Fentanyl
(PJMPHNIQZUBGLI-UHFFFAOYSA-N)
Structure
- SMILES
- CCC(=O)N(c1ccccc1)C1CCN(CC1)CCc1ccccc1
- Type(s)
- Approved; Illicit; Investigational; Vet_approved
- ATC code(s)
- N01AH01; N01AH51; N02AB03
- Molecular Formula:
- C22H28N2O
- Molecular Weight:
- 336.471
- Log P:
- 4.0746
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 0
- TPSA:
- 23.55
- CAS Number(s):
- 437-38-7
Synonym(s)
1.
Fentanyl
2.
Phentanyl
3.
Duragesic
4.
Durogesic
5.
Fentanest
6.
Fentanyl Citrate
7.
Fentora
8.
R-4263
9.
Sublimaze
10.
Transmucosal Oral Fentanyl Citrate
11.
R 4263
12.
R4263
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Wrong technique in drug usage process | FAERS: 4162 | OFFSIDES US FAERS | |
| 2 | Product quality issue | FAERS: 3479 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Drug ineffective | FAERS: 3153 Canada Vigilance: 82 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Product adhesion issue | FAERS: 2982 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 5 | Pain | FAERS: 1812 Canada Vigilance: 22 |
35781
526382 1294918 2311157 2358560 3919524 4025853 6132369 6771831 7128786 7645789 8644975 8803381 8986972 9060031 10481417 10691234 11027906 11501851 11707788 11973202 12075649 12222557 12380661 12459700 14570661 15025835 15645768 16043000 16043013 16129988 16418084 17689623 17872872 17906213 18008122 18222628 18292686 19040334 19200067 19317728 19697012 19803312 19838028 19904081 20015921 20529380 20800358 20820150 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 6 | Drug prescribing error | FAERS: 1686 | OFFSIDES US FAERS | |
| 7 | Inappropriate schedule of drug administration | FAERS: 1392 | OFFSIDES US FAERS | |
| 8 | Wrong technique in product usage process | FAERS: 1257 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 9 | Drug dose omission | FAERS: 1186 | OFFSIDES US FAERS | |
| 10 | Overdose | FAERS: 1121 Canada Vigilance: 136 | Canada Vigilance US FAERS | |
| 11 | Nausea | FAERS: 1044 Canada Vigilance: 17 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 12 | Vomiting | FAERS: 781 Canada Vigilance: 4 | CTD SIDER Canada Vigilance US FAERS | |
| 13 | Somnolence | FAERS: 664 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 14 | Malaise | FAERS: 662 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 15 | Drug withdrawal syndrome | FAERS: 625 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 16 | Pharmaceutical product complaint | FAERS: 612 | OFFSIDES US FAERS | |
| 17 | Dizziness | FAERS: 592 Canada Vigilance: 8 | CTD SIDER Canada Vigilance US FAERS | |
| 18 | Drug administered at inappropriate site | FAERS: 586 | OFFSIDES US FAERS | |
| 19 | Inadequate analgesia | FAERS: 580 | US FAERS | |
| 20 | Toxicity to various agents | FAERS: 579 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 21 | Incorrect drug administration duration | FAERS: 493 | OFFSIDES US FAERS | |
| 22 | Feeling abnormal | FAERS: 488 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 23 | Application site erythema | FAERS: 478 | OFFSIDES US FAERS | |
| 24 | Drug abuse | FAERS: 475 Canada Vigilance: 74 | Canada Vigilance SIDER US FAERS | |
| 25 | Application site pruritus | FAERS: 471 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 26 | Drug administration error | FAERS: 459 | OFFSIDES US FAERS | |
| 27 | Application site rash | FAERS: 402 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 28 | Medication Error | FAERS: 382 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 29 | Headache | FAERS: 371 Canada Vigilance: 3 | 11554966 18181379 20800358 | CTD SIDER Canada Vigilance US FAERS |
| 30 | Intentional drug misuse | FAERS: 344 | SIDER US FAERS | |
| 31 | Pruritus | FAERS: 339 Canada Vigilance: 11 | CTD SIDER Canada Vigilance US FAERS | |
| 32 | Breakthrough Pain | FAERS: 337 | OFFSIDES US FAERS | |
| 33 | Product substitution issue | FAERS: 325 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 34 | Application site irritation | FAERS: 302 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 35 | Adverse event | FAERS: 298 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Malignant neoplasm progression | FAERS: 290 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 37 | Tremor | FAERS: 271 Canada Vigilance: 5 | 3688511 9060031 | CTD SIDER Canada Vigilance US FAERS |
| 38 | Incorrect dose administered | FAERS: 268 | US FAERS | |
| 39 | Application site pain | FAERS: 255 | SIDER US FAERS | |
| 40 | Accidental overdose | FAERS: 251 Canada Vigilance: 19 | Canada Vigilance SIDER US FAERS | |
| 41 | Anxiety | FAERS: 250 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 42 | Weight decreased | FAERS: 239 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 43 | Fatigue | FAERS: 236 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 44 | Constipation | FAERS: 234 Canada Vigilance: 3 | 11501851 15025835 | CTD SIDER Canada Vigilance US FAERS |
| 45 | Incorrect route of drug administration | FAERS: 216 | US FAERS | |
| 46 | Respiratory Depression | FAERS: 215 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 47 | Application site reaction | FAERS: 208 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 48 | Drug diversion | FAERS: 204 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 49 | Drug toxicity | FAERS: 201 | OFFSIDES US FAERS | |
| 50 | Asthenia | FAERS: 199 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 51 | Back Pain | FAERS: 197 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 52 | Application site vesicles | FAERS: 193 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 53 | Device leakage | FAERS: 193 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Drug abuser | FAERS: 193 | US FAERS | |
| 55 | Respiratory arrest | FAERS: 171 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 56 | Pneumonia | FAERS: 169 | SIDER US FAERS | |
| 57 | Poor quality drug administered | FAERS: 169 | US FAERS | |
| 58 | Intentional product misuse | FAERS: 165 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 59 | Chills | FAERS: 163 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Lethargy | FAERS: 163 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 61 | Unresponsive to stimuli | FAERS: 160 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 62 | No adverse event | FAERS: 149 | US FAERS | |
| 63 | Delirium | FAERS: 147 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 64 | Drug effect incomplete | FAERS: 146 | US FAERS | |
| 65 | Depressed Level of Consciousness | FAERS: 134 Canada Vigilance: 16 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 66 | Product physical issue | FAERS: 131 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Application site burn | FAERS: 130 | US FAERS | |
| 68 | Cerebrovascular accident | FAERS: 118 | US FAERS | |
| 69 | Erythema | FAERS: 118 Canada Vigilance: 6 | 18181379 | CTD SIDER Canada Vigilance US FAERS |
| 70 | Accidental exposure | FAERS: 116 | US FAERS | |
| 71 | Drug Dependence | FAERS: 116 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 72 | Skin irritation | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Chest Pain | FAERS: 115 Canada Vigilance: 3 | 10960295 | CTD SIDER Canada Vigilance US FAERS |
| 74 | Drug dispensing error | FAERS: 115 | US FAERS | |
| 75 | Expired drug administered | FAERS: 114 | US FAERS | |
| 76 | Disorientation | FAERS: 109 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Myocardial Infarction | FAERS: 109 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Therapeutic response unexpected with drug substitution | FAERS: 107 | US FAERS | |
| 79 | Urticaria | FAERS: 107 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 80 | Agitation | FAERS: 106 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 81 | Completed Suicide | FAERS: 106 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 82 | Cardiac Arrest | FAERS: 103 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 83 | Product packaging quantity issue | FAERS: 103 | US FAERS | |
| 84 | Hypersensitivity | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 85 | Palpitations | FAERS: 101 | SIDER US FAERS | |
| 86 | Accidental death | FAERS: 98 | US FAERS | |
| 87 | Dehydration | FAERS: 98 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 88 | Nervousness | FAERS: 98 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 89 | Unevaluable event | FAERS: 98 | US FAERS | |
| 90 | Hypotension | FAERS: 97 Canada Vigilance: 3 |
481612
1675391 2131881 2358560 3284271 3493358 5131458 6411105 8053578 8067230 8130053 8590509 9037435 9249836 9771299 10481417 10638892 11581460 15449752 15765343 15957693 15966388 16115962 16786914 17319428 17321923 18544179 19731845 19957053 | CTD SIDER Canada Vigilance US FAERS |
| 91 | Device adhesion issue | FAERS: 94 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 92 | Respiratory Failure | FAERS: 92 | SIDER US FAERS | |
| 93 | Arthralgia | FAERS: 90 | SIDER US FAERS | |
| 94 | Cold sweat | FAERS: 87 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 95 | Restlessness | FAERS: 87 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 96 | Memory impairment | FAERS: 86 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 97 | Product dose omission | FAERS: 86 | US FAERS | |
| 98 | Product packaging issue | FAERS: 86 | US FAERS | |
| 99 | Burning sensation | FAERS: 84 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 100 | Hypersomnia | FAERS: 84 | US FAERS | |
| 101 | Abdominal discomfort | FAERS: 83 | OFFSIDES SIDER US FAERS | |
| 102 | Disease Progression | FAERS: 83 | OFFSIDES US FAERS | |
| 103 | Narcotic intoxication | FAERS: 83 | OFFSIDES US FAERS | |
| 104 | Accidental exposure to product | FAERS: 81 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 105 | Amnesia | FAERS: 81 | 5131458 | CTD OFFSIDES SIDER US FAERS |
| 106 | Cyanosis | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 107 | Device Failure | FAERS: 77 | US FAERS | |
| 108 | Intentional misuse | FAERS: 77 | US FAERS | |
| 109 | Accidental exposure to product by child | FAERS: 73 | US FAERS | |
| 110 | Drug screen negative | FAERS: 73 | US FAERS | |
| 111 | Product availability issue | FAERS: 73 | US FAERS | |
| 112 | Feeling Cold | FAERS: 71 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 113 | Product use issue | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Abdominal Pain | FAERS: 68 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 115 | Intentional product use issue | FAERS: 68 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 116 | Application site erosion | FAERS: 66 | US FAERS | |
| 117 | Anorexia | FAERS: 64 | SIDER US FAERS | |
| 118 | Expired product administered | FAERS: 64 | US FAERS | |
| 119 | Discomfort | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 120 | Mental status changes | FAERS: 58 | OFFSIDES SIDER US FAERS | |
| 121 | Drug Tolerance | FAERS: 54 | OFFSIDES US FAERS | |
| 122 | Euphoric mood | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 123 | Incorrect drug administration rate | FAERS: 54 | US FAERS | |
| 124 | Bedridden | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Therapy cessation | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Product complaint | FAERS: 52 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 127 | Crying | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Drug level increased | FAERS: 51 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 129 | Hypoxia | FAERS: 51 | CTD SIDER US FAERS | |
| 130 | Abasia | FAERS: 50 | US FAERS | |
| 131 | Application site exfoliation | FAERS: 50 | US FAERS | |
| 132 | Application site urticaria | FAERS: 49 | OFFSIDES US FAERS | |
| 133 | Dysarthria | FAERS: 49 | SIDER US FAERS | |
| 134 | General physical health deterioration | FAERS: 49 | OFFSIDES US FAERS | |
| 135 | Bradycardia | FAERS: 48 Canada Vigilance: 5 |
481612
564641 1678901 1989731 2131881 2892519 3149155 5131458 7189340 7629934 7943823 8059057 8130053 9037435 9223206 9952103 10481417 11581460 14984867 17697771 18544179 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 136 | Chest discomfort | FAERS: 48 | SIDER US FAERS | |
| 137 | Suicide attempt | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Dysgeusia | FAERS: 46 | 20800358 | CTD OFFSIDES SIDER US FAERS |
| 139 | Night sweats | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 140 | Tachycardia | FAERS: 46 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 141 | Disability | FAERS: 45 | US FAERS | |
| 142 | Infection | FAERS: 45 | OFFSIDES SIDER US FAERS | |
| 143 | Syncope | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 144 | Muscle Rigidity | FAERS: 44 Canada Vigilance: 4 |
274086
1758246 1931065 2077987 2304628 2499224 2556653 2564649 2644747 3257727 3337659 3438022 3780697 6829933 6829964 6859587 6943947 7194606 7294381 7550544 8015726 8036282 8039989 8130053 8233045 8265680 8466061 8577396 8703464 8848244 8903304 8956951 9054252 9131668 9166335 9416730 9877042 10654227 10675796 10752838 10928600 12885182 18950344 19471184 19755623 20118943 | CTD SIDER Canada Vigilance US FAERS |
| 145 | Vertigo | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 146 | Formication | FAERS: 43 | OFFSIDES US FAERS | |
| 147 | Drug screen positive | FAERS: 42 | US FAERS | |
| 148 | Hypoventilation | FAERS: 42 | SIDER US FAERS | |
| 149 | Product use in unapproved indication | FAERS: 42 | US FAERS | |
| 150 | Back disorder | FAERS: 41 | US FAERS | |
| 151 | Arthritis | FAERS: 40 | SIDER US FAERS | |
| 152 | Dependence | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 153 | Myalgia | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 154 | Application site swelling | FAERS: 39 | US FAERS | |
| 155 | Feeling of body temperature change | FAERS: 39 | SIDER US FAERS | |
| 156 | Product leakage | FAERS: 39 | US FAERS | |
| 157 | Diabetes Mellitus | FAERS: 37 | US FAERS | |
| 158 | Dysuria | FAERS: 37 | OFFSIDES SIDER US FAERS | |
| 159 | Emotional distress | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Influenza | FAERS: 37 | SIDER US FAERS | |
| 161 | Retching | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 162 | Sepsis | FAERS: 36 | SIDER US FAERS | |
| 163 | Application site scar | FAERS: 35 | US FAERS | |
| 164 | Application site ulcer | FAERS: 35 | SIDER US FAERS | |
| 165 | Accidental drug intake by child | FAERS: 34 | US FAERS | |
| 166 | Aphasia | FAERS: 34 | SIDER US FAERS | |
| 167 | Neuralgia | FAERS: 34 | OFFSIDES US FAERS | |
| 168 | Pancreatic carcinoma | FAERS: 34 | US FAERS | |
| 169 | Drug ineffective for unapproved indication | FAERS: 33 | US FAERS | |
| 170 | Mental impairment | FAERS: 33 | US FAERS | |
| 171 | Nasopharyngitis | FAERS: 33 | 20800358 | CTD OFFSIDES SIDER US FAERS |
| 172 | Neck Pain | FAERS: 33 | SIDER US FAERS | |
| 173 | Activities of daily living impaired | FAERS: 32 | US FAERS | |
| 174 | Application site scab | FAERS: 32 | US FAERS | |
| 175 | Feeling jittery | FAERS: 32 | SIDER US FAERS | |
| 176 | Stress | FAERS: 32 | US FAERS | |
| 177 | Dry skin | FAERS: 31 | US FAERS | |
| 178 | Intestinal Obstruction | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 179 | Respiratory distress | FAERS: 31 | SIDER US FAERS | |
| 180 | Skin reaction | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 181 | Visual Impairment | FAERS: 31 | SIDER US FAERS | |
| 182 | Tinnitus | FAERS: 30 | SIDER US FAERS | |
| 183 | Dementia | FAERS: 29 | US FAERS | |
| 184 | Restless Legs Syndrome | FAERS: 29 | US FAERS | |
| 185 | Urinary tract infection | FAERS: 29 | SIDER US FAERS | |
| 186 | Thermal burn | FAERS: 28 | US FAERS | |
| 187 | Thrombosis | FAERS: 28 | US FAERS | |
| 188 | Analgesic drug level increased | FAERS: 27 | US FAERS | |
| 189 | Hypokinesia | FAERS: 27 Canada Vigilance: 1 | 19471184 | CTD SIDER Canada Vigilance US FAERS |
| 190 | Incoherent | FAERS: 27 | US FAERS | |
| 191 | Product label issue | FAERS: 27 | US FAERS | |
| 192 | Stomatitis | FAERS: 27 | SIDER US FAERS | |
| 193 | Therapeutic response unexpected | FAERS: 27 | US FAERS | |
| 194 | Urinary Retention | FAERS: 27 | CTD SIDER US FAERS | |
| 195 | Altered state of consciousness | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 196 | Blood glucose increased | FAERS: 26 | SIDER US FAERS | |
| 197 | Flushing | FAERS: 26 | SIDER US FAERS | |
| 198 | Joint injury | FAERS: 26 | US FAERS | |
| 199 | Pulmonary Embolism | FAERS: 26 | SIDER US FAERS | |
| 200 | Pulmonary congestion | FAERS: 26 | US FAERS | |
| 201 | Sopor | FAERS: 26 | US FAERS | |
| 202 | Application site laceration | FAERS: 25 | US FAERS | |
| 203 | Cellulitis | FAERS: 25 | SIDER US FAERS | |
| 204 | Depressed mood | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Drug effect delayed | FAERS: 25 | US FAERS | |
| 206 | Impaired work ability | FAERS: 25 | US FAERS | |
| 207 | Musculoskeletal stiffness | FAERS: 25 | SIDER US FAERS | |
| 208 | Bronchitis | FAERS: 24 | SIDER US FAERS | |
| 209 | Fibromyalgia | FAERS: 24 | US FAERS | |
| 210 | Acute kidney injury | FAERS: 23 | US FAERS | |
| 211 | Alopecia | FAERS: 23 | SIDER US FAERS | |
| 212 | Drug exposure during pregnancy | FAERS: 23 | US FAERS | |
| 213 | Hospice Care | FAERS: 23 | US FAERS | |
| 214 | Wheezing | FAERS: 23 | SIDER US FAERS | |
| 215 | Arthropathy | FAERS: 22 | SIDER US FAERS | |
| 216 | Asthma | FAERS: 22 | SIDER US FAERS | |
| 217 | Coma scale abnormal | FAERS: 22 Canada Vigilance: 36 | Canada Vigilance US FAERS | |
| 218 | Impaired driving ability | FAERS: 22 | US FAERS | |
| 219 | Pancreatitis | FAERS: 22 | US FAERS | |
| 220 | Peripheral swelling | FAERS: 22 | US FAERS | |
| 221 | Poisoning | FAERS: 22 | US FAERS | |
| 222 | Swelling | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 223 | Therapy naive | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 224 | Urinary Incontinence | FAERS: 22 | SIDER US FAERS | |
| 225 | Application site dryness | FAERS: 21 | US FAERS | |
| 226 | Application site perspiration | FAERS: 21 | US FAERS | |
| 227 | Emotional disorder | FAERS: 21 | US FAERS | |
| 228 | Incorrect product storage | FAERS: 21 | US FAERS | |
| 229 | Intervertebral Disc Degeneration | FAERS: 21 | US FAERS | |
| 230 | Blood cholesterol increased | FAERS: 20 | US FAERS | |
| 231 | Circumstance or information capable of leading to medication error | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | False negative investigation result | FAERS: 20 | US FAERS | |
| 233 | Musculoskeletal Pain | FAERS: 20 | SIDER US FAERS | |
| 234 | Rhabdomyolysis | FAERS: 20 | US FAERS | |
| 235 | Skin Ulcer | FAERS: 20 | SIDER US FAERS | |
| 236 | Angina Pectoris | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 237 | Nephrolithiasis | FAERS: 19 | US FAERS | |
| 238 | Therapeutic product effect decreased | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 239 | Atrial Fibrillation | FAERS: 18 | 18980425 | CTD US FAERS |
| 240 | Blindness | FAERS: 18 | US FAERS | |
| 241 | Device malfunction | FAERS: 18 | US FAERS | |
| 242 | Dyspepsia | FAERS: 18 | SIDER US FAERS | |
| 243 | Dysphonia | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 244 | Laceration | FAERS: 18 | US FAERS | |
| 245 | Leukoencephalopathy | FAERS: 18 | US FAERS | |
| 246 | Pallor | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 247 | Product tampering | FAERS: 18 | US FAERS | |
| 248 | Rash erythematous | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 249 | Application site warmth | FAERS: 17 | US FAERS | |
| 250 | Deafness | FAERS: 17 | US FAERS | |
| 251 | Hyperventilation | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 252 | Mood swings | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 253 | Mydriasis | FAERS: 17 | US FAERS | |
| 254 | Oropharyngeal pain | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 255 | Osteoporosis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Product outer packaging issue | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Anger | FAERS: 16 | US FAERS | |
| 258 | Apparent death | FAERS: 16 | US FAERS | |
| 259 | Incorrect route of product administration | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 260 | Medical device complication | FAERS: 16 | US FAERS | |
| 261 | Metastatic Neoplasm | FAERS: 16 | US FAERS | |
| 262 | Nerve injury | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 263 | Product size issue | FAERS: 16 | US FAERS | |
| 264 | Reaction to drug excipients | FAERS: 16 | US FAERS | |
| 265 | Amnestic Disorder | FAERS: 15 | US FAERS | |
| 266 | Anaphylactic shock | FAERS: 15 | SIDER US FAERS | |
| 267 | Application site hypersensitivity | FAERS: 15 | SIDER US FAERS | |
| 268 | Blood potassium decreased | FAERS: 15 | OFFSIDES US FAERS | |
| 269 | Cancer Pain | FAERS: 15 | SIDER US FAERS | |
| 270 | Intercepted medication error | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Joint swelling | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 272 | Lymphoma | FAERS: 15 | US FAERS | |
| 273 | Product storage error | FAERS: 15 | US FAERS | |
| 274 | Skin lesion | FAERS: 15 | SIDER US FAERS | |
| 275 | Sneezing | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 276 | Snoring | FAERS: 15 | US FAERS | |
| 277 | Yawning | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Application site inflammation | FAERS: 14 | US FAERS | |
| 279 | Bone pain | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 280 | Dental caries | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 281 | Diplopia | FAERS: 14 | US FAERS | |
| 282 | Epistaxis | FAERS: 14 | 20800358 | CTD SIDER US FAERS |
| 283 | Limb injury | FAERS: 14 | US FAERS | |
| 284 | Sciatica | FAERS: 14 | US FAERS | |
| 285 | Sinusitis | FAERS: 14 | SIDER US FAERS | |
| 286 | Spinal fusion surgery | FAERS: 14 | US FAERS | |
| 287 | Troponin increased | FAERS: 14 | US FAERS | |
| 288 | Wrong drug administered | FAERS: 14 | US FAERS | |
| 289 | nervous system disorder | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 290 | Acne | FAERS: 13 | US FAERS | |
| 291 | Cardiomegaly | FAERS: 13 | US FAERS | |
| 292 | Hypophagia | FAERS: 13 | US FAERS | |
| 293 | Inappropriate schedule of product administration | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 294 | Intervertebral disc disorder | FAERS: 13 | OFFSIDES US FAERS | |
| 295 | Muscle tightness | FAERS: 13 | US FAERS | |
| 296 | Paranoia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 297 | Product measured potency issue | FAERS: 13 | US FAERS | |
| 298 | Product taste abnormal | FAERS: 13 | US FAERS | |
| 299 | Scab | FAERS: 13 | US FAERS | |
| 300 | Ankle Fracture | FAERS: 12 | US FAERS | |
| 301 | Blood testosterone decreased | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Cataract | FAERS: 12 | US FAERS | |
| 303 | Cerebral Infarction | FAERS: 12 | US FAERS | |
| 304 | Cystitis | FAERS: 12 | US FAERS | |
| 305 | Incorrect dose administered by device | FAERS: 12 | US FAERS | |
| 306 | Multiple Myeloma | FAERS: 12 | US FAERS | |
| 307 | Product formulation issue | FAERS: 12 | US FAERS | |
| 308 | Rheumatoid Arthritis | FAERS: 12 | US FAERS | |
| 309 | Rotator cuff syndrome | FAERS: 12 | US FAERS | |
| 310 | Stupor | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 311 | Sudden death | FAERS: 12 | OFFSIDES US FAERS | |
| 312 | Therapeutic response delayed | FAERS: 12 | US FAERS | |
| 313 | Ulcer | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 314 | Visual disturbance | FAERS: 12 | SIDER US FAERS | |
| 315 | Analgesic drug level decreased | FAERS: 11 | US FAERS | |
| 316 | Application site discomfort | FAERS: 11 | US FAERS | |
| 317 | Application site infection | FAERS: 11 | US FAERS | |
| 318 | Application site papules | FAERS: 11 | US FAERS | |
| 319 | Blood urine present | FAERS: 11 | OFFSIDES US FAERS | |
| 320 | Carcinoma | FAERS: 11 | US FAERS | |
| 321 | Extra dose administered | FAERS: 11 | US FAERS | |
| 322 | Fracture | FAERS: 11 | US FAERS | |
| 323 | Loss of personal independence in daily activities | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 324 | Myoclonus | FAERS: 11 | CTD SIDER US FAERS | |
| 325 | Post procedural complication | FAERS: 11 | US FAERS | |
| 326 | Product administered at inappropriate site | FAERS: 11 | US FAERS | |
| 327 | Sunburn | FAERS: 11 | US FAERS | |
| 328 | Therapy change | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 329 | Tooth Loss | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 330 | Toxicologic test abnormal | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Blood glucose decreased | FAERS: 10 | US FAERS | |
| 332 | Brain Death | FAERS: 10 | US FAERS | |
| 333 | Diverticulitis | FAERS: 10 | US FAERS | |
| 334 | Drug level decreased | FAERS: 10 | US FAERS | |
| 335 | Menopause | FAERS: 10 | US FAERS | |
| 336 | Multiple Sclerosis | FAERS: 10 | US FAERS | |
| 337 | Personality Change | FAERS: 10 | US FAERS | |
| 338 | Physical product label issue | FAERS: 10 | US FAERS | |
| 339 | Presyncope | FAERS: 10 | US FAERS | |
| 340 | Product use complaint | FAERS: 10 | US FAERS | |
| 341 | Secretion discharge | FAERS: 10 | OFFSIDES US FAERS | |
| 342 | Therapeutic product ineffective | FAERS: 10 | US FAERS | |
| 343 | Alanine Aminotransferase Increased | FAERS: 9 | US FAERS | |
| 344 | Anoxic Encephalopathy | FAERS: 9 | OFFSIDES US FAERS | |
| 345 | Aspartate Aminotransferase Increased | FAERS: 9 | SIDER US FAERS | |
| 346 | Blood creatine phosphokinase increased | FAERS: 9 | US FAERS | |
| 347 | Blood pressure fluctuation | FAERS: 9 | US FAERS | |
| 348 | Cachexia | FAERS: 9 | SIDER US FAERS | |
| 349 | Choking | FAERS: 9 | OFFSIDES US FAERS | |
| 350 | Drug withdrawal convulsions | FAERS: 9 | US FAERS | |
| 351 | Electrocardiogram abnormal | FAERS: 9 | US FAERS | |
| 352 | Epilepsy | FAERS: 9 | OFFSIDES US FAERS | |
| 353 | General physical condition abnormal | FAERS: 9 | US FAERS | |
| 354 | Head discomfort | FAERS: 9 | US FAERS | |
| 355 | Hepatic congestion | FAERS: 9 | US FAERS | |
| 356 | Hernia | FAERS: 9 | US FAERS | |
| 357 | Hypothyroidism | FAERS: 9 | US FAERS | |
| 358 | Incorrect product administration duration | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 359 | Intestinal Perforation | FAERS: 9 | SIDER US FAERS | |
| 360 | Laryngitis | FAERS: 9 | SIDER US FAERS | |
| 361 | Metabolic acidosis | FAERS: 9 | US FAERS | |
| 362 | Nonspecific reaction | FAERS: 9 | OFFSIDES US FAERS | |
| 363 | Product physical consistency issue | FAERS: 9 | US FAERS | |
| 364 | Productive Cough | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Sinus Tachycardia | FAERS: 9 | SIDER US FAERS | |
| 366 | Application site pustules | FAERS: 8 | US FAERS | |
| 367 | Bradyphrenia | FAERS: 8 | US FAERS | |
| 368 | Bronchospasm | FAERS: 8 | SIDER US FAERS | |
| 369 | Carpal Tunnel Syndrome | FAERS: 8 | US FAERS | |
| 370 | Cervix carcinoma | FAERS: 8 | US FAERS | |
| 371 | Cholelithiasis | FAERS: 8 | US FAERS | |
| 372 | Coronary Artery Disease | FAERS: 8 | US FAERS | |
| 373 | Deep Vein Thrombosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 374 | Drug effect variable | FAERS: 8 | US FAERS | |
| 375 | Electrolyte imbalance | FAERS: 8 | US FAERS | |
| 376 | Eye pain | FAERS: 8 | US FAERS | |
| 377 | Gangrene | FAERS: 8 | US FAERS | |
| 378 | Gastric ulcer | FAERS: 8 | US FAERS | |
| 379 | Impaired gastric emptying | FAERS: 8 | SIDER US FAERS | |
| 380 | Initial insomnia | FAERS: 8 | US FAERS | |
| 381 | Limb discomfort | FAERS: 8 | US FAERS | |
| 382 | Lip swelling | FAERS: 8 | US FAERS | |
| 383 | Medication residue present | FAERS: 8 | US FAERS | |
| 384 | Poor quality sleep | FAERS: 8 | US FAERS | |
| 385 | Prescription drug used without a prescription | FAERS: 8 | US FAERS | |
| 386 | Screaming | FAERS: 8 | US FAERS | |
| 387 | Serotonin Syndrome | FAERS: 8 | 18757161 | CTD US FAERS |
| 388 | Throat cancer | FAERS: 8 | US FAERS | |
| 389 | Throat irritation | FAERS: 8 | SIDER US FAERS | |
| 390 | Toxic leukoencephalopathy | FAERS: 8 | US FAERS | |
| 391 | Victim of homicide | FAERS: 8 | US FAERS | |
| 392 | Wheelchair user | FAERS: 8 | US FAERS | |
| 393 | Apathy | FAERS: 7 | US FAERS | |
| 394 | Dermal absorption impaired | FAERS: 7 | US FAERS | |
| 395 | Dermatitis | FAERS: 7 | SIDER US FAERS | |
| 396 | Dysgraphia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 397 | Failure to Thrive | FAERS: 7 | US FAERS | |
| 398 | Foaming at mouth | FAERS: 7 | US FAERS | |
| 399 | Frustration tolerance decreased | FAERS: 7 | US FAERS | |
| 400 | Gait inability | FAERS: 7 | US FAERS | |
| 401 | Gastritis | FAERS: 7 | SIDER US FAERS | |
| 402 | Gastrointestinal Pain | FAERS: 7 | SIDER US FAERS | |
| 403 | Hallucinations, mixed | FAERS: 7 | US FAERS | |
| 404 | Impaired quality of life | FAERS: 7 | US FAERS | |
| 405 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 406 | Maternal exposure during pregnancy | FAERS: 7 | US FAERS | |
| 407 | Megacolon | FAERS: 7 | US FAERS | |
| 408 | Middle insomnia | FAERS: 7 | US FAERS | |
| 409 | Product residue present | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 410 | Product solubility abnormal | FAERS: 7 | US FAERS | |
| 411 | Psychiatric symptom | FAERS: 7 | US FAERS | |
| 412 | Skin laceration | FAERS: 7 | US FAERS | |
| 413 | Tension | FAERS: 7 | SIDER US FAERS | |
| 414 | Terminal state | FAERS: 7 | US FAERS | |
| 415 | Therapy non-responder | FAERS: 7 | US FAERS | |
| 416 | Acarodermatitis | FAERS: 6 | US FAERS | |
| 417 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 418 | Analgesic drug level above therapeutic | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 419 | Application site discharge | FAERS: 6 | US FAERS | |
| 420 | Application site injury | FAERS: 6 | US FAERS | |
| 421 | Atelectasis | FAERS: 6 | OFFSIDES US FAERS | |
| 422 | Bipolar Disorder | FAERS: 6 | US FAERS | |
| 423 | Bladder pain | FAERS: 6 | SIDER US FAERS | |
| 424 | Bronchopneumonia | FAERS: 6 | US FAERS | |
| 425 | Colectomy | FAERS: 6 | US FAERS | |
| 426 | Delusional disorder, persecutory type | FAERS: 6 | US FAERS | |
| 427 | Device breakage | FAERS: 6 | US FAERS | |
| 428 | Diabetes Insipidus | FAERS: 6 | US FAERS | |
| 429 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 430 | Drug exposure via breast milk | FAERS: 6 | US FAERS | |
| 431 | Economic problem | FAERS: 6 | US FAERS | |
| 432 | Eczema | FAERS: 6 | SIDER US FAERS | |
| 433 | Flatulence | FAERS: 6 | SIDER US FAERS | |
| 434 | Gout | FAERS: 6 | US FAERS | |
| 435 | Incontinence | FAERS: 6 | US FAERS | |
| 436 | Intracranial Aneurysm | FAERS: 6 | OFFSIDES US FAERS | |
| 437 | Leukocytosis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Macular degeneration | FAERS: 6 | US FAERS | |
| 439 | Musculoskeletal discomfort | FAERS: 6 | SIDER US FAERS | |
| 440 | Neutropenia | FAERS: 6 | SIDER US FAERS | |
| 441 | Oral pain | FAERS: 6 | US FAERS | |
| 442 | Osteomyelitis | FAERS: 6 | US FAERS | |
| 443 | Post-Traumatic Stress Disorder | FAERS: 6 | US FAERS | |
| 444 | Procedural complication | FAERS: 6 | OFFSIDES US FAERS | |
| 445 | Pulmonary thrombosis | FAERS: 6 | US FAERS | |
| 446 | Quality of life decreased | FAERS: 6 | US FAERS | |
| 447 | Shock | FAERS: 6 | SIDER US FAERS | |
| 448 | Skeletal injury | FAERS: 6 | US FAERS | |
| 449 | Starvation | FAERS: 6 | US FAERS | |
| 450 | Ventricular hypertrophy | FAERS: 6 | US FAERS | |
| 451 | Visceral congestion | FAERS: 6 | US FAERS | |
| 452 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 453 | Abdominal rigidity | FAERS: 5 | US FAERS | |
| 454 | Acute Coronary Syndrome | FAERS: 5 | US FAERS | |
| 455 | Akathisia | FAERS: 5 | SIDER US FAERS | |
| 456 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 457 | Aphagia | FAERS: 5 | US FAERS | |
| 458 | Application site excoriation | FAERS: 5 | US FAERS | |
| 459 | Autonomic nervous system imbalance | FAERS: 5 | US FAERS | |
| 460 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 461 | Blood pH decreased | FAERS: 5 | US FAERS | |
| 462 | Blood urea increased | FAERS: 5 | US FAERS | |
| 463 | Chest wall pain | FAERS: 5 | SIDER US FAERS | |
| 464 | Chorea | FAERS: 5 | US FAERS | |
| 465 | Drug delivery system malfunction | FAERS: 5 | US FAERS | |
| 466 | Emergency Care | FAERS: 5 | US FAERS | |
| 467 | Erectile dysfunction | FAERS: 5 | SIDER US FAERS | |
| 468 | Excoriation | FAERS: 5 | OFFSIDES US FAERS | |
| 469 | Frustration | FAERS: 5 | US FAERS | |
| 470 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 471 | Hydronephrosis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 472 | Hysterectomy | FAERS: 5 | US FAERS | |
| 473 | Immobile | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 474 | Inflammation | FAERS: 5 | SIDER US FAERS | |
| 475 | Intercepted drug administration error | FAERS: 5 | US FAERS | |
| 476 | Intercepted drug dispensing error | FAERS: 5 | US FAERS | |
| 477 | Intercepted drug prescribing error | FAERS: 5 | US FAERS | |
| 478 | Lymphadenopathy | FAERS: 5 | SIDER US FAERS | |
| 479 | Marasmus | FAERS: 5 | US FAERS | |
| 480 | Motion Sickness | FAERS: 5 | SIDER US FAERS | |
| 481 | Multiple drug overdose | FAERS: 5 | US FAERS | |
| 482 | Panic Disorder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 483 | Piloerection | FAERS: 5 | US FAERS | |
| 484 | Pneumonitis | FAERS: 5 | US FAERS | |
| 485 | Product prescribing error | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 486 | Product substitution | FAERS: 5 | US FAERS | |
| 487 | Product supply issue | FAERS: 5 | US FAERS | |
| 488 | Respiratory tract congestion | FAERS: 5 | US FAERS | |
| 489 | Sluggishness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 490 | Stridor | FAERS: 5 | US FAERS | |
| 491 | Tetany | FAERS: 5 | US FAERS | |
| 492 | Therapeutic product effect incomplete | FAERS: 5 | US FAERS | |
| 493 | Thirst | FAERS: 5 | SIDER US FAERS | |
| 494 | Tooth Infection | FAERS: 5 | OFFSIDES US FAERS | |
| 495 | Urinary hesitation | FAERS: 5 | SIDER US FAERS | |
| 496 | skin abrasion | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 497 | Acidosis | FAERS: 4 | SIDER US FAERS | |
| 498 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 499 | Anoxia | FAERS: 4 | US FAERS | |
| 500 | Application site acne | FAERS: 4 | US FAERS | |
| 501 | Application site necrosis | FAERS: 4 | US FAERS | |
| 502 | Asthenopia | FAERS: 4 | US FAERS | |
| 503 | Caustic injury | FAERS: 4 | US FAERS | |
| 504 | Chemical injury | FAERS: 4 | US FAERS | |
| 505 | Chromaturia | FAERS: 4 | US FAERS | |
| 506 | Corrective lens user | FAERS: 4 | US FAERS | |
| 507 | Culture urine positive | FAERS: 4 | US FAERS | |
| 508 | Cyst | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 509 | Deafness Neurosensory | FAERS: 4 | US FAERS | |
| 510 | Device defective | FAERS: 4 | US FAERS | |
| 511 | Device ineffective | FAERS: 4 | US FAERS | |
| 512 | Disease complication | FAERS: 4 | US FAERS | |
| 513 | Disease recurrence | FAERS: 4 | US FAERS | |
| 514 | Dreamy state | FAERS: 4 | US FAERS | |
| 515 | Drug level above therapeutic | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 516 | Drug level below therapeutic | FAERS: 4 | US FAERS | |
| 517 | Drug level changed | FAERS: 4 | US FAERS | |
| 518 | Dysphemia | FAERS: 4 | US FAERS | |
| 519 | Electroencephalogram abnormal | FAERS: 4 | US FAERS | |
| 520 | Facial Pain | FAERS: 4 | US FAERS | |
| 521 | Flank Pain | FAERS: 4 | SIDER US FAERS | |
| 522 | Gamma-Glutamyltransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 523 | Gastrectomy | FAERS: 4 | US FAERS | |
| 524 | Hip surgery | FAERS: 4 | US FAERS | |
| 525 | Homicide | FAERS: 4 | US FAERS | |
| 526 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 527 | Hypertensive heart disease | FAERS: 4 | OFFSIDES US FAERS | |
| 528 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 529 | Intracranial Hypotension | FAERS: 4 | US FAERS | |
| 530 | Joint sprain | FAERS: 4 | US FAERS | |
| 531 | Limb operation | FAERS: 4 | US FAERS | |
| 532 | Manufacturing production issue | FAERS: 4 | US FAERS | |
| 533 | Medication tampering | FAERS: 4 | US FAERS | |
| 534 | Muscle strain | FAERS: 4 | US FAERS | |
| 535 | Musculoskeletal chest pain | FAERS: 4 | SIDER US FAERS | |
| 536 | Myocardial Stunning | FAERS: 4 | US FAERS | |
| 537 | Obesity | FAERS: 4 | US FAERS | |
| 538 | Oncologic complication | FAERS: 4 | US FAERS | |
| 539 | Pain of skin | FAERS: 4 | SIDER US FAERS | |
| 540 | Pelvic Pain | FAERS: 4 | SIDER US FAERS | |
| 541 | Performance status decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 542 | Petechiae | FAERS: 4 | US FAERS | |
| 543 | Pregnancy | FAERS: 4 | SIDER US FAERS | |
| 544 | Product administration error | FAERS: 4 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 545 | Product distribution issue | FAERS: 4 | US FAERS | |
| 546 | Product label confusion | FAERS: 4 | US FAERS | |
| 547 | Renal cyst | FAERS: 4 | US FAERS | |
| 548 | Renal pain | FAERS: 4 | SIDER US FAERS | |
| 549 | Sarcoidosis | FAERS: 4 | US FAERS | |
| 550 | Septic Shock | FAERS: 4 | US FAERS | |
| 551 | Squamous cell carcinoma | FAERS: 4 | US FAERS | |
| 552 | Staring | FAERS: 4 | US FAERS | |
| 553 | Stevens-Johnson Syndrome | FAERS: 4 | SIDER US FAERS | |
| 554 | Suspected counterfeit product | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 555 | Tongue discomfort | FAERS: 4 | US FAERS | |
| 556 | Walking aid user | FAERS: 4 | US FAERS | |
| 557 | jaundice | FAERS: 4 | SIDER US FAERS | |
| 558 | Abscess | FAERS: 3 | SIDER US FAERS | |
| 559 | Adenocarcinoma | FAERS: 3 | US FAERS | |
| 560 | Amputation | FAERS: 3 | US FAERS | |
| 561 | Analgesic drug level | FAERS: 3 | US FAERS | |
| 562 | Anaphylactoid Reaction | FAERS: 3 | SIDER US FAERS | |
| 563 | Anuria | FAERS: 3 | SIDER US FAERS | |
| 564 | Apallic syndrome | FAERS: 3 | US FAERS | |
| 565 | Aphthous Stomatitis | FAERS: 3 | SIDER US FAERS | |
| 566 | Appendicitis | FAERS: 3 | US FAERS | |
| 567 | Arachnoiditis | FAERS: 3 | US FAERS | |
| 568 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 569 | Ataxia | FAERS: 3 | US FAERS | |
| 570 | Atherosclerosis | FAERS: 3 | US FAERS | |
| 571 | Bladder spasm | FAERS: 3 | US FAERS | |
| 572 | Blood alkaline phosphatase increased | FAERS: 3 | SIDER US FAERS | |
| 573 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 574 | Blood pressure immeasurable | FAERS: 3 | US FAERS | |
| 575 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 576 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 577 | Brain Hypoxia | FAERS: 3 | OFFSIDES US FAERS | |
| 578 | Cardiovascular insufficiency | FAERS: 3 | SIDER US FAERS | |
| 579 | Catatonia | FAERS: 3 | US FAERS | |
| 580 | Cerebellar infarction | FAERS: 3 | US FAERS | |
| 581 | Cerebral atrophy | FAERS: 3 | US FAERS | |
| 582 | Chemical burn of skin | FAERS: 3 | US FAERS | |
| 583 | Cleft Palate | FAERS: 3 | US FAERS | |
| 584 | Colitis | FAERS: 3 | OFFSIDES US FAERS | |
| 585 | Decreased immune responsiveness | FAERS: 3 | US FAERS | |
| 586 | Deformity | FAERS: 3 | US FAERS | |
| 587 | Device damage | FAERS: 3 | US FAERS | |
| 588 | Device related infection | FAERS: 3 | US FAERS | |
| 589 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 590 | Documented hypersensitivity to administered product | FAERS: 3 | US FAERS | |
| 591 | Drooling | FAERS: 3 | US FAERS | |
| 592 | Drowning | FAERS: 3 | US FAERS | |
| 593 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 594 | Dyspnoea exacerbated | FAERS: 3 | US FAERS | |
| 595 | Educational problem | FAERS: 3 | US FAERS | |
| 596 | Embolism | FAERS: 3 | OFFSIDES US FAERS | |
| 597 | Endocarditis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 598 | Endometriosis | FAERS: 3 | US FAERS | |
| 599 | Escherichia infection | FAERS: 3 | OFFSIDES US FAERS | |
| 600 | Eye inflammation | FAERS: 3 | US FAERS | |
| 601 | Fluid overload | FAERS: 3 | US FAERS | |
| 602 | Foreign body aspiration | FAERS: 3 | US FAERS | |
| 603 | Gaze palsy | FAERS: 3 | OFFSIDES US FAERS | |
| 604 | Glioblastoma | FAERS: 3 | US FAERS | |
| 605 | Heat exposure injury | FAERS: 3 | US FAERS | |
| 606 | Hemiparesis | FAERS: 3 | US FAERS | |
| 607 | Hepatitis C | FAERS: 3 | US FAERS | |
| 608 | Hyperacusis | FAERS: 3 | US FAERS | |
| 609 | Hyperreflexia | FAERS: 3 | US FAERS | |
| 610 | Ileus | FAERS: 3 | SIDER US FAERS | |
| 611 | Incorrect disposal of product | FAERS: 3 | US FAERS | |
| 612 | Incorrect drug dosage form administered | FAERS: 3 | US FAERS | |
| 613 | Increased tendency to bruise | FAERS: 3 | US FAERS | |
| 614 | Increased upper airway secretion | FAERS: 3 | US FAERS | |
| 615 | Injury asphyxiation | FAERS: 3 | US FAERS | |
| 616 | Joint Range of Motion Decreased | FAERS: 3 | US FAERS | |
| 617 | Joint stiffness | FAERS: 3 | US FAERS | |
| 618 | Lack of application site rotation | FAERS: 3 | US FAERS | |
| 619 | Live Birth | FAERS: 3 | US FAERS | |
| 620 | Lordosis | FAERS: 3 | US FAERS | |
| 621 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 622 | Malabsorption | FAERS: 3 | US FAERS | |
| 623 | Markedly reduced dietary intake | FAERS: 3 | US FAERS | |
| 624 | Micturition frequency decreased | FAERS: 3 | US FAERS | |
| 625 | Monoplegia | FAERS: 3 | US FAERS | |
| 626 | Morbid thoughts | FAERS: 3 | US FAERS | |
| 627 | Mouth swelling | FAERS: 3 | US FAERS | |
| 628 | Multiple drug overdose intentional | FAERS: 3 | US FAERS | |
| 629 | Muscle Cramp | FAERS: 3 | US FAERS | |
| 630 | Neonatal disorder | FAERS: 3 | US FAERS | |
| 631 | Opiates positive | FAERS: 3 | US FAERS | |
| 632 | Parotitis | FAERS: 3 | US FAERS | |
| 633 | Partner stress | FAERS: 3 | US FAERS | |
| 634 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 635 | Peritonitis | FAERS: 3 | SIDER US FAERS | |
| 636 | Physical assault | FAERS: 3 | US FAERS | |
| 637 | Pneumothorax | FAERS: 3 | SIDER US FAERS | |
| 638 | Poor feeding infant | FAERS: 3 | US FAERS | |
| 639 | Postural Orthostatic Tachycardia Syndrome | FAERS: 3 | US FAERS | |
| 640 | Product coating issue | FAERS: 3 | US FAERS | |
| 641 | Product contamination | FAERS: 3 | US FAERS | |
| 642 | Product counterfeit | FAERS: 3 | US FAERS | |
| 643 | Psoriasis | FAERS: 3 | US FAERS | |
| 644 | Respiratory fume inhalation disorder | FAERS: 3 | US FAERS | |
| 645 | Shoulder Pain | FAERS: 3 | SIDER US FAERS | |
| 646 | Skin hypertrophy | FAERS: 3 | US FAERS | |
| 647 | Small cell lung cancer metastatic | FAERS: 3 | US FAERS | |
| 648 | Somnambulism | FAERS: 3 | US FAERS | |
| 649 | Splenectomy | FAERS: 3 | US FAERS | |
| 650 | Subileus | FAERS: 3 | SIDER US FAERS | |
| 651 | Tension Headache | FAERS: 3 | US FAERS | |
| 652 | Therapeutic agent urine negative | FAERS: 3 | US FAERS | |
| 653 | Therapeutic agent urine positive | FAERS: 3 | US FAERS | |
| 654 | Therapeutic reaction time decreased | FAERS: 3 | US FAERS | |
| 655 | Therapeutic response changed | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 656 | Thrombocytopenia | FAERS: 3 | SIDER US FAERS | |
| 657 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 658 | Tooth Erosion | FAERS: 3 | US FAERS | |
| 659 | Trismus | FAERS: 3 | 15096252 | CTD US FAERS |
| 660 | VIIth nerve paralysis | FAERS: 3 | SIDER US FAERS | |
| 661 | pH body fluid abnormal | FAERS: 3 | US FAERS | |
| 662 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 663 | Acute Chest Syndrome | FAERS: 2 | US FAERS | |
| 664 | Acute Lung Injury | FAERS: 2 | US FAERS | |
| 665 | Acute psychosis | FAERS: 2 | US FAERS | |
| 666 | Administration site irritation | FAERS: 2 | US FAERS | |
| 667 | Airway peak pressure increased | FAERS: 2 | US FAERS | |
| 668 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 669 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 670 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 671 | Aneurysm | FAERS: 2 | US FAERS | |
| 672 | Angioedema | FAERS: 2 | US FAERS | |
| 673 | Anhedonia | FAERS: 2 | US FAERS | |
| 674 | Aphonia | FAERS: 2 | OFFSIDES US FAERS | |
| 675 | Application site fissure | FAERS: 2 | US FAERS | |
| 676 | Application site mass | FAERS: 2 | US FAERS | |
| 677 | Application site nodule | FAERS: 2 | US FAERS | |
| 678 | Application site wound | FAERS: 2 | US FAERS | |
| 679 | Ascites | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 680 | Asphyxia | FAERS: 2 | US FAERS | |
| 681 | Atrioventricular Block | FAERS: 2 | 7629934 | CTD US FAERS |
| 682 | Bacteria blood identified | FAERS: 2 | US FAERS | |
| 683 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 684 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 685 | Blister rupture | FAERS: 2 | US FAERS | |
| 686 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 687 | Blood chloride decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 688 | Blood cortisol increased | FAERS: 2 | US FAERS | |
| 689 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 690 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 691 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 692 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 693 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 694 | Bone fragmentation | FAERS: 2 | US FAERS | |
| 695 | Bradykinesia | FAERS: 2 | US FAERS | |
| 696 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 697 | Cardiac Death | FAERS: 2 | US FAERS | |
| 698 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 699 | Cardiac ablation | FAERS: 2 | US FAERS | |
| 700 | Cartilage injury | FAERS: 2 | US FAERS | |
| 701 | Cataract operation | FAERS: 2 | US FAERS | |
| 702 | Catheter related infection | FAERS: 2 | US FAERS | |
| 703 | Chronic tonsillitis | FAERS: 2 | US FAERS | |
| 704 | Claustrophobia | FAERS: 2 | US FAERS | |
| 705 | Clostridium colitis | FAERS: 2 | US FAERS | |
| 706 | Clumsiness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 707 | Cluster Headache | FAERS: 2 | US FAERS | |
| 708 | Coccidioidomycosis | FAERS: 2 | US FAERS | |
| 709 | Complication of delivery | FAERS: 2 | US FAERS | |
| 710 | Complications of transplant surgery | FAERS: 2 | US FAERS | |
| 711 | Compression fracture | FAERS: 2 | US FAERS | |
| 712 | Conjunctivitis | FAERS: 2 | SIDER US FAERS | |
| 713 | Craniotomy | FAERS: 2 | US FAERS | |
| 714 | Death of relative | FAERS: 2 | US FAERS | |
| 715 | Denture wearer | FAERS: 2 | OFFSIDES US FAERS | |
| 716 | Dermal absorption increased | FAERS: 2 | US FAERS | |
| 717 | Device infusion issue | FAERS: 2 | US FAERS | |
| 718 | Device physical property issue | FAERS: 2 | US FAERS | |
| 719 | Device use error | FAERS: 2 | US FAERS | |
| 720 | Diabetic ulcer | FAERS: 2 | US FAERS | |
| 721 | Dissociation | FAERS: 2 | US FAERS | |
| 722 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 723 | Drug addict | FAERS: 2 | US FAERS | |
| 724 | Drug delivery device implantation | FAERS: 2 | US FAERS | |
| 725 | Drug level fluctuating | FAERS: 2 | US FAERS | |
| 726 | Elevated mood | FAERS: 2 | US FAERS | |
| 727 | Enamel anomaly | FAERS: 2 | US FAERS | |
| 728 | Enuresis | FAERS: 2 | US FAERS | |
| 729 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 730 | Eosinophilia | FAERS: 2 | US FAERS | |
| 731 | Eructation | FAERS: 2 | SIDER US FAERS | |
| 732 | Eschar | FAERS: 2 | US FAERS | |
| 733 | Exposure via partner | FAERS: 2 | US FAERS | |
| 734 | Exposure via skin contact | FAERS: 2 | US FAERS | |
| 735 | Eyelid Function Disorder | FAERS: 2 | US FAERS | |
| 736 | Fear of falling | FAERS: 2 | US FAERS | |
| 737 | Food Poisoning | FAERS: 2 | US FAERS | |
| 738 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 739 | Gastric outlet obstruction | FAERS: 2 | US FAERS | |
| 740 | Gastroenteritis | FAERS: 2 | SIDER US FAERS | |
| 741 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 742 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 743 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 744 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 745 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 746 | Gingival Recession | FAERS: 2 | US FAERS | |
| 747 | Heat illness | FAERS: 2 | US FAERS | |
| 748 | Hemiplegia | FAERS: 2 | SIDER US FAERS | |
| 749 | Hunger | FAERS: 2 | US FAERS | |
| 750 | Hypercapnia | FAERS: 2 | CTD US FAERS | |
| 751 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 752 | Hypermetabolism | FAERS: 2 | US FAERS | |
| 753 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 754 | Hypogonadism | FAERS: 2 | SIDER US FAERS | |
| 755 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 756 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 757 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 758 | Keratosis pilaris | FAERS: 2 | US FAERS | |
| 759 | Labile blood pressure | FAERS: 2 | US FAERS | |
| 760 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 761 | Laryngospasm | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 762 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 763 | Ligament rupture | FAERS: 2 | OFFSIDES US FAERS | |
| 764 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 765 | Lipase increased | FAERS: 2 | US FAERS | |
| 766 | Liquid product physical issue | FAERS: 2 | US FAERS | |
| 767 | Lividity | FAERS: 2 | US FAERS | |
| 768 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 769 | Lyme Disease | FAERS: 2 | OFFSIDES US FAERS | |
| 770 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 771 | Mastectomy | FAERS: 2 | US FAERS | |
| 772 | Meningitis | FAERS: 2 | US FAERS | |
| 773 | Meniscus injury | FAERS: 2 | US FAERS | |
| 774 | Metastasis | FAERS: 2 | US FAERS | |
| 775 | Moaning | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 776 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 777 | Multiple allergies | FAERS: 2 | US FAERS | |
| 778 | Multiple drug overdose accidental | FAERS: 2 | US FAERS | |
| 779 | Multiple use of single-use product | FAERS: 2 | US FAERS | |
| 780 | Murder | FAERS: 2 | US FAERS | |
| 781 | Muscle necrosis | FAERS: 2 | US FAERS | |
| 782 | Narcolepsy | FAERS: 2 | US FAERS | |
| 783 | Near Drowning | FAERS: 2 | US FAERS | |
| 784 | Neck exploration | FAERS: 2 | US FAERS | |
| 785 | Negative thoughts | FAERS: 2 | US FAERS | |
| 786 | Nerve Block | FAERS: 2 | US FAERS | |
| 787 | Neurectomy | FAERS: 2 | US FAERS | |
| 788 | Neuroleptic Malignant Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 789 | No adverse effect | FAERS: 2 | US FAERS | |
| 790 | Nodule | FAERS: 2 | US FAERS | |
| 791 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 792 | Obstruction | FAERS: 2 | US FAERS | |
| 793 | Ocular icterus | FAERS: 2 | US FAERS | |
| 794 | Oliguria | FAERS: 2 | SIDER US FAERS | |
| 795 | Oral discharge | FAERS: 2 | US FAERS | |
| 796 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 797 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 798 | Overweight | FAERS: 2 | US FAERS | |
| 799 | Oxygen supplementation | FAERS: 2 | US FAERS | |
| 800 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 801 | Phantom pain | FAERS: 2 | US FAERS | |
| 802 | Photophobia | FAERS: 2 | US FAERS | |
| 803 | Polydipsia | FAERS: 2 | US FAERS | |
| 804 | Polyuria | FAERS: 2 | SIDER US FAERS | |
| 805 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 806 | Post procedural infection | FAERS: 2 | US FAERS | |
| 807 | Post procedural nausea | FAERS: 2 | US FAERS | |
| 808 | Postoperative infection | FAERS: 2 | US FAERS | |
| 809 | Posturing | FAERS: 2 | OFFSIDES US FAERS | |
| 810 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 811 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 812 | Procedural nausea | FAERS: 2 | US FAERS | |
| 813 | Product impurity | FAERS: 2 | US FAERS | |
| 814 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 815 | Proteinuria | FAERS: 2 | SIDER US FAERS | |
| 816 | Psychomotor skills impaired | FAERS: 2 | US FAERS | |
| 817 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 818 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 819 | Purpura | FAERS: 2 | US FAERS | |
| 820 | Purulent discharge | FAERS: 2 | OFFSIDES US FAERS | |
| 821 | Radiculopathy | FAERS: 2 | 9794061 | CTD US FAERS |
| 822 | Rales | FAERS: 2 | US FAERS | |
| 823 | Retinal vascular thrombosis | FAERS: 2 | US FAERS | |
| 824 | Rubber sensitivity | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 825 | Schizophrenia | FAERS: 2 | US FAERS | |
| 826 | Similar reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 827 | Skin discomfort | FAERS: 2 | US FAERS | |
| 828 | Sleep Talking | FAERS: 2 | OFFSIDES US FAERS | |
| 829 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 830 | Slow speech | FAERS: 2 | US FAERS | |
| 831 | Spinal column stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 832 | Spinal cord infection | FAERS: 2 | US FAERS | |
| 833 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 834 | Suspected product tampering | FAERS: 2 | US FAERS | |
| 835 | Syringe issue | FAERS: 2 | US FAERS | |
| 836 | Tablet issue | FAERS: 2 | US FAERS | |
| 837 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 838 | Therapeutic product effect increased | FAERS: 2 | US FAERS | |
| 839 | Therapy regimen changed | FAERS: 2 | US FAERS | |
| 840 | Thoracic outlet surgery | FAERS: 2 | US FAERS | |
| 841 | Tongue biting | FAERS: 2 | OFFSIDES US FAERS | |
| 842 | Tooth Extraction | FAERS: 2 | OFFSIDES US FAERS | |
| 843 | Toothache | FAERS: 2 | US FAERS | |
| 844 | Transaminases increased | FAERS: 2 | US FAERS | |
| 845 | Transcription medication error | FAERS: 2 | US FAERS | |
| 846 | Unexpected therapeutic drug effect | FAERS: 2 | US FAERS | |
| 847 | Vasculitis | FAERS: 2 | US FAERS | |
| 848 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 849 | White blood cell count abnormal | FAERS: 2 | US FAERS | |
| 850 | Wound Complication | FAERS: 2 | US FAERS | |
| 851 | Wound necrosis | FAERS: 2 | US FAERS | |
| 852 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 853 | Wrong technique in device usage process | FAERS: 2 | US FAERS | |
| 854 | furuncle | FAERS: 2 | US FAERS | |
| 855 | kyphosis | FAERS: 2 | US FAERS | |
| 856 | muscle injury | FAERS: 2 | US FAERS | |
| 857 | ovarian neoplasm | FAERS: 2 | US FAERS | |
| 858 | treatment failure | FAERS: 2 | US FAERS | |
| 859 | AIDS related complication | FAERS: 1 | US FAERS | |
| 860 | Abdominal mass | FAERS: 1 | US FAERS | |
| 861 | Abnormal clotting factor | FAERS: 1 | US FAERS | |
| 862 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 863 | Adenomatous Polyposis Coli | FAERS: 1 | US FAERS | |
| 864 | Administration site hypersensitivity | FAERS: 1 | US FAERS | |
| 865 | Administration site indentation | FAERS: 1 | US FAERS | |
| 866 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 867 | Adrenocortical insufficiency chronic | FAERS: 1 | US FAERS | |
| 868 | Agraphia | FAERS: 1 | OFFSIDES US FAERS | |
| 869 | Aicardi's syndrome | FAERS: 1 | US FAERS | |
| 870 | Air Embolism | FAERS: 1 | US FAERS | |
| 871 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 872 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 873 | Alcohol test false positive | FAERS: 1 | US FAERS | |
| 874 | Amblyopia | FAERS: 1 | SIDER US FAERS | |
| 875 | Ammonia increased | FAERS: 1 | US FAERS | |
| 876 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 877 | Anal Fistula | FAERS: 1 | US FAERS | |
| 878 | Analgesic effect | FAERS: 1 | US FAERS | |
| 879 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 880 | Anticonvulsant drug level above therapeutic | FAERS: 1 | US FAERS | |
| 881 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 882 | Application site abscess | FAERS: 1 | US FAERS | |
| 883 | Application site cellulitis | FAERS: 1 | US FAERS | |
| 884 | Application site induration | FAERS: 1 | US FAERS | |
| 885 | Application site telangiectasia | FAERS: 1 | US FAERS | |
| 886 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 887 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 888 | Asterixis | FAERS: 1 | US FAERS | |
| 889 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 890 | Autophobia | FAERS: 1 | US FAERS | |
| 891 | Aversion | FAERS: 1 | US FAERS | |
| 892 | Bacteria urine identified | FAERS: 1 | US FAERS | |
| 893 | Bacterial food poisoning | FAERS: 1 | US FAERS | |
| 894 | Bacteriuria | FAERS: 1 | US FAERS | |
| 895 | Barbiturates positive | FAERS: 1 | US FAERS | |
| 896 | Base excess decreased | FAERS: 1 | US FAERS | |
| 897 | Belligerence | FAERS: 1 | US FAERS | |
| 898 | Bifascicular block | FAERS: 1 | US FAERS | |
| 899 | Biliary Dyskinesia | FAERS: 1 | US FAERS | |
| 900 | Biliary cancer metastatic | FAERS: 1 | US FAERS | |
| 901 | Biopsy site unspecified abnormal | FAERS: 1 | US FAERS | |
| 902 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 903 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 904 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 905 | Blood Pressure | FAERS: 1 | US FAERS | |
| 906 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 907 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 908 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 909 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 910 | Blood lactate dehydrogenase increased | FAERS: 1 | SIDER US FAERS | |
| 911 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 912 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 913 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 914 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 915 | Bone marrow myelogram abnormal | FAERS: 1 | US FAERS | |
| 916 | Breast Microcalcification | FAERS: 1 | US FAERS | |
| 917 | Bronchial Fistula | FAERS: 1 | US FAERS | |
| 918 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 919 | Bruxism | FAERS: 1 | US FAERS | |
| 920 | Bunion | FAERS: 1 | US FAERS | |
| 921 | Calcinosis | FAERS: 1 | US FAERS | |
| 922 | Candida endophthalmitis | FAERS: 1 | US FAERS | |
| 923 | Candida sepsis | FAERS: 1 | US FAERS | |
| 924 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 925 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 926 | Cardiac infection | FAERS: 1 | US FAERS | |
| 927 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 928 | Cardiotoxicity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 929 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 930 | Central line infection | FAERS: 1 | OFFSIDES US FAERS | |
| 931 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 932 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 933 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 934 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 935 | Cheilitis | FAERS: 1 | SIDER US FAERS | |
| 936 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 937 | Chemotherapy | FAERS: 1 | US FAERS | |
| 938 | Cheyne-Stokes Respiration | FAERS: 1 | US FAERS | |
| 939 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 940 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 941 | Chronic disease | FAERS: 1 | US FAERS | |
| 942 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 943 | Clonus | FAERS: 1 | US FAERS | |
| 944 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 945 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 946 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 947 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 948 | Conversion disorder | FAERS: 1 | US FAERS | |
| 949 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 950 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 951 | Coronary bypass thrombosis | FAERS: 1 | US FAERS | |
| 952 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 953 | Cyst drainage | FAERS: 1 | US FAERS | |
| 954 | Demyelination | FAERS: 1 | US FAERS | |
| 955 | Depression suicidal | FAERS: 1 | US FAERS | |
| 956 | Device component issue | FAERS: 1 | US FAERS | |
| 957 | Device computer issue | FAERS: 1 | US FAERS | |
| 958 | Device connection issue | FAERS: 1 | US FAERS | |
| 959 | Device difficult to use | FAERS: 1 | US FAERS | |
| 960 | Device use issue | FAERS: 1 | US FAERS | |
| 961 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 962 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 963 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 964 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 965 | Disseminated Intravascular Coagulation | FAERS: 1 | OFFSIDES US FAERS | |
| 966 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 967 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 968 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 969 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 970 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 971 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 972 | Drug label confusion | FAERS: 1 | US FAERS | |
| 973 | Drug metabolising enzyme increased | FAERS: 1 | US FAERS | |
| 974 | Drug monitoring procedure not performed | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 975 | Drug resistance | FAERS: 1 | US FAERS | |
| 976 | Drug titration error | FAERS: 1 | US FAERS | |
| 977 | Drug use for unknown indication | FAERS: 1 | US FAERS | |
| 978 | Drug withdrawal maintenance therapy | FAERS: 1 | US FAERS | |
| 979 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 980 | Dumping Syndrome | FAERS: 1 | US FAERS | |
| 981 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 982 | Duodenitis | FAERS: 1 | US FAERS | |
| 983 | Dyslexia | FAERS: 1 | US FAERS | |
| 984 | Dystonia | FAERS: 1 | 1742831 | CTD OFFSIDES US FAERS |
| 985 | Ear discomfort | FAERS: 1 | SIDER US FAERS | |
| 986 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 987 | Elbow operation | FAERS: 1 | US FAERS | |
| 988 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 989 | Electroconvulsive Therapy | FAERS: 1 | US FAERS | |
| 990 | Embolic stroke | FAERS: 1 | US FAERS | |
| 991 | Encephalitis | FAERS: 1 | US FAERS | |
| 992 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 993 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 994 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 995 | Enterocolitis | FAERS: 1 | US FAERS | |
| 996 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 997 | Epileptic aura | FAERS: 1 | US FAERS | |
| 998 | Epstein-Barr virus antigen positive | FAERS: 1 | US FAERS | |
| 999 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 1000 | Erysipelas | FAERS: 1 | US FAERS | |
| 1001 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 1002 | Euthanasia | FAERS: 1 | US FAERS | |
| 1003 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 1004 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 1005 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 1006 | Exposure to contaminated device | FAERS: 1 | US FAERS | |
| 1007 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 1008 | Exposure to unspecified agent | FAERS: 1 | US FAERS | |
| 1009 | Exposure via father | FAERS: 1 | US FAERS | |
| 1010 | Eye Infection | FAERS: 1 | US FAERS | |
| 1011 | Eye Redness | FAERS: 1 | US FAERS | |
| 1012 | Eye irritation | FAERS: 1 | US FAERS | |
| 1013 | Eye ulcer | FAERS: 1 | US FAERS | |
| 1014 | Eyeball rupture | FAERS: 1 | US FAERS | |
| 1015 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 1016 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 1017 | Fibrosis | FAERS: 1 | US FAERS | |
| 1018 | Fistula discharge | FAERS: 1 | US FAERS | |
| 1019 | Flight of ideas | FAERS: 1 | US FAERS | |
| 1020 | Food Allergy | FAERS: 1 | US FAERS | |
| 1021 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 1022 | Fumbling | FAERS: 1 | US FAERS | |
| 1023 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 1024 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 1025 | Gastric Stenosis | FAERS: 1 | US FAERS | |
| 1026 | Gastrointestinal endoscopic therapy | FAERS: 1 | US FAERS | |
| 1027 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 1028 | Gastrointestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 1029 | Genital pain | FAERS: 1 | US FAERS | |
| 1030 | Glaucoma | FAERS: 1 | US FAERS | |
| 1031 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 1032 | Glossitis | FAERS: 1 | SIDER US FAERS | |
| 1033 | Glossopharyngeal Neuralgia | FAERS: 1 | US FAERS | |
| 1034 | Granuloma | FAERS: 1 | SIDER US FAERS | |
| 1035 | Groin infection | FAERS: 1 | US FAERS | |
| 1036 | Head and neck cancer metastatic | FAERS: 1 | US FAERS | |
| 1037 | Heat Stroke | FAERS: 1 | US FAERS | |
| 1038 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 1039 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 1040 | Hepatitis C positive | FAERS: 1 | US FAERS | |
| 1041 | Hepatitis | FAERS: 1 | US FAERS | |
| 1042 | Hernia obstructive | FAERS: 1 | US FAERS | |
| 1043 | Hilar lymphadenopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1044 | Hostility | FAERS: 1 | SIDER US FAERS | |
| 1045 | Hyperaldosteronism | FAERS: 1 | US FAERS | |
| 1046 | Hypercapnic coma | FAERS: 1 | US FAERS | |
| 1047 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 1048 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 1049 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 1050 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 1051 | Hypomania | FAERS: 1 | US FAERS | |
| 1052 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 1053 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 1054 | Hypotonic-hyporesponsive episode | FAERS: 1 | US FAERS | |
| 1055 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 1056 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 1057 | Impatience | FAERS: 1 | US FAERS | |
| 1058 | Implant site reaction | FAERS: 1 | US FAERS | |
| 1059 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 1060 | Inappropriate Prescribing | FAERS: 1 | US FAERS | |
| 1061 | Inappropriate release of product for distribution | FAERS: 1 | US FAERS | |
| 1062 | Incision site complication | FAERS: 1 | US FAERS | |
| 1063 | Incision site infection | FAERS: 1 | US FAERS | |
| 1064 | Incisional hernia | FAERS: 1 | US FAERS | |
| 1065 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 1066 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 1067 | Infarction | FAERS: 1 | US FAERS | |
| 1068 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 1069 | Injection site erythema | FAERS: 1 | US FAERS | |
| 1070 | Injection site irritation | FAERS: 1 | US FAERS | |
| 1071 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 1072 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 1073 | Insurance issue | FAERS: 1 | US FAERS | |
| 1074 | Intercepted accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 1075 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 1076 | Intervertebral disc compression | FAERS: 1 | OFFSIDES US FAERS | |
| 1077 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 1078 | Intestinal resection | FAERS: 1 | US FAERS | |
| 1079 | Iron deficiency | FAERS: 1 | US FAERS | |
| 1080 | Irregular breathing | FAERS: 1 | US FAERS | |
| 1081 | Labile hypertension | FAERS: 1 | US FAERS | |
| 1082 | Lack of administration site rotation | FAERS: 1 | US FAERS | |
| 1083 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 1084 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 1085 | Latex allergy | FAERS: 1 | US FAERS | |
| 1086 | Leukoderma | FAERS: 1 | US FAERS | |
| 1087 | Libido disorder | FAERS: 1 | US FAERS | |
| 1088 | Ligament injury | FAERS: 1 | US FAERS | |
| 1089 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 1090 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 1091 | Liver Abscess | FAERS: 1 | US FAERS | |
| 1092 | Living in residential institution | FAERS: 1 | US FAERS | |
| 1093 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 1094 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 1095 | Loose tooth | FAERS: 1 | US FAERS | |
| 1096 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 1097 | Lung Injury | FAERS: 1 | US FAERS | |
| 1098 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 1099 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 1100 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 1101 | Mastication disorder | FAERS: 1 | US FAERS | |
| 1102 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 1103 | Meconium Aspiration Syndrome | FAERS: 1 | US FAERS | |
| 1104 | Meconium ileus | FAERS: 1 | US FAERS | |
| 1105 | Medical device implantation | FAERS: 1 | US FAERS | |
| 1106 | Medical device site rash | FAERS: 1 | US FAERS | |
| 1107 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 1108 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 1109 | Meningioma | FAERS: 1 | US FAERS | |
| 1110 | Mesothelioma | FAERS: 1 | US FAERS | |
| 1111 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 1112 | Metastases to abdominal wall | FAERS: 1 | US FAERS | |
| 1113 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 1114 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 1115 | Metastatic Renal Cell Carcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 1116 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 1117 | Miliaria | FAERS: 1 | US FAERS | |
| 1118 | Multimorbidity | FAERS: 1 | US FAERS | |
| 1119 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1120 | Muscle Spasticity | FAERS: 1 | 2008943 | CTD US FAERS |
| 1121 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 1122 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 1123 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 1124 | Myocardial rupture | FAERS: 1 | US FAERS | |
| 1125 | Myocarditis | FAERS: 1 | US FAERS | |
| 1126 | Myopathy | FAERS: 1 | SIDER US FAERS | |
| 1127 | Myopia | FAERS: 1 | US FAERS | |
| 1128 | Narcotic Bowel Syndrome | FAERS: 1 | US FAERS | |
| 1129 | Nasal mucosal disorder | FAERS: 1 | SIDER US FAERS | |
| 1130 | Necrosis | FAERS: 1 | 6711842 | CTD US FAERS |
| 1131 | Neonatal respiratory acidosis | FAERS: 1 | US FAERS | |
| 1132 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 1133 | Neuritis | FAERS: 1 | US FAERS | |
| 1134 | Neuroblastoma | FAERS: 1 | US FAERS | |
| 1135 | Neuroma | FAERS: 1 | US FAERS | |
| 1136 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 1137 | No reaction on previous exposure to drug | FAERS: 1 | OFFSIDES US FAERS | |
| 1138 | Nocturia | FAERS: 1 | SIDER US FAERS | |
| 1139 | Nodule on extremity | FAERS: 1 | US FAERS | |
| 1140 | Nuclear magnetic resonance imaging brain | FAERS: 1 | US FAERS | |
| 1141 | Nystagmus | FAERS: 1 | US FAERS | |
| 1142 | Obesity surgery | FAERS: 1 | US FAERS | |
| 1143 | Occupational exposure to product | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1144 | Ocular cancer metastatic | FAERS: 1 | US FAERS | |
| 1145 | Onychalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 1146 | Onychoclasis | FAERS: 1 | SIDER US FAERS | |
| 1147 | Onychomycosis | FAERS: 1 | US FAERS | |
| 1148 | Open wound | FAERS: 1 | US FAERS | |
| 1149 | Opiates negative | FAERS: 1 | US FAERS | |
| 1150 | Oral candidiasis | FAERS: 1 | SIDER US FAERS | |
| 1151 | Oral infection | FAERS: 1 | US FAERS | |
| 1152 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1153 | Osteolysis | FAERS: 1 | OFFSIDES US FAERS | |
| 1154 | Otitis Externa | FAERS: 1 | US FAERS | |
| 1155 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 1156 | Palliative Care | FAERS: 1 | US FAERS | |
| 1157 | Pancreas lipomatosis | FAERS: 1 | US FAERS | |
| 1158 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 1159 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 1160 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 1161 | Pancytopenia | FAERS: 1 | SIDER US FAERS | |
| 1162 | Papule | FAERS: 1 | SIDER US FAERS | |
| 1163 | Paraplegia | FAERS: 1 | US FAERS | |
| 1164 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 1165 | Pelvic kidney | FAERS: 1 | US FAERS | |
| 1166 | Pelvic mass | FAERS: 1 | US FAERS | |
| 1167 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 1168 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 1169 | Periarthritis | FAERS: 1 | US FAERS | |
| 1170 | Perineal pain | FAERS: 1 | US FAERS | |
| 1171 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 1172 | Phantom shocks | FAERS: 1 | US FAERS | |
| 1173 | Phlebitis | FAERS: 1 | US FAERS | |
| 1174 | Physical disability | FAERS: 1 | US FAERS | |
| 1175 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 1176 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1177 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 1178 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 1179 | Poriomania | FAERS: 1 | US FAERS | |
| 1180 | Post procedural pain | FAERS: 1 | US FAERS | |
| 1181 | Postmortem blood drug level abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1182 | Postoperative analgesia | FAERS: 1 | US FAERS | |
| 1183 | Postoperative dizziness | FAERS: 1 | US FAERS | |
| 1184 | Postural reflex impairment | FAERS: 1 | US FAERS | |
| 1185 | Pouchitis | FAERS: 1 | US FAERS | |
| 1186 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 1187 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 1188 | Product closure issue | FAERS: 1 | US FAERS | |
| 1189 | Product communication issue | FAERS: 1 | US FAERS | |
| 1190 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 1191 | Product container issue | FAERS: 1 | US FAERS | |
| 1192 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1193 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 1194 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1195 | Product friable | FAERS: 1 | US FAERS | |
| 1196 | Product lot number issue | FAERS: 1 | US FAERS | |
| 1197 | Product selection error | FAERS: 1 | US FAERS | |
| 1198 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1199 | Protein total increased | FAERS: 1 | US FAERS | |
| 1200 | Protein urine present | FAERS: 1 | SIDER US FAERS | |
| 1201 | Pulmonary coccidioides | FAERS: 1 | US FAERS | |
| 1202 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 1203 | Pulmonary hypertensive crisis | FAERS: 1 | US FAERS | |
| 1204 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 1205 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1206 | Pyuria | FAERS: 1 | US FAERS | |
| 1207 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1208 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 1209 | Radical hysterectomy | FAERS: 1 | US FAERS | |
| 1210 | Radicular pain | FAERS: 1 | OFFSIDES US FAERS | |
| 1211 | Rash maculovesicular | FAERS: 1 | US FAERS | |
| 1212 | Rebound effect | FAERS: 1 | US FAERS | |
| 1213 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 1214 | Regurgitation | FAERS: 1 | US FAERS | |
| 1215 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1216 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1217 | Renal mass | FAERS: 1 | US FAERS | |
| 1218 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 1219 | Rhinalgia | FAERS: 1 | SIDER US FAERS | |
| 1220 | Rhonchi | FAERS: 1 | US FAERS | |
| 1221 | Rift Valley Fever | FAERS: 1 | US FAERS | |
| 1222 | Scleroderma | FAERS: 1 | US FAERS | |
| 1223 | Sedation complication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1224 | Sense of oppression | FAERS: 1 | US FAERS | |
| 1225 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 1226 | Septic embolus | FAERS: 1 | US FAERS | |
| 1227 | Sexual Dysfunction | FAERS: 1 | SIDER US FAERS | |
| 1228 | Shoplifting | FAERS: 1 | US FAERS | |
| 1229 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 1230 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 1231 | Sinus bradycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 1232 | Sinus operation | FAERS: 1 | US FAERS | |
| 1233 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 1234 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1235 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1236 | Skin graft failure | FAERS: 1 | US FAERS | |
| 1237 | Skin tightness | FAERS: 1 | US FAERS | |
| 1238 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 1239 | Smoker | FAERS: 1 | US FAERS | |
| 1240 | Sphincter of Oddi Dysfunction | FAERS: 1 | 1119938 6828978 | CTD US FAERS |
| 1241 | Spinal haemangioma | FAERS: 1 | US FAERS | |
| 1242 | Splenomegaly | FAERS: 1 | US FAERS | |
| 1243 | Spondylitis | FAERS: 1 | US FAERS | |
| 1244 | Sputum retention | FAERS: 1 | US FAERS | |
| 1245 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 1246 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1247 | Stenosis | FAERS: 1 | US FAERS | |
| 1248 | Stillbirth | FAERS: 1 | US FAERS | |
| 1249 | Strabismus | FAERS: 1 | US FAERS | |
| 1250 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 1251 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 1252 | Supraventricular tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 1253 | Suture rupture | FAERS: 1 | US FAERS | |
| 1254 | Synovial Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 1255 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 1256 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 1257 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 1258 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 1259 | Tenosynovitis | FAERS: 1 | OFFSIDES US FAERS | |
| 1260 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1261 | Toe operation | FAERS: 1 | US FAERS | |
| 1262 | Tongue blistering | FAERS: 1 | SIDER US FAERS | |
| 1263 | Tongue cancer recurrent | FAERS: 1 | US FAERS | |
| 1264 | Tonic posturing | FAERS: 1 | US FAERS | |
| 1265 | Transplant | FAERS: 1 | US FAERS | |
| 1266 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 1267 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1268 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 1269 | Tuberculosis | FAERS: 1 | US FAERS | |
| 1270 | Tumour related complication | FAERS: 1 | US FAERS | |
| 1271 | Type II hypersensitivity | FAERS: 1 | US FAERS | |
| 1272 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 1273 | Umbilical hernia perforation | FAERS: 1 | US FAERS | |
| 1274 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1275 | Unemployment | FAERS: 1 | US FAERS | |
| 1276 | Unresponsive to pain stimuli | FAERS: 1 | US FAERS | |
| 1277 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 1278 | Upper airway obstruction | FAERS: 1 | SIDER US FAERS | |
| 1279 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 1280 | Vaginal pain | FAERS: 1 | US FAERS | |
| 1281 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 1282 | Ventricular Fibrillation | FAERS: 1 | OFFSIDES US FAERS | |
| 1283 | Vertebroplasty | FAERS: 1 | US FAERS | |
| 1284 | Victim of child abuse | FAERS: 1 | US FAERS | |
| 1285 | Victim of elder abuse | FAERS: 1 | US FAERS | |
| 1286 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1287 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1288 | Vitiligo | FAERS: 1 | US FAERS | |
| 1289 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 1290 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 1291 | Wrong dose | FAERS: 1 | US FAERS | |
| 1292 | intensive care | FAERS: 1 | US FAERS | |
| 1293 | Abnormal vision | SIDER | ||
| 1294 | Abscess management | OFFSIDES | ||
| 1295 | Acidosis, Respiratory | 2499224 | CTD | |
| 1296 | Administration site rash | Canada Vigilance: 1 | Canada Vigilance | |
| 1297 | Administration site reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 1298 | Ageusia | SIDER | ||
| 1299 | Alveolitis | OFFSIDES | ||
| 1300 | Amphetamines | OFFSIDES | ||
| 1301 | Analgesia | OFFSIDES | ||
| 1302 | Anorgasmia | SIDER | ||
| 1303 | Anosmia | SIDER | ||
| 1304 | Apnea | CTD | ||
| 1305 | Application site eczema | SIDER | ||
| 1306 | Arthroscopy | OFFSIDES | ||
| 1307 | Aspiration Pneumonia | OFFSIDES | ||
| 1308 | Atrial tachycardia | OFFSIDES | ||
| 1309 | Attention Deficit Disorder | SIDER | ||
| 1310 | Avascular necrosis | OFFSIDES | ||
| 1311 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 1312 | Blood Glucose | OFFSIDES | ||
| 1313 | Blood and lymphatic system disorders | SIDER | ||
| 1314 | Blood sodium | OFFSIDES | ||
| 1315 | Blood uric acid | OFFSIDES | ||
| 1316 | Bone density decreased | OFFSIDES | ||
| 1317 | Bradycardia-tachycardia syndrome | SIDER | ||
| 1318 | Brain Diseases | 17585604 | CTD | |
| 1319 | Breech Presentation | OFFSIDES | ||
| 1320 | Bursitis | OFFSIDES | ||
| 1321 | Calcific deposits removal | OFFSIDES | ||
| 1322 | Cardiomyopathies | 3414990 | CTD | |
| 1323 | Catalepsy | CTD | ||
| 1324 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 1325 | Cholangiolitis | OFFSIDES | ||
| 1326 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1327 | Chronic pain | SIDER | ||
| 1328 | Chronobiology Disorders | 15978007 | CTD | |
| 1329 | Circulatory depression | SIDER | ||
| 1330 | Cognition Disorders | 6838742 18761243 | CTD | |
| 1331 | Confabulation | OFFSIDES | ||
| 1332 | Confusion | CTD | ||
| 1333 | Consciousness Disorders | 14694924 | CTD | |
| 1334 | Cramps of lower extremities | SIDER | ||
| 1335 | Deafness Permanent | SIDER | ||
| 1336 | Debridement | OFFSIDES | ||
| 1337 | Disturbance in sexual arousal | SIDER | ||
| 1338 | Diverticulosis | OFFSIDES | ||
| 1339 | Drowsiness | OFFSIDES SIDER | ||
| 1340 | Ear and labyrinth disorders | SIDER | ||
| 1341 | Empyema | OFFSIDES | ||
| 1342 | Endophthalmitis | SIDER | ||
| 1343 | Enlargement abdomen | SIDER | ||
| 1344 | Enterocolitis viral | OFFSIDES | ||
| 1345 | Epicondylitis | OFFSIDES | ||
| 1346 | Epstein-Barr virus associated lymphoproliferative disorder | OFFSIDES | ||
| 1347 | Exposure via breast milk | Canada Vigilance: 1 | Canada Vigilance | |
| 1348 | Facial paralysis | SIDER | ||
| 1349 | Feeding tube complication | OFFSIDES | ||
| 1350 | Fetal Distress | 7943823 9223206 | CTD | |
| 1351 | Fever | 8087910 | CTD | |
| 1352 | Gastrointestinal cancer metastatic | OFFSIDES | ||
| 1353 | Gingival erythema | OFFSIDES | ||
| 1354 | Gingivitis | SIDER | ||
| 1355 | Hallucinations | 4562467 9060031 | CTD | |
| 1356 | Hemorrhage of colon | SIDER | ||
| 1357 | Hepatic impairment | SIDER | ||
| 1358 | Hepatic necrosis | OFFSIDES | ||
| 1359 | Hepatorenal Syndrome | SIDER | ||
| 1360 | Hepatotoxicity | OFFSIDES | ||
| 1361 | Hiccough | OFFSIDES | ||
| 1362 | Histiocytosis haematophagic | OFFSIDES | ||
| 1363 | Horner Syndrome | 10051945 17270429 | CTD | |
| 1364 | Hyperalgesia |
9060031
10691234 11973202 14666255 16192778 17038211 17142651 17240843 17906213 18222628 18292686 18701828 18766156 19247760 19608840 19697012 20081245 | CTD | |
| 1365 | Hyperplastic cholecystopathy | OFFSIDES | ||
| 1366 | Hypotension, Orthostatic | 10520911 | CTD | |
| 1367 | Hypotensive | SIDER | ||
| 1368 | Increased bronchial secretion | SIDER | ||
| 1369 | Infestation | SIDER | ||
| 1370 | Influenza-like symptoms | SIDER | ||
| 1371 | Injection site pain | SIDER | ||
| 1372 | Instillation site pain | SIDER | ||
| 1373 | Intention tremor | OFFSIDES | ||
| 1374 | Intraoperative Awareness | 3919524 | CTD | |
| 1375 | Labor Pain | CTD | ||
| 1376 | Lacrimal structural disorder | SIDER | ||
| 1377 | Lactic dehydrogenase activity increased | SIDER | ||
| 1378 | Laparotomy | OFFSIDES | ||
| 1379 | Leukopenia neonatal | OFFSIDES | ||
| 1380 | Leukopenia | SIDER | ||
| 1381 | Listeria sepsis | OFFSIDES | ||
| 1382 | Liver carcinoma ruptured | OFFSIDES | ||
| 1383 | Localised skin reaction | SIDER | ||
| 1384 | Long QT Syndrome | 16757186 | CTD | |
| 1385 | Malaise and fatigue | SIDER | ||
| 1386 | Mass excision | OFFSIDES | ||
| 1387 | Maternal use of illicit drugs | OFFSIDES | ||
| 1388 | Meniscus removal | OFFSIDES | ||
| 1389 | Migraine Disorders | 15623730 | CTD | |
| 1390 | Multiple sclerosis relapse | OFFSIDES | ||
| 1391 | Muscle relaxant therapy | SIDER | ||
| 1392 | Myocardial Ischemia | 7887099 | CTD | |
| 1393 | Nasal discomfort | SIDER | ||
| 1394 | Neck stiffness | SIDER | ||
| 1395 | Neurologic Manifestations | 8694368 11004039 | CTD | |
| 1396 | Neuropathy | SIDER | ||
| 1397 | Non-cardiac chest pain | SIDER | ||
| 1398 | Nuchal Rigidity | SIDER | ||
| 1399 | Oculogyric crisis | SIDER | ||
| 1400 | Opioid naive | SIDER | ||
| 1401 | Oral Cavity Fistula | OFFSIDES | ||
| 1402 | Oral pustule | SIDER | ||
| 1403 | Oropharyngeal discomfort | OFFSIDES | ||
| 1404 | Osteosclerosis | OFFSIDES | ||
| 1405 | Pain, Postoperative |
2961290
3328681 7549168 8067230 8160955 8301822 8457049 9352758 9404164 9583555 9698952 9836029 9856709 10051932 10490157 10520911 10642972 10691217 10764171 10992828 11270012 11300388 11359592 11554966 11732515 11782331 12492791 12766657 15025617 15564946 17000818 17006078 18028044 18181379 19138915 19229379 19329015 19471184 19634546 19843808 20005913 20084599 20833531 | CTD | |
| 1406 | Panophthalmitis | OFFSIDES | ||
| 1407 | Paranoid reaction | SIDER | ||
| 1408 | Paresis | 10960295 16786914 | CTD | |
| 1409 | Partial permanent deafness | SIDER | ||
| 1410 | Partial transitory deafness | SIDER | ||
| 1411 | Periodontitis | OFFSIDES | ||
| 1412 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 1413 | Pharyngitis | SIDER | ||
| 1414 | Pharyngolaryngeal Pain | SIDER | ||
| 1415 | Pleurisy | OFFSIDES | ||
| 1416 | Postoperative Complications | 18806051 | CTD | |
| 1417 | Postoperative Nausea and Vomiting | CTD | ||
| 1418 | Primary sequestrum | OFFSIDES | ||
| 1419 | Procedural hypotension | OFFSIDES | ||
| 1420 | Pseudolymphoma | Canada Vigilance: 1 | Canada Vigilance | |
| 1421 | Psychomotor Agitation | 9060031 | CTD | |
| 1422 | Psychotic Disorders | 18486797 | CTD | |
| 1423 | Pulmonary Edema | 717752 17400983 | CTD | |
| 1424 | Pulmonary function test decreased | SIDER | ||
| 1425 | Pulmonary radiation injury | OFFSIDES | ||
| 1426 | Pupillary light reflex tests abnormal | OFFSIDES | ||
| 1427 | Pyelonephritis | SIDER | ||
| 1428 | Radiation mucositis | OFFSIDES | ||
| 1429 | Rectal fissure | OFFSIDES | ||
| 1430 | Reflex, Abnormal | 9920213 | CTD | |
| 1431 | Renal Insufficiency | 9549427 | CTD | |
| 1432 | Respiratory Insufficiency |
3257727
3337659 3938174 6110396 6129881 6784740 8986972 9037435 9698952 10475320 11581460 14694924 16764215 17914664 18544179 19461299 19755623 19819313 29669042 | CTD SIDER | |
| 1433 | Respiratory Tract Diseases | 15930401 | CTD | |
| 1434 | Rhinitis | OFFSIDES SIDER | ||
| 1435 | Salpingo-oophorectomy | OFFSIDES | ||
| 1436 | Seizures |
1758248
2151504 2675664 2725188 6407366 6422799 6693516 6703383 7149296 9174307 10642972 11093997 12908689 15897677 | CTD | |
| 1437 | Sensation Disorders | 12459700 19200067 | CTD | |
| 1438 | Sequestrectomy | OFFSIDES | ||
| 1439 | Shivering | SIDER | ||
| 1440 | Sick Sinus Syndrome | SIDER | ||
| 1441 | Sinus Arrest, Cardiac | 22294 1678901 16167799 | CTD | |
| 1442 | Skin toxicity | OFFSIDES | ||
| 1443 | Soft Tissue Injuries | OFFSIDES | ||
| 1444 | Soliloquy | OFFSIDES | ||
| 1445 | Spasm | 1119938 7196706 | CTD | |
| 1446 | Spinal Cord Injuries | 9794061 | CTD | |
| 1447 | Stomatocytes present | OFFSIDES | ||
| 1448 | Substance Withdrawal Syndrome | CTD | ||
| 1449 | Substance-Related Disorders | 9695458 | CTD | |
| 1450 | Sweating | SIDER | ||
| 1451 | Synovitis | OFFSIDES SIDER | ||
| 1452 | Testicular cancer metastatic | OFFSIDES | ||
| 1453 | Thrombophlebitis | SIDER | ||
| 1454 | Torsades de Pointes | 10402818 | CTD | |
| 1455 | Upper respiratory tract congestion | SIDER | ||
| 1456 | Upper-airway cough syndrome | SIDER | ||
| 1457 | Upset stomach | SIDER | ||
| 1458 | Urinary Bladder Diseases | 11581460 | CTD | |
| 1459 | Urination Disorders | 15025617 | CTD | |
| 1460 | Urine output increased | SIDER | ||
| 1461 | Vasodilation procedure | SIDER | ||
| 1462 | Vasodilation | SIDER | ||
| 1463 | Ventricular Dysfunction, Left | 3879290 | CTD | |
| 1464 | Vesiculobullous rash | SIDER | ||
| 1465 | anaphylaxis | 17400983 | CTD | |
| 1466 | pustule | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.