Dabigatran
(XETBXHPXHHOLOE-UHFFFAOYSA-N)
Structure
- SMILES
- CS(=O)(=O)O.CCCCCCOC(=O)/N=C(\c1ccc(cc1)NCc1nc2c(n1C)ccc(c2)C(=O)N(c1ccccn1)CCC(=O)OCC)/N
- Molecular Formula:
- C35H45N7O8S
- Molecular Weight:
- 723.839
- Log P:
- 6.9607
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 3
- TPSA:
- 216.78
- CAS Number(s):
- 593282-20-3
Synonym(s)
1.
Dabigatran
2.
BIBR 1048
3.
Dabigatran Etexilate
4.
Dabigatran Etexilate Mesylate
5.
N-((2-(((4-(aminoiminomethyl)phenyl)amino)methyl)-1-methyl-1H-benzimidazol-5-yl)carbonyl)-N-2-pyridinyl-beta-alanine
6.
Pradaxa
7.
Etexilate Mesylate, Dabigatran
8.
Etexilate, Dabigatran
9.
Mesylate, Dabigatran Etexilate
External Link(s)
| MeSH | D000069604 |
| PubChem Compound | 72960092 135566083 11434065 10439877 |
| ChEBI | 70743 |
| CHEMBL | CHEMBL1615369 |
| KEGG | dr:D07082 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Cerebrovascular accident | FAERS: 2410 Canada Vigilance: 72 | Canada Vigilance US FAERS | |
| 2 | Deep Vein Thrombosis | FAERS: 583 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 582 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Dyspepsia | FAERS: 554 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 5 | Pulmonary Embolism | FAERS: 551 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Cerebral Infarction | FAERS: 520 | US FAERS | |
| 7 | Headache | FAERS: 490 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Myocardial Infarction | FAERS: 451 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 9 | Atrial Fibrillation | FAERS: 433 | US FAERS | |
| 10 | Asthenia | FAERS: 426 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Epistaxis | FAERS: 410 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Nausea | FAERS: 364 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Abdominal discomfort | FAERS: 352 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Thrombosis | FAERS: 349 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Drug ineffective | FAERS: 341 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 16 | Pneumonia | FAERS: 340 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 17 | Fatigue | FAERS: 335 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Malaise | FAERS: 320 | US FAERS | |
| 19 | Chest Pain | FAERS: 316 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | Arthralgia | FAERS: 293 | US FAERS | |
| 21 | Vomiting | FAERS: 248 | US FAERS | |
| 22 | Embolic stroke | FAERS: 243 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Sepsis | FAERS: 232 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Cardiac Tamponade | FAERS: 227 | US FAERS | |
| 25 | Acute kidney injury | FAERS: 225 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 26 | Abdominal Pain | FAERS: 213 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Hypotension | FAERS: 201 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Pain | FAERS: 196 | US FAERS | |
| 29 | Atrial thrombosis | FAERS: 190 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Pericardial effusion | FAERS: 180 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Unevaluable event | FAERS: 180 | US FAERS | |
| 32 | Flatulence | FAERS: 167 | US FAERS | |
| 33 | Blood urine present | FAERS: 162 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 34 | Overdose | FAERS: 158 | US FAERS | |
| 35 | Procoagulant therapy | FAERS: 158 | US FAERS | |
| 36 | Chest discomfort | FAERS: 156 | US FAERS | |
| 37 | Back Pain | FAERS: 155 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Pruritus | FAERS: 149 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Syncope | FAERS: 143 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Constipation | FAERS: 140 | US FAERS | |
| 41 | Hemiparesis | FAERS: 140 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Urinary tract infection | FAERS: 139 | US FAERS | |
| 43 | Respiratory Failure | FAERS: 136 | US FAERS | |
| 44 | Aphasia | FAERS: 132 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Cardiac Arrest | FAERS: 130 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Weight decreased | FAERS: 128 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Dehydration | FAERS: 122 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Feeling abnormal | FAERS: 122 | US FAERS | |
| 49 | Nasopharyngitis | FAERS: 117 | US FAERS | |
| 50 | Incorrect dose administered | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Joint swelling | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Myalgia | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Throat irritation | FAERS: 107 | US FAERS | |
| 54 | Embolism | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Laceration | FAERS: 104 | US FAERS | |
| 56 | Acute myocardial infarction | FAERS: 102 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 57 | Memory impairment | FAERS: 102 | US FAERS | |
| 58 | Blood creatinine increased | FAERS: 98 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Thrombocytopenia | FAERS: 95 | US FAERS | |
| 60 | Alopecia | FAERS: 93 | US FAERS | |
| 61 | Creatinine renal clearance decreased | FAERS: 89 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 62 | Oropharyngeal pain | FAERS: 89 | US FAERS | |
| 63 | Dementia | FAERS: 87 | US FAERS | |
| 64 | Septic Shock | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Visual Impairment | FAERS: 83 | US FAERS | |
| 66 | Erythema | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | No adverse event | FAERS: 72 | US FAERS | |
| 68 | Burning sensation | FAERS: 69 | US FAERS | |
| 69 | Gastritis | FAERS: 68 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 70 | Adverse event | FAERS: 67 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 71 | Medication Error | FAERS: 66 | US FAERS | |
| 72 | Influenza | FAERS: 65 | US FAERS | |
| 73 | Arthritis | FAERS: 64 | US FAERS | |
| 74 | Dysarthria | FAERS: 64 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Hemiplegia | FAERS: 64 | US FAERS | |
| 76 | Infection | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | General physical health deterioration | FAERS: 63 | US FAERS | |
| 78 | Shock | FAERS: 61 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 79 | Eructation | FAERS: 60 | US FAERS | |
| 80 | Intestinal Obstruction | FAERS: 60 | US FAERS | |
| 81 | Palpitations | FAERS: 60 | US FAERS | |
| 82 | Product quality issue | FAERS: 60 | US FAERS | |
| 83 | Accidental overdose | FAERS: 59 | US FAERS | |
| 84 | Disseminated Intravascular Coagulation | FAERS: 59 | US FAERS | |
| 85 | Bronchitis | FAERS: 56 | US FAERS | |
| 86 | Nephrolithiasis | FAERS: 56 | US FAERS | |
| 87 | Dysgeusia | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Somnolence | FAERS: 54 | US FAERS | |
| 89 | Chromaturia | FAERS: 53 | US FAERS | |
| 90 | Peripheral swelling | FAERS: 53 | US FAERS | |
| 91 | Amnesia | FAERS: 49 | US FAERS | |
| 92 | Swelling | FAERS: 49 | US FAERS | |
| 93 | Neck Pain | FAERS: 48 | US FAERS | |
| 94 | Appendicitis | FAERS: 47 | US FAERS | |
| 95 | Splenic Rupture | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Peripheral embolism | FAERS: 46 | US FAERS | |
| 97 | Wheezing | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Hypersensitivity | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Limb injury | FAERS: 45 | US FAERS | |
| 100 | Tachycardia | FAERS: 45 | US FAERS | |
| 101 | Tremor | FAERS: 45 | US FAERS | |
| 102 | Urticaria | FAERS: 45 | US FAERS | |
| 103 | Anxiety | FAERS: 44 | US FAERS | |
| 104 | Lethargy | FAERS: 44 | US FAERS | |
| 105 | Mental status changes | FAERS: 44 | US FAERS | |
| 106 | Ecchymosis | FAERS: 43 | US FAERS | |
| 107 | Feeling Cold | FAERS: 43 | US FAERS | |
| 108 | Blindness | FAERS: 42 | US FAERS | |
| 109 | Diverticulitis | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 110 | Acute respiratory failure | FAERS: 41 | US FAERS | |
| 111 | Disorientation | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Joint injury | FAERS: 41 | US FAERS | |
| 113 | Blood glucose increased | FAERS: 40 | US FAERS | |
| 114 | Cardiac ablation | FAERS: 40 | US FAERS | |
| 115 | Musculoskeletal Pain | FAERS: 40 | US FAERS | |
| 116 | Anorectal discomfort | FAERS: 39 | US FAERS | |
| 117 | Drug effect incomplete | FAERS: 39 | US FAERS | |
| 118 | Gastric ulcer | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Infarction | FAERS: 39 | US FAERS | |
| 120 | Aortic Aneurysm | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Cellulitis | FAERS: 38 | US FAERS | |
| 122 | Diverticulum | FAERS: 38 | US FAERS | |
| 123 | Atrial Flutter | FAERS: 37 | US FAERS | |
| 124 | Intestinal Perforation | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Pneumothorax | FAERS: 37 | US FAERS | |
| 126 | Urinary Retention | FAERS: 37 | US FAERS | |
| 127 | Pancreatitis | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Cataract | FAERS: 35 | US FAERS | |
| 129 | Angina Pectoris | FAERS: 34 | US FAERS | |
| 130 | Peritonitis | FAERS: 34 | US FAERS | |
| 131 | Sudden death | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Toxicity to various agents | FAERS: 34 | US FAERS | |
| 133 | Ulcer | FAERS: 34 | US FAERS | |
| 134 | Cerebral artery occlusion | FAERS: 33 | US FAERS | |
| 135 | Acute Coronary Syndrome | FAERS: 32 | US FAERS | |
| 136 | Occult blood positive | FAERS: 32 | US FAERS | |
| 137 | Cardiac valve replacement complication | FAERS: 31 | US FAERS | |
| 138 | Drug dispensing error | FAERS: 31 | US FAERS | |
| 139 | Dysphonia | FAERS: 31 | US FAERS | |
| 140 | Product use issue | FAERS: 30 | US FAERS | |
| 141 | Unresponsive to stimuli | FAERS: 30 | US FAERS | |
| 142 | Skin Ulcer | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Ileus | FAERS: 28 | US FAERS | |
| 144 | Phlebitis | FAERS: 28 | US FAERS | |
| 145 | Sinusitis | FAERS: 28 | US FAERS | |
| 146 | Suicide attempt | FAERS: 28 | US FAERS | |
| 147 | Wrong technique in drug usage process | FAERS: 28 | US FAERS | |
| 148 | Discomfort | FAERS: 27 | US FAERS | |
| 149 | Embolic cerebral infarction | FAERS: 27 | US FAERS | |
| 150 | Fracture | FAERS: 27 | US FAERS | |
| 151 | Gastrointestinal carcinoma | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Inappropriate schedule of drug administration | FAERS: 27 | US FAERS | |
| 153 | Lymphoma | FAERS: 27 | US FAERS | |
| 154 | Vertigo | FAERS: 27 | US FAERS | |
| 155 | Activated partial thromboplastin time abnormal | FAERS: 26 | US FAERS | |
| 156 | Metabolic acidosis | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 157 | Pancreatic carcinoma | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 158 | Post procedural complication | FAERS: 26 | US FAERS | |
| 159 | Therapeutic response unexpected | FAERS: 26 | US FAERS | |
| 160 | Bradycardia | FAERS: 25 | US FAERS | |
| 161 | Cholecystitis | FAERS: 25 | US FAERS | |
| 162 | Drug level increased | FAERS: 25 | US FAERS | |
| 163 | Epilepsy | FAERS: 25 | US FAERS | |
| 164 | Pallor | FAERS: 25 | US FAERS | |
| 165 | Drug administration error | FAERS: 24 | US FAERS | |
| 166 | Musculoskeletal discomfort | FAERS: 24 | US FAERS | |
| 167 | Pulmonary thrombosis | FAERS: 24 | US FAERS | |
| 168 | jaundice | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Anticoagulation drug level increased | FAERS: 23 | US FAERS | |
| 170 | Flushing | FAERS: 23 | US FAERS | |
| 171 | Limb discomfort | FAERS: 23 | US FAERS | |
| 172 | Nervousness | FAERS: 23 | US FAERS | |
| 173 | Aphagia | FAERS: 22 | US FAERS | |
| 174 | Blood urea increased | FAERS: 22 | US FAERS | |
| 175 | Carotid artery occlusion | FAERS: 22 | US FAERS | |
| 176 | Chills | FAERS: 22 | US FAERS | |
| 177 | Diabetes Mellitus | FAERS: 22 | US FAERS | |
| 178 | Drug prescribing error | FAERS: 22 | US FAERS | |
| 179 | Dysuria | FAERS: 22 | US FAERS | |
| 180 | Hernia | FAERS: 22 | US FAERS | |
| 181 | Musculoskeletal stiffness | FAERS: 22 | US FAERS | |
| 182 | Ankle Fracture | FAERS: 21 | US FAERS | |
| 183 | Anuria | FAERS: 21 | US FAERS | |
| 184 | Cholelithiasis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Gout | FAERS: 21 | US FAERS | |
| 186 | Hydrocephalus | FAERS: 21 | US FAERS | |
| 187 | Incorrect route of drug administration | FAERS: 21 | US FAERS | |
| 188 | Macular degeneration | FAERS: 21 | US FAERS | |
| 189 | treatment failure | FAERS: 21 | US FAERS | |
| 190 | Abasia | FAERS: 20 | US FAERS | |
| 191 | Angioedema | FAERS: 20 | US FAERS | |
| 192 | Choking | FAERS: 20 | US FAERS | |
| 193 | Coagulation test abnormal | FAERS: 20 | US FAERS | |
| 194 | Cystitis | FAERS: 20 | US FAERS | |
| 195 | Malignant neoplasm progression | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 196 | Peripheral artery thrombosis | FAERS: 20 | US FAERS | |
| 197 | Cerebellar infarction | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Deafness | FAERS: 19 | US FAERS | |
| 199 | Depressed Level of Consciousness | FAERS: 19 | US FAERS | |
| 200 | Gastrointestinal Pain | FAERS: 19 | US FAERS | |
| 201 | Hypertensive crisis | FAERS: 19 | US FAERS | |
| 202 | Incarcerated hernia | FAERS: 19 | US FAERS | |
| 203 | Musculoskeletal chest pain | FAERS: 19 | US FAERS | |
| 204 | Pericarditis | FAERS: 19 | US FAERS | |
| 205 | Procedural complication | FAERS: 19 | US FAERS | |
| 206 | Vasculitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 207 | Ageusia | FAERS: 18 | US FAERS | |
| 208 | Alanine Aminotransferase Increased | FAERS: 18 | US FAERS | |
| 209 | Coronary Artery Disease | FAERS: 18 | US FAERS | |
| 210 | Gamma-Glutamyltransferase Increased | FAERS: 18 | US FAERS | |
| 211 | Inflammation | FAERS: 18 | US FAERS | |
| 212 | Large intestine perforation | FAERS: 18 | US FAERS | |
| 213 | Monoparesis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Petechiae | FAERS: 18 | US FAERS | |
| 215 | Retching | FAERS: 18 | US FAERS | |
| 216 | Altered state of consciousness | FAERS: 17 | US FAERS | |
| 217 | Anticoagulation drug level above therapeutic | FAERS: 17 | US FAERS | |
| 218 | Arterial thrombosis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Brain Contusion | FAERS: 17 | US FAERS | |
| 220 | Cerebral Thrombosis | FAERS: 17 | US FAERS | |
| 221 | Diplopia | FAERS: 17 | US FAERS | |
| 222 | Fluid overload | FAERS: 17 | US FAERS | |
| 223 | Hypoxia | FAERS: 17 | US FAERS | |
| 224 | Lower respiratory tract infection | FAERS: 17 | US FAERS | |
| 225 | Product storage error | FAERS: 17 | US FAERS | |
| 226 | Transaminases increased | FAERS: 17 | US FAERS | |
| 227 | Wrong technique in product usage process | FAERS: 17 | US FAERS | |
| 228 | Aspartate Aminotransferase Increased | FAERS: 16 | US FAERS | |
| 229 | Asthma | FAERS: 16 | US FAERS | |
| 230 | Cholecystitis infective | FAERS: 16 | US FAERS | |
| 231 | Hepatitis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Intracranial Aneurysm | FAERS: 16 | US FAERS | |
| 233 | Laryngitis | FAERS: 16 | US FAERS | |
| 234 | Pulmonary Hypertension | FAERS: 16 | US FAERS | |
| 235 | Respiratory distress | FAERS: 16 | US FAERS | |
| 236 | Toothache | FAERS: 16 | US FAERS | |
| 237 | VIIth nerve paralysis | FAERS: 16 | US FAERS | |
| 238 | Arthropathy | FAERS: 15 | US FAERS | |
| 239 | Atrioventricular Block | FAERS: 15 | US FAERS | |
| 240 | Bone pain | FAERS: 15 | US FAERS | |
| 241 | Endocarditis | FAERS: 15 | US FAERS | |
| 242 | Exsanguination | FAERS: 15 | US FAERS | |
| 243 | Eye pain | FAERS: 15 | US FAERS | |
| 244 | Mental impairment | FAERS: 15 | US FAERS | |
| 245 | Pancytopenia | FAERS: 15 | US FAERS | |
| 246 | Skin lesion | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 247 | Thrombotic cerebral infarction | FAERS: 15 | US FAERS | |
| 248 | Tooth Extraction | FAERS: 15 | US FAERS | |
| 249 | White blood cell count decreased | FAERS: 15 | US FAERS | |
| 250 | Aneurysm | FAERS: 14 | US FAERS | |
| 251 | Apparent death | FAERS: 14 | US FAERS | |
| 252 | Blood count abnormal | FAERS: 14 | US FAERS | |
| 253 | Delirium | FAERS: 14 | US FAERS | |
| 254 | Gangrene | FAERS: 14 | US FAERS | |
| 255 | Renal pain | FAERS: 14 | US FAERS | |
| 256 | Respiratory arrest | FAERS: 14 | US FAERS | |
| 257 | Tinnitus | FAERS: 14 | US FAERS | |
| 258 | Venous Thrombosis | FAERS: 14 | US FAERS | |
| 259 | Ventricular Fibrillation | FAERS: 14 | US FAERS | |
| 260 | nervous system disorder | FAERS: 14 | US FAERS | |
| 261 | Basal cell carcinoma | FAERS: 13 | US FAERS | |
| 262 | Colitis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 263 | Gastroenteritis | FAERS: 13 | US FAERS | |
| 264 | Glaucoma | FAERS: 13 | US FAERS | |
| 265 | Incorrect drug administration duration | FAERS: 13 | US FAERS | |
| 266 | Increased tendency to bruise | FAERS: 13 | US FAERS | |
| 267 | Productive Cough | FAERS: 13 | US FAERS | |
| 268 | Prothrombin time abnormal | FAERS: 13 | US FAERS | |
| 269 | Pulmonary congestion | FAERS: 13 | US FAERS | |
| 270 | Thrombotic stroke | FAERS: 13 | US FAERS | |
| 271 | Urinary Incontinence | FAERS: 13 | US FAERS | |
| 272 | Wound Infection | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Activities of daily living impaired | FAERS: 12 | US FAERS | |
| 274 | Duodenal Ulcer | FAERS: 12 | US FAERS | |
| 275 | Duodenal ulcer perforation | FAERS: 12 | US FAERS | |
| 276 | Lip swelling | FAERS: 12 | US FAERS | |
| 277 | Prothrombin time ratio decreased | FAERS: 12 | US FAERS | |
| 278 | Strangulated hernia | FAERS: 12 | US FAERS | |
| 279 | Venous thrombosis limb | FAERS: 12 | US FAERS | |
| 280 | Agitation | FAERS: 11 | US FAERS | |
| 281 | Arteriosclerosis | FAERS: 11 | US FAERS | |
| 282 | Blood creatinine decreased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Blood potassium increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | Cardiac Flutter | FAERS: 11 | US FAERS | |
| 285 | Cerebral disorder | FAERS: 11 | US FAERS | |
| 286 | Cholestasis | FAERS: 11 | US FAERS | |
| 287 | Depressed mood | FAERS: 11 | US FAERS | |
| 288 | Drug dose omission | FAERS: 11 | US FAERS | |
| 289 | Facial paralysis | FAERS: 11 | US FAERS | |
| 290 | Increased upper airway secretion | FAERS: 11 | US FAERS | |
| 291 | Medical device complication | FAERS: 11 | US FAERS | |
| 292 | Night sweats | FAERS: 11 | US FAERS | |
| 293 | Poor quality sleep | FAERS: 11 | US FAERS | |
| 294 | Purpura | FAERS: 11 | US FAERS | |
| 295 | Rash erythematous | FAERS: 11 | US FAERS | |
| 296 | Restlessness | FAERS: 11 | US FAERS | |
| 297 | Right ventricular failure | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 298 | Stomatitis | FAERS: 11 | US FAERS | |
| 299 | Tooth Infection | FAERS: 11 | US FAERS | |
| 300 | Activated partial thromboplastin time shortened | FAERS: 10 | US FAERS | |
| 301 | Ascites | FAERS: 10 | US FAERS | |
| 302 | Back disorder | FAERS: 10 | US FAERS | |
| 303 | Bladder Neoplasm | FAERS: 10 | US FAERS | |
| 304 | Blood pressure fluctuation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Carotid Artery Thrombosis | FAERS: 10 | US FAERS | |
| 306 | Contraindicated product administered | FAERS: 10 | US FAERS | |
| 307 | Emotional distress | FAERS: 10 | US FAERS | |
| 308 | Feeling jittery | FAERS: 10 | US FAERS | |
| 309 | Flank Pain | FAERS: 10 | US FAERS | |
| 310 | Gastrointestinal perforation | FAERS: 10 | US FAERS | |
| 311 | Gastrointestinal ulcer | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 312 | Hyperchlorhydria | FAERS: 10 | US FAERS | |
| 313 | Incorrect product storage | FAERS: 10 | US FAERS | |
| 314 | Joint stiffness | FAERS: 10 | US FAERS | |
| 315 | Nocturia | FAERS: 10 | US FAERS | |
| 316 | Peripheral artery occlusion | FAERS: 10 | US FAERS | |
| 317 | Renal tubular necrosis | FAERS: 10 | US FAERS | |
| 318 | Retinal Artery Occlusion | FAERS: 10 | US FAERS | |
| 319 | Retinal Detachment | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Stevens-Johnson Syndrome | FAERS: 10 | US FAERS | |
| 321 | Tumour haemorrhage | FAERS: 10 | US FAERS | |
| 322 | Vitreous floaters | FAERS: 10 | US FAERS | |
| 323 | skin abrasion | FAERS: 10 | US FAERS | |
| 324 | Aphonia | FAERS: 9 | US FAERS | |
| 325 | Brain Death | FAERS: 9 | US FAERS | |
| 326 | Cholangitis | FAERS: 9 | US FAERS | |
| 327 | Dental caries | FAERS: 9 | US FAERS | |
| 328 | Device dislocation | FAERS: 9 | US FAERS | |
| 329 | Disability | FAERS: 9 | US FAERS | |
| 330 | Dry skin | FAERS: 9 | US FAERS | |
| 331 | Duodenitis | FAERS: 9 | US FAERS | |
| 332 | Facial Paresis | FAERS: 9 | US FAERS | |
| 333 | Foreign body in respiratory tract | FAERS: 9 | US FAERS | |
| 334 | Head discomfort | FAERS: 9 | US FAERS | |
| 335 | Hepatotoxicity | FAERS: 9 | US FAERS | |
| 336 | Hypocoagulable state | FAERS: 9 | US FAERS | |
| 337 | Hypophagia | FAERS: 9 | US FAERS | |
| 338 | Iron deficiency | FAERS: 9 | US FAERS | |
| 339 | Leukocytosis | FAERS: 9 | US FAERS | |
| 340 | MYELODYSPLASTIC SYNDROME | FAERS: 9 | US FAERS | |
| 341 | Menorrhagia | FAERS: 9 | US FAERS | |
| 342 | Post procedural stroke | FAERS: 9 | US FAERS | |
| 343 | Presyncope | FAERS: 9 | US FAERS | |
| 344 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 345 | Sudden Cardiac Death | FAERS: 9 | US FAERS | |
| 346 | Thrombocytosis | FAERS: 9 | US FAERS | |
| 347 | Blood albumin decreased | FAERS: 8 | US FAERS | |
| 348 | Blood blister | FAERS: 8 | US FAERS | |
| 349 | Blood glucose decreased | FAERS: 8 | US FAERS | |
| 350 | Dieulafoy's vascular malformation | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 351 | Disease complication | FAERS: 8 | US FAERS | |
| 352 | Electrocardiogram abnormal | FAERS: 8 | US FAERS | |
| 353 | Excoriation | FAERS: 8 | US FAERS | |
| 354 | Gastrointestinal sounds abnormal | FAERS: 8 | US FAERS | |
| 355 | Hypothyroidism | FAERS: 8 | US FAERS | |
| 356 | Impaired driving ability | FAERS: 8 | US FAERS | |
| 357 | Implantable defibrillator insertion | FAERS: 8 | US FAERS | |
| 358 | Intentional drug misuse | FAERS: 8 | US FAERS | |
| 359 | Intentional product misuse | FAERS: 8 | US FAERS | |
| 360 | Lobar Pneumonia | FAERS: 8 | US FAERS | |
| 361 | Mallory-Weiss Syndrome | FAERS: 8 | US FAERS | |
| 362 | Meningitis | FAERS: 8 | US FAERS | |
| 363 | Metastatic Neoplasm | FAERS: 8 | US FAERS | |
| 364 | Middle insomnia | FAERS: 8 | US FAERS | |
| 365 | Monoplegia | FAERS: 8 | US FAERS | |
| 366 | Neurological decompensation | FAERS: 8 | US FAERS | |
| 367 | Peripheral arterial occlusive disease | FAERS: 8 | US FAERS | |
| 368 | Quadriplegia | FAERS: 8 | US FAERS | |
| 369 | Restless Legs Syndrome | FAERS: 8 | US FAERS | |
| 370 | Skin necrosis | FAERS: 8 | US FAERS | |
| 371 | Splenic Infarction | FAERS: 8 | US FAERS | |
| 372 | Stress | FAERS: 8 | US FAERS | |
| 373 | Temporal Arteritis | FAERS: 8 | US FAERS | |
| 374 | Thrombin time abnormal | FAERS: 8 | US FAERS | |
| 375 | Wound dehiscence | FAERS: 8 | US FAERS | |
| 376 | Acidosis | FAERS: 7 | US FAERS | |
| 377 | Agranulocytosis | FAERS: 7 | US FAERS | |
| 378 | Amaurosis Fugax | FAERS: 7 | US FAERS | |
| 379 | Angiodysplasia | FAERS: 7 | US FAERS | |
| 380 | Blood alkaline phosphatase increased | FAERS: 7 | US FAERS | |
| 381 | Blood creatinine abnormal | FAERS: 7 | US FAERS | |
| 382 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 383 | Bronchopneumonia | FAERS: 7 | US FAERS | |
| 384 | Bronchospasm | FAERS: 7 | US FAERS | |
| 385 | Cardiac perforation | FAERS: 7 | US FAERS | |
| 386 | Cardiac ventricular thrombosis | FAERS: 7 | US FAERS | |
| 387 | Choking sensation | FAERS: 7 | US FAERS | |
| 388 | Clostridium difficile colitis | FAERS: 7 | US FAERS | |
| 389 | Colectomy | FAERS: 7 | US FAERS | |
| 390 | Drug level decreased | FAERS: 7 | US FAERS | |
| 391 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 392 | Erectile dysfunction | FAERS: 7 | US FAERS | |
| 393 | Hip surgery | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 394 | Laboratory test interference | FAERS: 7 | US FAERS | |
| 395 | Muscle strain | FAERS: 7 | US FAERS | |
| 396 | Oliguria | FAERS: 7 | US FAERS | |
| 397 | Oral pain | FAERS: 7 | US FAERS | |
| 398 | Paresis | FAERS: 7 | US FAERS | |
| 399 | Physical disability | FAERS: 7 | US FAERS | |
| 400 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 401 | Pyelonephritis | FAERS: 7 | US FAERS | |
| 402 | Rotator cuff syndrome | FAERS: 7 | US FAERS | |
| 403 | Sciatica | FAERS: 7 | US FAERS | |
| 404 | Seroma | FAERS: 7 | US FAERS | |
| 405 | Skin irritation | FAERS: 7 | US FAERS | |
| 406 | Thrombophlebitis | FAERS: 7 | US FAERS | |
| 407 | Abscess | FAERS: 6 | US FAERS | |
| 408 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 409 | Aortic Valve Stenosis | FAERS: 6 | US FAERS | |
| 410 | Ataxia | FAERS: 6 | US FAERS | |
| 411 | Basilar artery occlusion | FAERS: 6 | US FAERS | |
| 412 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 413 | Carpal Tunnel Syndrome | FAERS: 6 | US FAERS | |
| 414 | Coagulation time shortened | FAERS: 6 | US FAERS | |
| 415 | Compression fracture | FAERS: 6 | US FAERS | |
| 416 | Dysgraphia | FAERS: 6 | US FAERS | |
| 417 | Food Poisoning | FAERS: 6 | US FAERS | |
| 418 | Gastrointestinal infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 419 | Hernia obstructive | FAERS: 6 | US FAERS | |
| 420 | Hyperthyroidism | FAERS: 6 | US FAERS | |
| 421 | Incoherent | FAERS: 6 | US FAERS | |
| 422 | Intestinal infarction | FAERS: 6 | US FAERS | |
| 423 | Laparotomy | FAERS: 6 | US FAERS | |
| 424 | Liver Abscess | FAERS: 6 | US FAERS | |
| 425 | Meningorrhagia | FAERS: 6 | US FAERS | |
| 426 | Necrosis | FAERS: 6 | US FAERS | |
| 427 | Nephrectomy | FAERS: 6 | US FAERS | |
| 428 | Pain of skin | FAERS: 6 | US FAERS | |
| 429 | Personality Change | FAERS: 6 | US FAERS | |
| 430 | Pulmonary Infarction | FAERS: 6 | US FAERS | |
| 431 | Rebound effect | FAERS: 6 | US FAERS | |
| 432 | Regurgitation | FAERS: 6 | US FAERS | |
| 433 | Rhabdomyolysis | FAERS: 6 | US FAERS | |
| 434 | Secretion discharge | FAERS: 6 | US FAERS | |
| 435 | Therapeutic procedure | FAERS: 6 | US FAERS | |
| 436 | Thrombosis in device | FAERS: 6 | US FAERS | |
| 437 | Troponin increased | FAERS: 6 | US FAERS | |
| 438 | Vascular stent thrombosis | FAERS: 6 | US FAERS | |
| 439 | Abdominal strangulated hernia | FAERS: 5 | US FAERS | |
| 440 | Accidental exposure | FAERS: 5 | US FAERS | |
| 441 | Anger | FAERS: 5 | US FAERS | |
| 442 | Aortic Rupture | FAERS: 5 | US FAERS | |
| 443 | Basilar artery thrombosis | FAERS: 5 | US FAERS | |
| 444 | Capillary Fragility | FAERS: 5 | US FAERS | |
| 445 | Cold sweat | FAERS: 5 | US FAERS | |
| 446 | Creatinine renal clearance increased | FAERS: 5 | US FAERS | |
| 447 | Cyanosis | FAERS: 5 | US FAERS | |
| 448 | Dermatitis | FAERS: 5 | US FAERS | |
| 449 | Device related infection | FAERS: 5 | US FAERS | |
| 450 | Dysphemia | FAERS: 5 | US FAERS | |
| 451 | Ear discomfort | FAERS: 5 | US FAERS | |
| 452 | Economic problem | FAERS: 5 | US FAERS | |
| 453 | Encephalitis | FAERS: 5 | US FAERS | |
| 454 | Eosinophilia | FAERS: 5 | US FAERS | |
| 455 | Erysipelas | FAERS: 5 | US FAERS | |
| 456 | Eye irritation | FAERS: 5 | US FAERS | |
| 457 | Gait inability | FAERS: 5 | US FAERS | |
| 458 | Gastrointestinal arteriovenous malformation | FAERS: 5 | US FAERS | |
| 459 | Gastrostomy | FAERS: 5 | US FAERS | |
| 460 | General physical condition abnormal | FAERS: 5 | US FAERS | |
| 461 | Hypercapnia | FAERS: 5 | US FAERS | |
| 462 | Impaired work ability | FAERS: 5 | US FAERS | |
| 463 | Intracranial mass | FAERS: 5 | US FAERS | |
| 464 | Lung consolidation | FAERS: 5 | US FAERS | |
| 465 | Mechanical ileus | FAERS: 5 | US FAERS | |
| 466 | Muscle tightness | FAERS: 5 | US FAERS | |
| 467 | Neuralgia | FAERS: 5 | US FAERS | |
| 468 | Neutropenia | FAERS: 5 | US FAERS | |
| 469 | PROTHROMBIN TIME | FAERS: 5 | US FAERS | |
| 470 | Pelvic venous thrombosis | FAERS: 5 | US FAERS | |
| 471 | Peptic Ulcer | FAERS: 5 | US FAERS | |
| 472 | Poisoning | FAERS: 5 | US FAERS | |
| 473 | Polymyalgia Rheumatica | FAERS: 5 | US FAERS | |
| 474 | Portal Vein Thrombosis | FAERS: 5 | US FAERS | |
| 475 | Post procedural pulmonary embolism | FAERS: 5 | US FAERS | |
| 476 | Product package associated injury | FAERS: 5 | US FAERS | |
| 477 | Product packaging issue | FAERS: 5 | US FAERS | |
| 478 | Product use complaint | FAERS: 5 | US FAERS | |
| 479 | Psoriasis | FAERS: 5 | US FAERS | |
| 480 | Quality of life decreased | FAERS: 5 | US FAERS | |
| 481 | Renal cyst | FAERS: 5 | US FAERS | |
| 482 | Renal embolism | FAERS: 5 | US FAERS | |
| 483 | Retinal Vein Occlusion | FAERS: 5 | US FAERS | |
| 484 | Sluggishness | FAERS: 5 | US FAERS | |
| 485 | Sneezing | FAERS: 5 | US FAERS | |
| 486 | Spinal column stenosis | FAERS: 5 | US FAERS | |
| 487 | Squamous cell carcinoma | FAERS: 5 | US FAERS | |
| 488 | Therapy cessation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 489 | Therapy regimen changed | FAERS: 5 | US FAERS | |
| 490 | Tongue biting | FAERS: 5 | US FAERS | |
| 491 | Wound Complication | FAERS: 5 | US FAERS | |
| 492 | Abdominal Infection | FAERS: 4 | US FAERS | |
| 493 | Acne | FAERS: 4 | US FAERS | |
| 494 | Adenocarcinoma | FAERS: 4 | US FAERS | |
| 495 | Anosmia | FAERS: 4 | US FAERS | |
| 496 | Anticoagulation drug level abnormal | FAERS: 4 | US FAERS | |
| 497 | Antiphospholipid Syndrome | FAERS: 4 | US FAERS | |
| 498 | Antiphospholipid antibodies positive | FAERS: 4 | US FAERS | |
| 499 | Aortic dissection rupture | FAERS: 4 | US FAERS | |
| 500 | Apparent life threatening event | FAERS: 4 | US FAERS | |
| 501 | Asphyxia | FAERS: 4 | US FAERS | |
| 502 | Bladder Diverticulum | FAERS: 4 | US FAERS | |
| 503 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 504 | Blood fibrinogen decreased | FAERS: 4 | US FAERS | |
| 505 | Blood iron decreased | FAERS: 4 | US FAERS | |
| 506 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 507 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 508 | Bursitis | FAERS: 4 | US FAERS | |
| 509 | Candidiasis | FAERS: 4 | US FAERS | |
| 510 | Cardiac Death | FAERS: 4 | US FAERS | |
| 511 | Cartilage injury | FAERS: 4 | US FAERS | |
| 512 | Central nervous system lesion | FAERS: 4 | US FAERS | |
| 513 | Cerebral vascular occlusion | FAERS: 4 | US FAERS | |
| 514 | Complication associated with device | FAERS: 4 | US FAERS | |
| 515 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 516 | Coronary artery embolism | FAERS: 4 | US FAERS | |
| 517 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 518 | Diastolic dysfunction | FAERS: 4 | US FAERS | |
| 519 | Diffuse Large B-Cell Lymphoma | FAERS: 4 | US FAERS | |
| 520 | Disease Progression | FAERS: 4 | US FAERS | |
| 521 | Diverticular perforation | FAERS: 4 | US FAERS | |
| 522 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 523 | Dysplasia | FAERS: 4 | US FAERS | |
| 524 | Empyema | FAERS: 4 | US FAERS | |
| 525 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 526 | Extra dose administered | FAERS: 4 | US FAERS | |
| 527 | Facial Pain | FAERS: 4 | US FAERS | |
| 528 | Factor V Leiden mutation | FAERS: 4 | US FAERS | |
| 529 | Full blood count decreased | FAERS: 4 | US FAERS | |
| 530 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 4 | US FAERS | |
| 531 | Gastrointestinal erosion | FAERS: 4 | US FAERS | |
| 532 | General symptom | FAERS: 4 | US FAERS | |
| 533 | Hepatic congestion | FAERS: 4 | US FAERS | |
| 534 | Hunger | FAERS: 4 | US FAERS | |
| 535 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 536 | Hypersomnia | FAERS: 4 | US FAERS | |
| 537 | Hypoperfusion | FAERS: 4 | US FAERS | |
| 538 | Incontinence | FAERS: 4 | US FAERS | |
| 539 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 540 | Infectious colitis | FAERS: 4 | US FAERS | |
| 541 | Infectious peritonitis | FAERS: 4 | US FAERS | |
| 542 | Initial insomnia | FAERS: 4 | US FAERS | |
| 543 | Leukopenia | FAERS: 4 | US FAERS | |
| 544 | Malnutrition | FAERS: 4 | US FAERS | |
| 545 | Micturition frequency decreased | FAERS: 4 | US FAERS | |
| 546 | Nasal discomfort | FAERS: 4 | US FAERS | |
| 547 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 548 | Nerve injury | FAERS: 4 | US FAERS | |
| 549 | Non-cardiac chest pain | FAERS: 4 | US FAERS | |
| 550 | Osteomyelitis | FAERS: 4 | US FAERS | |
| 551 | Paraplegia | FAERS: 4 | US FAERS | |
| 552 | Physical assault | FAERS: 4 | US FAERS | |
| 553 | Platelet count abnormal | FAERS: 4 | US FAERS | |
| 554 | Pleurisy | FAERS: 4 | US FAERS | |
| 555 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 556 | Pneumatosis intestinalis | FAERS: 4 | US FAERS | |
| 557 | Pneumoperitoneum | FAERS: 4 | US FAERS | |
| 558 | Pre-existing condition improved | FAERS: 4 | US FAERS | |
| 559 | Prerenal failure | FAERS: 4 | US FAERS | |
| 560 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 561 | Product blister packaging issue | FAERS: 4 | US FAERS | |
| 562 | Product physical issue | FAERS: 4 | US FAERS | |
| 563 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 564 | Rosacea | FAERS: 4 | US FAERS | |
| 565 | Ruptured cerebral aneurysm | FAERS: 4 | US FAERS | |
| 566 | Sinus headache | FAERS: 4 | US FAERS | |
| 567 | Sinus operation | FAERS: 4 | US FAERS | |
| 568 | Skeletal injury | FAERS: 4 | US FAERS | |
| 569 | Skin reaction | FAERS: 4 | US FAERS | |
| 570 | Splenic embolism | FAERS: 4 | US FAERS | |
| 571 | Stenosis | FAERS: 4 | US FAERS | |
| 572 | Stress ulcer | FAERS: 4 | US FAERS | |
| 573 | Thirst | FAERS: 4 | US FAERS | |
| 574 | Thyroid Neoplasm | FAERS: 4 | US FAERS | |
| 575 | Traumatic liver injury | FAERS: 4 | US FAERS | |
| 576 | Uterine Cancer | FAERS: 4 | US FAERS | |
| 577 | Vascular occlusion | FAERS: 4 | US FAERS | |
| 578 | Vascular rupture | FAERS: 4 | US FAERS | |
| 579 | Abdominal Abscess | FAERS: 3 | US FAERS | |
| 580 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 581 | Abdominal sepsis | FAERS: 3 | US FAERS | |
| 582 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 583 | Acute aortic syndrome | FAERS: 3 | US FAERS | |
| 584 | Acute prerenal failure | FAERS: 3 | US FAERS | |
| 585 | Anal Fissure | FAERS: 3 | US FAERS | |
| 586 | Anal Ulcer | FAERS: 3 | US FAERS | |
| 587 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 588 | Anastomotic ulcer | FAERS: 3 | US FAERS | |
| 589 | Animal bite | FAERS: 3 | US FAERS | |
| 590 | Anticoagulation drug level below therapeutic | FAERS: 3 | US FAERS | |
| 591 | Antiphospholipid Antibodies | FAERS: 3 | US FAERS | |
| 592 | Apathy | FAERS: 3 | US FAERS | |
| 593 | Arterial Injury | FAERS: 3 | US FAERS | |
| 594 | Atrial tachycardia | FAERS: 3 | US FAERS | |
| 595 | Bedridden | FAERS: 3 | US FAERS | |
| 596 | Benign Prostatic Hyperplasia | FAERS: 3 | US FAERS | |
| 597 | Bladder cancer recurrent | FAERS: 3 | US FAERS | |
| 598 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 599 | Blood fibrinogen increased | FAERS: 3 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 600 | Blood glucose abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 601 | Bone contusion | FAERS: 3 | US FAERS | |
| 602 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 603 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 604 | Cardiovascular insufficiency | FAERS: 3 | US FAERS | |
| 605 | Cluster Headache | FAERS: 3 | US FAERS | |
| 606 | Coagulation time abnormal | FAERS: 3 | US FAERS | |
| 607 | Colon adenoma | FAERS: 3 | US FAERS | |
| 608 | Crying | FAERS: 3 | US FAERS | |
| 609 | Dengue Fever | FAERS: 3 | US FAERS | |
| 610 | Device malfunction | FAERS: 3 | US FAERS | |
| 611 | Eczema | FAERS: 3 | US FAERS | |
| 612 | Endodontic procedure | FAERS: 3 | US FAERS | |
| 613 | Enterococcal infection | FAERS: 3 | US FAERS | |
| 614 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 615 | Escherichia urinary tract infection | FAERS: 3 | US FAERS | |
| 616 | Eye Infection | FAERS: 3 | US FAERS | |
| 617 | Factor V deficiency | FAERS: 3 | US FAERS | |
| 618 | Frustration tolerance decreased | FAERS: 3 | US FAERS | |
| 619 | Gastrectomy | FAERS: 3 | US FAERS | |
| 620 | Gastric Antral Vascular Ectasia | FAERS: 3 | US FAERS | |
| 621 | Gastrointestinal angiodysplasia | FAERS: 3 | US FAERS | |
| 622 | Gastrointestinal hypomotility | FAERS: 3 | US FAERS | |
| 623 | Gastrointestinal obstruction | FAERS: 3 | US FAERS | |
| 624 | Gaze palsy | FAERS: 3 | US FAERS | |
| 625 | Glomerular Filtration Rate | FAERS: 3 | US FAERS | |
| 626 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 627 | Hepatorenal Syndrome | FAERS: 3 | US FAERS | |
| 628 | Hypertrophic Cardiomyopathy | FAERS: 3 | US FAERS | |
| 629 | Immobile | FAERS: 3 | US FAERS | |
| 630 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 631 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 632 | Joint dislocation postoperative | FAERS: 3 | US FAERS | |
| 633 | Limb operation | FAERS: 3 | US FAERS | |
| 634 | Marasmus | FAERS: 3 | US FAERS | |
| 635 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 636 | Medication residue | FAERS: 3 | US FAERS | |
| 637 | Meningioma | FAERS: 3 | US FAERS | |
| 638 | Mesenteric arterial occlusion | FAERS: 3 | US FAERS | |
| 639 | Metastasis | FAERS: 3 | US FAERS | |
| 640 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 641 | Multiple allergies | FAERS: 3 | US FAERS | |
| 642 | Myasthenia Gravis | FAERS: 3 | US FAERS | |
| 643 | NIH stroke scale abnormal | FAERS: 3 | US FAERS | |
| 644 | Pancreatic Cyst | FAERS: 3 | US FAERS | |
| 645 | Pancreatic operation | FAERS: 3 | US FAERS | |
| 646 | Papule | FAERS: 3 | US FAERS | |
| 647 | Perforated ulcer | FAERS: 3 | US FAERS | |
| 648 | Poor peripheral circulation | FAERS: 3 | US FAERS | |
| 649 | Post procedural discharge | FAERS: 3 | US FAERS | |
| 650 | Post procedural swelling | FAERS: 3 | US FAERS | |
| 651 | Proctitis | FAERS: 3 | US FAERS | |
| 652 | Product label issue | FAERS: 3 | US FAERS | |
| 653 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 654 | Product substitution issue | FAERS: 3 | US FAERS | |
| 655 | Prothrombin level decreased | FAERS: 3 | US FAERS | |
| 656 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 657 | Pulmonary artery thrombosis | FAERS: 3 | US FAERS | |
| 658 | Renal Colic | FAERS: 3 | US FAERS | |
| 659 | Renal mass | FAERS: 3 | US FAERS | |
| 660 | Renal vascular thrombosis | FAERS: 3 | US FAERS | |
| 661 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 662 | Retinal vascular occlusion | FAERS: 3 | US FAERS | |
| 663 | Retrograde amnesia | FAERS: 3 | US FAERS | |
| 664 | Scab | FAERS: 3 | US FAERS | |
| 665 | Sensation of blood flow | FAERS: 3 | US FAERS | |
| 666 | Sick Sinus Syndrome | FAERS: 3 | US FAERS | |
| 667 | Skin laceration | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 668 | Spinal column injury | FAERS: 3 | US FAERS | |
| 669 | Splenomegaly | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 670 | Spondylolisthesis | FAERS: 3 | US FAERS | |
| 671 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 672 | Sudden onset of sleep | FAERS: 3 | US FAERS | |
| 673 | Superficial vein prominence | FAERS: 3 | US FAERS | |
| 674 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 675 | Tachyarrhythmia | FAERS: 3 | US FAERS | |
| 676 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 677 | Tension Headache | FAERS: 3 | US FAERS | |
| 678 | Thalamic infarction | FAERS: 3 | US FAERS | |
| 679 | Thermal burn | FAERS: 3 | US FAERS | |
| 680 | Tooth Loss | FAERS: 3 | US FAERS | |
| 681 | Trigeminal Neuralgia | FAERS: 3 | US FAERS | |
| 682 | Upper respiratory tract congestion | FAERS: 3 | US FAERS | |
| 683 | Urethral Stenosis | FAERS: 3 | US FAERS | |
| 684 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 685 | Ventricle rupture | FAERS: 3 | US FAERS | |
| 686 | Vertebral Artery Stenosis | FAERS: 3 | US FAERS | |
| 687 | Wrong dose | FAERS: 3 | US FAERS | |
| 688 | Abdominal incarcerated hernia | FAERS: 2 | US FAERS | |
| 689 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 690 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 691 | Accidental death | FAERS: 2 | US FAERS | |
| 692 | Adrenal mass | FAERS: 2 | US FAERS | |
| 693 | Albuminuria | FAERS: 2 | US FAERS | |
| 694 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 695 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 696 | Amaurosis | FAERS: 2 | US FAERS | |
| 697 | Ammonia increased | FAERS: 2 | US FAERS | |
| 698 | Amyloidosis | FAERS: 2 | US FAERS | |
| 699 | Anhedonia | FAERS: 2 | US FAERS | |
| 700 | Animal scratch | FAERS: 2 | US FAERS | |
| 701 | Anosognosia | FAERS: 2 | US FAERS | |
| 702 | Anticoagulation drug level decreased | FAERS: 2 | US FAERS | |
| 703 | Aortic aneurysm repair | FAERS: 2 | US FAERS | |
| 704 | Aortic embolus | FAERS: 2 | US FAERS | |
| 705 | Apallic syndrome | FAERS: 2 | US FAERS | |
| 706 | Arteriovenous fistula | FAERS: 2 | US FAERS | |
| 707 | Atelectasis | FAERS: 2 | US FAERS | |
| 708 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 709 | Bacillus test positive | FAERS: 2 | US FAERS | |
| 710 | Bladder pain | FAERS: 2 | US FAERS | |
| 711 | Bladder spasm | FAERS: 2 | US FAERS | |
| 712 | Bleeding time abnormal | FAERS: 2 | US FAERS | |
| 713 | Bleeding time shortened | FAERS: 2 | US FAERS | |
| 714 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 715 | Blood glucagon abnormal | FAERS: 2 | US FAERS | |
| 716 | Blood immunoglobulin E | FAERS: 2 | US FAERS | |
| 717 | Blood parathyroid hormone increased | FAERS: 2 | US FAERS | |
| 718 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 719 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 720 | Blood product transfusion dependent | FAERS: 2 | US FAERS | |
| 721 | Blood thrombin increased | FAERS: 2 | US FAERS | |
| 722 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 723 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 724 | Bronchopneumopathy | FAERS: 2 | US FAERS | |
| 725 | Cardiac procedure complication | FAERS: 2 | US FAERS | |
| 726 | Cataract operation | FAERS: 2 | US FAERS | |
| 727 | Catheter placement | FAERS: 2 | US FAERS | |
| 728 | Cerebellar artery occlusion | FAERS: 2 | US FAERS | |
| 729 | Cerebellar embolism | FAERS: 2 | US FAERS | |
| 730 | Cerebral Amyloid Angiopathy | FAERS: 2 | US FAERS | |
| 731 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 732 | Cerebral microhaemorrhage | FAERS: 2 | US FAERS | |
| 733 | Cerebral vasoconstriction | FAERS: 2 | US FAERS | |
| 734 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 735 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 736 | Clostridium difficile infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 737 | Coagulation factor increased | FAERS: 2 | US FAERS | |
| 738 | Coagulation test normal | FAERS: 2 | US FAERS | |
| 739 | Coma scale abnormal | FAERS: 2 | US FAERS | |
| 740 | Contraindicated drug administered | FAERS: 2 | US FAERS | |
| 741 | Coronary artery perforation | FAERS: 2 | US FAERS | |
| 742 | Craniotomy | FAERS: 2 | US FAERS | |
| 743 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 744 | Device related sepsis | FAERS: 2 | US FAERS | |
| 745 | Device related thrombosis | FAERS: 2 | US FAERS | |
| 746 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 747 | Diabetic Retinopathy | FAERS: 2 | US FAERS | |
| 748 | Disease recurrence | FAERS: 2 | US FAERS | |
| 749 | Drooling | FAERS: 2 | US FAERS | |
| 750 | Drug Dependence | FAERS: 2 | US FAERS | |
| 751 | Drug abuse | FAERS: 2 | US FAERS | |
| 752 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 753 | Drug level below therapeutic | FAERS: 2 | US FAERS | |
| 754 | Duodenal perforation | FAERS: 2 | US FAERS | |
| 755 | Dyslalia | FAERS: 2 | US FAERS | |
| 756 | Ear congestion | FAERS: 2 | US FAERS | |
| 757 | Early satiety | FAERS: 2 | US FAERS | |
| 758 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 759 | Ejection fraction abnormal | FAERS: 2 | US FAERS | |
| 760 | Emergency Care | FAERS: 2 | US FAERS | |
| 761 | Emotional disorder | FAERS: 2 | US FAERS | |
| 762 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 763 | Escherichia infection | FAERS: 2 | US FAERS | |
| 764 | Extravasation | FAERS: 2 | US FAERS | |
| 765 | Extremity necrosis | FAERS: 2 | US FAERS | |
| 766 | Factor V Leiden carrier | FAERS: 2 | US FAERS | |
| 767 | Factor VIII Deficiency | FAERS: 2 | US FAERS | |
| 768 | Factor XI Deficiency | FAERS: 2 | US FAERS | |
| 769 | Femoral artery occlusion | FAERS: 2 | US FAERS | |
| 770 | Femoral hernia incarcerated | FAERS: 2 | US FAERS | |
| 771 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 772 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 773 | Food Allergy | FAERS: 2 | US FAERS | |
| 774 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 775 | Formication | FAERS: 2 | US FAERS | |
| 776 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 777 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 778 | Gastric mucosal lesion | FAERS: 2 | US FAERS | |
| 779 | Gastrointestinal endoscopic therapy | FAERS: 2 | US FAERS | |
| 780 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 781 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 782 | Gastrointestinal mucosal disorder | FAERS: 2 | US FAERS | |
| 783 | Gastrointestinal tract adenoma | FAERS: 2 | US FAERS | |
| 784 | Gastrointestinal viral infection | FAERS: 2 | US FAERS | |
| 785 | Gingivitis | FAERS: 2 | US FAERS | |
| 786 | Granulomatosis with polyangiitis | FAERS: 2 | US FAERS | |
| 787 | Heart valve calcification | FAERS: 2 | US FAERS | |
| 788 | Heat illness | FAERS: 2 | US FAERS | |
| 789 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 790 | Hepatitis B | FAERS: 2 | US FAERS | |
| 791 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 792 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 793 | Hypertensive emergency | FAERS: 2 | US FAERS | |
| 794 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 795 | Hypogeusia | FAERS: 2 | US FAERS | |
| 796 | Hypokinesia | FAERS: 2 | US FAERS | |
| 797 | Hyposideraemia | FAERS: 2 | US FAERS | |
| 798 | Hypotonic-hyporesponsive episode | FAERS: 2 | US FAERS | |
| 799 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 800 | Iliac artery occlusion | FAERS: 2 | US FAERS | |
| 801 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 802 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 803 | Incarcerated inguinal hernia | FAERS: 2 | US FAERS | |
| 804 | Incorrect product administration duration | FAERS: 2 | US FAERS | |
| 805 | Infectious pleural effusion | FAERS: 2 | US FAERS | |
| 806 | Infective exacerbation of chronic obstructive airways disease | FAERS: 2 | US FAERS | |
| 807 | Internal injury | FAERS: 2 | US FAERS | |
| 808 | Interventional procedure | FAERS: 2 | US FAERS | |
| 809 | Intervertebral disc compression | FAERS: 2 | US FAERS | |
| 810 | Intestinal polyp haemorrhage | FAERS: 2 | US FAERS | |
| 811 | Intestinal resection | FAERS: 2 | US FAERS | |
| 812 | Intestinal sepsis | FAERS: 2 | US FAERS | |
| 813 | Intussusception | FAERS: 2 | US FAERS | |
| 814 | Laryngospasm | FAERS: 2 | US FAERS | |
| 815 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 816 | Lens dislocation | FAERS: 2 | US FAERS | |
| 817 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 818 | Limb mass | FAERS: 2 | US FAERS | |
| 819 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 820 | Loose tooth | FAERS: 2 | US FAERS | |
| 821 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 822 | Macular fibrosis | FAERS: 2 | US FAERS | |
| 823 | Macule | FAERS: 2 | US FAERS | |
| 824 | Malignant neoplasm of spinal cord | FAERS: 2 | US FAERS | |
| 825 | Medical device implantation | FAERS: 2 | US FAERS | |
| 826 | Medical device pain | FAERS: 2 | US FAERS | |
| 827 | Medical procedure | FAERS: 2 | US FAERS | |
| 828 | Meniscus injury | FAERS: 2 | US FAERS | |
| 829 | Metaplasia | FAERS: 2 | US FAERS | |
| 830 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 831 | Mixed liver injury | FAERS: 2 | US FAERS | |
| 832 | Motion Sickness | FAERS: 2 | US FAERS | |
| 833 | Mucosal exfoliation | FAERS: 2 | US FAERS | |
| 834 | Multimorbidity | FAERS: 2 | US FAERS | |
| 835 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 836 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 837 | Mydriasis | FAERS: 2 | US FAERS | |
| 838 | Myocardial rupture | FAERS: 2 | US FAERS | |
| 839 | Myocarditis | FAERS: 2 | US FAERS | |
| 840 | Myopathy | FAERS: 2 | US FAERS | |
| 841 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 842 | Nipple pain | FAERS: 2 | US FAERS | |
| 843 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 844 | Obstruction | FAERS: 2 | US FAERS | |
| 845 | Onychoclasis | FAERS: 2 | US FAERS | |
| 846 | Open globe injury | FAERS: 2 | US FAERS | |
| 847 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 848 | Oral administration complication | FAERS: 2 | US FAERS | |
| 849 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 850 | Oral infection | FAERS: 2 | US FAERS | |
| 851 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 852 | Oropharyngeal plaque | FAERS: 2 | US FAERS | |
| 853 | Osteopenia | FAERS: 2 | US FAERS | |
| 854 | Osteoporosis | FAERS: 2 | US FAERS | |
| 855 | Panic Disorder | FAERS: 2 | US FAERS | |
| 856 | Partner stress | FAERS: 2 | US FAERS | |
| 857 | Percutaneous Coronary Intervention | FAERS: 2 | US FAERS | |
| 858 | Periproctitis | FAERS: 2 | US FAERS | |
| 859 | Pharyngitis | FAERS: 2 | US FAERS | |
| 860 | Phlebitis deep | FAERS: 2 | US FAERS | |
| 861 | Photophobia | FAERS: 2 | US FAERS | |
| 862 | Platelet Transfusion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 863 | Post procedural infection | FAERS: 2 | US FAERS | |
| 864 | Postoperative fever | FAERS: 2 | US FAERS | |
| 865 | Postoperative ileus | FAERS: 2 | US FAERS | |
| 866 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 867 | Product counterfeit | FAERS: 2 | US FAERS | |
| 868 | Prostatectomy | FAERS: 2 | US FAERS | |
| 869 | Prosthesis Implantation | FAERS: 2 | US FAERS | |
| 870 | Protein total increased | FAERS: 2 | US FAERS | |
| 871 | Proteinuria | FAERS: 2 | US FAERS | |
| 872 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 873 | Radiculopathy | FAERS: 2 | US FAERS | |
| 874 | Rectal discharge | FAERS: 2 | US FAERS | |
| 875 | Rectal polyp | FAERS: 2 | US FAERS | |
| 876 | Rectal tenesmus | FAERS: 2 | US FAERS | |
| 877 | Reflux laryngitis | FAERS: 2 | US FAERS | |
| 878 | Removal of foreign body from gastrointestinal tract | FAERS: 2 | US FAERS | |
| 879 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 880 | Renal artery occlusion | FAERS: 2 | US FAERS | |
| 881 | Senile dementia | FAERS: 2 | US FAERS | |
| 882 | Septic embolus | FAERS: 2 | US FAERS | |
| 883 | Sinus rhythm | FAERS: 2 | US FAERS | |
| 884 | Skin Erosion | FAERS: 2 | US FAERS | |
| 885 | Skin tightness | FAERS: 2 | US FAERS | |
| 886 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 887 | Small intestine carcinoma | FAERS: 2 | US FAERS | |
| 888 | Somnambulism | FAERS: 2 | US FAERS | |
| 889 | Stasis dermatitis | FAERS: 2 | US FAERS | |
| 890 | Stupor | FAERS: 2 | US FAERS | |
| 891 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 892 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 893 | Suture related complication | FAERS: 2 | US FAERS | |
| 894 | Teeth brittle | FAERS: 2 | US FAERS | |
| 895 | Terminal state | FAERS: 2 | US FAERS | |
| 896 | Thrombectomy | FAERS: 2 | US FAERS | |
| 897 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 898 | Toxic Epidermal Necrolysis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 899 | Toxic Shock Syndrome | FAERS: 2 | US FAERS | |
| 900 | Transfusion Reaction | FAERS: 2 | US FAERS | |
| 901 | Transfusion-Related Acute Lung Injury | FAERS: 2 | US FAERS | |
| 902 | Transplant | FAERS: 2 | US FAERS | |
| 903 | Traumatic fracture | FAERS: 2 | US FAERS | |
| 904 | Troponin | FAERS: 2 | US FAERS | |
| 905 | Trousseau's syndrome | FAERS: 2 | US FAERS | |
| 906 | Ulcerative gastritis | FAERS: 2 | US FAERS | |
| 907 | Ureterolithiasis | FAERS: 2 | US FAERS | |
| 908 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 909 | Urinary tract infection staphylococcal | FAERS: 2 | US FAERS | |
| 910 | Urine output increased | FAERS: 2 | US FAERS | |
| 911 | Uterine Perforation | FAERS: 2 | US FAERS | |
| 912 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 913 | Vascular stent stenosis | FAERS: 2 | US FAERS | |
| 914 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 915 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 916 | Vertebral artery occlusion | FAERS: 2 | US FAERS | |
| 917 | Visual acuity reduced transiently | FAERS: 2 | US FAERS | |
| 918 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 919 | Vulvitis | FAERS: 2 | US FAERS | |
| 920 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 921 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 922 | angiogram | FAERS: 2 | US FAERS | |
| 923 | colonoscopy | FAERS: 2 | US FAERS | |
| 924 | effusion | FAERS: 2 | US FAERS | |
| 925 | gliosarcoma | FAERS: 2 | US FAERS | |
| 926 | insulinoma | FAERS: 2 | US FAERS | |
| 927 | muscle injury | FAERS: 2 | US FAERS | |
| 928 | Abdominal Compartment Syndrome | FAERS: 1 | US FAERS | |
| 929 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 930 | Abdominal hernia gangrenous | FAERS: 1 | US FAERS | |
| 931 | Abdominal mass | FAERS: 1 | US FAERS | |
| 932 | Abnormal clotting factor | FAERS: 1 | US FAERS | |
| 933 | Abnormal withdrawal bleeding | FAERS: 1 | US FAERS | |
| 934 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 935 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 936 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 937 | Accidental underdose | FAERS: 1 | US FAERS | |
| 938 | Activated partial thromboplastin time normal | FAERS: 1 | US FAERS | |
| 939 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 940 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 941 | Administration related reaction | FAERS: 1 | US FAERS | |
| 942 | Agonal death struggle | FAERS: 1 | US FAERS | |
| 943 | Agraphia | FAERS: 1 | US FAERS | |
| 944 | Akathisia | FAERS: 1 | US FAERS | |
| 945 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 946 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 947 | Allergy to vaccine | FAERS: 1 | US FAERS | |
| 948 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 949 | Amegakaryocytic thrombocytopenia | FAERS: 1 | US FAERS | |
| 950 | Anal abscess | FAERS: 1 | US FAERS | |
| 951 | Anal erosion | FAERS: 1 | US FAERS | |
| 952 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 953 | Anastomotic complication | FAERS: 1 | US FAERS | |
| 954 | Angiodermatitis | FAERS: 1 | US FAERS | |
| 955 | Angioplasty | FAERS: 1 | US FAERS | |
| 956 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 957 | Anorectal operation | FAERS: 1 | US FAERS | |
| 958 | Anti factor VIII antibody test | FAERS: 1 | US FAERS | |
| 959 | Antibiotic therapy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 960 | Anticoagulant therapy | FAERS: 1 | US FAERS | |
| 961 | Anticoagulation drug level | FAERS: 1 | US FAERS | |
| 962 | Aortic Injury | FAERS: 1 | US FAERS | |
| 963 | Aortic bypass | FAERS: 1 | US FAERS | |
| 964 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 965 | Aortic valve calcification | FAERS: 1 | US FAERS | |
| 966 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 967 | Application site discharge | FAERS: 1 | US FAERS | |
| 968 | Aqueous fibrin | FAERS: 1 | US FAERS | |
| 969 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 970 | Arterial wall hypertrophy | FAERS: 1 | US FAERS | |
| 971 | Arthropod bite | FAERS: 1 | US FAERS | |
| 972 | Arthropod sting | FAERS: 1 | US FAERS | |
| 973 | Asbestosis | FAERS: 1 | US FAERS | |
| 974 | Asthenopia | FAERS: 1 | US FAERS | |
| 975 | Atrial appendage resection | FAERS: 1 | US FAERS | |
| 976 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 977 | Auricular swelling | FAERS: 1 | US FAERS | |
| 978 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 979 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 980 | Babesiosis | FAERS: 1 | US FAERS | |
| 981 | Bacterial Translocation | FAERS: 1 | US FAERS | |
| 982 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 983 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 984 | Balanitis | FAERS: 1 | US FAERS | |
| 985 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 986 | Basal ganglia stroke | FAERS: 1 | US FAERS | |
| 987 | Bile output abnormal | FAERS: 1 | US FAERS | |
| 988 | Biliary sepsis | FAERS: 1 | US FAERS | |
| 989 | Biopsy | FAERS: 1 | US FAERS | |
| 990 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 991 | Birth mark | FAERS: 1 | US FAERS | |
| 992 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 993 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 994 | Bladder tamponade | FAERS: 1 | US FAERS | |
| 995 | Blepharospasm | FAERS: 1 | US FAERS | |
| 996 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 997 | Blood brain barrier defect | FAERS: 1 | US FAERS | |
| 998 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 999 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 1000 | Blood creatine decreased | FAERS: 1 | US FAERS | |
| 1001 | Blood creatine phosphokinase MB | FAERS: 1 | US FAERS | |
| 1002 | Blood creatine | FAERS: 1 | US FAERS | |
| 1003 | Blood gastrin increased | FAERS: 1 | US FAERS | |
| 1004 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 1005 | Blood iron increased | FAERS: 1 | US FAERS | |
| 1006 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 1007 | Blood thrombin | FAERS: 1 | US FAERS | |
| 1008 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 1009 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 1010 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 1011 | Blood urea nitrogen/creatinine ratio decreased | FAERS: 1 | US FAERS | |
| 1012 | Blood viscosity decreased | FAERS: 1 | US FAERS | |
| 1013 | Bloody airway discharge | FAERS: 1 | US FAERS | |
| 1014 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 1015 | Body fat disorder | FAERS: 1 | US FAERS | |
| 1016 | Bone density decreased | FAERS: 1 | US FAERS | |
| 1017 | Bone fissure | FAERS: 1 | US FAERS | |
| 1018 | Bone lesion | FAERS: 1 | US FAERS | |
| 1019 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 1020 | Brachiocephalic vein thrombosis | FAERS: 1 | US FAERS | |
| 1021 | Bradykinesia | FAERS: 1 | US FAERS | |
| 1022 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 1023 | Brain natriuretic peptide abnormal | FAERS: 1 | US FAERS | |
| 1024 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 1025 | Breast discomfort | FAERS: 1 | US FAERS | |
| 1026 | Breast tenderness | FAERS: 1 | US FAERS | |
| 1027 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 1028 | Brown-Sequard Syndrome | FAERS: 1 | US FAERS | |
| 1029 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 1030 | Capillaritis | FAERS: 1 | US FAERS | |
| 1031 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 1032 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 1033 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 1034 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 1035 | Cardiac valve fibroelastoma | FAERS: 1 | US FAERS | |
| 1036 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 1037 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 1038 | Cardioactive drug level increased | FAERS: 1 | US FAERS | |
| 1039 | Cardiomyopathy acute | FAERS: 1 | US FAERS | |
| 1040 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 1041 | Catatonia | FAERS: 1 | US FAERS | |
| 1042 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 1043 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 1044 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 1045 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 1046 | Cerebral microembolism | FAERS: 1 | US FAERS | |
| 1047 | Cerebral ventricle collapse | FAERS: 1 | US FAERS | |
| 1048 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 1049 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 1050 | Cheilitis | FAERS: 1 | US FAERS | |
| 1051 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 1052 | Chemical peritonitis | FAERS: 1 | US FAERS | |
| 1053 | Child-Pugh-Turcotte score abnormal | FAERS: 1 | US FAERS | |
| 1054 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 1055 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 1056 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 1057 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 1058 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 1059 | Clot retraction time prolonged | FAERS: 1 | US FAERS | |
| 1060 | Clumsiness | FAERS: 1 | US FAERS | |
| 1061 | Coagulation factor IX level decreased | FAERS: 1 | US FAERS | |
| 1062 | Coagulation factor V level decreased | FAERS: 1 | US FAERS | |
| 1063 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 1064 | Coagulation test | FAERS: 1 | US FAERS | |
| 1065 | Collateral Circulation | FAERS: 1 | US FAERS | |
| 1066 | Colonic Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 1067 | Complement factor abnormal | FAERS: 1 | US FAERS | |
| 1068 | Completed Suicide | FAERS: 1 | US FAERS | |
| 1069 | Complicated fracture | FAERS: 1 | US FAERS | |
| 1070 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 1071 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 1072 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 1073 | Congenital heart valve disorder | FAERS: 1 | US FAERS | |
| 1074 | Conjunctival pallor | FAERS: 1 | US FAERS | |
| 1075 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 1076 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 1077 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 1078 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 1079 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 1080 | Corneal Infection | FAERS: 1 | US FAERS | |
| 1081 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 1082 | Cranial operation | FAERS: 1 | US FAERS | |
| 1083 | Critical Illness | FAERS: 1 | US FAERS | |
| 1084 | Cupulolithiasis | FAERS: 1 | US FAERS | |
| 1085 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 1086 | Cyst removal | FAERS: 1 | US FAERS | |
| 1087 | Cystocele | FAERS: 1 | US FAERS | |
| 1088 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 1089 | Dental discomfort | FAERS: 1 | US FAERS | |
| 1090 | Depression suicidal | FAERS: 1 | US FAERS | |
| 1091 | Device Failure | FAERS: 1 | US FAERS | |
| 1092 | Device breakage | FAERS: 1 | US FAERS | |
| 1093 | Device lead damage | FAERS: 1 | US FAERS | |
| 1094 | Device occlusion | FAERS: 1 | US FAERS | |
| 1095 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 1096 | Dialysis device insertion | FAERS: 1 | US FAERS | |
| 1097 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 1098 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 1099 | Diffuse vasculitis | FAERS: 1 | US FAERS | |
| 1100 | Diplegia | FAERS: 1 | US FAERS | |
| 1101 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 1102 | Drug label confusion | FAERS: 1 | US FAERS | |
| 1103 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 1104 | Drug level fluctuating | FAERS: 1 | US FAERS | |
| 1105 | Drug name confusion | FAERS: 1 | US FAERS | |
| 1106 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 1107 | Drug therapeutic incompatibility | FAERS: 1 | US FAERS | |
| 1108 | Dry gangrene | FAERS: 1 | US FAERS | |
| 1109 | Duodenal switch | FAERS: 1 | US FAERS | |
| 1110 | Duodenal vascular ectasia | FAERS: 1 | US FAERS | |
| 1111 | Dural abscess | FAERS: 1 | US FAERS | |
| 1112 | Dyslexia | FAERS: 1 | US FAERS | |
| 1113 | Dystonia | FAERS: 1 | US FAERS | |
| 1114 | Elective procedure | FAERS: 1 | US FAERS | |
| 1115 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 1116 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 1117 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 1118 | Embolic pneumonia | FAERS: 1 | US FAERS | |
| 1119 | Encephalocele | FAERS: 1 | US FAERS | |
| 1120 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 1121 | Endometrial cancer stage III | FAERS: 1 | US FAERS | |
| 1122 | Enteritis | FAERS: 1 | US FAERS | |
| 1123 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 1124 | Enterocolitis | FAERS: 1 | US FAERS | |
| 1125 | Epididymitis | FAERS: 1 | US FAERS | |
| 1126 | Epiglottitis | FAERS: 1 | US FAERS | |
| 1127 | Erection increased | FAERS: 1 | US FAERS | |
| 1128 | Erythropsia | FAERS: 1 | US FAERS | |
| 1129 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 1130 | Euphoric mood | FAERS: 1 | US FAERS | |
| 1131 | Expired drug administered | FAERS: 1 | US FAERS | |
| 1132 | Expired product administered | FAERS: 1 | US FAERS | |
| 1133 | Eye inflammation | FAERS: 1 | US FAERS | |
| 1134 | Eyeball rupture | FAERS: 1 | US FAERS | |
| 1135 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 1136 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 1137 | Familial Tremor | FAERS: 1 | US FAERS | |
| 1138 | Fasting | FAERS: 1 | US FAERS | |
| 1139 | Fibrin increased | FAERS: 1 | US FAERS | |
| 1140 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 1141 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 1142 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 1143 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 1144 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 1145 | Gastric infection | FAERS: 1 | US FAERS | |
| 1146 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 1147 | Gastric pacemaker insertion | FAERS: 1 | US FAERS | |
| 1148 | Gastric ulcer, obstructive | FAERS: 1 | US FAERS | |
| 1149 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 1150 | Gastrointestinal lymphoma | FAERS: 1 | US FAERS | |
| 1151 | Gastrointestinal mucosal exfoliation | FAERS: 1 | US FAERS | |
| 1152 | Gastrointestinal telangiectasia | FAERS: 1 | US FAERS | |
| 1153 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 1154 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 1155 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1156 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 1157 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 1158 | Grief reaction | FAERS: 1 | US FAERS | |
| 1159 | Growing pains | FAERS: 1 | US FAERS | |
| 1160 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 1161 | Hair growth rate abnormal | FAERS: 1 | US FAERS | |
| 1162 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 1163 | Head Banging | FAERS: 1 | US FAERS | |
| 1164 | Head titubation | FAERS: 1 | US FAERS | |
| 1165 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 1166 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 1167 | Hepatectomy | FAERS: 1 | US FAERS | |
| 1168 | Hepatic artery embolism | FAERS: 1 | US FAERS | |
| 1169 | Hepatic dysplasia | FAERS: 1 | US FAERS | |
| 1170 | Hepatic vein dilatation | FAERS: 1 | US FAERS | |
| 1171 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 1172 | Hepatitis C | FAERS: 1 | US FAERS | |
| 1173 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 1174 | Hospice Care | FAERS: 1 | US FAERS | |
| 1175 | Hydrothorax | FAERS: 1 | US FAERS | |
| 1176 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 1177 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 1178 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 1179 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 1180 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 1181 | Hypoventilation | FAERS: 1 | US FAERS | |
| 1182 | Hysterectomy | FAERS: 1 | US FAERS | |
| 1183 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 1184 | Idiopathic neutropenia | FAERS: 1 | US FAERS | |
| 1185 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 1186 | Ileal ulcer | FAERS: 1 | US FAERS | |
| 1187 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 1188 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 1189 | Impaired self-care | FAERS: 1 | US FAERS | |
| 1190 | Implant site infection | FAERS: 1 | US FAERS | |
| 1191 | Implant site swelling | FAERS: 1 | US FAERS | |
| 1192 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 1193 | Incision site infection | FAERS: 1 | US FAERS | |
| 1194 | Incision site pain | FAERS: 1 | US FAERS | |
| 1195 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 1196 | Induration | FAERS: 1 | US FAERS | |
| 1197 | Infected bite | FAERS: 1 | US FAERS | |
| 1198 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 1199 | Infusion site necrosis | FAERS: 1 | US FAERS | |
| 1200 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 1201 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 1202 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 1203 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 1204 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 1205 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 1206 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 1207 | Intestinal congestion | FAERS: 1 | US FAERS | |
| 1208 | Intra-cerebral aneurysm operation | FAERS: 1 | US FAERS | |
| 1209 | Intracardiac mass | FAERS: 1 | US FAERS | |
| 1210 | Intraspinal abscess | FAERS: 1 | US FAERS | |
| 1211 | Iodine uptake decreased | FAERS: 1 | US FAERS | |
| 1212 | Iritis | FAERS: 1 | US FAERS | |
| 1213 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 1214 | Jaw fistula | FAERS: 1 | US FAERS | |
| 1215 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 1216 | Kidney ablation | FAERS: 1 | US FAERS | |
| 1217 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 1218 | Lamin A/C gene mutation | FAERS: 1 | US FAERS | |
| 1219 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 1220 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 1221 | Laser Therapy | FAERS: 1 | US FAERS | |
| 1222 | Laser brain ablation | FAERS: 1 | US FAERS | |
| 1223 | Laziness | FAERS: 1 | US FAERS | |
| 1224 | Leptospirosis | FAERS: 1 | US FAERS | |
| 1225 | Leriche Syndrome | FAERS: 1 | US FAERS | |
| 1226 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 1227 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 1228 | Lichen Planus | FAERS: 1 | US FAERS | |
| 1229 | Ligament injury | FAERS: 1 | US FAERS | |
| 1230 | Ligament rupture | FAERS: 1 | US FAERS | |
| 1231 | Limb fracture | FAERS: 1 | US FAERS | |
| 1232 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 1233 | Listeriosis | FAERS: 1 | US FAERS | |
| 1234 | Lithotripsy | FAERS: 1 | US FAERS | |
| 1235 | Local reaction | FAERS: 1 | US FAERS | |
| 1236 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 1237 | Low income | FAERS: 1 | US FAERS | |
| 1238 | Lung hernia | FAERS: 1 | US FAERS | |
| 1239 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1240 | Lymph node palpable | FAERS: 1 | US FAERS | |
| 1241 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 1242 | Macroangiopathy | FAERS: 1 | US FAERS | |
| 1243 | Malabsorption | FAERS: 1 | US FAERS | |
| 1244 | Malignant anorectal neoplasm | FAERS: 1 | US FAERS | |
| 1245 | Malignant breast lump removal | FAERS: 1 | US FAERS | |
| 1246 | Mastectomy | FAERS: 1 | US FAERS | |
| 1247 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 1248 | Medical device site infection | FAERS: 1 | US FAERS | |
| 1249 | Megacolon | FAERS: 1 | US FAERS | |
| 1250 | Meningism | FAERS: 1 | US FAERS | |
| 1251 | Mesenteric Vascular Occlusion | FAERS: 1 | US FAERS | |
| 1252 | Mesothelioma | FAERS: 1 | US FAERS | |
| 1253 | Metastatic Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 1254 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 1255 | Microembolism | FAERS: 1 | US FAERS | |
| 1256 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 1257 | Mood swings | FAERS: 1 | US FAERS | |
| 1258 | Mouth cyst | FAERS: 1 | US FAERS | |
| 1259 | Mouth swelling | FAERS: 1 | US FAERS | |
| 1260 | Mucosal excoriation | FAERS: 1 | US FAERS | |
| 1261 | Mucosal necrosis | FAERS: 1 | US FAERS | |
| 1262 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 1263 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 1264 | Muscle contusion | FAERS: 1 | US FAERS | |
| 1265 | Myiasis | FAERS: 1 | US FAERS | |
| 1266 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 1267 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 1268 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 1269 | Myoclonus | FAERS: 1 | US FAERS | |
| 1270 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 1271 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 1272 | NIH stroke scale score increased | FAERS: 1 | US FAERS | |
| 1273 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 1274 | Nephritis | FAERS: 1 | US FAERS | |
| 1275 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 1276 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 1277 | Nerve Block | FAERS: 1 | US FAERS | |
| 1278 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 1279 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 1280 | Neurological infection | FAERS: 1 | US FAERS | |
| 1281 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1282 | Nodal osteoarthritis | FAERS: 1 | US FAERS | |
| 1283 | Nodule | FAERS: 1 | US FAERS | |
| 1284 | Non-Hodgkin's lymphoma metastatic | FAERS: 1 | US FAERS | |
| 1285 | Non-compaction cardiomyopathy | FAERS: 1 | US FAERS | |
| 1286 | Numb chin syndrome | FAERS: 1 | US FAERS | |
| 1287 | Nystagmus | FAERS: 1 | US FAERS | |
| 1288 | Ocular icterus | FAERS: 1 | US FAERS | |
| 1289 | Oncologic complication | FAERS: 1 | US FAERS | |
| 1290 | Onychalgia | FAERS: 1 | US FAERS | |
| 1291 | Onychomycosis | FAERS: 1 | US FAERS | |
| 1292 | Opiates positive | FAERS: 1 | US FAERS | |
| 1293 | Organic brain syndrome | FAERS: 1 | US FAERS | |
| 1294 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 1295 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 1296 | Osteitis | FAERS: 1 | US FAERS | |
| 1297 | Otitis Media | FAERS: 1 | US FAERS | |
| 1298 | Ototoxicity | FAERS: 1 | US FAERS | |
| 1299 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 1300 | Pachymeningitis | FAERS: 1 | US FAERS | |
| 1301 | Page kidney | FAERS: 1 | US FAERS | |
| 1302 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 1303 | Panniculitis | FAERS: 1 | US FAERS | |
| 1304 | Paracentesis | FAERS: 1 | US FAERS | |
| 1305 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1306 | Paranoia | FAERS: 1 | US FAERS | |
| 1307 | Paraparesis | FAERS: 1 | US FAERS | |
| 1308 | Paroxysmal arrhythmia | FAERS: 1 | US FAERS | |
| 1309 | Patellectomy | FAERS: 1 | US FAERS | |
| 1310 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 1311 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1312 | Penile Infection | FAERS: 1 | US FAERS | |
| 1313 | Periarthritis | FAERS: 1 | US FAERS | |
| 1314 | Perineal infection | FAERS: 1 | US FAERS | |
| 1315 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 1316 | Peripheral artery stent insertion | FAERS: 1 | US FAERS | |
| 1317 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 1318 | Peritoneal perforation | FAERS: 1 | US FAERS | |
| 1319 | Phrenic nerve paralysis | FAERS: 1 | US FAERS | |
| 1320 | Piloerection | FAERS: 1 | US FAERS | |
| 1321 | Pituitary enlargement | FAERS: 1 | US FAERS | |
| 1322 | Pleocytosis | FAERS: 1 | US FAERS | |
| 1323 | Pleural Mesothelioma | FAERS: 1 | US FAERS | |
| 1324 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 1325 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 1326 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 1327 | Porokeratosis | FAERS: 1 | US FAERS | |
| 1328 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 1329 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 1330 | Preoperative Care | FAERS: 1 | US FAERS | |
| 1331 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 1332 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1333 | Procedural dizziness | FAERS: 1 | US FAERS | |
| 1334 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 1335 | Procedural shock | FAERS: 1 | US FAERS | |
| 1336 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 1337 | Product administration error | FAERS: 1 | US FAERS | |
| 1338 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 1339 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 1340 | Product friable | FAERS: 1 | US FAERS | |
| 1341 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 1342 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1343 | Product prescribing error | FAERS: 1 | US FAERS | |
| 1344 | Product residue present | FAERS: 1 | US FAERS | |
| 1345 | Product tampering | FAERS: 1 | US FAERS | |
| 1346 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 1347 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 1348 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 1349 | Prosthetic cardiac valve thrombosis | FAERS: 1 | US FAERS | |
| 1350 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 1351 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 1352 | Protein total decreased | FAERS: 1 | US FAERS | |
| 1353 | Prothrombin time ratio increased | FAERS: 1 | US FAERS | |
| 1354 | Pseudoporphyria | FAERS: 1 | US FAERS | |
| 1355 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 1356 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 1357 | Pulmonary renal syndrome | FAERS: 1 | US FAERS | |
| 1358 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 1359 | Pulmonary vein occlusion | FAERS: 1 | US FAERS | |
| 1360 | Pulmonary venous thrombosis | FAERS: 1 | US FAERS | |
| 1361 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1362 | Quadranopia | FAERS: 1 | US FAERS | |
| 1363 | Rales | FAERS: 1 | US FAERS | |
| 1364 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 1365 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1366 | Rectocele | FAERS: 1 | US FAERS | |
| 1367 | Refusal of examination | FAERS: 1 | US FAERS | |
| 1368 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1369 | Renal abscess | FAERS: 1 | US FAERS | |
| 1370 | Renal vasculitis | FAERS: 1 | US FAERS | |
| 1371 | Respiratory Paralysis | FAERS: 1 | US FAERS | |
| 1372 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 1373 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 1374 | Rhinalgia | FAERS: 1 | US FAERS | |
| 1375 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1376 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 1377 | Right hemisphere deficit syndrome | FAERS: 1 | US FAERS | |
| 1378 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 1379 | Sacroiliac fracture | FAERS: 1 | US FAERS | |
| 1380 | Saliva altered | FAERS: 1 | US FAERS | |
| 1381 | Schizophrenia | FAERS: 1 | US FAERS | |
| 1382 | Sciatic Nerve Palsy | FAERS: 1 | US FAERS | |
| 1383 | Screaming | FAERS: 1 | US FAERS | |
| 1384 | Sensory processing disorder | FAERS: 1 | US FAERS | |
| 1385 | Septal panniculitis | FAERS: 1 | US FAERS | |
| 1386 | Serum Sickness | FAERS: 1 | US FAERS | |
| 1387 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 1388 | Sight disability | FAERS: 1 | US FAERS | |
| 1389 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 1390 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 1391 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1392 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1393 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 1394 | Small intestine carcinoma metastatic | FAERS: 1 | US FAERS | |
| 1395 | Sopor | FAERS: 1 | US FAERS | |
| 1396 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 1397 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 1398 | Splenectomy | FAERS: 1 | US FAERS | |
| 1399 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 1400 | Splinter | FAERS: 1 | US FAERS | |
| 1401 | Sputum retention | FAERS: 1 | US FAERS | |
| 1402 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 1403 | Starvation | FAERS: 1 | US FAERS | |
| 1404 | Steroid therapy | FAERS: 1 | US FAERS | |
| 1405 | Strangulated umbilical hernia | FAERS: 1 | US FAERS | |
| 1406 | Streptococcal endocarditis | FAERS: 1 | US FAERS | |
| 1407 | Streptococcal urinary tract infection | FAERS: 1 | US FAERS | |
| 1408 | Stridor | FAERS: 1 | US FAERS | |
| 1409 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 1410 | Subacute endocarditis | FAERS: 1 | US FAERS | |
| 1411 | Subclavian artery occlusion | FAERS: 1 | US FAERS | |
| 1412 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 1413 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 1414 | Sunburn | FAERS: 1 | US FAERS | |
| 1415 | Superinfection viral | FAERS: 1 | US FAERS | |
| 1416 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 1417 | Supraventricular tachyarrhythmia | FAERS: 1 | US FAERS | |
| 1418 | Surgical failure | FAERS: 1 | US FAERS | |
| 1419 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 1420 | Suture rupture | FAERS: 1 | US FAERS | |
| 1421 | Swan ganz catheter placement | FAERS: 1 | US FAERS | |
| 1422 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1423 | Systemic Scleroderma | FAERS: 1 | US FAERS | |
| 1424 | Systemic leakage | FAERS: 1 | US FAERS | |
| 1425 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 1426 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 1427 | Tension | FAERS: 1 | US FAERS | |
| 1428 | Tetany | FAERS: 1 | US FAERS | |
| 1429 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1430 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1431 | Throat cancer | FAERS: 1 | US FAERS | |
| 1432 | Thromboembolectomy | FAERS: 1 | US FAERS | |
| 1433 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1434 | Toe operation | FAERS: 1 | US FAERS | |
| 1435 | Tongue movement disturbance | FAERS: 1 | US FAERS | |
| 1436 | Transfusion related complication | FAERS: 1 | US FAERS | |
| 1437 | Transitional cell carcinoma urethra | FAERS: 1 | US FAERS | |
| 1438 | Transurethral resection syndrome | FAERS: 1 | US FAERS | |
| 1439 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1440 | Trismus | FAERS: 1 | US FAERS | |
| 1441 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1442 | Upper gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 1443 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 1444 | Ureteric compression | FAERS: 1 | US FAERS | |
| 1445 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 1446 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 1447 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 1448 | Urinary tract discomfort | FAERS: 1 | US FAERS | |
| 1449 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 1450 | Urine flow decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1451 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1452 | Vaginal hyperplasia | FAERS: 1 | US FAERS | |
| 1453 | Varicophlebitis | FAERS: 1 | US FAERS | |
| 1454 | Vascular access placement | FAERS: 1 | US FAERS | |
| 1455 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 1456 | Vascular pain | FAERS: 1 | US FAERS | |
| 1457 | Vascular parkinsonism | FAERS: 1 | US FAERS | |
| 1458 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 1459 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 1460 | Vascular stent insertion | FAERS: 1 | US FAERS | |
| 1461 | Vasculitis gastrointestinal | FAERS: 1 | US FAERS | |
| 1462 | Vein pain | FAERS: 1 | US FAERS | |
| 1463 | Venous Injury | FAERS: 1 | US FAERS | |
| 1464 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 1465 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1466 | Venous stenosis | FAERS: 1 | US FAERS | |
| 1467 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 1468 | Verbigeration | FAERS: 1 | US FAERS | |
| 1469 | Vertebral Artery Dissection | FAERS: 1 | US FAERS | |
| 1470 | Vertebral artery thrombosis | FAERS: 1 | US FAERS | |
| 1471 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 1472 | Vessel puncture site reaction | FAERS: 1 | US FAERS | |
| 1473 | Viral test positive | FAERS: 1 | US FAERS | |
| 1474 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1475 | Visual brightness | FAERS: 1 | US FAERS | |
| 1476 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 1477 | Vitamin B12 abnormal | FAERS: 1 | US FAERS | |
| 1478 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 1479 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 1480 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 1481 | Vocal cord cyst | FAERS: 1 | US FAERS | |
| 1482 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1483 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 1484 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1485 | Walking aid user | FAERS: 1 | US FAERS | |
| 1486 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1487 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1488 | White matter lesion | FAERS: 1 | US FAERS | |
| 1489 | Wound decomposition | FAERS: 1 | US FAERS | |
| 1490 | Wound evisceration | FAERS: 1 | US FAERS | |
| 1491 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1492 | Wound sepsis | FAERS: 1 | US FAERS | |
| 1493 | furuncle | FAERS: 1 | US FAERS | |
| 1494 | heart rate | FAERS: 1 | US FAERS | |
| 1495 | prostatitis | FAERS: 1 | US FAERS | |
| 1496 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 1497 | Coagulation factor VIII level increased | Canada Vigilance: 4 | Canada Vigilance | |
| 1498 | Product dose omission | Canada Vigilance: 5 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.