Doxycycline
(SGKRLCUYIXIAHR-AKNGSSGZSA-N)
Structure
- SMILES
- CN([C@@H]1C(=O)C(=C([C@@]2([C@H]1[C@@H](O)[C@@H]1[C@@H](C)c3cccc(c3C(=C1C2=O)O)O)O)O)C(=O)N)C
- Type(s)
- Approved; Investigational; Vet_approved
- ATC code(s)
- A01AB22; J01AA02; J01AA20
- Molecular Formula:
- C22H24N2O8
- Molecular Weight:
- 444.435
- Log P:
- 0.1961
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 6
- TPSA:
- 181.62
- CAS Number(s):
- 564-25-0; 7164-70-7; 24390-14-5; 94088-85-4
Synonym(s)
1.
Doxycycline
2.
2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,5,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, (4S-(4alpha,4aalpha,5alpha,5aalpha,6alpha,12aalpha))-
3.
Alpha-6-Deoxyoxytetracycline
4.
Atridox
5.
BMY-28689
6.
BU-3839T
7.
Doryx
8.
Doxycycline Calcium
9.
Doxycycline Calcium Salt (1:2)
10.
Doxycycline Hemiethanolate
11.
Doxycycline Hyclate
12.
Doxycycline Monohydrate
13.
Doxycycline Monohydrochloride, 6-epimer
14.
Doxycycline Monohydrochloride, Dihydrate
15.
Doxycycline Phosphate (1:1)
16.
Doxycycline-Chinoin
17.
Hydramycin
18.
Oracea
19.
Periostat
20.
Vibra-Tabs
21.
Vibramycin
22.
Vibramycin Novum
23.
Vibravenos
24.
Alpha 6 Deoxyoxytetracycline
25.
BMY 28689
26.
BMY28689
27.
BU 3839T
28.
BU3839T
29.
Doxycycline Chinoin
30.
Doxycycline Monohydrochloride, 6 epimer
31.
Vibra Tabs
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 138 Canada Vigilance: 12 | 10534208 17103211 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Nausea | FAERS: 122 Canada Vigilance: 31 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 3 | Vomiting | FAERS: 88 Canada Vigilance: 29 | 10534208 12649241 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Malaise | FAERS: 80 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 5 | Drug ineffective | FAERS: 62 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 6 | Pruritus | FAERS: 58 Canada Vigilance: 9 | 138789 18332631 | CTD Canada Vigilance US FAERS |
| 7 | Abdominal discomfort | FAERS: 51 Canada Vigilance: 15 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Pain | FAERS: 51 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Anxiety | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Dizziness | FAERS: 47 Canada Vigilance: 7 | 17103211 21053638 | CTD OFFSIDES Canada Vigilance US FAERS |
| 11 | Hypersensitivity | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 12 | Fatigue | FAERS: 46 Canada Vigilance: 5 | 9004058 13130401 | CTD OFFSIDES Canada Vigilance US FAERS |
| 13 | Chest Pain | FAERS: 42 Canada Vigilance: 7 | 13130401 | CTD OFFSIDES Canada Vigilance US FAERS |
| 14 | Erythema | FAERS: 40 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Gastrointestinal mucosal necrosis | FAERS: 40 | US FAERS | |
| 16 | Pancreatitis | FAERS: 36 | OFFSIDES US FAERS | |
| 17 | Asthenia | FAERS: 34 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Abdominal Pain | FAERS: 33 Canada Vigilance: 6 | 10879639 13130401 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 19 | Urticaria | FAERS: 33 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 20 | Completed Suicide | FAERS: 32 | OFFSIDES US FAERS | |
| 21 | Tinnitus | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Arthralgia | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Myalgia | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Stevens-Johnson Syndrome | FAERS: 24 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 25 | Depressed mood | FAERS: 22 | OFFSIDES US FAERS | |
| 26 | Dyspepsia | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Back Pain | FAERS: 20 Canada Vigilance: 1 | 13130401 | CTD SIDER Canada Vigilance US FAERS |
| 28 | Palpitations | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Weight decreased | FAERS: 19 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 31 | Swelling | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Tremor | FAERS: 18 Canada Vigilance: 2 | 9004058 | CTD Canada Vigilance US FAERS |
| 33 | Visual Impairment | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Chest discomfort | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Product use issue | FAERS: 17 | US FAERS | |
| 36 | jaundice | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Acute kidney injury | FAERS: 15 | US FAERS | |
| 38 | Discomfort | FAERS: 15 | SIDER US FAERS | |
| 39 | Oropharyngeal pain | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 40 | Photophobia | FAERS: 15 | US FAERS | |
| 41 | treatment failure | FAERS: 15 | OFFSIDES US FAERS | |
| 42 | Hypotension | FAERS: 14 | SIDER US FAERS | |
| 43 | Medication Error | FAERS: 14 | US FAERS | |
| 44 | Tachycardia | FAERS: 14 | SIDER US FAERS | |
| 45 | Peripheral swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Rash erythematous | FAERS: 13 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 47 | Retinal exudates | FAERS: 13 | US FAERS | |
| 48 | Burning sensation | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 49 | Chills | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 50 | Dehydration | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 51 | Disease recurrence | FAERS: 12 | OFFSIDES US FAERS | |
| 52 | Gastric ulcer | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Toxic Epidermal Necrolysis | FAERS: 12 | SIDER US FAERS | |
| 54 | Alopecia | FAERS: 11 | OFFSIDES US FAERS | |
| 55 | Angioedema | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 56 | Blindness | FAERS: 11 | US FAERS | |
| 57 | Drug dispensing error | FAERS: 11 | OFFSIDES US FAERS | |
| 58 | Product use in unapproved indication | FAERS: 11 | US FAERS | |
| 59 | Syncope | FAERS: 11 Canada Vigilance: 3 | 9145823 | CTD Canada Vigilance US FAERS |
| 60 | Amnesia | FAERS: 10 | 17103211 | CTD OFFSIDES US FAERS |
| 61 | Diplopia | FAERS: 10 | US FAERS | |
| 62 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 63 | Hepatitis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 64 | Lip swelling | FAERS: 10 | US FAERS | |
| 65 | Alanine Aminotransferase Increased | FAERS: 9 | US FAERS | |
| 66 | Crystal nephropathy | FAERS: 9 | US FAERS | |
| 67 | Drug ineffective for unapproved indication | FAERS: 9 | US FAERS | |
| 68 | Epistaxis | FAERS: 9 | OFFSIDES US FAERS | |
| 69 | Hypereosinophilic syndrome | FAERS: 9 | US FAERS | |
| 70 | Musculoskeletal stiffness | FAERS: 9 | US FAERS | |
| 71 | Optic Atrophy | FAERS: 9 | 12649241 | CTD US FAERS |
| 72 | Unevaluable event | FAERS: 9 | US FAERS | |
| 73 | Cholestasis | FAERS: 8 | US FAERS | |
| 74 | Constipation | FAERS: 8 | US FAERS | |
| 75 | Disseminated Intravascular Coagulation | FAERS: 8 | US FAERS | |
| 76 | Dysuria | FAERS: 8 | OFFSIDES US FAERS | |
| 77 | Intentional product use issue | FAERS: 8 | US FAERS | |
| 78 | Lymphadenopathy | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Mood swings | FAERS: 8 | US FAERS | |
| 80 | Neck Pain | FAERS: 8 | SIDER US FAERS | |
| 81 | Onycholysis | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 82 | Pulmonary Fibrosis | FAERS: 8 | US FAERS | |
| 83 | Sunburn | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Throat irritation | FAERS: 8 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 85 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 86 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 87 | Dermatitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Dry skin | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 89 | Eosinophilic Pneumonia | FAERS: 7 | US FAERS | |
| 90 | Eye pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Hepatotoxicity | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 92 | Hyperthyroidism | FAERS: 7 | US FAERS | |
| 93 | Neutrophilic dermatosis | FAERS: 7 | US FAERS | |
| 94 | No adverse event | FAERS: 7 | US FAERS | |
| 95 | Pneumonia | FAERS: 7 | 9145823 | CTD US FAERS |
| 96 | Septic Shock | FAERS: 7 | OFFSIDES US FAERS | |
| 97 | Shock | FAERS: 7 | US FAERS | |
| 98 | Alcohol interaction | FAERS: 6 | US FAERS | |
| 99 | Anosmia | FAERS: 6 | OFFSIDES US FAERS | |
| 100 | Aspartate Aminotransferase Increased | FAERS: 6 | SIDER US FAERS | |
| 101 | Clostridium difficile colitis | FAERS: 6 | SIDER US FAERS | |
| 102 | Depressed Level of Consciousness | FAERS: 6 | SIDER US FAERS | |
| 103 | Dysarthria | FAERS: 6 | 9004058 | CTD US FAERS |
| 104 | Dysgeusia | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 105 | Eye irritation | FAERS: 6 | US FAERS | |
| 106 | Fixed eruption | FAERS: 6 | US FAERS | |
| 107 | Impaired work ability | FAERS: 6 | US FAERS | |
| 108 | Inflammation | FAERS: 6 | SIDER US FAERS | |
| 109 | Lethargy | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Lyme Disease | FAERS: 6 | 9332695 17103211 | CTD US FAERS |
| 111 | Memory impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Penile swelling | FAERS: 6 | US FAERS | |
| 113 | Pharmaceutical product complaint | FAERS: 6 | US FAERS | |
| 114 | Product storage error | FAERS: 6 | US FAERS | |
| 115 | Product substitution issue | FAERS: 6 | US FAERS | |
| 116 | Respiratory Failure | FAERS: 6 | OFFSIDES US FAERS | |
| 117 | Respiratory distress | FAERS: 6 | US FAERS | |
| 118 | Somnolence | FAERS: 6 | SIDER US FAERS | |
| 119 | Wheezing | FAERS: 6 | US FAERS | |
| 120 | Acne | FAERS: 5 | OFFSIDES US FAERS | |
| 121 | Alveolitis | FAERS: 5 | US FAERS | |
| 122 | Bronchitis | FAERS: 5 | 9004058 | CTD OFFSIDES SIDER US FAERS |
| 123 | Deafness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 124 | Eosinophilia | FAERS: 5 | 9145823 | CTD SIDER US FAERS |
| 125 | Erythema Multiforme | FAERS: 5 | SIDER US FAERS | |
| 126 | Fixed drug eruption | FAERS: 5 | US FAERS | |
| 127 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 128 | Incorrect drug administration duration | FAERS: 5 | US FAERS | |
| 129 | Kounis Syndrome | FAERS: 5 | US FAERS | |
| 130 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 131 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 132 | Pancytopenia | FAERS: 5 | US FAERS | |
| 133 | Pseudoporphyria | FAERS: 5 | US FAERS | |
| 134 | Renal tubular injury | FAERS: 5 | US FAERS | |
| 135 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 136 | Rosacea | FAERS: 5 | 19588640 20645521 21916272 | CTD US FAERS |
| 137 | Vertigo | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Activities of daily living impaired | FAERS: 4 | OFFSIDES US FAERS | |
| 139 | Anorexia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 140 | Asphyxia | FAERS: 4 | US FAERS | |
| 141 | Autoimmune hepatitis | FAERS: 4 | OFFSIDES US FAERS | |
| 142 | Cellulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 143 | Conjunctivitis | FAERS: 4 | SIDER US FAERS | |
| 144 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 145 | Disorientation | FAERS: 4 | US FAERS | |
| 146 | Dysphonia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 147 | Ear discomfort | FAERS: 4 | US FAERS | |
| 148 | Feeling jittery | FAERS: 4 | US FAERS | |
| 149 | Flushing | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 150 | Gastric mucosal lesion | FAERS: 4 | US FAERS | |
| 151 | General physical health deterioration | FAERS: 4 | OFFSIDES US FAERS | |
| 152 | Hepatic necrosis | FAERS: 4 | OFFSIDES US FAERS | |
| 153 | Hyperoxaluria | FAERS: 4 | US FAERS | |
| 154 | Joint swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 155 | Keratitis | FAERS: 4 | US FAERS | |
| 156 | Leukocytosis | FAERS: 4 | US FAERS | |
| 157 | Leukopenia | FAERS: 4 | 9145823 | CTD SIDER US FAERS |
| 158 | Lymphomatoid Papulosis | FAERS: 4 | US FAERS | |
| 159 | Mental status changes | FAERS: 4 | OFFSIDES US FAERS | |
| 160 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 161 | Nervousness | FAERS: 4 | US FAERS | |
| 162 | Onychalgia | FAERS: 4 | US FAERS | |
| 163 | Oral candidiasis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 164 | Pharyngolaryngeal Pain | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 165 | Product quality issue | FAERS: 4 | US FAERS | |
| 166 | Retching | FAERS: 4 | US FAERS | |
| 167 | Supraventricular tachycardia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Transaminases increased | FAERS: 4 | US FAERS | |
| 169 | Vasculitis | FAERS: 4 | US FAERS | |
| 170 | Vitamin K Deficiency | FAERS: 4 | US FAERS | |
| 171 | Abasia | FAERS: 3 | OFFSIDES US FAERS | |
| 172 | Abdominal tenderness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 173 | Abnormal sleep-related event | FAERS: 3 | US FAERS | |
| 174 | Ageusia | FAERS: 3 | SIDER US FAERS | |
| 175 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 176 | Aphagia | FAERS: 3 | OFFSIDES US FAERS | |
| 177 | Blood albumin decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 178 | Candidiasis | FAERS: 3 | 17103211 | CTD US FAERS |
| 179 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 180 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 181 | Cholestatic liver injury | FAERS: 3 | US FAERS | |
| 182 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 183 | Cold sweat | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Drooling | FAERS: 3 | US FAERS | |
| 185 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 186 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 187 | Dysbiosis | FAERS: 3 | US FAERS | |
| 188 | Ecchymosis | FAERS: 3 | US FAERS | |
| 189 | Excoriation | FAERS: 3 | OFFSIDES US FAERS | |
| 190 | Facial paralysis | FAERS: 3 | US FAERS | |
| 191 | Feeling Cold | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Feelings of worthlessness | FAERS: 3 | US FAERS | |
| 193 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 194 | Gastrointestinal Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 195 | Hyperacusis | FAERS: 3 | US FAERS | |
| 196 | Hyperventilation | FAERS: 3 | US FAERS | |
| 197 | Hypoxia | FAERS: 3 | OFFSIDES US FAERS | |
| 198 | Infection | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 199 | Lupus-like syndrome | FAERS: 3 | US FAERS | |
| 200 | Musculoskeletal Pain | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 201 | Neonatal disorder | FAERS: 3 | US FAERS | |
| 202 | No reaction on previous exposure to drug | FAERS: 3 | US FAERS | |
| 203 | Paranoia | FAERS: 3 | OFFSIDES US FAERS | |
| 204 | Plasmodium falciparum infection | FAERS: 3 | US FAERS | |
| 205 | Pneumonitis | FAERS: 3 | US FAERS | |
| 206 | Product label issue | FAERS: 3 | US FAERS | |
| 207 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 208 | Purpura | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 209 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 210 | Skin lesion | FAERS: 3 | US FAERS | |
| 211 | Splenic Infarction | FAERS: 3 | US FAERS | |
| 212 | Stomatitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 213 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 3 | US FAERS | |
| 214 | Tendon discomfort | FAERS: 3 | US FAERS | |
| 215 | Thrombocytopenia | FAERS: 3 | SIDER US FAERS | |
| 216 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 217 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 218 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 219 | Arthritis | FAERS: 2 | OFFSIDES US FAERS | |
| 220 | Arthropathy | FAERS: 2 | US FAERS | |
| 221 | Ascites | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Asthma | FAERS: 2 | US FAERS | |
| 223 | Autoimmune thrombocytopenia | FAERS: 2 | US FAERS | |
| 224 | Blood blister | FAERS: 2 | US FAERS | |
| 225 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 226 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 227 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 228 | Blood iron decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 229 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 230 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 231 | Blood urea increased | FAERS: 2 | SIDER US FAERS | |
| 232 | Blood urine present | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Bronchospasm | FAERS: 2 | SIDER US FAERS | |
| 234 | Choking | FAERS: 2 | US FAERS | |
| 235 | Chromatopsia | FAERS: 2 | US FAERS | |
| 236 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 237 | Colitis | FAERS: 2 | OFFSIDES US FAERS | |
| 238 | Conversion disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 239 | Crying | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Disease Progression | FAERS: 2 | US FAERS | |
| 241 | Documented hypersensitivity to administered drug | FAERS: 2 | US FAERS | |
| 242 | Drug dose omission | FAERS: 2 | US FAERS | |
| 243 | Drug level increased | FAERS: 2 | US FAERS | |
| 244 | Drug resistance | FAERS: 2 | US FAERS | |
| 245 | Ejection Fraction Decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 246 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 247 | Encephalitis | FAERS: 2 | US FAERS | |
| 248 | Eructation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 249 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 250 | Facial Pain | FAERS: 2 | US FAERS | |
| 251 | Feeling of body temperature change | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 252 | Fibrosis | FAERS: 2 | US FAERS | |
| 253 | Foreign body in respiratory tract | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 254 | Gastritis | FAERS: 2 | US FAERS | |
| 255 | Gastrointestinal ulcer | FAERS: 2 | OFFSIDES US FAERS | |
| 256 | Gingival erythema | FAERS: 2 | OFFSIDES US FAERS | |
| 257 | Gout | FAERS: 2 | US FAERS | |
| 258 | Granuloma | FAERS: 2 | OFFSIDES US FAERS | |
| 259 | Head discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Hepatomegaly | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Hunger | FAERS: 2 | US FAERS | |
| 262 | Hypophagia | FAERS: 2 | OFFSIDES US FAERS | |
| 263 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 264 | Lymphoma | FAERS: 2 | 20133848 | CTD US FAERS |
| 265 | Malaria | FAERS: 2 | 8619448 12649241 17826578 | CTD US FAERS |
| 266 | Middle insomnia | FAERS: 2 | US FAERS | |
| 267 | Mixed liver injury | FAERS: 2 | US FAERS | |
| 268 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 269 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 270 | Negative thoughts | FAERS: 2 | US FAERS | |
| 271 | Nephritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 272 | Nerve injury | FAERS: 2 | US FAERS | |
| 273 | Neutropenia | FAERS: 2 | 9145823 | CTD SIDER US FAERS |
| 274 | Night sweats | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Oral pain | FAERS: 2 | SIDER US FAERS | |
| 276 | Osteomyelitis | FAERS: 2 | OFFSIDES US FAERS | |
| 277 | Overdose | FAERS: 2 | US FAERS | |
| 278 | Papule | FAERS: 2 | US FAERS | |
| 279 | Pathogen resistance | FAERS: 2 | US FAERS | |
| 280 | Pericarditis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 281 | Petechiae | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Phonophobia | FAERS: 2 | US FAERS | |
| 283 | Physical product label issue | FAERS: 2 | US FAERS | |
| 284 | Polyuria | FAERS: 2 | OFFSIDES US FAERS | |
| 285 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 286 | Portal hypertensive gastropathy | FAERS: 2 | US FAERS | |
| 287 | Psoriasis | FAERS: 2 | US FAERS | |
| 288 | Pulmonary Eosinophilia | FAERS: 2 | US FAERS | |
| 289 | Pulmonary congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 290 | Q Fever | FAERS: 2 | US FAERS | |
| 291 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 292 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 293 | Scotoma | FAERS: 2 | US FAERS | |
| 294 | Sinusitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 295 | Symblepharon | FAERS: 2 | US FAERS | |
| 296 | Tachyphylaxis | FAERS: 2 | US FAERS | |
| 297 | Therapy non-responder | FAERS: 2 | OFFSIDES US FAERS | |
| 298 | Thermal burn | FAERS: 2 | US FAERS | |
| 299 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 300 | Tongue blistering | FAERS: 2 | US FAERS | |
| 301 | Toothache | FAERS: 2 | SIDER US FAERS | |
| 302 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 303 | Urinary Retention | FAERS: 2 | US FAERS | |
| 304 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 305 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 306 | furuncle | FAERS: 2 | OFFSIDES US FAERS | |
| 307 | nervous system disorder | FAERS: 2 | US FAERS | |
| 308 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 309 | Acrodermatitis | FAERS: 1 | US FAERS | |
| 310 | Adverse event | FAERS: 1 | US FAERS | |
| 311 | Agitation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 312 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 313 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 314 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 315 | Amaurosis | FAERS: 1 | US FAERS | |
| 316 | Amniotic membrane graft | FAERS: 1 | US FAERS | |
| 317 | Anger | FAERS: 1 | OFFSIDES US FAERS | |
| 318 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 1 | US FAERS | |
| 319 | Antibiotic level above therapeutic | FAERS: 1 | US FAERS | |
| 320 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 321 | Apathy | FAERS: 1 | OFFSIDES US FAERS | |
| 322 | Aphonia | FAERS: 1 | US FAERS | |
| 323 | Apparent death | FAERS: 1 | US FAERS | |
| 324 | Arthropod bite | FAERS: 1 | OFFSIDES US FAERS | |
| 325 | Asthenopia | FAERS: 1 | US FAERS | |
| 326 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 327 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 328 | Autophony | FAERS: 1 | US FAERS | |
| 329 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 330 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 331 | Balanitis | FAERS: 1 | US FAERS | |
| 332 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 333 | Bedridden | FAERS: 1 | OFFSIDES US FAERS | |
| 334 | Biopsy stomach abnormal | FAERS: 1 | US FAERS | |
| 335 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 336 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 337 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 338 | Blood osmolarity increased | FAERS: 1 | US FAERS | |
| 339 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 340 | Blood pH increased | FAERS: 1 | US FAERS | |
| 341 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 342 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 343 | Bone pain | FAERS: 1 | US FAERS | |
| 344 | Bowel movement irregularity | FAERS: 1 | OFFSIDES US FAERS | |
| 345 | Bradycardia | FAERS: 1 | US FAERS | |
| 346 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 347 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 348 | Cataract | FAERS: 1 | OFFSIDES US FAERS | |
| 349 | Catheter site erosion | FAERS: 1 | US FAERS | |
| 350 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 351 | Cervical polyp | FAERS: 1 | US FAERS | |
| 352 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 353 | Chromaturia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 354 | Coagulation factor V level decreased | FAERS: 1 | US FAERS | |
| 355 | Coagulation factor VII level decreased | FAERS: 1 | US FAERS | |
| 356 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 357 | Conjunctival ulcer | FAERS: 1 | US FAERS | |
| 358 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 359 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 360 | Corneal erosion | FAERS: 1 | US FAERS | |
| 361 | Cyanosis | FAERS: 1 | US FAERS | |
| 362 | Cytolytic hepatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 363 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 364 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 365 | Deformity | FAERS: 1 | US FAERS | |
| 366 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 367 | Device leakage | FAERS: 1 | US FAERS | |
| 368 | Dreamy state | FAERS: 1 | US FAERS | |
| 369 | Drug Dependence | FAERS: 1 | US FAERS | |
| 370 | Drug administration error | FAERS: 1 | US FAERS | |
| 371 | Drug dispensing issue | FAERS: 1 | US FAERS | |
| 372 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 373 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 374 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 375 | Eczema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 376 | Educational problem | FAERS: 1 | US FAERS | |
| 377 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 378 | Empyema | FAERS: 1 | US FAERS | |
| 379 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 380 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 381 | Epilepsy | FAERS: 1 | US FAERS | |
| 382 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 383 | Expired product administered | FAERS: 1 | US FAERS | |
| 384 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 385 | Extravasation | FAERS: 1 | US FAERS | |
| 386 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 387 | Facial Paresis | FAERS: 1 | US FAERS | |
| 388 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 389 | Flatulence | FAERS: 1 | US FAERS | |
| 390 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 391 | Food Allergy | FAERS: 1 | US FAERS | |
| 392 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 393 | Foreign body trauma | FAERS: 1 | OFFSIDES US FAERS | |
| 394 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 395 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 396 | Gastrooesophageal heterotopia | FAERS: 1 | US FAERS | |
| 397 | Genital infection | FAERS: 1 | US FAERS | |
| 398 | Genital pain | FAERS: 1 | US FAERS | |
| 399 | Genital swelling | FAERS: 1 | US FAERS | |
| 400 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 401 | Glossitis | FAERS: 1 | SIDER US FAERS | |
| 402 | Hepatitis B surface antibody positive | FAERS: 1 | US FAERS | |
| 403 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 404 | Hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 405 | Hostility | FAERS: 1 | US FAERS | |
| 406 | Hyperphagia | FAERS: 1 | US FAERS | |
| 407 | Hypersomnia | FAERS: 1 | US FAERS | |
| 408 | Hypomania | FAERS: 1 | OFFSIDES US FAERS | |
| 409 | Idiopathic angioedema | FAERS: 1 | US FAERS | |
| 410 | Idiopathic urticaria | FAERS: 1 | US FAERS | |
| 411 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 412 | Impaired driving ability | FAERS: 1 | OFFSIDES US FAERS | |
| 413 | Impaired self-care | FAERS: 1 | US FAERS | |
| 414 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 415 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 416 | Influenza | FAERS: 1 | SIDER US FAERS | |
| 417 | Infusion site pain | FAERS: 1 | US FAERS | |
| 418 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 419 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 420 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 421 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 422 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 423 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 424 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 425 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 426 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 427 | Laceration | FAERS: 1 | US FAERS | |
| 428 | Late onset hypogonadism syndrome | FAERS: 1 | US FAERS | |
| 429 | Limb discomfort | FAERS: 1 | US FAERS | |
| 430 | Live Birth | FAERS: 1 | US FAERS | |
| 431 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 432 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 433 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 434 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 435 | Lymphopenia | FAERS: 1 | 9145823 | CTD US FAERS |
| 436 | Malnutrition | FAERS: 1 | US FAERS | |
| 437 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 438 | Medical device complication | FAERS: 1 | US FAERS | |
| 439 | Medication residue present | FAERS: 1 | US FAERS | |
| 440 | Medication tampering | FAERS: 1 | US FAERS | |
| 441 | Meniscus injury | FAERS: 1 | US FAERS | |
| 442 | Menorrhagia | FAERS: 1 | SIDER US FAERS | |
| 443 | Merycism | FAERS: 1 | US FAERS | |
| 444 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 445 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 446 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 447 | Monocyte percentage decreased | FAERS: 1 | US FAERS | |
| 448 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 449 | Monoplegia | FAERS: 1 | US FAERS | |
| 450 | Mouth swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 451 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 452 | Myoclonus | FAERS: 1 | US FAERS | |
| 453 | Myositis | FAERS: 1 | US FAERS | |
| 454 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 455 | Nail necrosis | FAERS: 1 | US FAERS | |
| 456 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 457 | Narcolepsy | FAERS: 1 | US FAERS | |
| 458 | Nephrolithiasis | FAERS: 1 | OFFSIDES US FAERS | |
| 459 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Neuropathy | FAERS: 1 | US FAERS | |
| 461 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 462 | Nodule | FAERS: 1 | US FAERS | |
| 463 | Non-cardiac chest pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 464 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 465 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 466 | Ocular icterus | FAERS: 1 | US FAERS | |
| 467 | Oculomucocutaneous syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 468 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 469 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 470 | Oral mucosal petechiae | FAERS: 1 | US FAERS | |
| 471 | PO2 increased | FAERS: 1 | US FAERS | |
| 472 | Pallor | FAERS: 1 | OFFSIDES US FAERS | |
| 473 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 474 | Paternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 475 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 476 | Penile erythema | FAERS: 1 | US FAERS | |
| 477 | Periarthritis | FAERS: 1 | US FAERS | |
| 478 | Photodermatosis | FAERS: 1 | US FAERS | |
| 479 | Plasmodium malariae infection | FAERS: 1 | US FAERS | |
| 480 | Poisoning | FAERS: 1 | US FAERS | |
| 481 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 482 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 483 | Post procedural complication | FAERS: 1 | US FAERS | |
| 484 | Pregnancy | FAERS: 1 | US FAERS | |
| 485 | Presyncope | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 486 | Procedural complication | FAERS: 1 | US FAERS | |
| 487 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 488 | Product contamination physical | FAERS: 1 | US FAERS | |
| 489 | Product deposit | FAERS: 1 | US FAERS | |
| 490 | Product dispensing error | FAERS: 1 | US FAERS | |
| 491 | Product dose omission | FAERS: 1 | US FAERS | |
| 492 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 493 | Product label confusion | FAERS: 1 | US FAERS | |
| 494 | Product lot number issue | FAERS: 1 | US FAERS | |
| 495 | Product packaging issue | FAERS: 1 | US FAERS | |
| 496 | Product prescribing error | FAERS: 1 | US FAERS | |
| 497 | Product residue present | FAERS: 1 | US FAERS | |
| 498 | Product selection error | FAERS: 1 | US FAERS | |
| 499 | Pulmonary function test decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 500 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 501 | Purulence | FAERS: 1 | OFFSIDES US FAERS | |
| 502 | Pyuria | FAERS: 1 | US FAERS | |
| 503 | Rales | FAERS: 1 | US FAERS | |
| 504 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 505 | Rebound effect | FAERS: 1 | US FAERS | |
| 506 | Regurgitation | FAERS: 1 | US FAERS | |
| 507 | Renal pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 508 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 509 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 510 | Restlessness | FAERS: 1 | US FAERS | |
| 511 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 512 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 513 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 514 | Scrub Typhus | FAERS: 1 | US FAERS | |
| 515 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 516 | Sepsis | FAERS: 1 | US FAERS | |
| 517 | Severe Acute Respiratory Syndrome | FAERS: 1 | US FAERS | |
| 518 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 519 | Single umbilical artery | FAERS: 1 | US FAERS | |
| 520 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 521 | Sinus headache | FAERS: 1 | SIDER US FAERS | |
| 522 | Skin irritation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 523 | Skin laceration | FAERS: 1 | OFFSIDES US FAERS | |
| 524 | Skin necrosis | FAERS: 1 | US FAERS | |
| 525 | Skin reaction | FAERS: 1 | US FAERS | |
| 526 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 527 | Sluggishness | FAERS: 1 | US FAERS | |
| 528 | Sneezing | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 529 | Solar urticaria | FAERS: 1 | US FAERS | |
| 530 | Splenomegaly | FAERS: 1 | US FAERS | |
| 531 | Staring | FAERS: 1 | US FAERS | |
| 532 | Starvation | FAERS: 1 | US FAERS | |
| 533 | Stress | FAERS: 1 | OFFSIDES US FAERS | |
| 534 | Stupor | FAERS: 1 | SIDER US FAERS | |
| 535 | Synovial Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 536 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 537 | Teeth brittle | FAERS: 1 | US FAERS | |
| 538 | Temperature intolerance | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 539 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 540 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 541 | Therapy cessation | FAERS: 1 | US FAERS | |
| 542 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 543 | Tooth Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 544 | Tooth Loss | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 545 | Tracheal Stenosis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 546 | Transcription medication error | FAERS: 1 | US FAERS | |
| 547 | Transferrin increased | FAERS: 1 | US FAERS | |
| 548 | Trismus | FAERS: 1 | US FAERS | |
| 549 | Ulcer | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 550 | Underweight | FAERS: 1 | US FAERS | |
| 551 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 552 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 553 | Urine output increased | FAERS: 1 | OFFSIDES US FAERS | |
| 554 | VIIth nerve paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 555 | Vaginal mycosis | FAERS: 1 | US FAERS | |
| 556 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 557 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 558 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 559 | Vulvovaginal mycotic infection | FAERS: 1 | SIDER US FAERS | |
| 560 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 561 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 562 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 563 | pseudomembranous colitis | FAERS: 1 | SIDER US FAERS | |
| 564 | Abdominal rigidity | Canada Vigilance: 1 | Canada Vigilance | |
| 565 | Abdominal strangulated hernia | OFFSIDES | ||
| 566 | Abnormal vision | OFFSIDES | ||
| 567 | Abscess management | OFFSIDES | ||
| 568 | Abscess | OFFSIDES SIDER | ||
| 569 | Abuse | OFFSIDES | ||
| 570 | Accidental overdose | OFFSIDES | ||
| 571 | Ache | SIDER | ||
| 572 | Acid indigestion | SIDER | ||
| 573 | Acid reflux | OFFSIDES | ||
| 574 | Acidosis | OFFSIDES | ||
| 575 | Acne Vulgaris | CTD | ||
| 576 | Acneiform Eruptions | 21738965 | CTD | |
| 577 | Actinomycosis | OFFSIDES | ||
| 578 | Acute Coronary Syndrome | OFFSIDES | ||
| 579 | Acute bronchitis | OFFSIDES | ||
| 580 | Acute myocardial infarction | OFFSIDES | ||
| 581 | Acute prerenal failure | OFFSIDES | ||
| 582 | Acute psychosis | OFFSIDES | ||
| 583 | Administration site infection | OFFSIDES | ||
| 584 | Agraphia | OFFSIDES | ||
| 585 | Alcohol consumption | OFFSIDES | ||
| 586 | Amenorrhea | OFFSIDES | ||
| 587 | Anaphylactic shock | SIDER | ||
| 588 | Aneurysm | 15741211 | CTD | |
| 589 | Angioplasty | OFFSIDES | ||
| 590 | Anhedonia | OFFSIDES | ||
| 591 | Anhidrosis | OFFSIDES | ||
| 592 | Animal bite | OFFSIDES | ||
| 593 | Ankle Fracture | OFFSIDES | ||
| 594 | Anoxic Encephalopathy | OFFSIDES | ||
| 595 | Anticonvulsant drug level decreased | OFFSIDES | ||
| 596 | Anuria | OFFSIDES | ||
| 597 | Anxiety Disorders | 13130401 | CTD | |
| 598 | Aortic Rupture | 18178469 | CTD | |
| 599 | Aphthous Stomatitis | SIDER | ||
| 600 | Apraxias | 9004058 | CTD | |
| 601 | Arteriosclerosis | OFFSIDES | ||
| 602 | Aspergillosis | OFFSIDES | ||
| 603 | Ataxia | OFFSIDES | ||
| 604 | Aura | OFFSIDES | ||
| 605 | Automatism | OFFSIDES | ||
| 606 | Back disorder | OFFSIDES | ||
| 607 | Bacterial Endocarditis | OFFSIDES | ||
| 608 | Band neutrophil count decreased | OFFSIDES | ||
| 609 | Basal cell carcinoma | OFFSIDES | ||
| 610 | Beta 2 microglobulin increased | OFFSIDES | ||
| 611 | Bicytopenia | OFFSIDES | ||
| 612 | Biliary Dyskinesia | OFFSIDES | ||
| 613 | Biliary Tract Diseases | 138789 | CTD | |
| 614 | Biopsy bone abnormal | OFFSIDES | ||
| 615 | Black hairy tongue | SIDER | ||
| 616 | Bladder cancer stage IV | OFFSIDES | ||
| 617 | Blepharitis | OFFSIDES | ||
| 618 | Blood Glucose | OFFSIDES | ||
| 619 | Blood amylase increased | OFFSIDES | ||
| 620 | Blood chloride decreased | OFFSIDES | ||
| 621 | Blood cholesterol | OFFSIDES | ||
| 622 | Blood cortisol abnormal | OFFSIDES | ||
| 623 | Blood creatine phosphokinase MB increased | OFFSIDES | ||
| 624 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 625 | Blood phosphorus increased | OFFSIDES | ||
| 626 | Blood potassium decreased | OFFSIDES | ||
| 627 | Blood pressure fluctuation | OFFSIDES | ||
| 628 | Blood prolactin increased | OFFSIDES | ||
| 629 | Blood sodium | OFFSIDES | ||
| 630 | Blurred vision | OFFSIDES | ||
| 631 | Bone density decreased | OFFSIDES | ||
| 632 | Bone erosion | OFFSIDES | ||
| 633 | Bone fragmentation | OFFSIDES | ||
| 634 | Bone lesion | OFFSIDES | ||
| 635 | Bone scan abnormal | OFFSIDES | ||
| 636 | Bone swelling | OFFSIDES | ||
| 637 | Brain Abscess | OFFSIDES | ||
| 638 | Brain natriuretic peptide increased | OFFSIDES | ||
| 639 | Breast Cyst | OFFSIDES | ||
| 640 | Bronchitis, Chronic | 38382 | CTD | |
| 641 | Bronchoscopy | OFFSIDES | ||
| 642 | Brucella serology positive | OFFSIDES | ||
| 643 | Brucellosis | OFFSIDES | ||
| 644 | Bruxism | OFFSIDES | ||
| 645 | Bulbar palsy | OFFSIDES | ||
| 646 | Bursitis | OFFSIDES | ||
| 647 | Candiduria | OFFSIDES | ||
| 648 | Cardiomegaly | 18089841 | CTD | |
| 649 | Cartilage atrophy | OFFSIDES | ||
| 650 | Cartilage injury | OFFSIDES | ||
| 651 | Cataract operation | OFFSIDES | ||
| 652 | Catatonia | OFFSIDES | ||
| 653 | Catheter placement | OFFSIDES | ||
| 654 | Catheter related complication | OFFSIDES | ||
| 655 | Catheter site infection | OFFSIDES | ||
| 656 | Cerebral artery stenosis | OFFSIDES | ||
| 657 | Cerebral atrophy | OFFSIDES | ||
| 658 | Cerebrosclerosis | OFFSIDES | ||
| 659 | Cervical dysplasia | OFFSIDES | ||
| 660 | Cervical myelopathy | OFFSIDES | ||
| 661 | Chemical and Drug Induced Liver Injury | 22331495 24865821 27765674 | CTD | |
| 662 | Chlamydia Infections | 10534208 | CTD | |
| 663 | Choking sensation | OFFSIDES | ||
| 664 | Cholangiolitis | OFFSIDES | ||
| 665 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 666 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 667 | Chronic sinusitis | OFFSIDES | ||
| 668 | Ciliophora Infections | 12113305 | CTD | |
| 669 | Clonus | OFFSIDES | ||
| 670 | Clostridium colitis | OFFSIDES | ||
| 671 | Clumsiness | OFFSIDES | ||
| 672 | Cocaine-Related Disorders | 19629758 | CTD | |
| 673 | Colon adenoma | OFFSIDES | ||
| 674 | Color blindness | OFFSIDES | ||
| 675 | Common Cold | SIDER | ||
| 676 | Community-Acquired Infections | 9145823 | CTD | |
| 677 | Compression fracture | OFFSIDES | ||
| 678 | Confabulation | OFFSIDES | ||
| 679 | Congenital pyelocaliectasis | OFFSIDES | ||
| 680 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 681 | Conjunctival abrasion | OFFSIDES | ||
| 682 | Cor pulmonale | OFFSIDES | ||
| 683 | Crystalluria | OFFSIDES | ||
| 684 | Cutaneous hypersensitivity | SIDER | ||
| 685 | Cyst | OFFSIDES | ||
| 686 | Cytomegalovirus antibody positive | OFFSIDES | ||
| 687 | Debridement | OFFSIDES | ||
| 688 | Decreased Libido | OFFSIDES | ||
| 689 | Demyelinating Diseases | 8902563 | CTD | |
| 690 | Demyelination | OFFSIDES | ||
| 691 | Dental Fistula | OFFSIDES | ||
| 692 | Dental abscess | OFFSIDES | ||
| 693 | Dental alveolar anomaly | OFFSIDES | ||
| 694 | Dental caries | OFFSIDES | ||
| 695 | Dental examination | OFFSIDES | ||
| 696 | Denture wearer | OFFSIDES | ||
| 697 | Dependence | OFFSIDES | ||
| 698 | Depressive disorder | 13130401 | CTD | |
| 699 | Diabetes | OFFSIDES | ||
| 700 | Diabetic Nephropathy | OFFSIDES | ||
| 701 | Diarrhea | 10879639 13130401 | CTD OFFSIDES | |
| 702 | Dirofilariasis | 18930598 25936435 | CTD | |
| 703 | Disorders of Excessive Somnolence | 30746 17103211 | CTD | |
| 704 | Diverticulosis | OFFSIDES | ||
| 705 | Diverticulum | OFFSIDES | ||
| 706 | Drowsiness | OFFSIDES | ||
| 707 | Drug Eruptions | 138789 | CTD | |
| 708 | Drug addict | OFFSIDES | ||
| 709 | Drug exposure before pregnancy | OFFSIDES | ||
| 710 | Drug screen positive | OFFSIDES | ||
| 711 | Drug toxicity | OFFSIDES | ||
| 712 | Drug withdrawal headache | OFFSIDES | ||
| 713 | Duodenitis | OFFSIDES | ||
| 714 | Dyscalculia | OFFSIDES | ||
| 715 | Dyschezia | OFFSIDES | ||
| 716 | Dysthymic Disorder | OFFSIDES | ||
| 717 | Ear congestion | OFFSIDES | ||
| 718 | Economic problem | OFFSIDES | ||
| 719 | Electrocardiogram change | OFFSIDES | ||
| 720 | Emotional disorder | OFFSIDES | ||
| 721 | Enterococcal infection | OFFSIDES | ||
| 722 | Enterocolitis | SIDER | ||
| 723 | Enuresis | OFFSIDES | ||
| 724 | Epstein-Barr virus antibody positive | OFFSIDES | ||
| 725 | Essential Hypertension | SIDER | ||
| 726 | Eustachian tube disorder | OFFSIDES | ||
| 727 | Exanthema | 6268571 | CTD | |
| 728 | Extremity necrosis | OFFSIDES | ||
| 729 | Eye inflammation | OFFSIDES | ||
| 730 | Failure to Thrive | OFFSIDES | ||
| 731 | Fanconi Syndrome | OFFSIDES | ||
| 732 | Fatty Liver | 24469900 | CTD OFFSIDES | |
| 733 | Fibroadenoma of breast | OFFSIDES | ||
| 734 | Fish Diseases | 12113305 | CTD | |
| 735 | Fistula discharge | OFFSIDES | ||
| 736 | Flight of ideas | OFFSIDES | ||
| 737 | Flu symptoms | SIDER | ||
| 738 | Fluid intake restriction | OFFSIDES | ||
| 739 | Focal glomerulosclerosis | OFFSIDES | ||
| 740 | Foreign body sensation in eyes | OFFSIDES | ||
| 741 | Formication | OFFSIDES | ||
| 742 | Gait Ataxia | 9004058 | CTD | |
| 743 | Gambling | OFFSIDES | ||
| 744 | Gastric Bypass | OFFSIDES | ||
| 745 | Gastric pH decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 746 | Gastrointestinal Diseases | 16291409 17103211 17826578 | CTD | |
| 747 | Gastrointestinal infection | OFFSIDES | ||
| 748 | Gingival graft | OFFSIDES | ||
| 749 | Gingivitis | SIDER | ||
| 750 | Glossitis, Benign Migratory | 10879639 | CTD | |
| 751 | Granulocytosis | OFFSIDES | ||
| 752 | Granulomatous liver disease | OFFSIDES | ||
| 753 | Haemophilus Infections | 30746 | CTD | |
| 754 | Hearing Loss | 7855666 | CTD | |
| 755 | Hemiplegia | OFFSIDES | ||
| 756 | Hepatitis B positive | OFFSIDES | ||
| 757 | Hiccough | OFFSIDES | ||
| 758 | Hordeolum | OFFSIDES | ||
| 759 | Hyperglycemia | 9145823 | CTD | |
| 760 | Hyperkeratosis | OFFSIDES | ||
| 761 | Hyperparathyroidism | OFFSIDES | ||
| 762 | Hyperpigmentation | OFFSIDES | ||
| 763 | Hyperpyrexia | Canada Vigilance: 1 | Canada Vigilance | |
| 764 | Hypesthesia | 11952888 | CTD | |
| 765 | Hypoaesthesia facial | OFFSIDES | ||
| 766 | Hyponatremia | 7635859 | CTD | |
| 767 | Hypophosphatemia | 3277077 | CTD | |
| 768 | Impetigo | OFFSIDES | ||
| 769 | Implant site induration | OFFSIDES | ||
| 770 | Incontinence | OFFSIDES | ||
| 771 | Increased bronchial secretion | OFFSIDES | ||
| 772 | Induration | OFFSIDES | ||
| 773 | Infectious Mononucleosis | OFFSIDES | ||
| 774 | Infusion site mobility decreased | OFFSIDES | ||
| 775 | Injection site dermatitis | OFFSIDES | ||
| 776 | Injection site pain | Canada Vigilance: 1 | Canada Vigilance | |
| 777 | Injection site phlebitis | OFFSIDES | ||
| 778 | Intention tremor | OFFSIDES | ||
| 779 | Intentional drug misuse | OFFSIDES | ||
| 780 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 781 | Intervertebral disc disorder | OFFSIDES | ||
| 782 | Intracranial Aneurysm | OFFSIDES | ||
| 783 | Intracranial Hypertension | 12649241 17103211 | CTD | |
| 784 | Joint injury | OFFSIDES | ||
| 785 | Joint sprain | OFFSIDES | ||
| 786 | Kidney Failure | OFFSIDES | ||
| 787 | Leishmaniasis | OFFSIDES | ||
| 788 | Leukoencephalopathy | OFFSIDES | ||
| 789 | Leukopenia neonatal | OFFSIDES | ||
| 790 | Life expectancy shortened | OFFSIDES | ||
| 791 | Limb operation | OFFSIDES | ||
| 792 | Lipase | OFFSIDES | ||
| 793 | Liver Failure, Acute | 19539102 | CTD | |
| 794 | Liver diseases | 13130401 | CTD | |
| 795 | Loose tooth | OFFSIDES | ||
| 796 | Low Back Pain | SIDER | ||
| 797 | Lymphocyte count decreased | OFFSIDES | ||
| 798 | Lymphocytic infiltration | OFFSIDES | ||
| 799 | Lymphocytosis | OFFSIDES | ||
| 800 | Macrocytosis | OFFSIDES | ||
| 801 | Marfan Syndrome | 18178469 | CTD | |
| 802 | Mastication disorder | OFFSIDES | ||
| 803 | Maxillofacial operation | OFFSIDES | ||
| 804 | Mechanical ventilation | OFFSIDES | ||
| 805 | Memory Disorders | 9004058 | CTD | |
| 806 | Meniscus removal | OFFSIDES | ||
| 807 | Mental impairment | OFFSIDES | ||
| 808 | Metaplasia | OFFSIDES | ||
| 809 | Metastases to thorax | OFFSIDES | ||
| 810 | Metastatic Neoplasm | OFFSIDES | ||
| 811 | Metastatic pain | OFFSIDES | ||
| 812 | Multiple Myeloma | OFFSIDES | ||
| 813 | Muscle Cramp | 11952888 | CTD | |
| 814 | Muscle Weakness | OFFSIDES | ||
| 815 | Muscle necrosis | OFFSIDES | ||
| 816 | Muscle tightness | OFFSIDES | ||
| 817 | Musculoskeletal chest pain | OFFSIDES | ||
| 818 | Musculoskeletal discomfort | SIDER | ||
| 819 | Myeloma recurrence | OFFSIDES | ||
| 820 | Nasal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 821 | Nasal mucosal disorder | OFFSIDES | ||
| 822 | Nerve Root Compression | OFFSIDES | ||
| 823 | Nervous tension | OFFSIDES | ||
| 824 | Neurodermatitis | OFFSIDES | ||
| 825 | Nodule on extremity | OFFSIDES | ||
| 826 | Olfaction Disorders | 2139490 14676161 | CTD | |
| 827 | Optic Disc Edema | OFFSIDES | ||
| 828 | Oral Cavity Fistula | OFFSIDES | ||
| 829 | Oral fungal infection | OFFSIDES | ||
| 830 | Oral infection | OFFSIDES | ||
| 831 | Oral mucosa atrophy | OFFSIDES | ||
| 832 | Oral mucosal exfoliation | OFFSIDES | ||
| 833 | Oral polypectomy | OFFSIDES | ||
| 834 | Orchitis | OFFSIDES | ||
| 835 | Oropharyngeal blistering | OFFSIDES | ||
| 836 | Oropharyngeal discomfort | SIDER | ||
| 837 | Orthopnea | OFFSIDES | ||
| 838 | Orthosis user | OFFSIDES | ||
| 839 | Osteolysis | OFFSIDES | ||
| 840 | Osteopenia | OFFSIDES SIDER | ||
| 841 | Osteoporosis | OFFSIDES | ||
| 842 | Osteoradionecrosis | OFFSIDES | ||
| 843 | Osteosclerosis | OFFSIDES | ||
| 844 | PCO2 decreased | OFFSIDES | ||
| 845 | Papilledema | 12649241 | CTD | |
| 846 | Paresthesia | 5026677 | CTD | |
| 847 | Parotidectomy | OFFSIDES | ||
| 848 | Parotitis | OFFSIDES | ||
| 849 | Pelvic Infection | 17103211 | CTD | |
| 850 | Pelvic discomfort | OFFSIDES | ||
| 851 | Periodontal operation | OFFSIDES | ||
| 852 | Periodontitis | 11089368 22017477 | CTD OFFSIDES | |
| 853 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 854 | Peritoneal Dialysis | OFFSIDES | ||
| 855 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 856 | Pharyngitis | Canada Vigilance: 1 | Canada Vigilance | |
| 857 | Phlebitis | 138789 | CTD SIDER | |
| 858 | Phobia of driving | OFFSIDES | ||
| 859 | Photosensitivity Disorders | 5026677 9145823 17103211 | CTD | |
| 860 | Physical disability | OFFSIDES | ||
| 861 | Pigmentation Disorders | 17103211 | CTD | |
| 862 | Plague | 28223382 | CTD | |
| 863 | Plasmacytoma | OFFSIDES | ||
| 864 | Plasmacytosis | OFFSIDES | ||
| 865 | Pleural decortication | OFFSIDES | ||
| 866 | Pleurectomy | OFFSIDES | ||
| 867 | Pleurisy | OFFSIDES | ||
| 868 | Pneumococcal Infections | 30746 | CTD | |
| 869 | Polymyositis | OFFSIDES | ||
| 870 | Post procedural infection | OFFSIDES | ||
| 871 | Postmenopausal bleeding | OFFSIDES | ||
| 872 | Pre-menstrual tension syndrome | SIDER | ||
| 873 | Premenstrual Tension | SIDER | ||
| 874 | Premenstrual syndrome | SIDER | ||
| 875 | Presbyopia | OFFSIDES | ||
| 876 | Prescribed overdose | OFFSIDES | ||
| 877 | Primary sequestrum | OFFSIDES | ||
| 878 | Procedural hypertension | OFFSIDES | ||
| 879 | Proctitis | SIDER | ||
| 880 | Product administration error | Canada Vigilance: 1 | Canada Vigilance | |
| 881 | Productive Cough | OFFSIDES | ||
| 882 | Prolonged menses | SIDER | ||
| 883 | Prostatectomy | OFFSIDES | ||
| 884 | Prosthesis Failure | 15741211 | CTD | |
| 885 | Proteinuria | 12900822 | CTD | |
| 886 | Pseudotumor Cerebri | 15210900 19204639 19345447 | CTD | |
| 887 | Pseudotumor | SIDER | ||
| 888 | Pterygium | 22724003 | CTD | |
| 889 | Pubic pain | OFFSIDES | ||
| 890 | Pulmonary Hypertension | OFFSIDES | ||
| 891 | Pulmonary Infarction | OFFSIDES | ||
| 892 | Purulent discharge | OFFSIDES | ||
| 893 | Pyelonephritis | OFFSIDES | ||
| 894 | Radiation skin injury | OFFSIDES | ||
| 895 | Radiotherapy to brain | OFFSIDES | ||
| 896 | Rectal discharge | OFFSIDES | ||
| 897 | Renal cyst | OFFSIDES | ||
| 898 | Renal tubular necrosis | OFFSIDES | ||
| 899 | Residual urine | OFFSIDES | ||
| 900 | Respiratory Tract Infections | 138789 17103211 | CTD | |
| 901 | Retrocollis | OFFSIDES | ||
| 902 | Rhinitis | OFFSIDES SIDER | ||
| 903 | Risus sardonicus | OFFSIDES | ||
| 904 | Schizoaffective Disorder | OFFSIDES | ||
| 905 | Schizophrenia | OFFSIDES | ||
| 906 | Seizures | 9190241 | CTD | |
| 907 | Semen analysis abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 908 | Sequestrectomy | OFFSIDES | ||
| 909 | Serum Sickness | SIDER | ||
| 910 | Serum urea increased | SIDER | ||
| 911 | Shoulder Pain | SIDER | ||
| 912 | Shunt malfunction | OFFSIDES | ||
| 913 | Sinus bradycardia | OFFSIDES | ||
| 914 | Skeletal injury | OFFSIDES | ||
| 915 | Skin Diseases, Infectious | 17103211 | CTD | |
| 916 | Skin Erosion | OFFSIDES | ||
| 917 | Skin discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 918 | Skin neoplasm excision | OFFSIDES | ||
| 919 | Skull X-ray abnormal | OFFSIDES | ||
| 920 | Sleep Paralysis | OFFSIDES | ||
| 921 | Sleep Talking | OFFSIDES | ||
| 922 | Soft Tissue Infection | OFFSIDES | ||
| 923 | Sopor | OFFSIDES | ||
| 924 | Sore mouth | SIDER | ||
| 925 | Sperm count decreased | OFFSIDES | ||
| 926 | Spinal column stenosis | OFFSIDES | ||
| 927 | Spinal fusion surgery | OFFSIDES | ||
| 928 | Sputum culture positive | OFFSIDES | ||
| 929 | Stem cell transplant | OFFSIDES | ||
| 930 | Stomach ache | SIDER | ||
| 931 | Stridor | OFFSIDES | ||
| 932 | Subcutaneous nodule | OFFSIDES | ||
| 933 | Suppuration | 6268571 | CTD | |
| 934 | Syphilis | 8108759 | CTD | |
| 935 | Tendinitis | OFFSIDES | ||
| 936 | Tension Headache | SIDER | ||
| 937 | Tension | SIDER | ||
| 938 | Thoracic Outlet Syndrome | OFFSIDES | ||
| 939 | Thoracotomy | OFFSIDES | ||
| 940 | Thrombectomy | OFFSIDES | ||
| 941 | Thrombocytopenic purpura | SIDER | ||
| 942 | Thrombosis in device | OFFSIDES | ||
| 943 | Tinea cruris | OFFSIDES | ||
| 944 | Tobacco user | OFFSIDES | ||
| 945 | Tooth Discoloration | 17103211 | CTD | |
| 946 | Tooth Erosion | OFFSIDES | ||
| 947 | Tooth Extraction | OFFSIDES | ||
| 948 | Tracheal fistula | OFFSIDES | ||
| 949 | Troponin increased | OFFSIDES | ||
| 950 | Upper-airway cough syndrome | SIDER | ||
| 951 | Upset stomach | SIDER | ||
| 952 | Urethral Stenosis | OFFSIDES | ||
| 953 | Urethritis | 10534208 | CTD | |
| 954 | Urge Incontinence | OFFSIDES | ||
| 955 | Urinary tract infection enterococcal | OFFSIDES | ||
| 956 | Uterine Cervicitis | 10534208 | CTD | |
| 957 | Uterine Prolapse | OFFSIDES | ||
| 958 | Vaginal Diseases | 17826578 | CTD | |
| 959 | Vascular anomaly | OFFSIDES | ||
| 960 | Vascular purpura | SIDER | ||
| 961 | Vasculitis, Leukocytoclastic, Cutaneous | 6268571 | CTD | |
| 962 | Vocal cord cyst | OFFSIDES | ||
| 963 | Vulvovaginal dryness | OFFSIDES | ||
| 964 | Walking aid user | OFFSIDES | ||
| 965 | Weight Gain | OFFSIDES | ||
| 966 | Wernicke-Korsakoff Syndrome | OFFSIDES | ||
| 967 | Wound dehiscence | OFFSIDES | ||
| 968 | Wound infection staphylococcal | OFFSIDES | ||
| 969 | carbuncle | OFFSIDES | ||
| 970 | colonoscopy | OFFSIDES | ||
| 971 | effusion | OFFSIDES | ||
| 972 | fibroma | OFFSIDES | ||
| 973 | jejunitis | OFFSIDES | ||
| 974 | kyphosis | OFFSIDES | ||
| 975 | muscle injury | OFFSIDES | ||
| 976 | pain neck/shoulder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.