Fluoxetine
(RTHCYVBBDHJXIQ-UHFFFAOYSA-N)
Structure
- SMILES
- CNCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- N06AB03; N06CA03
- Molecular Formula:
- C17H18F3NO
- Molecular Weight:
- 309.326
- Log P:
- 4.8259
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 21.26
- CAS Number(s):
- 54910-89-3; 57226-07-0
Synonym(s)
1.
Fluoxetine
2.
Fluoxetin
3.
Fluoxetine Hydrochloride
4.
Lilly-110140
5.
N-Methyl-gamma-(4-(trifluoromethyl)phenoxy)benzenepropanamine
6.
Prozac
7.
Sarafem
8.
Lilly 110140
9.
Lilly110140
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 243 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 2 | Drug exposure during pregnancy | FAERS: 203 | US FAERS | |
| 3 | Product substitution issue | FAERS: 187 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 4 | Anxiety | FAERS: 171 Canada Vigilance: 12 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Headache | FAERS: 119 Canada Vigilance: 5 | CTD SIDER Canada Vigilance US FAERS | |
| 6 | Nausea | FAERS: 115 Canada Vigilance: 11 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 7 | Fatigue | FAERS: 110 Canada Vigilance: 4 | 9442553 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 8 | Completed Suicide | FAERS: 106 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Feeling abnormal | FAERS: 99 | OFFSIDES SIDER US FAERS | |
| 10 | Dizziness | FAERS: 96 Canada Vigilance: 10 | 2356884 3500189 8166325 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 11 | Tremor | FAERS: 93 Canada Vigilance: 8 | CTD SIDER Canada Vigilance US FAERS | |
| 12 | Pharmaceutical product complaint | FAERS: 86 | US FAERS | |
| 13 | Vomiting | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Agitation | FAERS: 81 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 15 | Malaise | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 16 | Suicide attempt | FAERS: 79 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 17 | Overdose | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Serotonin Syndrome | FAERS: 61 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 19 | Product quality issue | FAERS: 60 | US FAERS | |
| 20 | Therapeutic response unexpected with drug substitution | FAERS: 51 | US FAERS | |
| 21 | Dyspepsia | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Depressed mood | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Memory impairment | FAERS: 45 | SIDER US FAERS | |
| 24 | Somnolence | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Urticaria | FAERS: 44 | 2628588 8520068 | CTD SIDER US FAERS |
| 26 | Palpitations | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 27 | Crying | FAERS: 41 | OFFSIDES US FAERS | |
| 28 | Intentional self-injury | FAERS: 41 | US FAERS | |
| 29 | Asthenia | FAERS: 40 | 1479050 11078032 | CTD OFFSIDES SIDER US FAERS |
| 30 | Syncope | FAERS: 40 | CTD SIDER US FAERS | |
| 31 | Drug withdrawal syndrome | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Pruritus | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 33 | Alopecia | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 34 | Arthralgia | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 35 | Toxicity to various agents | FAERS: 34 | US FAERS | |
| 36 | Feeling jittery | FAERS: 33 | SIDER US FAERS | |
| 37 | Hypersensitivity | FAERS: 32 | SIDER US FAERS | |
| 38 | Restlessness | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Abdominal discomfort | FAERS: 31 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Anger | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Anorgasmia | FAERS: 29 | SIDER US FAERS | |
| 42 | Weight decreased | FAERS: 26 | SIDER US FAERS | |
| 43 | Abdominal Pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 44 | Apathy | FAERS: 23 | SIDER US FAERS | |
| 45 | Cerebral disorder | FAERS: 23 | US FAERS | |
| 46 | Disease recurrence | FAERS: 23 | US FAERS | |
| 47 | Lethargy | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 48 | Flushing | FAERS: 22 | US FAERS | |
| 49 | Iritis | FAERS: 22 | SIDER US FAERS | |
| 50 | Paranoia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 51 | Tinnitus | FAERS: 22 | SIDER US FAERS | |
| 52 | Bruxism | FAERS: 21 | 15705018 19740153 | CTD OFFSIDES SIDER US FAERS |
| 53 | Erectile dysfunction | FAERS: 21 | CTD SIDER US FAERS | |
| 54 | Hypotension | FAERS: 21 | CTD SIDER US FAERS | |
| 55 | Pain | FAERS: 21 Canada Vigilance: 2 | 8959479 12798668 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 56 | Sexual Dysfunction | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 57 | Nervousness | FAERS: 20 | SIDER US FAERS | |
| 58 | Disorientation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Neonatal disorder | FAERS: 19 | US FAERS | |
| 60 | Photophobia | FAERS: 19 | SIDER US FAERS | |
| 61 | Tachycardia | FAERS: 19 Canada Vigilance: 2 | 2944028 9442553 11805215 | CTD SIDER Canada Vigilance US FAERS |
| 62 | Mood swings | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Musculoskeletal stiffness | FAERS: 18 | SIDER US FAERS | |
| 64 | Myalgia | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 65 | Blood glucose increased | FAERS: 17 | US FAERS | |
| 66 | Chest Pain | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 67 | Hypersomnia | FAERS: 17 | US FAERS | |
| 68 | Maternal exposure during pregnancy | FAERS: 17 | US FAERS | |
| 69 | Restless Legs Syndrome | FAERS: 17 Canada Vigilance: 1 | 18468624 | CTD Canada Vigilance US FAERS |
| 70 | Sneezing | FAERS: 17 | US FAERS | |
| 71 | Amnesia | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 72 | Lip swelling | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Retinal Detachment | FAERS: 16 | US FAERS | |
| 74 | Rhabdomyolysis | FAERS: 16 | US FAERS | |
| 75 | Throat irritation | FAERS: 16 | US FAERS | |
| 76 | Alanine Aminotransferase Increased | FAERS: 15 | SIDER US FAERS | |
| 77 | Chest discomfort | FAERS: 15 | US FAERS | |
| 78 | Erythema | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Hepatotoxicity | FAERS: 15 | US FAERS | |
| 80 | Incorrect dose administered | FAERS: 15 | US FAERS | |
| 81 | Obsessive-Compulsive Disorder | FAERS: 15 Canada Vigilance: 2 |
1552034
1883009 1919549 2005077 2258456 2549018 7726327 7961535 8071291 8151009 8253700 8292312 8407756 8848522 8923100 9546514 9632039 9717345 10327925 10505588 12046001 14674056 15213579 20418887 | CTD Canada Vigilance US FAERS |
| 82 | Patent ductus arteriosus | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Presyncope | FAERS: 15 | US FAERS | |
| 84 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 85 | Burning sensation | FAERS: 14 | US FAERS | |
| 86 | Feeding disorder neonatal | FAERS: 14 | US FAERS | |
| 87 | Muscle Rigidity | FAERS: 14 | US FAERS | |
| 88 | Poor quality sleep | FAERS: 14 | OFFSIDES US FAERS | |
| 89 | Blindness | FAERS: 13 | US FAERS | |
| 90 | Cerebrovascular accident | FAERS: 13 | SIDER US FAERS | |
| 91 | Drug abuse | FAERS: 13 | US FAERS | |
| 92 | Drug exposure via breast milk | FAERS: 13 | US FAERS | |
| 93 | Drug toxicity | FAERS: 13 | OFFSIDES US FAERS | |
| 94 | Dysarthria | FAERS: 13 | SIDER US FAERS | |
| 95 | Hyperreflexia | FAERS: 13 | SIDER US FAERS | |
| 96 | Sinus Tachycardia | FAERS: 13 | US FAERS | |
| 97 | Urinary Retention | FAERS: 13 | CTD SIDER US FAERS | |
| 98 | nervous system disorder | FAERS: 13 | US FAERS | |
| 99 | Akathisia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 100 | Diabetes Mellitus | FAERS: 12 | SIDER US FAERS | |
| 101 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 102 | Emotional disorder | FAERS: 12 | US FAERS | |
| 103 | Personality Change | FAERS: 12 | US FAERS | |
| 104 | Stress | FAERS: 12 | US FAERS | |
| 105 | Unresponsive to stimuli | FAERS: 12 | OFFSIDES US FAERS | |
| 106 | Vertigo | FAERS: 12 | 1602320 | CTD SIDER US FAERS |
| 107 | Alcohol interaction | FAERS: 11 | US FAERS | |
| 108 | Anhedonia | FAERS: 11 | 26454213 | CTD US FAERS |
| 109 | Aphasia | FAERS: 11 | 2107764 | CTD US FAERS |
| 110 | Blood creatine phosphokinase increased | FAERS: 11 | SIDER US FAERS | |
| 111 | Bradycardia | FAERS: 11 | CTD SIDER US FAERS | |
| 112 | Deafness | FAERS: 11 | SIDER US FAERS | |
| 113 | Dysuria | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 114 | Flatulence | FAERS: 11 | SIDER US FAERS | |
| 115 | Medication Error | FAERS: 11 | US FAERS | |
| 116 | Product taste abnormal | FAERS: 11 | US FAERS | |
| 117 | Talipes | FAERS: 11 | US FAERS | |
| 118 | Visual Impairment | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 119 | Yawning | FAERS: 11 | SIDER US FAERS | |
| 120 | Activities of daily living impaired | FAERS: 10 | OFFSIDES US FAERS | |
| 121 | Angioedema | FAERS: 10 | 2628588 | CTD SIDER US FAERS |
| 122 | Anterior chamber cleavage syndrome | FAERS: 10 | US FAERS | |
| 123 | Dysgeusia | FAERS: 10 | SIDER US FAERS | |
| 124 | Dystonia | FAERS: 10 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 125 | Homicide | FAERS: 10 | US FAERS | |
| 126 | Oropharyngeal pain | FAERS: 10 | OFFSIDES US FAERS | |
| 127 | Pneumonia | FAERS: 10 Canada Vigilance: 1 | 17477857 | CTD SIDER Canada Vigilance US FAERS |
| 128 | Pregnancy | FAERS: 10 | SIDER US FAERS | |
| 129 | Product physical issue | FAERS: 10 | US FAERS | |
| 130 | Single umbilical artery | FAERS: 10 | US FAERS | |
| 131 | Accidental overdose | FAERS: 9 | US FAERS | |
| 132 | Asphyxia | FAERS: 9 | US FAERS | |
| 133 | Back Pain | FAERS: 9 | SIDER US FAERS | |
| 134 | Blood triglycerides increased | FAERS: 9 | OFFSIDES US FAERS | |
| 135 | Bone pain | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 136 | Cardiac Arrest | FAERS: 9 | SIDER US FAERS | |
| 137 | Chills | FAERS: 9 | SIDER US FAERS | |
| 138 | Constipation | FAERS: 9 | SIDER US FAERS | |
| 139 | Delirium | FAERS: 9 | CTD SIDER US FAERS | |
| 140 | Dysmorphism | FAERS: 9 | US FAERS | |
| 141 | Ecchymosis | FAERS: 9 | SIDER US FAERS | |
| 142 | Euphoric mood | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 143 | Exposure during breast feeding | FAERS: 9 | US FAERS | |
| 144 | Flat affect | FAERS: 9 | SIDER US FAERS | |
| 145 | Impaired work ability | FAERS: 9 | US FAERS | |
| 146 | Injury asphyxiation | FAERS: 9 | US FAERS | |
| 147 | Intentional misuse | FAERS: 9 | US FAERS | |
| 148 | Joint swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Low birth weight baby | FAERS: 9 | US FAERS | |
| 150 | Myoclonus | FAERS: 9 | CTD SIDER US FAERS | |
| 151 | Thrombocytopenia | FAERS: 9 | SIDER US FAERS | |
| 152 | Trismus | FAERS: 9 | 19440092 | CTD US FAERS |
| 153 | Unevaluable event | FAERS: 9 | US FAERS | |
| 154 | Alcohol poisoning | FAERS: 8 | US FAERS | |
| 155 | Altered state of consciousness | FAERS: 8 | US FAERS | |
| 156 | Antidepressant drug level increased | FAERS: 8 | US FAERS | |
| 157 | Diplopia | FAERS: 8 | 1602320 | CTD OFFSIDES SIDER US FAERS |
| 158 | Dissociation | FAERS: 8 | US FAERS | |
| 159 | Drug dose omission | FAERS: 8 | US FAERS | |
| 160 | Dry skin | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 161 | Emotional distress | FAERS: 8 | OFFSIDES US FAERS | |
| 162 | Feeling Cold | FAERS: 8 | US FAERS | |
| 163 | Hallucinations, mixed | FAERS: 8 | US FAERS | |
| 164 | Pallor | FAERS: 8 | SIDER US FAERS | |
| 165 | Psychogenic seizure | FAERS: 8 | US FAERS | |
| 166 | Pulmonary Hypertension | FAERS: 8 | SIDER US FAERS | |
| 167 | Renal pain | FAERS: 8 | SIDER US FAERS | |
| 168 | Stevens-Johnson Syndrome | FAERS: 8 | 25811541 | CTD SIDER US FAERS |
| 169 | Tension | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 170 | Trichotillomania | FAERS: 8 | US FAERS | |
| 171 | Urinary tract infection | FAERS: 8 | SIDER US FAERS | |
| 172 | Ventricular Fibrillation | FAERS: 8 | SIDER US FAERS | |
| 173 | Angle Closure Glaucoma | FAERS: 7 | US FAERS | |
| 174 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 175 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 176 | Blood testosterone decreased | FAERS: 7 | US FAERS | |
| 177 | Catatonia | FAERS: 7 | 8887967 | CTD US FAERS |
| 178 | Chromaturia | FAERS: 7 | OFFSIDES US FAERS | |
| 179 | Cyanosis | FAERS: 7 | US FAERS | |
| 180 | Disturbance in sexual arousal | FAERS: 7 | SIDER US FAERS | |
| 181 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 182 | Eructation | FAERS: 7 | SIDER US FAERS | |
| 183 | Gamma-Glutamyltransferase Increased | FAERS: 7 | US FAERS | |
| 184 | Gastroschisis | FAERS: 7 | US FAERS | |
| 185 | Hemiplegia | FAERS: 7 | OFFSIDES US FAERS | |
| 186 | Mental impairment | FAERS: 7 | OFFSIDES US FAERS | |
| 187 | Middle insomnia | FAERS: 7 | US FAERS | |
| 188 | Mydriasis | FAERS: 7 | SIDER US FAERS | |
| 189 | Neutrophil count decreased | FAERS: 7 | US FAERS | |
| 190 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 191 | Platelet dysfunction | FAERS: 7 | US FAERS | |
| 192 | Product formulation issue | FAERS: 7 | US FAERS | |
| 193 | Quality of life decreased | FAERS: 7 | US FAERS | |
| 194 | Reaction to drug excipients | FAERS: 7 | US FAERS | |
| 195 | Respiratory Depression | FAERS: 7 | US FAERS | |
| 196 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 197 | Retrograde ejaculation | FAERS: 7 | US FAERS | |
| 198 | Screaming | FAERS: 7 | US FAERS | |
| 199 | Semen volume decreased | FAERS: 7 | US FAERS | |
| 200 | Sleep Paralysis | FAERS: 7 | US FAERS | |
| 201 | Tachyphrenia | FAERS: 7 | US FAERS | |
| 202 | Tardive Dyskinesia | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 203 | Therapy non-responder | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Abnormal weight gain | FAERS: 6 | US FAERS | |
| 205 | Adverse event | FAERS: 6 | US FAERS | |
| 206 | Blood Corticotrophin Decreased | FAERS: 6 | US FAERS | |
| 207 | Blood pressure orthostatic abnormal | FAERS: 6 | US FAERS | |
| 208 | Bronchiectasis | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 209 | Cerebral vasoconstriction | FAERS: 6 | US FAERS | |
| 210 | Cortisol decreased | FAERS: 6 | US FAERS | |
| 211 | Dark circles under eyes | FAERS: 6 | US FAERS | |
| 212 | Dehydroepiandrosterone decreased | FAERS: 6 | US FAERS | |
| 213 | Depressed Level of Consciousness | FAERS: 6 | SIDER US FAERS | |
| 214 | Discomfort | FAERS: 6 | SIDER US FAERS | |
| 215 | Dysphonia | FAERS: 6 | 16144188 | CTD US FAERS |
| 216 | Exposure via breast milk | FAERS: 6 | US FAERS | |
| 217 | Gastritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 218 | Head deformity | FAERS: 6 | US FAERS | |
| 219 | Hostility | FAERS: 6 | SIDER US FAERS | |
| 220 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 221 | Intestinal Obstruction | FAERS: 6 | SIDER US FAERS | |
| 222 | Left Ventricular Hypertrophy | FAERS: 6 | US FAERS | |
| 223 | Limb injury | FAERS: 6 | US FAERS | |
| 224 | Mental status changes | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 225 | Muscle Spasticity | FAERS: 6 | 10084445 | CTD US FAERS |
| 226 | Poisoning | FAERS: 6 | US FAERS | |
| 227 | Poor sucking reflex | FAERS: 6 | US FAERS | |
| 228 | Pulmonary congestion | FAERS: 6 | OFFSIDES US FAERS | |
| 229 | Regurgitation | FAERS: 6 | US FAERS | |
| 230 | Respiratory Failure | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 231 | Retinal Vein Occlusion | FAERS: 6 | 18025637 | CTD US FAERS |
| 232 | Reversible cerebral vasoconstriction syndrome | FAERS: 6 | US FAERS | |
| 233 | Tension Headache | FAERS: 6 | US FAERS | |
| 234 | jaundice | FAERS: 6 | SIDER US FAERS | |
| 235 | Ascites | FAERS: 5 | OFFSIDES US FAERS | |
| 236 | Cardiotoxicity | FAERS: 5 | SIDER US FAERS | |
| 237 | Choking | FAERS: 5 | US FAERS | |
| 238 | Dissociative Identity Disorder | FAERS: 5 | US FAERS | |
| 239 | Drug Dependence | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 240 | Drug screen positive | FAERS: 5 | US FAERS | |
| 241 | Erythema Multiforme | FAERS: 5 | SIDER US FAERS | |
| 242 | Exposure via father | FAERS: 5 | US FAERS | |
| 243 | Gastrointestinal Pain | FAERS: 5 | SIDER US FAERS | |
| 244 | Head circumference abnormal | FAERS: 5 | US FAERS | |
| 245 | Infection | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 246 | Initial insomnia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 247 | Intrusive thoughts | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 248 | Lymphocyte count decreased | FAERS: 5 | US FAERS | |
| 249 | Male sexual dysfunction | FAERS: 5 | US FAERS | |
| 250 | Mastitis | FAERS: 5 | US FAERS | |
| 251 | Myopathy | FAERS: 5 | SIDER US FAERS | |
| 252 | Nasopharyngitis | FAERS: 5 | OFFSIDES US FAERS | |
| 253 | Neutropenia | FAERS: 5 | US FAERS | |
| 254 | Nystagmus | FAERS: 5 | US FAERS | |
| 255 | Ocular Hypertension | FAERS: 5 | US FAERS | |
| 256 | Poor weight gain neonatal | FAERS: 5 | US FAERS | |
| 257 | Product use issue | FAERS: 5 | US FAERS | |
| 258 | Pulmonary Fibrosis | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 259 | Retching | FAERS: 5 | US FAERS | |
| 260 | Sinus bradycardia | FAERS: 5 | US FAERS | |
| 261 | Slow speech | FAERS: 5 | US FAERS | |
| 262 | Sunburn | FAERS: 5 | US FAERS | |
| 263 | Troponin increased | FAERS: 5 | OFFSIDES US FAERS | |
| 264 | Acne | FAERS: 4 | SIDER US FAERS | |
| 265 | Anorexia | FAERS: 4 | CTD OFFSIDES SIDER US FAERS | |
| 266 | Bipolar I disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 267 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 268 | Blood follicle stimulating hormone increased | FAERS: 4 | US FAERS | |
| 269 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 270 | Bradykinesia | FAERS: 4 | US FAERS | |
| 271 | Brain stem thrombosis | FAERS: 4 | US FAERS | |
| 272 | Bursitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 273 | Cardiomyopathy neonatal | FAERS: 4 | US FAERS | |
| 274 | Cerebral Palsy | FAERS: 4 | US FAERS | |
| 275 | Chorea | FAERS: 4 | 8618711 8723152 | CTD US FAERS |
| 276 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 277 | Congenital heart valve disorder | FAERS: 4 | US FAERS | |
| 278 | Congenital scoliosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Congenital tricuspid valve incompetence | FAERS: 4 | US FAERS | |
| 280 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 281 | Drug level increased | FAERS: 4 | US FAERS | |
| 282 | Drug screen false positive | FAERS: 4 | US FAERS | |
| 283 | Echolalia | FAERS: 4 | US FAERS | |
| 284 | Economic problem | FAERS: 4 | US FAERS | |
| 285 | Electromechanical dissociation | FAERS: 4 | US FAERS | |
| 286 | Enuresis | FAERS: 4 | US FAERS | |
| 287 | Epilepsy | FAERS: 4 | 12632110 20707986 | CTD US FAERS |
| 288 | Epistaxis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 289 | Excoriation | FAERS: 4 | US FAERS | |
| 290 | Feeling of body temperature change | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 291 | Gastrointestinal inflammation | FAERS: 4 | US FAERS | |
| 292 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 293 | Head discomfort | FAERS: 4 | US FAERS | |
| 294 | Hyperventilation | FAERS: 4 | SIDER US FAERS | |
| 295 | Joint stiffness | FAERS: 4 | US FAERS | |
| 296 | Long QT Syndrome | FAERS: 4 | CTD US FAERS | |
| 297 | Loss of dreaming | FAERS: 4 | US FAERS | |
| 298 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 299 | Neonatal tachycardia | FAERS: 4 | US FAERS | |
| 300 | Opisthotonus | FAERS: 4 | US FAERS | |
| 301 | Orgasmic sensation decreased | FAERS: 4 | US FAERS | |
| 302 | Osteopenia | FAERS: 4 | OFFSIDES US FAERS | |
| 303 | Pancreatitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 304 | Platelet function test abnormal | FAERS: 4 | US FAERS | |
| 305 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 306 | Pre-Eclampsia | FAERS: 4 | US FAERS | |
| 307 | Priapism | FAERS: 4 | SIDER US FAERS | |
| 308 | Product measured potency issue | FAERS: 4 | US FAERS | |
| 309 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 310 | Pulmonary Embolism | FAERS: 4 | 12724510 | CTD SIDER US FAERS |
| 311 | Quadriparesis | FAERS: 4 | US FAERS | |
| 312 | Sensation of blood flow | FAERS: 4 | US FAERS | |
| 313 | Sepsis | FAERS: 4 | US FAERS | |
| 314 | Serum Sickness | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 315 | Stillbirth | FAERS: 4 | US FAERS | |
| 316 | Stupor | FAERS: 4 | SIDER US FAERS | |
| 317 | Temperature intolerance | FAERS: 4 | OFFSIDES US FAERS | |
| 318 | Temperature regulation disorder | FAERS: 4 | US FAERS | |
| 319 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 320 | Torticollis | FAERS: 4 | 12046001 | CTD US FAERS |
| 321 | treatment failure | FAERS: 4 | US FAERS | |
| 322 | Abasia | FAERS: 3 | OFFSIDES US FAERS | |
| 323 | Anencephaly | FAERS: 3 | US FAERS | |
| 324 | Antidepressant drug level above therapeutic | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 325 | Atrial Fibrillation | FAERS: 3 | 2016253 | CTD SIDER US FAERS |
| 326 | Atrioventricular Block | FAERS: 3 | SIDER US FAERS | |
| 327 | Bipolar Disorder | FAERS: 3 |
1564030
1647392 1815442 1906498 2107764 2375448 3485926 3871593 7943454 8923100 9171912 9864074 11180215 11197585 11384912 11485152 11910263 12192418 15213579 15298662 15708425 19573494 20021991 | CTD US FAERS |
| 328 | Blood creatine phosphokinase MB | FAERS: 3 | US FAERS | |
| 329 | Blood pressure immeasurable | FAERS: 3 | US FAERS | |
| 330 | Blood thyroid stimulating hormone increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Bradyphrenia | FAERS: 3 | US FAERS | |
| 332 | Brief psychotic disorder, with postpartum onset | FAERS: 3 | US FAERS | |
| 333 | Cogwheel Rigidity | FAERS: 3 | US FAERS | |
| 334 | Compulsive shopping | FAERS: 3 | US FAERS | |
| 335 | Dehydration | FAERS: 3 | SIDER US FAERS | |
| 336 | Depression suicidal | FAERS: 3 | US FAERS | |
| 337 | Dysphemia | FAERS: 3 | US FAERS | |
| 338 | Educational problem | FAERS: 3 | US FAERS | |
| 339 | Electroencephalogram abnormal | FAERS: 3 | SIDER US FAERS | |
| 340 | Exposure via partner | FAERS: 3 | US FAERS | |
| 341 | Eye pain | FAERS: 3 | SIDER US FAERS | |
| 342 | Female Orgasmic Disorder | FAERS: 3 | US FAERS | |
| 343 | Flank Pain | FAERS: 3 | OFFSIDES US FAERS | |
| 344 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 345 | Formication | FAERS: 3 | OFFSIDES US FAERS | |
| 346 | Gait Apraxia | FAERS: 3 | US FAERS | |
| 347 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 348 | Hunger | FAERS: 3 | US FAERS | |
| 349 | Hyperthyroidism | FAERS: 3 | SIDER US FAERS | |
| 350 | Hypomania | FAERS: 3 | SIDER US FAERS | |
| 351 | Hypometabolism | FAERS: 3 | US FAERS | |
| 352 | Hypoplastic Left Heart Syndrome | FAERS: 3 | US FAERS | |
| 353 | Hypothermia neonatal | FAERS: 3 | US FAERS | |
| 354 | Hypothyroidism | FAERS: 3 | SIDER US FAERS | |
| 355 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 356 | Infantile apnoeic attack | FAERS: 3 | US FAERS | |
| 357 | Inflammation | FAERS: 3 | 12798668 21966942 | CTD US FAERS |
| 358 | Influenza | FAERS: 3 | SIDER US FAERS | |
| 359 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 360 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 361 | Kleptomania | FAERS: 3 | US FAERS | |
| 362 | Leukocytosis | FAERS: 3 | SIDER US FAERS | |
| 363 | Live Birth | FAERS: 3 | US FAERS | |
| 364 | Macroglossia | FAERS: 3 | US FAERS | |
| 365 | Meningitis | FAERS: 3 | US FAERS | |
| 366 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 367 | Muscle tightness | FAERS: 3 | US FAERS | |
| 368 | Mutism | FAERS: 3 | US FAERS | |
| 369 | Neck Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 370 | Negative thoughts | FAERS: 3 | US FAERS | |
| 371 | Neuralgia | FAERS: 3 | SIDER US FAERS | |
| 372 | No adverse event | FAERS: 3 | US FAERS | |
| 373 | Obsessive thoughts | FAERS: 3 | US FAERS | |
| 374 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 375 | Pressure of speech | FAERS: 3 | US FAERS | |
| 376 | Product contamination | FAERS: 3 | US FAERS | |
| 377 | Product size issue | FAERS: 3 | US FAERS | |
| 378 | Product storage error | FAERS: 3 | US FAERS | |
| 379 | Protein urine present | FAERS: 3 | US FAERS | |
| 380 | Psychiatric decompensation | FAERS: 3 | US FAERS | |
| 381 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 382 | Pyloric Stenosis | FAERS: 3 | US FAERS | |
| 383 | Respiratory distress | FAERS: 3 | SIDER US FAERS | |
| 384 | Resting Tremor | FAERS: 3 | US FAERS | |
| 385 | Serum serotonin decreased | FAERS: 3 | US FAERS | |
| 386 | Spontaneous ejaculation | FAERS: 3 | US FAERS | |
| 387 | Staring | FAERS: 3 | US FAERS | |
| 388 | Suggestibility | FAERS: 3 | US FAERS | |
| 389 | Swelling | FAERS: 3 | US FAERS | |
| 390 | Thirst | FAERS: 3 | SIDER US FAERS | |
| 391 | Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 392 | Trisomy 21 | FAERS: 3 | US FAERS | |
| 393 | Wrong technique in drug usage process | FAERS: 3 | OFFSIDES US FAERS | |
| 394 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 395 | Acidosis | FAERS: 2 | US FAERS | |
| 396 | Agitated depression | FAERS: 2 | US FAERS | |
| 397 | Agoraphobia | FAERS: 2 | US FAERS | |
| 398 | Alcohol Intolerance | FAERS: 2 | SIDER US FAERS | |
| 399 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 400 | Anoxia | FAERS: 2 | US FAERS | |
| 401 | Arthropathy | FAERS: 2 | SIDER US FAERS | |
| 402 | Asthma | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 403 | Ataxia | FAERS: 2 | 1602320 2107764 7806697 | CTD SIDER US FAERS |
| 404 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 405 | Blood alkaline phosphatase increased | FAERS: 2 | SIDER US FAERS | |
| 406 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 407 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 408 | Blunted affect | FAERS: 2 | US FAERS | |
| 409 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 410 | Cholelithiasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 411 | Cleft Palate | FAERS: 2 | US FAERS | |
| 412 | Clonus | FAERS: 2 | US FAERS | |
| 413 | Clumsiness | FAERS: 2 | US FAERS | |
| 414 | Confabulation | FAERS: 2 | OFFSIDES US FAERS | |
| 415 | Congenital cystic lung | FAERS: 2 | US FAERS | |
| 416 | Craniosynostosis | FAERS: 2 | US FAERS | |
| 417 | Cystitis | FAERS: 2 | SIDER US FAERS | |
| 418 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 419 | Delusional disorder, persecutory type | FAERS: 2 | US FAERS | |
| 420 | Demyelination | FAERS: 2 | OFFSIDES US FAERS | |
| 421 | Dermoid Cyst | FAERS: 2 | US FAERS | |
| 422 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 423 | Dysgraphia | FAERS: 2 | US FAERS | |
| 424 | Erysipelas | FAERS: 2 | US FAERS | |
| 425 | Excessive masturbation | FAERS: 2 | US FAERS | |
| 426 | Exhibitionism | FAERS: 2 | US FAERS | |
| 427 | Exposure via ingestion | FAERS: 2 | US FAERS | |
| 428 | Feelings of worthlessness | FAERS: 2 | OFFSIDES US FAERS | |
| 429 | Foaming at mouth | FAERS: 2 | OFFSIDES US FAERS | |
| 430 | Food Allergy | FAERS: 2 | US FAERS | |
| 431 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 432 | Fracture | FAERS: 2 | US FAERS | |
| 433 | Frontotemporal dementia | FAERS: 2 | US FAERS | |
| 434 | Frustration | FAERS: 2 | US FAERS | |
| 435 | Gambling | FAERS: 2 | OFFSIDES US FAERS | |
| 436 | Glaucoma | FAERS: 2 | SIDER US FAERS | |
| 437 | HELLP Syndrome | FAERS: 2 | US FAERS | |
| 438 | Hepatitis | FAERS: 2 | 10405699 | CTD OFFSIDES SIDER US FAERS |
| 439 | Hypermobility syndrome | FAERS: 2 | US FAERS | |
| 440 | Hypokinesia | FAERS: 2 | 12046001 | CTD US FAERS |
| 441 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 442 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 443 | Inappropriate schedule of drug administration | FAERS: 2 | OFFSIDES US FAERS | |
| 444 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 445 | Irregular breathing | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 446 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 447 | Lipase increased | FAERS: 2 | US FAERS | |
| 448 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 449 | Lymphadenopathy | FAERS: 2 | SIDER US FAERS | |
| 450 | Markedly reduced dietary intake | FAERS: 2 | US FAERS | |
| 451 | Menorrhagia | FAERS: 2 | SIDER US FAERS | |
| 452 | Mental Retardation | FAERS: 2 | US FAERS | |
| 453 | Microcephaly | FAERS: 2 | US FAERS | |
| 454 | Micropenis | FAERS: 2 | US FAERS | |
| 455 | Mood disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 456 | Multiple drug overdose | FAERS: 2 | US FAERS | |
| 457 | Musculoskeletal Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 458 | Myasthenic Syndrome | FAERS: 2 | US FAERS | |
| 459 | Myocardial Infarction | FAERS: 2 | SIDER US FAERS | |
| 460 | Myositis | FAERS: 2 | 10868505 | CTD SIDER US FAERS |
| 461 | Night sweats | FAERS: 2 | US FAERS | |
| 462 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 463 | Obsessive-compulsive symptom | FAERS: 2 | US FAERS | |
| 464 | Oliguria | FAERS: 2 | SIDER US FAERS | |
| 465 | Oral pain | FAERS: 2 | US FAERS | |
| 466 | Pancytopenia | FAERS: 2 | SIDER US FAERS | |
| 467 | Paresis | FAERS: 2 | US FAERS | |
| 468 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 469 | Phantom pain | FAERS: 2 | US FAERS | |
| 470 | Pneumonitis | FAERS: 2 | US FAERS | |
| 471 | Post procedural pain | FAERS: 2 | US FAERS | |
| 472 | Procedural complication | FAERS: 2 | US FAERS | |
| 473 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 474 | Psoriasis | FAERS: 2 | SIDER US FAERS | |
| 475 | Psychomotor skills impaired | FAERS: 2 | US FAERS | |
| 476 | Pulmonary Valve Stenosis | FAERS: 2 | US FAERS | |
| 477 | Pulmonary malformation | FAERS: 2 | US FAERS | |
| 478 | Rales | FAERS: 2 | US FAERS | |
| 479 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 480 | School refusal | FAERS: 2 | OFFSIDES US FAERS | |
| 481 | Sinusitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 482 | Skin irritation | FAERS: 2 | US FAERS | |
| 483 | Sluggishness | FAERS: 2 | US FAERS | |
| 484 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 485 | Synovitis | FAERS: 2 | US FAERS | |
| 486 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 487 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 488 | Therapy change | FAERS: 2 | US FAERS | |
| 489 | Thermal burn | FAERS: 2 | US FAERS | |
| 490 | Thyroiditis | FAERS: 2 | US FAERS | |
| 491 | Tonic clonic movements | FAERS: 2 | US FAERS | |
| 492 | Toxic Epidermal Necrolysis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 493 | Trisomy 22 | FAERS: 2 | US FAERS | |
| 494 | Urinary Incontinence | FAERS: 2 | SIDER US FAERS | |
| 495 | Urine amphetamine positive | FAERS: 2 | US FAERS | |
| 496 | Walking aid user | FAERS: 2 | US FAERS | |
| 497 | Wheezing | FAERS: 2 | US FAERS | |
| 498 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 499 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 500 | Accidental death | FAERS: 1 | US FAERS | |
| 501 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 502 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 503 | Accidental exposure | FAERS: 1 | US FAERS | |
| 504 | Acquired macroglossia | FAERS: 1 | US FAERS | |
| 505 | Activated partial thromboplastin time abnormal | FAERS: 1 | US FAERS | |
| 506 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 507 | Adrenogenital Syndrome | FAERS: 1 | US FAERS | |
| 508 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 509 | Alcohol problem | FAERS: 1 | US FAERS | |
| 510 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 511 | Alpha-1 anti-trypsin increased | FAERS: 1 | US FAERS | |
| 512 | Aneurysm | FAERS: 1 | US FAERS | |
| 513 | Annular pancreas | FAERS: 1 | US FAERS | |
| 514 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 515 | Bankruptcy | FAERS: 1 | US FAERS | |
| 516 | Base excess increased | FAERS: 1 | US FAERS | |
| 517 | Bedridden | FAERS: 1 | OFFSIDES US FAERS | |
| 518 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 519 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 520 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 521 | Blepharospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 522 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 523 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 524 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 525 | Blood copper decreased | FAERS: 1 | US FAERS | |
| 526 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 527 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 528 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 529 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 530 | Blood potassium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 531 | Blood prolactin increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 532 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 533 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 534 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 535 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 536 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 537 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 538 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 539 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 540 | Boredom | FAERS: 1 | US FAERS | |
| 541 | Bottle feeding | FAERS: 1 | US FAERS | |
| 542 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 543 | Brain Death | FAERS: 1 | US FAERS | |
| 544 | Breast complication associated with device | FAERS: 1 | US FAERS | |
| 545 | Breech Presentation | FAERS: 1 | US FAERS | |
| 546 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 547 | Bronchopneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 548 | Bronchospasm | FAERS: 1 | SIDER US FAERS | |
| 549 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 550 | Cachexia | FAERS: 1 | SIDER US FAERS | |
| 551 | Capsule issue | FAERS: 1 | US FAERS | |
| 552 | Carbohydrate antigen 15-3 increased | FAERS: 1 | US FAERS | |
| 553 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 554 | Carcinoma | FAERS: 1 | US FAERS | |
| 555 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 556 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 557 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 558 | Cheilitis | FAERS: 1 | US FAERS | |
| 559 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 560 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 561 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 562 | Clubbing | FAERS: 1 | US FAERS | |
| 563 | Cold sweat | FAERS: 1 | US FAERS | |
| 564 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 565 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 566 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 567 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 568 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 569 | Conversion disorder | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 570 | Creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 571 | Cutaneous sarcoidosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 572 | Cyclothymic Disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 573 | Dementia | FAERS: 1 | US FAERS | |
| 574 | Dependent Personality Disorder | FAERS: 1 | US FAERS | |
| 575 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 576 | Disease Progression | FAERS: 1 | US FAERS | |
| 577 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 578 | Diverticulum | FAERS: 1 | OFFSIDES US FAERS | |
| 579 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 580 | Double Outlet Right Ventricle | FAERS: 1 | US FAERS | |
| 581 | Drug administration error | FAERS: 1 | US FAERS | |
| 582 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 583 | Drug effect variable | FAERS: 1 | US FAERS | |
| 584 | Drug label confusion | FAERS: 1 | US FAERS | |
| 585 | Drug level changed | FAERS: 1 | US FAERS | |
| 586 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 587 | Drug resistance | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 588 | Drug withdrawal headache | FAERS: 1 | OFFSIDES US FAERS | |
| 589 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 590 | Ear discomfort | FAERS: 1 | US FAERS | |
| 591 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 592 | Eczema | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 593 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 594 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 595 | Elevated mood | FAERS: 1 | US FAERS | |
| 596 | Emotional poverty | FAERS: 1 | US FAERS | |
| 597 | Eosinophil percentage decreased | FAERS: 1 | US FAERS | |
| 598 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 599 | Erythema Nodosum | FAERS: 1 | SIDER US FAERS | |
| 600 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 601 | Expired product administered | FAERS: 1 | US FAERS | |
| 602 | Eye Burns | FAERS: 1 | US FAERS | |
| 603 | Eye Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 604 | Eye irritation | FAERS: 1 | US FAERS | |
| 605 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 606 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 607 | False positive investigation result | FAERS: 1 | US FAERS | |
| 608 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 609 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 610 | Forceps delivery | FAERS: 1 | US FAERS | |
| 611 | Gangrene | FAERS: 1 | US FAERS | |
| 612 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 613 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 614 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 615 | Gaze palsy | FAERS: 1 | US FAERS | |
| 616 | General symptom | FAERS: 1 | US FAERS | |
| 617 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 618 | Glasgow coma scale | FAERS: 1 | US FAERS | |
| 619 | Gout | FAERS: 1 | SIDER US FAERS | |
| 620 | Growth retardation | FAERS: 1 | US FAERS | |
| 621 | Hanging | FAERS: 1 | US FAERS | |
| 622 | Hemiparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 623 | Hepatic artery flow decreased | FAERS: 1 | US FAERS | |
| 624 | Hepatic artery stenosis | FAERS: 1 | US FAERS | |
| 625 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 626 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 627 | Hyperacusis | FAERS: 1 | SIDER US FAERS | |
| 628 | Hyperphagia | FAERS: 1 | US FAERS | |
| 629 | Hypophagia | FAERS: 1 | OFFSIDES US FAERS | |
| 630 | Hyporeflexia | FAERS: 1 | SIDER US FAERS | |
| 631 | Hypospadias | FAERS: 1 | US FAERS | |
| 632 | Hypoventilation | FAERS: 1 | SIDER US FAERS | |
| 633 | Hypoxia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 634 | Ideas of reference | FAERS: 1 | US FAERS | |
| 635 | Ileal Stenosis | FAERS: 1 | US FAERS | |
| 636 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 637 | Incoherent | FAERS: 1 | US FAERS | |
| 638 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 639 | Intention tremor | FAERS: 1 | OFFSIDES US FAERS | |
| 640 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 641 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 642 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 643 | Intercepted product selection error | FAERS: 1 | US FAERS | |
| 644 | Laceration | FAERS: 1 | OFFSIDES US FAERS | |
| 645 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 646 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 647 | Leukocytoclastic vasculitis | FAERS: 1 | SIDER US FAERS | |
| 648 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 649 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 650 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 651 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 652 | Mastication disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 653 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 654 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 655 | Microgenia | FAERS: 1 | US FAERS | |
| 656 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 657 | Morbid thoughts | FAERS: 1 | OFFSIDES US FAERS | |
| 658 | Mouth swelling | FAERS: 1 | US FAERS | |
| 659 | Murder | FAERS: 1 | US FAERS | |
| 660 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 661 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 662 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 663 | Nail Infection | FAERS: 1 | US FAERS | |
| 664 | Narcissistic Personality Disorder | FAERS: 1 | US FAERS | |
| 665 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 666 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 667 | Neonatal aspiration | FAERS: 1 | US FAERS | |
| 668 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 669 | Nephritis | FAERS: 1 | US FAERS | |
| 670 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 671 | Neuroleptic Malignant Syndrome | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 672 | Neutrophil percentage decreased | FAERS: 1 | US FAERS | |
| 673 | Obesity | FAERS: 1 | CTD US FAERS | |
| 674 | Oculogyric crisis | FAERS: 1 | SIDER US FAERS | |
| 675 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 676 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 677 | Ovarian enlargement | FAERS: 1 | US FAERS | |
| 678 | Overweight | FAERS: 1 | OFFSIDES US FAERS | |
| 679 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 680 | Panic Disorder | FAERS: 1 Canada Vigilance: 1 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 681 | Parent-child problem | FAERS: 1 | US FAERS | |
| 682 | Pathological fracture | FAERS: 1 | US FAERS | |
| 683 | Pelvic kidney | FAERS: 1 | US FAERS | |
| 684 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 685 | Performance status decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 686 | Periodontitis | FAERS: 1 | US FAERS | |
| 687 | Petechiae | FAERS: 1 | SIDER US FAERS | |
| 688 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 689 | Pharyngolaryngeal Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 690 | Physical assault | FAERS: 1 | SIDER US FAERS | |
| 691 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 692 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 693 | Pregnancy on oral contraceptive | FAERS: 1 | US FAERS | |
| 694 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 695 | Premenstrual syndrome | FAERS: 1 Canada Vigilance: 1 | 8071300 12521737 | CTD Canada Vigilance US FAERS |
| 696 | Product availability issue | FAERS: 1 | US FAERS | |
| 697 | Product commingling | FAERS: 1 | US FAERS | |
| 698 | Product counterfeit | FAERS: 1 | US FAERS | |
| 699 | Product dispensing error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 700 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 701 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 702 | Product label confusion | FAERS: 1 | US FAERS | |
| 703 | Product label issue | FAERS: 1 | US FAERS | |
| 704 | Product lot number issue | FAERS: 1 | US FAERS | |
| 705 | Product prescribing error | FAERS: 1 | US FAERS | |
| 706 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 707 | Productive Cough | FAERS: 1 | US FAERS | |
| 708 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 709 | Pulmonary arterial pressure abnormal | FAERS: 1 | US FAERS | |
| 710 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 711 | Purulence | FAERS: 1 | US FAERS | |
| 712 | Rash neonatal | FAERS: 1 | US FAERS | |
| 713 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 714 | Rebound effect | FAERS: 1 | US FAERS | |
| 715 | Rebound psychosis | FAERS: 1 | US FAERS | |
| 716 | Red man syndrome | FAERS: 1 | US FAERS | |
| 717 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 718 | Renal Colic | FAERS: 1 | US FAERS | |
| 719 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 720 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 721 | Rhinalgia | FAERS: 1 | US FAERS | |
| 722 | Rosacea | FAERS: 1 | US FAERS | |
| 723 | Scab | FAERS: 1 | OFFSIDES US FAERS | |
| 724 | Schizophrenia | FAERS: 1 | 11910263 | CTD US FAERS |
| 725 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 726 | Secretion discharge | FAERS: 1 | US FAERS | |
| 727 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 728 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 729 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 730 | Shock | FAERS: 1 | SIDER US FAERS | |
| 731 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 732 | Skin Erosion | FAERS: 1 | US FAERS | |
| 733 | Skin Ulcer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 734 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 735 | Skin hypertrophy | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 736 | Skin indentation | FAERS: 1 | US FAERS | |
| 737 | Skin laceration | FAERS: 1 | US FAERS | |
| 738 | Sleep Talking | FAERS: 1 | US FAERS | |
| 739 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 740 | Somatoform disorder cardiovascular | FAERS: 1 | US FAERS | |
| 741 | Somnambulism | FAERS: 1 | US FAERS | |
| 742 | Specific gravity urine decreased | FAERS: 1 | US FAERS | |
| 743 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 744 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 745 | Stereotypic Movement Disorder | FAERS: 1 | US FAERS | |
| 746 | Stridor | FAERS: 1 | SIDER US FAERS | |
| 747 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 748 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 749 | Theft | FAERS: 1 | US FAERS | |
| 750 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 751 | Therapy cessation | FAERS: 1 | US FAERS | |
| 752 | Thrombocytosis | FAERS: 1 | SIDER US FAERS | |
| 753 | Tinea cruris | FAERS: 1 | US FAERS | |
| 754 | Tongue biting | FAERS: 1 | US FAERS | |
| 755 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 756 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 757 | Transaminases increased | FAERS: 1 | US FAERS | |
| 758 | Ulcer | FAERS: 1 | US FAERS | |
| 759 | Unequal Limb Length | FAERS: 1 | US FAERS | |
| 760 | Urine osmolarity decreased | FAERS: 1 | US FAERS | |
| 761 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 762 | Ventricular hypoplasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 763 | Wound Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 764 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 765 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 766 | skin abrasion | FAERS: 1 | US FAERS | |
| 767 | Abnormal ejaculation | SIDER | ||
| 768 | Abnormal vision | OFFSIDES SIDER | ||
| 769 | Acarodermatitis | OFFSIDES | ||
| 770 | Acid reflux | OFFSIDES | ||
| 771 | Acute Coronary Syndrome | SIDER | ||
| 772 | Acute myocardial infarction | OFFSIDES | ||
| 773 | Acute otitis media | OFFSIDES | ||
| 774 | Acute overdose | SIDER | ||
| 775 | Acute psychosis | OFFSIDES | ||
| 776 | Adenocarcinoma | OFFSIDES | ||
| 777 | Adnexa uteri mass | OFFSIDES | ||
| 778 | Adnexitis | OFFSIDES | ||
| 779 | Affective Disorders, Psychotic | 10917412 | CTD | |
| 780 | Ageusia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 781 | Akathisia, Drug-Induced | CTD | ||
| 782 | Albuminuria | SIDER | ||
| 783 | Altered bowel function | OFFSIDES | ||
| 784 | Amblyopia | SIDER | ||
| 785 | Ammonia increased | OFFSIDES | ||
| 786 | Amphetamine-Related Disorders | 10911936 11377919 17105925 | CTD | |
| 787 | Anal Fissure | OFFSIDES | ||
| 788 | Anal candidiasis | OFFSIDES | ||
| 789 | Anaphylactic shock | SIDER | ||
| 790 | Anaphylactoid Reaction | SIDER | ||
| 791 | Angina Pectoris | SIDER | ||
| 792 | Anhidrosis | OFFSIDES | ||
| 793 | Anti-thyroid antibody positive | Canada Vigilance: 1 | Canada Vigilance | |
| 794 | Antisocial Personality Disorder | SIDER | ||
| 795 | Anxiety Disorders | CTD | ||
| 796 | Aphthous Stomatitis | OFFSIDES SIDER | ||
| 797 | Apnea | 7655131 | CTD | |
| 798 | Application site rash | OFFSIDES | ||
| 799 | Arthritis | OFFSIDES SIDER | ||
| 800 | Arthropod bite | OFFSIDES | ||
| 801 | Asterixis | OFFSIDES | ||
| 802 | Asthenozoospermia | 26348076 | CTD | |
| 803 | Atelectasis | SIDER | ||
| 804 | Attention Deficit Disorder | SIDER | ||
| 805 | Aura | OFFSIDES | ||
| 806 | Autistic Disorder | 15246500 18775368 19232924 | CTD | |
| 807 | Autoimmune hepatitis | OFFSIDES | ||
| 808 | Autonomic neuropathy | OFFSIDES | ||
| 809 | Avascular necrosis | OFFSIDES | ||
| 810 | Azoospermia | SIDER | ||
| 811 | Basal Ganglia Diseases | CTD | ||
| 812 | Biliary Colic | SIDER | ||
| 813 | Bladder pain | SIDER | ||
| 814 | Blepharitis | OFFSIDES SIDER | ||
| 815 | Blood Glucose | OFFSIDES | ||
| 816 | Blood cholesterol | OFFSIDES | ||
| 817 | Blood cortisol decreased | OFFSIDES | ||
| 818 | Blood count abnormal | OFFSIDES | ||
| 819 | Blood glucose abnormal | OFFSIDES | ||
| 820 | Blood immunoglobulin G increased | OFFSIDES | ||
| 821 | Blood magnesium decreased | OFFSIDES | ||
| 822 | Blood sodium | OFFSIDES | ||
| 823 | Blood urea increased | SIDER | ||
| 824 | Blurred vision | OFFSIDES | ||
| 825 | Bone infarction | OFFSIDES | ||
| 826 | Brain Concussion | OFFSIDES | ||
| 827 | Brain Diseases | 2005077 9251093 | CTD | |
| 828 | Brain Infarction | 9329236 | CTD | |
| 829 | Breast Feeding | SIDER | ||
| 830 | Breast cancer stage II | OFFSIDES | ||
| 831 | Breast engorgement | SIDER | ||
| 832 | Bronchitis | OFFSIDES SIDER | ||
| 833 | Buccoglossal syndrome | SIDER | ||
| 834 | Bulimia Nervosa | 9472839 11772696 | CTD | |
| 835 | Bulimia | 15478135 | CTD | |
| 836 | Carcinogenicity | SIDER | ||
| 837 | Cardiac ablation | OFFSIDES | ||
| 838 | Cardio-respiratory distress | OFFSIDES | ||
| 839 | Cardiomegaly | 21619414 | CTD | |
| 840 | Cardiovascular Diseases | 9585718 | CTD | |
| 841 | Catalepsy | 9567763 19445393 20464512 | CTD | |
| 842 | Cataplexy | 6976152 8164831 16186554 | CTD | |
| 843 | Cataract | OFFSIDES SIDER | ||
| 844 | Catheter sepsis | OFFSIDES | ||
| 845 | Central nervous system lesion | OFFSIDES | ||
| 846 | Cerebellar infarction | OFFSIDES | ||
| 847 | Cerebral Hemorrhage | 9017779 | CTD | |
| 848 | Cerebral artery occlusion | OFFSIDES | ||
| 849 | Cerebral cyst | OFFSIDES | ||
| 850 | Cervical dysplasia | OFFSIDES | ||
| 851 | Chemical and Drug Induced Liver Injury | 10469626 15930079 22331495 | CTD | |
| 852 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 853 | Chest wall pain | OFFSIDES | ||
| 854 | Cholangiolitis | OFFSIDES | ||
| 855 | Cholecystitis | SIDER | ||
| 856 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 857 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 858 | Chronic sinusitis | OFFSIDES | ||
| 859 | Circumoral paresthesia | SIDER | ||
| 860 | Cirrhosis | OFFSIDES | ||
| 861 | Cluster Headache | OFFSIDES | ||
| 862 | Cocaine-Related Disorders | 10545663 17850417 19859697 | CTD | |
| 863 | Cognition Disorders | 2053640 | CTD | |
| 864 | Colitis | OFFSIDES SIDER | ||
| 865 | Colonic Neoplasms | 21554931 | CTD | |
| 866 | Conduct Disorder | 12046001 | CTD | |
| 867 | Confusion | 10928399 11078032 | CTD | |
| 868 | Congenital pyelocaliectasis | OFFSIDES | ||
| 869 | Conjunctivitis | SIDER | ||
| 870 | Corneal lesion | SIDER | ||
| 871 | Cramps of lower extremities | SIDER | ||
| 872 | Creatine Phosphokinase Increased | SIDER | ||
| 873 | Cubital Tunnel Syndrome | OFFSIDES | ||
| 874 | Culture positive | OFFSIDES | ||
| 875 | Cytolytic hepatitis | OFFSIDES | ||
| 876 | Cytomegalovirus antibody positive | OFFSIDES | ||
| 877 | Debridement | OFFSIDES | ||
| 878 | Decreased Libido | OFFSIDES | ||
| 879 | Dental abscess | OFFSIDES | ||
| 880 | Dependence | SIDER | ||
| 881 | Depressive disorder |
1460171
1525285 1564030 1575264 1765576 1883009 1897625 1928483 2016249 2107764 2136402 2258459 2295587 2531772 3307982 3882679 3897204 7625480 7655131 7714232 8010365 8195457 8253700 8256637 8267117 8494083 8547460 8561837 8562668 9201375 9596448 9617977 10084445 10327919 10401918 10671393 10755087 10917412 11181988 11304903 11488371 12046001 12082591 12527476 12586234 14658981 14870959 15014590 16636635 17110836 17414231 17803018 17950541 18593793 19018805 19477151 19605942 19894377 20196181 20584552 20816900 21945287 23770692 24125781 24952232 25218989 26454213 26475043 29107002 29291430 31586550 | CTD | |
| 882 | Device leakage | OFFSIDES | ||
| 883 | Diabetes | OFFSIDES | ||
| 884 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 885 | Diabetic Ketoacidosis | SIDER | ||
| 886 | Diabetic Retinopathy | OFFSIDES | ||
| 887 | Diarrhea | 3500189 9632030 10928399 | CTD OFFSIDES | |
| 888 | Diastolic dysfunction | OFFSIDES | ||
| 889 | Disorders of Excessive Somnolence | 2136402 | CTD | |
| 890 | Disruptive, Impulse Control, and Conduct Disorders | 25369145 | CTD | |
| 891 | Diuresis | SIDER | ||
| 892 | Diverticulitis | SIDER | ||
| 893 | Drowsiness | OFFSIDES SIDER | ||
| 894 | Drug Tolerance | SIDER | ||
| 895 | Drug addict | OFFSIDES | ||
| 896 | Drug seeking behavior | SIDER | ||
| 897 | Duodenal Ulcer | SIDER | ||
| 898 | Dyskinesia, Drug-Induced | CTD | ||
| 899 | Dyspareunia | OFFSIDES SIDER | ||
| 900 | Dysthymic Disorder | OFFSIDES | ||
| 901 | Edema | 12798668 | CTD | |
| 902 | Ejection Fraction Decreased | OFFSIDES | ||
| 903 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 904 | Electrocardiogram repolarisation abnormality | Canada Vigilance: 2 | Canada Vigilance | |
| 905 | Encephalitis | OFFSIDES | ||
| 906 | Endometriosis | 9098464 | CTD OFFSIDES | |
| 907 | Enlargement abdomen | SIDER | ||
| 908 | Enteritis | SIDER | ||
| 909 | Enterocolitis | SIDER | ||
| 910 | Eosinophilia | SIDER | ||
| 911 | Eosinophilic Pneumonia | SIDER | ||
| 912 | Epididymitis | SIDER | ||
| 913 | Essential Tremor | OFFSIDES | ||
| 914 | Excitation cerebral | SIDER | ||
| 915 | Exophthalmos | SIDER | ||
| 916 | Extremity contracture | OFFSIDES | ||
| 917 | Facial Neuralgia | OFFSIDES | ||
| 918 | Factor VIII Deficiency | OFFSIDES | ||
| 919 | Failure to Thrive | OFFSIDES | ||
| 920 | Fatty Liver | OFFSIDES | ||
| 921 | Feeding and Eating Disorders | 11439417 | CTD | |
| 922 | Female sexual dysfunction | OFFSIDES SIDER | ||
| 923 | Fetal Diseases | 17702969 | CTD | |
| 924 | Folliculitis | OFFSIDES | ||
| 925 | Foreign body trauma | OFFSIDES | ||
| 926 | Furunculosis | SIDER | ||
| 927 | Gait Disorders, Neurologic | 1602320 | CTD | |
| 928 | Gastric Bypass | OFFSIDES | ||
| 929 | Gastric pH decreased | SIDER | ||
| 930 | Gastric ulcer | OFFSIDES SIDER | ||
| 931 | Gastroenteritis | 11078032 | CTD OFFSIDES SIDER | |
| 932 | Gastrointestinal Diseases | 10505588 | CTD | |
| 933 | Gastrointestinal motility disorder | OFFSIDES | ||
| 934 | Gastrooesophageal reflux prophylaxis | OFFSIDES | ||
| 935 | Giardiasis | OFFSIDES | ||
| 936 | Gingivitis | SIDER | ||
| 937 | Glossitis | SIDER | ||
| 938 | Glycosuria | SIDER | ||
| 939 | Goiter | OFFSIDES | ||
| 940 | Growth Disorders | 10469626 | CTD | |
| 941 | Hallucinations | CTD | ||
| 942 | Hay fever | OFFSIDES | ||
| 943 | Hearing Loss | 2356881 | CTD | |
| 944 | Heart Block | 7905586 | CTD | |
| 945 | Heart Diseases | 8286821 8547749 | CTD | |
| 946 | Hemorrhage of colon | SIDER | ||
| 947 | Hepatitis C antibody positive | OFFSIDES | ||
| 948 | Hepatomegaly | 28108177 | CTD SIDER | |
| 949 | Heroin Dependence | 19150250 | CTD | |
| 950 | Hirsutism | SIDER | ||
| 951 | Hydrocephalus | OFFSIDES SIDER | ||
| 952 | Hyperalgesia | 15336946 21167239 | CTD | |
| 953 | Hyperchlorhydria | SIDER | ||
| 954 | Hyperkinesia | SIDER | ||
| 955 | Hyperpigmentation | 26443706 | CTD OFFSIDES | |
| 956 | Hyperplasia | SIDER | ||
| 957 | Hyperprolactinemia | 9098464 16848655 18585544 | CTD | |
| 958 | Hypersplenism acquired | OFFSIDES | ||
| 959 | Hypesthesia | CTD | ||
| 960 | Hypocoagulable state | OFFSIDES | ||
| 961 | Hyponatremia | CTD | ||
| 962 | Hypoxia-Ischemia, Brain | 16887358 | CTD | |
| 963 | Hysterectomy | OFFSIDES | ||
| 964 | Hysteria | SIDER | ||
| 965 | Immobile | SIDER | ||
| 966 | Impetigo | OFFSIDES | ||
| 967 | Infusion site mobility decreased | OFFSIDES | ||
| 968 | Injection site cellulitis | OFFSIDES | ||
| 969 | Injection site vesicles | OFFSIDES | ||
| 970 | Intentional injury | SIDER | ||
| 971 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 972 | Intervertebral disc disorder | OFFSIDES | ||
| 973 | Intestinal Perforation | OFFSIDES | ||
| 974 | Joint Range of Motion Decreased | OFFSIDES | ||
| 975 | Keratitis sicca | OFFSIDES | ||
| 976 | Kidney Failure | OFFSIDES | ||
| 977 | Large intestine perforation | OFFSIDES | ||
| 978 | Laryngeal Diseases | 20175668 | CTD | |
| 979 | Leukopenia | SIDER | ||
| 980 | Leukorrhea | SIDER | ||
| 981 | Ligament injury | OFFSIDES | ||
| 982 | Lightheadedness | SIDER | ||
| 983 | Lipase | OFFSIDES | ||
| 984 | Lipids abnormal | OFFSIDES | ||
| 985 | Liver Abscess | OFFSIDES | ||
| 986 | Liver fatty deposition | SIDER | ||
| 987 | Lung consolidation | OFFSIDES | ||
| 988 | Lyme Disease | OFFSIDES | ||
| 989 | Lymphocytosis | SIDER | ||
| 990 | Lymphoma | SIDER | ||
| 991 | Malignant syndrome NOS | SIDER | ||
| 992 | Malnutrition | SIDER | ||
| 993 | Manic psychosis | SIDER | ||
| 994 | Mastectomy | OFFSIDES | ||
| 995 | Medication tampering | OFFSIDES | ||
| 996 | Memory Disorders | 8407756 19914299 | CTD | |
| 997 | Menopause | SIDER | ||
| 998 | Mental disorders | CTD | ||
| 999 | Metrorrhagia | SIDER | ||
| 1000 | Migraine with Aura | 8331094 | CTD | |
| 1001 | Mood Disorders | 2221174 3266222 7884020 | CTD | |
| 1002 | Movement Disorders | CTD | ||
| 1003 | Multiple Sclerosis | OFFSIDES | ||
| 1004 | Muscle strain | OFFSIDES | ||
| 1005 | Myasthenic Syndromes, Congenital | 12771277 | CTD | |
| 1006 | Neck stiffness | SIDER | ||
| 1007 | Necrolysis epidermal | SIDER | ||
| 1008 | Necrosis | 10868505 | CTD SIDER | |
| 1009 | Neoplasms, Experimental | 21497159 | CTD | |
| 1010 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1011 | Nephrolithiasis | OFFSIDES SIDER | ||
| 1012 | Nervous tension | OFFSIDES | ||
| 1013 | Neuritis | SIDER | ||
| 1014 | Neurocognitive Disorders | 2221174 7840369 | CTD | |
| 1015 | Neurologic Manifestations | 11076330 | CTD | |
| 1016 | Neuropathic pain | OFFSIDES | ||
| 1017 | Neuropathy | SIDER | ||
| 1018 | Nocturia | SIDER | ||
| 1019 | Nuchal Rigidity | SIDER | ||
| 1020 | Numbness | SIDER | ||
| 1021 | Ocular Motility Disorders | 7779244 | CTD | |
| 1022 | Ocular icterus | OFFSIDES | ||
| 1023 | Oligospermia | 26348076 | CTD SIDER | |
| 1024 | Onychoclasis | Canada Vigilance: 1 | Canada Vigilance | |
| 1025 | Optic Neuritis | SIDER | ||
| 1026 | Orchitis noninfective | SIDER | ||
| 1027 | Orchitis | SIDER | ||
| 1028 | Oropharyngeal spasm | OFFSIDES | ||
| 1029 | Osteomyelitis | OFFSIDES SIDER | ||
| 1030 | Osteoporosis | SIDER | ||
| 1031 | Pancreatic enzymes increased | OFFSIDES | ||
| 1032 | Paranoid reaction | SIDER | ||
| 1033 | Paresthesia | 2356884 | CTD | |
| 1034 | Pelvic Pain | SIDER | ||
| 1035 | Penile Diseases | 1575264 1928483 | CTD | |
| 1036 | Peptic Ulcer | SIDER | ||
| 1037 | Pericarditis | OFFSIDES | ||
| 1038 | Periodontal Diseases | 21966942 | CTD | |
| 1039 | Peripheral embolism | OFFSIDES | ||
| 1040 | Peritonitis | OFFSIDES | ||
| 1041 | Personality Disorders | 11395183 20010449 | CTD | |
| 1042 | Pheochromocytoma | 8094789 | CTD | |
| 1043 | Phlebitis | SIDER | ||
| 1044 | Pick Disease of the Brain | 8041377 | CTD | |
| 1045 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 1046 | Pneumothorax | OFFSIDES SIDER | ||
| 1047 | Polyuria | SIDER | ||
| 1048 | Post procedural discharge | OFFSIDES | ||
| 1049 | Postoperative infection | OFFSIDES | ||
| 1050 | Precancerous Conditions | 10469626 | CTD | |
| 1051 | Precocious Puberty | OFFSIDES | ||
| 1052 | Prenatal Exposure Delayed Effects | 17850417 | CTD | |
| 1053 | Prothrombin level decreased | OFFSIDES | ||
| 1054 | Pseudarthrosis | OFFSIDES | ||
| 1055 | Psychoses, Substance-Induced | 1407229 | CTD | |
| 1056 | Pulmonary toxicity | OFFSIDES | ||
| 1057 | Purpura | SIDER | ||
| 1058 | Purpuric rash | SIDER | ||
| 1059 | Pyelonephritis | SIDER | ||
| 1060 | Pyuria | SIDER | ||
| 1061 | REM Sleep Behavior Disorder | 17803018 | CTD | |
| 1062 | Rash erythematous | Canada Vigilance: 1 | Canada Vigilance | |
| 1063 | Raynaud Disease | 9171912 | CTD | |
| 1064 | Rectal tenesmus | OFFSIDES | ||
| 1065 | Reflux laryngitis | OFFSIDES | ||
| 1066 | Renal tubular necrosis | OFFSIDES | ||
| 1067 | Rheumatoid Arthritis | SIDER | ||
| 1068 | Rhinitis | 2071559 | CTD OFFSIDES SIDER | |
| 1069 | Rhinorrhea | OFFSIDES | ||
| 1070 | Salpingitis | SIDER | ||
| 1071 | Sarcoidosis | OFFSIDES | ||
| 1072 | Scleritis | SIDER | ||
| 1073 | Scotoma | SIDER | ||
| 1074 | Sedation complication | Canada Vigilance: 1 | Canada Vigilance | |
| 1075 | Seizures |
1552045
1557494 1590506 1734754 1898627 2107764 2785443 2786293 7618791 8162401 8195457 9085399 9596448 10731855 10743914 10773209 11181988 12423383 15582832 15619548 16125150 17011125 | CTD | |
| 1076 | Sensation Disorders | 15563365 | CTD | |
| 1077 | Sequestrectomy | OFFSIDES | ||
| 1078 | Skin Induration | OFFSIDES | ||
| 1079 | Skin lesion | OFFSIDES | ||
| 1080 | Skin tightness | OFFSIDES | ||
| 1081 | Sleep Bruxism | 11157444 | CTD | |
| 1082 | Sleep Initiation and Maintenance Disorders | CTD | ||
| 1083 | Sleep Wake Disorders | 9184611 9326748 | CTD | |
| 1084 | Small Intestinal Stenosis | OFFSIDES | ||
| 1085 | Small intestine carcinoma | OFFSIDES | ||
| 1086 | Soft tissue inflammation | OFFSIDES | ||
| 1087 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 1088 | Status Epilepticus | 8016019 | CTD | |
| 1089 | Stomatitis | SIDER | ||
| 1090 | Stuttering | 2298709 11485152 | CTD | |
| 1091 | Subcutaneous Abscess | OFFSIDES | ||
| 1092 | Subcutaneous Emphysema | OFFSIDES | ||
| 1093 | Subcutaneous nodule | OFFSIDES | ||
| 1094 | Substance Withdrawal Syndrome | CTD | ||
| 1095 | Sudden death | OFFSIDES | ||
| 1096 | Suicide | SIDER | ||
| 1097 | Suprapubic pain | OFFSIDES | ||
| 1098 | Suspected product tampering | Canada Vigilance: 1 | Canada Vigilance | |
| 1099 | Sweating | SIDER | ||
| 1100 | Synovial Cyst | OFFSIDES | ||
| 1101 | Temporal Arteritis | OFFSIDES | ||
| 1102 | Tenosynovitis | SIDER | ||
| 1103 | Testicular Diseases | 26348076 | CTD | |
| 1104 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 1105 | Thoracotomy | OFFSIDES | ||
| 1106 | Thrombocytopenic purpura | SIDER | ||
| 1107 | Thrombophlebitis | SIDER | ||
| 1108 | Tobacco Use Disorder | 11377919 | CTD | |
| 1109 | Tolerance development | SIDER | ||
| 1110 | Tooth Extraction | OFFSIDES | ||
| 1111 | Torsades de Pointes | 7628890 9681092 16449492 | CTD | |
| 1112 | Urethritis noninfective | SIDER | ||
| 1113 | Urethritis | SIDER | ||
| 1114 | Urination Disorders | 7500682 | CTD | |
| 1115 | Urine output increased | SIDER | ||
| 1116 | Urolithiasis | SIDER | ||
| 1117 | Uterine fibroids enlarged | SIDER | ||
| 1118 | Uterine spasm | SIDER | ||
| 1119 | Vaginal Discharge | SIDER | ||
| 1120 | Vaginal Diseases | 8494083 10755087 | CTD | |
| 1121 | Vascular purpura | SIDER | ||
| 1122 | Vasculitis | 8520068 10868505 17373154 | CTD SIDER | |
| 1123 | Vasospasm | SIDER | ||
| 1124 | Venous Thrombosis | 8616279 12724510 | CTD | |
| 1125 | Ventricular arrhythmia | SIDER | ||
| 1126 | Vesiculobullous rash | SIDER | ||
| 1127 | Violent | SIDER | ||
| 1128 | Vision Disorders | 3500189 | CTD | |
| 1129 | Weight Gain | 19344674 | CTD OFFSIDES | |
| 1130 | Xerostomia | 9632030 10327919 | CTD | |
| 1131 | colonoscopy | OFFSIDES | ||
| 1132 | effusion | OFFSIDES | ||
| 1133 | furuncle | OFFSIDES SIDER | ||
| 1134 | muscle injury | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.