAERS | |
| 502 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 503 | Monocyte percentage decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 505 | Musculoskeletal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 506 | Myasthenia Gravis | FAERS: 1 | OFFSIDES US FAERS | |
| 507 | Myocarditis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 508 | Necrosis | FAERS: 1 | US FAERS | |
| 509 | Nerve injury | FAERS: 1 | US FAERS | |
| 510 | Nervousness | FAERS: 1 | US FAERS | |
| 511 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 512 | Neuropathy | FAERS: 1 | US FAERS | |
| 513 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 514 | Nodular rash | FAERS: 1 | US FAERS | |
| 515 | Ocular icterus | FAERS: 1 | US FAERS | |
| 516 | Onychoclasis | FAERS: 1 | US FAERS | |
| 517 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 518 | Oral Cavity Fistula | FAERS: 1 | US FAERS | |
| 519 | Oral candidiasis | FAERS: 1 | SIDER US FAERS | |
| 520 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 521 | Osteopenia | FAERS: 1 | US FAERS | |
| 522 | Ovarian failure | FAERS: 1 | US FAERS | |
| 523 | Overweight | FAERS: 1 | US FAERS | |
| 524 | Palpable purpura | FAERS: 1 | US FAERS | |
| 525 | Panniculitis | FAERS: 1 | US FAERS | |
| 526 | Paraplegia | FAERS: 1 | US FAERS | |
| 527 | Pemphigus | FAERS: 1 | US FAERS | |
| 528 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 529 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 530 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 531 | Polyarthritis | FAERS: 1 | US FAERS | |
| 532 | Polymyositis | FAERS: 1 | OFFSIDES US FAERS | |
| 533 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 534 | Post inflammatory pigmentation change | FAERS: 1 | US FAERS | |
| 535 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 536 | Precancerous skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 537 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 538 | Procedural complication | FAERS: 1 | US FAERS | |
| 539 | Product complaint | FAERS: 1 | US FAERS | |
| 540 | Product formulation issue | FAERS: 1 | US FAERS | |
| 541 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 542 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 543 | Protein C decreased | FAERS: 1 | US FAERS | |
| 544 | Protein total decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 545 | Protein urine present | FAERS: 1 | US FAERS | |
| 546 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 547 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 548 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 549 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 550 | QRS axis abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 551 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 552 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 553 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 554 | Restlessness | FAERS: 1 | US FAERS | |
| 555 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 556 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 557 | Rheumatoid Vasculitis | FAERS: 1 | OFFSIDES US FAERS | |
| 558 | Rhonchi | FAERS: 1 | OFFSIDES US FAERS | |
| 559 | Right ventricular heave | FAERS: 1 | US FAERS | |
| 560 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 561 | Scleritis | FAERS: 1 | OFFSIDES US FAERS | |
| 562 | Sense of oppression | FAERS: 1 | US FAERS | |
| 563 | Serositis | FAERS: 1 | US FAERS | |
| 564 | Skeletal dysplasia | FAERS: 1 | US FAERS | |
| 565 | Skeleton dysplasia | FAERS: 1 | US FAERS | |
| 566 | Skin Erosion | FAERS: 1 | US FAERS | |
| 567 | Skin irritation | FAERS: 1 | US FAERS | |
| 568 | Sluggishness | FAERS: 1 | US FAERS | |
| 569 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 570 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 571 | Subcutaneous Emphysema | FAERS: 1 | OFFSIDES US FAERS | |
| 572 | Subileus | FAERS: 1 | US FAERS | |
| 573 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 574 | Synovitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 575 | Syphilis | FAERS: 1 | US FAERS | |
| 576 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 577 | Talipes | FAERS: 1 | US FAERS | |
| 578 | Teeth brittle | FAERS: 1 | OFFSIDES US FAERS | |
| 579 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 580 | Therapeutic response changed | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 581 | Therapy cessation | FAERS: 1 | US FAERS | |
| 582 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 583 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 584 | Thyroiditis | FAERS: 1 | OFFSIDES US FAERS | |
| 585 | Tonsillitis | FAERS: 1 | OFFSIDES US FAERS | |
| 586 | Tracheitis | FAERS: 1 | US FAERS | |
| 587 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 588 | Troponin increased | FAERS: 1 | US FAERS | |
| 589 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 590 | Unwanted pregnancy | FAERS: 1 | OFFSIDES US FAERS | |
| 591 | Urethritis | FAERS: 1 | US FAERS | |
| 592 | Urinary tract discomfort | FAERS: 1 | US FAERS | |
| 593 | Urinary tract infection | FAERS: 1 | SIDER US FAERS | |
| 594 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 595 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 596 | Viral pericarditis | FAERS: 1 | US FAERS | |
| 597 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 598 | Wheelchair user | FAERS: 1 | OFFSIDES US FAERS | |
| 599 | Wound Complication | FAERS: 1 | US FAERS | |
| 600 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 601 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 602 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 603 | furuncle | FAERS: 1 | OFFSIDES US FAERS | |
| 604 | muscle injury | FAERS: 1 | US FAERS | |
| 605 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 606 | prostatitis | FAERS: 1 | US FAERS | |
| 607 | Abdominal Infection | OFFSIDES | ||
| 608 | Abdominal mass | OFFSIDES | ||
| 609 | Abdominal rigidity | OFFSIDES | ||
| 610 | Acanthoma | OFFSIDES | ||
| 611 | Acquired Immunodeficiency Syndrome | SIDER | ||
| 612 | Acquired bronchial cyst | OFFSIDES | ||
| 613 | Acute bronchitis | OFFSIDES | ||
| 614 | Acute overdose | SIDER | ||
| 615 | Adenitis | OFFSIDES | ||
| 616 | Adenocarcinoma | OFFSIDES | ||
| 617 | Adenosquamous cell lung cancer | OFFSIDES | ||
| 618 | Albuminuria | SIDER | ||
| 619 | Alopecia effluvium | OFFSIDES | ||
| 620 | Alopecia totalis | OFFSIDES | ||
| 621 | Alpha 2 globulin decreased | OFFSIDES | ||
| 622 | Amblyopia | SIDER | ||
| 623 | Anal sphincter atony | OFFSIDES | ||
| 624 | Anaphylactoid Reaction | SIDER | ||
| 625 | Androgens decreased | OFFSIDES | ||
| 626 | Angiotensin converting enzyme increased | OFFSIDES | ||
| 627 | Animal scratch | OFFSIDES | ||
| 628 | Anorectal cellulitis | OFFSIDES | ||
| 629 | Anoxia | OFFSIDES | ||
| 630 | Anti factor VIII antibody positive | OFFSIDES | ||
| 631 | Anti factor XII antibody positive | OFFSIDES | ||
| 632 | Anti-erythrocyte antibody positive | OFFSIDES | ||
| 633 | Anticonvulsant drug level abnormal | OFFSIDES | ||
| 634 | Aortic bypass | OFFSIDES | ||
| 635 | Aphthous Stomatitis | OFFSIDES SIDER | ||
| 636 | Arthritis, Experimental | 25481498 26221077 | CTD | |
| 637 | Arthrodesis | OFFSIDES | ||
| 638 | Arthropod bite | OFFSIDES | ||
| 639 | Aspergilloma | OFFSIDES | ||
| 640 | Asterixis | OFFSIDES | ||
| 641 | Autoantibody positive | OFFSIDES | ||
| 642 | B-cell lymphoma stage II | OFFSIDES | ||
| 643 | Bacterial DNA test positive | OFFSIDES | ||
| 644 | Bacterial pyelonephritis | OFFSIDES | ||
| 645 | Band neutrophil percentage increased | OFFSIDES | ||
| 646 | Beta 2 microglobulin increased | OFFSIDES | ||
| 647 | Bladder Neoplasm | OFFSIDES | ||
| 648 | Bladder cancer recurrent | OFFSIDES | ||
| 649 | Bladder pain | SIDER | ||
| 650 | Blood and lymphatic system disorders | SIDER | ||
| 651 | Blood bilirubin unconjugated | OFFSIDES | ||
| 652 | Blood cholinesterase decreased | OFFSIDES | ||
| 653 | Blood creatine increased | OFFSIDES | ||
| 654 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 655 | Blood electrolytes decreased | OFFSIDES | ||
| 656 | Blood immunoglobulin M | OFFSIDES | ||
| 657 | Blood pH decreased | OFFSIDES | ||
| 658 | Body Height | OFFSIDES | ||
| 659 | Body temperature fluctuation | OFFSIDES | ||
| 660 | Bone Diseases, Developmental | 17604599 | CTD | |
| 661 | Bone Resorption | 26221077 | CTD | |
| 662 | Bone fissure | OFFSIDES | ||
| 663 | Bowen's Disease | OFFSIDES | ||
| 664 | Breast cancer stage III | OFFSIDES | ||
| 665 | Breech Presentation | OFFSIDES | ||
| 666 | Bronchial irritation | OFFSIDES | ||
| 667 | Bronchopleural Fistula | OFFSIDES | ||
| 668 | Bunion operation | OFFSIDES | ||
| 669 | Bunion | OFFSIDES | ||
| 670 | Bursal operation | OFFSIDES | ||
| 671 | Candida sepsis | OFFSIDES | ||
| 672 | Candidiasis of vagina | OFFSIDES | ||
| 673 | Cardiac infection | OFFSIDES | ||
| 674 | Cardiac stress test abnormal | OFFSIDES | ||
| 675 | Carotid artery aneurysm | OFFSIDES | ||
| 676 | Cataract | SIDER | ||
| 677 | Catheter sepsis | OFFSIDES | ||
| 678 | Cavernous Sinus Thrombosis | OFFSIDES | ||
| 679 | Cerebral ventricle dilatation | OFFSIDES | ||
| 680 | Chemical and Drug Induced Liver Injury | CTD | ||
| 681 | Chest wall pain | OFFSIDES | ||
| 682 | Chlamydia serology | OFFSIDES | ||
| 683 | Cholangiolitis | OFFSIDES | ||
| 684 | Choroiditis | OFFSIDES | ||
| 685 | Chronic left ventricular failure | OFFSIDES | ||
| 686 | Clubbing | OFFSIDES | ||
| 687 | Coagulation time abnormal | OFFSIDES | ||
| 688 | Coccidioidomycosis | OFFSIDES | ||
| 689 | Colon cancer recurrent | OFFSIDES | ||
| 690 | Colonic fistula | OFFSIDES | ||
| 691 | Congenital heart valve disorder | OFFSIDES | ||
| 692 | Congenital hypertrichosis | OFFSIDES | ||
| 693 | Congenital vaginal cyst | OFFSIDES | ||
| 694 | Corneal abscess | OFFSIDES | ||
| 695 | Cramps of lower extremities | SIDER | ||
| 696 | Craniofacial Abnormalities | 17604599 | CTD | |
| 697 | Creatine Phosphokinase Increased | SIDER | ||
| 698 | Creatinine renal clearance increased | OFFSIDES | ||
| 699 | Cutaneous Candidiasis | OFFSIDES | ||
| 700 | Cutaneous sarcoidosis | OFFSIDES | ||
| 701 | Cystitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 702 | Cytomegalovirus gastroenteritis | OFFSIDES | ||
| 703 | Decreased immune responsiveness | OFFSIDES | ||
| 704 | Device dislocation | OFFSIDES | ||
| 705 | Diarrhea | 14971821 | CTD OFFSIDES | |
| 706 | Diffuse alveolar damage | OFFSIDES | ||
| 707 | Diffuse large B-cell lymphoma recurrent | OFFSIDES | ||
| 708 | Drug delivery system malfunction | OFFSIDES | ||
| 709 | Drug specific antibody present | OFFSIDES | ||
| 710 | Duodenal fistula | OFFSIDES | ||
| 711 | Duodenal ulcer perforation | OFFSIDES | ||
| 712 | Dysuria | SIDER | ||
| 713 | Electromyogram abnormal | OFFSIDES | ||
| 714 | Empyema | OFFSIDES | ||
| 715 | Endocarditis | OFFSIDES | ||
| 716 | Enterovesical Fistula | OFFSIDES | ||
| 717 | Epidural Abscess | OFFSIDES | ||
| 718 | Erythema Induratum | OFFSIDES | ||
| 719 | Escherichia urinary tract infection | OFFSIDES | ||
| 720 | Exfoliative rash | OFFSIDES | ||
| 721 | Eye Redness | OFFSIDES | ||
| 722 | Facial Neuralgia | OFFSIDES | ||
| 723 | Fat redistribution | OFFSIDES | ||
| 724 | Fatty Liver | 11083289 | CTD OFFSIDES | |
| 725 | Fibromatosis | OFFSIDES | ||
| 726 | Folliculitis | OFFSIDES | ||
| 727 | Fungus serology test positive | OFFSIDES | ||
| 728 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 729 | Gastrooesophageal sphincter insufficiency | OFFSIDES | ||
| 730 | General symptom | OFFSIDES | ||
| 731 | Genital discharge | OFFSIDES | ||
| 732 | Glaucoma surgery | OFFSIDES | ||
| 733 | Granulocytosis | OFFSIDES | ||
| 734 | Granuloma Annulare | OFFSIDES | ||
| 735 | Grip strength | OFFSIDES | ||
| 736 | Hair discoloration | SIDER | ||
| 737 | Haptoglobin Decreased | OFFSIDES | ||
| 738 | Hematuria | 12468482 | CTD | |
| 739 | Hepatic Infarction | OFFSIDES | ||
| 740 | Hepatic congestion | OFFSIDES | ||
| 741 | Hepatitis B positive | OFFSIDES | ||
| 742 | Hepatitis C RNA | OFFSIDES | ||
| 743 | Herpes simplex DNA test positive | OFFSIDES | ||
| 744 | Hip surgery | OFFSIDES | ||
| 745 | Hoarseness | OFFSIDES | ||
| 746 | Hodgkin's disease mixed cellularity stage III | OFFSIDES | ||
| 747 | Hormone level abnormal | OFFSIDES | ||
| 748 | Hypertensive heart disease | OFFSIDES | ||
| 749 | Hypertrichosis | OFFSIDES | ||
| 750 | Immobile | SIDER | ||
| 751 | Immunosuppressant drug therapy | OFFSIDES | ||
| 752 | Impaired self-care | OFFSIDES | ||
| 753 | Implant site infection | OFFSIDES | ||
| 754 | Incision site infection | OFFSIDES | ||
| 755 | Incision site pain | OFFSIDES | ||
| 756 | Infestation | SIDER | ||
| 757 | Influenza serology positive | OFFSIDES | ||
| 758 | Infusion site infection | OFFSIDES | ||
| 759 | Injection site burning | OFFSIDES | ||
| 760 | Injection site cellulitis | OFFSIDES | ||
| 761 | Injection site dermatitis | OFFSIDES | ||
| 762 | Injection site discomfort | OFFSIDES | ||
| 763 | Injection site erythema | OFFSIDES | ||
| 764 | Injection site infection | OFFSIDES | ||
| 765 | Injection site irritation | OFFSIDES | ||
| 766 | Injection site mass | OFFSIDES | ||
| 767 | Injection site nodule | OFFSIDES | ||
| 768 | Injection site pruritus | OFFSIDES | ||
| 769 | Injection site recall reaction | OFFSIDES | ||
| 770 | Injection site stinging | OFFSIDES | ||
| 771 | Injection site streaking | OFFSIDES | ||
| 772 | Injection site urticaria | OFFSIDES | ||
| 773 | Injection site vesicles | OFFSIDES | ||
| 774 | Injection site warmth | OFFSIDES | ||
| 775 | Injury asphyxiation | OFFSIDES | ||
| 776 | Intracranial Aneurysm | OFFSIDES | ||
| 777 | Investigation abnormal | OFFSIDES | ||
| 778 | Iridocyclitis | OFFSIDES | ||
| 779 | Joint Instability | OFFSIDES | ||
| 780 | Joint abscess | OFFSIDES | ||
| 781 | Joint fluid drainage | OFFSIDES | ||
| 782 | Joint prosthesis user | OFFSIDES | ||
| 783 | Joint warmth | OFFSIDES | ||
| 784 | Keratitis sicca | OFFSIDES | ||
| 785 | Labile blood pressure | OFFSIDES | ||
| 786 | Lactic dehydrogenase activity increased | SIDER | ||
| 787 | Legionella serology positive | OFFSIDES | ||
| 788 | Legionella | OFFSIDES | ||
| 789 | Lentigo maligna stage I | OFFSIDES | ||
| 790 | Leprosy | OFFSIDES | ||
| 791 | Leptospirosis | OFFSIDES | ||
| 792 | Limb Deformities, Congenital | 19751817 | CTD | |
| 793 | Liver Cirrhosis | 11083289 | CTD | |
| 794 | Liver Failure | 28988120 | CTD | |
| 795 | Lower respiratory tract infection viral | OFFSIDES | ||
| 796 | Lupus hepatitis | OFFSIDES | ||
| 797 | Lymph Node Tuberculosis | OFFSIDES | ||
| 798 | Lymphatic obstruction | OFFSIDES | ||
| 799 | Lymphocyte percentage decreased | OFFSIDES | ||
| 800 | Malignant anorectal neoplasm | OFFSIDES | ||
| 801 | Markedly reduced dietary intake | OFFSIDES | ||
| 802 | Mediastinal mass | OFFSIDES | ||
| 803 | Mediastinoscopy | OFFSIDES | ||
| 804 | Medical device change | OFFSIDES | ||
| 805 | Megacolon | OFFSIDES | ||
| 806 | Mesangioproliferative glomerulonephritis | OFFSIDES | ||
| 807 | Mesothelioma | OFFSIDES | ||
| 808 | Microalbuminuria | OFFSIDES | ||
| 809 | Mixed Connective Tissue Disease | OFFSIDES | ||
| 810 | Mixed hepatocellular-cholestatic injury | OFFSIDES | ||
| 811 | Monocyte percentage increased | OFFSIDES | ||
| 812 | Mononeuropathy Multiplex | Canada Vigilance: 1 | Canada Vigilance | |
| 813 | Morganella infection | OFFSIDES | ||
| 814 | Muscle enzyme | OFFSIDES | ||
| 815 | Muscle necrosis | OFFSIDES | ||
| 816 | Myasthenic Syndrome | OFFSIDES | ||
| 817 | Mycosis Fungoides | OFFSIDES | ||
| 818 | Myeloid maturation arrest | OFFSIDES | ||
| 819 | Myocarditis post infection | OFFSIDES | ||
| 820 | Myopericarditis | OFFSIDES | ||
| 821 | Neck Pain | SIDER | ||
| 822 | Nephritis, Interstitial | 15102985 | CTD | |
| 823 | Neural Tube Defects | 17604599 | CTD | |
| 824 | Neuritis | SIDER | ||
| 825 | Neuroborreliosis | OFFSIDES | ||
| 826 | Neurological decompensation | OFFSIDES | ||
| 827 | Neurological examination abnormal | OFFSIDES | ||
| 828 | Nipple pain | OFFSIDES | ||
| 829 | Nodule on extremity | OFFSIDES | ||
| 830 | Open wound | OFFSIDES | ||
| 831 | Optic Disc Edema | OFFSIDES | ||
| 832 | Oropharyngeal discomfort | SIDER | ||
| 833 | Oropharyngitis fungal | OFFSIDES | ||
| 834 | Orthopnea | OFFSIDES | ||
| 835 | PO2 decreased | OFFSIDES | ||
| 836 | PROTHROMBIN TIME | OFFSIDES | ||
| 837 | Pain management | OFFSIDES | ||
| 838 | Parapsoriasis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 839 | Pelvic Pain | SIDER | ||
| 840 | Peptostreptococcus infection | OFFSIDES | ||
| 841 | Perianal abscess | OFFSIDES | ||
| 842 | Peripheral Nervous System Diseases | 17519271 21205510 | CTD | |
| 843 | Peritoneal Infection | OFFSIDES | ||
| 844 | Peroneal nerve injury | OFFSIDES | ||
| 845 | Pharyngitis | SIDER | ||
| 846 | Phimosis | OFFSIDES | ||
| 847 | Pleural Infection | OFFSIDES | ||
| 848 | Polyomavirus-associated nephropathy | OFFSIDES | ||
| 849 | Post procedural fistula | OFFSIDES | ||
| 850 | Post procedural headache | OFFSIDES | ||
| 851 | Postoperative infection | OFFSIDES | ||
| 852 | Postoperative wound complication | OFFSIDES | ||
| 853 | Pre-existing condition improved | OFFSIDES | ||
| 854 | Procedural nausea | OFFSIDES | ||
| 855 | Proctocolitis | OFFSIDES | ||
| 856 | Protein total abnormal | OFFSIDES | ||
| 857 | Pseudarthrosis | OFFSIDES | ||
| 858 | Psoas Abscess | OFFSIDES | ||
| 859 | Pulmonary Valve Stenosis | OFFSIDES | ||
| 860 | Pulmonary hypertensive crisis | OFFSIDES | ||
| 861 | Pulmonary necrosis | OFFSIDES | ||
| 862 | Puncture site reaction | OFFSIDES | ||
| 863 | Quadriparesis | OFFSIDES | ||
| 864 | Rectosigmoid cancer | OFFSIDES | ||
| 865 | Regurgitation | OFFSIDES | ||
| 866 | Renal Colic | OFFSIDES | ||
| 867 | Renal Osteodystrophy | OFFSIDES | ||
| 868 | Renal interstitial fibrosis | OFFSIDES | ||
| 869 | Renal mass | OFFSIDES | ||
| 870 | Respiratory tract congestion | OFFSIDES | ||
| 871 | Restrictive cardiomyopathy | OFFSIDES | ||
| 872 | Reticulocyte count decreased | OFFSIDES | ||
| 873 | Retinal vascular thrombosis | OFFSIDES | ||
| 874 | Rheumatoid factor increased | OFFSIDES | ||
| 875 | Rhinitis | SIDER | ||
| 876 | Rhinorrhea | OFFSIDES | ||
| 877 | Sarcoidosis | OFFSIDES | ||
| 878 | Seroma | OFFSIDES | ||
| 879 | Shoulder Dystocia | OFFSIDES | ||
| 880 | Shunt occlusion | OFFSIDES | ||
| 881 | Single functional kidney | OFFSIDES | ||
| 882 | Sinusitis aspergillus | OFFSIDES | ||
| 883 | Skin laceration | OFFSIDES | ||
| 884 | Skin necrosis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 885 | Skin nodule | SIDER | ||
| 886 | Spinal vascular disorder | OFFSIDES | ||
| 887 | Splenic vein thrombosis | OFFSIDES | ||
| 888 | Spondylolisthesis | OFFSIDES | ||
| 889 | Sputum retention | OFFSIDES | ||
| 890 | Stitch abscess | OFFSIDES | ||
| 891 | Subacute endocarditis | OFFSIDES | ||
| 892 | Subcutaneous nodule | OFFSIDES SIDER | ||
| 893 | Superficial Thrombophlebitis | OFFSIDES | ||
| 894 | Supraventricular tachyarrhythmia | OFFSIDES | ||
| 895 | Synovectomy | OFFSIDES | ||
| 896 | Synovial Cyst | OFFSIDES | ||
| 897 | Synoviorthesis | OFFSIDES | ||
| 898 | Systemic lupus erythematosus rash | Canada Vigilance: 1 | Canada Vigilance | |
| 899 | T-Cell Lymphoma | OFFSIDES | ||
| 900 | T-cell lymphoma stage IV | OFFSIDES | ||
| 901 | Takayasu Arteritis | 11491512 | CTD | |
| 902 | Tenosynovitis | OFFSIDES SIDER | ||
| 903 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 904 | Therapy regimen changed | OFFSIDES | ||
| 905 | Thoracic vertebral fracture | OFFSIDES | ||
| 906 | Thromboangiitis Obliterans | OFFSIDES | ||
| 907 | Toe operation | OFFSIDES | ||
| 908 | Tongue eruption | OFFSIDES | ||
| 909 | Traumatic liver injury | SIDER | ||
| 910 | Tri-iodothyronine uptake decreased | OFFSIDES | ||
| 911 | Truncus Arteriosus, Persistent | 17604599 | CTD | |
| 912 | Tuberculosis test positive | OFFSIDES | ||
| 913 | Ultrasound antenatal screen | OFFSIDES | ||
| 914 | Urinary occult blood positive | OFFSIDES | ||
| 915 | Urinary sediment present | OFFSIDES | ||
| 916 | Urine phosphorus increased | SIDER | ||
| 917 | Vascular procedure complication | OFFSIDES | ||
| 918 | Vasodilation procedure | SIDER | ||
| 919 | Vasodilation | SIDER | ||
| 920 | Vasospasm | OFFSIDES | ||
| 921 | Venous Insufficiency | OFFSIDES | ||
| 922 | Venous aneurysm | OFFSIDES | ||
| 923 | Ventricular hypoplasia | OFFSIDES | ||
| 924 | Vertebral abscess | OFFSIDES | ||
| 925 | Vibration test abnormal | OFFSIDES | ||
| 926 | Viral myocarditis | OFFSIDES | ||
| 927 | Vitamin K Deficiency | OFFSIDES | ||
| 928 | Vulvovaginal mycotic infection | SIDER | ||
| 929 | White blood cell count abnormal | OFFSIDES | ||
| 930 | Whole blood transfusion | OFFSIDES | ||
| 931 | bone marrow fibrosis | OFFSIDES | ||
| 932 | effusion | OFFSIDES | ||
| 933 | streptococcal serology | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.