Aspirin-oxycodone hydrochloride-oxycodone terephthalate combination
(BRUQQQPBMZOVGD-XFKAJCMBSA-N)
Structure
- SMILES
- COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@]4(O)CCC1=O)C
- Type(s)
- Approved; Illicit; Investigational
- ATC code(s)
- N02AA05; N02AA55; N02AA56; N02AJ17; N02AJ18; N02AJ19
- Molecular Formula:
- C18H21NO4
- Molecular Weight:
- 315.364
- Log P:
- 0.9861
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 59
- CAS Number(s):
- 76-42-6
Synonym(s)
1.
Aspirin-oxycodone hydrochloride-oxycodone terephthalate combination
2.
Percodan
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug Dependence | FAERS: 2689 Canada Vigilance: 585 | Canada Vigilance SIDER US FAERS | |
| 2 | Drug abuser | FAERS: 1606 | OFFSIDES US FAERS | |
| 3 | Drug withdrawal syndrome | FAERS: 1007 Canada Vigilance: 91 | Canada Vigilance SIDER US FAERS | |
| 4 | Drug abuse | FAERS: 977 Canada Vigilance: 482 | Canada Vigilance SIDER US FAERS | |
| 5 | Pain | FAERS: 939 Canada Vigilance: 31 |
1508838
2902362 6111570 7562497 8487060 8803381 9751092 11775926 17906213 18473019 18575163 19838028 20062554 20590588 21875950 26377394 26688378 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 6 | Overdose | FAERS: 907 Canada Vigilance: 36 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Drug ineffective | FAERS: 873 Canada Vigilance: 180 | Canada Vigilance OFFSIDES US FAERS | |
| 8 | Nausea | FAERS: 667 Canada Vigilance: 40 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 9 | Vomiting | FAERS: 538 Canada Vigilance: 30 | 8901078 19838028 21875950 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Anxiety | FAERS: 457 Canada Vigilance: 12 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Inadequate analgesia | FAERS: 390 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Headache | FAERS: 361 Canada Vigilance: 11 | 8901078 18575163 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Malaise | FAERS: 342 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 14 | Constipation | FAERS: 286 Canada Vigilance: 13 | CTD SIDER Canada Vigilance US FAERS | |
| 15 | Somnolence | FAERS: 237 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 16 | Feeling abnormal | FAERS: 229 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Completed Suicide | FAERS: 218 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Unevaluable event | FAERS: 192 | US FAERS | |
| 19 | Product formulation issue | FAERS: 191 | US FAERS | |
| 20 | Dizziness | FAERS: 186 Canada Vigilance: 21 | 8901078 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 21 | Euphoric mood | FAERS: 179 Canada Vigilance: 44 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Tremor | FAERS: 170 Canada Vigilance: 16 | 11210406 | CTD SIDER Canada Vigilance US FAERS |
| 23 | Pruritus | FAERS: 161 Canada Vigilance: 35 | 8901078 | CTD SIDER Canada Vigilance US FAERS |
| 24 | Drug Tolerance | FAERS: 160 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Paranoia | FAERS: 141 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 26 | Pharmaceutical product complaint | FAERS: 139 | OFFSIDES US FAERS | |
| 27 | Product substitution issue | FAERS: 136 Canada Vigilance: 56 | Canada Vigilance US FAERS | |
| 28 | Intentional drug misuse | FAERS: 131 | OFFSIDES US FAERS | |
| 29 | Myocardial Infarction | FAERS: 129 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 30 | Suicide attempt | FAERS: 129 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 31 | Medication Error | FAERS: 127 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Accidental overdose | FAERS: 125 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Fatigue | FAERS: 122 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 34 | Pneumonia | FAERS: 122 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Abdominal discomfort | FAERS: 120 Canada Vigilance: 10 | Canada Vigilance OFFSIDES US FAERS | |
| 36 | Delusional disorder, unspecified type | FAERS: 120 | US FAERS | |
| 37 | Amnesia | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 38 | Obsessive-Compulsive Disorder | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Product quality issue | FAERS: 110 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 40 | Weight decreased | FAERS: 109 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 41 | Respiratory Depression | FAERS: 105 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 42 | Respiratory arrest | FAERS: 100 | SIDER US FAERS | |
| 43 | Asthenia | FAERS: 92 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 44 | Back Pain | FAERS: 88 Canada Vigilance: 1 | 16669750 19996237 20440598 | CTD SIDER Canada Vigilance US FAERS |
| 45 | Delirium | FAERS: 87 | 19838028 | CTD SIDER US FAERS |
| 46 | Cardiac Arrest | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Malignant neoplasm progression | FAERS: 82 | US FAERS | |
| 48 | Cerebrovascular accident | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Therapeutic response unexpected with drug substitution | FAERS: 81 | OFFSIDES US FAERS | |
| 50 | Chills | FAERS: 78 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 51 | Wrong technique in drug usage process | FAERS: 78 | OFFSIDES US FAERS | |
| 52 | Abdominal Pain | FAERS: 74 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 53 | Urticaria | FAERS: 73 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 54 | Agitation | FAERS: 69 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 55 | Lethargy | FAERS: 68 Canada Vigilance: 2 | 23783165 | CTD OFFSIDES Canada Vigilance US FAERS |
| 56 | Activities of daily living impaired | FAERS: 67 | OFFSIDES US FAERS | |
| 57 | General physical health deterioration | FAERS: 65 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 58 | Emotional distress | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 59 | Memory impairment | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 60 | Unresponsive to stimuli | FAERS: 61 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 61 | Depressed Level of Consciousness | FAERS: 59 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 62 | Dyspepsia | FAERS: 58 Canada Vigilance: 5 | 9751092 | CTD SIDER Canada Vigilance US FAERS |
| 63 | Mood swings | FAERS: 58 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 64 | Hypotension | FAERS: 56 | SIDER US FAERS | |
| 65 | Intentional product use issue | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Carcinoma | FAERS: 55 | US FAERS | |
| 67 | Polysubstance abuse | FAERS: 54 | OFFSIDES US FAERS | |
| 68 | Wrong technique in product usage process | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Mental impairment | FAERS: 53 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 70 | Chest Pain | FAERS: 52 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 71 | Nervousness | FAERS: 52 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 72 | Impaired work ability | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Medication residue | FAERS: 50 | OFFSIDES US FAERS | |
| 74 | Palpitations | FAERS: 50 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 75 | Toxicity to various agents | FAERS: 50 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 76 | Anger | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 77 | Medication residue present | FAERS: 49 | US FAERS | |
| 78 | Intentional product misuse | FAERS: 48 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 79 | Anhedonia | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Mental status changes | FAERS: 45 | OFFSIDES US FAERS | |
| 81 | Dehydration | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 82 | Personality Change | FAERS: 44 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 83 | Hypersensitivity | FAERS: 43 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 84 | Impaired driving ability | FAERS: 42 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 85 | Cold sweat | FAERS: 41 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 86 | Respiratory Failure | FAERS: 41 | OFFSIDES SIDER US FAERS | |
| 87 | Accidental drug intake by child | FAERS: 40 | US FAERS | |
| 88 | Drug effect delayed | FAERS: 40 | US FAERS | |
| 89 | Anorexia | FAERS: 38 | OFFSIDES SIDER US FAERS | |
| 90 | Disorientation | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 91 | Incorrect dose administered | FAERS: 38 | US FAERS | |
| 92 | Accidental exposure | FAERS: 37 | US FAERS | |
| 93 | Crying | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 94 | Drug exposure during pregnancy | FAERS: 37 | US FAERS | |
| 95 | Incorrect route of drug administration | FAERS: 37 | US FAERS | |
| 96 | Hepatitis C | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 97 | Abasia | FAERS: 35 | OFFSIDES US FAERS | |
| 98 | Intestinal Obstruction | FAERS: 34 | SIDER US FAERS | |
| 99 | Dysarthria | FAERS: 33 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 100 | Thrombosis | FAERS: 33 | US FAERS | |
| 101 | Breakthrough Pain | FAERS: 32 | SIDER US FAERS | |
| 102 | Bedridden | FAERS: 31 | SIDER US FAERS | |
| 103 | Drug toxicity | FAERS: 31 | OFFSIDES US FAERS | |
| 104 | Pancreatitis | FAERS: 31 | OFFSIDES US FAERS | |
| 105 | Tooth Loss | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 106 | Restlessness | FAERS: 29 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 107 | Swelling | FAERS: 29 | SIDER US FAERS | |
| 108 | Arthralgia | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 109 | Disability | FAERS: 28 | US FAERS | |
| 110 | Flatulence | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 111 | Hypersomnia | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Dependence | FAERS: 27 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 113 | Hypoxia | FAERS: 27 | OFFSIDES US FAERS | |
| 114 | Multiple drug overdose | FAERS: 27 | OFFSIDES US FAERS | |
| 115 | Product solubility abnormal | FAERS: 27 | US FAERS | |
| 116 | Asthma | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 117 | Cyanosis | FAERS: 26 | SIDER US FAERS | |
| 118 | Diabetes Mellitus | FAERS: 26 | US FAERS | |
| 119 | Myalgia | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 120 | Inappropriate schedule of drug administration | FAERS: 25 | OFFSIDES US FAERS | |
| 121 | Intentional misuse | FAERS: 25 | US FAERS | |
| 122 | Product taste abnormal | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Quality of life decreased | FAERS: 25 | US FAERS | |
| 124 | Theft | FAERS: 25 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 125 | Blood glucose increased | FAERS: 24 | US FAERS | |
| 126 | Sepsis | FAERS: 24 | SIDER US FAERS | |
| 127 | Syncope | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 128 | Choking | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 129 | Infection | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 130 | Cellulitis | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 131 | Chest discomfort | FAERS: 22 | SIDER US FAERS | |
| 132 | Formication | FAERS: 22 | OFFSIDES US FAERS | |
| 133 | Stress | FAERS: 22 | OFFSIDES US FAERS | |
| 134 | nervous system disorder | FAERS: 21 | SIDER US FAERS | |
| 135 | Bronchitis | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 136 | Neck Pain | FAERS: 20 | 16669750 | CTD SIDER US FAERS |
| 137 | Nerve injury | FAERS: 20 | US FAERS | |
| 138 | Pulmonary Embolism | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Tinnitus | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 140 | Drug diversion | FAERS: 19 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 141 | Feeling Cold | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 142 | Urinary Retention | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 143 | Deafness | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 144 | Dental caries | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 145 | Drug effect incomplete | FAERS: 18 | US FAERS | |
| 146 | Feeling jittery | FAERS: 18 | US FAERS | |
| 147 | Nephrolithiasis | FAERS: 18 | OFFSIDES US FAERS | |
| 148 | Poisoning | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Product physical issue | FAERS: 18 | US FAERS | |
| 150 | Retching | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 151 | Urinary tract infection | FAERS: 18 | SIDER US FAERS | |
| 152 | Victim of homicide | FAERS: 18 | US FAERS | |
| 153 | Accidental exposure to product by child | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 154 | Atrial Fibrillation | FAERS: 17 | US FAERS | |
| 155 | Brain Death | FAERS: 17 | US FAERS | |
| 156 | Drug dispensing error | FAERS: 17 | US FAERS | |
| 157 | Drug dose omission | FAERS: 17 | OFFSIDES US FAERS | |
| 158 | Drug level increased | FAERS: 17 | US FAERS | |
| 159 | Emotional disorder | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 160 | Influenza | FAERS: 17 | SIDER US FAERS | |
| 161 | Intentional self-injury | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 162 | Visual Impairment | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 163 | Ankle Fracture | FAERS: 16 | OFFSIDES US FAERS | |
| 164 | Arthritis | FAERS: 16 | SIDER US FAERS | |
| 165 | Exposure via ingestion | FAERS: 16 | US FAERS | |
| 166 | Flushing | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 167 | Maternal exposure during pregnancy | FAERS: 16 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 168 | Product size issue | FAERS: 16 | US FAERS | |
| 169 | Depressed mood | FAERS: 15 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 170 | Drug screen positive | FAERS: 15 | US FAERS | |
| 171 | Feeling of body temperature change | FAERS: 15 | US FAERS | |
| 172 | Hypophagia | FAERS: 15 | OFFSIDES US FAERS | |
| 173 | Night sweats | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 174 | Pallor | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 175 | Respiratory distress | FAERS: 15 | US FAERS | |
| 176 | Stupor | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 177 | Tooth Extraction | FAERS: 15 | OFFSIDES US FAERS | |
| 178 | Bone pain | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 179 | Burning sensation | FAERS: 14 | OFFSIDES US FAERS | |
| 180 | Discomfort | FAERS: 14 | SIDER US FAERS | |
| 181 | Dysuria | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 182 | Extra dose administered | FAERS: 14 | US FAERS | |
| 183 | Limb injury | FAERS: 14 | OFFSIDES US FAERS | |
| 184 | Metabolic acidosis | FAERS: 14 | OFFSIDES US FAERS | |
| 185 | No adverse event | FAERS: 14 | US FAERS | |
| 186 | Pancreatic carcinoma | FAERS: 14 | US FAERS | |
| 187 | Tachycardia | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 188 | Visual disturbance | FAERS: 14 | OFFSIDES US FAERS | |
| 189 | Aphasia | FAERS: 13 | US FAERS | |
| 190 | Cholelithiasis | FAERS: 13 | US FAERS | |
| 191 | Disease Progression | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 192 | Musculoskeletal stiffness | FAERS: 13 | OFFSIDES US FAERS | |
| 193 | Osteomyelitis | FAERS: 13 | US FAERS | |
| 194 | Post procedural complication | FAERS: 13 | US FAERS | |
| 195 | Restless Legs Syndrome | FAERS: 13 | 18656214 | CTD US FAERS |
| 196 | Skin Ulcer | FAERS: 13 | US FAERS | |
| 197 | Blindness | FAERS: 12 | US FAERS | |
| 198 | Gastric Bypass | FAERS: 12 | US FAERS | |
| 199 | Homicide | FAERS: 12 | US FAERS | |
| 200 | Joint injury | FAERS: 12 | US FAERS | |
| 201 | Spinal fusion surgery | FAERS: 12 | US FAERS | |
| 202 | Suspected counterfeit product | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Toxic leukoencephalopathy | FAERS: 12 | US FAERS | |
| 204 | Urinary Incontinence | FAERS: 12 | US FAERS | |
| 205 | Vertigo | FAERS: 12 Canada Vigilance: 1 | 19838028 | CTD SIDER Canada Vigilance US FAERS |
| 206 | Drug prescribing error | FAERS: 11 | OFFSIDES US FAERS | |
| 207 | Dysgeusia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 208 | Eructation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 209 | Erythema | FAERS: 11 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 210 | Fibromyalgia | FAERS: 11 | OFFSIDES US FAERS | |
| 211 | Gastritis | FAERS: 11 | SIDER US FAERS | |
| 212 | Hernia | FAERS: 11 | OFFSIDES US FAERS | |
| 213 | Incoherent | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Joint swelling | FAERS: 11 | US FAERS | |
| 215 | Leukoencephalopathy | FAERS: 11 | OFFSIDES US FAERS | |
| 216 | Metastatic Neoplasm | FAERS: 11 | US FAERS | |
| 217 | Middle insomnia | FAERS: 11 | OFFSIDES US FAERS | |
| 218 | Musculoskeletal Pain | FAERS: 11 | US FAERS | |
| 219 | Nasopharyngitis | FAERS: 11 | SIDER US FAERS | |
| 220 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 221 | Paroxysmal sympathetic hyperactivity | FAERS: 11 | US FAERS | |
| 222 | Physical assault | FAERS: 11 | US FAERS | |
| 223 | Pulmonary Hypertension | FAERS: 11 | US FAERS | |
| 224 | Quadriplegia | FAERS: 11 | US FAERS | |
| 225 | Sinusitis | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 226 | Sudden death | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Therapeutic product effect decreased | FAERS: 11 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 228 | Thermal burn | FAERS: 11 | US FAERS | |
| 229 | Accidental exposure to product | FAERS: 10 | US FAERS | |
| 230 | Drug screen negative | FAERS: 10 | US FAERS | |
| 231 | Large intestine perforation | FAERS: 10 | US FAERS | |
| 232 | Murder | FAERS: 10 | US FAERS | |
| 233 | Osteoporosis | FAERS: 10 | OFFSIDES US FAERS | |
| 234 | Right ventricular failure | FAERS: 10 | US FAERS | |
| 235 | Stomatitis | FAERS: 10 | SIDER US FAERS | |
| 236 | Tooth Infection | FAERS: 10 | US FAERS | |
| 237 | Wheezing | FAERS: 10 | SIDER US FAERS | |
| 238 | Alopecia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Angina Pectoris | FAERS: 9 | US FAERS | |
| 240 | Apathy | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Apparent death | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Back disorder | FAERS: 9 | OFFSIDES US FAERS | |
| 243 | Exposure during breast feeding | FAERS: 9 | US FAERS | |
| 244 | Gastrointestinal Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 245 | Hypoventilation | FAERS: 9 | US FAERS | |
| 246 | Injection site infection | FAERS: 9 | US FAERS | |
| 247 | Intervertebral Disc Degeneration | FAERS: 9 | US FAERS | |
| 248 | Lip swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 249 | Malabsorption | FAERS: 9 | US FAERS | |
| 250 | Pulmonary toxicity | FAERS: 9 | US FAERS | |
| 251 | Sciatica | FAERS: 9 | US FAERS | |
| 252 | Sinus Tachycardia | FAERS: 9 | US FAERS | |
| 253 | Skin lesion | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 254 | Somnambulism | FAERS: 9 | US FAERS | |
| 255 | Aphagia | FAERS: 8 | US FAERS | |
| 256 | Aspartate Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 257 | Asphyxia | FAERS: 8 | US FAERS | |
| 258 | Blood potassium decreased | FAERS: 8 | US FAERS | |
| 259 | Bradycardia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 260 | Drug dose titration not performed | FAERS: 8 | US FAERS | |
| 261 | Electrolyte imbalance | FAERS: 8 | US FAERS | |
| 262 | Epistaxis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 263 | Feelings of worthlessness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Gastric ulcer | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Hepatitis | FAERS: 8 | SIDER US FAERS | |
| 266 | Hypokinesia | FAERS: 8 | SIDER US FAERS | |
| 267 | Increased upper airway secretion | FAERS: 8 | US FAERS | |
| 268 | Inflammation | FAERS: 8 | US FAERS | |
| 269 | Peripheral swelling | FAERS: 8 | US FAERS | |
| 270 | Rash erythematous | FAERS: 8 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 271 | Reaction to drug excipients | FAERS: 8 | US FAERS | |
| 272 | Shock | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 273 | Therapy non-responder | FAERS: 8 | US FAERS | |
| 274 | Throat irritation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Altered state of consciousness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 276 | Blood glucose decreased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Blood potassium increased | FAERS: 7 | US FAERS | |
| 278 | Dry skin | FAERS: 7 | SIDER US FAERS | |
| 279 | Economic problem | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Endocarditis | FAERS: 7 | US FAERS | |
| 281 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 282 | Loss of personal independence in daily activities | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Mydriasis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 284 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 285 | Product coating issue | FAERS: 7 | US FAERS | |
| 286 | Product residue present | FAERS: 7 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 287 | Rheumatoid Arthritis | FAERS: 7 | US FAERS | |
| 288 | Skin laceration | FAERS: 7 | OFFSIDES US FAERS | |
| 289 | Snoring | FAERS: 7 | US FAERS | |
| 290 | Wrong drug administered | FAERS: 7 | US FAERS | |
| 291 | jaundice | FAERS: 7 | US FAERS | |
| 292 | Abscess | FAERS: 6 | OFFSIDES US FAERS | |
| 293 | Accidental death | FAERS: 6 | US FAERS | |
| 294 | Acute Lung Injury | FAERS: 6 | US FAERS | |
| 295 | Akathisia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Arteriosclerosis | FAERS: 6 | US FAERS | |
| 297 | Bipolar Disorder | FAERS: 6 | US FAERS | |
| 298 | Candidiasis | FAERS: 6 | US FAERS | |
| 299 | Cataract | FAERS: 6 | US FAERS | |
| 300 | Colitis | FAERS: 6 | US FAERS | |
| 301 | Cystitis | FAERS: 6 | US FAERS | |
| 302 | Dementia | FAERS: 6 | US FAERS | |
| 303 | Device related infection | FAERS: 6 | US FAERS | |
| 304 | Diverticulitis | FAERS: 6 | OFFSIDES US FAERS | |
| 305 | Drug withdrawal convulsions | FAERS: 6 | US FAERS | |
| 306 | Erectile dysfunction | FAERS: 6 | SIDER US FAERS | |
| 307 | Hepatotoxicity | FAERS: 6 | US FAERS | |
| 308 | Impaired gastric emptying | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 309 | Intestinal Perforation | FAERS: 6 | US FAERS | |
| 310 | Leukocytosis | FAERS: 6 | US FAERS | |
| 311 | Limb operation | FAERS: 6 | US FAERS | |
| 312 | Metastasis | FAERS: 6 | US FAERS | |
| 313 | Obesity | FAERS: 6 | US FAERS | |
| 314 | Polysubstance dependence | FAERS: 6 | US FAERS | |
| 315 | Product dose omission | FAERS: 6 | US FAERS | |
| 316 | Productive Cough | FAERS: 6 | OFFSIDES US FAERS | |
| 317 | Renal pain | FAERS: 6 | US FAERS | |
| 318 | Rotator cuff syndrome | FAERS: 6 | US FAERS | |
| 319 | Screaming | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Sexual Dysfunction | FAERS: 6 | US FAERS | |
| 321 | Stool analysis abnormal | FAERS: 6 | US FAERS | |
| 322 | Tachyphrenia | FAERS: 6 | US FAERS | |
| 323 | Throat cancer | FAERS: 6 | US FAERS | |
| 324 | Transaminases increased | FAERS: 6 | US FAERS | |
| 325 | Ventricular Fibrillation | FAERS: 6 | OFFSIDES US FAERS | |
| 326 | muscle injury | FAERS: 6 | OFFSIDES US FAERS | |
| 327 | Acute respiratory failure | FAERS: 5 | US FAERS | |
| 328 | Adverse event | FAERS: 5 | US FAERS | |
| 329 | Basal cell carcinoma | FAERS: 5 | US FAERS | |
| 330 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 331 | Bronchopneumonia | FAERS: 5 | OFFSIDES US FAERS | |
| 332 | Cardiac Flutter | FAERS: 5 | US FAERS | |
| 333 | Cataract operation | FAERS: 5 | US FAERS | |
| 334 | Chromaturia | FAERS: 5 | US FAERS | |
| 335 | Compression fracture | FAERS: 5 | US FAERS | |
| 336 | Drug administration error | FAERS: 5 | US FAERS | |
| 337 | Emotional poverty | FAERS: 5 | US FAERS | |
| 338 | Encephalitis | FAERS: 5 | US FAERS | |
| 339 | Expired product administered | FAERS: 5 | US FAERS | |
| 340 | Eye irritation | FAERS: 5 | US FAERS | |
| 341 | Fracture | FAERS: 5 | US FAERS | |
| 342 | Gastrointestinal motility disorder | FAERS: 5 | US FAERS | |
| 343 | Laceration | FAERS: 5 | OFFSIDES US FAERS | |
| 344 | Malnutrition | FAERS: 5 | SIDER US FAERS | |
| 345 | Negative thoughts | FAERS: 5 | US FAERS | |
| 346 | Neuropsychiatric syndrome | FAERS: 5 | US FAERS | |
| 347 | Open wound | FAERS: 5 | US FAERS | |
| 348 | Oral pain | FAERS: 5 | US FAERS | |
| 349 | Panic Disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 350 | Poor quality drug administered | FAERS: 5 | US FAERS | |
| 351 | Post procedural infection | FAERS: 5 | US FAERS | |
| 352 | Pressure of speech | FAERS: 5 | US FAERS | |
| 353 | Product tampering | FAERS: 5 | OFFSIDES US FAERS | |
| 354 | Psychiatric symptom | FAERS: 5 | US FAERS | |
| 355 | Regurgitation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 356 | Sneezing | FAERS: 5 | SIDER US FAERS | |
| 357 | Therapeutic response delayed | FAERS: 5 | US FAERS | |
| 358 | Toothache | FAERS: 5 | US FAERS | |
| 359 | Ulcer | FAERS: 5 | US FAERS | |
| 360 | Abnormal sleep-related event | FAERS: 4 | US FAERS | |
| 361 | Acquired Immunodeficiency Syndrome | FAERS: 4 | US FAERS | |
| 362 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 363 | Anaphylactic shock | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 364 | Anoxic Encephalopathy | FAERS: 4 | US FAERS | |
| 365 | Appendicitis | FAERS: 4 | US FAERS | |
| 366 | Atrial Flutter | FAERS: 4 | OFFSIDES US FAERS | |
| 367 | Ballismus | FAERS: 4 | US FAERS | |
| 368 | Blood creatinine increased | FAERS: 4 | US FAERS | |
| 369 | Blood glucose abnormal | FAERS: 4 | US FAERS | |
| 370 | Blood testosterone decreased | FAERS: 4 | US FAERS | |
| 371 | Blood urine present | FAERS: 4 | US FAERS | |
| 372 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 373 | Coma scale abnormal | FAERS: 4 | US FAERS | |
| 374 | Consciousness fluctuating | FAERS: 4 | US FAERS | |
| 375 | Deformity | FAERS: 4 | US FAERS | |
| 376 | Depression suicidal | FAERS: 4 | OFFSIDES US FAERS | |
| 377 | Drug exposure via breast milk | FAERS: 4 | US FAERS | |
| 378 | Eye pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Frustration tolerance decreased | FAERS: 4 | US FAERS | |
| 380 | Gastrointestinal infection | FAERS: 4 | US FAERS | |
| 381 | Hydrocephalus | FAERS: 4 | 20440598 | CTD US FAERS |
| 382 | Hypercapnia | FAERS: 4 | OFFSIDES US FAERS | |
| 383 | Hypothalamic pituitary adrenal axis suppression | FAERS: 4 | US FAERS | |
| 384 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 385 | Hysterectomy | FAERS: 4 | OFFSIDES US FAERS | |
| 386 | Ileus | FAERS: 4 | SIDER US FAERS | |
| 387 | Immobile | FAERS: 4 | US FAERS | |
| 388 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 389 | Injection site abscess | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Limb crushing injury | FAERS: 4 | US FAERS | |
| 391 | Maternal exposure timing unspecified | FAERS: 4 | US FAERS | |
| 392 | Medical device implantation | FAERS: 4 | US FAERS | |
| 393 | Multiple Myeloma | FAERS: 4 | US FAERS | |
| 394 | Multiple drug overdose accidental | FAERS: 4 | US FAERS | |
| 395 | Multiple drug overdose intentional | FAERS: 4 | US FAERS | |
| 396 | Muscle Cramp | FAERS: 4 | US FAERS | |
| 397 | Muscle tightness | FAERS: 4 | OFFSIDES US FAERS | |
| 398 | No adverse effect | FAERS: 4 | US FAERS | |
| 399 | Opiates positive | FAERS: 4 | US FAERS | |
| 400 | Partner stress | FAERS: 4 | US FAERS | |
| 401 | Physical abuse | FAERS: 4 | US FAERS | |
| 402 | Post-Traumatic Stress Disorder | FAERS: 4 | US FAERS | |
| 403 | Product measured potency issue | FAERS: 4 | US FAERS | |
| 404 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 405 | Pulmonary congestion | FAERS: 4 | OFFSIDES US FAERS | |
| 406 | Pulmonary granuloma | FAERS: 4 | US FAERS | |
| 407 | Pulmonary thrombosis | FAERS: 4 | US FAERS | |
| 408 | Rhabdomyolysis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 409 | Rhonchi | FAERS: 4 | US FAERS | |
| 410 | Scab | FAERS: 4 | US FAERS | |
| 411 | Sluggishness | FAERS: 4 | US FAERS | |
| 412 | Terminal state | FAERS: 4 | US FAERS | |
| 413 | Troponin increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 414 | Walking aid user | FAERS: 4 | US FAERS | |
| 415 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 416 | Yawning | FAERS: 4 | SIDER US FAERS | |
| 417 | furuncle | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 418 | Acidosis | FAERS: 3 | OFFSIDES US FAERS | |
| 419 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 420 | Ammonia increased | FAERS: 3 | US FAERS | |
| 421 | Angioedema | FAERS: 3 | SIDER US FAERS | |
| 422 | Aphonia | FAERS: 3 | US FAERS | |
| 423 | Autoimmune thyroiditis | FAERS: 3 | OFFSIDES US FAERS | |
| 424 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 425 | Blood pH decreased | FAERS: 3 | US FAERS | |
| 426 | Blood potassium abnormal | FAERS: 3 | US FAERS | |
| 427 | Blood urea increased | FAERS: 3 | US FAERS | |
| 428 | Bradyphrenia | FAERS: 3 | US FAERS | |
| 429 | Bruxism | FAERS: 3 | OFFSIDES US FAERS | |
| 430 | Cardiac ablation | FAERS: 3 | US FAERS | |
| 431 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 432 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 433 | Chemical burn of skin | FAERS: 3 | US FAERS | |
| 434 | Coccidioidomycosis | FAERS: 3 | US FAERS | |
| 435 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 436 | Cyst | FAERS: 3 | US FAERS | |
| 437 | Drooling | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Drowning | FAERS: 3 | US FAERS | |
| 439 | Drug addict | FAERS: 3 | OFFSIDES US FAERS | |
| 440 | Dysentery | FAERS: 3 | US FAERS | |
| 441 | Dysphemia | FAERS: 3 | US FAERS | |
| 442 | Endodontic procedure | FAERS: 3 | US FAERS | |
| 443 | Epilepsy | FAERS: 3 | US FAERS | |
| 444 | Foaming at mouth | FAERS: 3 | US FAERS | |
| 445 | Frustration | FAERS: 3 | OFFSIDES US FAERS | |
| 446 | Gait inability | FAERS: 3 | US FAERS | |
| 447 | Gangrene | FAERS: 3 | OFFSIDES US FAERS | |
| 448 | Hepatomegaly | FAERS: 3 | SIDER US FAERS | |
| 449 | Hostility | FAERS: 3 | US FAERS | |
| 450 | Hyperacusis | FAERS: 3 | US FAERS | |
| 451 | Hyperventilation | FAERS: 3 | SIDER US FAERS | |
| 452 | Inappropriate schedule of product administration | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 453 | Incorrect route of product administration | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 454 | Injury asphyxiation | FAERS: 3 | US FAERS | |
| 455 | Intervertebral disc disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 456 | Intestinal resection | FAERS: 3 | US FAERS | |
| 457 | Joint stiffness | FAERS: 3 | OFFSIDES US FAERS | |
| 458 | Lip and/or oral cavity cancer | FAERS: 3 | US FAERS | |
| 459 | Medical device complication | FAERS: 3 | US FAERS | |
| 460 | Monoplegia | FAERS: 3 | US FAERS | |
| 461 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 462 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 463 | Myoclonus | FAERS: 3 | US FAERS | |
| 464 | Myoglobin blood increased | FAERS: 3 | US FAERS | |
| 465 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 466 | Necrosis | FAERS: 3 | 16220857 | CTD US FAERS |
| 467 | Neuropathy | FAERS: 3 | US FAERS | |
| 468 | Patient uncooperative | FAERS: 3 | US FAERS | |
| 469 | Pneumothorax | FAERS: 3 | OFFSIDES US FAERS | |
| 470 | Poor peripheral circulation | FAERS: 3 | US FAERS | |
| 471 | Poor personal hygiene | FAERS: 3 | US FAERS | |
| 472 | Pregnancy | FAERS: 3 | US FAERS | |
| 473 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 474 | Product used for unknown indication | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 475 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 476 | Reaction to excipient | FAERS: 3 | US FAERS | |
| 477 | Secretion discharge | FAERS: 3 | OFFSIDES US FAERS | |
| 478 | Slow speech | FAERS: 3 | US FAERS | |
| 479 | Sopor | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 480 | Spinal column injury | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 481 | Spousal Abuse | FAERS: 3 | US FAERS | |
| 482 | Stridor | FAERS: 3 | OFFSIDES US FAERS | |
| 483 | Tension Headache | FAERS: 3 | US FAERS | |
| 484 | Therapeutic product effect incomplete | FAERS: 3 | US FAERS | |
| 485 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 486 | Thirst | FAERS: 3 | SIDER US FAERS | |
| 487 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 488 | Victim of sexual abuse | FAERS: 3 | US FAERS | |
| 489 | colonoscopy | FAERS: 3 | US FAERS | |
| 490 | Acne | FAERS: 2 | US FAERS | |
| 491 | Ageusia | FAERS: 2 | US FAERS | |
| 492 | Agoraphobia | FAERS: 2 | US FAERS | |
| 493 | Alcohol withdrawal syndrome | FAERS: 2 | US FAERS | |
| 494 | Amputation | FAERS: 2 | US FAERS | |
| 495 | Amyloidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 496 | Anal Fissure | FAERS: 2 | US FAERS | |
| 497 | Aneurysm | FAERS: 2 | US FAERS | |
| 498 | Animal bite | FAERS: 2 | US FAERS | |
| 499 | Anion gap abnormal | FAERS: 2 | US FAERS | |
| 500 | Anoxia | FAERS: 2 | US FAERS | |
| 501 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 502 | Apallic syndrome | FAERS: 2 | US FAERS | |
| 503 | Arthropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 504 | Arthropod bite | FAERS: 2 | OFFSIDES US FAERS | |
| 505 | Ataxia | FAERS: 2 | US FAERS | |
| 506 | Atherosclerosis | FAERS: 2 | US FAERS | |
| 507 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 508 | Biopsy | FAERS: 2 | US FAERS | |
| 509 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 510 | Bladder pain | FAERS: 2 | US FAERS | |
| 511 | Bladder prolapse | FAERS: 2 | US FAERS | |
| 512 | Blepharospasm | FAERS: 2 | OFFSIDES US FAERS | |
| 513 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 514 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 515 | Blood creatine phosphokinase MB increased | FAERS: 2 | US FAERS | |
| 516 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 517 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 518 | Bone density decreased | FAERS: 2 | US FAERS | |
| 519 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 520 | Cachexia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 521 | Cancer Pain | FAERS: 2 | US FAERS | |
| 522 | Carbon Monoxide Poisoning | FAERS: 2 | US FAERS | |
| 523 | Cardiac infection | FAERS: 2 | US FAERS | |
| 524 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 525 | Catatonia | FAERS: 2 | US FAERS | |
| 526 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 527 | Cheyne-Stokes Respiration | FAERS: 2 | SIDER US FAERS | |
| 528 | Cholelithotomy | FAERS: 2 | US FAERS | |
| 529 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 530 | Circumstance or information capable of leading to medication error | FAERS: 2 | OFFSIDES US FAERS | |
| 531 | Cleft Palate | FAERS: 2 | US FAERS | |
| 532 | Coma acidotic | FAERS: 2 | US FAERS | |
| 533 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 534 | Diplegia | FAERS: 2 | US FAERS | |
| 535 | Diplopia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 536 | Diverticular perforation | FAERS: 2 | US FAERS | |
| 537 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 538 | Drug clearance increased | FAERS: 2 | US FAERS | |
| 539 | Drug exposure before pregnancy | FAERS: 2 | US FAERS | |
| 540 | Dysphonia | FAERS: 2 | US FAERS | |
| 541 | Dystonia | FAERS: 2 | US FAERS | |
| 542 | Embolism | FAERS: 2 | US FAERS | |
| 543 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 544 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 545 | Exsanguination | FAERS: 2 | US FAERS | |
| 546 | Failure to Thrive | FAERS: 2 | OFFSIDES US FAERS | |
| 547 | Flat affect | FAERS: 2 | US FAERS | |
| 548 | Food Poisoning | FAERS: 2 | US FAERS | |
| 549 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 550 | Foreign body trauma | FAERS: 2 | US FAERS | |
| 551 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 552 | Gastrectomy | FAERS: 2 | US FAERS | |
| 553 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 554 | Gastrointestinal viral infection | FAERS: 2 | US FAERS | |
| 555 | Glycopeptide antibiotic resistant enterococcal infection | FAERS: 2 | US FAERS | |
| 556 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 557 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 558 | Head discomfort | FAERS: 2 | US FAERS | |
| 559 | Hemiparesis | FAERS: 2 | US FAERS | |
| 560 | Hemiplegia | FAERS: 2 | US FAERS | |
| 561 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 562 | Hip surgery | FAERS: 2 | US FAERS | |
| 563 | Hospice Care | FAERS: 2 | US FAERS | |
| 564 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 565 | Hypogonadism | FAERS: 2 | SIDER US FAERS | |
| 566 | Hypoperfusion | FAERS: 2 | US FAERS | |
| 567 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 568 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 569 | Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 570 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 571 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 572 | Initial insomnia | FAERS: 2 | US FAERS | |
| 573 | Injection site cellulitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 574 | Inspiratory capacity decreased | FAERS: 2 | US FAERS | |
| 575 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 576 | Joint Instability | FAERS: 2 | US FAERS | |
| 577 | Joint Range of Motion Decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 578 | Ketoacidosis | FAERS: 2 | US FAERS | |
| 579 | Lipase increased | FAERS: 2 | US FAERS | |
| 580 | Liver transplant rejection | FAERS: 2 | US FAERS | |
| 581 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 582 | Lymphadenopathy | FAERS: 2 | SIDER US FAERS | |
| 583 | Lymphoma | FAERS: 2 | OFFSIDES US FAERS | |
| 584 | Medical device removal | FAERS: 2 | US FAERS | |
| 585 | Meniscus injury | FAERS: 2 | US FAERS | |
| 586 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 587 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 588 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 589 | Nerve Block | FAERS: 2 | US FAERS | |
| 590 | Nerve Root Compression | FAERS: 2 | US FAERS | |
| 591 | Neuralgia | FAERS: 2 Canada Vigilance: 1 | 18306017 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 592 | Nicotine Dependence | FAERS: 2 | US FAERS | |
| 593 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 594 | Obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 595 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 596 | Oliguria | FAERS: 2 | US FAERS | |
| 597 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 598 | Oral infection | FAERS: 2 | US FAERS | |
| 599 | Oral pruritus | FAERS: 2 | US FAERS | |
| 600 | Osteoradionecrosis | FAERS: 2 | US FAERS | |
| 601 | PCO2 increased | FAERS: 2 | US FAERS | |
| 602 | Pancreatic Neoplasm | FAERS: 2 | US FAERS | |
| 603 | Paraplegia | FAERS: 2 | US FAERS | |
| 604 | Paresis | FAERS: 2 | US FAERS | |
| 605 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 606 | Peripheral embolism | FAERS: 2 | US FAERS | |
| 607 | Pharmaceutical product counterfeit | FAERS: 2 | US FAERS | |
| 608 | Photophobia | FAERS: 2 | US FAERS | |
| 609 | Physical examination abnormal | FAERS: 2 | US FAERS | |
| 610 | Polychondritis | FAERS: 2 | US FAERS | |
| 611 | Polyuria | FAERS: 2 | SIDER US FAERS | |
| 612 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 613 | Product administration error | FAERS: 2 | US FAERS | |
| 614 | Product commingling | FAERS: 2 | US FAERS | |
| 615 | Product complaint | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 616 | Product counterfeit | FAERS: 2 | US FAERS | |
| 617 | Product gel formation | FAERS: 2 | US FAERS | |
| 618 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 619 | Protein urine present | FAERS: 2 | US FAERS | |
| 620 | Pruritus allergic | FAERS: 2 | US FAERS | |
| 621 | Pulmonary Infarction | FAERS: 2 | US FAERS | |
| 622 | Purpura | FAERS: 2 | US FAERS | |
| 623 | Rebound effect | FAERS: 2 | US FAERS | |
| 624 | Renal cyst | FAERS: 2 | US FAERS | |
| 625 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 626 | Schizophrenia | FAERS: 2 | OFFSIDES US FAERS | |
| 627 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 628 | Small cell lung cancer metastatic | FAERS: 2 | US FAERS | |
| 629 | Small intestine carcinoma | FAERS: 2 | US FAERS | |
| 630 | Spinal column stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 631 | Spinal cord infection | FAERS: 2 | US FAERS | |
| 632 | Staring | FAERS: 2 | US FAERS | |
| 633 | Stillbirth | FAERS: 2 | US FAERS | |
| 634 | Substance Dependence | FAERS: 2 | US FAERS | |
| 635 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 636 | Suspected product tampering | FAERS: 2 | US FAERS | |
| 637 | Symptom masked | FAERS: 2 | US FAERS | |
| 638 | Tablet issue | FAERS: 2 | US FAERS | |
| 639 | Tenosynovitis | FAERS: 2 | US FAERS | |
| 640 | Therapy cessation | FAERS: 2 | US FAERS | |
| 641 | Troponin I increased | FAERS: 2 | US FAERS | |
| 642 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 643 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 644 | Vasculitis | FAERS: 2 | US FAERS | |
| 645 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 646 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 647 | Vulvovaginal mycotic infection | FAERS: 2 | OFFSIDES US FAERS | |
| 648 | treatment failure | FAERS: 2 | US FAERS | |
| 649 | AIDS related complication | FAERS: 1 | US FAERS | |
| 650 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 651 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 652 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 653 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 654 | Abscess management | FAERS: 1 | US FAERS | |
| 655 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 656 | Acute myocardial infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 657 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 658 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 659 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 660 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 661 | Allodynia | FAERS: 1 | US FAERS | |
| 662 | Amaurosis | FAERS: 1 | US FAERS | |
| 663 | Amnestic Disorder | FAERS: 1 | US FAERS | |
| 664 | Amylase increased | FAERS: 1 | US FAERS | |
| 665 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 666 | Analgesic drug level increased | FAERS: 1 | US FAERS | |
| 667 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 668 | Anorgasmia | FAERS: 1 | US FAERS | |
| 669 | Anosmia | FAERS: 1 | US FAERS | |
| 670 | Anuria | FAERS: 1 | US FAERS | |
| 671 | Arterial Injury | FAERS: 1 | US FAERS | |
| 672 | Ascites | FAERS: 1 | US FAERS | |
| 673 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 674 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 675 | Autoscopy | FAERS: 1 | US FAERS | |
| 676 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 677 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 678 | Biliary dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 679 | Biopsy kidney abnormal | FAERS: 1 | US FAERS | |
| 680 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 681 | Bladder cancer stage IV | FAERS: 1 | US FAERS | |
| 682 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 683 | Blood Corticotrophin Decreased | FAERS: 1 | US FAERS | |
| 684 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 685 | Blood cortisol abnormal | FAERS: 1 | US FAERS | |
| 686 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 687 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 688 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 689 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 690 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 691 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 692 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 693 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 694 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 695 | Bone abscess | FAERS: 1 | US FAERS | |
| 696 | Bone atrophy | FAERS: 1 | US FAERS | |
| 697 | Bone infarction | FAERS: 1 | US FAERS | |
| 698 | Brain Abscess | FAERS: 1 | US FAERS | |
| 699 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 700 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 701 | Breast Cyst | FAERS: 1 | US FAERS | |
| 702 | Breast necrosis | FAERS: 1 | US FAERS | |
| 703 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 704 | Bronchospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 705 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 706 | Calcinosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 707 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 708 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 709 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 710 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 711 | Cardiac valve sclerosis | FAERS: 1 | US FAERS | |
| 712 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 713 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 714 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 715 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 716 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 717 | Cheilitis | FAERS: 1 | US FAERS | |
| 718 | Chest wall pain | FAERS: 1 | US FAERS | |
| 719 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 720 | Cholecystitis | FAERS: 1 | US FAERS | |
| 721 | Cholecystostomy | FAERS: 1 | US FAERS | |
| 722 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 723 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 724 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 725 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 726 | Clumsiness | FAERS: 1 | US FAERS | |
| 727 | Coagulation factor V level abnormal | FAERS: 1 | US FAERS | |
| 728 | Coating in mouth | FAERS: 1 | US FAERS | |
| 729 | Cold exposure injury | FAERS: 1 | US FAERS | |
| 730 | Colectomy | FAERS: 1 | US FAERS | |
| 731 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 732 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 733 | Conversion disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 734 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 735 | Craniotomy | FAERS: 1 | US FAERS | |
| 736 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 737 | Culture wound positive | FAERS: 1 | US FAERS | |
| 738 | Death of relative | FAERS: 1 | US FAERS | |
| 739 | Deep Vein Thrombosis | FAERS: 1 | SIDER US FAERS | |
| 740 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 741 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 742 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 743 | Device ineffective | FAERS: 1 | US FAERS | |
| 744 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 745 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 746 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 747 | Diet refusal | FAERS: 1 | US FAERS | |
| 748 | Difficult to wean from ventilator | FAERS: 1 | US FAERS | |
| 749 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 750 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 751 | Dreamy state | FAERS: 1 | US FAERS | |
| 752 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 753 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 754 | Drug half-life reduced | FAERS: 1 | US FAERS | |
| 755 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 756 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 757 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 758 | Drug titration error | FAERS: 1 | US FAERS | |
| 759 | Drug use disorder, antepartum | FAERS: 1 | US FAERS | |
| 760 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 761 | Dyschezia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 762 | Dysgraphia | FAERS: 1 | US FAERS | |
| 763 | Ear discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 764 | Ecchymosis | FAERS: 1 | US FAERS | |
| 765 | Eczema | FAERS: 1 | US FAERS | |
| 766 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 767 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 768 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 769 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 770 | Endometritis | FAERS: 1 | US FAERS | |
| 771 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 772 | Essential Tremor | FAERS: 1 | US FAERS | |
| 773 | Excoriation | FAERS: 1 | US FAERS | |
| 774 | Executive dysfunction | FAERS: 1 | US FAERS | |
| 775 | Expired drug administered | FAERS: 1 | US FAERS | |
| 776 | Exploratory operation | FAERS: 1 | US FAERS | |
| 777 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 778 | Eye Redness | FAERS: 1 | US FAERS | |
| 779 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 780 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 781 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 782 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 783 | Facial paralysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 784 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 785 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 786 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 787 | Filariasis | FAERS: 1 | US FAERS | |
| 788 | Fine motor delay | FAERS: 1 | US FAERS | |
| 789 | Flank Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 790 | Food Allergy | FAERS: 1 | US FAERS | |
| 791 | Food craving | FAERS: 1 | US FAERS | |
| 792 | Foreign body embolism | FAERS: 1 | US FAERS | |
| 793 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 794 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 795 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 796 | Gastrointestinal disorder therapy | FAERS: 1 | US FAERS | |
| 797 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 798 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 799 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 800 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 801 | General symptom | FAERS: 1 | OFFSIDES US FAERS | |
| 802 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 803 | Giardiasis | FAERS: 1 | US FAERS | |
| 804 | Glossectomy | FAERS: 1 | US FAERS | |
| 805 | Gout | FAERS: 1 | SIDER US FAERS | |
| 806 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 807 | Head lag abnormal | FAERS: 1 | US FAERS | |
| 808 | Heat Stroke | FAERS: 1 | US FAERS | |
| 809 | Hepatitis B | FAERS: 1 | US FAERS | |
| 810 | Hoarseness | FAERS: 1 | US FAERS | |
| 811 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 812 | Human Bite | FAERS: 1 | US FAERS | |
| 813 | Hunger | FAERS: 1 | US FAERS | |
| 814 | Hyperphagia | FAERS: 1 | US FAERS | |
| 815 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 816 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 817 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 818 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 819 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 820 | Hypothermia neonatal | FAERS: 1 | US FAERS | |
| 821 | Ideas of reference | FAERS: 1 | US FAERS | |
| 822 | Impaired self-care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 823 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 824 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 825 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 826 | Infarction | FAERS: 1 | US FAERS | |
| 827 | Injection site injury | FAERS: 1 | US FAERS | |
| 828 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 829 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 830 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 831 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 832 | Internal injury | FAERS: 1 | US FAERS | |
| 833 | Intervertebral disc annular tear | FAERS: 1 | US FAERS | |
| 834 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 835 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 836 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 837 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 838 | Intraspinal abscess | FAERS: 1 | US FAERS | |
| 839 | Joint sprain | FAERS: 1 | US FAERS | |
| 840 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 841 | Laboratory test normal | FAERS: 1 | US FAERS | |
| 842 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 843 | Laziness | FAERS: 1 | US FAERS | |
| 844 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 845 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 846 | Leukoplakia | FAERS: 1 | US FAERS | |
| 847 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 848 | Life expectancy shortened | FAERS: 1 | OFFSIDES US FAERS | |
| 849 | Ligament injury | FAERS: 1 | US FAERS | |
| 850 | Ligament rupture | FAERS: 1 | US FAERS | |
| 851 | Limb reconstructive surgery | FAERS: 1 | US FAERS | |
| 852 | Live Birth | FAERS: 1 | US FAERS | |
| 853 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 854 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 855 | Lung Injury | FAERS: 1 | US FAERS | |
| 856 | Lung consolidation | FAERS: 1 | OFFSIDES US FAERS | |
| 857 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 858 | Mechanical ventilation | FAERS: 1 | OFFSIDES US FAERS | |
| 859 | Medical diet | FAERS: 1 | US FAERS | |
| 860 | Medication crystals in urine present | FAERS: 1 | US FAERS | |
| 861 | Megacolon | FAERS: 1 | US FAERS | |
| 862 | Mesothelioma | FAERS: 1 | US FAERS | |
| 863 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 864 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 865 | Metastases to abdominal wall | FAERS: 1 | US FAERS | |
| 866 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 867 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 868 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 869 | Mouth plaque | FAERS: 1 | US FAERS | |
| 870 | Mouth swelling | FAERS: 1 | US FAERS | |
| 871 | Mucocutaneous flap necrosis | FAERS: 1 | US FAERS | |
| 872 | Muscle Rigidity | FAERS: 1 | SIDER US FAERS | |
| 873 | Muscle contusion | FAERS: 1 | US FAERS | |
| 874 | Muscle strain | FAERS: 1 | US FAERS | |
| 875 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 876 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 877 | Myopathy | FAERS: 1 | US FAERS | |
| 878 | Narcotic Bowel Syndrome | FAERS: 1 | US FAERS | |
| 879 | Narcotic intoxication | FAERS: 1 | US FAERS | |
| 880 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 881 | Nasopharyngeal reflux | FAERS: 1 | US FAERS | |
| 882 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 883 | Nephrectomy | FAERS: 1 | US FAERS | |
| 884 | Neuralgic Amyotrophy | FAERS: 1 | US FAERS | |
| 885 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 886 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 887 | Nocturia | FAERS: 1 | US FAERS | |
| 888 | Nodule | FAERS: 1 | US FAERS | |
| 889 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 890 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 891 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 892 | Opisthotonus | FAERS: 1 | US FAERS | |
| 893 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 894 | Oral mucosal exfoliation | FAERS: 1 | OFFSIDES US FAERS | |
| 895 | Osmolar gap abnormal | FAERS: 1 | US FAERS | |
| 896 | Osteodystrophy | FAERS: 1 | US FAERS | |
| 897 | Osteolysis | FAERS: 1 | US FAERS | |
| 898 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 899 | Oxygen saturation abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 900 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 901 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 902 | Pain of skin | FAERS: 1 | OFFSIDES US FAERS | |
| 903 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 904 | Paranasal sinus necrosis | FAERS: 1 | US FAERS | |
| 905 | Patient-device incompatibility | FAERS: 1 | US FAERS | |
| 906 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 907 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 908 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 909 | Pharyngeal swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 910 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 911 | Physical disability | FAERS: 1 | US FAERS | |
| 912 | Piloerection | FAERS: 1 | SIDER US FAERS | |
| 913 | Plastic surgery to the face | FAERS: 1 | US FAERS | |
| 914 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 915 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 916 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 917 | Polydipsia | FAERS: 1 | US FAERS | |
| 918 | Polymyositis | FAERS: 1 | US FAERS | |
| 919 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 920 | Posturing | FAERS: 1 | US FAERS | |
| 921 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 922 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 923 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 924 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 925 | Presyncope | FAERS: 1 | US FAERS | |
| 926 | Procedural complication | FAERS: 1 | US FAERS | |
| 927 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 928 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 929 | Product container issue | FAERS: 1 | US FAERS | |
| 930 | Product contamination | FAERS: 1 | US FAERS | |
| 931 | Product contamination chemical | FAERS: 1 | US FAERS | |
| 932 | Product identification number issue | FAERS: 1 | US FAERS | |
| 933 | Product label confusion | FAERS: 1 | US FAERS | |
| 934 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 935 | Product packaging issue | FAERS: 1 | US FAERS | |
| 936 | Product preparation error | FAERS: 1 | US FAERS | |
| 937 | Product shape issue | FAERS: 1 | US FAERS | |
| 938 | Product sterility lacking | FAERS: 1 | US FAERS | |
| 939 | Product substitution | FAERS: 1 | US FAERS | |
| 940 | Product use complaint | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 941 | Prognathism | FAERS: 1 | US FAERS | |
| 942 | Prosthesis user | FAERS: 1 | US FAERS | |
| 943 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 944 | Psoriasis | FAERS: 1 | US FAERS | |
| 945 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 946 | Psychomotor skills impaired | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 947 | Pulmonary function test decreased | FAERS: 1 | SIDER US FAERS | |
| 948 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 949 | Pupillary deformity | FAERS: 1 | US FAERS | |
| 950 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 951 | Purulence | FAERS: 1 | US FAERS | |
| 952 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 953 | Rales | FAERS: 1 | US FAERS | |
| 954 | Rectal discharge | FAERS: 1 | US FAERS | |
| 955 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 956 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 957 | Renal Colic | FAERS: 1 | US FAERS | |
| 958 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 959 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 960 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 961 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 962 | Rhinitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 963 | Rickets | FAERS: 1 | US FAERS | |
| 964 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 965 | Right ventricular systolic pressure increased | FAERS: 1 | US FAERS | |
| 966 | Romberg test positive | FAERS: 1 | US FAERS | |
| 967 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 968 | Sarcoma | FAERS: 1 | US FAERS | |
| 969 | Schistocytosis | FAERS: 1 | US FAERS | |
| 970 | Scleroderma | FAERS: 1 | US FAERS | |
| 971 | Scotoma | FAERS: 1 | US FAERS | |
| 972 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 973 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 974 | Septic Shock | FAERS: 1 | US FAERS | |
| 975 | Septic embolus | FAERS: 1 | US FAERS | |
| 976 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 977 | Serum serotonin decreased | FAERS: 1 | US FAERS | |
| 978 | Sexual inhibition | FAERS: 1 | US FAERS | |
| 979 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 980 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 981 | Skeletal injury | FAERS: 1 | OFFSIDES US FAERS | |
| 982 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 983 | Skin irritation | FAERS: 1 | US FAERS | |
| 984 | Skin reaction | FAERS: 1 | US FAERS | |
| 985 | Sleep Talking | FAERS: 1 | OFFSIDES US FAERS | |
| 986 | Soliloquy | FAERS: 1 | US FAERS | |
| 987 | Spinal rod insertion | FAERS: 1 | US FAERS | |
| 988 | Splenectomy | FAERS: 1 | US FAERS | |
| 989 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 990 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 991 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 992 | Stenosis | FAERS: 1 | US FAERS | |
| 993 | Stoma creation | FAERS: 1 | US FAERS | |
| 994 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 995 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 996 | Suicide threat | FAERS: 1 | US FAERS | |
| 997 | Supraventricular tachycardia | FAERS: 1 | SIDER US FAERS | |
| 998 | Suture rupture | FAERS: 1 | US FAERS | |
| 999 | Synovial Cyst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1000 | Temperature difference of extremities | FAERS: 1 | US FAERS | |
| 1001 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 1002 | Tension | FAERS: 1 | SIDER US FAERS | |
| 1003 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1004 | Thoracotomy | FAERS: 1 | US FAERS | |
| 1005 | Tongue blistering | FAERS: 1 | US FAERS | |
| 1006 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 1007 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 1008 | Underweight | FAERS: 1 | US FAERS | |
| 1009 | Unemployment | FAERS: 1 | US FAERS | |
| 1010 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 1011 | Urethral Stenosis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 1012 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 1013 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1014 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1015 | Uterine spasm | FAERS: 1 | US FAERS | |
| 1016 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1017 | Vaginal Prolapse | FAERS: 1 | US FAERS | |
| 1018 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 1019 | Victim of child abuse | FAERS: 1 | US FAERS | |
| 1020 | Viral load decreased | FAERS: 1 | US FAERS | |
| 1021 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1022 | Visceral congestion | FAERS: 1 | US FAERS | |
| 1023 | Visual acuity tests abnormal | FAERS: 1 | US FAERS | |
| 1024 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1025 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1026 | White matter lesion | FAERS: 1 | US FAERS | |
| 1027 | Whole blood transfusion | FAERS: 1 | US FAERS | |
| 1028 | Wound infection staphylococcal | FAERS: 1 | OFFSIDES US FAERS | |
| 1029 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 1030 | Xanthopsia | FAERS: 1 | US FAERS | |
| 1031 | cancer surgery | FAERS: 1 | US FAERS | |
| 1032 | intensive care | FAERS: 1 | US FAERS | |
| 1033 | pH body fluid decreased | FAERS: 1 | US FAERS | |
| 1034 | skin abrasion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1035 | Abdominal Cramps | SIDER | ||
| 1036 | Abdominal colic | SIDER | ||
| 1037 | Abnormal vision | SIDER | ||
| 1038 | Abuse | OFFSIDES | ||
| 1039 | Ache | SIDER | ||
| 1040 | Actinic keratosis | OFFSIDES | ||
| 1041 | Actinomycosis | OFFSIDES | ||
| 1042 | Acute bronchitis | OFFSIDES | ||
| 1043 | Alcohol abuse | SIDER | ||
| 1044 | Alveolitis | OFFSIDES | ||
| 1045 | Alveoloplasty | OFFSIDES | ||
| 1046 | Amblyopia | SIDER | ||
| 1047 | Analgesia | OFFSIDES | ||
| 1048 | Anaphylactoid Reaction | SIDER | ||
| 1049 | Anemia, Sickle Cell | 18593679 | CTD | |
| 1050 | Anhidrosis | OFFSIDES | ||
| 1051 | Application site abscess | OFFSIDES | ||
| 1052 | Application site reaction | OFFSIDES | ||
| 1053 | Artificial crown procedure | OFFSIDES | ||
| 1054 | Aspiration Pneumonia | OFFSIDES | ||
| 1055 | Asthenic conditions | SIDER | ||
| 1056 | Aura | OFFSIDES | ||
| 1057 | Biliary Colic | SIDER | ||
| 1058 | Biopsy bone abnormal | OFFSIDES | ||
| 1059 | Bladder neck obstruction | OFFSIDES | ||
| 1060 | Blood Glucose | OFFSIDES | ||
| 1061 | Blood and lymphatic system disorders | SIDER | ||
| 1062 | Blood chloride decreased | OFFSIDES | ||
| 1063 | Blood cholesterol | OFFSIDES | ||
| 1064 | Blood creatine phosphokinase abnormal | OFFSIDES | ||
| 1065 | Blood phosphorus | OFFSIDES | ||
| 1066 | Blood sodium | OFFSIDES | ||
| 1067 | Blood triglycerides increased | OFFSIDES | ||
| 1068 | Blurred vision | OFFSIDES | ||
| 1069 | Bone callus excessive | OFFSIDES | ||
| 1070 | Bone marrow necrosis | OFFSIDES | ||
| 1071 | Breast Feeding | SIDER | ||
| 1072 | Breech Presentation | OFFSIDES | ||
| 1073 | Bronchoconstriction | SIDER | ||
| 1074 | Buccal mucosal roughening | OFFSIDES | ||
| 1075 | Bursitis | OFFSIDES | ||
| 1076 | CD4 Lymphocytes Decreased | OFFSIDES | ||
| 1077 | Cardioactive drug level | OFFSIDES | ||
| 1078 | Cardiovascular insufficiency | SIDER | ||
| 1079 | Carotid bruit | OFFSIDES | ||
| 1080 | Catheter related infection | OFFSIDES | ||
| 1081 | Causalgia | OFFSIDES | ||
| 1082 | Cerebellar Diseases | 20440598 | CTD | |
| 1083 | Cervicobrachial syndrome | OFFSIDES | ||
| 1084 | Chest tightness | SIDER | ||
| 1085 | Cholestasis | SIDER | ||
| 1086 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 1087 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 1088 | Circulatory depression | SIDER | ||
| 1089 | Cirrhosis | OFFSIDES | ||
| 1090 | Citrobacter infection | OFFSIDES | ||
| 1091 | Clostridium colitis | OFFSIDES | ||
| 1092 | Clostridium difficile sepsis | OFFSIDES | ||
| 1093 | Cognition Disorders | 19729346 | CTD | |
| 1094 | Confabulation | OFFSIDES | ||
| 1095 | Confusion | 15859444 20440598 | CTD | |
| 1096 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1097 | Cor pulmonale | OFFSIDES | ||
| 1098 | Corrective lens user | OFFSIDES | ||
| 1099 | Culture positive | OFFSIDES | ||
| 1100 | Cutis anserina | SIDER | ||
| 1101 | Cystocele | OFFSIDES | ||
| 1102 | Debridement | OFFSIDES | ||
| 1103 | Delayed gastric emptying | SIDER | ||
| 1104 | Dental abscess | OFFSIDES | ||
| 1105 | Dependent Personality Disorder | OFFSIDES | ||
| 1106 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 1107 | Device Failure | OFFSIDES | ||
| 1108 | Disorders of Excessive Somnolence | 8901078 | CTD | |
| 1109 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 1110 | Dissociative disorder | OFFSIDES | ||
| 1111 | Disturbance in sexual arousal | SIDER | ||
| 1112 | Drowsiness | OFFSIDES SIDER | ||
| 1113 | Drug Overdose | 20440598 | CTD | |
| 1114 | Drug administered at inappropriate site | OFFSIDES | ||
| 1115 | Drug withdrawal headache | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 1116 | Dyspareunia | OFFSIDES | ||
| 1117 | Dysthymic Disorder | OFFSIDES | ||
| 1118 | Ear and labyrinth disorders | SIDER | ||
| 1119 | Early satiety | SIDER | ||
| 1120 | Embolic stroke | OFFSIDES | ||
| 1121 | Enterococcal infection | OFFSIDES | ||
| 1122 | Enterocolitis viral | OFFSIDES | ||
| 1123 | Esophageal Stenosis | OFFSIDES | ||
| 1124 | Exposure via breast milk | Canada Vigilance: 1 | Canada Vigilance | |
| 1125 | Fluid overload | OFFSIDES | ||
| 1126 | Focal dyscognitive seizures | Canada Vigilance: 1 | Canada Vigilance | |
| 1127 | Fullness abdominal | SIDER | ||
| 1128 | Fungal rash | OFFSIDES | ||
| 1129 | Gagging | SIDER | ||
| 1130 | Gastrointestinal perforation | OFFSIDES | ||
| 1131 | Gingivitis | SIDER | ||
| 1132 | Glomerulonephritis | 12203209 | CTD | |
| 1133 | Glossitis | SIDER | ||
| 1134 | Granuloma | OFFSIDES | ||
| 1135 | Grip strength | OFFSIDES | ||
| 1136 | Hallucinations | 11210406 12837679 15859444 | CTD | |
| 1137 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 1138 | Hyperalgesia | 17906213 | CTD | |
| 1139 | Hyperkinesia | SIDER | ||
| 1140 | Hyperpigmentation | OFFSIDES | ||
| 1141 | Hypotensive | SIDER | ||
| 1142 | Infestation | SIDER | ||
| 1143 | Infusion site mobility decreased | OFFSIDES | ||
| 1144 | Infusion site reaction | OFFSIDES | ||
| 1145 | Injection site atrophy | OFFSIDES | ||
| 1146 | Injection site erythema | OFFSIDES | ||
| 1147 | Injection site hypersensitivity | SIDER | ||
| 1148 | Injection site phlebitis | OFFSIDES | ||
| 1149 | Joint warmth | OFFSIDES | ||
| 1150 | Karnofsky scale worsened | OFFSIDES | ||
| 1151 | Kidney Failure, Chronic | 12203209 | CTD | |
| 1152 | Kidney Failure | OFFSIDES | ||
| 1153 | Lacrimal structural disorder | SIDER | ||
| 1154 | Lacrimation | SIDER | ||
| 1155 | Laryngospasm | OFFSIDES SIDER | ||
| 1156 | Leukopenia neonatal | OFFSIDES | ||
| 1157 | Lightheadedness | SIDER | ||
| 1158 | Lipoatrophy | Canada Vigilance: 1 | Canada Vigilance | |
| 1159 | Low Back Pain | 15629415 17326594 | CTD | |
| 1160 | Lumbar radiculopathy | OFFSIDES | ||
| 1161 | Lyme Disease | OFFSIDES | ||
| 1162 | Malignant neoplasm of thorax | OFFSIDES | ||
| 1163 | Malignant tumour excision | OFFSIDES | ||
| 1164 | Mastectomy | OFFSIDES | ||
| 1165 | Maternal exposure during breast feeding | Canada Vigilance: 1 | Canada Vigilance | |
| 1166 | Memory Disorders | 19729346 | CTD | |
| 1167 | Metastatic Renal Cell Carcinoma | OFFSIDES | ||
| 1168 | Mouth Diseases | 16220857 | CTD | |
| 1169 | Muscle Weakness | OFFSIDES | ||
| 1170 | Muscle relaxant therapy | SIDER | ||
| 1171 | Musculoskeletal discomfort | SIDER | ||
| 1172 | Myeloma recurrence | OFFSIDES | ||
| 1173 | Myopia | OFFSIDES | ||
| 1174 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1175 | Opioid abuse | SIDER | ||
| 1176 | Opioid naive | SIDER | ||
| 1177 | Oral polypectomy | OFFSIDES | ||
| 1178 | Oropharyngitis fungal | OFFSIDES | ||
| 1179 | Osteopenia | OFFSIDES | ||
| 1180 | Pain worsened | SIDER | ||
| 1181 | Pain, Postoperative | CTD | ||
| 1182 | Paranasal sinus hypersecretion | OFFSIDES | ||
| 1183 | Periodontal infection | OFFSIDES | ||
| 1184 | Petechiae | Canada Vigilance: 1 | Canada Vigilance | |
| 1185 | Pleurisy | OFFSIDES | ||
| 1186 | Polyneuropathy | OFFSIDES | ||
| 1187 | Portal Hypertension | OFFSIDES | ||
| 1188 | Post procedural constipation | SIDER | ||
| 1189 | Postoperative constipation | SIDER | ||
| 1190 | Postoperative ileus | OFFSIDES | ||
| 1191 | Postoperative infection | OFFSIDES | ||
| 1192 | Priapism | Canada Vigilance: 1 | Canada Vigilance | |
| 1193 | Primary Effusion Lymphoma | OFFSIDES | ||
| 1194 | Primary sequestrum | OFFSIDES | ||
| 1195 | Pulmonary radiation injury | OFFSIDES | ||
| 1196 | Rectocele | OFFSIDES | ||
| 1197 | Respiratory Insufficiency | 20440598 | CTD | |
| 1198 | Retinal vascular occlusion | OFFSIDES | ||
| 1199 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 1200 | Seizures | 16368452 | CTD | |
| 1201 | Self Mutilation | OFFSIDES | ||
| 1202 | Sequestrectomy | OFFSIDES | ||
| 1203 | Shivering | SIDER | ||
| 1204 | Shoulder Pain | OFFSIDES | ||
| 1205 | Sinus bradycardia | OFFSIDES | ||
| 1206 | Skin cold clammy | SIDER | ||
| 1207 | Skin hypertrophy | OFFSIDES | ||
| 1208 | Skin tightness | OFFSIDES | ||
| 1209 | Spasm biliary | SIDER | ||
| 1210 | Splenic abscess | OFFSIDES | ||
| 1211 | Spondylosis | OFFSIDES | ||
| 1212 | Substance Withdrawal Syndrome | 16669750 20440598 | CTD | |
| 1213 | Substance-Related Disorders | 12203209 26377394 | CTD | |
| 1214 | Sweating | SIDER | ||
| 1215 | Temporomandibular Joint Disorders | 2057015 | CTD | |
| 1216 | Tendinitis | OFFSIDES | ||
| 1217 | Therapy naive | SIDER | ||
| 1218 | Thrombophlebitis | SIDER | ||
| 1219 | Tongue movement disturbance | Canada Vigilance: 1 | Canada Vigilance | |
| 1220 | Tranquillisation excessive | SIDER | ||
| 1221 | Umbilical hernia | OFFSIDES | ||
| 1222 | Uremia | SIDER | ||
| 1223 | Ureteral spasm | SIDER | ||
| 1224 | Ureteral stent insertion | OFFSIDES | ||
| 1225 | Urethritis | OFFSIDES | ||
| 1226 | Urinary abnormalities | SIDER | ||
| 1227 | Urine output increased | SIDER | ||
| 1228 | Vasodilation procedure | SIDER | ||
| 1229 | Vasodilation | SIDER | ||
| 1230 | Vertebral Artery Stenosis | OFFSIDES | ||
| 1231 | Weight Gain | OFFSIDES | ||
| 1232 | West Nile viral infection | OFFSIDES | ||
| 1233 | Wound Debridement | OFFSIDES | ||
| 1234 | Wound Infection | OFFSIDES | ||
| 1235 | prostatitis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.