Erlotinib Hydrochloride
(GTTBEUCJPZQMDZ-UHFFFAOYSA-N)
Structure
- SMILES
- COCCOc1cc2c(ncnc2cc1OCCOC)Nc1cccc(c1)C#C.Cl
- Molecular Formula:
- C22H24ClN3O4
- Molecular Weight:
- 429.897
- Log P:
- 4.2801
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 74.73
- CAS Number(s):
- 183319-69-9
Synonym(s)
1.
Erlotinib Hydrochloride
2.
11C-erlotinib
3.
CP 358,774
4.
CP 358774
5.
CP-358,774
6.
CP-358774
7.
Erlotinib
8.
Erlotinib HCl
9.
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine
10.
OSI-774
11.
Tarceva
12.
11C erlotinib
13.
358,774, CP
14.
358774, CP
15.
CP358,774
16.
CP358774
17.
HCl, Erlotinib
18.
Hydrochloride, Erlotinib
19.
OSI 774
20.
OSI774
External Link(s)
| MeSH | D000069347 |
| PubChem Compound | 44263854 139074663 176871 |
| BindingDB | 50311470 |
| ChEBI | 53509 |
| CHEMBL | CHEMBL1079742 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 625 Canada Vigilance: 24 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Drug ineffective | FAERS: 591 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 584 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 4 | Fatigue | FAERS: 576 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Dry skin | FAERS: 474 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Pruritus | FAERS: 349 | US FAERS | |
| 7 | Vomiting | FAERS: 338 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Acne | FAERS: 309 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 9 | Alopecia | FAERS: 292 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 10 | Asthenia | FAERS: 281 Canada Vigilance: 1 | 21778302 | CTD OFFSIDES Canada Vigilance US FAERS |
| 11 | Malaise | FAERS: 280 | US FAERS | |
| 12 | Pneumonia | FAERS: 276 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Incorrect dose administered | FAERS: 258 | US FAERS | |
| 14 | Malignant neoplasm progression | FAERS: 255 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Weight decreased | FAERS: 234 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Dehydration | FAERS: 191 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Pain | FAERS: 181 | US FAERS | |
| 18 | Stomatitis | FAERS: 178 | US FAERS | |
| 19 | No adverse event | FAERS: 168 | US FAERS | |
| 20 | Dermatitis acneiform | FAERS: 161 | US FAERS | |
| 21 | Respiratory Failure | FAERS: 134 | OFFSIDES US FAERS | |
| 22 | Erythema | FAERS: 117 | US FAERS | |
| 23 | Constipation | FAERS: 116 | US FAERS | |
| 24 | Headache | FAERS: 112 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Eye irritation | FAERS: 100 | US FAERS | |
| 26 | Epistaxis | FAERS: 99 | OFFSIDES US FAERS | |
| 27 | Abdominal Pain | FAERS: 94 | US FAERS | |
| 28 | Dizziness | FAERS: 92 | US FAERS | |
| 29 | Pulmonary Embolism | FAERS: 91 | US FAERS | |
| 30 | Infection | FAERS: 82 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Dysgeusia | FAERS: 80 | US FAERS | |
| 32 | Dyspepsia | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Abdominal discomfort | FAERS: 77 | US FAERS | |
| 34 | Skin Ulcer | FAERS: 77 | US FAERS | |
| 35 | Arthralgia | FAERS: 74 | US FAERS | |
| 36 | General physical health deterioration | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 37 | Chest Pain | FAERS: 72 | US FAERS | |
| 38 | Cerebrovascular accident | FAERS: 69 | US FAERS | |
| 39 | Back Pain | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Onychoclasis | FAERS: 62 | OFFSIDES US FAERS | |
| 41 | Metastasis | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Incorrect product storage | FAERS: 56 | US FAERS | |
| 43 | Visual Impairment | FAERS: 56 | US FAERS | |
| 44 | Urinary tract infection | FAERS: 54 | US FAERS | |
| 45 | Conjunctivitis | FAERS: 53 | US FAERS | |
| 46 | Myocardial Infarction | FAERS: 52 | US FAERS | |
| 47 | Thrombosis | FAERS: 52 | US FAERS | |
| 48 | Rash erythematous | FAERS: 47 | US FAERS | |
| 49 | Peripheral swelling | FAERS: 45 | US FAERS | |
| 50 | Urticaria | FAERS: 45 | US FAERS | |
| 51 | Sepsis | FAERS: 44 | US FAERS | |
| 52 | Eye pain | FAERS: 43 | OFFSIDES US FAERS | |
| 53 | Intentional product use issue | FAERS: 43 | US FAERS | |
| 54 | Hypotension | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Pneumonitis | FAERS: 41 | US FAERS | |
| 56 | Anorexia | FAERS: 40 | OFFSIDES US FAERS | |
| 57 | Pancreatic carcinoma | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Burning sensation | FAERS: 39 | US FAERS | |
| 59 | Chills | FAERS: 39 | US FAERS | |
| 60 | Skin reaction | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Drug dose omission | FAERS: 37 | US FAERS | |
| 62 | Hypersensitivity | FAERS: 36 | US FAERS | |
| 63 | Intestinal Obstruction | FAERS: 36 | US FAERS | |
| 64 | Pericardial effusion | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 65 | Eye Infection | FAERS: 35 | US FAERS | |
| 66 | Oral pain | FAERS: 35 | US FAERS | |
| 67 | Metastatic Neoplasm | FAERS: 34 | US FAERS | |
| 68 | Anxiety | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Hospice Care | FAERS: 33 | US FAERS | |
| 70 | Unevaluable event | FAERS: 33 | US FAERS | |
| 71 | Bone pain | FAERS: 32 | US FAERS | |
| 72 | Flatulence | FAERS: 32 | OFFSIDES US FAERS | |
| 73 | Growth of eyelashes | FAERS: 32 | OFFSIDES US FAERS | |
| 74 | Ageusia | FAERS: 31 | US FAERS | |
| 75 | Pneumothorax | FAERS: 31 | US FAERS | |
| 76 | Skin irritation | FAERS: 31 | US FAERS | |
| 77 | Thrombocytopenia | FAERS: 31 | US FAERS | |
| 78 | Hypophagia | FAERS: 30 | OFFSIDES US FAERS | |
| 79 | Tremor | FAERS: 30 | US FAERS | |
| 80 | Scab | FAERS: 29 | OFFSIDES US FAERS | |
| 81 | Adverse event | FAERS: 28 | US FAERS | |
| 82 | Amnesia | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 83 | Deep Vein Thrombosis | FAERS: 28 | US FAERS | |
| 84 | Feeling abnormal | FAERS: 28 | US FAERS | |
| 85 | Skin lesion | FAERS: 28 | US FAERS | |
| 86 | Overdose | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Dysphonia | FAERS: 26 | US FAERS | |
| 88 | Pain of skin | FAERS: 26 | US FAERS | |
| 89 | Swelling | FAERS: 26 | US FAERS | |
| 90 | Hypoxia | FAERS: 25 | OFFSIDES US FAERS | |
| 91 | Chest discomfort | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Inappropriate schedule of drug administration | FAERS: 24 | US FAERS | |
| 93 | Myalgia | FAERS: 24 | US FAERS | |
| 94 | Nasal discomfort | FAERS: 24 | OFFSIDES US FAERS | |
| 95 | Drug resistance | FAERS: 23 | US FAERS | |
| 96 | Product storage error | FAERS: 23 | US FAERS | |
| 97 | Therapeutic product ineffective | FAERS: 23 | US FAERS | |
| 98 | Atrial Fibrillation | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Cardiac Arrest | FAERS: 22 | US FAERS | |
| 100 | Lethargy | FAERS: 22 | US FAERS | |
| 101 | Blood count abnormal | FAERS: 21 | US FAERS | |
| 102 | Blood urine present | FAERS: 21 | OFFSIDES US FAERS | |
| 103 | Productive Cough | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 104 | Somnolence | FAERS: 21 | US FAERS | |
| 105 | Ulcer | FAERS: 21 | OFFSIDES US FAERS | |
| 106 | Influenza | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Memory impairment | FAERS: 20 | US FAERS | |
| 108 | Oropharyngeal pain | FAERS: 20 | US FAERS | |
| 109 | Bronchitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Medication Error | FAERS: 19 | US FAERS | |
| 111 | Syncope | FAERS: 19 | US FAERS | |
| 112 | Aspartate Aminotransferase Increased | FAERS: 18 | US FAERS | |
| 113 | Lip swelling | FAERS: 18 | US FAERS | |
| 114 | Nephrolithiasis | FAERS: 18 | US FAERS | |
| 115 | Skin toxicity | FAERS: 18 | OFFSIDES US FAERS | |
| 116 | Vertigo | FAERS: 18 | US FAERS | |
| 117 | Abasia | FAERS: 17 | US FAERS | |
| 118 | Acute respiratory failure | FAERS: 17 | OFFSIDES US FAERS | |
| 119 | Alanine Aminotransferase Increased | FAERS: 17 | US FAERS | |
| 120 | Blindness | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Cellulitis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Dementia | FAERS: 17 | US FAERS | |
| 123 | Dermatitis | FAERS: 17 | US FAERS | |
| 124 | Flushing | FAERS: 17 | US FAERS | |
| 125 | Arthritis | FAERS: 16 | US FAERS | |
| 126 | Deafness | FAERS: 16 | US FAERS | |
| 127 | Dysuria | FAERS: 16 | US FAERS | |
| 128 | Nail Infection | FAERS: 16 | US FAERS | |
| 129 | Therapy non-responder | FAERS: 16 | US FAERS | |
| 130 | White blood cell count decreased | FAERS: 16 | US FAERS | |
| 131 | Keratitis | FAERS: 15 | US FAERS | |
| 132 | Nasopharyngitis | FAERS: 15 | US FAERS | |
| 133 | Toxicity to various agents | FAERS: 15 | US FAERS | |
| 134 | furuncle | FAERS: 15 | OFFSIDES US FAERS | |
| 135 | Acute myocardial infarction | FAERS: 14 | US FAERS | |
| 136 | Aphasia | FAERS: 14 | US FAERS | |
| 137 | Ascites | FAERS: 14 | US FAERS | |
| 138 | Cataract | FAERS: 14 | US FAERS | |
| 139 | Circumstance or information capable of leading to medication error | FAERS: 14 | US FAERS | |
| 140 | Disorientation | FAERS: 14 | US FAERS | |
| 141 | Facial Pain | FAERS: 14 | US FAERS | |
| 142 | Gastric ulcer | FAERS: 14 | US FAERS | |
| 143 | Joint swelling | FAERS: 14 | US FAERS | |
| 144 | Sunburn | FAERS: 14 | US FAERS | |
| 145 | Hepatotoxicity | FAERS: 13 | OFFSIDES US FAERS | |
| 146 | Mental status changes | FAERS: 13 | US FAERS | |
| 147 | Musculoskeletal Pain | FAERS: 13 | US FAERS | |
| 148 | Tachycardia | FAERS: 13 | US FAERS | |
| 149 | Uveitis | FAERS: 13 | US FAERS | |
| 150 | treatment failure | FAERS: 13 | OFFSIDES US FAERS | |
| 151 | Aphagia | FAERS: 12 | US FAERS | |
| 152 | Hirsutism | FAERS: 12 | US FAERS | |
| 153 | Malnutrition | FAERS: 12 | US FAERS | |
| 154 | Palpitations | FAERS: 12 | US FAERS | |
| 155 | Purpura | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Respiratory distress | FAERS: 12 | US FAERS | |
| 157 | Septic Shock | FAERS: 12 | US FAERS | |
| 158 | Sudden death | FAERS: 12 | OFFSIDES US FAERS | |
| 159 | Thermal burn | FAERS: 12 | US FAERS | |
| 160 | nervous system disorder | FAERS: 12 | US FAERS | |
| 161 | Blood creatinine increased | FAERS: 11 | US FAERS | |
| 162 | Blood glucose increased | FAERS: 11 | US FAERS | |
| 163 | Blood potassium decreased | FAERS: 11 | US FAERS | |
| 164 | Cystitis | FAERS: 11 | US FAERS | |
| 165 | Pancreatitis | FAERS: 11 | US FAERS | |
| 166 | Pneumatosis intestinalis | FAERS: 11 | US FAERS | |
| 167 | Viral upper respiratory tract infection | FAERS: 11 | US FAERS | |
| 168 | Cheilitis | FAERS: 10 | OFFSIDES US FAERS | |
| 169 | Depressed Level of Consciousness | FAERS: 10 | US FAERS | |
| 170 | Discomfort | FAERS: 10 | US FAERS | |
| 171 | Disseminated Intravascular Coagulation | FAERS: 10 | US FAERS | |
| 172 | Feeling Cold | FAERS: 10 | OFFSIDES US FAERS | |
| 173 | Folliculitis | FAERS: 10 | OFFSIDES US FAERS | |
| 174 | Full blood count decreased | FAERS: 10 | OFFSIDES US FAERS | |
| 175 | Hypothyroidism | FAERS: 10 | US FAERS | |
| 176 | Ileus | FAERS: 10 | US FAERS | |
| 177 | Incontinence | FAERS: 10 | US FAERS | |
| 178 | Leukopenia | FAERS: 10 | US FAERS | |
| 179 | Pulmonary toxicity | FAERS: 10 | US FAERS | |
| 180 | Sinusitis | FAERS: 10 | OFFSIDES US FAERS | |
| 181 | Throat irritation | FAERS: 10 | US FAERS | |
| 182 | Trichorrhexis | FAERS: 10 | OFFSIDES US FAERS | |
| 183 | jaundice | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Blood glucose decreased | FAERS: 9 | OFFSIDES US FAERS | |
| 185 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 186 | Duodenal Ulcer | FAERS: 9 | US FAERS | |
| 187 | Eye inflammation | FAERS: 9 | OFFSIDES US FAERS | |
| 188 | Eyelids pruritus | FAERS: 9 | US FAERS | |
| 189 | Gastritis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Glaucoma | FAERS: 9 | US FAERS | |
| 191 | Hepatitis | FAERS: 9 | 19261961 | CTD US FAERS |
| 192 | Laceration | FAERS: 9 | US FAERS | |
| 193 | Metastases to pelvis | FAERS: 9 | US FAERS | |
| 194 | Neutropenia | FAERS: 9 | US FAERS | |
| 195 | Performance status decreased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Pulmonary thrombosis | FAERS: 9 | OFFSIDES US FAERS | |
| 197 | Respiratory arrest | FAERS: 9 | US FAERS | |
| 198 | Stevens-Johnson Syndrome | FAERS: 9 | 25811541 | CTD US FAERS |
| 199 | Thirst | FAERS: 9 | US FAERS | |
| 200 | Tinnitus | FAERS: 9 | US FAERS | |
| 201 | Trichiasis | FAERS: 9 | US FAERS | |
| 202 | Vitreous floaters | FAERS: 9 | US FAERS | |
| 203 | Abscess | FAERS: 8 | US FAERS | |
| 204 | Amylase increased | FAERS: 8 | US FAERS | |
| 205 | Blepharitis | FAERS: 8 | OFFSIDES US FAERS | |
| 206 | Blood alkaline phosphatase increased | FAERS: 8 | OFFSIDES US FAERS | |
| 207 | Carcinoembryonic antigen increased | FAERS: 8 | OFFSIDES US FAERS | |
| 208 | Diplopia | FAERS: 8 | US FAERS | |
| 209 | Exfoliative rash | FAERS: 8 | US FAERS | |
| 210 | Eyelash thickening | FAERS: 8 | US FAERS | |
| 211 | Eyelid margin crusting | FAERS: 8 | US FAERS | |
| 212 | Failure to Thrive | FAERS: 8 | US FAERS | |
| 213 | Inflammation | FAERS: 8 | 21743808 | CTD US FAERS |
| 214 | Leukocytoclastic vasculitis | FAERS: 8 | US FAERS | |
| 215 | Metastases to stomach | FAERS: 8 | US FAERS | |
| 216 | Metastases to thorax | FAERS: 8 | US FAERS | |
| 217 | Onychalgia | FAERS: 8 | OFFSIDES US FAERS | |
| 218 | Pyogenic granuloma | FAERS: 8 | US FAERS | |
| 219 | Radiation Pneumonitis | FAERS: 8 | US FAERS | |
| 220 | Anaphylactic shock | FAERS: 7 | US FAERS | |
| 221 | Blood blister | FAERS: 7 | US FAERS | |
| 222 | Blood potassium increased | FAERS: 7 | US FAERS | |
| 223 | Cholestasis | FAERS: 7 | US FAERS | |
| 224 | Colitis | FAERS: 7 | US FAERS | |
| 225 | Diverticulitis | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 226 | Ear discomfort | FAERS: 7 | US FAERS | |
| 227 | Embolism | FAERS: 7 | US FAERS | |
| 228 | Epilepsy | FAERS: 7 | US FAERS | |
| 229 | Fracture | FAERS: 7 | US FAERS | |
| 230 | Gastrointestinal perforation | FAERS: 7 | US FAERS | |
| 231 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 232 | Intestinal Perforation | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 233 | Lipase increased | FAERS: 7 | US FAERS | |
| 234 | Loss of personal independence in daily activities | FAERS: 7 | US FAERS | |
| 235 | MYELODYSPLASTIC SYNDROME | FAERS: 7 | US FAERS | |
| 236 | Neck Pain | FAERS: 7 | US FAERS | |
| 237 | Nervousness | FAERS: 7 | US FAERS | |
| 238 | Night sweats | FAERS: 7 | US FAERS | |
| 239 | Onycholysis | FAERS: 7 | US FAERS | |
| 240 | Onychomycosis | FAERS: 7 | US FAERS | |
| 241 | Oral candidiasis | FAERS: 7 | US FAERS | |
| 242 | Product quality issue | FAERS: 7 | US FAERS | |
| 243 | Pulmonary Fibrosis | FAERS: 7 Canada Vigilance: 1 | 18424623 | CTD Canada Vigilance US FAERS |
| 244 | Rosacea | FAERS: 7 | US FAERS | |
| 245 | Therapy cessation | FAERS: 7 | US FAERS | |
| 246 | Wheezing | FAERS: 7 | US FAERS | |
| 247 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 248 | Accidental overdose | FAERS: 6 | US FAERS | |
| 249 | Aphonia | FAERS: 6 | US FAERS | |
| 250 | Atelectasis | FAERS: 6 | US FAERS | |
| 251 | Blood albumin decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 252 | Blood magnesium decreased | FAERS: 6 | US FAERS | |
| 253 | Cachexia | FAERS: 6 | US FAERS | |
| 254 | Cholecystitis | FAERS: 6 | OFFSIDES US FAERS | |
| 255 | Chromaturia | FAERS: 6 | US FAERS | |
| 256 | Clostridium difficile colitis | FAERS: 6 | US FAERS | |
| 257 | Corneal Perforation | FAERS: 6 | OFFSIDES US FAERS | |
| 258 | Cyst | FAERS: 6 | US FAERS | |
| 259 | Demyelination | FAERS: 6 | US FAERS | |
| 260 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 261 | Drug toxicity | FAERS: 6 | US FAERS | |
| 262 | Dysarthria | FAERS: 6 | US FAERS | |
| 263 | EGFR gene mutation | FAERS: 6 | US FAERS | |
| 264 | Ectropion | FAERS: 6 | US FAERS | |
| 265 | Eructation | FAERS: 6 | US FAERS | |
| 266 | Extra dose administered | FAERS: 6 | US FAERS | |
| 267 | Gastrointestinal inflammation | FAERS: 6 | OFFSIDES US FAERS | |
| 268 | Intercepted medication error | FAERS: 6 | US FAERS | |
| 269 | Iridocyclitis | FAERS: 6 | US FAERS | |
| 270 | Leukocytosis | FAERS: 6 | US FAERS | |
| 271 | Optic Neuritis | FAERS: 6 | US FAERS | |
| 272 | Pancytopenia | FAERS: 6 | US FAERS | |
| 273 | Petechiae | FAERS: 6 | US FAERS | |
| 274 | Pleurisy | FAERS: 6 | US FAERS | |
| 275 | Post procedural complication | FAERS: 6 | US FAERS | |
| 276 | Purulence | FAERS: 6 | OFFSIDES US FAERS | |
| 277 | Retching | FAERS: 6 | US FAERS | |
| 278 | Terminal state | FAERS: 6 | US FAERS | |
| 279 | Vasculitis | FAERS: 6 | US FAERS | |
| 280 | Vocal Cord Paralysis | FAERS: 6 | US FAERS | |
| 281 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 282 | Adenocarcinoma | FAERS: 5 | 21541241 27720938 | CTD US FAERS |
| 283 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 284 | Asthma | FAERS: 5 | US FAERS | |
| 285 | Bacterial sepsis | FAERS: 5 | US FAERS | |
| 286 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 287 | Blood urea increased | FAERS: 5 | US FAERS | |
| 288 | Bronchospasm | FAERS: 5 | US FAERS | |
| 289 | Clostridium difficile infection | FAERS: 5 | US FAERS | |
| 290 | Eczema | FAERS: 5 | US FAERS | |
| 291 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 292 | Gastrointestinal motility disorder | FAERS: 5 | US FAERS | |
| 293 | Gastrointestinal toxicity | FAERS: 5 | US FAERS | |
| 294 | Glossitis | FAERS: 5 | OFFSIDES US FAERS | |
| 295 | Gout | FAERS: 5 | US FAERS | |
| 296 | Hemiparesis | FAERS: 5 | OFFSIDES US FAERS | |
| 297 | Hepatic Encephalopathy | FAERS: 5 | US FAERS | |
| 298 | Hydrocephalus | FAERS: 5 | US FAERS | |
| 299 | Hydrothorax | FAERS: 5 | US FAERS | |
| 300 | Hypersomnia | FAERS: 5 | US FAERS | |
| 301 | Hypotrichosis | FAERS: 5 | US FAERS | |
| 302 | Incorrect storage of drug | FAERS: 5 | US FAERS | |
| 303 | Laryngitis | FAERS: 5 | US FAERS | |
| 304 | Musculoskeletal chest pain | FAERS: 5 | US FAERS | |
| 305 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 306 | Nasal mucosal disorder | FAERS: 5 | US FAERS | |
| 307 | Neutrophil count decreased | FAERS: 5 | US FAERS | |
| 308 | Nodule | FAERS: 5 | US FAERS | |
| 309 | Optic Atrophy | FAERS: 5 | US FAERS | |
| 310 | Oral fungal infection | FAERS: 5 | US FAERS | |
| 311 | Oral mucosal eruption | FAERS: 5 | US FAERS | |
| 312 | Peptic Ulcer | FAERS: 5 | US FAERS | |
| 313 | Pericarditis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Photophobia | FAERS: 5 | US FAERS | |
| 315 | Psoriasis | FAERS: 5 | US FAERS | |
| 316 | Restlessness | FAERS: 5 | US FAERS | |
| 317 | Rhinalgia | FAERS: 5 | US FAERS | |
| 318 | Skin Wrinkling | FAERS: 5 | US FAERS | |
| 319 | Tongue discomfort | FAERS: 5 | US FAERS | |
| 320 | Trichomegaly | FAERS: 5 | US FAERS | |
| 321 | VIIth nerve paralysis | FAERS: 5 | US FAERS | |
| 322 | Abdominal adhesions | FAERS: 4 | OFFSIDES US FAERS | |
| 323 | Agitation | FAERS: 4 | US FAERS | |
| 324 | Anaphylactoid Reaction | FAERS: 4 | US FAERS | |
| 325 | Arthropathy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 326 | Asphyxia | FAERS: 4 | US FAERS | |
| 327 | Bilirubin conjugated increased | FAERS: 4 | OFFSIDES US FAERS | |
| 328 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 329 | Bone lesion | FAERS: 4 | US FAERS | |
| 330 | Cardiac Tamponade | FAERS: 4 | OFFSIDES US FAERS | |
| 331 | Cataract operation | FAERS: 4 | US FAERS | |
| 332 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 333 | Cyanosis | FAERS: 4 | US FAERS | |
| 334 | Delirium | FAERS: 4 | US FAERS | |
| 335 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 336 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 337 | Eyelid irritation | FAERS: 4 | US FAERS | |
| 338 | Gastrointestinal obstruction | FAERS: 4 | OFFSIDES US FAERS | |
| 339 | Gingival Recession | FAERS: 4 | US FAERS | |
| 340 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 341 | Incoherent | FAERS: 4 | US FAERS | |
| 342 | Increased upper airway secretion | FAERS: 4 | OFFSIDES US FAERS | |
| 343 | Large intestine perforation | FAERS: 4 | US FAERS | |
| 344 | Limb discomfort | FAERS: 4 | US FAERS | |
| 345 | Lymphangiosis carcinomatosa | FAERS: 4 | OFFSIDES US FAERS | |
| 346 | Measles | FAERS: 4 | US FAERS | |
| 347 | Mood swings | FAERS: 4 | US FAERS | |
| 348 | Mouth swelling | FAERS: 4 | US FAERS | |
| 349 | Necrosis | FAERS: 4 | US FAERS | |
| 350 | Ocular Toxicity | FAERS: 4 | OFFSIDES US FAERS | |
| 351 | Paraplegia | FAERS: 4 | US FAERS | |
| 352 | Peripheral embolism | FAERS: 4 | OFFSIDES US FAERS | |
| 353 | Peritonitis | FAERS: 4 | US FAERS | |
| 354 | Pharyngolaryngeal Pain | FAERS: 4 | US FAERS | |
| 355 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 356 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 357 | Pulmonary pain | FAERS: 4 | US FAERS | |
| 358 | Radiation skin injury | FAERS: 4 | US FAERS | |
| 359 | Regurgitation | FAERS: 4 | US FAERS | |
| 360 | Retinitis | FAERS: 4 | OFFSIDES US FAERS | |
| 361 | Sneezing | FAERS: 4 | US FAERS | |
| 362 | Sudden Cardiac Death | FAERS: 4 | OFFSIDES US FAERS | |
| 363 | Suicide attempt | FAERS: 4 | US FAERS | |
| 364 | Temperature intolerance | FAERS: 4 | US FAERS | |
| 365 | Therapy change | FAERS: 4 | US FAERS | |
| 366 | Tongue eruption | FAERS: 4 | US FAERS | |
| 367 | Trismus | FAERS: 4 | US FAERS | |
| 368 | Tuberculosis | FAERS: 4 | US FAERS | |
| 369 | Upper-airway cough syndrome | FAERS: 4 | US FAERS | |
| 370 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 371 | Urinary Retention | FAERS: 4 | US FAERS | |
| 372 | Vulvovaginal dryness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 373 | Abdominal mass | FAERS: 3 | US FAERS | |
| 374 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 375 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 376 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 377 | Aneurysm | FAERS: 3 | US FAERS | |
| 378 | Anger | FAERS: 3 | US FAERS | |
| 379 | Angioedema | FAERS: 3 | US FAERS | |
| 380 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 381 | Apathy | FAERS: 3 | US FAERS | |
| 382 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 383 | Bronchiectasis | FAERS: 3 | US FAERS | |
| 384 | Candidiasis | FAERS: 3 | US FAERS | |
| 385 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 386 | Cardiomegaly | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 387 | Central nervous system lesion | FAERS: 3 | OFFSIDES US FAERS | |
| 388 | Cerebral atrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 389 | Cholangitis | FAERS: 3 | US FAERS | |
| 390 | Conjunctival ulcer | FAERS: 3 | OFFSIDES US FAERS | |
| 391 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 392 | Craniotomy | FAERS: 3 | US FAERS | |
| 393 | Cyst drainage | FAERS: 3 | US FAERS | |
| 394 | Dacryostenosis acquired | FAERS: 3 | US FAERS | |
| 395 | Deafness Neurosensory | FAERS: 3 | US FAERS | |
| 396 | Depressed mood | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 397 | Device related infection | FAERS: 3 | OFFSIDES US FAERS | |
| 398 | Disease complication | FAERS: 3 | US FAERS | |
| 399 | Disease recurrence | FAERS: 3 | US FAERS | |
| 400 | Drug administration error | FAERS: 3 | US FAERS | |
| 401 | Ejection Fraction Decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 402 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 403 | Encephalitis | FAERS: 3 | US FAERS | |
| 404 | Enteritis | FAERS: 3 | OFFSIDES US FAERS | |
| 405 | Eosinophilia | FAERS: 3 | US FAERS | |
| 406 | Eyelid pain | FAERS: 3 | US FAERS | |
| 407 | Facial Paresis | FAERS: 3 | US FAERS | |
| 408 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 409 | Gastrointestinal ulcer | FAERS: 3 | US FAERS | |
| 410 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 411 | Hemiplegia | FAERS: 3 | US FAERS | |
| 412 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 413 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 414 | Hernia | FAERS: 3 | US FAERS | |
| 415 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 416 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 417 | Intercepted product storage error | FAERS: 3 | US FAERS | |
| 418 | Iritis | FAERS: 3 | OFFSIDES US FAERS | |
| 419 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 420 | Limb injury | FAERS: 3 | US FAERS | |
| 421 | Limb mass | FAERS: 3 | US FAERS | |
| 422 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 423 | Lung consolidation | FAERS: 3 | US FAERS | |
| 424 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 425 | Lymphoma | FAERS: 3 | US FAERS | |
| 426 | Macular degeneration | FAERS: 3 | US FAERS | |
| 427 | Malignant ascites | FAERS: 3 | US FAERS | |
| 428 | Mechanical ventilation | FAERS: 3 | US FAERS | |
| 429 | Meningitis | FAERS: 3 | US FAERS | |
| 430 | Myopathy | FAERS: 3 | US FAERS | |
| 431 | Nail bed infection | FAERS: 3 | OFFSIDES US FAERS | |
| 432 | Nail bed tenderness | FAERS: 3 | OFFSIDES US FAERS | |
| 433 | Nasal pruritus | FAERS: 3 | US FAERS | |
| 434 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 435 | Neuralgia | FAERS: 3 | US FAERS | |
| 436 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 437 | Osteolysis | FAERS: 3 | US FAERS | |
| 438 | Osteoporosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 439 | Pemphigus | FAERS: 3 | US FAERS | |
| 440 | Poor quality product administered | FAERS: 3 | US FAERS | |
| 441 | Procedural complication | FAERS: 3 | US FAERS | |
| 442 | Product label issue | FAERS: 3 | US FAERS | |
| 443 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 444 | Radiation injury | FAERS: 3 | US FAERS | |
| 445 | Rehabilitation therapy | FAERS: 3 | US FAERS | |
| 446 | Renal pain | FAERS: 3 | US FAERS | |
| 447 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 448 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 449 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 450 | Secretion discharge | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 451 | Shock | FAERS: 3 | US FAERS | |
| 452 | Sinus Tachycardia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 453 | Skin Erosion | FAERS: 3 | OFFSIDES US FAERS | |
| 454 | Skin tightness | FAERS: 3 | US FAERS | |
| 455 | Suspected counterfeit product | FAERS: 3 | US FAERS | |
| 456 | Tongue blistering | FAERS: 3 | US FAERS | |
| 457 | Tooth Loss | FAERS: 3 | US FAERS | |
| 458 | Toothache | FAERS: 3 | US FAERS | |
| 459 | Tumour haemorrhage | FAERS: 3 | US FAERS | |
| 460 | Venous Thrombosis | FAERS: 3 | US FAERS | |
| 461 | Vulvovaginal burning sensation | FAERS: 3 | US FAERS | |
| 462 | Vulvovaginal pain | FAERS: 3 | US FAERS | |
| 463 | Xeroderma | FAERS: 3 | US FAERS | |
| 464 | Acidosis | FAERS: 2 | US FAERS | |
| 465 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 466 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 467 | Agraphia | FAERS: 2 | OFFSIDES US FAERS | |
| 468 | Anal Fissure | FAERS: 2 | US FAERS | |
| 469 | Androgenetic Alopecia | FAERS: 2 | OFFSIDES US FAERS | |
| 470 | Anosmia | FAERS: 2 | US FAERS | |
| 471 | Anuria | FAERS: 2 | US FAERS | |
| 472 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 473 | Ataxia | FAERS: 2 | US FAERS | |
| 474 | Biliary dilatation | FAERS: 2 | OFFSIDES US FAERS | |
| 475 | Blood creatine decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 476 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 477 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 478 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 479 | Cancer Pain | FAERS: 2 | US FAERS | |
| 480 | Carcinoma in situ of skin | FAERS: 2 | US FAERS | |
| 481 | Catheter related complication | FAERS: 2 | US FAERS | |
| 482 | Caustic injury | FAERS: 2 | OFFSIDES US FAERS | |
| 483 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 484 | Cerebral calcification | FAERS: 2 | US FAERS | |
| 485 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 486 | Choking | FAERS: 2 | US FAERS | |
| 487 | Compression fracture | FAERS: 2 | OFFSIDES US FAERS | |
| 488 | Corneal dystrophy | FAERS: 2 | US FAERS | |
| 489 | Corneal thinning | FAERS: 2 | US FAERS | |
| 490 | Crying | FAERS: 2 | US FAERS | |
| 491 | Culture positive | FAERS: 2 | US FAERS | |
| 492 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 493 | Cytopenia | FAERS: 2 | US FAERS | |
| 494 | Dental caries | FAERS: 2 | US FAERS | |
| 495 | Deposit eye | FAERS: 2 | US FAERS | |
| 496 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 497 | Diet refusal | FAERS: 2 | US FAERS | |
| 498 | Diffuse alveolar damage | FAERS: 2 | US FAERS | |
| 499 | Diplegia | FAERS: 2 | US FAERS | |
| 500 | Drug abuse | FAERS: 2 | US FAERS | |
| 501 | Duodenal Obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 502 | Duodenal perforation | FAERS: 2 | US FAERS | |
| 503 | Dyspnoea exacerbated | FAERS: 2 | OFFSIDES US FAERS | |
| 504 | Embolic stroke | FAERS: 2 | OFFSIDES US FAERS | |
| 505 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 506 | Erysipelas | FAERS: 2 | US FAERS | |
| 507 | Excoriation | FAERS: 2 | US FAERS | |
| 508 | Exposure via direct contact | FAERS: 2 | US FAERS | |
| 509 | Eye ulcer | FAERS: 2 | US FAERS | |
| 510 | Eyelash hyperpigmentation | FAERS: 2 | US FAERS | |
| 511 | Eyelid Function Disorder | FAERS: 2 | US FAERS | |
| 512 | Eyelid skin dryness | FAERS: 2 | US FAERS | |
| 513 | Fasciitis | FAERS: 2 | US FAERS | |
| 514 | Feeling jittery | FAERS: 2 | US FAERS | |
| 515 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 516 | Genital rash | FAERS: 2 | US FAERS | |
| 517 | Granuloma | FAERS: 2 | US FAERS | |
| 518 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 519 | Haematotoxicity | FAERS: 2 | US FAERS | |
| 520 | Head discomfort | FAERS: 2 | US FAERS | |
| 521 | Hepatitis B | FAERS: 2 | US FAERS | |
| 522 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 523 | Hordeolum | FAERS: 2 | US FAERS | |
| 524 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 525 | Hydropneumothorax | FAERS: 2 | US FAERS | |
| 526 | Hypergeusia | FAERS: 2 | US FAERS | |
| 527 | Hypertrichosis | FAERS: 2 | OFFSIDES US FAERS | |
| 528 | Hypohidrosis | FAERS: 2 | US FAERS | |
| 529 | Hypokinesia | FAERS: 2 | OFFSIDES US FAERS | |
| 530 | Immobile | FAERS: 2 | US FAERS | |
| 531 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 532 | Impetigo | FAERS: 2 | US FAERS | |
| 533 | Infarction | FAERS: 2 | US FAERS | |
| 534 | Infected cyst | FAERS: 2 | US FAERS | |
| 535 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 536 | Insulin Resistance | FAERS: 2 | OFFSIDES US FAERS | |
| 537 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 538 | Joint injury | FAERS: 2 | US FAERS | |
| 539 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 540 | Klebsiella sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 541 | Leukodystrophy | FAERS: 2 | OFFSIDES US FAERS | |
| 542 | Lichen Planus | FAERS: 2 | US FAERS | |
| 543 | Lumbar radiculopathy | FAERS: 2 | US FAERS | |
| 544 | Lung cyst | FAERS: 2 | US FAERS | |
| 545 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 546 | Lymphangitis | FAERS: 2 | US FAERS | |
| 547 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 548 | Macule | FAERS: 2 | US FAERS | |
| 549 | Malignant melanoma in situ | FAERS: 2 | US FAERS | |
| 550 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 551 | Meningeal disorder | FAERS: 2 | US FAERS | |
| 552 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 553 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 554 | Metastases to abdominal cavity | FAERS: 2 | US FAERS | |
| 555 | Metastases to adrenals | FAERS: 2 | US FAERS | |
| 556 | Monoparesis | FAERS: 2 | US FAERS | |
| 557 | Monoplegia | FAERS: 2 | US FAERS | |
| 558 | Mucocutaneous rash | FAERS: 2 | US FAERS | |
| 559 | Nail bed disorder | FAERS: 2 | US FAERS | |
| 560 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 561 | Nephrectomy | FAERS: 2 | US FAERS | |
| 562 | Nocturia | FAERS: 2 | US FAERS | |
| 563 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 564 | Nutritional condition abnormal | FAERS: 2 | US FAERS | |
| 565 | Obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 566 | Occult blood positive | FAERS: 2 | US FAERS | |
| 567 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 568 | Osteonecrosis of Jaw | FAERS: 2 | US FAERS | |
| 569 | Osteoradionecrosis | FAERS: 2 | US FAERS | |
| 570 | Otitis Externa | FAERS: 2 | US FAERS | |
| 571 | Ototoxicity | FAERS: 2 | US FAERS | |
| 572 | Oxygen supplementation | FAERS: 2 | US FAERS | |
| 573 | PCO2 decreased | FAERS: 2 | US FAERS | |
| 574 | Palmar erythema | FAERS: 2 | US FAERS | |
| 575 | Pathological fracture | FAERS: 2 | US FAERS | |
| 576 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 577 | Pituitary cyst | FAERS: 2 | US FAERS | |
| 578 | Pleural Infection | FAERS: 2 | US FAERS | |
| 579 | Pneumocystis jiroveci pneumonia | FAERS: 2 | OFFSIDES US FAERS | |
| 580 | Pneumoperitoneum | FAERS: 2 | US FAERS | |
| 581 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 582 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 583 | Positron emission tomogram abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 584 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 585 | Pregnancy | FAERS: 2 | US FAERS | |
| 586 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 587 | Product commingling | FAERS: 2 | US FAERS | |
| 588 | Product dispensing error | FAERS: 2 | US FAERS | |
| 589 | Product physical issue | FAERS: 2 | US FAERS | |
| 590 | Product size issue | FAERS: 2 | US FAERS | |
| 591 | Protein total decreased | FAERS: 2 | US FAERS | |
| 592 | Psychotic disorder due to a general medical condition | FAERS: 2 | OFFSIDES US FAERS | |
| 593 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 594 | Pulmonary congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 595 | Purulent discharge | FAERS: 2 | US FAERS | |
| 596 | Radiation sickness syndrome | FAERS: 2 | US FAERS | |
| 597 | Rectal abscess | FAERS: 2 | US FAERS | |
| 598 | Renal Colic | FAERS: 2 | US FAERS | |
| 599 | Renal cyst | FAERS: 2 | US FAERS | |
| 600 | Rhinitis | FAERS: 2 | US FAERS | |
| 601 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 602 | Sciatica | FAERS: 2 | US FAERS | |
| 603 | Scleroderma | FAERS: 2 | US FAERS | |
| 604 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 605 | Skin necrosis | FAERS: 2 | US FAERS | |
| 606 | Sluggishness | FAERS: 2 | US FAERS | |
| 607 | Splenomegaly | FAERS: 2 | US FAERS | |
| 608 | Stridor | FAERS: 2 | US FAERS | |
| 609 | Stupor | FAERS: 2 | US FAERS | |
| 610 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 611 | Thirst decreased | FAERS: 2 | US FAERS | |
| 612 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 613 | Transaminases increased | FAERS: 2 | OFFSIDES US FAERS | |
| 614 | Troponin increased | FAERS: 2 | OFFSIDES US FAERS | |
| 615 | Underweight | FAERS: 2 | US FAERS | |
| 616 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 617 | Vaginal burning sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 618 | Vascular encephalopathy | FAERS: 2 | OFFSIDES US FAERS | |
| 619 | Vascular rupture | FAERS: 2 | US FAERS | |
| 620 | Vascular stenosis | FAERS: 2 | US FAERS | |
| 621 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 622 | Viral tracheitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 623 | Vitiligo | FAERS: 2 | US FAERS | |
| 624 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 625 | Wound Infection | FAERS: 2 | US FAERS | |
| 626 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 627 | X-ray abnormal | FAERS: 2 | US FAERS | |
| 628 | Xerophthalmia | FAERS: 2 | US FAERS | |
| 629 | kyphosis | FAERS: 2 | US FAERS | |
| 630 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 631 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 632 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 633 | Accidental exposure | FAERS: 1 | US FAERS | |
| 634 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 635 | Acquired gene mutation | FAERS: 1 | US FAERS | |
| 636 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 637 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 638 | Adrenal mass | FAERS: 1 | US FAERS | |
| 639 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 640 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 641 | Alveolitis | FAERS: 1 | US FAERS | |
| 642 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 643 | Ammonia increased | FAERS: 1 | US FAERS | |
| 644 | Amputation stump pain | FAERS: 1 | US FAERS | |
| 645 | Anal Fistula | FAERS: 1 | US FAERS | |
| 646 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 647 | Angina Pectoris | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 648 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 649 | Anhidrosis | FAERS: 1 | US FAERS | |
| 650 | Anisocytosis | FAERS: 1 | US FAERS | |
| 651 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 652 | Anti-HBc IgG antibody positive | FAERS: 1 | US FAERS | |
| 653 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 654 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 655 | Aortic Injury | FAERS: 1 | US FAERS | |
| 656 | Apparent death | FAERS: 1 | US FAERS | |
| 657 | Appendicitis noninfective | FAERS: 1 | US FAERS | |
| 658 | Appendicitis | FAERS: 1 | US FAERS | |
| 659 | Arthropod sting | FAERS: 1 | US FAERS | |
| 660 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 661 | Aspergillosis | FAERS: 1 | US FAERS | |
| 662 | Asthenopia | FAERS: 1 | US FAERS | |
| 663 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 664 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 665 | Auricular swelling | FAERS: 1 | US FAERS | |
| 666 | Balanitis | FAERS: 1 | OFFSIDES US FAERS | |
| 667 | Bedridden | FAERS: 1 | US FAERS | |
| 668 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 669 | Benign bone neoplasm | FAERS: 1 | US FAERS | |
| 670 | Bile output decreased | FAERS: 1 | US FAERS | |
| 671 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 672 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 673 | Blister rupture | FAERS: 1 | US FAERS | |
| 674 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 675 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 676 | Blood bilirubin unconjugated increased | FAERS: 1 | OFFSIDES US FAERS | |
| 677 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 678 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 679 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 680 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 681 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 682 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 683 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 684 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 685 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 686 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 687 | Blood lactate dehydrogenase | FAERS: 1 | US FAERS | |
| 688 | Blood lactate dehydrogenase decreased | FAERS: 1 | US FAERS | |
| 689 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 690 | Blood pH increased | FAERS: 1 | US FAERS | |
| 691 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 692 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 693 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 694 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 695 | Blood urea abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 696 | Bradycardia | FAERS: 1 | US FAERS | |
| 697 | Brain Death | FAERS: 1 | US FAERS | |
| 698 | Breast discomfort | FAERS: 1 | US FAERS | |
| 699 | Breast tenderness | FAERS: 1 | US FAERS | |
| 700 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 701 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 702 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 703 | Bursitis | FAERS: 1 | US FAERS | |
| 704 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 705 | Candida sepsis | FAERS: 1 | US FAERS | |
| 706 | Carcinoembryonic antigen decreased | FAERS: 1 | US FAERS | |
| 707 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 708 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 709 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 710 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 711 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 712 | Carotid Endarterectomy | FAERS: 1 | US FAERS | |
| 713 | Carotid aneurysm rupture | FAERS: 1 | US FAERS | |
| 714 | Catatonia | FAERS: 1 | US FAERS | |
| 715 | Catheter related infection | FAERS: 1 | US FAERS | |
| 716 | Catheter site pain | FAERS: 1 | US FAERS | |
| 717 | Cell Death | FAERS: 1 | US FAERS | |
| 718 | Cheilosis | FAERS: 1 | US FAERS | |
| 719 | Cholelithiasis obstructive | FAERS: 1 | US FAERS | |
| 720 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 721 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 722 | Clubbing | FAERS: 1 | US FAERS | |
| 723 | Cognitive deterioration | FAERS: 1 | US FAERS | |
| 724 | Cold sweat | FAERS: 1 | US FAERS | |
| 725 | Colectomy | FAERS: 1 | US FAERS | |
| 726 | Completed Suicide | FAERS: 1 | US FAERS | |
| 727 | Complication associated with device | FAERS: 1 | US FAERS | |
| 728 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 729 | Corneal Scar | FAERS: 1 | US FAERS | |
| 730 | Corneal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 731 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 732 | Corneal erosion | FAERS: 1 | US FAERS | |
| 733 | Corneal irritation | FAERS: 1 | US FAERS | |
| 734 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 735 | Creutzfeldt-Jakob disease | FAERS: 1 | US FAERS | |
| 736 | Cross Infection | FAERS: 1 | US FAERS | |
| 737 | Culture urine positive | FAERS: 1 | US FAERS | |
| 738 | Dactylitis | FAERS: 1 | US FAERS | |
| 739 | Device Failure | FAERS: 1 | US FAERS | |
| 740 | Device breakage | FAERS: 1 | US FAERS | |
| 741 | Device damage | FAERS: 1 | US FAERS | |
| 742 | Device occlusion | FAERS: 1 | US FAERS | |
| 743 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 744 | Difficult to wean from ventilator | FAERS: 1 | US FAERS | |
| 745 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 746 | Disability | FAERS: 1 | US FAERS | |
| 747 | Diverticulum | FAERS: 1 | OFFSIDES US FAERS | |
| 748 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 749 | Drug effect variable | FAERS: 1 | US FAERS | |
| 750 | Drug level increased | FAERS: 1 | US FAERS | |
| 751 | Drug therapy changed | FAERS: 1 | OFFSIDES US FAERS | |
| 752 | Drug toxicity prophylaxis | FAERS: 1 | US FAERS | |
| 753 | Dumping Syndrome | FAERS: 1 | US FAERS | |
| 754 | Dysentery | FAERS: 1 | US FAERS | |
| 755 | Dysphemia | FAERS: 1 | US FAERS | |
| 756 | Ear congestion | FAERS: 1 | US FAERS | |
| 757 | Early satiety | FAERS: 1 | US FAERS | |
| 758 | Ecchymosis | FAERS: 1 | US FAERS | |
| 759 | Economic problem | FAERS: 1 | OFFSIDES US FAERS | |
| 760 | Eczema Herpeticum | FAERS: 1 | US FAERS | |
| 761 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 762 | Emergency Care | FAERS: 1 | US FAERS | |
| 763 | Emotional distress | FAERS: 1 | US FAERS | |
| 764 | Empyema | FAERS: 1 | OFFSIDES US FAERS | |
| 765 | Endometriosis | FAERS: 1 | US FAERS | |
| 766 | Enterocolitis | FAERS: 1 | US FAERS | |
| 767 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 768 | Entropion | FAERS: 1 | US FAERS | |
| 769 | Enuresis | FAERS: 1 | US FAERS | |
| 770 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 771 | Epiglottic carcinoma | FAERS: 1 | US FAERS | |
| 772 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 773 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 774 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 775 | Eschar | FAERS: 1 | US FAERS | |
| 776 | Escherichia infection | FAERS: 1 | US FAERS | |
| 777 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 778 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 779 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 780 | Euthanasia | FAERS: 1 | US FAERS | |
| 781 | Expired drug administered | FAERS: 1 | US FAERS | |
| 782 | Exsanguination | FAERS: 1 | US FAERS | |
| 783 | External ear cellulitis | FAERS: 1 | US FAERS | |
| 784 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 785 | Eye Burns | FAERS: 1 | US FAERS | |
| 786 | Eyeball avulsion | FAERS: 1 | US FAERS | |
| 787 | Eyelash changes | FAERS: 1 | US FAERS | |
| 788 | Eyelid rash | FAERS: 1 | US FAERS | |
| 789 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 790 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 791 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 792 | Fibrosis | FAERS: 1 | US FAERS | |
| 793 | Fingerprint loss | FAERS: 1 | US FAERS | |
| 794 | Fluid overload | FAERS: 1 | US FAERS | |
| 795 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 796 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 797 | Gangrene | FAERS: 1 | US FAERS | |
| 798 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 799 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 800 | Gastric Stenosis | FAERS: 1 | US FAERS | |
| 801 | Gastric infection | FAERS: 1 | US FAERS | |
| 802 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 803 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 804 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 805 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 806 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 807 | Gastrointestinal sounds abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 808 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 809 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 810 | Gastrostomy | FAERS: 1 | US FAERS | |
| 811 | Gene Mutation | FAERS: 1 | US FAERS | |
| 812 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 813 | General symptom | FAERS: 1 | US FAERS | |
| 814 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 815 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 816 | Genital infection | FAERS: 1 | US FAERS | |
| 817 | Gingival blister | FAERS: 1 | US FAERS | |
| 818 | Gingivitis | FAERS: 1 | US FAERS | |
| 819 | Gram stain positive | FAERS: 1 | US FAERS | |
| 820 | Groin infection | FAERS: 1 | US FAERS | |
| 821 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 822 | Hair injury | FAERS: 1 | US FAERS | |
| 823 | Hepatic cancer metastatic | FAERS: 1 | OFFSIDES US FAERS | |
| 824 | Hyperacusis | FAERS: 1 | US FAERS | |
| 825 | Hypercapnia | FAERS: 1 | US FAERS | |
| 826 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 827 | Hyperkinetic Heart Syndrome | FAERS: 1 | US FAERS | |
| 828 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 829 | Hyperphagia | FAERS: 1 | US FAERS | |
| 830 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 831 | Hypertrophic osteoarthropathy | FAERS: 1 | US FAERS | |
| 832 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 833 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 834 | Impaired self-care | FAERS: 1 | US FAERS | |
| 835 | Incision site infection | FAERS: 1 | US FAERS | |
| 836 | Incision site pain | FAERS: 1 | US FAERS | |
| 837 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 838 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 839 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 840 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 841 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 842 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 843 | Infestation | FAERS: 1 | US FAERS | |
| 844 | Injection site pain | FAERS: 1 | US FAERS | |
| 845 | Intention tremor | FAERS: 1 | US FAERS | |
| 846 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 847 | Intertrigo | FAERS: 1 | US FAERS | |
| 848 | Intracranial meningioma malignant | FAERS: 1 | US FAERS | |
| 849 | Joint stiffness | FAERS: 1 | US FAERS | |
| 850 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 851 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 852 | Lentigo | FAERS: 1 | US FAERS | |
| 853 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 854 | Limbal stem cell deficiency | FAERS: 1 | US FAERS | |
| 855 | Lip erythema | FAERS: 1 | US FAERS | |
| 856 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 857 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 858 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 859 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 860 | Lymphostasis | FAERS: 1 | US FAERS | |
| 861 | Malabsorption | FAERS: 1 | US FAERS | |
| 862 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 863 | Mastectomy | FAERS: 1 | US FAERS | |
| 864 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 865 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 866 | Mediastinitis | FAERS: 1 | OFFSIDES US FAERS | |
| 867 | Megacolon | FAERS: 1 | US FAERS | |
| 868 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 869 | Mental impairment | FAERS: 1 | US FAERS | |
| 870 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 871 | Metastases to abdominal wall | FAERS: 1 | US FAERS | |
| 872 | Metastases to biliary tract | FAERS: 1 | US FAERS | |
| 873 | Metastases to diaphragm | FAERS: 1 | US FAERS | |
| 874 | Metastases to gallbladder | FAERS: 1 | US FAERS | |
| 875 | Metastases to larynx | FAERS: 1 | US FAERS | |
| 876 | Metastases to mouth | FAERS: 1 | US FAERS | |
| 877 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 878 | Metastases to peripheral vascular system | FAERS: 1 | US FAERS | |
| 879 | Metastases to salivary gland | FAERS: 1 | US FAERS | |
| 880 | Metastatic Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 881 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 882 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 883 | Multimorbidity | FAERS: 1 | US FAERS | |
| 884 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 885 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 886 | Muscle strain | FAERS: 1 | OFFSIDES US FAERS | |
| 887 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 888 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 889 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 890 | Myositis | FAERS: 1 | US FAERS | |
| 891 | Nail cuticle fissure | FAERS: 1 | US FAERS | |
| 892 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 893 | Nail toxicity | FAERS: 1 | US FAERS | |
| 894 | Nerve injury | FAERS: 1 | US FAERS | |
| 895 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 896 | Nipple pain | FAERS: 1 | US FAERS | |
| 897 | Nodular rash | FAERS: 1 | US FAERS | |
| 898 | Non-small cell lung cancer recurrent | FAERS: 1 | US FAERS | |
| 899 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 900 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 901 | Ocular icterus | FAERS: 1 | US FAERS | |
| 902 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 903 | Oliguria | FAERS: 1 | US FAERS | |
| 904 | Oncologic complication | FAERS: 1 | US FAERS | |
| 905 | Onychomalacia | FAERS: 1 | US FAERS | |
| 906 | Oral infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 907 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 908 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 909 | Oropharyngitis fungal | FAERS: 1 | US FAERS | |
| 910 | Osteogenesis Imperfecta | FAERS: 1 | US FAERS | |
| 911 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 912 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 913 | PO2 decreased | FAERS: 1 | US FAERS | |
| 914 | Pallor | FAERS: 1 | US FAERS | |
| 915 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 916 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 917 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 918 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 919 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 920 | Panic Disorder | FAERS: 1 | US FAERS | |
| 921 | Panniculitis | FAERS: 1 | US FAERS | |
| 922 | Papule | FAERS: 1 | US FAERS | |
| 923 | Paraneoplastic neurological syndrome | FAERS: 1 | US FAERS | |
| 924 | Paresis | FAERS: 1 | US FAERS | |
| 925 | Paroxysmal arrhythmia | FAERS: 1 | OFFSIDES US FAERS | |
| 926 | Partial lung resection | FAERS: 1 | US FAERS | |
| 927 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 928 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 929 | Penile Infection | FAERS: 1 | US FAERS | |
| 930 | Periodontitis | FAERS: 1 | US FAERS | |
| 931 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 932 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 933 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 934 | Personality Change | FAERS: 1 | US FAERS | |
| 935 | Phlebitis | FAERS: 1 | US FAERS | |
| 936 | Physical disability | FAERS: 1 | US FAERS | |
| 937 | Pineal parenchymal neoplasm malignant | FAERS: 1 | US FAERS | |
| 938 | Pleurodesis | FAERS: 1 | US FAERS | |
| 939 | Poisoning | FAERS: 1 | US FAERS | |
| 940 | Polydipsia | FAERS: 1 | US FAERS | |
| 941 | Polyneuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 942 | Polyuria | FAERS: 1 | US FAERS | |
| 943 | Poor dental condition | FAERS: 1 | US FAERS | |
| 944 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 945 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 946 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 947 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 948 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 949 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 950 | Presyncope | FAERS: 1 | US FAERS | |
| 951 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 952 | Product administration error | FAERS: 1 | US FAERS | |
| 953 | Product container issue | FAERS: 1 | US FAERS | |
| 954 | Product counterfeit | FAERS: 1 | US FAERS | |
| 955 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 956 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 957 | Product supply issue | FAERS: 1 | US FAERS | |
| 958 | Product tampering | FAERS: 1 | US FAERS | |
| 959 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 960 | Proteinuria | FAERS: 1 | US FAERS | |
| 961 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 962 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 963 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 964 | Puncture site pain | FAERS: 1 | US FAERS | |
| 965 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 966 | Radiation Fibrosis | FAERS: 1 | US FAERS | |
| 967 | Radiation dysphagia | FAERS: 1 | US FAERS | |
| 968 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 969 | Radicular pain | FAERS: 1 | US FAERS | |
| 970 | Rash follicular | FAERS: 1 | US FAERS | |
| 971 | Reactive perforating collagenosis | FAERS: 1 | US FAERS | |
| 972 | Rectal discharge | FAERS: 1 | US FAERS | |
| 973 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 974 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 975 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 976 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 977 | Retinal fibrosis | FAERS: 1 | US FAERS | |
| 978 | Retroperitoneal lymphadenopathy | FAERS: 1 | US FAERS | |
| 979 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 980 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 981 | Scotoma | FAERS: 1 | US FAERS | |
| 982 | Screaming | FAERS: 1 | US FAERS | |
| 983 | Sensorimotor disorder | FAERS: 1 | US FAERS | |
| 984 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 985 | Sinus headache | FAERS: 1 | OFFSIDES US FAERS | |
| 986 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 987 | Skin discomfort | FAERS: 1 | US FAERS | |
| 988 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 989 | Skin laceration | FAERS: 1 | US FAERS | |
| 990 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 991 | Sopor | FAERS: 1 | US FAERS | |
| 992 | Spirometry abnormal | FAERS: 1 | US FAERS | |
| 993 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 994 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 995 | Staphylococcal blepharitis | FAERS: 1 | US FAERS | |
| 996 | Strabismus | FAERS: 1 | US FAERS | |
| 997 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 998 | Subileus | FAERS: 1 | US FAERS | |
| 999 | Superinfection | FAERS: 1 | US FAERS | |
| 1000 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 1001 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 1002 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 1003 | Therapy responder | FAERS: 1 | US FAERS | |
| 1004 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1005 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1006 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 1007 | Tinea cruris | FAERS: 1 | US FAERS | |
| 1008 | Tongue erythema | FAERS: 1 | US FAERS | |
| 1009 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 1010 | Tonsillitis | FAERS: 1 | US FAERS | |
| 1011 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 1012 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1013 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 1014 | Troponin I increased | FAERS: 1 | US FAERS | |
| 1015 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1016 | Umbilical hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 1017 | Urine sodium decreased | FAERS: 1 | US FAERS | |
| 1018 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1019 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 1020 | Vascular fragility | FAERS: 1 | US FAERS | |
| 1021 | Vascular purpura | FAERS: 1 | US FAERS | |
| 1022 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 1023 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1024 | Viral test positive | FAERS: 1 | US FAERS | |
| 1025 | Visual disturbance | FAERS: 1 | US FAERS | |
| 1026 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1027 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1028 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 1029 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1030 | Walking aid user | FAERS: 1 | US FAERS | |
| 1031 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1032 | White matter lesion | FAERS: 1 | US FAERS | |
| 1033 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 1034 | Wound infection bacterial | FAERS: 1 | US FAERS | |
| 1035 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 1036 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1037 | Xerosis | FAERS: 1 | US FAERS | |
| 1038 | Acneiform Eruptions | 21738965 | CTD | |
| 1039 | Alcoholic Intoxication | OFFSIDES | ||
| 1040 | Angiogram abnormal | OFFSIDES | ||
| 1041 | Anhedonia | OFFSIDES | ||
| 1042 | Anticonvulsant drug level increased | OFFSIDES | ||
| 1043 | Blood sodium | OFFSIDES | ||
| 1044 | Blurred vision | OFFSIDES | ||
| 1045 | Bowel movement irregularity | OFFSIDES | ||
| 1046 | Catheter site erythema | OFFSIDES | ||
| 1047 | Cell marker increased | OFFSIDES | ||
| 1048 | Chemical and Drug Induced Liver Injury | 22166485 | CTD | |
| 1049 | Choking sensation | OFFSIDES | ||
| 1050 | Colorectal Neoplasms | 17255274 | CTD | |
| 1051 | Congenital hypertrichosis | OFFSIDES | ||
| 1052 | Conjunctival deposit | OFFSIDES | ||
| 1053 | Corneal Ulcer | OFFSIDES | ||
| 1054 | Diarrhea | 21778302 24768708 | CTD OFFSIDES | |
| 1055 | Echocardiogram abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1056 | Edema | 24768708 | CTD | |
| 1057 | Encephalomalacia | OFFSIDES | ||
| 1058 | Exanthema | 21778302 27720938 | CTD | |
| 1059 | Fat necrosis | OFFSIDES | ||
| 1060 | Gastrointestinal Diseases | 24768708 | CTD | |
| 1061 | Glioma | 21346220 | CTD | |
| 1062 | Gliosis | OFFSIDES | ||
| 1063 | Granulocytosis | OFFSIDES | ||
| 1064 | Heart Diseases | 22166485 | CTD | |
| 1065 | Heart sounds abnormal | OFFSIDES | ||
| 1066 | Heat Exhaustion | OFFSIDES | ||
| 1067 | Hemothorax | OFFSIDES | ||
| 1068 | Hypogeusia | OFFSIDES | ||
| 1069 | Infective spondylitis | OFFSIDES | ||
| 1070 | Intraocular inflammation | OFFSIDES | ||
| 1071 | Loose tooth | OFFSIDES | ||
| 1072 | Lung Diseases, Interstitial | 20686337 | CTD | |
| 1073 | Lung Neoplasms | 21541241 22003817 23894143 | CTD | |
| 1074 | Lysosomal Storage Diseases | 28551711 | CTD | |
| 1075 | Mesothelioma | 21787763 | CTD | |
| 1076 | Neoplasms, Experimental | 21613822 27738319 | CTD | |
| 1077 | Neoplasms | 21738965 | CTD | |
| 1078 | Oculomucocutaneous syndrome | OFFSIDES | ||
| 1079 | Oral pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 1080 | Osteochondrosis | OFFSIDES | ||
| 1081 | Ovarian adhesion | OFFSIDES | ||
| 1082 | Pertussis | OFFSIDES | ||
| 1083 | Platelet count abnormal | OFFSIDES | ||
| 1084 | Pulmonary vasculitis | OFFSIDES | ||
| 1085 | Recurrence | 25605917 | CTD | |
| 1086 | Retroperitoneal fibrosis | OFFSIDES | ||
| 1087 | Rheumatoid factor increased | OFFSIDES | ||
| 1088 | Rhinorrhea | OFFSIDES | ||
| 1089 | Right Ventricular Dysfunction | OFFSIDES | ||
| 1090 | Risus sardonicus | OFFSIDES | ||
| 1091 | Sinus bradycardia | OFFSIDES | ||
| 1092 | Spinal haemangioma | OFFSIDES | ||
| 1093 | Sputum culture positive | OFFSIDES | ||
| 1094 | Temporal Arteritis | OFFSIDES | ||
| 1095 | Toxic Optic Neuropathy | OFFSIDES | ||
| 1096 | Urine leukocyte esterase | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.