Docetaxel
(ZDZOTLJHXYCWBA-VCVYQWHSSA-N)
Structure
- SMILES
- CC(=O)O[C@@]12CO[C@@H]1C[C@@H]([C@@]1([C@@H]2[C@H](OC(=O)c2ccccc2)[C@]2(O)C[C@H](OC(=O)[C@@H]([C@H](c3ccccc3)NC(=O)OC(C)(C)C)O)C(=C(C2(C)C)[C@H](C1=O)O)C)C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01CD02
- Molecular Formula:
- C43H53NO14
- Molecular Weight:
- 807.879
- Log P:
- 3.6505
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 5
- TPSA:
- 224.45
- CAS Number(s):
- 114977-28-5
Synonym(s)
1.
Docetaxel
2.
Docetaxel Anhydrous
3.
Docetaxel Hydrate
4.
Docetaxel Trihydrate
5.
Docetaxol
6.
N-Debenzoyl-N-tert-butoxycarbonyl-10-deacetyltaxol
7.
NSC 628503
8.
RP 56976
9.
RP-56976
10.
Taxoltere Metro
11.
Taxotere
12.
N Debenzoyl N tert butoxycarbonyl 10 deacetyltaxol
13.
RP56976
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Alopecia | FAERS: 10176 Canada Vigilance: 11 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 2 | Emotional distress | FAERS: 3929 | OFFSIDES US FAERS | |
| 3 | Anxiety | FAERS: 3166 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Pain | FAERS: 1906 | OFFSIDES SIDER US FAERS | |
| 5 | Impaired quality of life | FAERS: 1840 | US FAERS | |
| 6 | Psychological Trauma | FAERS: 646 | US FAERS | |
| 7 | Impaired work ability | FAERS: 191 | US FAERS | |
| 8 | Erythema | FAERS: 185 Canada Vigilance: 11 | 7907667 10792238 19687336 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 9 | Discomfort | FAERS: 174 | US FAERS | |
| 10 | Flushing | FAERS: 133 Canada Vigilance: 17 | 7918126 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Alopecia Areata | FAERS: 111 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Febrile Neutropenia | FAERS: 110 Canada Vigilance: 5 | 23758476 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 13 | Neutropenia | FAERS: 109 Canada Vigilance: 1 |
7918124
9364537 9779713 10416005 10792238 11326485 12006518 12794247 12801257 12926135 14758127 15332544 15585077 15839914 16012734 16525670 17461902 17697552 17919350 19174694 20087171 20700740 21415776 21726821 25648089 | CTD SIDER Canada Vigilance US FAERS |
| 14 | Deformity | FAERS: 100 | US FAERS | |
| 15 | Nausea | FAERS: 98 Canada Vigilance: 9 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 16 | Back Pain | FAERS: 90 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 17 | Asthenia | FAERS: 76 Canada Vigilance: 1 | 9779713 20185313 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 18 | Fatigue | FAERS: 72 Canada Vigilance: 2 | 11299845 12365019 17846704 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 19 | Leukopenia | FAERS: 61 | CTD SIDER US FAERS | |
| 20 | Vomiting | FAERS: 61 Canada Vigilance: 4 | CTD SIDER Canada Vigilance US FAERS | |
| 21 | Chest Pain | FAERS: 58 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Chest discomfort | FAERS: 58 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 23 | Respiratory Failure | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 24 | Hypotension | FAERS: 54 | 12794247 | CTD SIDER US FAERS |
| 25 | Abdominal Pain | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 26 | Pneumonia | FAERS: 48 Canada Vigilance: 1 | 12365019 21415776 | CTD SIDER Canada Vigilance US FAERS |
| 27 | Disease Progression | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 28 | Malaise | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 29 | Sepsis | FAERS: 42 | SIDER US FAERS | |
| 30 | Neutrophil count decreased | FAERS: 40 | OFFSIDES US FAERS | |
| 31 | Dizziness | FAERS: 39 | SIDER US FAERS | |
| 32 | White blood cell count decreased | FAERS: 38 | US FAERS | |
| 33 | Arthralgia | FAERS: 36 Canada Vigilance: 1 | 11299845 15118009 | CTD SIDER Canada Vigilance US FAERS |
| 34 | Myalgia | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 35 | Pneumonitis | FAERS: 36 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 36 | Dehydration | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 37 | Hypersensitivity | FAERS: 34 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 38 | Disseminated Intravascular Coagulation | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 39 | Tachycardia | FAERS: 32 | SIDER US FAERS | |
| 40 | Quality of life decreased | FAERS: 31 | US FAERS | |
| 41 | Swelling | FAERS: 31 | SIDER US FAERS | |
| 42 | Drug ineffective | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Hypoxia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 44 | Headache | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Stomatitis | FAERS: 29 | CTD SIDER US FAERS | |
| 46 | Bone pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 47 | Cardiac Arrest | FAERS: 27 | US FAERS | |
| 48 | Toxicity to various agents | FAERS: 27 | US FAERS | |
| 49 | General physical health deterioration | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 50 | Scleroderma | FAERS: 25 | SIDER US FAERS | |
| 51 | Septic Shock | FAERS: 25 | OFFSIDES US FAERS | |
| 52 | Skin reaction | FAERS: 25 | US FAERS | |
| 53 | Vertigo | FAERS: 24 | US FAERS | |
| 54 | Burning sensation | FAERS: 23 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 55 | Pulmonary Embolism | FAERS: 23 | 12756431 17846704 | CTD SIDER US FAERS |
| 56 | Shock | FAERS: 22 | SIDER US FAERS | |
| 57 | Thrombocytopenia | FAERS: 22 | 12365019 18000507 20087171 | CTD SIDER US FAERS |
| 58 | Capillary Leak Syndrome | FAERS: 21 | OFFSIDES US FAERS | |
| 59 | Constipation | FAERS: 21 | SIDER US FAERS | |
| 60 | Medication Error | FAERS: 21 | US FAERS | |
| 61 | Pruritus | FAERS: 21 | SIDER US FAERS | |
| 62 | Syncope | FAERS: 21 | SIDER US FAERS | |
| 63 | Inflammation | FAERS: 20 | SIDER US FAERS | |
| 64 | Respiratory distress | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 65 | Weight decreased | FAERS: 20 | SIDER US FAERS | |
| 66 | Ascites | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 67 | Palpitations | FAERS: 19 | SIDER US FAERS | |
| 68 | Pulmonary toxicity | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 69 | Agranulocytosis | FAERS: 18 | 11679186 | CTD SIDER US FAERS |
| 70 | Atrial Fibrillation | FAERS: 18 | 12597151 | CTD SIDER US FAERS |
| 71 | Chills | FAERS: 18 | SIDER US FAERS | |
| 72 | Neutropenic sepsis | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 73 | Visual Impairment | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Extravasation | FAERS: 16 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 75 | Feeling abnormal | FAERS: 16 | SIDER US FAERS | |
| 76 | Wheezing | FAERS: 16 | US FAERS | |
| 77 | Acute kidney injury | FAERS: 15 | US FAERS | |
| 78 | Myocardial Infarction | FAERS: 15 | SIDER US FAERS | |
| 79 | Onycholysis | FAERS: 15 | SIDER US FAERS | |
| 80 | Depressed Level of Consciousness | FAERS: 14 | US FAERS | |
| 81 | Malignant neoplasm progression | FAERS: 14 | OFFSIDES US FAERS | |
| 82 | Product quality issue | FAERS: 14 | US FAERS | |
| 83 | Rash erythematous | FAERS: 14 | SIDER US FAERS | |
| 84 | Emotional disorder | FAERS: 13 | US FAERS | |
| 85 | Enterocolitis | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 86 | Hypophagia | FAERS: 13 | OFFSIDES US FAERS | |
| 87 | Skin toxicity | FAERS: 13 | SIDER US FAERS | |
| 88 | Thermal burn | FAERS: 13 | US FAERS | |
| 89 | Pneumothorax | FAERS: 12 | OFFSIDES US FAERS | |
| 90 | Psoriasis | FAERS: 12 | US FAERS | |
| 91 | Adverse event | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 92 | Aspartate Aminotransferase Increased | FAERS: 11 | SIDER US FAERS | |
| 93 | Colitis | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 94 | Infection | FAERS: 11 | 7918126 9779713 15839914 | CTD OFFSIDES SIDER US FAERS |
| 95 | Infusion Site Extravasation | FAERS: 11 | US FAERS | |
| 96 | Polyneuropathy | FAERS: 11 | SIDER US FAERS | |
| 97 | Pulmonary Fibrosis | FAERS: 11 | SIDER US FAERS | |
| 98 | Urticaria | FAERS: 11 | US FAERS | |
| 99 | Cellulitis | FAERS: 10 | OFFSIDES US FAERS | |
| 100 | Dysgeusia | FAERS: 10 | 18378545 | CTD OFFSIDES SIDER US FAERS |
| 101 | Leukocytosis | FAERS: 10 | US FAERS | |
| 102 | Myositis | FAERS: 10 | US FAERS | |
| 103 | Pancreatitis | FAERS: 10 | 20602134 | CTD US FAERS |
| 104 | Pericardial effusion | FAERS: 10 | 17987805 | CTD OFFSIDES SIDER US FAERS |
| 105 | Rhabdomyolysis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Cyanosis | FAERS: 9 | US FAERS | |
| 107 | Dermatitis | FAERS: 9 | 17987805 | CTD SIDER US FAERS |
| 108 | Gastric ulcer | FAERS: 9 | US FAERS | |
| 109 | Hydrocephalus | FAERS: 9 | US FAERS | |
| 110 | Productive Cough | FAERS: 9 | US FAERS | |
| 111 | Respiratory Depression | FAERS: 9 | US FAERS | |
| 112 | Restlessness | FAERS: 9 | US FAERS | |
| 113 | Skin Ulcer | FAERS: 9 | US FAERS | |
| 114 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 115 | Alanine Aminotransferase Increased | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 116 | Angioedema | FAERS: 8 | US FAERS | |
| 117 | Anhedonia | FAERS: 8 | OFFSIDES US FAERS | |
| 118 | Blindness | FAERS: 8 | US FAERS | |
| 119 | Blood urea increased | FAERS: 8 | OFFSIDES US FAERS | |
| 120 | Cataract | FAERS: 8 | OFFSIDES US FAERS | |
| 121 | Choking sensation | FAERS: 8 | OFFSIDES US FAERS | |
| 122 | Diffuse alveolar damage | FAERS: 8 | US FAERS | |
| 123 | Ileus | FAERS: 8 | SIDER US FAERS | |
| 124 | Infusion site erythema | FAERS: 8 | US FAERS | |
| 125 | No adverse event | FAERS: 8 | US FAERS | |
| 126 | Phlebitis | FAERS: 8 Canada Vigilance: 4 | 12564432 25634538 | CTD SIDER Canada Vigilance US FAERS |
| 127 | Presyncope | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Respiratory arrest | FAERS: 8 | US FAERS | |
| 129 | Skin lesion | FAERS: 8 | US FAERS | |
| 130 | Tinnitus | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Abasia | FAERS: 7 | US FAERS | |
| 132 | Activities of daily living impaired | FAERS: 7 | US FAERS | |
| 133 | Anaphylactic shock | FAERS: 7 | SIDER US FAERS | |
| 134 | Blood lactate dehydrogenase increased | FAERS: 7 | OFFSIDES US FAERS | |
| 135 | Bradycardia | FAERS: 7 | OFFSIDES US FAERS | |
| 136 | Dacryostenosis acquired | FAERS: 7 | SIDER US FAERS | |
| 137 | Deafness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 138 | Febrile bone marrow aplasia | FAERS: 7 | OFFSIDES US FAERS | |
| 139 | Gastritis | FAERS: 7 | US FAERS | |
| 140 | Gastrointestinal toxicity | FAERS: 7 | US FAERS | |
| 141 | Intestinal Perforation | FAERS: 7 | OFFSIDES US FAERS | |
| 142 | Memory impairment | FAERS: 7 | US FAERS | |
| 143 | Musculoskeletal Pain | FAERS: 7 | OFFSIDES US FAERS | |
| 144 | Pericarditis | FAERS: 7 | OFFSIDES US FAERS | |
| 145 | Petechiae | FAERS: 7 | US FAERS | |
| 146 | Recall phenomenon | FAERS: 7 | SIDER US FAERS | |
| 147 | Skin necrosis | FAERS: 7 | US FAERS | |
| 148 | Soft tissue necrosis | FAERS: 7 | US FAERS | |
| 149 | Urinary Retention | FAERS: 7 | US FAERS | |
| 150 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 151 | Wound dehiscence | FAERS: 7 | OFFSIDES US FAERS | |
| 152 | Androgenetic Alopecia | FAERS: 6 | US FAERS | |
| 153 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 154 | Blood creatinine increased | FAERS: 6 | OFFSIDES US FAERS | |
| 155 | Bronchospasm | FAERS: 6 | SIDER US FAERS | |
| 156 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 157 | Deep Vein Thrombosis | FAERS: 6 | SIDER US FAERS | |
| 158 | Dermatitis acneiform | FAERS: 6 | US FAERS | |
| 159 | Diffuse alopecia | FAERS: 6 | US FAERS | |
| 160 | Drug resistance | FAERS: 6 | US FAERS | |
| 161 | Dyspepsia | FAERS: 6 | SIDER US FAERS | |
| 162 | Encephalitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Eye pain | FAERS: 6 | OFFSIDES US FAERS | |
| 164 | General physical condition abnormal | FAERS: 6 | US FAERS | |
| 165 | Hypertensive crisis | FAERS: 6 | US FAERS | |
| 166 | Infusion site pain | FAERS: 6 | US FAERS | |
| 167 | Lung infection pseudomonal | FAERS: 6 | US FAERS | |
| 168 | Lymphopenia | FAERS: 6 | SIDER US FAERS | |
| 169 | Necrosis | FAERS: 6 | 11778233 | CTD SIDER US FAERS |
| 170 | Neuralgia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 171 | Oropharyngeal pain | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 172 | Osteoradionecrosis | FAERS: 6 | OFFSIDES US FAERS | |
| 173 | Pancytopenia | FAERS: 6 | SIDER US FAERS | |
| 174 | Performance status decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 175 | Peripheral swelling | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 176 | Skin hypertrophy | FAERS: 6 | US FAERS | |
| 177 | Supraventricular tachycardia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 178 | Tremor | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 180 | White blood cell count abnormal | FAERS: 6 | US FAERS | |
| 181 | jaundice | FAERS: 6 | SIDER US FAERS | |
| 182 | Abdominal discomfort | FAERS: 5 | OFFSIDES US FAERS | |
| 183 | Ageusia | FAERS: 5 | SIDER US FAERS | |
| 184 | Akinesia | FAERS: 5 | US FAERS | |
| 185 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 186 | Amnesia | FAERS: 5 | US FAERS | |
| 187 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 188 | Carbon dioxide decreased | FAERS: 5 | US FAERS | |
| 189 | Cerebral Infarction | FAERS: 5 | 20087171 | CTD US FAERS |
| 190 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 191 | Cholecystitis | FAERS: 5 | US FAERS | |
| 192 | Drug toxicity | FAERS: 5 | US FAERS | |
| 193 | Embolism | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 194 | Eubacterium infection | FAERS: 5 | US FAERS | |
| 195 | Fasciitis | FAERS: 5 | US FAERS | |
| 196 | Haematotoxicity | FAERS: 5 | US FAERS | |
| 197 | Injection site extravasation | FAERS: 5 | US FAERS | |
| 198 | Injection site pain | FAERS: 5 | US FAERS | |
| 199 | Lymphocyte count decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 200 | Neutropenic infection | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 201 | Oral pain | FAERS: 5 | US FAERS | |
| 202 | Pelvic Pain | FAERS: 5 | US FAERS | |
| 203 | Pneumatosis intestinalis | FAERS: 5 | US FAERS | |
| 204 | Porphyria non-acute | FAERS: 5 | US FAERS | |
| 205 | Product substitution issue | FAERS: 5 | US FAERS | |
| 206 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 207 | Sinusitis | FAERS: 5 | OFFSIDES US FAERS | |
| 208 | Toxic Epidermal Necrolysis | FAERS: 5 | SIDER US FAERS | |
| 209 | Trismus | FAERS: 5 | US FAERS | |
| 210 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 211 | Accidental overdose | FAERS: 4 | US FAERS | |
| 212 | Acute Lung Injury | FAERS: 4 | US FAERS | |
| 213 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 214 | Agitation | FAERS: 4 | US FAERS | |
| 215 | Alcohol abuse | FAERS: 4 | US FAERS | |
| 216 | Atelectasis | FAERS: 4 | OFFSIDES US FAERS | |
| 217 | Blood albumin decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 218 | Blood creatine phosphokinase MB increased | FAERS: 4 | US FAERS | |
| 219 | Breast necrosis | FAERS: 4 | US FAERS | |
| 220 | Chemical injury | FAERS: 4 | US FAERS | |
| 221 | Choking | FAERS: 4 | OFFSIDES US FAERS | |
| 222 | Diabetic Ketoacidosis | FAERS: 4 | US FAERS | |
| 223 | Diplopia | FAERS: 4 | US FAERS | |
| 224 | Disease recurrence | FAERS: 4 | US FAERS | |
| 225 | Dry skin | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 226 | Epidermolysis | FAERS: 4 | US FAERS | |
| 227 | Fibrin D dimer increased | FAERS: 4 | US FAERS | |
| 228 | Histiocytosis haematophagic | FAERS: 4 | US FAERS | |
| 229 | Infusion site reaction | FAERS: 4 | SIDER US FAERS | |
| 230 | Infusion site swelling | FAERS: 4 | US FAERS | |
| 231 | Karnofsky scale worsened | FAERS: 4 | US FAERS | |
| 232 | Large intestine perforation | FAERS: 4 | SIDER US FAERS | |
| 233 | Laryngospasm | FAERS: 4 | OFFSIDES US FAERS | |
| 234 | Leukoencephalopathy | FAERS: 4 | US FAERS | |
| 235 | Metastasis | FAERS: 4 | US FAERS | |
| 236 | Nail toxicity | FAERS: 4 | SIDER US FAERS | |
| 237 | Nasopharyngitis | FAERS: 4 | SIDER US FAERS | |
| 238 | Neutrophil count abnormal | FAERS: 4 | US FAERS | |
| 239 | Oliguria | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 240 | Optic Atrophy | FAERS: 4 | US FAERS | |
| 241 | Pain of skin | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Paraparesis | FAERS: 4 | US FAERS | |
| 243 | Pleurisy | FAERS: 4 | US FAERS | |
| 244 | Purpura | FAERS: 4 | US FAERS | |
| 245 | Radiation skin injury | FAERS: 4 | OFFSIDES US FAERS | |
| 246 | Rales | FAERS: 4 | US FAERS | |
| 247 | Renal tubular disorder | FAERS: 4 | US FAERS | |
| 248 | Sinus Arrhythmia | FAERS: 4 | US FAERS | |
| 249 | Stevens-Johnson Syndrome | FAERS: 4 | 25811541 | CTD SIDER US FAERS |
| 250 | Throat irritation | FAERS: 4 | US FAERS | |
| 251 | Ulcer | FAERS: 4 | OFFSIDES US FAERS | |
| 252 | Unevaluable event | FAERS: 4 | US FAERS | |
| 253 | Visual disturbance | FAERS: 4 | SIDER US FAERS | |
| 254 | Acute respiratory failure | FAERS: 3 | OFFSIDES US FAERS | |
| 255 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 256 | Anuria | FAERS: 3 | US FAERS | |
| 257 | Autoimmune thrombocytopenia | FAERS: 3 | US FAERS | |
| 258 | Bone marrow depression | FAERS: 3 | US FAERS | |
| 259 | Cardiotoxicity | FAERS: 3 | SIDER US FAERS | |
| 260 | Cell marker increased | FAERS: 3 | US FAERS | |
| 261 | Creatine phosphokinase decreased | FAERS: 3 | US FAERS | |
| 262 | Crying | FAERS: 3 | US FAERS | |
| 263 | Cystitis | FAERS: 3 | US FAERS | |
| 264 | Dementia | FAERS: 3 | US FAERS | |
| 265 | Depressed mood | FAERS: 3 | OFFSIDES US FAERS | |
| 266 | Dermatomyositis | FAERS: 3 | OFFSIDES US FAERS | |
| 267 | Disability | FAERS: 3 | US FAERS | |
| 268 | Disorientation | FAERS: 3 | US FAERS | |
| 269 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 270 | Dysuria | FAERS: 3 | OFFSIDES US FAERS | |
| 271 | Ecthyma | FAERS: 3 | US FAERS | |
| 272 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 273 | Fixed drug eruption | FAERS: 3 | US FAERS | |
| 274 | Flatulence | FAERS: 3 | OFFSIDES US FAERS | |
| 275 | Gallbladder necrosis | FAERS: 3 | US FAERS | |
| 276 | Gastrointestinal perforation | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 277 | Glaucoma | FAERS: 3 | US FAERS | |
| 278 | Gout | FAERS: 3 | US FAERS | |
| 279 | Hemiparesis | FAERS: 3 | US FAERS | |
| 280 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 281 | Hyperkeratosis | FAERS: 3 | US FAERS | |
| 282 | Impaired self-care | FAERS: 3 | US FAERS | |
| 283 | Intracranial Hypotension | FAERS: 3 | US FAERS | |
| 284 | Ketoacidosis | FAERS: 3 | US FAERS | |
| 285 | Lethargy | FAERS: 3 | SIDER US FAERS | |
| 286 | Lip swelling | FAERS: 3 | US FAERS | |
| 287 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 288 | Lung consolidation | FAERS: 3 | OFFSIDES US FAERS | |
| 289 | Lymphangiosis carcinomatosa | FAERS: 3 | OFFSIDES US FAERS | |
| 290 | Mental impairment | FAERS: 3 | US FAERS | |
| 291 | Mental status changes | FAERS: 3 | US FAERS | |
| 292 | Metaplasia | FAERS: 3 | US FAERS | |
| 293 | Metastatic Neoplasm | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 294 | Monoplegia | FAERS: 3 | US FAERS | |
| 295 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 296 | Nerve injury | FAERS: 3 | US FAERS | |
| 297 | Neutropenic colitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 298 | Noninfective gingivitis | FAERS: 3 | US FAERS | |
| 299 | Optic Neuropathy | FAERS: 3 | US FAERS | |
| 300 | Oral candidiasis | FAERS: 3 | SIDER US FAERS | |
| 301 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 302 | Osteonecrosis of Jaw | FAERS: 3 | US FAERS | |
| 303 | Paraplegia | FAERS: 3 | US FAERS | |
| 304 | Portal venous gas | FAERS: 3 | US FAERS | |
| 305 | Product formulation issue | FAERS: 3 | US FAERS | |
| 306 | Prostate cancer recurrent | FAERS: 3 | OFFSIDES US FAERS | |
| 307 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 308 | Pulmonary Infarction | FAERS: 3 | US FAERS | |
| 309 | Sense of oppression | FAERS: 3 | US FAERS | |
| 310 | Skin irritation | FAERS: 3 | US FAERS | |
| 311 | Soft Tissue Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 312 | Stress | FAERS: 3 | US FAERS | |
| 313 | Sudden death | FAERS: 3 | OFFSIDES US FAERS | |
| 314 | Toxic Optic Neuropathy | FAERS: 3 | US FAERS | |
| 315 | Troponin I increased | FAERS: 3 | US FAERS | |
| 316 | Tuberculosis | FAERS: 3 | US FAERS | |
| 317 | Vasculitis | FAERS: 3 | US FAERS | |
| 318 | Vocal Cord Paralysis | FAERS: 3 | US FAERS | |
| 319 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 320 | pseudomembranous colitis | FAERS: 3 | US FAERS | |
| 321 | Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 322 | Acquired porphyria | FAERS: 2 | US FAERS | |
| 323 | Alveolitis | FAERS: 2 | US FAERS | |
| 324 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 325 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 326 | Anosmia | FAERS: 2 | OFFSIDES US FAERS | |
| 327 | Aortic aneurysm repair | FAERS: 2 | US FAERS | |
| 328 | Arthritis | FAERS: 2 | US FAERS | |
| 329 | Asphyxia | FAERS: 2 | US FAERS | |
| 330 | Ataxia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 331 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 332 | Autonomic Dysreflexia | FAERS: 2 | US FAERS | |
| 333 | Beta 2 microglobulin urine increased | FAERS: 2 | US FAERS | |
| 334 | Blood Corticotrophin Decreased | FAERS: 2 | US FAERS | |
| 335 | Blood cortisol decreased | FAERS: 2 | US FAERS | |
| 336 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 337 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 338 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 339 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 340 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 341 | Bronchitis | FAERS: 2 | OFFSIDES US FAERS | |
| 342 | Bronchopneumonia | FAERS: 2 | SIDER US FAERS | |
| 343 | Candida sepsis | FAERS: 2 | US FAERS | |
| 344 | Cardiac Tamponade | FAERS: 2 | OFFSIDES US FAERS | |
| 345 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 346 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 347 | Catheter site erythema | FAERS: 2 | US FAERS | |
| 348 | Chemical burn of skin | FAERS: 2 | US FAERS | |
| 349 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 350 | Chylothorax | FAERS: 2 | US FAERS | |
| 351 | Clostridium colitis | FAERS: 2 | US FAERS | |
| 352 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 353 | Cold sweat | FAERS: 2 | US FAERS | |
| 354 | Delirium | FAERS: 2 | US FAERS | |
| 355 | Diplegia | FAERS: 2 | US FAERS | |
| 356 | Diverticulitis | FAERS: 2 | US FAERS | |
| 357 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 358 | Duodenal Ulcer | FAERS: 2 | SIDER US FAERS | |
| 359 | Duodenitis | FAERS: 2 | US FAERS | |
| 360 | Dysphonia | FAERS: 2 | OFFSIDES US FAERS | |
| 361 | Eccrine squamous syringometaplasia | FAERS: 2 | US FAERS | |
| 362 | Eczema | FAERS: 2 | US FAERS | |
| 363 | Electrocardiogram T wave biphasic | FAERS: 2 | US FAERS | |
| 364 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 365 | Enterovesical Fistula | FAERS: 2 | US FAERS | |
| 366 | Epidermal necrosis | FAERS: 2 | US FAERS | |
| 367 | Epistaxis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 368 | Erectile dysfunction | FAERS: 2 | OFFSIDES US FAERS | |
| 369 | Erythema Multiforme | FAERS: 2 | SIDER US FAERS | |
| 370 | Eschar | FAERS: 2 | US FAERS | |
| 371 | Exfoliative rash | FAERS: 2 | SIDER US FAERS | |
| 372 | Eye inflammation | FAERS: 2 | US FAERS | |
| 373 | Eye irritation | FAERS: 2 | SIDER US FAERS | |
| 374 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 375 | Fibromyalgia | FAERS: 2 | OFFSIDES US FAERS | |
| 376 | Fibrosis | FAERS: 2 | US FAERS | |
| 377 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 378 | Gangrene | FAERS: 2 | US FAERS | |
| 379 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 380 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 381 | Gastrointestinal wall thickening | FAERS: 2 | US FAERS | |
| 382 | Glomerulonephritis | FAERS: 2 | US FAERS | |
| 383 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 384 | Hyaluronic acid decreased | FAERS: 2 | US FAERS | |
| 385 | Hypercapnia | FAERS: 2 | US FAERS | |
| 386 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 387 | Incontinence | FAERS: 2 | US FAERS | |
| 388 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 389 | Inflammatory marker increased | FAERS: 2 | US FAERS | |
| 390 | Influenza | FAERS: 2 | US FAERS | |
| 391 | Infusion site bruising | FAERS: 2 | US FAERS | |
| 392 | Infusion site cellulitis | FAERS: 2 | US FAERS | |
| 393 | Infusion site vesicles | FAERS: 2 | US FAERS | |
| 394 | Injection site erythema | FAERS: 2 | US FAERS | |
| 395 | Injection site irritation | FAERS: 2 | US FAERS | |
| 396 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 397 | Intentional drug misuse | FAERS: 2 | OFFSIDES US FAERS | |
| 398 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 399 | Intestinal Obstruction | FAERS: 2 | SIDER US FAERS | |
| 400 | Intestinal gangrene | FAERS: 2 | US FAERS | |
| 401 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 402 | Labile blood pressure | FAERS: 2 | US FAERS | |
| 403 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 404 | Lymphocele | FAERS: 2 | US FAERS | |
| 405 | Medical device site pain | FAERS: 2 | US FAERS | |
| 406 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 407 | Mucosal Infection | FAERS: 2 | US FAERS | |
| 408 | Muscle necrosis | FAERS: 2 | US FAERS | |
| 409 | Muscle tightness | FAERS: 2 | US FAERS | |
| 410 | Nail pigmentation | FAERS: 2 | US FAERS | |
| 411 | Neck Pain | FAERS: 2 | US FAERS | |
| 412 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 413 | Neuritis | FAERS: 2 | SIDER US FAERS | |
| 414 | Neutrophil percentage increased | FAERS: 2 | US FAERS | |
| 415 | Onychoclasis | FAERS: 2 | US FAERS | |
| 416 | Osteomyelitis | FAERS: 2 | OFFSIDES US FAERS | |
| 417 | Overdose | FAERS: 2 | US FAERS | |
| 418 | PO2 decreased | FAERS: 2 | US FAERS | |
| 419 | Peripheral motor neuropathy | FAERS: 2 | SIDER US FAERS | |
| 420 | Photophobia | FAERS: 2 | US FAERS | |
| 421 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 422 | Procedural complication | FAERS: 2 | US FAERS | |
| 423 | Product use issue | FAERS: 2 | US FAERS | |
| 424 | Pulmonary necrosis | FAERS: 2 | US FAERS | |
| 425 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 426 | Quadriplegia | FAERS: 2 | US FAERS | |
| 427 | Retching | FAERS: 2 | US FAERS | |
| 428 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 429 | Sinus bradycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 430 | Skin Erosion | FAERS: 2 | US FAERS | |
| 431 | Skin discomfort | FAERS: 2 | US FAERS | |
| 432 | Somnolence | FAERS: 2 | SIDER US FAERS | |
| 433 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 434 | Stridor | FAERS: 2 | US FAERS | |
| 435 | Stupor | FAERS: 2 | US FAERS | |
| 436 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 437 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 438 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 439 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 440 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 441 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 442 | Accidental exposure | FAERS: 1 | US FAERS | |
| 443 | Activated partial thromboplastin time abnormal | FAERS: 1 | US FAERS | |
| 444 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 445 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 446 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 447 | Alopecia universalis | FAERS: 1 | US FAERS | |
| 448 | Anal abscess | FAERS: 1 | US FAERS | |
| 449 | Androgen receptor gene overexpression | FAERS: 1 | US FAERS | |
| 450 | Angiodermatitis | FAERS: 1 | US FAERS | |
| 451 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 452 | Anhidrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 453 | Aortic Aneurysm | FAERS: 1 | OFFSIDES US FAERS | |
| 454 | Aphonia | FAERS: 1 | US FAERS | |
| 455 | Aphthous Stomatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 456 | Apoptosis | FAERS: 1 | US FAERS | |
| 457 | Appendicitis | FAERS: 1 | US FAERS | |
| 458 | Arterial Injury | FAERS: 1 | US FAERS | |
| 459 | Arthropathy | FAERS: 1 | US FAERS | |
| 460 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 461 | Asthenopia | FAERS: 1 | OFFSIDES US FAERS | |
| 462 | Bacterial food poisoning | FAERS: 1 | US FAERS | |
| 463 | Bedridden | FAERS: 1 | US FAERS | |
| 464 | Beta-N-acetyl-D-glucosaminidase increased | FAERS: 1 | US FAERS | |
| 465 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 466 | Bladder sphincter atony | FAERS: 1 | US FAERS | |
| 467 | Blepharospasm | FAERS: 1 | US FAERS | |
| 468 | Blister rupture | FAERS: 1 | US FAERS | |
| 469 | Blood alkaline phosphatase increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 470 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 471 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 472 | Blood creatinine decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 473 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 474 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 475 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 476 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 477 | Blood pH increased | FAERS: 1 | OFFSIDES US FAERS | |
| 478 | Bone fistula | FAERS: 1 | US FAERS | |
| 479 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 480 | Botulism | FAERS: 1 | US FAERS | |
| 481 | Bowen's Disease | FAERS: 1 | US FAERS | |
| 482 | Brain natriuretic peptide increased | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 484 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 485 | C-reactive protein abnormal | FAERS: 1 | US FAERS | |
| 486 | Candidiasis | FAERS: 1 | US FAERS | |
| 487 | Capillaritis | FAERS: 1 | US FAERS | |
| 488 | Cardiac Flutter | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 489 | Cardiac infection | FAERS: 1 | US FAERS | |
| 490 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 491 | Carotidynia | FAERS: 1 | US FAERS | |
| 492 | Catheter related complication | FAERS: 1 | OFFSIDES US FAERS | |
| 493 | Catheter site infection | FAERS: 1 | US FAERS | |
| 494 | Cellulitis of male external genital organ | FAERS: 1 | US FAERS | |
| 495 | Cerebral atrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 496 | Cerebral disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 497 | Cholangitis | FAERS: 1 | US FAERS | |
| 498 | Cholestasis | FAERS: 1 | US FAERS | |
| 499 | Chorea | FAERS: 1 | US FAERS | |
| 500 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 501 | Choroiditis | FAERS: 1 | US FAERS | |
| 502 | Chromaturia | FAERS: 1 | US FAERS | |
| 503 | Clonus | FAERS: 1 | US FAERS | |
| 504 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 505 | Conjunctival erosion | FAERS: 1 | US FAERS | |
| 506 | Conjunctivitis | FAERS: 1 | 11299845 | CTD SIDER US FAERS |
| 507 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 508 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 509 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 510 | Culture urine positive | FAERS: 1 | US FAERS | |
| 511 | Cyst | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 512 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 513 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 514 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 515 | Device alarm issue | FAERS: 1 | US FAERS | |
| 516 | Device use error | FAERS: 1 | US FAERS | |
| 517 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 518 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 519 | Dihydropyrimidine Dehydrogenase Deficiency | FAERS: 1 | US FAERS | |
| 520 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 521 | Drug dose omission | FAERS: 1 | US FAERS | |
| 522 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 523 | Dysphasia | FAERS: 1 | US FAERS | |
| 524 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 525 | Ear discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 526 | Economic problem | FAERS: 1 | US FAERS | |
| 527 | Ejection Fraction Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 528 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 529 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 530 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 531 | Endotoxic shock | FAERS: 1 | US FAERS | |
| 532 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 533 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 534 | Enuresis | FAERS: 1 | US FAERS | |
| 535 | Eosinophilia | FAERS: 1 | US FAERS | |
| 536 | Eructation | FAERS: 1 | US FAERS | |
| 537 | Escherichia infection | FAERS: 1 | US FAERS | |
| 538 | Excoriation | FAERS: 1 | US FAERS | |
| 539 | Expired product administered | FAERS: 1 | US FAERS | |
| 540 | Eye Burns | FAERS: 1 | US FAERS | |
| 541 | Facial Pain | FAERS: 1 | US FAERS | |
| 542 | Febrile infection | FAERS: 1 | US FAERS | |
| 543 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 544 | Flank Pain | FAERS: 1 | US FAERS | |
| 545 | Focal dyscognitive seizures | FAERS: 1 | US FAERS | |
| 546 | Folliculitis | FAERS: 1 | US FAERS | |
| 547 | Fracture | FAERS: 1 | US FAERS | |
| 548 | Frustration | FAERS: 1 | US FAERS | |
| 549 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 550 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 551 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 552 | Gaze palsy | FAERS: 1 | US FAERS | |
| 553 | Gingival Recession | FAERS: 1 | US FAERS | |
| 554 | Gingival erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 555 | Gingivitis | FAERS: 1 | US FAERS | |
| 556 | Glossitis | FAERS: 1 | US FAERS | |
| 557 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 558 | Granulocytes abnormal | FAERS: 1 | US FAERS | |
| 559 | Hair growth rate abnormal | FAERS: 1 | US FAERS | |
| 560 | Head discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 561 | Hepatitis B | FAERS: 1 | US FAERS | |
| 562 | Hepatotoxicity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 563 | Hernia | FAERS: 1 | US FAERS | |
| 564 | Hyperventilation | FAERS: 1 | US FAERS | |
| 565 | Hypoaesthesia facial | FAERS: 1 | OFFSIDES US FAERS | |
| 566 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 567 | Hysterectomy | FAERS: 1 | US FAERS | |
| 568 | Immobile | FAERS: 1 | US FAERS | |
| 569 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 570 | Immunosuppression | FAERS: 1 | OFFSIDES US FAERS | |
| 571 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 572 | Implant site infection | FAERS: 1 | OFFSIDES US FAERS | |
| 573 | Incision site pain | FAERS: 1 | US FAERS | |
| 574 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 575 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 576 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 577 | Induration | FAERS: 1 | US FAERS | |
| 578 | Infection in an immunocompromised host | FAERS: 1 | OFFSIDES US FAERS | |
| 579 | Infusion site induration | FAERS: 1 | US FAERS | |
| 580 | Infusion site inflammation | FAERS: 1 | US FAERS | |
| 581 | Infusion site phlebitis | FAERS: 1 | US FAERS | |
| 582 | Infusion site rash | FAERS: 1 | US FAERS | |
| 583 | Injection Site Reaction | FAERS: 1 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 584 | Injection site movement impairment | FAERS: 1 | US FAERS | |
| 585 | Injection site scar | FAERS: 1 | US FAERS | |
| 586 | Injection site streaking | FAERS: 1 | US FAERS | |
| 587 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 588 | Injury associated with device | FAERS: 1 | US FAERS | |
| 589 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 590 | Iritis | FAERS: 1 | US FAERS | |
| 591 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 592 | Joint swelling | FAERS: 1 | US FAERS | |
| 593 | Keratitis | FAERS: 1 | US FAERS | |
| 594 | Laceration | FAERS: 1 | US FAERS | |
| 595 | Left atrial dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 596 | Limb discomfort | FAERS: 1 | US FAERS | |
| 597 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 598 | Lividity | FAERS: 1 | US FAERS | |
| 599 | Lung Abscess | FAERS: 1 | US FAERS | |
| 600 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 601 | Lymphoma | FAERS: 1 | US FAERS | |
| 602 | Malignant ascites | FAERS: 1 | US FAERS | |
| 603 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 604 | Markedly reduced dietary intake | FAERS: 1 | OFFSIDES US FAERS | |
| 605 | Mastitis | FAERS: 1 | US FAERS | |
| 606 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 607 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 608 | Meningitis | FAERS: 1 | US FAERS | |
| 609 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 610 | Menopause | FAERS: 1 | US FAERS | |
| 611 | Menorrhagia | FAERS: 1 | US FAERS | |
| 612 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 613 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 614 | Metastases to larynx | FAERS: 1 | US FAERS | |
| 615 | Middle insomnia | FAERS: 1 | US FAERS | |
| 616 | Mitral valve disease mixed | FAERS: 1 | US FAERS | |
| 617 | Mucoepidermoid Carcinoma | FAERS: 1 | US FAERS | |
| 618 | Mucosal excoriation | FAERS: 1 | US FAERS | |
| 619 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 620 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 621 | Musculoskeletal stiffness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 622 | Mutism | FAERS: 1 | US FAERS | |
| 623 | Myocarditis | FAERS: 1 | US FAERS | |
| 624 | Myofascitis | FAERS: 1 | US FAERS | |
| 625 | Nail Infection | FAERS: 1 | US FAERS | |
| 626 | Nail bed infection | FAERS: 1 | US FAERS | |
| 627 | Nail bed tenderness | FAERS: 1 | US FAERS | |
| 628 | Negative thoughts | FAERS: 1 | US FAERS | |
| 629 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 630 | Nerve Block | FAERS: 1 | OFFSIDES US FAERS | |
| 631 | Neuropathy | FAERS: 1 | SIDER US FAERS | |
| 632 | Night sweats | FAERS: 1 | US FAERS | |
| 633 | Nocturia | FAERS: 1 | US FAERS | |
| 634 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 635 | Non-small cell lung cancer recurrent | FAERS: 1 | US FAERS | |
| 636 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 637 | Onychalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 638 | Opisthotonus | FAERS: 1 | US FAERS | |
| 639 | Optic Neuritis | FAERS: 1 | OFFSIDES US FAERS | |
| 640 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 641 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 642 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 643 | Osteitis Deformans | FAERS: 1 | OFFSIDES US FAERS | |
| 644 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 645 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 646 | Oxygen saturation increased | FAERS: 1 | US FAERS | |
| 647 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 648 | PCO2 increased | FAERS: 1 | US FAERS | |
| 649 | PTEN gene mutation | FAERS: 1 | US FAERS | |
| 650 | Palindromic rheumatism | FAERS: 1 | US FAERS | |
| 651 | Pallor | FAERS: 1 | OFFSIDES US FAERS | |
| 652 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 653 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 654 | Panic Disorder | FAERS: 1 | US FAERS | |
| 655 | Pathological fracture | FAERS: 1 | US FAERS | |
| 656 | Pelvic mass | FAERS: 1 | US FAERS | |
| 657 | Peritonitis | FAERS: 1 | US FAERS | |
| 658 | Perivascular dermatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 659 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 660 | Pharyngolaryngeal Pain | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 661 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 662 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 663 | Pleuropericarditis | FAERS: 1 | US FAERS | |
| 664 | Pneumocystis jiroveci pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 665 | Pneumopericardium | FAERS: 1 | US FAERS | |
| 666 | Polyuria | FAERS: 1 | US FAERS | |
| 667 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 668 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 669 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 670 | Post procedural infection | FAERS: 1 | US FAERS | |
| 671 | Post procedural nausea | FAERS: 1 | US FAERS | |
| 672 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 673 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 674 | Posturing | FAERS: 1 | US FAERS | |
| 675 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 676 | Product container issue | FAERS: 1 | US FAERS | |
| 677 | Product deposit | FAERS: 1 | US FAERS | |
| 678 | Product label issue | FAERS: 1 | US FAERS | |
| 679 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 680 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 681 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 682 | Radiation Pneumonitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 683 | Radiation mucositis | FAERS: 1 | US FAERS | |
| 684 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 685 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 686 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 687 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 688 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 689 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 690 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 691 | Sacral pain | FAERS: 1 | US FAERS | |
| 692 | Saliva altered | FAERS: 1 | US FAERS | |
| 693 | Scab | FAERS: 1 | US FAERS | |
| 694 | Sclerema | FAERS: 1 | US FAERS | |
| 695 | Scleroderma-like reaction | FAERS: 1 | US FAERS | |
| 696 | Scotoma | FAERS: 1 | SIDER US FAERS | |
| 697 | Screaming | FAERS: 1 | US FAERS | |
| 698 | Secretion discharge | FAERS: 1 | US FAERS | |
| 699 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 700 | Skin Induration | FAERS: 1 | US FAERS | |
| 701 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 702 | Skin tightness | FAERS: 1 | US FAERS | |
| 703 | Soft tissue swelling | FAERS: 1 | US FAERS | |
| 704 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 705 | Spinal Muscular Atrophy | FAERS: 1 | US FAERS | |
| 706 | Staphylococcal impetigo | FAERS: 1 | US FAERS | |
| 707 | Steroid therapy | FAERS: 1 | US FAERS | |
| 708 | Stoma Site Infection | FAERS: 1 | US FAERS | |
| 709 | Subcutaneous Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 710 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 711 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 712 | Sunburn | FAERS: 1 | US FAERS | |
| 713 | Superinfection | FAERS: 1 | US FAERS | |
| 714 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 715 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 716 | Terminal state | FAERS: 1 | US FAERS | |
| 717 | Thrombosis | FAERS: 1 | US FAERS | |
| 718 | Tongue biting | FAERS: 1 | OFFSIDES US FAERS | |
| 719 | Tooth Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 720 | Tooth Loss | FAERS: 1 | US FAERS | |
| 721 | Tracheitis | FAERS: 1 | US FAERS | |
| 722 | Transaminases increased | FAERS: 1 | US FAERS | |
| 723 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 724 | Transient psychosis | FAERS: 1 | US FAERS | |
| 725 | Treatment related secondary malignancy | FAERS: 1 | US FAERS | |
| 726 | Troponin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 727 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 728 | Ultrasound Doppler abnormal | FAERS: 1 | US FAERS | |
| 729 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 730 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 731 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 732 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 733 | Venous occlusion | FAERS: 1 | US FAERS | |
| 734 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 735 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 736 | Wound decomposition | FAERS: 1 | US FAERS | |
| 737 | Wound necrosis | FAERS: 1 | US FAERS | |
| 738 | Wrong technique in product usage process | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 739 | Xerosis | FAERS: 1 | US FAERS | |
| 740 | effusion | FAERS: 1 | SIDER US FAERS | |
| 741 | muscle injury | FAERS: 1 | US FAERS | |
| 742 | treatment failure | FAERS: 1 | US FAERS | |
| 743 | Abdominal mass | OFFSIDES | ||
| 744 | Abuse | OFFSIDES | ||
| 745 | Acantholysis | OFFSIDES | ||
| 746 | Actinomycosis | OFFSIDES | ||
| 747 | Acute Coronary Syndrome | SIDER | ||
| 748 | Adenocarcinoma | 12794247 | CTD | |
| 749 | Adenoma | OFFSIDES | ||
| 750 | Advanced breast cancer | SIDER | ||
| 751 | Albumin globulin ratio decreased | OFFSIDES | ||
| 752 | Anal sphincter atony | OFFSIDES | ||
| 753 | Anemia | CTD | ||
| 754 | Anisocytosis | OFFSIDES | ||
| 755 | Anorexia | 12365019 16525670 22902858 | CTD OFFSIDES SIDER | |
| 756 | Aortitis | 20407388 | CTD | |
| 757 | Arteriosclerosis | OFFSIDES | ||
| 758 | Arthroscopy | OFFSIDES | ||
| 759 | Artificial crown procedure | OFFSIDES | ||
| 760 | Aspiration Pneumonia | OFFSIDES | ||
| 761 | Atrial Flutter | OFFSIDES SIDER | ||
| 762 | Atrial tachycardia | OFFSIDES | ||
| 763 | Autonomic neuropathy | OFFSIDES | ||
| 764 | Bacteria stool identified | OFFSIDES | ||
| 765 | Bacteria urine identified | OFFSIDES | ||
| 766 | Basal ganglion degeneration | OFFSIDES | ||
| 767 | Biliary adenoma | OFFSIDES | ||
| 768 | Biopsy bone abnormal | OFFSIDES | ||
| 769 | Biopsy bone marrow abnormal | OFFSIDES | ||
| 770 | Biopsy | OFFSIDES | ||
| 771 | Bladder calculus removal | OFFSIDES | ||
| 772 | Blood Glucose | OFFSIDES | ||
| 773 | Blood and lymphatic system disorders | SIDER | ||
| 774 | Blood chloride decreased | OFFSIDES | ||
| 775 | Blood chloride increased | OFFSIDES | ||
| 776 | Blood sodium | OFFSIDES | ||
| 777 | Blood testosterone decreased | OFFSIDES | ||
| 778 | Blood urea abnormal | OFFSIDES | ||
| 779 | Bone abscess | OFFSIDES | ||
| 780 | Bone density decreased | OFFSIDES | ||
| 781 | Bone erosion | OFFSIDES | ||
| 782 | Bone fragmentation | OFFSIDES | ||
| 783 | Bone infarction | OFFSIDES | ||
| 784 | Bone lesion | OFFSIDES | ||
| 785 | Bone swelling | OFFSIDES | ||
| 786 | Bone trimming | OFFSIDES | ||
| 787 | Brain Diseases | 12801056 | CTD | |
| 788 | Breast tenderness | OFFSIDES | ||
| 789 | Bronchoalveolar Lavage | OFFSIDES | ||
| 790 | Bulbar palsy | OFFSIDES | ||
| 791 | Bullous eruption | SIDER | ||
| 792 | Bursitis | OFFSIDES | ||
| 793 | Calcific deposits removal | OFFSIDES | ||
| 794 | Cancer Pain | OFFSIDES SIDER | ||
| 795 | Candidiasis of vagina | OFFSIDES | ||
| 796 | Carcinoma of lung | SIDER | ||
| 797 | Carcinoma, Endometrioid | 21151415 | CTD | |
| 798 | Carcinoma, Transitional Cell | 12576464 16813948 | CTD | |
| 799 | Cardiomyopathies | 11552226 | CTD | |
| 800 | Carotid bruit | OFFSIDES | ||
| 801 | Cartilage injury | OFFSIDES | ||
| 802 | Catheter related infection | OFFSIDES | ||
| 803 | Cerebellar Ataxia | 9332695 | CTD OFFSIDES | |
| 804 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 805 | Cerebral artery stenosis | OFFSIDES | ||
| 806 | Cervical dysplasia | OFFSIDES | ||
| 807 | Cervicitis human papilloma virus | OFFSIDES | ||
| 808 | Cervicobrachial syndrome | OFFSIDES | ||
| 809 | Chemical and Drug Induced Liver Injury | 17846704 | CTD | |
| 810 | Chest tightness | SIDER | ||
| 811 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 812 | Chronic sinusitis | OFFSIDES | ||
| 813 | Clostridium difficile colitis | OFFSIDES | ||
| 814 | Colonic Neoplasms | 15970518 | CTD | |
| 815 | Colonic fistula | OFFSIDES | ||
| 816 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 817 | Consciousness Disorders | 12801056 | CTD | |
| 818 | Contact Dermatitis | OFFSIDES | ||
| 819 | Continuous Positive Airway Pressure | OFFSIDES | ||
| 820 | Crystalluria | OFFSIDES | ||
| 821 | Cutaneous hypersensitivity | SIDER | ||
| 822 | Debridement | OFFSIDES | ||
| 823 | Decreased Libido | OFFSIDES | ||
| 824 | Dental abscess | OFFSIDES | ||
| 825 | Dental caries | OFFSIDES | ||
| 826 | Dental cleaning | OFFSIDES | ||
| 827 | Dental discomfort | OFFSIDES | ||
| 828 | Denture wearer | OFFSIDES | ||
| 829 | Diabetes | OFFSIDES | ||
| 830 | Diarrhea | CTD OFFSIDES | ||
| 831 | Diverticulosis | OFFSIDES | ||
| 832 | Diverticulum | OFFSIDES | ||
| 833 | Drug Eruptions | CTD | ||
| 834 | Dyspnea | 12756431 12794247 | CTD | |
| 835 | Dysthymic Disorder | OFFSIDES | ||
| 836 | Dystonia | OFFSIDES | ||
| 837 | Ear and labyrinth disorders | SIDER | ||
| 838 | Edema | CTD | ||
| 839 | Ejection fraction abnormal | OFFSIDES | ||
| 840 | Electrocardiogram ST-T change | OFFSIDES | ||
| 841 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 842 | Embolic stroke | OFFSIDES | ||
| 843 | Endodontic procedure | OFFSIDES | ||
| 844 | Endophthalmitis | OFFSIDES | ||
| 845 | Enteritis | OFFSIDES SIDER | ||
| 846 | Epicondylitis | OFFSIDES | ||
| 847 | Epidural lipomatosis | OFFSIDES | ||
| 848 | Esophageal Neoplasms | 16337965 | CTD | |
| 849 | Esophageal Perforation | OFFSIDES | ||
| 850 | Esophagitis | 21415776 | CTD | |
| 851 | Essential Hypertension | OFFSIDES | ||
| 852 | Eyelids pruritus | OFFSIDES | ||
| 853 | Failure to Thrive | OFFSIDES | ||
| 854 | Fat necrosis | OFFSIDES | ||
| 855 | Fatty Liver | OFFSIDES | ||
| 856 | Fever | CTD | ||
| 857 | Fistula discharge | OFFSIDES | ||
| 858 | Fluid imbalance | SIDER | ||
| 859 | Foot Dermatoses | 17919350 19174694 | CTD | |
| 860 | Gait Ataxia | 9332695 | CTD | |
| 861 | Gastrointestinal Neoplasms | 12794247 18000507 | CTD | |
| 862 | Gastrointestinal Pain | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 863 | General disorders and administration site conditions | SIDER | ||
| 864 | Gingival Hypertrophy | OFFSIDES | ||
| 865 | Glioma | 20512610 | CTD | |
| 866 | Graft infection | OFFSIDES | ||
| 867 | Granulocytosis | OFFSIDES | ||
| 868 | Hand Dermatoses | 17919350 19174694 | CTD | |
| 869 | Haptoglobin Decreased | OFFSIDES | ||
| 870 | Heart Diseases | 20185313 | CTD | |
| 871 | Heart failure | 15585077 19687336 | CTD | |
| 872 | Heartburn | SIDER | ||
| 873 | Hemiplegia | OFFSIDES | ||
| 874 | Hemorrhage | 12564432 | CTD | |
| 875 | Hepatic Encephalopathy | 11305259 | CTD | |
| 876 | Hepatic cancer metastatic | OFFSIDES | ||
| 877 | Hepatitis | 11305259 | CTD SIDER | |
| 878 | High frequency ablation | OFFSIDES | ||
| 879 | Hordeolum | OFFSIDES | ||
| 880 | Human papilloma virus test positive | OFFSIDES | ||
| 881 | Hypercreatinaemia | OFFSIDES | ||
| 882 | Hyperglycemia | 15839914 | CTD | |
| 883 | Hyperpigmentation | 12564432 | CTD OFFSIDES | |
| 884 | Hypocalcemia | 17846704 | CTD | |
| 885 | Impetigo | OFFSIDES | ||
| 886 | Implant site erosion | OFFSIDES | ||
| 887 | Incorrect dose administered | Canada Vigilance: 1 | Canada Vigilance | |
| 888 | Infected epidermal cyst | OFFSIDES | ||
| 889 | Infestation | SIDER | ||
| 890 | Injection site infection | SIDER | ||
| 891 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 892 | Intervertebral disc disorder | OFFSIDES | ||
| 893 | Intravenous catheter management | OFFSIDES | ||
| 894 | Joint stiffness | OFFSIDES | ||
| 895 | Kidney Failure | OFFSIDES | ||
| 896 | Lacrimal Duct Obstruction | SIDER | ||
| 897 | Lacrimal structural disorder | SIDER | ||
| 898 | Lacrimation | SIDER | ||
| 899 | Leukodystrophy | OFFSIDES | ||
| 900 | Leukopenia neonatal | OFFSIDES | ||
| 901 | Life expectancy shortened | OFFSIDES | ||
| 902 | Ligament rupture | OFFSIDES | ||
| 903 | Lightheadedness | SIDER | ||
| 904 | Loop electrosurgical excision procedure | OFFSIDES | ||
| 905 | Loose tooth | OFFSIDES | ||
| 906 | Lower respiratory tract infection | SIDER | ||
| 907 | Lung Neoplasms | 11778233 11895925 | CTD | |
| 908 | Lung diseases | 12756431 17805486 20699278 | CTD | |
| 909 | Lupus Erythematosus | SIDER | ||
| 910 | Lymph node palpable | OFFSIDES | ||
| 911 | Lymphedema | OFFSIDES | ||
| 912 | MYELODYSPLASTIC SYNDROME | SIDER | ||
| 913 | Malnutrition | SIDER | ||
| 914 | Malocclusion | OFFSIDES | ||
| 915 | Mass excision | OFFSIDES | ||
| 916 | Mastectomy | OFFSIDES | ||
| 917 | Mastication disorder | OFFSIDES | ||
| 918 | Maxillofacial operation | OFFSIDES | ||
| 919 | Medical device removal | OFFSIDES | ||
| 920 | Meniscus removal | OFFSIDES | ||
| 921 | Mesenteric vascular insufficiency | OFFSIDES | ||
| 922 | Metastases to adrenals | OFFSIDES | ||
| 923 | Modified radical mastectomy | OFFSIDES | ||
| 924 | Mononeuritis | OFFSIDES | ||
| 925 | Mood disorder due to a general medical condition | OFFSIDES | ||
| 926 | Multiple Myeloma | 15728126 | CTD | |
| 927 | Muscle Weakness | 8559355 8710063 9093729 | CTD | |
| 928 | Muscle abscess | OFFSIDES | ||
| 929 | Musculoskeletal discomfort | SIDER | ||
| 930 | Myelodysplasia | OFFSIDES | ||
| 931 | Myelosuppression | SIDER | ||
| 932 | Nail Diseases | CTD | ||
| 933 | Nail changes | SIDER | ||
| 934 | Nasopharyngeal Neoplasms | 17697552 | CTD | |
| 935 | Necrotizing Enterocolitis | SIDER | ||
| 936 | Neoplasm Metastasis | CTD | ||
| 937 | Neoplasms, Experimental | 19706800 21551258 | CTD | |
| 938 | Neoplasms, Hormone-Dependent | 14506750 | CTD | |
| 939 | Neoplasms | CTD | ||
| 940 | Nerve Degeneration | 10603043 | CTD | |
| 941 | Nerve Root Compression | OFFSIDES | ||
| 942 | Neurosensory hypoacusis | OFFSIDES | ||
| 943 | Non-cardiac chest pain | SIDER | ||
| 944 | Oral polypectomy | OFFSIDES | ||
| 945 | Oropharyngeal discomfort | SIDER | ||
| 946 | Osteolysis | 18606716 | CTD OFFSIDES | |
| 947 | Osteopetrosis | OFFSIDES | ||
| 948 | Osteoporosis | OFFSIDES | ||
| 949 | Osteosclerosis | OFFSIDES | ||
| 950 | Otitis Media | SIDER | ||
| 951 | Ototoxicity | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 952 | Pancreatic Cyst | OFFSIDES | ||
| 953 | Paracentesis | OFFSIDES | ||
| 954 | Paresthesia | 7907667 17919350 | CTD | |
| 955 | Periodontal operation | OFFSIDES | ||
| 956 | Periodontitis | OFFSIDES | ||
| 957 | Peripheral Nervous System Diseases | CTD | ||
| 958 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 959 | Pharyngitis | SIDER | ||
| 960 | Physical disability | OFFSIDES | ||
| 961 | Pleurectomy | OFFSIDES | ||
| 962 | Pneumonia moraxella | OFFSIDES | ||
| 963 | Poikilocytosis | OFFSIDES | ||
| 964 | Poor personal hygiene | OFFSIDES | ||
| 965 | Primary sequestrum | OFFSIDES | ||
| 966 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 967 | Prostatic Neoplasms, Castration-Resistant | 18500220 | CTD | |
| 968 | Prostatic Neoplasms |
12627929
12756431 14506750 15839914 16520278 16644109 16685278 16731754 16886663 16921509 17639587 18606716 18824434 19103299 19706800 19920389 21551258 22026922 22666205 25655047 | CTD | |
| 969 | Prosthesis Implantation | OFFSIDES | ||
| 970 | Protein total decreased | OFFSIDES | ||
| 971 | Prothrombin level decreased | SIDER | ||
| 972 | Prothrombin time abnormal | OFFSIDES | ||
| 973 | Prurigo | SIDER | ||
| 974 | Pulmonary radiation injury | OFFSIDES | ||
| 975 | Purulence | OFFSIDES | ||
| 976 | Purulent discharge | OFFSIDES | ||
| 977 | Pyoderma Gangrenosum | Canada Vigilance: 1 | Canada Vigilance | |
| 978 | Radiation Fibrosis | OFFSIDES | ||
| 979 | Radiation associated pain | OFFSIDES | ||
| 980 | Radical hysterectomy | OFFSIDES | ||
| 981 | Radicular pain | OFFSIDES | ||
| 982 | Reaction gastrointestinal | SIDER | ||
| 983 | Rectal fissure | OFFSIDES | ||
| 984 | Red blood cell schistocytes present | OFFSIDES | ||
| 985 | Redness | SIDER | ||
| 986 | Renal Colic | OFFSIDES | ||
| 987 | Respiratory tract congestion | OFFSIDES | ||
| 988 | Reticulocyte count increased | OFFSIDES | ||
| 989 | Retrocollis | OFFSIDES | ||
| 990 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 991 | Rhinitis | OFFSIDES SIDER | ||
| 992 | Rhinorrhea | OFFSIDES | ||
| 993 | Right atrial dilatation | OFFSIDES | ||
| 994 | Risus sardonicus | OFFSIDES | ||
| 995 | Salpingo-oophorectomy | OFFSIDES | ||
| 996 | Sarcoidosis | OFFSIDES | ||
| 997 | Sarcoma | 7918126 | CTD | |
| 998 | Sclerosis | 8630861 19153362 | CTD | |
| 999 | Sensitive skin | Canada Vigilance: 1 | Canada Vigilance | |
| 1000 | Sequestrectomy | OFFSIDES | ||
| 1001 | Sigmoiditis | OFFSIDES | ||
| 1002 | Sinus Tachycardia | SIDER | ||
| 1003 | Sinus operation | OFFSIDES | ||
| 1004 | Skin Neoplasms | 15970518 | CTD | |
| 1005 | Soft Tissue Neoplasms | 7918126 | CTD | |
| 1006 | Somatosensory Disorders | 9484402 | CTD | |
| 1007 | Speech Disorders | 12801056 | CTD | |
| 1008 | Splenic cyst | OFFSIDES | ||
| 1009 | Stomach Neoplasms | 16525670 16557585 | CTD | |
| 1010 | Stomatocytes present | OFFSIDES | ||
| 1011 | Surgical failure | OFFSIDES | ||
| 1012 | Synovial Cyst | OFFSIDES | ||
| 1013 | Synovitis | OFFSIDES | ||
| 1014 | Temporal Arteritis | OFFSIDES | ||
| 1015 | Tendinitis | OFFSIDES | ||
| 1016 | Tenosynovitis | OFFSIDES | ||
| 1017 | Thoracotomy | OFFSIDES | ||
| 1018 | Thrombophlebitis | 17461902 | CTD OFFSIDES SIDER | |
| 1019 | Tooth Extraction | OFFSIDES | ||
| 1020 | Tooth repair | OFFSIDES | ||
| 1021 | Transferrin decreased | OFFSIDES | ||
| 1022 | Urine ketone body present | OFFSIDES | ||
| 1023 | Uterine Neoplasms | 10458265 | CTD | |
| 1024 | VIIth nerve paralysis | OFFSIDES | ||
| 1025 | Vaginal Fistula | OFFSIDES | ||
| 1026 | Vena cava filter insertion | OFFSIDES | ||
| 1027 | Venous Thromboembolism | 12627929 | CTD | |
| 1028 | Venous Thrombosis | 10955862 17639587 17846704 | CTD | |
| 1029 | Venous thrombosis limb | OFFSIDES | ||
| 1030 | Ventricular Dysfunction, Left | 11454849 12926135 | CTD | |
| 1031 | Ventricular hypokinesia | OFFSIDES | ||
| 1032 | Vertebroplasty | OFFSIDES | ||
| 1033 | Viral labyrinthitis | OFFSIDES | ||
| 1034 | Walking aid user | OFFSIDES | ||
| 1035 | Wheelchair user | OFFSIDES | ||
| 1036 | Wound Debridement | OFFSIDES | ||
| 1037 | Wound Infection | OFFSIDES | ||
| 1038 | anaphylaxis | 7918126 12006518 | CTD | |
| 1039 | kyphosis | OFFSIDES | ||
| 1040 | leiomyosarcoma | 10458265 | CTD | |
| 1041 | liposarcoma | OFFSIDES | ||
| 1042 | melanoma | 12417787 | CTD | |
| 1043 | skin abrasion | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.