Insulin Glargine
(COCFEDIXXNGUNL-RFKWWTKHSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CCCNC(=N)N)CCCNC(=N)N)[C@H](O)C)NC(=O)[C@@H]1CCCN1C(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H]1CSSC[C@H](NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(=O)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](Cc2ccc(cc2)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H]2CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H]([C@H](CC)C)NC(=O)CN)CCC(=O)O)CCC(=O)N)C(=O)N[C@@H](CSSC[C@@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)C(C)C)CC(C)C)Cc1ccc(cc1)O)CC(C)C)C)CCC(=O)O)C(C)C)CC(C)C)Cc1nc[nH]c1)CO)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc1ccccc1)N)CC(=O)N)CCC(=O)N)Cc1nc[nH]c1)CC(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2)[C@H](CC)C)CO)[C@H](O)C)C(=O)NCC(=O)O)CCC(=O)O)CCCNC(=N)N)Cc1ccccc1)Cc1ccc(cc1)O
- Molecular Formula:
- C267H404N72O78S6
- Molecular Weight:
- 6062.890
- Log P:
- 5.9233
- Hydrogen Bond Acceptor:
- 154
- Hydrogen Bond Donor:
- 85
- TPSA:
- 2589.78
- CAS Number(s):
- 160337-95-1
Synonym(s)
1.
Insulin Glargine
2.
A21-Gly-B31-Arg-B32-Arg-insulin
3.
Basaglar
4.
Glargine
5.
HOE 901
6.
HOE-901
7.
Insulin, Gly(A21)-Arg(B31,B32)
8.
Insulin, Glycyl(A21)-Arginyl(B31,B32)
9.
Lantus
10.
Lantus Solostar
11.
901, HOE
12.
A21 Gly B31 Arg B32 Arg insulin
13.
Glargine, Insulin
14.
HOE901
15.
Solostar, Lantus
External Link(s)
| MeSH | D000069036 |
| PubChem Compound | 118984454 44146714 |
| Therapeutic Target Database | D07NGZ |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood glucose increased | FAERS: 2889 Canada Vigilance: 88 | Canada Vigilance US FAERS | |
| 2 | Device operational issue | FAERS: 913 | US FAERS | |
| 3 | Inappropriate schedule of product administration | FAERS: 892 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 734 Canada Vigilance: 129 | Canada Vigilance US FAERS | |
| 5 | Product dose omission | FAERS: 693 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Blood glucose decreased | FAERS: 667 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 7 | Visual Impairment | FAERS: 621 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Drug dose omission | FAERS: 602 | US FAERS | |
| 9 | Injection site pain | FAERS: 561 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 10 | Product use issue | FAERS: 513 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 11 | Cerebrovascular accident | FAERS: 486 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 12 | Malaise | FAERS: 452 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Product storage error | FAERS: 417 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 14 | Blood glucose abnormal | FAERS: 396 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 15 | Incorrect dose administered | FAERS: 365 | US FAERS | |
| 16 | Myocardial Infarction | FAERS: 314 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 17 | Dizziness | FAERS: 284 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 18 | Blood glucose fluctuation | FAERS: 237 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Drug administration error | FAERS: 221 | US FAERS | |
| 20 | Feeling abnormal | FAERS: 212 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Weight decreased | FAERS: 210 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | Product quality issue | FAERS: 203 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 23 | Blindness | FAERS: 198 | SIDER US FAERS | |
| 24 | Headache | FAERS: 197 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 25 | Diabetes mellitus inadequate control | FAERS: 193 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 26 | Accidental underdose | FAERS: 184 | US FAERS | |
| 27 | Pain | FAERS: 178 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 28 | Asthenia | FAERS: 176 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 29 | Incorrect dose administered by device | FAERS: 168 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Fatigue | FAERS: 167 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 31 | Nausea | FAERS: 167 | US FAERS | |
| 32 | Cataract | FAERS: 164 | SIDER US FAERS | |
| 33 | Pneumonia | FAERS: 160 | US FAERS | |
| 34 | Memory impairment | FAERS: 156 | US FAERS | |
| 35 | Tremor | FAERS: 153 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Pruritus | FAERS: 146 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 37 | Disability | FAERS: 143 | US FAERS | |
| 38 | Injection site bruising | FAERS: 139 | US FAERS | |
| 39 | Device malfunction | FAERS: 138 | US FAERS | |
| 40 | Vomiting | FAERS: 137 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Diabetic Ketoacidosis | FAERS: 124 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Unevaluable event | FAERS: 124 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Drug exposure during pregnancy | FAERS: 118 | US FAERS | |
| 44 | Injury associated with device | FAERS: 116 | US FAERS | |
| 45 | Wrong technique in product usage process | FAERS: 110 | US FAERS | |
| 46 | Inappropriate schedule of drug administration | FAERS: 108 | US FAERS | |
| 47 | Peripheral swelling | FAERS: 107 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 48 | Hypersensitivity | FAERS: 106 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 49 | Nasopharyngitis | FAERS: 99 | US FAERS | |
| 50 | Intentional product misuse | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Burning sensation | FAERS: 88 | US FAERS | |
| 52 | Arthralgia | FAERS: 80 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 53 | Arthritis | FAERS: 80 | US FAERS | |
| 54 | Back Pain | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Somnolence | FAERS: 78 | US FAERS | |
| 56 | Chest Pain | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Pharmaceutical product complaint | FAERS: 74 | US FAERS | |
| 58 | Device leakage | FAERS: 73 | US FAERS | |
| 59 | Intentional product use issue | FAERS: 73 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 60 | Urinary tract infection | FAERS: 72 | SIDER US FAERS | |
| 61 | Urticaria | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 62 | Anxiety | FAERS: 68 | US FAERS | |
| 63 | Medication Error | FAERS: 68 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Nervousness | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Dementia | FAERS: 65 | US FAERS | |
| 66 | Device defective | FAERS: 65 | US FAERS | |
| 67 | Glaucoma | FAERS: 63 | US FAERS | |
| 68 | Infection | FAERS: 63 | SIDER US FAERS | |
| 69 | Ketoacidosis | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 70 | Needle issue | FAERS: 63 | US FAERS | |
| 71 | Palpitations | FAERS: 62 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 72 | Cardiac Arrest | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Device breakage | FAERS: 61 | US FAERS | |
| 74 | Abdominal discomfort | FAERS: 60 | US FAERS | |
| 75 | Adverse event | FAERS: 60 | US FAERS | |
| 76 | Expired product administered | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 77 | Thrombosis | FAERS: 56 | US FAERS | |
| 78 | Diabetic Retinopathy | FAERS: 55 | SIDER US FAERS | |
| 79 | Inability to afford medication | FAERS: 55 | US FAERS | |
| 80 | Incorrect product storage | FAERS: 54 | US FAERS | |
| 81 | Swelling | FAERS: 54 | SIDER US FAERS | |
| 82 | Dehydration | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Injection site mass | FAERS: 52 | SIDER US FAERS | |
| 84 | Pancreatic carcinoma | FAERS: 52 | US FAERS | |
| 85 | Atrial Fibrillation | FAERS: 51 | US FAERS | |
| 86 | Product use complaint | FAERS: 49 | US FAERS | |
| 87 | Diabetes Mellitus | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Limb injury | FAERS: 48 | US FAERS | |
| 89 | Pancreatitis | FAERS: 48 | US FAERS | |
| 90 | Influenza | FAERS: 47 | SIDER US FAERS | |
| 91 | Macular degeneration | FAERS: 47 | US FAERS | |
| 92 | Overdose | FAERS: 47 | US FAERS | |
| 93 | Syncope | FAERS: 46 | US FAERS | |
| 94 | Amnesia | FAERS: 44 | US FAERS | |
| 95 | Deafness | FAERS: 44 | US FAERS | |
| 96 | Injection Site Reaction | FAERS: 44 | SIDER US FAERS | |
| 97 | Stress | FAERS: 44 | US FAERS | |
| 98 | Abdominal Pain | FAERS: 42 | SIDER US FAERS | |
| 99 | Device use issue | FAERS: 42 | US FAERS | |
| 100 | Hypotension | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 101 | Myalgia | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 102 | Extra dose administered | FAERS: 41 | US FAERS | |
| 103 | Suicide attempt | FAERS: 40 | US FAERS | |
| 104 | Wrong technique in device usage process | FAERS: 38 | US FAERS | |
| 105 | Asthma | FAERS: 37 | SIDER US FAERS | |
| 106 | Back disorder | FAERS: 37 | US FAERS | |
| 107 | Limb discomfort | FAERS: 37 | US FAERS | |
| 108 | Arthropathy | FAERS: 36 | US FAERS | |
| 109 | Erythema | FAERS: 36 | SIDER US FAERS | |
| 110 | Sepsis | FAERS: 36 | US FAERS | |
| 111 | Dysgeusia | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 112 | Acute myocardial infarction | FAERS: 32 | US FAERS | |
| 113 | Diabetic Foot | FAERS: 32 | US FAERS | |
| 114 | Gangrene | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Skin Ulcer | FAERS: 32 | US FAERS | |
| 116 | Gait inability | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | General physical health deterioration | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Alopecia | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Cataract operation | FAERS: 29 | US FAERS | |
| 120 | Cellulitis | FAERS: 29 | US FAERS | |
| 121 | Injection site erythema | FAERS: 29 | US FAERS | |
| 122 | Musculoskeletal Pain | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Product contamination with body fluid | FAERS: 28 | US FAERS | |
| 124 | Constipation | FAERS: 27 | US FAERS | |
| 125 | Dysphonia | FAERS: 27 | US FAERS | |
| 126 | Hepatitis C | FAERS: 27 | US FAERS | |
| 127 | Nephrolithiasis | FAERS: 27 | US FAERS | |
| 128 | Product packaging quantity issue | FAERS: 27 | US FAERS | |
| 129 | Bronchitis | FAERS: 26 | SIDER US FAERS | |
| 130 | Coronary Artery Disease | FAERS: 26 | US FAERS | |
| 131 | Device Failure | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 132 | Multiple use of single-use product | FAERS: 26 | US FAERS | |
| 133 | Ankle Fracture | FAERS: 25 | US FAERS | |
| 134 | Abasia | FAERS: 24 | US FAERS | |
| 135 | Chest discomfort | FAERS: 24 | US FAERS | |
| 136 | Hunger | FAERS: 24 | US FAERS | |
| 137 | Maternal exposure during pregnancy | FAERS: 24 | US FAERS | |
| 138 | Product administration error | FAERS: 24 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 139 | Rheumatoid Arthritis | FAERS: 24 | US FAERS | |
| 140 | Bedridden | FAERS: 23 | US FAERS | |
| 141 | Dyspepsia | FAERS: 23 | US FAERS | |
| 142 | Accidental overdose | FAERS: 22 | US FAERS | |
| 143 | Chills | FAERS: 22 | US FAERS | |
| 144 | Injection site pruritus | FAERS: 22 | US FAERS | |
| 145 | Thirst | FAERS: 22 | US FAERS | |
| 146 | Accidental exposure to product | FAERS: 21 | US FAERS | |
| 147 | Angina Pectoris | FAERS: 21 | US FAERS | |
| 148 | Fracture | FAERS: 21 | SIDER US FAERS | |
| 149 | Impaired work ability | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Joint swelling | FAERS: 21 | US FAERS | |
| 151 | Neck Pain | FAERS: 21 | US FAERS | |
| 152 | Vertigo | FAERS: 21 | US FAERS | |
| 153 | Injection site injury | FAERS: 20 | US FAERS | |
| 154 | Intentional dose omission | FAERS: 20 | US FAERS | |
| 155 | Osteomyelitis | FAERS: 20 | US FAERS | |
| 156 | Wheelchair user | FAERS: 20 | US FAERS | |
| 157 | Blood cholesterol increased | FAERS: 19 | US FAERS | |
| 158 | Joint injury | FAERS: 19 | US FAERS | |
| 159 | Discomfort | FAERS: 18 | US FAERS | |
| 160 | Disorientation | FAERS: 18 | US FAERS | |
| 161 | Night sweats | FAERS: 18 | US FAERS | |
| 162 | Aphasia | FAERS: 17 | US FAERS | |
| 163 | Drug prescribing error | FAERS: 17 | US FAERS | |
| 164 | Dysarthria | FAERS: 17 | US FAERS | |
| 165 | Pulmonary Embolism | FAERS: 17 | US FAERS | |
| 166 | Rotator cuff syndrome | FAERS: 17 | US FAERS | |
| 167 | Blood creatinine increased | FAERS: 16 | US FAERS | |
| 168 | Retinal Detachment | FAERS: 16 | US FAERS | |
| 169 | Wrong technique in drug usage process | FAERS: 16 | US FAERS | |
| 170 | Apparent death | FAERS: 15 | US FAERS | |
| 171 | Carpal Tunnel Syndrome | FAERS: 15 | US FAERS | |
| 172 | Cerebral Infarction | FAERS: 15 | US FAERS | |
| 173 | Cold sweat | FAERS: 15 | US FAERS | |
| 174 | Cystitis | FAERS: 15 | US FAERS | |
| 175 | Device ineffective | FAERS: 15 | US FAERS | |
| 176 | Flatulence | FAERS: 15 | US FAERS | |
| 177 | Incorrect route of drug administration | FAERS: 15 | US FAERS | |
| 178 | No adverse event | FAERS: 15 | US FAERS | |
| 179 | Product packaging issue | FAERS: 15 | US FAERS | |
| 180 | Respiratory arrest | FAERS: 15 | US FAERS | |
| 181 | Sinusitis | FAERS: 15 | SIDER US FAERS | |
| 182 | Agitation | FAERS: 14 | US FAERS | |
| 183 | Angioedema | FAERS: 14 | SIDER US FAERS | |
| 184 | Device difficult to use | FAERS: 14 | US FAERS | |
| 185 | Diabetic metabolic decompensation | FAERS: 14 | US FAERS | |
| 186 | Dysuria | FAERS: 14 | US FAERS | |
| 187 | Infarction | FAERS: 14 | US FAERS | |
| 188 | Inflammation | FAERS: 14 | SIDER US FAERS | |
| 189 | Insulin Resistance | FAERS: 14 | US FAERS | |
| 190 | Lethargy | FAERS: 14 | US FAERS | |
| 191 | Oropharyngeal pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 192 | Product dispensing error | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | nervous system disorder | FAERS: 14 | SIDER US FAERS | |
| 194 | Amputation | FAERS: 13 | US FAERS | |
| 195 | Cholelithiasis | FAERS: 13 | US FAERS | |
| 196 | Expired drug administered | FAERS: 13 | US FAERS | |
| 197 | Feeling jittery | FAERS: 13 | US FAERS | |
| 198 | Flushing | FAERS: 13 | US FAERS | |
| 199 | Hypersomnia | FAERS: 13 | US FAERS | |
| 200 | Injection site urticaria | FAERS: 13 | US FAERS | |
| 201 | Limb operation | FAERS: 13 | US FAERS | |
| 202 | Lip swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Mental impairment | FAERS: 13 | US FAERS | |
| 204 | Sneezing | FAERS: 13 | US FAERS | |
| 205 | Tachycardia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Wrong drug administered | FAERS: 13 | US FAERS | |
| 207 | Blood ketone body | FAERS: 12 | US FAERS | |
| 208 | Cerebral Thrombosis | FAERS: 12 | US FAERS | |
| 209 | Gout | FAERS: 12 | US FAERS | |
| 210 | Hearing disability | FAERS: 12 | US FAERS | |
| 211 | Hemiplegia | FAERS: 12 | US FAERS | |
| 212 | Injection site extravasation | FAERS: 12 | US FAERS | |
| 213 | Lymphoma | FAERS: 12 | US FAERS | |
| 214 | Altered state of consciousness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Crying | FAERS: 11 | US FAERS | |
| 216 | Depressed mood | FAERS: 11 | US FAERS | |
| 217 | Device dispensing error | FAERS: 11 | US FAERS | |
| 218 | Eye pain | FAERS: 11 | US FAERS | |
| 219 | Gastrointestinal carcinoma | FAERS: 11 | US FAERS | |
| 220 | Hernia | FAERS: 11 | US FAERS | |
| 221 | Incorrect drug administration duration | FAERS: 11 | US FAERS | |
| 222 | Incorrect product administration duration | FAERS: 11 | US FAERS | |
| 223 | Injection site hypersensitivity | FAERS: 11 | US FAERS | |
| 224 | Injection site nodule | FAERS: 11 | US FAERS | |
| 225 | Injection site scar | FAERS: 11 | US FAERS | |
| 226 | Multiple Sclerosis | FAERS: 11 | US FAERS | |
| 227 | Nerve injury | FAERS: 11 | US FAERS | |
| 228 | Nodule | FAERS: 11 | US FAERS | |
| 229 | Poor quality drug administered | FAERS: 11 | US FAERS | |
| 230 | Product label confusion | FAERS: 11 | US FAERS | |
| 231 | Pulmonary Fibrosis | FAERS: 11 | US FAERS | |
| 232 | Skin lesion | FAERS: 11 | US FAERS | |
| 233 | Throat irritation | FAERS: 11 | US FAERS | |
| 234 | Wrong schedule | FAERS: 11 | US FAERS | |
| 235 | Completed Suicide | FAERS: 10 | US FAERS | |
| 236 | Device occlusion | FAERS: 10 | US FAERS | |
| 237 | Disease Progression | FAERS: 10 | US FAERS | |
| 238 | Dry skin | FAERS: 10 | US FAERS | |
| 239 | Feeling Cold | FAERS: 10 | US FAERS | |
| 240 | Hepatitis | FAERS: 10 | US FAERS | |
| 241 | Lower respiratory tract infection | FAERS: 10 | US FAERS | |
| 242 | Musculoskeletal stiffness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Neuralgia | FAERS: 10 | US FAERS | |
| 244 | Product substitution issue | FAERS: 10 | US FAERS | |
| 245 | Restlessness | FAERS: 10 | US FAERS | |
| 246 | Thermal burn | FAERS: 10 | US FAERS | |
| 247 | Tuberculosis | FAERS: 10 | US FAERS | |
| 248 | Wheezing | FAERS: 10 | US FAERS | |
| 249 | jaundice | FAERS: 10 | US FAERS | |
| 250 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 251 | Anger | FAERS: 9 | US FAERS | |
| 252 | Atrioventricular Block | FAERS: 9 | US FAERS | |
| 253 | Circumstance or information capable of leading to medication error | FAERS: 9 | US FAERS | |
| 254 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 255 | Dysgraphia | FAERS: 9 | US FAERS | |
| 256 | Epilepsy | FAERS: 9 | US FAERS | |
| 257 | Hypophagia | FAERS: 9 | US FAERS | |
| 258 | Injection site discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 259 | Malignant neoplasm progression | FAERS: 9 | US FAERS | |
| 260 | Obesity | FAERS: 9 | US FAERS | |
| 261 | Product contamination physical | FAERS: 9 | US FAERS | |
| 262 | Respiratory Failure | FAERS: 9 | US FAERS | |
| 263 | Respiratory distress | FAERS: 9 | US FAERS | |
| 264 | Spondylitis | FAERS: 9 | US FAERS | |
| 265 | Sudden death | FAERS: 9 | US FAERS | |
| 266 | Tinnitus | FAERS: 9 | US FAERS | |
| 267 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 268 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 269 | Angioplasty | FAERS: 8 | US FAERS | |
| 270 | Blood ketone body increased | FAERS: 8 | US FAERS | |
| 271 | Cerebral disorder | FAERS: 8 | US FAERS | |
| 272 | Clostridium difficile infection | FAERS: 8 | US FAERS | |
| 273 | Diplopia | FAERS: 8 | US FAERS | |
| 274 | Epistaxis | FAERS: 8 | US FAERS | |
| 275 | Eye Infection | FAERS: 8 | US FAERS | |
| 276 | Fibromyalgia | FAERS: 8 | US FAERS | |
| 277 | Foreign body trauma | FAERS: 8 | US FAERS | |
| 278 | Impaired gastric emptying | FAERS: 8 | US FAERS | |
| 279 | Injection site irritation | FAERS: 8 | US FAERS | |
| 280 | Irritable Bowel Syndrome | FAERS: 8 | US FAERS | |
| 281 | Medical device complication | FAERS: 8 | US FAERS | |
| 282 | Musculoskeletal discomfort | FAERS: 8 | SIDER US FAERS | |
| 283 | Pallor | FAERS: 8 | US FAERS | |
| 284 | Post procedural complication | FAERS: 8 | US FAERS | |
| 285 | Pregnancy | FAERS: 8 | US FAERS | |
| 286 | Product container issue | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | Therapy cessation | FAERS: 8 | US FAERS | |
| 288 | Ulcer | FAERS: 8 | US FAERS | |
| 289 | Uterine Cancer | FAERS: 8 | US FAERS | |
| 290 | Wound Infection | FAERS: 8 | US FAERS | |
| 291 | Wrong dose | FAERS: 8 | US FAERS | |
| 292 | Wrong patient received product | FAERS: 8 | US FAERS | |
| 293 | treatment failure | FAERS: 8 | US FAERS | |
| 294 | Abscess | FAERS: 7 | US FAERS | |
| 295 | Anorexia | FAERS: 7 | US FAERS | |
| 296 | Aphonia | FAERS: 7 | US FAERS | |
| 297 | Ascites | FAERS: 7 | US FAERS | |
| 298 | Asphyxia | FAERS: 7 | US FAERS | |
| 299 | Bipolar Disorder | FAERS: 7 | US FAERS | |
| 300 | Blood potassium increased | FAERS: 7 | US FAERS | |
| 301 | Bone pain | FAERS: 7 | US FAERS | |
| 302 | Corrective lens user | FAERS: 7 | US FAERS | |
| 303 | Cyst | FAERS: 7 | US FAERS | |
| 304 | Deep Vein Thrombosis | FAERS: 7 | US FAERS | |
| 305 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 306 | Eructation | FAERS: 7 | US FAERS | |
| 307 | Gastroenteritis | FAERS: 7 | SIDER US FAERS | |
| 308 | Head discomfort | FAERS: 7 | US FAERS | |
| 309 | Incorrect dose administered by product | FAERS: 7 | US FAERS | |
| 310 | Injection site vesicles | FAERS: 7 | US FAERS | |
| 311 | Intervertebral disc disorder | FAERS: 7 | US FAERS | |
| 312 | Liquid product physical issue | FAERS: 7 | US FAERS | |
| 313 | Mental status changes | FAERS: 7 | US FAERS | |
| 314 | Osteoporosis | FAERS: 7 | US FAERS | |
| 315 | Poor peripheral circulation | FAERS: 7 | US FAERS | |
| 316 | Product leakage | FAERS: 7 | US FAERS | |
| 317 | Productive Cough | FAERS: 7 | US FAERS | |
| 318 | Psoriasis | FAERS: 7 | US FAERS | |
| 319 | Restless Legs Syndrome | FAERS: 7 | US FAERS | |
| 320 | Septic Shock | FAERS: 7 | US FAERS | |
| 321 | Therapeutic response unexpected | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Therapy change | FAERS: 7 | US FAERS | |
| 323 | Throat cancer | FAERS: 7 | US FAERS | |
| 324 | Vitreous floaters | FAERS: 7 | US FAERS | |
| 325 | Acne | FAERS: 6 | US FAERS | |
| 326 | Application site pain | FAERS: 6 | SIDER US FAERS | |
| 327 | Blood iron decreased | FAERS: 6 | US FAERS | |
| 328 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 329 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 330 | Blood urine present | FAERS: 6 | US FAERS | |
| 331 | Breast cancer recurrent | FAERS: 6 | US FAERS | |
| 332 | Choking | FAERS: 6 | US FAERS | |
| 333 | Colitis | FAERS: 6 | US FAERS | |
| 334 | Depressed Level of Consciousness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 335 | Device damage | FAERS: 6 | US FAERS | |
| 336 | Diabetic Nephropathy | FAERS: 6 | US FAERS | |
| 337 | Disease complication | FAERS: 6 | US FAERS | |
| 338 | Diverticulitis | FAERS: 6 | US FAERS | |
| 339 | Drug abuse | FAERS: 6 | US FAERS | |
| 340 | Drug administered in wrong device | FAERS: 6 | US FAERS | |
| 341 | Drug dose omission by device | FAERS: 6 | US FAERS | |
| 342 | Gastric ulcer | FAERS: 6 | US FAERS | |
| 343 | Hypothyroidism | FAERS: 6 | US FAERS | |
| 344 | Incorrect route of product administration | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Joint stiffness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 346 | Laryngitis | FAERS: 6 | US FAERS | |
| 347 | Medical device discomfort | FAERS: 6 | US FAERS | |
| 348 | Metastatic Neoplasm | FAERS: 6 | US FAERS | |
| 349 | Monoplegia | FAERS: 6 | US FAERS | |
| 350 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 351 | Peritonitis | FAERS: 6 | US FAERS | |
| 352 | Polydipsia | FAERS: 6 | US FAERS | |
| 353 | Presyncope | FAERS: 6 | US FAERS | |
| 354 | Product administered at inappropriate site | FAERS: 6 | US FAERS | |
| 355 | Product contamination | FAERS: 6 | US FAERS | |
| 356 | Product label issue | FAERS: 6 | US FAERS | |
| 357 | Pulmonary congestion | FAERS: 6 | US FAERS | |
| 358 | Renal cancer metastatic | FAERS: 6 | US FAERS | |
| 359 | Retching | FAERS: 6 | US FAERS | |
| 360 | Skin reaction | FAERS: 6 | US FAERS | |
| 361 | Soft Tissue Infection | FAERS: 6 | US FAERS | |
| 362 | Stillbirth | FAERS: 6 | US FAERS | |
| 363 | Urine ketone body present | FAERS: 6 | US FAERS | |
| 364 | Walking aid user | FAERS: 6 | US FAERS | |
| 365 | furuncle | FAERS: 6 | US FAERS | |
| 366 | Acute Coronary Syndrome | FAERS: 5 | SIDER US FAERS | |
| 367 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 368 | Anti-insulin antibody positive | FAERS: 5 | US FAERS | |
| 369 | Arteriosclerosis | FAERS: 5 | US FAERS | |
| 370 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 371 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 372 | Bradycardia | FAERS: 5 | US FAERS | |
| 373 | Chromaturia | FAERS: 5 | US FAERS | |
| 374 | Disease recurrence | FAERS: 5 | US FAERS | |
| 375 | Dose calculation error | FAERS: 5 | US FAERS | |
| 376 | Facial paralysis | FAERS: 5 | US FAERS | |
| 377 | Gastritis | FAERS: 5 | US FAERS | |
| 378 | Gastrointestinal infection | FAERS: 5 | US FAERS | |
| 379 | Hyperphagia | FAERS: 5 | US FAERS | |
| 380 | Hypokinesia | FAERS: 5 | US FAERS | |
| 381 | Incoherent | FAERS: 5 | US FAERS | |
| 382 | Injection site atrophy | FAERS: 5 | US FAERS | |
| 383 | Injection site warmth | FAERS: 5 | US FAERS | |
| 384 | Intestinal Obstruction | FAERS: 5 | US FAERS | |
| 385 | Loss of personal independence in daily activities | FAERS: 5 | US FAERS | |
| 386 | Mood swings | FAERS: 5 | US FAERS | |
| 387 | Ocular discomfort | FAERS: 5 | US FAERS | |
| 388 | Polyuria | FAERS: 5 | US FAERS | |
| 389 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 390 | Post procedural infection | FAERS: 5 | US FAERS | |
| 391 | Product physical issue | FAERS: 5 | US FAERS | |
| 392 | Rash erythematous | FAERS: 5 | US FAERS | |
| 393 | Sciatica | FAERS: 5 | US FAERS | |
| 394 | Skin irritation | FAERS: 5 | US FAERS | |
| 395 | Spinal column injury | FAERS: 5 | US FAERS | |
| 396 | Vascular occlusion | FAERS: 5 | US FAERS | |
| 397 | Viral upper respiratory tract infection | FAERS: 5 | US FAERS | |
| 398 | Visual disturbance | FAERS: 5 | US FAERS | |
| 399 | intensive care | FAERS: 5 | US FAERS | |
| 400 | Acidosis | FAERS: 4 | US FAERS | |
| 401 | Astigmatism | FAERS: 4 | US FAERS | |
| 402 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 403 | Carotid artery occlusion | FAERS: 4 | US FAERS | |
| 404 | Cartilage injury | FAERS: 4 | US FAERS | |
| 405 | Catheter placement | FAERS: 4 | US FAERS | |
| 406 | Chemotherapy | FAERS: 4 | US FAERS | |
| 407 | Cholecystitis | FAERS: 4 | US FAERS | |
| 408 | Delirium | FAERS: 4 | US FAERS | |
| 409 | Dermatitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 410 | Diabetic foot infection | FAERS: 4 | US FAERS | |
| 411 | Diabetic mastopathy | FAERS: 4 | US FAERS | |
| 412 | Emotional disorder | FAERS: 4 | US FAERS | |
| 413 | Expired device used | FAERS: 4 | US FAERS | |
| 414 | Frustration tolerance decreased | FAERS: 4 | US FAERS | |
| 415 | Gastric Bypass | FAERS: 4 | US FAERS | |
| 416 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 417 | Hysterectomy | FAERS: 4 | US FAERS | |
| 418 | Incontinence | FAERS: 4 | US FAERS | |
| 419 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 420 | Insurance issue | FAERS: 4 | US FAERS | |
| 421 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 422 | Intestinal resection | FAERS: 4 | US FAERS | |
| 423 | Ketosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 424 | Laceration | FAERS: 4 | US FAERS | |
| 425 | Ligament rupture | FAERS: 4 | US FAERS | |
| 426 | Lip and/or oral cavity cancer | FAERS: 4 | US FAERS | |
| 427 | Myasthenia Gravis | FAERS: 4 | US FAERS | |
| 428 | Myopia | FAERS: 4 | US FAERS | |
| 429 | Oral pain | FAERS: 4 | US FAERS | |
| 430 | Pancreatic Cyst | FAERS: 4 | US FAERS | |
| 431 | Photophobia | FAERS: 4 | US FAERS | |
| 432 | Pneumothorax | FAERS: 4 | US FAERS | |
| 433 | Polyhydramnios | FAERS: 4 | US FAERS | |
| 434 | Product formulation issue | FAERS: 4 | US FAERS | |
| 435 | Pulmonary Hypertension | FAERS: 4 | US FAERS | |
| 436 | Renal Cell Carcinoma | FAERS: 4 | US FAERS | |
| 437 | Rhinitis | FAERS: 4 | SIDER US FAERS | |
| 438 | Screaming | FAERS: 4 | US FAERS | |
| 439 | Shock | FAERS: 4 | SIDER US FAERS | |
| 440 | Spinal column stenosis | FAERS: 4 | US FAERS | |
| 441 | Subcutaneous Abscess | FAERS: 4 | US FAERS | |
| 442 | Tooth Loss | FAERS: 4 | US FAERS | |
| 443 | VIIth nerve paralysis | FAERS: 4 | US FAERS | |
| 444 | Venous occlusion | FAERS: 4 | US FAERS | |
| 445 | Wrong patient received medication | FAERS: 4 | US FAERS | |
| 446 | Wrong product administered | FAERS: 4 | US FAERS | |
| 447 | Ageusia | FAERS: 3 | US FAERS | |
| 448 | Agraphia | FAERS: 3 | US FAERS | |
| 449 | Animal scratch | FAERS: 3 | US FAERS | |
| 450 | Aphagia | FAERS: 3 | US FAERS | |
| 451 | Appendicitis | FAERS: 3 | US FAERS | |
| 452 | Atherosclerosis | FAERS: 3 | US FAERS | |
| 453 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 454 | Blood blister | FAERS: 3 | US FAERS | |
| 455 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 456 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 457 | Blood potassium abnormal | FAERS: 3 | US FAERS | |
| 458 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 459 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 460 | Colectomy | FAERS: 3 | US FAERS | |
| 461 | Complication associated with device | FAERS: 3 | US FAERS | |
| 462 | Complications of maternal exposure to therapeutic drugs | FAERS: 3 | US FAERS | |
| 463 | Corneal Scar | FAERS: 3 | US FAERS | |
| 464 | Cyanosis | FAERS: 3 | US FAERS | |
| 465 | Dawn phenomenon | FAERS: 3 | US FAERS | |
| 466 | Dengue Fever | FAERS: 3 | US FAERS | |
| 467 | Device infusion issue | FAERS: 3 | US FAERS | |
| 468 | Diabetic ulcer | FAERS: 3 | US FAERS | |
| 469 | Drug Dependence | FAERS: 3 | US FAERS | |
| 470 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 471 | Ear congestion | FAERS: 3 | US FAERS | |
| 472 | Embolism | FAERS: 3 | US FAERS | |
| 473 | Enteritis | FAERS: 3 | US FAERS | |
| 474 | Erysipelas | FAERS: 3 | US FAERS | |
| 475 | Escherichia infection | FAERS: 3 | US FAERS | |
| 476 | Exposure via skin contact | FAERS: 3 | US FAERS | |
| 477 | Feeding tube user | FAERS: 3 | US FAERS | |
| 478 | Formication | FAERS: 3 | US FAERS | |
| 479 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 480 | Gestational Diabetes | FAERS: 3 | US FAERS | |
| 481 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 482 | Hemiparesis | FAERS: 3 | US FAERS | |
| 483 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 484 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 485 | Hip surgery | FAERS: 3 | US FAERS | |
| 486 | Hyperkeratosis | FAERS: 3 | US FAERS | |
| 487 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 488 | Hypoxia | FAERS: 3 | US FAERS | |
| 489 | Initial insomnia | FAERS: 3 | US FAERS | |
| 490 | Injection site infection | FAERS: 3 | US FAERS | |
| 491 | Injection site inflammation | FAERS: 3 | US FAERS | |
| 492 | Intentional device misuse | FAERS: 3 | US FAERS | |
| 493 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 494 | Intracranial Aneurysm | FAERS: 3 | US FAERS | |
| 495 | Intracranial mass | FAERS: 3 | US FAERS | |
| 496 | Lipodystrophy acquired | FAERS: 3 | SIDER US FAERS | |
| 497 | Loose tooth | FAERS: 3 | US FAERS | |
| 498 | Malnutrition | FAERS: 3 | SIDER US FAERS | |
| 499 | Manufacturing issue | FAERS: 3 | US FAERS | |
| 500 | Meniscus injury | FAERS: 3 | US FAERS | |
| 501 | Mental Fatigue | FAERS: 3 | US FAERS | |
| 502 | Middle insomnia | FAERS: 3 | US FAERS | |
| 503 | Mouth swelling | FAERS: 3 | US FAERS | |
| 504 | Muscle strain | FAERS: 3 | US FAERS | |
| 505 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 506 | Overweight | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 507 | Pancreatic Insufficiency | FAERS: 3 | US FAERS | |
| 508 | Pancreatic Neoplasm | FAERS: 3 | US FAERS | |
| 509 | Papule | FAERS: 3 | US FAERS | |
| 510 | Paranoia | FAERS: 3 | US FAERS | |
| 511 | Personality Change | FAERS: 3 | US FAERS | |
| 512 | Physical disability | FAERS: 3 | US FAERS | |
| 513 | Pneumonitis | FAERS: 3 | US FAERS | |
| 514 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 515 | Post-Traumatic Stress Disorder | FAERS: 3 | US FAERS | |
| 516 | Product complaint | FAERS: 3 Canada Vigilance: 22 | Canada Vigilance US FAERS | |
| 517 | Product prescribing issue | FAERS: 3 | US FAERS | |
| 518 | Product tampering | FAERS: 3 | US FAERS | |
| 519 | Radiation injury | FAERS: 3 | US FAERS | |
| 520 | Renal pain | FAERS: 3 | US FAERS | |
| 521 | Retinal vascular thrombosis | FAERS: 3 | US FAERS | |
| 522 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 523 | Schizophrenia | FAERS: 3 | US FAERS | |
| 524 | Sight disability | FAERS: 3 | US FAERS | |
| 525 | Sinus headache | FAERS: 3 | US FAERS | |
| 526 | Sinus pain | FAERS: 3 | US FAERS | |
| 527 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 528 | Sluggishness | FAERS: 3 | US FAERS | |
| 529 | Splenomegaly | FAERS: 3 | US FAERS | |
| 530 | Squamous cell carcinoma | FAERS: 3 | US FAERS | |
| 531 | Syndactyly | FAERS: 3 | US FAERS | |
| 532 | Syringe issue | FAERS: 3 | US FAERS | |
| 533 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 534 | Tension Headache | FAERS: 3 | US FAERS | |
| 535 | Throat clearing | FAERS: 3 | US FAERS | |
| 536 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 537 | Ventricular arrhythmia | FAERS: 3 | US FAERS | |
| 538 | Vitrectomy | FAERS: 3 | US FAERS | |
| 539 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 540 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 541 | Accidental exposure | FAERS: 2 | US FAERS | |
| 542 | Administration site bruise | FAERS: 2 | US FAERS | |
| 543 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 544 | Allodynia | FAERS: 2 | US FAERS | |
| 545 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 546 | Anaphylactic shock | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 547 | Anosmia | FAERS: 2 | US FAERS | |
| 548 | Anti-insulin antibody increased | FAERS: 2 | US FAERS | |
| 549 | Apgar score abnormal | FAERS: 2 | US FAERS | |
| 550 | Arthropod sting | FAERS: 2 | US FAERS | |
| 551 | Ataxia | FAERS: 2 | US FAERS | |
| 552 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 553 | Biliary Colic | FAERS: 2 | US FAERS | |
| 554 | Bipolar II disorder | FAERS: 2 | US FAERS | |
| 555 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 556 | Blood insulin abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | Blood insulin decreased | FAERS: 2 | US FAERS | |
| 558 | Blood ketone body present | FAERS: 2 | US FAERS | |
| 559 | Blood thyroid stimulating hormone increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 560 | Blood urea increased | FAERS: 2 | US FAERS | |
| 561 | Brain Death | FAERS: 2 | US FAERS | |
| 562 | Cachexia | FAERS: 2 | US FAERS | |
| 563 | Calcinosis | FAERS: 2 | US FAERS | |
| 564 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 565 | Cardiac assistance device user | FAERS: 2 | US FAERS | |
| 566 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 567 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 568 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 569 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 570 | Cleft Palate | FAERS: 2 | US FAERS | |
| 571 | Coma scale abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 572 | Complications of transplant surgery | FAERS: 2 | US FAERS | |
| 573 | Compression fracture | FAERS: 2 | US FAERS | |
| 574 | Cystocele | FAERS: 2 | US FAERS | |
| 575 | Dental caries | FAERS: 2 | US FAERS | |
| 576 | Device related infection | FAERS: 2 | US FAERS | |
| 577 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 578 | Drug dispensed to wrong patient | FAERS: 2 | US FAERS | |
| 579 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 580 | Drug effect variable | FAERS: 2 | US FAERS | |
| 581 | Drug label confusion | FAERS: 2 | US FAERS | |
| 582 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 583 | Dyslexia | FAERS: 2 | US FAERS | |
| 584 | Dysphemia | FAERS: 2 | US FAERS | |
| 585 | Ear discomfort | FAERS: 2 | US FAERS | |
| 586 | Economic problem | FAERS: 2 | US FAERS | |
| 587 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 588 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 589 | Emotional distress | FAERS: 2 | US FAERS | |
| 590 | Endoscopy gastrointestinal abnormal | FAERS: 2 | US FAERS | |
| 591 | Erythema Nodosum | FAERS: 2 | US FAERS | |
| 592 | Eschar | FAERS: 2 | US FAERS | |
| 593 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 594 | Exposure via inhalation | FAERS: 2 | US FAERS | |
| 595 | Eye inflammation | FAERS: 2 | US FAERS | |
| 596 | Eye irritation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 597 | Eye laser surgery | FAERS: 2 | US FAERS | |
| 598 | Food Allergy | FAERS: 2 | US FAERS | |
| 599 | Food craving | FAERS: 2 | US FAERS | |
| 600 | Frostbite | FAERS: 2 | US FAERS | |
| 601 | Gastroenteritis norovirus | FAERS: 2 | US FAERS | |
| 602 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 603 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 604 | Glaucoma surgery | FAERS: 2 | US FAERS | |
| 605 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 606 | Head lag | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 607 | Hepatitis A | FAERS: 2 | US FAERS | |
| 608 | Hepatitis B | FAERS: 2 | US FAERS | |
| 609 | Hordeolum | FAERS: 2 | US FAERS | |
| 610 | Hyperacusis | FAERS: 2 | US FAERS | |
| 611 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 612 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 613 | Immature respiratory system | FAERS: 2 | US FAERS | |
| 614 | Immobile | FAERS: 2 | US FAERS | |
| 615 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 616 | Injection site abscess | FAERS: 2 | US FAERS | |
| 617 | Injection site indentation | FAERS: 2 | US FAERS | |
| 618 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 619 | Intentional device use issue | FAERS: 2 | US FAERS | |
| 620 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 621 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 622 | Intercepted product selection error | FAERS: 2 | US FAERS | |
| 623 | Intercepted product storage error | FAERS: 2 | US FAERS | |
| 624 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 625 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 626 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 627 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 628 | Lipohypertrophy | FAERS: 2 | SIDER US FAERS | |
| 629 | Lipoma | FAERS: 2 | US FAERS | |
| 630 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 631 | Lyme Disease | FAERS: 2 | US FAERS | |
| 632 | Mallory-Weiss Syndrome | FAERS: 2 | US FAERS | |
| 633 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 634 | Meningioma | FAERS: 2 | US FAERS | |
| 635 | Meningitis | FAERS: 2 | US FAERS | |
| 636 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 637 | Metastases to stomach | FAERS: 2 | US FAERS | |
| 638 | Metastasis | FAERS: 2 | US FAERS | |
| 639 | Monoparesis | FAERS: 2 | US FAERS | |
| 640 | Multiple allergies | FAERS: 2 | US FAERS | |
| 641 | Muscle tightness | FAERS: 2 | US FAERS | |
| 642 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 643 | Mutism | FAERS: 2 | US FAERS | |
| 644 | Mydriasis | FAERS: 2 | US FAERS | |
| 645 | Myocardial necrosis marker increased | FAERS: 2 | US FAERS | |
| 646 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 647 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 648 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 649 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 650 | Ocular icterus | FAERS: 2 | US FAERS | |
| 651 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 652 | Oral infection | FAERS: 2 | US FAERS | |
| 653 | Oropharyngeal discomfort | FAERS: 2 | SIDER US FAERS | |
| 654 | Pain of skin | FAERS: 2 | US FAERS | |
| 655 | Pancreatectomy | FAERS: 2 | US FAERS | |
| 656 | Pancreaticoduodenectomy | FAERS: 2 | US FAERS | |
| 657 | Panic Disorder | FAERS: 2 | US FAERS | |
| 658 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 659 | Physical product label issue | FAERS: 2 | US FAERS | |
| 660 | Poisoning | FAERS: 2 | US FAERS | |
| 661 | Premature baby death | FAERS: 2 | US FAERS | |
| 662 | Procedural complication | FAERS: 2 | US FAERS | |
| 663 | Product administration interrupted | FAERS: 2 | US FAERS | |
| 664 | Product appearance confusion | FAERS: 2 | US FAERS | |
| 665 | Product availability issue | FAERS: 2 | US FAERS | |
| 666 | Product design issue | FAERS: 2 | US FAERS | |
| 667 | Product expiration date issue | FAERS: 2 | US FAERS | |
| 668 | Product lot number issue | FAERS: 2 | US FAERS | |
| 669 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 670 | Product supply issue | FAERS: 2 | US FAERS | |
| 671 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 672 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 673 | Proteinuria | FAERS: 2 | US FAERS | |
| 674 | Purpura | FAERS: 2 | US FAERS | |
| 675 | Purulence | FAERS: 2 | US FAERS | |
| 676 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 677 | Quadriparesis | FAERS: 2 | US FAERS | |
| 678 | Renal mass | FAERS: 2 | US FAERS | |
| 679 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 680 | Retinitis Pigmentosa | FAERS: 2 | US FAERS | |
| 681 | Scab | FAERS: 2 | US FAERS | |
| 682 | Senile dementia | FAERS: 2 | US FAERS | |
| 683 | Sensitive skin | FAERS: 2 | US FAERS | |
| 684 | Skeletal injury | FAERS: 2 | US FAERS | |
| 685 | Skin Induration | FAERS: 2 | US FAERS | |
| 686 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 687 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 688 | Skin indentation | FAERS: 2 | US FAERS | |
| 689 | Skin tightness | FAERS: 2 | US FAERS | |
| 690 | Sleep disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 691 | Slow speech | FAERS: 2 | US FAERS | |
| 692 | Sopor | FAERS: 2 | US FAERS | |
| 693 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 694 | Stenosis | FAERS: 2 | US FAERS | |
| 695 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 696 | Stomatitis | FAERS: 2 | US FAERS | |
| 697 | Sunburn | FAERS: 2 | US FAERS | |
| 698 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 699 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 700 | Therapeutic product effect decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 701 | Thirst decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 702 | Tissue injury | FAERS: 2 | US FAERS | |
| 703 | Tonsillitis | FAERS: 2 | US FAERS | |
| 704 | Tooth Infection | FAERS: 2 | US FAERS | |
| 705 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 706 | Transcription medication error | FAERS: 2 | US FAERS | |
| 707 | Trisomy 21 | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 708 | Typhoid Fever | FAERS: 2 | US FAERS | |
| 709 | Underweight | FAERS: 2 | US FAERS | |
| 710 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 711 | Urinary Retention | FAERS: 2 | US FAERS | |
| 712 | Urinary tract obstruction | FAERS: 2 | US FAERS | |
| 713 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 714 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 715 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 716 | Wrong device used | FAERS: 2 | US FAERS | |
| 717 | colonoscopy | FAERS: 2 | US FAERS | |
| 718 | liposarcoma | FAERS: 2 | US FAERS | |
| 719 | muscle injury | FAERS: 2 | US FAERS | |
| 720 | skin abrasion | FAERS: 2 | US FAERS | |
| 721 | Abdominal fat apron | FAERS: 1 | US FAERS | |
| 722 | Abdominal mass | FAERS: 1 | US FAERS | |
| 723 | Abdominal strangulated hernia | FAERS: 1 | US FAERS | |
| 724 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 725 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 726 | Acanthosis Nigricans | FAERS: 1 | US FAERS | |
| 727 | Accidental death | FAERS: 1 | US FAERS | |
| 728 | Accidental needle stick | FAERS: 1 | US FAERS | |
| 729 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 730 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 731 | Acromegaly | FAERS: 1 | US FAERS | |
| 732 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 733 | Administration site reaction | FAERS: 1 | US FAERS | |
| 734 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 735 | Allergic cough | FAERS: 1 | US FAERS | |
| 736 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 737 | Amblyopia | FAERS: 1 | US FAERS | |
| 738 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 739 | Ammonia increased | FAERS: 1 | US FAERS | |
| 740 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 741 | Amyloidosis | FAERS: 1 | US FAERS | |
| 742 | Anal Fissure | FAERS: 1 | US FAERS | |
| 743 | Anal abscess | FAERS: 1 | US FAERS | |
| 744 | Aneurysm | FAERS: 1 | US FAERS | |
| 745 | Angiotensin converting enzyme increased | FAERS: 1 | US FAERS | |
| 746 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 747 | Ankle deformity | FAERS: 1 | US FAERS | |
| 748 | Anti-GAD antibody positive | FAERS: 1 | US FAERS | |
| 749 | Antibody test positive | FAERS: 1 | US FAERS | |
| 750 | Antipsychotic drug level increased | FAERS: 1 | US FAERS | |
| 751 | Anuria | FAERS: 1 | US FAERS | |
| 752 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 753 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 754 | Apathy | FAERS: 1 | US FAERS | |
| 755 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 756 | Aplasia Cutis Congenita | FAERS: 1 | US FAERS | |
| 757 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 758 | Application site nerve damage | FAERS: 1 | US FAERS | |
| 759 | Application site reaction | FAERS: 1 | US FAERS | |
| 760 | Arterial bypass operation | FAERS: 1 | US FAERS | |
| 761 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 762 | Arthropod bite | FAERS: 1 | US FAERS | |
| 763 | Arthroscopy | FAERS: 1 | US FAERS | |
| 764 | Artificial heart device user | FAERS: 1 | US FAERS | |
| 765 | Asthenopia | FAERS: 1 | US FAERS | |
| 766 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 767 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 768 | Automatic bladder | FAERS: 1 | US FAERS | |
| 769 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 770 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 771 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 772 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 773 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 774 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 775 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 776 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 777 | Bladder stenosis | FAERS: 1 | US FAERS | |
| 778 | Blepharospasm | FAERS: 1 | US FAERS | |
| 779 | Blighted ovum | FAERS: 1 | US FAERS | |
| 780 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 781 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 782 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 783 | Blood glucose false positive | FAERS: 1 | US FAERS | |
| 784 | Blood glucose normal | FAERS: 1 | US FAERS | |
| 785 | Blood ketone body decreased | FAERS: 1 | US FAERS | |
| 786 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 787 | Blood lactic acid | FAERS: 1 | US FAERS | |
| 788 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 789 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 790 | Body height abnormal | FAERS: 1 | US FAERS | |
| 791 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 792 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 793 | Bone density decreased | FAERS: 1 | US FAERS | |
| 794 | Bone erosion | FAERS: 1 | US FAERS | |
| 795 | Bone fissure | FAERS: 1 | US FAERS | |
| 796 | Bone lesion | FAERS: 1 | US FAERS | |
| 797 | Borderline Personality Disorder | FAERS: 1 | US FAERS | |
| 798 | Bradykinesia | FAERS: 1 | US FAERS | |
| 799 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 800 | Breast adenoma | FAERS: 1 | US FAERS | |
| 801 | Breast cancer stage II | FAERS: 1 | US FAERS | |
| 802 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 803 | Bronchospasm | FAERS: 1 | SIDER US FAERS | |
| 804 | Bruxism | FAERS: 1 | US FAERS | |
| 805 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 806 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 807 | Bunion | FAERS: 1 | US FAERS | |
| 808 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 809 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 810 | Carcinoma | FAERS: 1 | US FAERS | |
| 811 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 812 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 813 | Cardiac infection | FAERS: 1 | US FAERS | |
| 814 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 815 | Cataplexy | FAERS: 1 | US FAERS | |
| 816 | Catatonia | FAERS: 1 | US FAERS | |
| 817 | Cell Death | FAERS: 1 | US FAERS | |
| 818 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 819 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 820 | Cerebellar stroke | FAERS: 1 | US FAERS | |
| 821 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 822 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 823 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 824 | Cervix carcinoma stage I | FAERS: 1 | US FAERS | |
| 825 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 826 | Cervix enlargement | FAERS: 1 | US FAERS | |
| 827 | Charles Bonnet Syndrome | FAERS: 1 | US FAERS | |
| 828 | Cheilitis | FAERS: 1 | US FAERS | |
| 829 | Choking sensation | FAERS: 1 | US FAERS | |
| 830 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 831 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 832 | Chorea | FAERS: 1 | US FAERS | |
| 833 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 834 | Chronic disease | FAERS: 1 | US FAERS | |
| 835 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 836 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 837 | Cluster Headache | FAERS: 1 | US FAERS | |
| 838 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 839 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 840 | Congenital pneumonia | FAERS: 1 | US FAERS | |
| 841 | Congenital scoliosis | FAERS: 1 | US FAERS | |
| 842 | Conjunctival abrasion | FAERS: 1 | US FAERS | |
| 843 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 844 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 845 | Cyst removal | FAERS: 1 | US FAERS | |
| 846 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 847 | Debridement | FAERS: 1 | US FAERS | |
| 848 | Decreased bronchial secretion | FAERS: 1 | US FAERS | |
| 849 | Depression suicidal | FAERS: 1 | US FAERS | |
| 850 | Dermal absorption impaired | FAERS: 1 | US FAERS | |
| 851 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 852 | Device effect decreased | FAERS: 1 | US FAERS | |
| 853 | Device physical property issue | FAERS: 1 | US FAERS | |
| 854 | Diabetes mellitus management | FAERS: 1 | US FAERS | |
| 855 | Diabetic blindness | FAERS: 1 | US FAERS | |
| 856 | Diabetic glaucoma | FAERS: 1 | US FAERS | |
| 857 | Diabetic keratopathy | FAERS: 1 | US FAERS | |
| 858 | Diabetic neuropathic ulcer | FAERS: 1 | US FAERS | |
| 859 | Diabetic wound | FAERS: 1 | US FAERS | |
| 860 | Diplegia | FAERS: 1 | US FAERS | |
| 861 | Double Outlet Right Ventricle | FAERS: 1 | US FAERS | |
| 862 | Drowning | FAERS: 1 | US FAERS | |
| 863 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 864 | Drug abuser | FAERS: 1 | US FAERS | |
| 865 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 866 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 867 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 868 | Drug level decreased | FAERS: 1 | US FAERS | |
| 869 | Drug resistance | FAERS: 1 | US FAERS | |
| 870 | Drug therapy changed | FAERS: 1 | US FAERS | |
| 871 | Drug toxicity | FAERS: 1 | US FAERS | |
| 872 | Dyschromatopsia | FAERS: 1 | US FAERS | |
| 873 | Dystonia | FAERS: 1 | US FAERS | |
| 874 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 875 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 876 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 877 | Elbow deformity | FAERS: 1 | US FAERS | |
| 878 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 879 | Encephalitis | FAERS: 1 | US FAERS | |
| 880 | Endocarditis | FAERS: 1 | US FAERS | |
| 881 | Endometriosis | FAERS: 1 | US FAERS | |
| 882 | Enuresis | FAERS: 1 | US FAERS | |
| 883 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 884 | Epiglottitis | FAERS: 1 | US FAERS | |
| 885 | Erythema Induratum | FAERS: 1 | US FAERS | |
| 886 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 887 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 888 | Euphoric mood | FAERS: 1 | US FAERS | |
| 889 | Excessive dynamic airway collapse | FAERS: 1 | US FAERS | |
| 890 | Exophthalmos | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 891 | Exposure to radiation | FAERS: 1 | US FAERS | |
| 892 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 893 | Eye complication associated with device | FAERS: 1 | US FAERS | |
| 894 | Eye ulcer | FAERS: 1 | US FAERS | |
| 895 | Eyelid erosion | FAERS: 1 | US FAERS | |
| 896 | Facial Pain | FAERS: 1 | US FAERS | |
| 897 | Facial Paresis | FAERS: 1 | US FAERS | |
| 898 | Fine motor delay | FAERS: 1 | US FAERS | |
| 899 | Fistula repair | FAERS: 1 | US FAERS | |
| 900 | Fixed eruption | FAERS: 1 | US FAERS | |
| 901 | Flank Pain | FAERS: 1 | US FAERS | |
| 902 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 903 | Fluid overload | FAERS: 1 | US FAERS | |
| 904 | Food Poisoning | FAERS: 1 | US FAERS | |
| 905 | Fructosamine increased | FAERS: 1 | US FAERS | |
| 906 | Frustration | FAERS: 1 | US FAERS | |
| 907 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 908 | Gastric infection | FAERS: 1 | US FAERS | |
| 909 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 910 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 911 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 912 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 913 | Genital infection | FAERS: 1 | US FAERS | |
| 914 | Gingival erythema | FAERS: 1 | US FAERS | |
| 915 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 916 | Glucose tolerance increased | FAERS: 1 | US FAERS | |
| 917 | Glycosuria | FAERS: 1 | SIDER US FAERS | |
| 918 | Grief reaction | FAERS: 1 | US FAERS | |
| 919 | Groin infection | FAERS: 1 | US FAERS | |
| 920 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 921 | Head titubation | FAERS: 1 | US FAERS | |
| 922 | Heat Stroke | FAERS: 1 | US FAERS | |
| 923 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 924 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 925 | Hernia pain | FAERS: 1 | US FAERS | |
| 926 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 927 | Histamine abnormal | FAERS: 1 | US FAERS | |
| 928 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 929 | Hydrocele operation | FAERS: 1 | US FAERS | |
| 930 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 931 | Hypercapnia | FAERS: 1 | US FAERS | |
| 932 | Hyperinsulinism | FAERS: 1 | US FAERS | |
| 933 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 934 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 935 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 936 | Hyperventilation | FAERS: 1 | US FAERS | |
| 937 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 938 | Hypogeusia | FAERS: 1 | US FAERS | |
| 939 | Hypophysectomy | FAERS: 1 | US FAERS | |
| 940 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 941 | Hypospadias | FAERS: 1 | US FAERS | |
| 942 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 943 | Hypoventilation | FAERS: 1 | US FAERS | |
| 944 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 945 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 946 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 947 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 948 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 949 | Increased insulin requirement | FAERS: 1 | US FAERS | |
| 950 | Induration | FAERS: 1 | US FAERS | |
| 951 | Infected cyst | FAERS: 1 | US FAERS | |
| 952 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 953 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 954 | Infusion site pain | FAERS: 1 | US FAERS | |
| 955 | Injection site fibrosis | FAERS: 1 | US FAERS | |
| 956 | Injection site laceration | FAERS: 1 | US FAERS | |
| 957 | Injection site scab | FAERS: 1 | US FAERS | |
| 958 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 959 | Instillation site foreign body sensation | FAERS: 1 | US FAERS | |
| 960 | Instillation site pain | FAERS: 1 | SIDER US FAERS | |
| 961 | Insulin C-peptide increased | FAERS: 1 | US FAERS | |
| 962 | Insulin autoimmune syndrome | FAERS: 1 | US FAERS | |
| 963 | Insulin resistance syndrome | FAERS: 1 | US FAERS | |
| 964 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 965 | Intentional misuse | FAERS: 1 | US FAERS | |
| 966 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 967 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 968 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 969 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 970 | Joint sprain | FAERS: 1 | US FAERS | |
| 971 | Ketonuria | FAERS: 1 | US FAERS | |
| 972 | Knuckle pads | FAERS: 1 | US FAERS | |
| 973 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 974 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 975 | Laryngospasm | FAERS: 1 | US FAERS | |
| 976 | Laser Therapy | FAERS: 1 | US FAERS | |
| 977 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 978 | Leukocytosis | FAERS: 1 | US FAERS | |
| 979 | Lichen Planus | FAERS: 1 | US FAERS | |
| 980 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 981 | Limb mass | FAERS: 1 | US FAERS | |
| 982 | Limb prosthesis user | FAERS: 1 | US FAERS | |
| 983 | Lipoatrophy | FAERS: 1 | SIDER US FAERS | |
| 984 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 985 | Local reaction | FAERS: 1 | US FAERS | |
| 986 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 987 | Lung Abscess | FAERS: 1 | US FAERS | |
| 988 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 989 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 990 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 991 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 992 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 993 | Malabsorption from injection site | FAERS: 1 | US FAERS | |
| 994 | Malabsorption | FAERS: 1 | US FAERS | |
| 995 | Malignant Fibrous Histiocytoma | FAERS: 1 | US FAERS | |
| 996 | Malignant dysphagia | FAERS: 1 | US FAERS | |
| 997 | Mastectomy | FAERS: 1 | US FAERS | |
| 998 | Mechanical ventilation complication | FAERS: 1 | US FAERS | |
| 999 | Metastases to tonsils | FAERS: 1 | US FAERS | |
| 1000 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 1001 | Multiple System Atrophy | FAERS: 1 | US FAERS | |
| 1002 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 1003 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 1004 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 1005 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 1006 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 1007 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 1008 | Myoclonus | FAERS: 1 | US FAERS | |
| 1009 | Myopathy | FAERS: 1 | US FAERS | |
| 1010 | Neck Dissection | FAERS: 1 | US FAERS | |
| 1011 | Necrosis | FAERS: 1 | US FAERS | |
| 1012 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 1013 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 1014 | Neuritis | FAERS: 1 | US FAERS | |
| 1015 | Neuropathy | FAERS: 1 | SIDER US FAERS | |
| 1016 | Nipple pain | FAERS: 1 | US FAERS | |
| 1017 | No adverse effect | FAERS: 1 | US FAERS | |
| 1018 | Nocturia | FAERS: 1 | US FAERS | |
| 1019 | Non-cirrhotic portal hypertension | FAERS: 1 | US FAERS | |
| 1020 | Oliguria | FAERS: 1 | US FAERS | |
| 1021 | Oncologic complication | FAERS: 1 | US FAERS | |
| 1022 | Onychalgia | FAERS: 1 | US FAERS | |
| 1023 | Onychomycosis | FAERS: 1 | US FAERS | |
| 1024 | Open globe injury | FAERS: 1 | US FAERS | |
| 1025 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 1026 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 1027 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 1028 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 1029 | Orchitis | FAERS: 1 | US FAERS | |
| 1030 | Orthosis user | FAERS: 1 | US FAERS | |
| 1031 | Osteosarcoma | FAERS: 1 | US FAERS | |
| 1032 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 1033 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 1034 | Pancreas islet cell transplant | FAERS: 1 | US FAERS | |
| 1035 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 1036 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 1037 | Pancreatic leak | FAERS: 1 | US FAERS | |
| 1038 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 1039 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 1040 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 1041 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 1042 | Paraplegia | FAERS: 1 | US FAERS | |
| 1043 | Paratyphoid Fever | FAERS: 1 | US FAERS | |
| 1044 | Paresis | FAERS: 1 | US FAERS | |
| 1045 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 1046 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 1047 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1048 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 1049 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 1050 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 1051 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 1052 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 1053 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 1054 | Phlebitis | FAERS: 1 | US FAERS | |
| 1055 | Plagiocephaly | FAERS: 1 | US FAERS | |
| 1056 | Pleurisy | FAERS: 1 | US FAERS | |
| 1057 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 1058 | Polyarthritis | FAERS: 1 | US FAERS | |
| 1059 | Polydactyly | FAERS: 1 | US FAERS | |
| 1060 | Poor quality device used | FAERS: 1 | US FAERS | |
| 1061 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 1062 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 1063 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 1064 | Pregnancy with contraceptive device | FAERS: 1 | US FAERS | |
| 1065 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1066 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 1067 | Product container seal issue | FAERS: 1 | US FAERS | |
| 1068 | Product counterfeit | FAERS: 1 | US FAERS | |
| 1069 | Product deposit | FAERS: 1 | US FAERS | |
| 1070 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 1071 | Product distribution issue | FAERS: 1 | US FAERS | |
| 1072 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 1073 | Product name confusion | FAERS: 1 | US FAERS | |
| 1074 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 1075 | Product package associated injury | FAERS: 1 | US FAERS | |
| 1076 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 1077 | Product prescribing error | FAERS: 1 | US FAERS | |
| 1078 | Product size issue | FAERS: 1 | US FAERS | |
| 1079 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 1080 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 1081 | Protein urine present | FAERS: 1 | US FAERS | |
| 1082 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 1083 | Pseudocyst | FAERS: 1 | US FAERS | |
| 1084 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 1085 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 1086 | Pterygium | FAERS: 1 | US FAERS | |
| 1087 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 1088 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 1089 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 1090 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 1091 | Pyuria | FAERS: 1 | US FAERS | |
| 1092 | Quadriplegia | FAERS: 1 | US FAERS | |
| 1093 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 1094 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 1095 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1096 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 1097 | Renal abscess | FAERS: 1 | US FAERS | |
| 1098 | Renal cyst | FAERS: 1 | US FAERS | |
| 1099 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 1100 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 1101 | Retinal Vascular Disorder | FAERS: 1 | SIDER US FAERS | |
| 1102 | Retinal scar | FAERS: 1 | US FAERS | |
| 1103 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 1104 | Retinitis | FAERS: 1 | US FAERS | |
| 1105 | Retirement | FAERS: 1 | US FAERS | |
| 1106 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 1107 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 1108 | Sarcoma | FAERS: 1 | US FAERS | |
| 1109 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 1110 | Scleroderma | FAERS: 1 | US FAERS | |
| 1111 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 1112 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 1113 | Serum Sickness | FAERS: 1 | US FAERS | |
| 1114 | Single functional kidney | FAERS: 1 | US FAERS | |
| 1115 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1116 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1117 | Sleep Talking | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1118 | Small intestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 1119 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 1120 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 1121 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 1122 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 1123 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1124 | Starvation | FAERS: 1 | US FAERS | |
| 1125 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 1126 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 1127 | Stent malfunction | FAERS: 1 | US FAERS | |
| 1128 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 1129 | Subcutaneous drug absorption impaired | FAERS: 1 | US FAERS | |
| 1130 | Superinfection | FAERS: 1 | US FAERS | |
| 1131 | Supravalvular aortic stenosis | FAERS: 1 | US FAERS | |
| 1132 | Surgical failure | FAERS: 1 | US FAERS | |
| 1133 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 1134 | Suspected product tampering | FAERS: 1 | US FAERS | |
| 1135 | Suture insertion | FAERS: 1 | US FAERS | |
| 1136 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1137 | Tendon discomfort | FAERS: 1 | US FAERS | |
| 1138 | Tension | FAERS: 1 | US FAERS | |
| 1139 | Tetany | FAERS: 1 | US FAERS | |
| 1140 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1141 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 1142 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1143 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1144 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1145 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1146 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 1147 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 1148 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 1149 | Thymoma | FAERS: 1 | US FAERS | |
| 1150 | Tongue discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1151 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 1152 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 1153 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 1154 | Tracheitis | FAERS: 1 | US FAERS | |
| 1155 | Transaminases increased | FAERS: 1 | US FAERS | |
| 1156 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 1157 | Traumatic liver injury | FAERS: 1 | US FAERS | |
| 1158 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1159 | Unemployment | FAERS: 1 | US FAERS | |
| 1160 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1161 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 1162 | Urethral caruncle | FAERS: 1 | US FAERS | |
| 1163 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 1164 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 1165 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 1166 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 1167 | Urine ketone body | FAERS: 1 | US FAERS | |
| 1168 | Urine output increased | FAERS: 1 | US FAERS | |
| 1169 | Urobilinuria | FAERS: 1 | US FAERS | |
| 1170 | Urological examination | FAERS: 1 | US FAERS | |
| 1171 | Vaginal Discharge | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1172 | Vascular bypass graft | FAERS: 1 | US FAERS | |
| 1173 | Vascular stent insertion | FAERS: 1 | US FAERS | |
| 1174 | Vasculitis | FAERS: 1 | US FAERS | |
| 1175 | Vein collapse | FAERS: 1 | US FAERS | |
| 1176 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 1177 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 1178 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 1179 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 1180 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 1181 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 1182 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 1183 | West Nile virus test positive | FAERS: 1 | US FAERS | |
| 1184 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 1185 | Wound Complication | FAERS: 1 | US FAERS | |
| 1186 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1187 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1188 | Wound sepsis | FAERS: 1 | US FAERS | |
| 1189 | Wrong dosage formulation | FAERS: 1 | US FAERS | |
| 1190 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 1191 | abdominal wall wound | FAERS: 1 | US FAERS | |
| 1192 | angiogram | FAERS: 1 | US FAERS | |
| 1193 | cancer surgery | FAERS: 1 | US FAERS | |
| 1194 | Amaurosis | SIDER | ||
| 1195 | Benign neoplasm of skin | SIDER | ||
| 1196 | Blood glucagon increased | Canada Vigilance: 1 | Canada Vigilance | |
| 1197 | Hypoglycaemic episode | SIDER | ||
| 1198 | Lipodystrophy | SIDER | ||
| 1199 | Metrorrhagia | Canada Vigilance: 1 | Canada Vigilance | |
| 1200 | Micronuclei, Chromosome-Defective | 27884723 | CTD | |
| 1201 | Neuroglycopenia | SIDER | ||
| 1202 | Ophthalmoplegia | Canada Vigilance: 1 | Canada Vigilance | |
| 1203 | Pharyngeal swelling | Canada Vigilance: 2 | Canada Vigilance | |
| 1204 | Pharyngitis | SIDER | ||
| 1205 | Redness | SIDER | ||
| 1206 | Tinea Pedis | Canada Vigilance: 1 | Canada Vigilance | |
| 1207 | Worsening of diabetes | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.