Lisinopril
(RLAWWYSOJDYHDC-BZSNNMDCSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N[C@H](C(=O)O)CCc1ccccc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- C09AA03; C09BA03; C09BB03; C10BX07
- Molecular Formula:
- C21H31N3O5
- Molecular Weight:
- 405.488
- Log P:
- 2.2643
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 132.96
- CAS Number(s):
- 76547-98-3; 77726-95-5; 83915-83-7
Synonym(s)
1.
Lisinopril
2.
Lisinopril Maleate (1:1)
3.
Lisinopril Sulfate (1:2)
4.
Lysinopril
5.
MK-521
6.
Prinivil
7.
Zestril
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Angioedema | FAERS: 3163 Canada Vigilance: 3 |
1310578
1315673 1316863 1325341 1581715 2167396 7673623 7978713 7988234 8380620 9125659 10024785 10100445 10423659 10512511 11034011 12126067 12744557 16258215 16957427 17537275 17955500 18281733 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Drug ineffective | FAERS: 392 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 3 | Lip swelling | FAERS: 355 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Dizziness | FAERS: 354 Canada Vigilance: 6 | 2442561 2550641 18825420 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Hypotension | FAERS: 236 Canada Vigilance: 2 |
1658975
2442561 2550641 7708426 11176729 11198499 12148128 12421219 12514658 12566371 15383642 16945058 18084312 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Hypersensitivity | FAERS: 222 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Headache | FAERS: 217 Canada Vigilance: 8 | CTD SIDER Canada Vigilance US FAERS | |
| 8 | Wheezing | FAERS: 180 | SIDER US FAERS | |
| 9 | Nausea | FAERS: 162 Canada Vigilance: 3 | 2550641 10344374 10676825 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 10 | Urticaria | FAERS: 138 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Pruritus | FAERS: 130 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 12 | Fatigue | FAERS: 123 Canada Vigilance: 2 | 2442561 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 13 | Vomiting | FAERS: 122 | 10344374 | CTD SIDER US FAERS |
| 14 | Product substitution issue | FAERS: 119 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 15 | Malaise | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Feeling abnormal | FAERS: 108 | SIDER US FAERS | |
| 17 | Acute kidney injury | FAERS: 103 | CTD US FAERS | |
| 18 | Asthenia | FAERS: 98 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Chest Pain | FAERS: 88 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 20 | Pharmaceutical product complaint | FAERS: 88 | US FAERS | |
| 21 | Swelling | FAERS: 86 | US FAERS | |
| 22 | Pain | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 23 | Palpitations | FAERS: 77 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 24 | Syncope | FAERS: 75 | SIDER US FAERS | |
| 25 | Abdominal Pain | FAERS: 74 Canada Vigilance: 3 | 10344374 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 26 | Blood creatinine increased | FAERS: 71 | OFFSIDES SIDER US FAERS | |
| 27 | Dysphonia | FAERS: 71 | OFFSIDES US FAERS | |
| 28 | Blood pressure inadequately controlled | FAERS: 70 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 29 | Oropharyngeal pain | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Intestinal angioedema | FAERS: 63 | US FAERS | |
| 31 | Arthralgia | FAERS: 60 | SIDER US FAERS | |
| 32 | Product quality issue | FAERS: 59 | US FAERS | |
| 33 | Weight decreased | FAERS: 57 | SIDER US FAERS | |
| 34 | Respiratory distress | FAERS: 56 | US FAERS | |
| 35 | Tachycardia | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Blood potassium increased | FAERS: 50 | OFFSIDES US FAERS | |
| 37 | Abdominal discomfort | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 38 | Chest discomfort | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Myalgia | FAERS: 48 | SIDER US FAERS | |
| 40 | Throat irritation | FAERS: 47 | US FAERS | |
| 41 | Dehydration | FAERS: 45 | OFFSIDES SIDER US FAERS | |
| 42 | Blood urea increased | FAERS: 44 | SIDER US FAERS | |
| 43 | Erythema | FAERS: 44 | OFFSIDES SIDER US FAERS | |
| 44 | Respiratory Failure | FAERS: 44 | OFFSIDES US FAERS | |
| 45 | Bradycardia | FAERS: 43 | 15729089 | CTD OFFSIDES SIDER US FAERS |
| 46 | Therapeutic response unexpected with drug substitution | FAERS: 42 | US FAERS | |
| 47 | Allergic cough | FAERS: 41 | US FAERS | |
| 48 | Anxiety | FAERS: 41 | OFFSIDES SIDER US FAERS | |
| 49 | Pancreatitis | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 50 | Accidental exposure to product by child | FAERS: 40 | US FAERS | |
| 51 | Adverse event | FAERS: 40 | US FAERS | |
| 52 | Tremor | FAERS: 40 | SIDER US FAERS | |
| 53 | Dysgeusia | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 54 | Small bowel angioedema | FAERS: 38 | US FAERS | |
| 55 | Incorrect dose administered | FAERS: 37 | US FAERS | |
| 56 | Peripheral swelling | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Somnolence | FAERS: 37 | SIDER US FAERS | |
| 58 | Metabolic acidosis | FAERS: 35 | US FAERS | |
| 59 | Back Pain | FAERS: 34 | SIDER US FAERS | |
| 60 | Cerebrovascular accident | FAERS: 33 | SIDER US FAERS | |
| 61 | Tinnitus | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 62 | Alopecia | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 63 | Overdose | FAERS: 31 | OFFSIDES US FAERS | |
| 64 | Joint swelling | FAERS: 30 | US FAERS | |
| 65 | Drooling | FAERS: 29 | US FAERS | |
| 66 | Medication Error | FAERS: 29 | US FAERS | |
| 67 | Ascites | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Blood pressure fluctuation | FAERS: 28 | US FAERS | |
| 69 | Hypotensive Transfusion Reaction | FAERS: 28 | US FAERS | |
| 70 | Pneumonia | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 71 | Product use in unapproved indication | FAERS: 26 | US FAERS | |
| 72 | Choking | FAERS: 25 | US FAERS | |
| 73 | Myocardial Infarction | FAERS: 24 Canada Vigilance: 3 | 9061270 12514658 15889206 | CTD SIDER Canada Vigilance US FAERS |
| 74 | Atrial Fibrillation | FAERS: 23 | SIDER US FAERS | |
| 75 | Burning sensation | FAERS: 22 | OFFSIDES US FAERS | |
| 76 | Chills | FAERS: 22 | SIDER US FAERS | |
| 77 | Oligohydramnios | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Presyncope | FAERS: 21 | US FAERS | |
| 79 | Renal tubular acidosis | FAERS: 21 | US FAERS | |
| 80 | Anaphylactic shock | FAERS: 20 | SIDER US FAERS | |
| 81 | Completed Suicide | FAERS: 20 | US FAERS | |
| 82 | Drug dose omission | FAERS: 20 | US FAERS | |
| 83 | Retching | FAERS: 20 | US FAERS | |
| 84 | Wrong technique in product usage process | FAERS: 20 | US FAERS | |
| 85 | Drug exposure during pregnancy | FAERS: 19 | US FAERS | |
| 86 | Stridor | FAERS: 19 | US FAERS | |
| 87 | Constipation | FAERS: 18 | SIDER US FAERS | |
| 88 | Musculoskeletal Pain | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 89 | Respiratory arrest | FAERS: 18 | US FAERS | |
| 90 | Visual Impairment | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Diabetes Mellitus | FAERS: 17 | SIDER US FAERS | |
| 92 | Dyspepsia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 93 | Flushing | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 94 | Food Allergy | FAERS: 17 | US FAERS | |
| 95 | Nasopharyngitis | FAERS: 17 | SIDER US FAERS | |
| 96 | Neck Pain | FAERS: 17 | SIDER US FAERS | |
| 97 | Productive Cough | FAERS: 17 | US FAERS | |
| 98 | Urinary tract infection | FAERS: 17 | SIDER US FAERS | |
| 99 | Mouth swelling | FAERS: 16 | US FAERS | |
| 100 | Septic Shock | FAERS: 16 | US FAERS | |
| 101 | Vertigo | FAERS: 16 | SIDER US FAERS | |
| 102 | Activities of daily living impaired | FAERS: 15 | US FAERS | |
| 103 | Acute respiratory failure | FAERS: 15 | US FAERS | |
| 104 | Aphasia | FAERS: 15 | US FAERS | |
| 105 | Dysarthria | FAERS: 15 | US FAERS | |
| 106 | Unevaluable event | FAERS: 15 | US FAERS | |
| 107 | Apparent death | FAERS: 14 | OFFSIDES US FAERS | |
| 108 | Cardiac Arrest | FAERS: 14 | SIDER US FAERS | |
| 109 | Ileus | FAERS: 14 | US FAERS | |
| 110 | Nervousness | FAERS: 14 | SIDER US FAERS | |
| 111 | Oropharyngeal swelling | FAERS: 14 | US FAERS | |
| 112 | Toxicity to various agents | FAERS: 14 | US FAERS | |
| 113 | Agitation | FAERS: 13 | US FAERS | |
| 114 | Disorientation | FAERS: 13 | US FAERS | |
| 115 | Erectile dysfunction | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 116 | Intestinal Perforation | FAERS: 13 | OFFSIDES US FAERS | |
| 117 | Lethargy | FAERS: 13 | US FAERS | |
| 118 | Renal pain | FAERS: 13 | SIDER US FAERS | |
| 119 | Bronchitis | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 120 | Middle insomnia | FAERS: 12 | OFFSIDES US FAERS | |
| 121 | Anger | FAERS: 11 | US FAERS | |
| 122 | Aphonia | FAERS: 11 | US FAERS | |
| 123 | Asthma | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 124 | Cholangitis | FAERS: 11 | US FAERS | |
| 125 | Dysuria | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 126 | Fibromyalgia | FAERS: 11 | OFFSIDES US FAERS | |
| 127 | Hepatitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 128 | Impaired driving ability | FAERS: 11 | US FAERS | |
| 129 | No adverse event | FAERS: 11 | US FAERS | |
| 130 | Psoriasis | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 131 | Sepsis | FAERS: 11 | US FAERS | |
| 132 | Stress | FAERS: 11 | OFFSIDES US FAERS | |
| 133 | Abdominal tenderness | FAERS: 10 | US FAERS | |
| 134 | Angiotensin converting enzyme inhibitor foetopathy | FAERS: 10 | US FAERS | |
| 135 | Blood glucose increased | FAERS: 10 | US FAERS | |
| 136 | Deafness | FAERS: 10 | US FAERS | |
| 137 | Flatulence | FAERS: 10 | SIDER US FAERS | |
| 138 | Gout | FAERS: 10 | SIDER US FAERS | |
| 139 | Hypophagia | FAERS: 10 | US FAERS | |
| 140 | Mental status changes | FAERS: 10 | OFFSIDES US FAERS | |
| 141 | Musculoskeletal stiffness | FAERS: 10 | OFFSIDES US FAERS | |
| 142 | Oral allergy syndrome | FAERS: 10 | US FAERS | |
| 143 | Rash erythematous | FAERS: 10 | US FAERS | |
| 144 | Respiratory Depression | FAERS: 10 | US FAERS | |
| 145 | Urinary Incontinence | FAERS: 10 | US FAERS | |
| 146 | Cellulitis | FAERS: 9 | OFFSIDES US FAERS | |
| 147 | Dry skin | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 148 | Electrocardiogram change | FAERS: 9 | US FAERS | |
| 149 | Epistaxis | FAERS: 9 | SIDER US FAERS | |
| 150 | Extra dose administered | FAERS: 9 | US FAERS | |
| 151 | Lymphadenopathy | FAERS: 9 | US FAERS | |
| 152 | Nephrolithiasis | FAERS: 9 | OFFSIDES US FAERS | |
| 153 | Therapy non-responder | FAERS: 9 | US FAERS | |
| 154 | Upper airway obstruction | FAERS: 9 | US FAERS | |
| 155 | Urinary Retention | FAERS: 9 | US FAERS | |
| 156 | Abasia | FAERS: 8 | OFFSIDES US FAERS | |
| 157 | Anorexia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 158 | Asthenopia | FAERS: 8 | US FAERS | |
| 159 | Bone pain | FAERS: 8 | OFFSIDES US FAERS | |
| 160 | Choking sensation | FAERS: 8 | OFFSIDES US FAERS | |
| 161 | Coronary Artery Disease | FAERS: 8 | US FAERS | |
| 162 | Crying | FAERS: 8 | US FAERS | |
| 163 | Delirium | FAERS: 8 | US FAERS | |
| 164 | Drug dispensing error | FAERS: 8 | US FAERS | |
| 165 | Enlarged uvula | FAERS: 8 | US FAERS | |
| 166 | Eructation | FAERS: 8 | US FAERS | |
| 167 | Lymphomatoid Papulosis | FAERS: 8 | US FAERS | |
| 168 | Malabsorption | FAERS: 8 | US FAERS | |
| 169 | Reaction to drug excipients | FAERS: 8 | US FAERS | |
| 170 | Rosacea | FAERS: 8 | US FAERS | |
| 171 | Sinusitis | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 172 | treatment failure | FAERS: 8 | US FAERS | |
| 173 | Acute myocardial infarction | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 174 | Acute prerenal failure | FAERS: 7 | US FAERS | |
| 175 | Amnesia | FAERS: 7 | OFFSIDES US FAERS | |
| 176 | Angina Pectoris | FAERS: 7 | SIDER US FAERS | |
| 177 | Arthropod bite | FAERS: 7 | US FAERS | |
| 178 | Blood creatine increased | FAERS: 7 | OFFSIDES US FAERS | |
| 179 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 180 | Burning feet syndrome | FAERS: 7 | US FAERS | |
| 181 | Circumstance or information capable of leading to medication error | FAERS: 7 | US FAERS | |
| 182 | Concomitant disease aggravated | FAERS: 7 | US FAERS | |
| 183 | Depressed Level of Consciousness | FAERS: 7 | US FAERS | |
| 184 | Discomfort | FAERS: 7 | SIDER US FAERS | |
| 185 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 186 | Ear discomfort | FAERS: 7 | US FAERS | |
| 187 | Economic problem | FAERS: 7 | US FAERS | |
| 188 | Gastroenteritis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 189 | Head discomfort | FAERS: 7 | US FAERS | |
| 190 | Impaired work ability | FAERS: 7 | US FAERS | |
| 191 | Increased upper airway secretion | FAERS: 7 | US FAERS | |
| 192 | Intestinal villi atrophy | FAERS: 7 | US FAERS | |
| 193 | Leukocytosis | FAERS: 7 | SIDER US FAERS | |
| 194 | Memory impairment | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 195 | Metrorrhagia | FAERS: 7 | US FAERS | |
| 196 | Nodular rash | FAERS: 7 | US FAERS | |
| 197 | Petechiae | FAERS: 7 | US FAERS | |
| 198 | Product use issue | FAERS: 7 | US FAERS | |
| 199 | Renal Artery Stenosis | FAERS: 7 | US FAERS | |
| 200 | Sneezing | FAERS: 7 | US FAERS | |
| 201 | Upper-airway cough syndrome | FAERS: 7 | US FAERS | |
| 202 | Anoxia | FAERS: 6 | US FAERS | |
| 203 | Anuria | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 204 | Bronchospasm | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 205 | Chromaturia | FAERS: 6 | OFFSIDES US FAERS | |
| 206 | Chronic gastritis | FAERS: 6 | US FAERS | |
| 207 | Cold sweat | FAERS: 6 | US FAERS | |
| 208 | Dermatitis | FAERS: 6 | SIDER US FAERS | |
| 209 | Emotional distress | FAERS: 6 | OFFSIDES US FAERS | |
| 210 | Eye pain | FAERS: 6 | US FAERS | |
| 211 | Facial Pain | FAERS: 6 | US FAERS | |
| 212 | Hypertensive crisis | FAERS: 6 | US FAERS | |
| 213 | Hypospadias | FAERS: 6 | US FAERS | |
| 214 | Inappropriate schedule of drug administration | FAERS: 6 | OFFSIDES US FAERS | |
| 215 | Inflammation | FAERS: 6 | US FAERS | |
| 216 | Intentional product use issue | FAERS: 6 | US FAERS | |
| 217 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 218 | Muscle tightness | FAERS: 6 | US FAERS | |
| 219 | Musculoskeletal discomfort | FAERS: 6 | SIDER US FAERS | |
| 220 | Nerve injury | FAERS: 6 | US FAERS | |
| 221 | Oral pruritus | FAERS: 6 | US FAERS | |
| 222 | Post procedural complication | FAERS: 6 | US FAERS | |
| 223 | Product dispensing error | FAERS: 6 | US FAERS | |
| 224 | Product dose omission | FAERS: 6 | US FAERS | |
| 225 | Quality of life decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 226 | Renal tubular necrosis | FAERS: 6 | US FAERS | |
| 227 | Restless Legs Syndrome | FAERS: 6 | US FAERS | |
| 228 | Restlessness | FAERS: 6 | US FAERS | |
| 229 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 230 | Therapy cessation | FAERS: 6 | US FAERS | |
| 231 | Thirst | FAERS: 6 | US FAERS | |
| 232 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 233 | Abscess | FAERS: 5 | US FAERS | |
| 234 | Arthritis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 235 | Blindness | FAERS: 5 | SIDER US FAERS | |
| 236 | Bronchopneumonia | FAERS: 5 | US FAERS | |
| 237 | Electrocardiogram T wave peaked | FAERS: 5 | US FAERS | |
| 238 | Endotracheal intubation complication | FAERS: 5 | US FAERS | |
| 239 | Epiglottitis | FAERS: 5 | US FAERS | |
| 240 | Hypoxia | FAERS: 5 | OFFSIDES US FAERS | |
| 241 | Infection | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 242 | Intentional product misuse | FAERS: 5 | US FAERS | |
| 243 | Laryngospasm | FAERS: 5 | US FAERS | |
| 244 | Night sweats | FAERS: 5 | US FAERS | |
| 245 | Pharyngolaryngeal Pain | FAERS: 5 | OFFSIDES US FAERS | |
| 246 | Product size issue | FAERS: 5 | US FAERS | |
| 247 | Pulmonary congestion | FAERS: 5 | US FAERS | |
| 248 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 249 | Sexual Dysfunction | FAERS: 5 | US FAERS | |
| 250 | Stevens-Johnson Syndrome | FAERS: 5 | 25811541 | CTD SIDER US FAERS |
| 251 | Therapy change | FAERS: 5 | US FAERS | |
| 252 | Ulnar Nerve Palsy | FAERS: 5 | US FAERS | |
| 253 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 254 | jaundice | FAERS: 5 | 2172073 7885528 | CTD SIDER US FAERS |
| 255 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 256 | Accidental overdose | FAERS: 4 | US FAERS | |
| 257 | Acute Coronary Syndrome | FAERS: 4 | SIDER US FAERS | |
| 258 | Ageusia | FAERS: 4 | US FAERS | |
| 259 | Allergic reaction to excipient | FAERS: 4 | US FAERS | |
| 260 | Aneurysm | FAERS: 4 | OFFSIDES US FAERS | |
| 261 | Bone formation decreased | FAERS: 4 | US FAERS | |
| 262 | Charles Bonnet Syndrome | FAERS: 4 | US FAERS | |
| 263 | Cystitis | FAERS: 4 | SIDER US FAERS | |
| 264 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 265 | Diplopia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 266 | Drug administration error | FAERS: 4 | OFFSIDES US FAERS | |
| 267 | Drug toxicity | FAERS: 4 | US FAERS | |
| 268 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 269 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 270 | Eosinophilia | FAERS: 4 | SIDER US FAERS | |
| 271 | Erythema Multiforme | FAERS: 4 | SIDER US FAERS | |
| 272 | Erythrodermic psoriasis | FAERS: 4 | US FAERS | |
| 273 | Essential Hypertension | FAERS: 4 | OFFSIDES US FAERS | |
| 274 | Gastrointestinal Pain | FAERS: 4 | SIDER US FAERS | |
| 275 | General physical health deterioration | FAERS: 4 | OFFSIDES US FAERS | |
| 276 | Glaucoma | FAERS: 4 | OFFSIDES US FAERS | |
| 277 | Gluten sensitivity | FAERS: 4 | US FAERS | |
| 278 | Hemiplegia | FAERS: 4 | US FAERS | |
| 279 | Hypersomnia | FAERS: 4 | SIDER US FAERS | |
| 280 | Idiosyncratic drug reaction | FAERS: 4 | OFFSIDES US FAERS | |
| 281 | Influenza | FAERS: 4 | SIDER US FAERS | |
| 282 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 283 | Labile blood pressure | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | Macroglossia | FAERS: 4 | US FAERS | |
| 285 | Musculoskeletal chest pain | FAERS: 4 | OFFSIDES US FAERS | |
| 286 | Neonatal hypotension | FAERS: 4 | US FAERS | |
| 287 | No reaction on previous exposure to drug | FAERS: 4 | US FAERS | |
| 288 | Polymyalgia Rheumatica | FAERS: 4 | OFFSIDES US FAERS | |
| 289 | Product physical issue | FAERS: 4 | US FAERS | |
| 290 | Screaming | FAERS: 4 | US FAERS | |
| 291 | Stomatitis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 292 | Systemic Inflammatory Response Syndrome | FAERS: 4 | US FAERS | |
| 293 | Thrombocytopenia | FAERS: 4 | SIDER US FAERS | |
| 294 | Thrombosis | FAERS: 4 | US FAERS | |
| 295 | Unresponsive to stimuli | FAERS: 4 | OFFSIDES US FAERS | |
| 296 | Wound dehiscence | FAERS: 4 | OFFSIDES US FAERS | |
| 297 | Accidental exposure | FAERS: 3 | US FAERS | |
| 298 | Alcohol withdrawal syndrome | FAERS: 3 | US FAERS | |
| 299 | Anaphylactoid Reaction | FAERS: 3 | SIDER US FAERS | |
| 300 | Anosmia | FAERS: 3 | OFFSIDES US FAERS | |
| 301 | Aphagia | FAERS: 3 | US FAERS | |
| 302 | Asphyxia | FAERS: 3 | US FAERS | |
| 303 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 304 | Blood glucose decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 305 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 306 | Blood urine present | FAERS: 3 | US FAERS | |
| 307 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 308 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 309 | Cyanosis | FAERS: 3 | US FAERS | |
| 310 | Deafness Neurosensory | FAERS: 3 | US FAERS | |
| 311 | Disease recurrence | FAERS: 3 | US FAERS | |
| 312 | Emotional disorder | FAERS: 3 | US FAERS | |
| 313 | Eye irritation | FAERS: 3 | US FAERS | |
| 314 | Feeling jittery | FAERS: 3 | US FAERS | |
| 315 | Formication | FAERS: 3 | US FAERS | |
| 316 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 317 | Gastritis | FAERS: 3 | SIDER US FAERS | |
| 318 | Gastrointestinal inflammation | FAERS: 3 | US FAERS | |
| 319 | Genital burning sensation | FAERS: 3 | US FAERS | |
| 320 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 321 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 322 | Incontinence | FAERS: 3 | OFFSIDES US FAERS | |
| 323 | Increased tendency to bruise | FAERS: 3 | US FAERS | |
| 324 | Left Ventricular Hypertrophy | FAERS: 3 | US FAERS | |
| 325 | Leukopenia | FAERS: 3 | SIDER US FAERS | |
| 326 | Limb discomfort | FAERS: 3 | US FAERS | |
| 327 | Local reaction | FAERS: 3 | US FAERS | |
| 328 | Lupus-like syndrome | FAERS: 3 | US FAERS | |
| 329 | Mastocytosis | FAERS: 3 | US FAERS | |
| 330 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 331 | Oropharyngeal discomfort | FAERS: 3 | SIDER US FAERS | |
| 332 | Orthostatic intolerance | FAERS: 3 | US FAERS | |
| 333 | Pancytopenia | FAERS: 3 | 7519541 | CTD SIDER US FAERS |
| 334 | Pemphigus | FAERS: 3 | SIDER US FAERS | |
| 335 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 336 | Personality Change | FAERS: 3 | US FAERS | |
| 337 | Pharyngitis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 338 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 339 | Product packaging issue | FAERS: 3 | US FAERS | |
| 340 | Proteinuria | FAERS: 3 |
1660550
2442551 3041097 9165371 9640348 10412735 10598677 11499566 11849387 12164870 12566371 12819241 16352916 16636307 16945058 18825420 19018148 19225054 19293598 20061926 | CTD SIDER US FAERS |
| 341 | Pulmonary Valve Stenosis | FAERS: 3 | US FAERS | |
| 342 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 343 | Rhinitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 344 | Tongue discomfort | FAERS: 3 | US FAERS | |
| 345 | Toothache | FAERS: 3 | US FAERS | |
| 346 | Transcription medication error | FAERS: 3 | US FAERS | |
| 347 | Troponin increased | FAERS: 3 | US FAERS | |
| 348 | Ventricular Fibrillation | FAERS: 3 | SIDER US FAERS | |
| 349 | prostatitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 350 | Acidosis | FAERS: 2 | 20061926 | CTD US FAERS |
| 351 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 352 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 353 | Anoxic Encephalopathy | FAERS: 2 | OFFSIDES US FAERS | |
| 354 | Antipsychotic drug level increased | FAERS: 2 | US FAERS | |
| 355 | Aortic Aneurysm | FAERS: 2 | OFFSIDES US FAERS | |
| 356 | Arthropathy | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 357 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 358 | Atelectasis | FAERS: 2 | OFFSIDES US FAERS | |
| 359 | Aura | FAERS: 2 | OFFSIDES US FAERS | |
| 360 | Biopsy bone marrow abnormal | FAERS: 2 | US FAERS | |
| 361 | Blood Pressure | FAERS: 2 | US FAERS | |
| 362 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 363 | Blood glucose abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 364 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 365 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 366 | Brain Death | FAERS: 2 | OFFSIDES US FAERS | |
| 367 | Breast Cyst | FAERS: 2 | US FAERS | |
| 368 | Breech Presentation | FAERS: 2 | US FAERS | |
| 369 | Cardiomegaly | FAERS: 2 | 8586805 | CTD US FAERS |
| 370 | Cheilitis | FAERS: 2 | US FAERS | |
| 371 | Cluster Headache | FAERS: 2 | US FAERS | |
| 372 | Colitis | FAERS: 2 | OFFSIDES US FAERS | |
| 373 | Contrast media reaction | FAERS: 2 | US FAERS | |
| 374 | Croup infectious | FAERS: 2 | US FAERS | |
| 375 | Dementia | FAERS: 2 | US FAERS | |
| 376 | Depressed mood | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Dermatitis Herpetiformis | FAERS: 2 | US FAERS | |
| 378 | Device interaction | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 379 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 380 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 381 | Disease Progression | FAERS: 2 | US FAERS | |
| 382 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 383 | Documented hypersensitivity to administered drug | FAERS: 2 | US FAERS | |
| 384 | Drug dispensed to wrong patient | FAERS: 2 | US FAERS | |
| 385 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 386 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 387 | Eczema | FAERS: 2 | SIDER US FAERS | |
| 388 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 389 | Embolism | FAERS: 2 | US FAERS | |
| 390 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 391 | Epididymitis | FAERS: 2 | US FAERS | |
| 392 | Eyelid irritation | FAERS: 2 | US FAERS | |
| 393 | Facial paralysis | FAERS: 2 | US FAERS | |
| 394 | Feeling Cold | FAERS: 2 | US FAERS | |
| 395 | Fluid replacement | FAERS: 2 | US FAERS | |
| 396 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 397 | Gastric Lavage | FAERS: 2 | US FAERS | |
| 398 | Glossitis | FAERS: 2 | US FAERS | |
| 399 | Growth retardation | FAERS: 2 | US FAERS | |
| 400 | Head circumference abnormal | FAERS: 2 | US FAERS | |
| 401 | Hemiparesis | FAERS: 2 | US FAERS | |
| 402 | Henoch-Schonlein purpura nephritis | FAERS: 2 | US FAERS | |
| 403 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 404 | Hip swelling | FAERS: 2 | US FAERS | |
| 405 | Hypercapnia | FAERS: 2 | US FAERS | |
| 406 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 407 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 408 | Laryngitis | FAERS: 2 | SIDER US FAERS | |
| 409 | Lichen Planus | FAERS: 2 | US FAERS | |
| 410 | Lip pruritus | FAERS: 2 | US FAERS | |
| 411 | Medication residue | FAERS: 2 | US FAERS | |
| 412 | Medication residue present | FAERS: 2 | US FAERS | |
| 413 | Megacolon | FAERS: 2 | US FAERS | |
| 414 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 415 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 416 | Nephritis | FAERS: 2 | US FAERS | |
| 417 | Nocturia | FAERS: 2 | US FAERS | |
| 418 | Oliguria | FAERS: 2 | 9165371 | CTD OFFSIDES SIDER US FAERS |
| 419 | Oral pain | FAERS: 2 | US FAERS | |
| 420 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 421 | Pallor | FAERS: 2 | US FAERS | |
| 422 | Parakeratosis | FAERS: 2 | US FAERS | |
| 423 | Paranoia | FAERS: 2 | US FAERS | |
| 424 | Periarthritis | FAERS: 2 | US FAERS | |
| 425 | Perivascular dermatitis | FAERS: 2 | US FAERS | |
| 426 | Photophobia | FAERS: 2 | SIDER US FAERS | |
| 427 | Pityriasis Rosea | FAERS: 2 | US FAERS | |
| 428 | Pneumothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 429 | Poisoning | FAERS: 2 | US FAERS | |
| 430 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 431 | Polyuria | FAERS: 2 | US FAERS | |
| 432 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 433 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 434 | Product formulation issue | FAERS: 2 | US FAERS | |
| 435 | Product label confusion | FAERS: 2 | US FAERS | |
| 436 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 437 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 438 | Pruritus allergic | FAERS: 2 | US FAERS | |
| 439 | Pseudolymphoma | FAERS: 2 | SIDER US FAERS | |
| 440 | Pulmonary Embolism | FAERS: 2 | SIDER US FAERS | |
| 441 | Rales | FAERS: 2 | US FAERS | |
| 442 | Renal cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 443 | Renal dysplasia | FAERS: 2 | US FAERS | |
| 444 | Renal failure neonatal | FAERS: 2 | US FAERS | |
| 445 | Retinal Vasculitis | FAERS: 2 | US FAERS | |
| 446 | Rhonchi | FAERS: 2 | OFFSIDES US FAERS | |
| 447 | Shock | FAERS: 2 | SIDER US FAERS | |
| 448 | Similar reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 449 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 450 | Sinus bradycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 451 | Sleep disorder due to general medical condition, insomnia type | FAERS: 2 | US FAERS | |
| 452 | Tension Headache | FAERS: 2 | US FAERS | |
| 453 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 454 | Thermal burn | FAERS: 2 | US FAERS | |
| 455 | Tooth Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 456 | Tooth Loss | FAERS: 2 | US FAERS | |
| 457 | Trismus | FAERS: 2 | US FAERS | |
| 458 | Ulcer | FAERS: 2 | OFFSIDES US FAERS | |
| 459 | Uvulitis | FAERS: 2 | US FAERS | |
| 460 | Vascular bypass graft | FAERS: 2 | US FAERS | |
| 461 | Viral pharyngitis | FAERS: 2 | US FAERS | |
| 462 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 463 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 464 | nervous system disorder | FAERS: 2 | US FAERS | |
| 465 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 466 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 467 | Accidental underdose | FAERS: 1 | US FAERS | |
| 468 | Acne | FAERS: 1 | US FAERS | |
| 469 | Actinic keratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 470 | Activation syndrome | FAERS: 1 | US FAERS | |
| 471 | Alcohol abuse | FAERS: 1 | OFFSIDES US FAERS | |
| 472 | Alcohol test false positive | FAERS: 1 | US FAERS | |
| 473 | Allergy to animal | FAERS: 1 | US FAERS | |
| 474 | Allergy to arthropod sting | FAERS: 1 | US FAERS | |
| 475 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 476 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 477 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 478 | Ankle Fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 479 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 480 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 481 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 482 | Arteriosclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 484 | Back disorder | FAERS: 1 | US FAERS | |
| 485 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 486 | Bedridden | FAERS: 1 | US FAERS | |
| 487 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 488 | Beta 2 microglobulin increased | FAERS: 1 | US FAERS | |
| 489 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 490 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 491 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 492 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 493 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 494 | Blood aldosterone abnormal | FAERS: 1 | US FAERS | |
| 495 | Blood aldosterone decreased | FAERS: 1 | US FAERS | |
| 496 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 497 | Blood blister | FAERS: 1 | US FAERS | |
| 498 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 499 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 500 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 501 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 502 | Blood glucose fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 503 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 504 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 505 | Blood product transfusion dependent | FAERS: 1 | US FAERS | |
| 506 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 507 | Blood triglycerides increased | FAERS: 1 | OFFSIDES US FAERS | |
| 508 | Bone swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 509 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 510 | Brain natriuretic peptide increased | FAERS: 1 | OFFSIDES US FAERS | |
| 511 | Breast tenderness | FAERS: 1 | US FAERS | |
| 512 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 513 | Bursitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 514 | Butterfly rash | FAERS: 1 | US FAERS | |
| 515 | CD30 expression | FAERS: 1 | US FAERS | |
| 516 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 517 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 518 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 519 | Cardioactive drug level increased | FAERS: 1 | OFFSIDES US FAERS | |
| 520 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 521 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 522 | Cataract | FAERS: 1 | OFFSIDES US FAERS | |
| 523 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 524 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 525 | Cholestasis | FAERS: 1 | US FAERS | |
| 526 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 527 | Chromatopsia | FAERS: 1 | OFFSIDES US FAERS | |
| 528 | Cleft Palate | FAERS: 1 | US FAERS | |
| 529 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 530 | Coronary angioplasty | FAERS: 1 | OFFSIDES US FAERS | |
| 531 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 532 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 533 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 534 | Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 535 | Dental caries | FAERS: 1 | OFFSIDES US FAERS | |
| 536 | Depression suicidal | FAERS: 1 | US FAERS | |
| 537 | Device occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 538 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 539 | Diabetic Nephropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 540 | Diabetic Retinopathy | FAERS: 1 | 12140727 | CTD OFFSIDES US FAERS |
| 541 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 542 | Disability | FAERS: 1 | US FAERS | |
| 543 | Diverticulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 544 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 545 | Drug Dependence | FAERS: 1 | US FAERS | |
| 546 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 547 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 548 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 549 | Drug level changed | FAERS: 1 | US FAERS | |
| 550 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 551 | Drug screen negative | FAERS: 1 | US FAERS | |
| 552 | Drug therapy changed | FAERS: 1 | US FAERS | |
| 553 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 554 | Duodenal Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 555 | Duodenitis | FAERS: 1 | OFFSIDES US FAERS | |
| 556 | Dyschezia | FAERS: 1 | US FAERS | |
| 557 | Dysmorphism | FAERS: 1 | US FAERS | |
| 558 | Ear congestion | FAERS: 1 | US FAERS | |
| 559 | Ejection Fraction Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 560 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 561 | Emergency Care | FAERS: 1 | US FAERS | |
| 562 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 563 | Enteritis | FAERS: 1 | US FAERS | |
| 564 | Euphoric mood | FAERS: 1 | US FAERS | |
| 565 | Excoriation | FAERS: 1 | US FAERS | |
| 566 | Expired drug administered | FAERS: 1 | US FAERS | |
| 567 | Expired product administered | FAERS: 1 | US FAERS | |
| 568 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 569 | Exposure via father | FAERS: 1 | US FAERS | |
| 570 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 571 | Fibroadenoma of breast | FAERS: 1 | US FAERS | |
| 572 | Fluid overload | FAERS: 1 | SIDER US FAERS | |
| 573 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 574 | Folliculitis | FAERS: 1 | US FAERS | |
| 575 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 576 | Fracture | FAERS: 1 | US FAERS | |
| 577 | Frostbite | FAERS: 1 | US FAERS | |
| 578 | Full blood count increased | FAERS: 1 | US FAERS | |
| 579 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 580 | Gingivitis | FAERS: 1 | US FAERS | |
| 581 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 582 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 583 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 584 | Hepatic Encephalopathy | FAERS: 1 | 2172073 | CTD US FAERS |
| 585 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 586 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 587 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 588 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 589 | Hidradenitis | FAERS: 1 | US FAERS | |
| 590 | Hoarseness | FAERS: 1 | US FAERS | |
| 591 | Hydrocele operation | FAERS: 1 | US FAERS | |
| 592 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 593 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 594 | Hyperventilation | FAERS: 1 | US FAERS | |
| 595 | Hypoaldosteronism | FAERS: 1 | US FAERS | |
| 596 | Hypocalvaria | FAERS: 1 | US FAERS | |
| 597 | Ileitis | FAERS: 1 | US FAERS | |
| 598 | Immobile | FAERS: 1 | US FAERS | |
| 599 | Impaired self-care | FAERS: 1 | OFFSIDES US FAERS | |
| 600 | Incoherent | FAERS: 1 | US FAERS | |
| 601 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 602 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 603 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 604 | Infertility | FAERS: 1 | US FAERS | |
| 605 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 606 | Injection site bruising | FAERS: 1 | US FAERS | |
| 607 | Injection site erythema | FAERS: 1 | US FAERS | |
| 608 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 609 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 610 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 611 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 612 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 613 | Intubation complication | FAERS: 1 | US FAERS | |
| 614 | Iodine deficiency | FAERS: 1 | US FAERS | |
| 615 | Irregular breathing | FAERS: 1 | US FAERS | |
| 616 | Joint Range of Motion Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 617 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 618 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 619 | Laceration | FAERS: 1 | US FAERS | |
| 620 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 621 | Laryngectomy | FAERS: 1 | US FAERS | |
| 622 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 623 | Ligament pain | FAERS: 1 | US FAERS | |
| 624 | Ligament rupture | FAERS: 1 | US FAERS | |
| 625 | Limb injury | FAERS: 1 | OFFSIDES US FAERS | |
| 626 | Lip erythema | FAERS: 1 | US FAERS | |
| 627 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 628 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 629 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 630 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 631 | Macular degeneration | FAERS: 1 | US FAERS | |
| 632 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 633 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 634 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 635 | Mechanical ventilation complication | FAERS: 1 | US FAERS | |
| 636 | Mechanical ventilation | FAERS: 1 | OFFSIDES US FAERS | |
| 637 | Meningitis | FAERS: 1 | US FAERS | |
| 638 | Meniscus injury | FAERS: 1 | US FAERS | |
| 639 | Menopause | FAERS: 1 | US FAERS | |
| 640 | Menorrhagia | FAERS: 1 | US FAERS | |
| 641 | Mental impairment | FAERS: 1 | US FAERS | |
| 642 | Microcephaly | FAERS: 1 | US FAERS | |
| 643 | Mini-tracheostomy | FAERS: 1 | US FAERS | |
| 644 | Mood swings | FAERS: 1 | US FAERS | |
| 645 | Morbid thoughts | FAERS: 1 | OFFSIDES US FAERS | |
| 646 | Multiple allergies | FAERS: 1 | OFFSIDES US FAERS | |
| 647 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 648 | Myoclonus | FAERS: 1 | US FAERS | |
| 649 | Nasal Flaring | FAERS: 1 | US FAERS | |
| 650 | Necrosis | FAERS: 1 | US FAERS | |
| 651 | Negativism | FAERS: 1 | US FAERS | |
| 652 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 653 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 654 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 655 | Neuropathy | FAERS: 1 | SIDER US FAERS | |
| 656 | Neutropenia | FAERS: 1 | SIDER US FAERS | |
| 657 | Nodule | FAERS: 1 | US FAERS | |
| 658 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 659 | Nystagmus | FAERS: 1 | US FAERS | |
| 660 | Obstruction | FAERS: 1 | US FAERS | |
| 661 | Ocular icterus | FAERS: 1 | OFFSIDES US FAERS | |
| 662 | Open wound | FAERS: 1 | US FAERS | |
| 663 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 664 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 665 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 666 | Osteitis | FAERS: 1 | US FAERS | |
| 667 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 668 | Otosclerosis | FAERS: 1 | US FAERS | |
| 669 | Palatal swelling | FAERS: 1 | US FAERS | |
| 670 | Panic Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 671 | Papule | FAERS: 1 | US FAERS | |
| 672 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 673 | Paresis | FAERS: 1 | US FAERS | |
| 674 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 675 | Performance status decreased | FAERS: 1 | US FAERS | |
| 676 | Perineal pain | FAERS: 1 | US FAERS | |
| 677 | Periodontal infection | FAERS: 1 | US FAERS | |
| 678 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 679 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 680 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 681 | Pertussis | FAERS: 1 | US FAERS | |
| 682 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 683 | Pneumonitis | FAERS: 1 | US FAERS | |
| 684 | Polydipsia | FAERS: 1 | US FAERS | |
| 685 | Poor dental condition | FAERS: 1 | US FAERS | |
| 686 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 687 | Post-tussive vomiting | FAERS: 1 | US FAERS | |
| 688 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 689 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 690 | Poverty of speech | FAERS: 1 | US FAERS | |
| 691 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 692 | Procedural complication | FAERS: 1 | US FAERS | |
| 693 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 694 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 695 | Product contamination | FAERS: 1 | US FAERS | |
| 696 | Product contamination physical | FAERS: 1 | US FAERS | |
| 697 | Product counterfeit | FAERS: 1 | OFFSIDES US FAERS | |
| 698 | Product label issue | FAERS: 1 | US FAERS | |
| 699 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 700 | Product prescribing error | FAERS: 1 | US FAERS | |
| 701 | Product tampering | FAERS: 1 | US FAERS | |
| 702 | Product use complaint | FAERS: 1 | US FAERS | |
| 703 | Protein urine present | FAERS: 1 | SIDER US FAERS | |
| 704 | Pseudohyperkalaemia | FAERS: 1 | US FAERS | |
| 705 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 706 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 707 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 708 | Pulse volume decreased | FAERS: 1 | US FAERS | |
| 709 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 710 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 711 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 712 | Rectal discharge | FAERS: 1 | US FAERS | |
| 713 | Regurgitation | FAERS: 1 | OFFSIDES US FAERS | |
| 714 | Renal Replacement Therapy | FAERS: 1 | US FAERS | |
| 715 | Renal impairment neonatal | FAERS: 1 | US FAERS | |
| 716 | Renin increased | FAERS: 1 | US FAERS | |
| 717 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 718 | Retrognathia | FAERS: 1 | US FAERS | |
| 719 | Retropharyngeal Abscess | FAERS: 1 | US FAERS | |
| 720 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 721 | Saliva altered | FAERS: 1 | US FAERS | |
| 722 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 723 | Scan abdomen abnormal | FAERS: 1 | US FAERS | |
| 724 | Sciatica | FAERS: 1 | US FAERS | |
| 725 | Scotoma | FAERS: 1 | US FAERS | |
| 726 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 727 | Secondary hyperthyroidism | FAERS: 1 | US FAERS | |
| 728 | Secretion discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 729 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 730 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 731 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 732 | Skeletal injury | FAERS: 1 | US FAERS | |
| 733 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 734 | Skin dystrophy | FAERS: 1 | US FAERS | |
| 735 | Skin irritation | FAERS: 1 | US FAERS | |
| 736 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 737 | Skin reaction | FAERS: 1 | US FAERS | |
| 738 | Skin tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 739 | Sluggishness | FAERS: 1 | US FAERS | |
| 740 | Smoker | FAERS: 1 | US FAERS | |
| 741 | Snoring | FAERS: 1 | US FAERS | |
| 742 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 743 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 744 | Splenomegaly | FAERS: 1 | US FAERS | |
| 745 | Starvation | FAERS: 1 | US FAERS | |
| 746 | Strawberry tongue | FAERS: 1 | US FAERS | |
| 747 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 748 | Suicide attempt | FAERS: 1 | US FAERS | |
| 749 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 750 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 751 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 752 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 753 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 754 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 755 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 756 | Tongue biting | FAERS: 1 | US FAERS | |
| 757 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 758 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 759 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 760 | Transaminases increased | FAERS: 1 | US FAERS | |
| 761 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 762 | Umbilical cord vascular disorder | FAERS: 1 | US FAERS | |
| 763 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 764 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 765 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 766 | Urine output increased | FAERS: 1 | US FAERS | |
| 767 | Vascular rupture | FAERS: 1 | US FAERS | |
| 768 | Vasculitis | FAERS: 1 | 2850876 | CTD SIDER US FAERS |
| 769 | Venous Insufficiency | FAERS: 1 | OFFSIDES US FAERS | |
| 770 | Verbigeration | FAERS: 1 | US FAERS | |
| 771 | Visual disturbance | FAERS: 1 | US FAERS | |
| 772 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 773 | Vulvitis | FAERS: 1 | US FAERS | |
| 774 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 775 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 776 | X-ray limb abnormal | FAERS: 1 | US FAERS | |
| 777 | hypertensive nephropathy | FAERS: 1 | US FAERS | |
| 778 | muscle injury | FAERS: 1 | US FAERS | |
| 779 | pH urine increased | FAERS: 1 | US FAERS | |
| 780 | Abdominal Infection | OFFSIDES | ||
| 781 | Acid reflux | OFFSIDES | ||
| 782 | Acquired angioedema | 9839915 | CTD | |
| 783 | Adenoma | OFFSIDES | ||
| 784 | Agoraphobia | OFFSIDES | ||
| 785 | Agranulocytosis | SIDER | ||
| 786 | Airway Obstruction | 1325341 | CTD | |
| 787 | Albuminuria | 9061270 9538979 21878554 | CTD | |
| 788 | Alcohol interaction | Canada Vigilance: 1 | Canada Vigilance | |
| 789 | Alveolitis | OFFSIDES | ||
| 790 | Amphetamines | OFFSIDES | ||
| 791 | Anal Fissure | OFFSIDES | ||
| 792 | Androgens decreased | OFFSIDES | ||
| 793 | Anhedonia | OFFSIDES | ||
| 794 | Animal bite | OFFSIDES | ||
| 795 | Ankylosing spondylitis | OFFSIDES | ||
| 796 | Aphthous Stomatitis | OFFSIDES | ||
| 797 | Apoptosis | OFFSIDES | ||
| 798 | Asbestosis | OFFSIDES | ||
| 799 | Ataxia | OFFSIDES SIDER | ||
| 800 | Atrial Flutter | SIDER | ||
| 801 | Atrial fibrillation and flutter | SIDER | ||
| 802 | Atrial tachycardia | OFFSIDES SIDER | ||
| 803 | Atrophic vulvovaginitis | OFFSIDES | ||
| 804 | Azotemia | 9165371 16988746 | CTD | |
| 805 | Bacteria tissue specimen identified | OFFSIDES | ||
| 806 | Bacterial test positive | OFFSIDES | ||
| 807 | Biliary dilatation | OFFSIDES | ||
| 808 | Bilirubin conjugated increased | OFFSIDES | ||
| 809 | Biopsy bone abnormal | OFFSIDES | ||
| 810 | Biopsy breast abnormal | OFFSIDES | ||
| 811 | Biopsy lymph gland abnormal | OFFSIDES | ||
| 812 | Biopsy mucosa abnormal | OFFSIDES | ||
| 813 | Biopsy | OFFSIDES | ||
| 814 | Bipolar Disorder | 7568661 | CTD OFFSIDES | |
| 815 | Blood Glucose | OFFSIDES | ||
| 816 | Blood and lymphatic system disorders | SIDER | ||
| 817 | Blood bicarbonate | OFFSIDES | ||
| 818 | Blood cholesterol | OFFSIDES | ||
| 819 | Blood immunoglobulin E increased | Canada Vigilance: 1 | Canada Vigilance | |
| 820 | Blood immunoglobulin G increased | OFFSIDES | ||
| 821 | Blood triglycerides | OFFSIDES | ||
| 822 | Blurred vision | OFFSIDES | ||
| 823 | Bone abscess | OFFSIDES | ||
| 824 | Bone density decreased | OFFSIDES | ||
| 825 | Bone lesion | OFFSIDES | ||
| 826 | Bone marrow depression | SIDER | ||
| 827 | Brain Concussion | OFFSIDES | ||
| 828 | Brain Contusion | OFFSIDES | ||
| 829 | Breast hyperplasia | OFFSIDES | ||
| 830 | Bronchoalveolar Lavage | OFFSIDES | ||
| 831 | Capillary Leak Syndrome | OFFSIDES | ||
| 832 | Cardiac asthma | OFFSIDES | ||
| 833 | Cardiovascular insufficiency | OFFSIDES | ||
| 834 | Cataract operation | OFFSIDES | ||
| 835 | Catheter placement | OFFSIDES | ||
| 836 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 837 | Chemical and Drug Induced Liver Injury | 2172073 7885528 8387127 | CTD | |
| 838 | Chest wall pain | OFFSIDES | ||
| 839 | Chondromalacia | OFFSIDES | ||
| 840 | Choroidal Detachment | OFFSIDES | ||
| 841 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 842 | Chronic left ventricular failure | OFFSIDES | ||
| 843 | Chronic respiratory failure | OFFSIDES | ||
| 844 | Common Cold | SIDER | ||
| 845 | Compression fracture | OFFSIDES | ||
| 846 | Compression stockings application | OFFSIDES | ||
| 847 | Confabulation | OFFSIDES | ||
| 848 | Congenital tracheomalacia | OFFSIDES | ||
| 849 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 850 | Conjunctival deposit | OFFSIDES | ||
| 851 | Creatinine increased | SIDER | ||
| 852 | Cytopenia | SIDER | ||
| 853 | Debridement | OFFSIDES | ||
| 854 | Delusional perception | OFFSIDES | ||
| 855 | Demyelination | OFFSIDES | ||
| 856 | Dental Fistula | OFFSIDES | ||
| 857 | Dental abscess | OFFSIDES | ||
| 858 | Dental prosthesis placement | OFFSIDES | ||
| 859 | Dental prosthesis user | OFFSIDES | ||
| 860 | Dextrocardia | OFFSIDES | ||
| 861 | Diabetes | OFFSIDES | ||
| 862 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 863 | Diabetic Foot | OFFSIDES | ||
| 864 | Diabetic Neuropathies | 11523311 | CTD | |
| 865 | Diabetic ulcer | OFFSIDES | ||
| 866 | Diabetic | SIDER | ||
| 867 | Diarrhea | 2442561 2550641 | CTD OFFSIDES | |
| 868 | Disturbance in sexual arousal | SIDER | ||
| 869 | Diverticulosis | OFFSIDES | ||
| 870 | Dry cough | SIDER | ||
| 871 | Dyspnea | 2550641 | CTD | |
| 872 | Dyspnoea exacerbated | OFFSIDES | ||
| 873 | Ectropion | OFFSIDES | ||
| 874 | Ejection fraction abnormal | OFFSIDES | ||
| 875 | Electrocardiogram ST-T change | OFFSIDES | ||
| 876 | Encephalomalacia | OFFSIDES | ||
| 877 | Endometrial hypertrophy | OFFSIDES | ||
| 878 | Epicondylitis | OFFSIDES | ||
| 879 | Epidural Abscess | OFFSIDES | ||
| 880 | Erosive gastritis | OFFSIDES | ||
| 881 | Esophageal Stenosis | OFFSIDES | ||
| 882 | Eustachian tube disorder | OFFSIDES | ||
| 883 | Exanthema | 2442551 2442561 2550641 | CTD | |
| 884 | Extremity necrosis | OFFSIDES | ||
| 885 | Eye laser surgery | OFFSIDES | ||
| 886 | Fatty Liver | OFFSIDES | ||
| 887 | Feeding tube complication | OFFSIDES | ||
| 888 | Feelings of worthlessness | OFFSIDES | ||
| 889 | Fever | 2172073 | CTD | |
| 890 | Fibrosis | 1535655 | CTD | |
| 891 | Flank Pain | OFFSIDES SIDER | ||
| 892 | Gastrinoma | OFFSIDES | ||
| 893 | Gastrointestinal cramps | SIDER | ||
| 894 | Gastrointestinal perforation | OFFSIDES | ||
| 895 | Gene Mutation | OFFSIDES | ||
| 896 | Glycosuria | 1316108 | CTD | |
| 897 | Hay fever | OFFSIDES | ||
| 898 | Hearing aid user | OFFSIDES | ||
| 899 | Heart failure | CTD | ||
| 900 | Heartburn | SIDER | ||
| 901 | Hematoma | 19281750 | CTD | |
| 902 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 903 | Hepatitis C | OFFSIDES | ||
| 904 | High frequency ablation | OFFSIDES | ||
| 905 | Hyperalgesia | 9151293 | CTD | |
| 906 | Hypercholesterolemia | 12566371 | CTD | |
| 907 | Hyperkalemia | 11176729 20112435 | CTD | |
| 908 | Hyperpigmentation | OFFSIDES | ||
| 909 | Hypertriglyceridemia | 12566371 | CTD | |
| 910 | Hypotension, Orthostatic | 15811171 | CTD | |
| 911 | Infant, Premature, Diseases | 8247923 | CTD | |
| 912 | Infarction | SIDER | ||
| 913 | Influenza-like symptoms | SIDER | ||
| 914 | Infusion site mobility decreased | OFFSIDES | ||
| 915 | Inhibitory drug interaction | OFFSIDES | ||
| 916 | Injection site irritation | OFFSIDES | ||
| 917 | Injection site urticaria | OFFSIDES | ||
| 918 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 919 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 920 | Intestinal Diseases | 7978713 11034011 | CTD | |
| 921 | Intravenous catheter management | OFFSIDES | ||
| 922 | JC virus infection | OFFSIDES | ||
| 923 | Kidney Diseases | CTD | ||
| 924 | Kidney Failure, Chronic | 16988746 | CTD | |
| 925 | Kidney Failure | OFFSIDES | ||
| 926 | Knee pain | SIDER | ||
| 927 | Lightheadedness | SIDER | ||
| 928 | Limb operation | OFFSIDES | ||
| 929 | Livedo Reticularis | OFFSIDES | ||
| 930 | Liver Cirrhosis, Experimental | 17900296 | CTD | |
| 931 | Loose tooth | OFFSIDES | ||
| 932 | Low Back Pain | SIDER | ||
| 933 | Lung consolidation | OFFSIDES | ||
| 934 | Lymph nodes scan abnormal | OFFSIDES | ||
| 935 | Lymphocytic infiltration | OFFSIDES | ||
| 936 | Macrocytosis | OFFSIDES | ||
| 937 | Malignant neoplasm progression | OFFSIDES | ||
| 938 | Mastectomy | OFFSIDES | ||
| 939 | Medical device removal | OFFSIDES | ||
| 940 | Metaplasia | OFFSIDES | ||
| 941 | Migraine with Aura | OFFSIDES | ||
| 942 | Mood Disorders | 11384921 | CTD | |
| 943 | Mouth Diseases | 7673623 | CTD | |
| 944 | Muscle Weakness | OFFSIDES | ||
| 945 | Muscle fibrosis | OFFSIDES | ||
| 946 | Muscle strain | OFFSIDES | ||
| 947 | Nephritis, Interstitial | 10344374 | CTD | |
| 948 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 949 | Nephrosis | 9165371 | CTD | |
| 950 | Nerve Block | OFFSIDES | ||
| 951 | Non-cardiac chest pain | OFFSIDES | ||
| 952 | Ocular Hypertension | OFFSIDES | ||
| 953 | Open reduction of fracture | OFFSIDES | ||
| 954 | Oral mucosal hypertrophy | OFFSIDES | ||
| 955 | Oral polypectomy | OFFSIDES | ||
| 956 | Orthopnea | OFFSIDES | ||
| 957 | Osteitis Deformans | OFFSIDES | ||
| 958 | Osteomyelitis | OFFSIDES | ||
| 959 | Osteoporosis | OFFSIDES | ||
| 960 | Otitis Media | SIDER | ||
| 961 | Panniculitis | OFFSIDES | ||
| 962 | Pelvic Pain | SIDER | ||
| 963 | Pelvic fluid collection | OFFSIDES | ||
| 964 | Penile Diseases | 10512511 | CTD | |
| 965 | Platelet Transfusion | OFFSIDES | ||
| 966 | Positron emission tomogram abnormal | OFFSIDES | ||
| 967 | Postinfarction angina | SIDER | ||
| 968 | Postmenopausal bleeding | OFFSIDES | ||
| 969 | Postoperative infection | OFFSIDES | ||
| 970 | Primary sequestrum | OFFSIDES | ||
| 971 | Prolapse repair | OFFSIDES | ||
| 972 | Psychotic Disorders | 11384921 | CTD | |
| 973 | Pulmonary Edema | 7988234 | CTD | |
| 974 | Pulmonary Eosinophilia | SIDER | ||
| 975 | Pulmonary Fibrosis | 16458281 | CTD | |
| 976 | Pulmonary radiation injury | OFFSIDES | ||
| 977 | Pyelonephritis | SIDER | ||
| 978 | Rectal Prolapse | OFFSIDES | ||
| 979 | Reflux gastritis | OFFSIDES | ||
| 980 | Refusal of treatment by relative | OFFSIDES | ||
| 981 | Renal Insufficiency | 2442561 8247923 11845579 | CTD | |
| 982 | Retinal Degeneration | OFFSIDES | ||
| 983 | Sacroiliitis | OFFSIDES | ||
| 984 | Schizophrenia | OFFSIDES | ||
| 985 | Scleroderma | OFFSIDES | ||
| 986 | Seroma | OFFSIDES | ||
| 987 | Shoulder Pain | OFFSIDES SIDER | ||
| 988 | Sialorrhea | 11384921 | CTD | |
| 989 | Situs Inversus | OFFSIDES | ||
| 990 | Skin Induration | OFFSIDES | ||
| 991 | Skin hypertrophy | OFFSIDES | ||
| 992 | Skin laceration | OFFSIDES | ||
| 993 | Sleep Talking | OFFSIDES | ||
| 994 | Sleep Wake Disorders | 11384921 | CTD | |
| 995 | Soft tissue inflammation | OFFSIDES | ||
| 996 | Spondylolisthesis | OFFSIDES | ||
| 997 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 998 | Stem cell transplant | OFFSIDES | ||
| 999 | Stillbirth | Canada Vigilance: 2 | Canada Vigilance | |
| 1000 | Substance Withdrawal Syndrome | 7968134 | CTD | |
| 1001 | Superficial Thrombophlebitis | OFFSIDES | ||
| 1002 | Sustained ventricular tachycardia | SIDER | ||
| 1003 | Sweating | SIDER | ||
| 1004 | Tardive Dyskinesia | OFFSIDES | ||
| 1005 | Taste Disorders | SIDER | ||
| 1006 | Tension | SIDER | ||
| 1007 | Therapeutic procedure | OFFSIDES | ||
| 1008 | Thoracotomy | OFFSIDES | ||
| 1009 | Tobacco user | OFFSIDES | ||
| 1010 | Tooth Extraction | OFFSIDES | ||
| 1011 | Tympanic Membrane Perforation | OFFSIDES | ||
| 1012 | Umbilical hernia | OFFSIDES | ||
| 1013 | Unspecified visual loss | SIDER | ||
| 1014 | Upper respiratory tract inflammation | OFFSIDES | ||
| 1015 | Uremia | SIDER | ||
| 1016 | Urine flow decreased | OFFSIDES | ||
| 1017 | Vaginal abscess | OFFSIDES | ||
| 1018 | Varicose vein operation | OFFSIDES | ||
| 1019 | Vascular insufficiency | OFFSIDES | ||
| 1020 | Ventricular Dysfunction, Left | 2539403 9061270 | CTD | |
| 1021 | Ventricular Dysfunction | 8393685 | CTD | |
| 1022 | Ventricular Remodeling | 17079761 | CTD | |
| 1023 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 1024 | Vitamin B1 increased | OFFSIDES | ||
| 1025 | Walking aid user | OFFSIDES | ||
| 1026 | Weight Gain | OFFSIDES | ||
| 1027 | Xerosis | OFFSIDES | ||
| 1028 | colonoscopy | OFFSIDES | ||
| 1029 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.