Estrogens, Conjugated (USP)
(VUCAHVBMSFIGAI-ZFINNJDLSA-M)
Structure
- SMILES
- O=C1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)OS(=O)(=O)[O-].[Na+]
- Molecular Formula:
- C18H21NaO5S
- Molecular Weight:
- 372.411
- Log P:
- 4.0316
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 0
- TPSA:
- 91.88
- CAS Number(s):
- 438-67-5
Synonym(s)
1.
Estrogens, Conjugated (USP)
2.
Estrogenic Substances, Conjugated
3.
Carentil
4.
Climarest
5.
Climopax
6.
Congest
7.
Conjugated Equine Estrogens
8.
Conjugated Estrogens
9.
Dagynil
10.
Estro-Feminal
11.
Estrogenic Hormones, Conjugated
12.
Estrogens, Conjugated
13.
Femavit
14.
Oestro-Feminal
15.
Oestrofeminal
16.
Prelestrin
17.
Premarin
18.
Presomen
19.
Progens
20.
Transannon
21.
Conjugated Estrogenic Hormones
22.
Conjugated Estrogenic Substances
23.
Equine Estrogens, Conjugated
24.
Estro Feminal
25.
Oestro Feminal
External Link(s)
| MeSH | D004966 |
| PubChem Compound | 23667301 |
| ChEBI | 8389 |
| CHEMBL | CHEMBL2106240 |
| KEGG | dr:D00312 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 817 Canada Vigilance: 40 | Canada Vigilance US FAERS | |
| 2 | Vulvovaginal burning sensation | FAERS: 244 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Malaise | FAERS: 229 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Thrombosis | FAERS: 214 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Headache | FAERS: 212 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 6 | Cerebrovascular accident | FAERS: 209 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Feeling abnormal | FAERS: 179 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 8 | Product quality issue | FAERS: 178 | US FAERS | |
| 9 | Product use issue | FAERS: 169 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Pain | FAERS: 137 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 11 | Urinary tract infection | FAERS: 137 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Vulvovaginal discomfort | FAERS: 137 | US FAERS | |
| 13 | Vulvovaginal pruritus | FAERS: 120 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Alopecia | FAERS: 110 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Intentional product misuse | FAERS: 109 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Nausea | FAERS: 107 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 17 | Vulvovaginal pain | FAERS: 101 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Myocardial Infarction | FAERS: 100 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Pruritus | FAERS: 96 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | Dizziness | FAERS: 95 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Fatigue | FAERS: 87 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | Burning sensation | FAERS: 84 | US FAERS | |
| 23 | Product use in unapproved indication | FAERS: 80 | US FAERS | |
| 24 | Pulmonary Embolism | FAERS: 79 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 25 | Hypersensitivity | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Anxiety | FAERS: 72 | OFFSIDES US FAERS | |
| 27 | Nervousness | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Night sweats | FAERS: 70 | US FAERS | |
| 29 | Drug ineffective for unapproved indication | FAERS: 62 | US FAERS | |
| 30 | Vulvovaginal mycotic infection | FAERS: 62 | US FAERS | |
| 31 | Therapeutic response unexpected | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Vulvovaginal dryness | FAERS: 60 | US FAERS | |
| 33 | Asthenia | FAERS: 57 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 34 | Drug effect incomplete | FAERS: 57 | US FAERS | |
| 35 | Breast tenderness | FAERS: 52 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 36 | Emotional disorder | FAERS: 52 | US FAERS | |
| 37 | Abdominal Pain | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Back Pain | FAERS: 50 | US FAERS | |
| 39 | Incorrect dose administered | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Memory impairment | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Cystitis | FAERS: 47 | US FAERS | |
| 42 | Chest Pain | FAERS: 46 | OFFSIDES US FAERS | |
| 43 | Deep Vein Thrombosis | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Mood swings | FAERS: 45 | US FAERS | |
| 45 | Nasopharyngitis | FAERS: 45 | US FAERS | |
| 46 | Weight decreased | FAERS: 44 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 47 | Pre-existing condition improved | FAERS: 43 | US FAERS | |
| 48 | Wrong technique in product usage process | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Crying | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Expired product administered | FAERS: 40 | US FAERS | |
| 51 | Application site pain | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 52 | Drug dose omission | FAERS: 39 | US FAERS | |
| 53 | Infection | FAERS: 39 | OFFSIDES US FAERS | |
| 54 | Tremor | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Urticaria | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Vulvovaginal swelling | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Arthritis | FAERS: 37 | US FAERS | |
| 58 | Discomfort | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Hormone level abnormal | FAERS: 35 | US FAERS | |
| 60 | Contralateral breast cancer | FAERS: 34 | OFFSIDES US FAERS | |
| 61 | Swelling | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Breast cancer recurrent | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 63 | Poor quality drug administered | FAERS: 33 | US FAERS | |
| 64 | Stress | FAERS: 33 | US FAERS | |
| 65 | Vaginal Discharge | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Dementia | FAERS: 31 | US FAERS | |
| 67 | Diabetes Mellitus | FAERS: 31 | US FAERS | |
| 68 | Drug withdrawal syndrome | FAERS: 31 | US FAERS | |
| 69 | Dyspareunia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Palpitations | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Arthropathy | FAERS: 29 | US FAERS | |
| 72 | Erythema | FAERS: 28 | US FAERS | |
| 73 | Depressed mood | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Influenza | FAERS: 27 | US FAERS | |
| 75 | Abdominal discomfort | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Amnesia | FAERS: 26 | US FAERS | |
| 77 | Dysuria | FAERS: 26 | US FAERS | |
| 78 | Dry skin | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Visual Impairment | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 80 | Vulvovaginal erythema | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Intentional product use issue | FAERS: 24 | US FAERS | |
| 82 | Osteoporosis | FAERS: 24 | US FAERS | |
| 83 | Suspected counterfeit product | FAERS: 24 | US FAERS | |
| 84 | Pelvic Pain | FAERS: 23 | US FAERS | |
| 85 | Vomiting | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Asthma | FAERS: 21 | OFFSIDES US FAERS | |
| 87 | Inappropriate schedule of drug administration | FAERS: 21 | US FAERS | |
| 88 | Blood cholesterol increased | FAERS: 20 | US FAERS | |
| 89 | Drug effect delayed | FAERS: 20 | US FAERS | |
| 90 | Urinary Incontinence | FAERS: 20 | US FAERS | |
| 91 | Wrong technique in drug usage process | FAERS: 20 | US FAERS | |
| 92 | Uterine Cancer | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 93 | Medication residue | FAERS: 18 | US FAERS | |
| 94 | Pneumonia | FAERS: 18 | US FAERS | |
| 95 | Arthralgia | FAERS: 16 | US FAERS | |
| 96 | Drug dispensing error | FAERS: 16 | US FAERS | |
| 97 | Dyspepsia | FAERS: 16 | OFFSIDES US FAERS | |
| 98 | Joint swelling | FAERS: 16 | US FAERS | |
| 99 | Limb injury | FAERS: 16 | US FAERS | |
| 100 | Anger | FAERS: 15 | US FAERS | |
| 101 | Bladder prolapse | FAERS: 15 | OFFSIDES US FAERS | |
| 102 | Breast Cyst | FAERS: 15 | OFFSIDES US FAERS | |
| 103 | Deafness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 104 | No adverse event | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Skin irritation | FAERS: 15 | US FAERS | |
| 106 | Acne | FAERS: 14 | US FAERS | |
| 107 | Cataract | FAERS: 13 | OFFSIDES US FAERS | |
| 108 | Constipation | FAERS: 13 | US FAERS | |
| 109 | Pharmaceutical product complaint | FAERS: 13 | US FAERS | |
| 110 | Product complaint | FAERS: 13 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 111 | Application site irritation | FAERS: 12 | US FAERS | |
| 112 | Fibromyalgia | FAERS: 12 | US FAERS | |
| 113 | Nipple pain | FAERS: 12 | OFFSIDES US FAERS | |
| 114 | Peripheral swelling | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Agitation | FAERS: 11 | US FAERS | |
| 116 | Chest discomfort | FAERS: 11 | US FAERS | |
| 117 | Chills | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 118 | Contraindicated product administered | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Dysphonia | FAERS: 11 | US FAERS | |
| 120 | Expired drug administered | FAERS: 11 | US FAERS | |
| 121 | Limb discomfort | FAERS: 11 | OFFSIDES US FAERS | |
| 122 | Medication residue present | FAERS: 11 | US FAERS | |
| 123 | Atrophic vulvovaginitis | FAERS: 10 | OFFSIDES US FAERS | |
| 124 | Back disorder | FAERS: 10 | US FAERS | |
| 125 | Blindness | FAERS: 10 | US FAERS | |
| 126 | Circumstance or information capable of leading to medication error | FAERS: 10 | US FAERS | |
| 127 | Drug administered at inappropriate site | FAERS: 10 | US FAERS | |
| 128 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 129 | Feeling Cold | FAERS: 10 | US FAERS | |
| 130 | Feeling jittery | FAERS: 10 | US FAERS | |
| 131 | Flatulence | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Intentional drug misuse | FAERS: 10 | US FAERS | |
| 133 | Malabsorption | FAERS: 10 | US FAERS | |
| 134 | Menorrhagia | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 135 | Metrorrhagia | FAERS: 10 | US FAERS | |
| 136 | Vaginal Prolapse | FAERS: 10 | OFFSIDES US FAERS | |
| 137 | Activities of daily living impaired | FAERS: 9 | US FAERS | |
| 138 | Bone density decreased | FAERS: 9 | US FAERS | |
| 139 | Bronchitis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 140 | Drug effective for unapproved indication | FAERS: 9 | US FAERS | |
| 141 | Exposure via partner | FAERS: 9 | US FAERS | |
| 142 | Frustration | FAERS: 9 | US FAERS | |
| 143 | Impaired driving ability | FAERS: 9 | US FAERS | |
| 144 | Laryngitis | FAERS: 9 | US FAERS | |
| 145 | Muscle tightness | FAERS: 9 | US FAERS | |
| 146 | Product prescribing error | FAERS: 9 | US FAERS | |
| 147 | Rash erythematous | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 148 | Sinusitis | FAERS: 9 | OFFSIDES US FAERS | |
| 149 | Tinnitus | FAERS: 9 | OFFSIDES US FAERS | |
| 150 | Unevaluable event | FAERS: 9 | US FAERS | |
| 151 | Vaginal erosion | FAERS: 9 | US FAERS | |
| 152 | Vulvovaginal rash | FAERS: 9 | US FAERS | |
| 153 | nervous system disorder | FAERS: 9 | US FAERS | |
| 154 | Accidental exposure | FAERS: 8 | US FAERS | |
| 155 | Adenocarcinoma | FAERS: 8 | OFFSIDES US FAERS | |
| 156 | Blood glucose increased | FAERS: 8 | US FAERS | |
| 157 | Bone pain | FAERS: 8 | US FAERS | |
| 158 | Drug administration error | FAERS: 8 | US FAERS | |
| 159 | Endometriosis | FAERS: 8 | US FAERS | |
| 160 | Joint injury | FAERS: 8 | OFFSIDES US FAERS | |
| 161 | Middle insomnia | FAERS: 8 | US FAERS | |
| 162 | Myalgia | FAERS: 8 | US FAERS | |
| 163 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 164 | Reaction to drug excipients | FAERS: 8 | US FAERS | |
| 165 | Vaginal mucosal blistering | FAERS: 8 | US FAERS | |
| 166 | Wheezing | FAERS: 8 | US FAERS | |
| 167 | Adnexa uteri pain | FAERS: 7 | US FAERS | |
| 168 | Application site discomfort | FAERS: 7 | US FAERS | |
| 169 | Application site erythema | FAERS: 7 | US FAERS | |
| 170 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 171 | Cholelithiasis | FAERS: 7 | US FAERS | |
| 172 | Dysgeusia | FAERS: 7 | US FAERS | |
| 173 | Flushing | FAERS: 7 | US FAERS | |
| 174 | Medication Error | FAERS: 7 | US FAERS | |
| 175 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 176 | Nonspecific reaction | FAERS: 7 | OFFSIDES US FAERS | |
| 177 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 178 | Precocious Puberty | FAERS: 7 | US FAERS | |
| 179 | Product dispensing error | FAERS: 7 | US FAERS | |
| 180 | Product dose omission | FAERS: 7 | US FAERS | |
| 181 | Product physical issue | FAERS: 7 | US FAERS | |
| 182 | Rheumatoid Arthritis | FAERS: 7 | US FAERS | |
| 183 | Somnolence | FAERS: 7 | US FAERS | |
| 184 | Tachycardia | FAERS: 7 | US FAERS | |
| 185 | Uterine spasm | FAERS: 7 | US FAERS | |
| 186 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 187 | Application site swelling | FAERS: 6 | US FAERS | |
| 188 | Blood urine present | FAERS: 6 | US FAERS | |
| 189 | Coronary Artery Disease | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Drug Dependence | FAERS: 6 | US FAERS | |
| 191 | Endometrial Hyperplasia | FAERS: 6 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 192 | General physical health deterioration | FAERS: 6 | US FAERS | |
| 193 | Glaucoma | FAERS: 6 | US FAERS | |
| 194 | Head discomfort | FAERS: 6 | US FAERS | |
| 195 | Hypothyroidism | FAERS: 6 | US FAERS | |
| 196 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 197 | Meningioma | FAERS: 6 | US FAERS | |
| 198 | Metastatic Neoplasm | FAERS: 6 | US FAERS | |
| 199 | Sexual Dysfunction | FAERS: 6 | US FAERS | |
| 200 | Skin lesion | FAERS: 6 | US FAERS | |
| 201 | Syncope | FAERS: 6 | US FAERS | |
| 202 | Therapeutic response changed | FAERS: 6 | US FAERS | |
| 203 | Throat irritation | FAERS: 6 | US FAERS | |
| 204 | furuncle | FAERS: 6 | US FAERS | |
| 205 | Aneurysm | FAERS: 5 | OFFSIDES US FAERS | |
| 206 | Anorectal discomfort | FAERS: 5 | US FAERS | |
| 207 | Aphonia | FAERS: 5 | US FAERS | |
| 208 | Bacterial Vaginosis | FAERS: 5 | US FAERS | |
| 209 | Blood cholesterol abnormal | FAERS: 5 | US FAERS | |
| 210 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 211 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 212 | Cerebral Thrombosis | FAERS: 5 | US FAERS | |
| 213 | Chromaturia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Cold sweat | FAERS: 5 | US FAERS | |
| 215 | Colitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 216 | Disorientation | FAERS: 5 | US FAERS | |
| 217 | Drug administered to patient of inappropriate age | FAERS: 5 | US FAERS | |
| 218 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 219 | Hirsutism | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Hysterectomy | FAERS: 5 | OFFSIDES US FAERS | |
| 221 | Inflammation | FAERS: 5 | US FAERS | |
| 222 | Intervertebral Disc Degeneration | FAERS: 5 | OFFSIDES US FAERS | |
| 223 | Irritable Bowel Syndrome | FAERS: 5 | US FAERS | |
| 224 | Lethargy | FAERS: 5 | US FAERS | |
| 225 | Macular degeneration | FAERS: 5 | US FAERS | |
| 226 | Menopause | FAERS: 5 | US FAERS | |
| 227 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 228 | Musculoskeletal discomfort | FAERS: 5 | US FAERS | |
| 229 | Nephrolithiasis | FAERS: 5 | US FAERS | |
| 230 | Overdose | FAERS: 5 | US FAERS | |
| 231 | Pelvic prolapse | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 232 | Precancerous skin lesion | FAERS: 5 | OFFSIDES US FAERS | |
| 233 | Presyncope | FAERS: 5 | US FAERS | |
| 234 | Product contamination | FAERS: 5 | US FAERS | |
| 235 | Restlessness | FAERS: 5 | US FAERS | |
| 236 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 237 | Ulcer | FAERS: 5 | US FAERS | |
| 238 | Urinary Retention | FAERS: 5 | US FAERS | |
| 239 | Vertigo | FAERS: 5 | US FAERS | |
| 240 | jaundice | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Abasia | FAERS: 4 | US FAERS | |
| 242 | Application site hypersensitivity | FAERS: 4 | US FAERS | |
| 243 | Application site pruritus | FAERS: 4 | US FAERS | |
| 244 | Bacterial vulvovaginitis | FAERS: 4 | US FAERS | |
| 245 | Bipolar Disorder | FAERS: 4 | US FAERS | |
| 246 | Bladder pain | FAERS: 4 | US FAERS | |
| 247 | Blood testosterone abnormal | FAERS: 4 | US FAERS | |
| 248 | Breast cancer stage II | FAERS: 4 | US FAERS | |
| 249 | Cells in urine | FAERS: 4 | US FAERS | |
| 250 | Cyst | FAERS: 4 | US FAERS | |
| 251 | Dehydration | FAERS: 4 | OFFSIDES US FAERS | |
| 252 | Disease Progression | FAERS: 4 | US FAERS | |
| 253 | Disease recurrence | FAERS: 4 | US FAERS | |
| 254 | Eczema | FAERS: 4 | US FAERS | |
| 255 | Endometrial hypertrophy | FAERS: 4 | US FAERS | |
| 256 | Epilepsy | FAERS: 4 | US FAERS | |
| 257 | Food Allergy | FAERS: 4 | US FAERS | |
| 258 | Fracture | FAERS: 4 | US FAERS | |
| 259 | Genital burning sensation | FAERS: 4 | US FAERS | |
| 260 | Hyperthyroidism | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Incontinence | FAERS: 4 | OFFSIDES US FAERS | |
| 262 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 263 | Malabsorption from application site | FAERS: 4 | US FAERS | |
| 264 | Mental impairment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Multiple Sclerosis | FAERS: 4 | OFFSIDES US FAERS | |
| 266 | Obsessive-Compulsive Disorder | FAERS: 4 | US FAERS | |
| 267 | Onychoclasis | FAERS: 4 | US FAERS | |
| 268 | Pancreatitis | FAERS: 4 | US FAERS | |
| 269 | Phlebitis | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 270 | Post procedural complication | FAERS: 4 | OFFSIDES US FAERS | |
| 271 | Precancerous cells present | FAERS: 4 | US FAERS | |
| 272 | Product counterfeit | FAERS: 4 | US FAERS | |
| 273 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 274 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 275 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 276 | Sepsis | FAERS: 4 | US FAERS | |
| 277 | Thermal burn | FAERS: 4 | US FAERS | |
| 278 | Underweight | FAERS: 4 | US FAERS | |
| 279 | Uterine Prolapse | FAERS: 4 | OFFSIDES US FAERS | |
| 280 | Vaginal lesion | FAERS: 4 | US FAERS | |
| 281 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 282 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 283 | Bacterial test positive | FAERS: 3 | OFFSIDES US FAERS | |
| 284 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 285 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 286 | Breast cancer stage III | FAERS: 3 | OFFSIDES US FAERS | |
| 287 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 288 | Carotid Artery Thrombosis | FAERS: 3 | OFFSIDES US FAERS | |
| 289 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 290 | Chloasma | FAERS: 3 | US FAERS | |
| 291 | Diplopia | FAERS: 3 | OFFSIDES US FAERS | |
| 292 | Diverticulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 293 | Dysgraphia | FAERS: 3 | US FAERS | |
| 294 | Endometrial disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 295 | Epistaxis | FAERS: 3 | US FAERS | |
| 296 | Eructation | FAERS: 3 | US FAERS | |
| 297 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 298 | Eye pain | FAERS: 3 | US FAERS | |
| 299 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 300 | Formication | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 301 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 302 | Gastritis | FAERS: 3 | US FAERS | |
| 303 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 304 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 305 | Genital swelling | FAERS: 3 | US FAERS | |
| 306 | Impaired work ability | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 308 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 309 | Intercepted drug dispensing error | FAERS: 3 | US FAERS | |
| 310 | Invasive Ductal Breast Carcinoma | FAERS: 3 | US FAERS | |
| 311 | Joint stiffness | FAERS: 3 | US FAERS | |
| 312 | Labyrinthitis | FAERS: 3 | US FAERS | |
| 313 | Lipids abnormal | FAERS: 3 | US FAERS | |
| 314 | Loss of personal independence in daily activities | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Meniscus injury | FAERS: 3 | US FAERS | |
| 316 | Metastasis | FAERS: 3 | US FAERS | |
| 317 | Muscle strain | FAERS: 3 | US FAERS | |
| 318 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 319 | Neck Pain | FAERS: 3 | US FAERS | |
| 320 | Nocturia | FAERS: 3 | OFFSIDES US FAERS | |
| 321 | Osteopenia | FAERS: 3 | OFFSIDES US FAERS | |
| 322 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 323 | Polyarthritis | FAERS: 3 | US FAERS | |
| 324 | Post-Traumatic Stress Disorder | FAERS: 3 | US FAERS | |
| 325 | Premenstrual syndrome | FAERS: 3 | US FAERS | |
| 326 | Product packaging issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Product prescribing issue | FAERS: 3 | US FAERS | |
| 328 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 329 | Radiation injury | FAERS: 3 | US FAERS | |
| 330 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 331 | Sciatica | FAERS: 3 | US FAERS | |
| 332 | Scleroderma | FAERS: 3 | OFFSIDES US FAERS | |
| 333 | Sexual relationship change | FAERS: 3 | US FAERS | |
| 334 | Shock | FAERS: 3 | US FAERS | |
| 335 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 336 | Skin Wrinkling | FAERS: 3 | US FAERS | |
| 337 | Sneezing | FAERS: 3 | US FAERS | |
| 338 | Spinal column stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 339 | Stomatitis | FAERS: 3 | US FAERS | |
| 340 | Therapeutic product effect incomplete | FAERS: 3 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 341 | Thrombotic stroke | FAERS: 3 | US FAERS | |
| 342 | Uterine inflammation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 343 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 344 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 345 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 346 | Abdominal wound dehiscence | FAERS: 2 | US FAERS | |
| 347 | Acoustic Neuroma | FAERS: 2 | OFFSIDES US FAERS | |
| 348 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 349 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 350 | Antinuclear antibody increased | FAERS: 2 | US FAERS | |
| 351 | Aphasia | FAERS: 2 | US FAERS | |
| 352 | Apparent death | FAERS: 2 | US FAERS | |
| 353 | Application site rash | FAERS: 2 | US FAERS | |
| 354 | Application site reaction | FAERS: 2 | US FAERS | |
| 355 | Bedridden | FAERS: 2 | US FAERS | |
| 356 | Blood potassium decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 357 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 358 | Breast discomfort | FAERS: 2 | US FAERS | |
| 359 | Breast fibroma | FAERS: 2 | US FAERS | |
| 360 | Breast hyperplasia | FAERS: 2 | OFFSIDES US FAERS | |
| 361 | Carcinoma | FAERS: 2 | US FAERS | |
| 362 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 363 | Cervical dysplasia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 364 | Cheilitis | FAERS: 2 | US FAERS | |
| 365 | Choking | FAERS: 2 | US FAERS | |
| 366 | Chorea | FAERS: 2 | US FAERS | |
| 367 | Citrobacter infection | FAERS: 2 | US FAERS | |
| 368 | Coital bleeding | FAERS: 2 | US FAERS | |
| 369 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 370 | Dissociation | FAERS: 2 | US FAERS | |
| 371 | Dissociative Amnesia | FAERS: 2 | US FAERS | |
| 372 | Ear discomfort | FAERS: 2 | US FAERS | |
| 373 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 374 | Emotional distress | FAERS: 2 | US FAERS | |
| 375 | Excoriation | FAERS: 2 | OFFSIDES US FAERS | |
| 376 | Extra dose administered | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Eye irritation | FAERS: 2 | US FAERS | |
| 378 | Gait inability | FAERS: 2 | US FAERS | |
| 379 | Genital rash | FAERS: 2 | OFFSIDES US FAERS | |
| 380 | Hemiparesis | FAERS: 2 | US FAERS | |
| 381 | Hepatitis | FAERS: 2 | US FAERS | |
| 382 | Hernia | FAERS: 2 | US FAERS | |
| 383 | Hostility | FAERS: 2 | US FAERS | |
| 384 | Hydrocephalus | FAERS: 2 | OFFSIDES US FAERS | |
| 385 | Hypersomnia | FAERS: 2 | US FAERS | |
| 386 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 387 | Hypothalamo-pituitary disorder | FAERS: 2 | US FAERS | |
| 388 | Ileus | FAERS: 2 | US FAERS | |
| 389 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 390 | Intestinal cyst | FAERS: 2 | US FAERS | |
| 391 | Lip swelling | FAERS: 2 | US FAERS | |
| 392 | Lipoma | FAERS: 2 | US FAERS | |
| 393 | Lyme Disease | FAERS: 2 | US FAERS | |
| 394 | Lymphangioleiomyomatosis | FAERS: 2 | US FAERS | |
| 395 | Lymphoma | FAERS: 2 | US FAERS | |
| 396 | Malnutrition | FAERS: 2 | US FAERS | |
| 397 | Mastitis | FAERS: 2 | US FAERS | |
| 398 | Metastatic uterine cancer | FAERS: 2 | US FAERS | |
| 399 | Micturition frequency decreased | FAERS: 2 | US FAERS | |
| 400 | Migraine with Aura | FAERS: 2 | OFFSIDES US FAERS | |
| 401 | Monoplegia | FAERS: 2 | US FAERS | |
| 402 | Multiple allergies | FAERS: 2 | US FAERS | |
| 403 | Muscle Cramp | FAERS: 2 | US FAERS | |
| 404 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 405 | Musculoskeletal chest pain | FAERS: 2 | OFFSIDES US FAERS | |
| 406 | Neuralgia | FAERS: 2 | US FAERS | |
| 407 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 408 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 409 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 410 | Osteomyelitis | FAERS: 2 | OFFSIDES US FAERS | |
| 411 | Paranoia | FAERS: 2 | US FAERS | |
| 412 | Penile burning sensation | FAERS: 2 | US FAERS | |
| 413 | Personality Change | FAERS: 2 | US FAERS | |
| 414 | Pertussis | FAERS: 2 | US FAERS | |
| 415 | Petechiae | FAERS: 2 | US FAERS | |
| 416 | Pharmaceutical product counterfeit | FAERS: 2 | US FAERS | |
| 417 | Photophobia | FAERS: 2 | US FAERS | |
| 418 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 419 | Product leakage | FAERS: 2 | US FAERS | |
| 420 | Product physical consistency issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 421 | Product preparation error | FAERS: 2 | US FAERS | |
| 422 | Psoriasis | FAERS: 2 | US FAERS | |
| 423 | Pulmonary Hypertension | FAERS: 2 | OFFSIDES US FAERS | |
| 424 | Pyelocaliectasis | FAERS: 2 | US FAERS | |
| 425 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 426 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 427 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 428 | Scab | FAERS: 2 | US FAERS | |
| 429 | Screaming | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 430 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 431 | Sinus headache | FAERS: 2 | OFFSIDES US FAERS | |
| 432 | Skin Erosion | FAERS: 2 | OFFSIDES US FAERS | |
| 433 | Skin reaction | FAERS: 2 | US FAERS | |
| 434 | Skin test positive | FAERS: 2 | US FAERS | |
| 435 | Sluggishness | FAERS: 2 | US FAERS | |
| 436 | Splenomegaly | FAERS: 2 | US FAERS | |
| 437 | Sunburn | FAERS: 2 | US FAERS | |
| 438 | Tension Headache | FAERS: 2 | OFFSIDES US FAERS | |
| 439 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 440 | Tissue injury | FAERS: 2 | US FAERS | |
| 441 | Toothache | FAERS: 2 | US FAERS | |
| 442 | Trichorrhexis | FAERS: 2 | OFFSIDES US FAERS | |
| 443 | Triple vessel bypass graft | FAERS: 2 | US FAERS | |
| 444 | Tuberculosis | FAERS: 2 | US FAERS | |
| 445 | Urethritis | FAERS: 2 | US FAERS | |
| 446 | Urinary tract infection fungal | FAERS: 2 | US FAERS | |
| 447 | Urinary tract inflammation | FAERS: 2 | US FAERS | |
| 448 | Vaginal burning sensation | FAERS: 2 | US FAERS | |
| 449 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 450 | Vulvovaginal injury | FAERS: 2 | US FAERS | |
| 451 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 452 | Wound Complication | FAERS: 2 | US FAERS | |
| 453 | fibroma | FAERS: 2 | OFFSIDES US FAERS | |
| 454 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 455 | Accidental overdose | FAERS: 1 | US FAERS | |
| 456 | Acquired cardiac septal defect | FAERS: 1 | US FAERS | |
| 457 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 458 | Adenoid Cystic Carcinoma | FAERS: 1 | US FAERS | |
| 459 | Adrenocortical insufficiency chronic | FAERS: 1 | US FAERS | |
| 460 | Adverse event | FAERS: 1 | US FAERS | |
| 461 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 462 | Ammonia increased | FAERS: 1 | OFFSIDES US FAERS | |
| 463 | Anal inflammation | FAERS: 1 | US FAERS | |
| 464 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 465 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 466 | Anhedonia | FAERS: 1 | US FAERS | |
| 467 | Anhidrosis | FAERS: 1 | US FAERS | |
| 468 | Anorgasmia | FAERS: 1 | US FAERS | |
| 469 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 470 | Antiphospholipid antibodies positive | FAERS: 1 | OFFSIDES US FAERS | |
| 471 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 472 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 473 | Apathy | FAERS: 1 | US FAERS | |
| 474 | Appendicitis | FAERS: 1 | US FAERS | |
| 475 | Application site dryness | FAERS: 1 | US FAERS | |
| 476 | Application site erosion | FAERS: 1 | US FAERS | |
| 477 | Arteriosclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 478 | Arthropod bite | FAERS: 1 | US FAERS | |
| 479 | Arthropod sting | FAERS: 1 | US FAERS | |
| 480 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 481 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 482 | Benign female reproductive tract neoplasm | FAERS: 1 | US FAERS | |
| 483 | Bile output increased | FAERS: 1 | US FAERS | |
| 484 | Biopsy endometrium abnormal | FAERS: 1 | US FAERS | |
| 485 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 486 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 487 | Bladder neck obstruction | FAERS: 1 | US FAERS | |
| 488 | Bladder spasm | FAERS: 1 | US FAERS | |
| 489 | Blood albumin decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 490 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 491 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 492 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 493 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 494 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 495 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 496 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 497 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 498 | Bone scan abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 499 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 500 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 501 | Breast Microcalcification | FAERS: 1 | OFFSIDES US FAERS | |
| 502 | Breast engorgement | FAERS: 1 | US FAERS | |
| 503 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 504 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 505 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 506 | Cardiac Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 507 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 508 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 509 | Cartilage injury | FAERS: 1 | US FAERS | |
| 510 | Cerebral aneurysm perforation | FAERS: 1 | US FAERS | |
| 511 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 512 | Chemical injury | FAERS: 1 | US FAERS | |
| 513 | Chloropsia | FAERS: 1 | US FAERS | |
| 514 | Choking sensation | FAERS: 1 | US FAERS | |
| 515 | Cholecystitis | FAERS: 1 | US FAERS | |
| 516 | Cholestasis | FAERS: 1 | US FAERS | |
| 517 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 518 | Colon adenoma | FAERS: 1 | OFFSIDES US FAERS | |
| 519 | Colostomy infection | FAERS: 1 | US FAERS | |
| 520 | Compression fracture | FAERS: 1 | US FAERS | |
| 521 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 522 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 523 | Conversion disorder | FAERS: 1 | US FAERS | |
| 524 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 525 | Cystitis escherichia | FAERS: 1 | US FAERS | |
| 526 | Cystitis-like symptom | FAERS: 1 | US FAERS | |
| 527 | Cystocele | FAERS: 1 | OFFSIDES US FAERS | |
| 528 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 529 | Degeneration of uterine fibroid | FAERS: 1 | US FAERS | |
| 530 | Dependence | FAERS: 1 | US FAERS | |
| 531 | Dermal absorption impaired | FAERS: 1 | US FAERS | |
| 532 | Device breakage | FAERS: 1 | US FAERS | |
| 533 | Disability | FAERS: 1 | US FAERS | |
| 534 | Drug effect variable | FAERS: 1 | US FAERS | |
| 535 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 536 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 537 | Dysarthria | FAERS: 1 | US FAERS | |
| 538 | Dystonia | FAERS: 1 | OFFSIDES US FAERS | |
| 539 | Economic problem | FAERS: 1 | OFFSIDES US FAERS | |
| 540 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 541 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 542 | Endometrial adenocarcinoma | FAERS: 1 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 543 | Endometrial cancer stage III | FAERS: 1 | US FAERS | |
| 544 | Endometrial thickening | FAERS: 1 | US FAERS | |
| 545 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 546 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 547 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 548 | Escherichia infection | FAERS: 1 | OFFSIDES US FAERS | |
| 549 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 550 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 551 | Euphoric mood | FAERS: 1 | OFFSIDES US FAERS | |
| 552 | Extravasation | FAERS: 1 | US FAERS | |
| 553 | Eye Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 554 | Eye inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 555 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 556 | False positive investigation result | FAERS: 1 | US FAERS | |
| 557 | Flank Pain | FAERS: 1 | US FAERS | |
| 558 | Food craving | FAERS: 1 | US FAERS | |
| 559 | Gastroenteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 560 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 561 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 562 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 563 | Genital erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 564 | Genital tract inflammation | FAERS: 1 | US FAERS | |
| 565 | Glioma | FAERS: 1 | US FAERS | |
| 566 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 567 | Growth failure | FAERS: 1 | US FAERS | |
| 568 | Head titubation | FAERS: 1 | US FAERS | |
| 569 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 570 | Heat Stroke | FAERS: 1 | OFFSIDES US FAERS | |
| 571 | Hemiplegia | FAERS: 1 | US FAERS | |
| 572 | Hepatitis B | FAERS: 1 | US FAERS | |
| 573 | Hepatitis C | FAERS: 1 | OFFSIDES US FAERS | |
| 574 | Hepatomegaly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 576 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 577 | Hydrometra | FAERS: 1 | US FAERS | |
| 578 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 579 | Hyperphagia | FAERS: 1 | US FAERS | |
| 580 | Hyperplasia | FAERS: 1 | US FAERS | |
| 581 | Hyperventilation | FAERS: 1 | US FAERS | |
| 582 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 583 | Implant site reaction | FAERS: 1 | OFFSIDES US FAERS | |
| 584 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 585 | Incision site complication | FAERS: 1 | US FAERS | |
| 586 | Incision site pruritus | FAERS: 1 | US FAERS | |
| 587 | Incisional hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 588 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 589 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 590 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 591 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 592 | Induration | FAERS: 1 | US FAERS | |
| 593 | Infarction | FAERS: 1 | US FAERS | |
| 594 | Infected varicose vein | FAERS: 1 | US FAERS | |
| 595 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 596 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 597 | Insulin-like growth factor decreased | FAERS: 1 | US FAERS | |
| 598 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 599 | Intermittent Claudication | FAERS: 1 | OFFSIDES US FAERS | |
| 600 | Intervertebral disc disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 601 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 602 | Joint prosthesis user | FAERS: 1 | US FAERS | |
| 603 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 604 | Lactose Intolerance | FAERS: 1 | OFFSIDES US FAERS | |
| 605 | Laziness | FAERS: 1 | US FAERS | |
| 606 | Lichen Planus | FAERS: 1 | OFFSIDES US FAERS | |
| 607 | Ligament pain | FAERS: 1 | US FAERS | |
| 608 | Ligament rupture | FAERS: 1 | US FAERS | |
| 609 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 610 | Lipoma of breast | FAERS: 1 | OFFSIDES US FAERS | |
| 611 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 612 | Lymphocele | FAERS: 1 | US FAERS | |
| 613 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 614 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 615 | Mastectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 616 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 617 | Meningitis | FAERS: 1 | US FAERS | |
| 618 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 619 | Mental status changes | FAERS: 1 | OFFSIDES US FAERS | |
| 620 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 621 | Metastases to muscle | FAERS: 1 | OFFSIDES US FAERS | |
| 622 | Metastases to perineum | FAERS: 1 | US FAERS | |
| 623 | Miliaria | FAERS: 1 | US FAERS | |
| 624 | Mouth swelling | FAERS: 1 | US FAERS | |
| 625 | Moyamoya Disease | FAERS: 1 | US FAERS | |
| 626 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 627 | Mutism | FAERS: 1 | US FAERS | |
| 628 | Nephritis | FAERS: 1 | US FAERS | |
| 629 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 630 | Nerve injury | FAERS: 1 | US FAERS | |
| 631 | Neutropenia | FAERS: 1 | US FAERS | |
| 632 | Obesity | FAERS: 1 | US FAERS | |
| 633 | Ocular icterus | FAERS: 1 | OFFSIDES US FAERS | |
| 634 | Oral mucosal erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 635 | Oral pain | FAERS: 1 | US FAERS | |
| 636 | Oral pruritus | FAERS: 1 | OFFSIDES US FAERS | |
| 637 | Orgasmic sensation decreased | FAERS: 1 | US FAERS | |
| 638 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 639 | Oropharyngeal plaque | FAERS: 1 | OFFSIDES US FAERS | |
| 640 | Orthostatic tremor | FAERS: 1 | US FAERS | |
| 641 | Osteitis Deformans | FAERS: 1 | OFFSIDES US FAERS | |
| 642 | Otosclerosis | FAERS: 1 | US FAERS | |
| 643 | Overweight | FAERS: 1 | US FAERS | |
| 644 | PO2 decreased | FAERS: 1 | US FAERS | |
| 645 | Pallor | FAERS: 1 | US FAERS | |
| 646 | Panic Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 647 | Papule | FAERS: 1 | US FAERS | |
| 648 | Paraesthesia of genital female | FAERS: 1 | US FAERS | |
| 649 | Paranoid Personality Disorder | FAERS: 1 | US FAERS | |
| 650 | Pelvic Floor Muscle Weakness | FAERS: 1 | US FAERS | |
| 651 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 652 | Penile size reduced | FAERS: 1 | US FAERS | |
| 653 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 654 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 655 | Persistent genital arousal disorder | FAERS: 1 | US FAERS | |
| 656 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 657 | Piloerection | FAERS: 1 | US FAERS | |
| 658 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 659 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 660 | Porphyria non-acute | FAERS: 1 | OFFSIDES US FAERS | |
| 661 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 662 | Positron emission tomogram abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 663 | Prehypertension | FAERS: 1 | US FAERS | |
| 664 | Premature Menopause | FAERS: 1 | US FAERS | |
| 665 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 666 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 667 | Procedural complication | FAERS: 1 | US FAERS | |
| 668 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 669 | Product container issue | FAERS: 1 | US FAERS | |
| 670 | Product container seal issue | FAERS: 1 | US FAERS | |
| 671 | Product contamination physical | FAERS: 1 | US FAERS | |
| 672 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 673 | Product formulation issue | FAERS: 1 | US FAERS | |
| 674 | Product label confusion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 675 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 676 | Product residue present | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 677 | Product selection error | FAERS: 1 | US FAERS | |
| 678 | Product shape issue | FAERS: 1 | US FAERS | |
| 679 | Product size issue | FAERS: 1 | US FAERS | |
| 680 | Protein urine present | FAERS: 1 | US FAERS | |
| 681 | Pubic pain | FAERS: 1 | US FAERS | |
| 682 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 683 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 684 | Pulmonary congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 685 | Pyuria | FAERS: 1 | OFFSIDES US FAERS | |
| 686 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 687 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 688 | Rectal Prolapse | FAERS: 1 | OFFSIDES US FAERS | |
| 689 | Rectal injury | FAERS: 1 | US FAERS | |
| 690 | Rectocele | FAERS: 1 | OFFSIDES US FAERS | |
| 691 | Rectosigmoid cancer | FAERS: 1 | US FAERS | |
| 692 | Renal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 693 | Renal pain | FAERS: 1 | US FAERS | |
| 694 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 695 | Renin increased | FAERS: 1 | US FAERS | |
| 696 | Respiratory Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 697 | Retinoblastoma | FAERS: 1 | US FAERS | |
| 698 | Rhinitis | FAERS: 1 | US FAERS | |
| 699 | SLE arthritis | FAERS: 1 | US FAERS | |
| 700 | Sarcoma | FAERS: 1 | US FAERS | |
| 701 | Schizophrenia | FAERS: 1 | US FAERS | |
| 702 | Secretion discharge | FAERS: 1 | US FAERS | |
| 703 | Sensitive skin | FAERS: 1 | US FAERS | |
| 704 | Sensory processing disorder | FAERS: 1 | US FAERS | |
| 705 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 706 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 707 | Skin tightness | FAERS: 1 | US FAERS | |
| 708 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 709 | Soliloquy | FAERS: 1 | US FAERS | |
| 710 | Strabismus | FAERS: 1 | US FAERS | |
| 711 | Streptococcal urinary tract infection | FAERS: 1 | US FAERS | |
| 712 | Struck by lightning | FAERS: 1 | US FAERS | |
| 713 | Stupor | FAERS: 1 | US FAERS | |
| 714 | Sudden death | FAERS: 1 | US FAERS | |
| 715 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 716 | Supraventricular tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 717 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 718 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 719 | Therapy cessation | FAERS: 1 | US FAERS | |
| 720 | Thirst | FAERS: 1 | US FAERS | |
| 721 | Throat cancer | FAERS: 1 | US FAERS | |
| 722 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 723 | Toe operation | FAERS: 1 | US FAERS | |
| 724 | Tonsillitis | FAERS: 1 | US FAERS | |
| 725 | Tooth Loss | FAERS: 1 | OFFSIDES US FAERS | |
| 726 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 727 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 728 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 729 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 730 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 731 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 732 | Urinary tract infection staphylococcal | FAERS: 1 | US FAERS | |
| 733 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 734 | Urine output increased | FAERS: 1 | US FAERS | |
| 735 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 736 | Vaginal cancer recurrent | FAERS: 1 | US FAERS | |
| 737 | Vaginal exfoliation | FAERS: 1 | US FAERS | |
| 738 | Vaginal pH abnormal | FAERS: 1 | US FAERS | |
| 739 | Vaginal pain | FAERS: 1 | US FAERS | |
| 740 | Vascular calcification | FAERS: 1 | US FAERS | |
| 741 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 742 | Vascular pain | FAERS: 1 | US FAERS | |
| 743 | Vascular rupture | FAERS: 1 | US FAERS | |
| 744 | Vasospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 745 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 746 | Visual disturbance | FAERS: 1 | US FAERS | |
| 747 | Vocal Cord Paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 748 | Vulvitis | FAERS: 1 | OFFSIDES US FAERS | |
| 749 | Vulvovaginal warts | FAERS: 1 | US FAERS | |
| 750 | Wound dehiscence | FAERS: 1 | OFFSIDES US FAERS | |
| 751 | Wrong dose | FAERS: 1 | US FAERS | |
| 752 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 753 | muscle injury | FAERS: 1 | US FAERS | |
| 754 | Abdominal adhesions | OFFSIDES | ||
| 755 | Abnormal cervical smear | OFFSIDES | ||
| 756 | Acid reflux | OFFSIDES | ||
| 757 | Acquired porphyria | OFFSIDES | ||
| 758 | Actinic keratosis | OFFSIDES | ||
| 759 | Actinomycosis | OFFSIDES | ||
| 760 | Acute bronchitis | OFFSIDES | ||
| 761 | Acute otitis media | OFFSIDES | ||
| 762 | Adenitis | OFFSIDES | ||
| 763 | Adenoma | OFFSIDES | ||
| 764 | Adrenal mass | OFFSIDES | ||
| 765 | Alopecia effluvium | OFFSIDES | ||
| 766 | Alveolitis | OFFSIDES | ||
| 767 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 768 | Anti-thyroid antibody positive | OFFSIDES | ||
| 769 | Aortic valve sclerosis | OFFSIDES | ||
| 770 | Arachnoiditis | OFFSIDES | ||
| 771 | Arterial thrombosis | OFFSIDES | ||
| 772 | Arteriogram coronary abnormal | OFFSIDES | ||
| 773 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 774 | Arteritis | OFFSIDES | ||
| 775 | Artificial crown procedure | OFFSIDES | ||
| 776 | Aspiration Pneumonia | OFFSIDES | ||
| 777 | Asterixis | OFFSIDES | ||
| 778 | Astrocytoma | OFFSIDES | ||
| 779 | Ataxia | OFFSIDES | ||
| 780 | Atelectasis | OFFSIDES | ||
| 781 | Atherosclerosis | OFFSIDES | ||
| 782 | Athetosis | OFFSIDES | ||
| 783 | Atrial Flutter | OFFSIDES | ||
| 784 | Atrial tachycardia | OFFSIDES | ||
| 785 | Avascular necrosis | OFFSIDES | ||
| 786 | B-cell lymphoma stage II | OFFSIDES | ||
| 787 | Bacterial disease carrier | OFFSIDES | ||
| 788 | Bacterial sepsis | OFFSIDES | ||
| 789 | Band neutrophil percentage increased | OFFSIDES | ||
| 790 | Basal cell carcinoma | OFFSIDES | ||
| 791 | Benign Neoplasm | OFFSIDES | ||
| 792 | Biliary adenoma | OFFSIDES | ||
| 793 | Biliary cirrhosis | Canada Vigilance: 1 | Canada Vigilance | |
| 794 | Bilirubin conjugated increased | OFFSIDES | ||
| 795 | Bilirubinuria | OFFSIDES | ||
| 796 | Biopsy bone abnormal | OFFSIDES | ||
| 797 | Biopsy breast abnormal | OFFSIDES | ||
| 798 | Biopsy breast normal | OFFSIDES | ||
| 799 | Biopsy gingival | OFFSIDES | ||
| 800 | Biopsy lymph gland abnormal | OFFSIDES | ||
| 801 | Bladder calculus removal | OFFSIDES | ||
| 802 | Bladder cancer recurrent | OFFSIDES | ||
| 803 | Blood amylase decreased | OFFSIDES | ||
| 804 | Blood calcium abnormal | OFFSIDES | ||
| 805 | Blood chloride increased | OFFSIDES | ||
| 806 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 807 | Blood electrolytes abnormal | OFFSIDES | ||
| 808 | Blood fibrinogen | OFFSIDES | ||
| 809 | Blood glucose decreased | OFFSIDES | ||
| 810 | Blood insulin | OFFSIDES | ||
| 811 | Blood ketone body | OFFSIDES | ||
| 812 | Blood magnesium decreased | OFFSIDES | ||
| 813 | Blood osmolarity decreased | OFFSIDES | ||
| 814 | Blood pH decreased | OFFSIDES | ||
| 815 | Blood parathyroid hormone increased | OFFSIDES | ||
| 816 | Blood phosphorus decreased | OFFSIDES | ||
| 817 | Blood uric acid | OFFSIDES | ||
| 818 | Bone density increased | OFFSIDES | ||
| 819 | Bone fissure | OFFSIDES | ||
| 820 | Bone marrow depression | OFFSIDES | ||
| 821 | Bradyphrenia | Canada Vigilance: 1 | Canada Vigilance | |
| 822 | Brain natriuretic peptide increased | OFFSIDES | ||
| 823 | Breast necrosis | OFFSIDES | ||
| 824 | Breast prosthesis user | OFFSIDES | ||
| 825 | Bronchiectasis | OFFSIDES | ||
| 826 | Bronchopleural Fistula | OFFSIDES | ||
| 827 | Bursitis | OFFSIDES | ||
| 828 | CSF shunt removal | OFFSIDES | ||
| 829 | Cancer gene carrier | OFFSIDES | ||
| 830 | Carcinoembryonic antigen increased | OFFSIDES | ||
| 831 | Cardiac asthma | OFFSIDES | ||
| 832 | Cardiac procedure complication | OFFSIDES | ||
| 833 | Cardiac stress test abnormal | OFFSIDES | ||
| 834 | Cardioactive drug level increased | OFFSIDES | ||
| 835 | Carotid bruit | OFFSIDES | ||
| 836 | Cataract operation | OFFSIDES | ||
| 837 | Catheter related complication | OFFSIDES | ||
| 838 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 839 | Cerebral artery occlusion | OFFSIDES | ||
| 840 | Cerebral artery stenosis | OFFSIDES | ||
| 841 | Cerebral atrophy | OFFSIDES | ||
| 842 | Cerebral cyst | OFFSIDES | ||
| 843 | Cerebrosclerosis | OFFSIDES | ||
| 844 | Cervicobrachial syndrome | OFFSIDES | ||
| 845 | Chemical burn of skin | OFFSIDES | ||
| 846 | Chest wall pain | OFFSIDES | ||
| 847 | Cholangitis | Canada Vigilance: 1 | Canada Vigilance | |
| 848 | Cholecystitis infective | OFFSIDES | ||
| 849 | Cholesteatoma | OFFSIDES | ||
| 850 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 851 | Chronic sinusitis | OFFSIDES | ||
| 852 | Chylothorax | OFFSIDES | ||
| 853 | Clumsiness | OFFSIDES | ||
| 854 | Colon cancer recurrent | OFFSIDES | ||
| 855 | Concomitant disease aggravated | OFFSIDES | ||
| 856 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 857 | Conjunctival deposit | OFFSIDES | ||
| 858 | Contraindicated product prescribed | Canada Vigilance: 1 | Canada Vigilance | |
| 859 | Corneal Ulcer | OFFSIDES | ||
| 860 | Coronary artery insufficiency | OFFSIDES | ||
| 861 | Cubital Tunnel Syndrome | OFFSIDES | ||
| 862 | Culture positive | OFFSIDES | ||
| 863 | Culture wound positive | OFFSIDES | ||
| 864 | Cutaneous Candidiasis | OFFSIDES | ||
| 865 | Cyst aspiration | OFFSIDES | ||
| 866 | Cyst removal | OFFSIDES | ||
| 867 | Debridement | OFFSIDES | ||
| 868 | Delusional disorder, unspecified type | OFFSIDES | ||
| 869 | Demyelination | OFFSIDES | ||
| 870 | Dental abscess | OFFSIDES | ||
| 871 | Dental alveolar anomaly | OFFSIDES | ||
| 872 | Dental caries | OFFSIDES | ||
| 873 | Dental discomfort | OFFSIDES | ||
| 874 | Dental examination | OFFSIDES | ||
| 875 | Denture wearer | OFFSIDES | ||
| 876 | Depressed Level of Consciousness | OFFSIDES | ||
| 877 | Device Failure | OFFSIDES | ||
| 878 | Diabetes | OFFSIDES | ||
| 879 | Diabetic Retinopathy | OFFSIDES | ||
| 880 | Diabetic foot infection | OFFSIDES | ||
| 881 | Diverticulosis | OFFSIDES | ||
| 882 | Diverticulum | OFFSIDES | ||
| 883 | Drug Tolerance | OFFSIDES | ||
| 884 | Drug abuser | OFFSIDES | ||
| 885 | Drug addict | OFFSIDES | ||
| 886 | Drug toxicity | OFFSIDES | ||
| 887 | Duodenitis | OFFSIDES | ||
| 888 | Dyschezia | OFFSIDES | ||
| 889 | Dysphasia | OFFSIDES | ||
| 890 | Dyspnoea exacerbated | OFFSIDES | ||
| 891 | Ejection Fraction Decreased | OFFSIDES | ||
| 892 | Electrocardiogram ST-T segment abnormal | OFFSIDES | ||
| 893 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 894 | Empyema | OFFSIDES | ||
| 895 | Enterovesical Fistula | OFFSIDES | ||
| 896 | Epidural Abscess | OFFSIDES | ||
| 897 | Esophageal Stenosis | OFFSIDES | ||
| 898 | Eustachian tube disorder | OFFSIDES | ||
| 899 | Eyelid infection | OFFSIDES | ||
| 900 | Fatty Liver | OFFSIDES | ||
| 901 | Feeding tube complication | OFFSIDES | ||
| 902 | Femoral arterial stenosis | OFFSIDES | ||
| 903 | Fibroadenoma of breast | OFFSIDES | ||
| 904 | Fibroadenoma | OFFSIDES | ||
| 905 | Fibromuscular Dysplasia | OFFSIDES | ||
| 906 | Fistula repair | OFFSIDES | ||
| 907 | Fluid overload | OFFSIDES | ||
| 908 | Foaming at mouth | OFFSIDES | ||
| 909 | Focal glomerulosclerosis | OFFSIDES | ||
| 910 | Freezing phenomenon | OFFSIDES | ||
| 911 | Fungal rash | OFFSIDES | ||
| 912 | Gallop rhythm present | OFFSIDES | ||
| 913 | Gambling | OFFSIDES | ||
| 914 | Gammopathy | OFFSIDES | ||
| 915 | Gastric infection | OFFSIDES | ||
| 916 | Gastric mucosal lesion | OFFSIDES | ||
| 917 | Gastroduodenitis | OFFSIDES | ||
| 918 | Gastrointestinal tract adenoma | OFFSIDES | ||
| 919 | General symptom | OFFSIDES | ||
| 920 | Germ Cell Cancer | OFFSIDES | ||
| 921 | Globulinuria | OFFSIDES | ||
| 922 | Glossitis | OFFSIDES | ||
| 923 | Goiter | OFFSIDES | ||
| 924 | Gonorrhea | OFFSIDES | ||
| 925 | Granuloma | OFFSIDES | ||
| 926 | Grip strength | OFFSIDES | ||
| 927 | Hallucinations, mixed | OFFSIDES | ||
| 928 | Hay fever | OFFSIDES | ||
| 929 | Head Banging | OFFSIDES | ||
| 930 | Histoplasmosis | OFFSIDES | ||
| 931 | Hoarseness | OFFSIDES | ||
| 932 | Hydronephrosis | OFFSIDES | ||
| 933 | Hydropneumothorax | OFFSIDES | ||
| 934 | Hypercapnia | OFFSIDES | ||
| 935 | Hyperpigmentation | OFFSIDES | ||
| 936 | Hypervitaminosis | OFFSIDES | ||
| 937 | Hypokinesia | OFFSIDES | ||
| 938 | Hypotension | Canada Vigilance: 1 | Canada Vigilance | |
| 939 | Hypoxia | OFFSIDES | ||
| 940 | Hysteroscopy | OFFSIDES | ||
| 941 | Iliac artery occlusion | OFFSIDES | ||
| 942 | Iliac artery stenosis | OFFSIDES | ||
| 943 | Iliotibial Band Syndrome | OFFSIDES | ||
| 944 | Immunosuppression | OFFSIDES | ||
| 945 | Impaired self-care | OFFSIDES | ||
| 946 | Implant site inflammation | OFFSIDES | ||
| 947 | Implant site pain | OFFSIDES | ||
| 948 | Implantable defibrillator insertion | OFFSIDES | ||
| 949 | Incision site infection | OFFSIDES | ||
| 950 | Infected bunion | OFFSIDES | ||
| 951 | Influenza serology positive | OFFSIDES | ||
| 952 | Infusion site irritation | OFFSIDES | ||
| 953 | Infusion site pruritus | OFFSIDES | ||
| 954 | Injection site burning | OFFSIDES | ||
| 955 | Injection site desquamation | OFFSIDES | ||
| 956 | Injection site stinging | OFFSIDES | ||
| 957 | Insulin Resistance | OFFSIDES | ||
| 958 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 959 | Intestinal hypomotility | OFFSIDES | ||
| 960 | Intracranial Hypotension | OFFSIDES | ||
| 961 | Intracranial meningioma malignant | OFFSIDES | ||
| 962 | Iridectomy | OFFSIDES | ||
| 963 | Jaw lesion excision | OFFSIDES | ||
| 964 | Joint Instability | OFFSIDES | ||
| 965 | Joint sprain | OFFSIDES | ||
| 966 | Jugular vein distension | OFFSIDES | ||
| 967 | Labile hypertension | OFFSIDES | ||
| 968 | Laceration | OFFSIDES | ||
| 969 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 970 | Left atrial dilatation | OFFSIDES | ||
| 971 | Lesion excision | OFFSIDES | ||
| 972 | Lipase | OFFSIDES | ||
| 973 | Low turnover osteopathy | OFFSIDES | ||
| 974 | Lumbar radiculopathy | OFFSIDES | ||
| 975 | Lymph node cancer metastatic | OFFSIDES | ||
| 976 | Lymphocyte percentage decreased | OFFSIDES | ||
| 977 | Macrocytosis | OFFSIDES | ||
| 978 | Macrognathia | OFFSIDES | ||
| 979 | Malignant Hypertension | OFFSIDES | ||
| 980 | Malignant melanoma in situ | OFFSIDES | ||
| 981 | Malignant tumour excision | OFFSIDES | ||
| 982 | Mammary duct ectasia | OFFSIDES | ||
| 983 | Marasmus | OFFSIDES | ||
| 984 | Markedly reduced dietary intake | OFFSIDES | ||
| 985 | Mastication disorder | OFFSIDES | ||
| 986 | Mastoiditis | OFFSIDES | ||
| 987 | Maxillofacial operation | OFFSIDES | ||
| 988 | Mechanical ventilation | OFFSIDES | ||
| 989 | Medical device implantation | OFFSIDES | ||
| 990 | Medical device removal | OFFSIDES | ||
| 991 | Meningitis herpes | OFFSIDES | ||
| 992 | Metaplasia | OFFSIDES | ||
| 993 | Metastases to abdominal cavity | OFFSIDES | ||
| 994 | Metastases to stomach | OFFSIDES | ||
| 995 | Metatarsalgia | OFFSIDES | ||
| 996 | Micrographic skin surgery | OFFSIDES | ||
| 997 | Mitral valve sclerosis | OFFSIDES | ||
| 998 | Monocyte percentage decreased | OFFSIDES | ||
| 999 | Mononeuritis | OFFSIDES | ||
| 1000 | Mood disorder due to a general medical condition | OFFSIDES | ||
| 1001 | Multiple Myeloma | OFFSIDES | ||
| 1002 | Multiple sclerosis relapse | OFFSIDES | ||
| 1003 | Muscle flap operation | OFFSIDES | ||
| 1004 | Muscle necrosis | OFFSIDES | ||
| 1005 | Myasthenia Gravis | OFFSIDES | ||
| 1006 | Myelodysplastic syndrome transformation | OFFSIDES | ||
| 1007 | Myringitis | OFFSIDES | ||
| 1008 | Neoplasm prophylaxis | OFFSIDES | ||
| 1009 | Nephrectomy | OFFSIDES | ||
| 1010 | Neurectomy | OFFSIDES | ||
| 1011 | Neuroma | OFFSIDES | ||
| 1012 | Neuropathic ulcer | OFFSIDES | ||
| 1013 | Non-cardiac chest pain | OFFSIDES | ||
| 1014 | Nuchal Rigidity | OFFSIDES | ||
| 1015 | Nuclear magnetic resonance imaging abdominal | OFFSIDES | ||
| 1016 | Nystagmus | OFFSIDES | ||
| 1017 | Obstruction | OFFSIDES | ||
| 1018 | Occult blood positive | OFFSIDES | ||
| 1019 | Onycholysis | OFFSIDES | ||
| 1020 | Open reduction of fracture | OFFSIDES | ||
| 1021 | Optic Atrophy | OFFSIDES | ||
| 1022 | Optic Disc Edema | OFFSIDES | ||
| 1023 | Optic Neuritis | Canada Vigilance: 1 | Canada Vigilance | |
| 1024 | Oral Cavity Fistula | OFFSIDES | ||
| 1025 | Orthopnea | OFFSIDES | ||
| 1026 | Osteolysis | OFFSIDES | ||
| 1027 | Osteoma | OFFSIDES | ||
| 1028 | Osteosclerosis | OFFSIDES | ||
| 1029 | Pacemaker complication | OFFSIDES | ||
| 1030 | Pain of skin | OFFSIDES | ||
| 1031 | Panic disorder with agoraphobia | OFFSIDES | ||
| 1032 | Papilloma | OFFSIDES | ||
| 1033 | Parvovirus B19 serology positive | OFFSIDES | ||
| 1034 | Pelvic fluid collection | OFFSIDES | ||
| 1035 | Perianal erythema | OFFSIDES | ||
| 1036 | Peripheral paralysis | OFFSIDES | ||
| 1037 | Physical breast examination abnormal | OFFSIDES | ||
| 1038 | Pinguecula | OFFSIDES | ||
| 1039 | Plasmacytosis | OFFSIDES | ||
| 1040 | Pleurisy | OFFSIDES | ||
| 1041 | Pneumothorax | OFFSIDES | ||
| 1042 | Polyuria | OFFSIDES | ||
| 1043 | Poor dental condition | OFFSIDES | ||
| 1044 | Post procedural pain | OFFSIDES | ||
| 1045 | Post procedural pulmonary embolism | OFFSIDES | ||
| 1046 | Posterior Capsulotomy | OFFSIDES | ||
| 1047 | Postoperative adhesion | OFFSIDES | ||
| 1048 | Postoperative infection | OFFSIDES | ||
| 1049 | Postoperative wound complication | OFFSIDES | ||
| 1050 | Presbyopia | OFFSIDES | ||
| 1051 | Primary sequestrum | OFFSIDES | ||
| 1052 | Procedural hypertension | OFFSIDES | ||
| 1053 | Proctitis | OFFSIDES | ||
| 1054 | Progesterone receptor assay negative | OFFSIDES | ||
| 1055 | Progesterone receptor assay | OFFSIDES | ||
| 1056 | Pruritus allergic | OFFSIDES | ||
| 1057 | Pseudocyst | OFFSIDES | ||
| 1058 | Psychiatric symptom | OFFSIDES | ||
| 1059 | Pulmonary radiation injury | OFFSIDES | ||
| 1060 | Purulence | OFFSIDES | ||
| 1061 | Radicular Cyst | OFFSIDES | ||
| 1062 | Rales | OFFSIDES | ||
| 1063 | Rebound hypertension | OFFSIDES | ||
| 1064 | Rectal polyp | OFFSIDES | ||
| 1065 | Reflux gastritis | OFFSIDES | ||
| 1066 | Reflux laryngitis | OFFSIDES | ||
| 1067 | Regurgitation of food | OFFSIDES | ||
| 1068 | Renal cyst | OFFSIDES | ||
| 1069 | Respiratory tract congestion | OFFSIDES | ||
| 1070 | Retinal Vein Occlusion | OFFSIDES | ||
| 1071 | Retinal vascular occlusion | OFFSIDES | ||
| 1072 | Rhinalgia | OFFSIDES | ||
| 1073 | Rhinitis perennial | OFFSIDES | ||
| 1074 | Rhinorrhea | OFFSIDES | ||
| 1075 | Ruptured cerebral aneurysm | OFFSIDES | ||
| 1076 | Sacroiliitis | OFFSIDES | ||
| 1077 | Scotoma | OFFSIDES | ||
| 1078 | Secondary sequestrum | OFFSIDES | ||
| 1079 | Serum Sickness | OFFSIDES | ||
| 1080 | Shoulder Pain | OFFSIDES | ||
| 1081 | Shunt infection | OFFSIDES | ||
| 1082 | Silent myocardial infarction | OFFSIDES | ||
| 1083 | Sinus antrostomy | OFFSIDES | ||
| 1084 | Sinus operation | OFFSIDES | ||
| 1085 | Sinus polyp | OFFSIDES | ||
| 1086 | Skin discomfort | OFFSIDES | ||
| 1087 | Skin laceration | OFFSIDES | ||
| 1088 | Skin neoplasm excision | OFFSIDES | ||
| 1089 | Smoker | OFFSIDES | ||
| 1090 | Soft tissue necrosis | OFFSIDES | ||
| 1091 | Spinal claudication | OFFSIDES | ||
| 1092 | Spinal fusion surgery | OFFSIDES | ||
| 1093 | Splenectomy | OFFSIDES | ||
| 1094 | Splinter | OFFSIDES | ||
| 1095 | Spondylolisthesis | OFFSIDES | ||
| 1096 | Spondylosis | OFFSIDES | ||
| 1097 | Sputum culture positive | OFFSIDES | ||
| 1098 | Sternal injury | OFFSIDES | ||
| 1099 | Suture related complication | OFFSIDES | ||
| 1100 | T-Cell Lymphoma | OFFSIDES | ||
| 1101 | Tardive Dyskinesia | OFFSIDES | ||
| 1102 | Tarsal Tunnel Syndrome | OFFSIDES | ||
| 1103 | Tenosynovitis | OFFSIDES | ||
| 1104 | Therapeutic procedure | OFFSIDES | ||
| 1105 | Therapeutic product effect decreased | Canada Vigilance: 6 | Canada Vigilance | |
| 1106 | Therapeutic product effect delayed | Canada Vigilance: 1 | Canada Vigilance | |
| 1107 | Thoracic vertebral fracture | OFFSIDES | ||
| 1108 | Thrombophlebitis | Canada Vigilance: 2 | Canada Vigilance | |
| 1109 | Tooth Extraction | OFFSIDES | ||
| 1110 | Tooth Infection | OFFSIDES | ||
| 1111 | Tooth repair | OFFSIDES | ||
| 1112 | Tracheitis | OFFSIDES | ||
| 1113 | Transfusion Reaction | OFFSIDES | ||
| 1114 | Tri-iodothyronine uptake decreased | OFFSIDES | ||
| 1115 | Troponin increased | OFFSIDES | ||
| 1116 | Ultrasound biliary tract | OFFSIDES | ||
| 1117 | Ultrasound breast abnormal | OFFSIDES | ||
| 1118 | Ultrasound thyroid abnormal | OFFSIDES | ||
| 1119 | Ultrasound uterus abnormal | OFFSIDES | ||
| 1120 | Umbilical hernia | OFFSIDES | ||
| 1121 | Unexpected therapeutic drug effect | OFFSIDES | ||
| 1122 | Urethral stricture | OFFSIDES | ||
| 1123 | Urge Incontinence | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 1124 | Urinary tract infection pseudomonal | OFFSIDES | ||
| 1125 | Uterovaginal prolapse | OFFSIDES | ||
| 1126 | Ventricular Fibrillation | OFFSIDES | ||
| 1127 | Ventricular hypokinesia | OFFSIDES | ||
| 1128 | Vertebral Artery Stenosis | OFFSIDES | ||
| 1129 | Vitrectomy | OFFSIDES | ||
| 1130 | Walking aid user | OFFSIDES | ||
| 1131 | Wheelchair user | OFFSIDES | ||
| 1132 | Withdrawal of life support | OFFSIDES | ||
| 1133 | Wound closure | OFFSIDES | ||
| 1134 | Wound infection bacterial | OFFSIDES | ||
| 1135 | Wound necrosis | OFFSIDES | ||
| 1136 | Wrist deformity | OFFSIDES | ||
| 1137 | colonoscopy | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.