Albuterol
(NDAUXUAQIAJITI-UHFFFAOYSA-N)
Structure
- SMILES
- OCc1cc(ccc1O)C(CNC(C)(C)C)O
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- R03AC02; R03AK04; R03AK13; R03AL02; R03CC02
- Molecular Formula:
- C13H21NO3
- Molecular Weight:
- 239.311
- Log P:
- 1.6969
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 4
- TPSA:
- 72.72
- CAS Number(s):
- 18559-94-9; 35763-26-9
Synonym(s)
1.
Albuterol
2.
Salbutamol
3.
2-t-Butylamino-1-(4-hydroxy-3-hydroxy-3-hydroxymethyl)phenylethanol
4.
Albuterol Sulfate
5.
Proventil
6.
Sultanol
7.
Ventolin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product quality issue | FAERS: 3066 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 1617 Canada Vigilance: 104 | Canada Vigilance US FAERS | |
| 3 | No adverse event | FAERS: 1371 | US FAERS | |
| 4 | Drug dose omission | FAERS: 1242 | OFFSIDES US FAERS | |
| 5 | Asthma | FAERS: 732 Canada Vigilance: 59 |
81404
1572199 1978102 2693116 2782734 2849969 2936370 2974263 3109801 3223643 3537092 3898925 3968329 4067618 4430301 4921234 6435488 6811006 7117428 7437783 7893301 7982368 8417883 8681661 8968295 9428298 9616533 9707465 9949315 10023788 10480584 11142280 11729705 11991558 12027070 12355682 12734767 12972899 17380691 17700005 18023335 18225795 18717146 19329721 19363516 22607479 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 6 | Overdose | FAERS: 426 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Medication Error | FAERS: 335 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Pneumonia | FAERS: 312 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 9 | Incorrect dose administered | FAERS: 299 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Wheezing | FAERS: 258 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 11 | Pharmaceutical product complaint | FAERS: 250 | US FAERS | |
| 12 | Malaise | FAERS: 245 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 13 | Device use error | FAERS: 236 | US FAERS | |
| 14 | Dysgeusia | FAERS: 207 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 15 | Drug administration error | FAERS: 187 | US FAERS | |
| 16 | Poor quality device used | FAERS: 169 | US FAERS | |
| 17 | Product dose omission | FAERS: 167 | US FAERS | |
| 18 | Product container issue | FAERS: 157 | US FAERS | |
| 19 | Tachycardia | FAERS: 157 Canada Vigilance: 7 |
212150
465875 1979847 3223643 3408637 3898925 4843699 6145533 6552999 6751238 7362736 7407527 8968295 9088585 12865102 | CTD SIDER Canada Vigilance US FAERS |
| 20 | Circumstance or information capable of leading to medication error | FAERS: 149 | US FAERS | |
| 21 | Drug prescribing error | FAERS: 147 | US FAERS | |
| 22 | Choking | FAERS: 146 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Prescribed overdose | FAERS: 145 | US FAERS | |
| 24 | Bronchitis | FAERS: 142 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Tremor | FAERS: 141 Canada Vigilance: 26 |
698761
2370642 2384652 2462383 2693116 2782734 2849969 2893778 2974263 3311117 3767127 3898925 3907640 7912539 7982368 8102213 8428859 8968295 9707465 12865102 12972899 15338796 18023335 | CTD SIDER Canada Vigilance US FAERS |
| 26 | Dizziness | FAERS: 140 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 27 | Chest discomfort | FAERS: 135 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Wrong technique in product usage process | FAERS: 132 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 29 | Headache | FAERS: 116 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 30 | Anxiety | FAERS: 105 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 31 | Chest Pain | FAERS: 105 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Palpitations | FAERS: 104 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 33 | Throat irritation | FAERS: 100 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 34 | Product use issue | FAERS: 98 | US FAERS | |
| 35 | Device malfunction | FAERS: 93 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Nasopharyngitis | FAERS: 91 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 37 | Dysphonia | FAERS: 90 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 38 | Myocardial Infarction | FAERS: 87 Canada Vigilance: 3 | CTD Canada Vigilance US FAERS | |
| 39 | Nausea | FAERS: 77 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 40 | Hypersensitivity | FAERS: 76 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 41 | Oropharyngeal pain | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 42 | Vomiting | FAERS: 72 Canada Vigilance: 5 | 8285977 | CTD SIDER Canada Vigilance US FAERS |
| 43 | Pain | FAERS: 71 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 44 | Productive Cough | FAERS: 71 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 45 | Adverse event | FAERS: 70 | OFFSIDES US FAERS | |
| 46 | Feeling abnormal | FAERS: 70 | SIDER US FAERS | |
| 47 | Fatigue | FAERS: 68 Canada Vigilance: 3 | 3769383 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 48 | Arthritis | FAERS: 67 | US FAERS | |
| 49 | Expired product administered | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Product taste abnormal | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Product use in unapproved indication | FAERS: 59 | US FAERS | |
| 52 | Drug effect incomplete | FAERS: 58 | US FAERS | |
| 53 | Cerebrovascular accident | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 54 | Inappropriate schedule of drug administration | FAERS: 56 | US FAERS | |
| 55 | Influenza | FAERS: 54 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 56 | Asthenia | FAERS: 53 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 57 | Diabetes Mellitus | FAERS: 53 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 58 | Sinusitis | FAERS: 53 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 59 | Bronchospasm | FAERS: 52 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 60 | Wrong technique in device usage process | FAERS: 52 | US FAERS | |
| 61 | Nervousness | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Unevaluable event | FAERS: 51 | US FAERS | |
| 63 | Cataract | FAERS: 50 | OFFSIDES US FAERS | |
| 64 | Incorrect route of drug administration | FAERS: 50 | US FAERS | |
| 65 | Feeling jittery | FAERS: 47 | US FAERS | |
| 66 | Respiratory Failure | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 67 | Atrial Fibrillation | FAERS: 42 Canada Vigilance: 1 | 2308690 2394158 2527421 | CTD SIDER Canada Vigilance US FAERS |
| 68 | Blood count abnormal | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 69 | Metabolic acidosis | FAERS: 42 | SIDER US FAERS | |
| 70 | Product substitution issue | FAERS: 41 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 71 | Retching | FAERS: 41 | SIDER US FAERS | |
| 72 | Urticaria | FAERS: 41 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 73 | Accidental overdose | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Intentional product use issue | FAERS: 40 | US FAERS | |
| 75 | Thermal burn | FAERS: 40 | US FAERS | |
| 76 | Accidental exposure to product | FAERS: 39 | US FAERS | |
| 77 | Extra dose administered | FAERS: 39 | US FAERS | |
| 78 | Lower respiratory tract infection | FAERS: 39 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 79 | Respiratory distress | FAERS: 39 | US FAERS | |
| 80 | Intentional drug misuse | FAERS: 38 | OFFSIDES US FAERS | |
| 81 | Memory impairment | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Product complaint | FAERS: 37 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 83 | Agitation | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 84 | Inhalation Therapy | FAERS: 36 | US FAERS | |
| 85 | Intentional product misuse | FAERS: 35 | US FAERS | |
| 86 | Erythema | FAERS: 34 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 87 | Foreign body aspiration | FAERS: 34 | US FAERS | |
| 88 | Hyperventilation | FAERS: 34 | SIDER US FAERS | |
| 89 | Product packaging quantity issue | FAERS: 33 | US FAERS | |
| 90 | Pulmonary congestion | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 91 | Loss of personal independence in daily activities | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 92 | Visual Impairment | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 93 | Wrong technique in drug usage process | FAERS: 31 | US FAERS | |
| 94 | Poor quality drug administered | FAERS: 30 | US FAERS | |
| 95 | Expired drug administered | FAERS: 29 | US FAERS | |
| 96 | Burning sensation | FAERS: 28 | US FAERS | |
| 97 | Pneumothorax | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Drug abuse | FAERS: 26 | US FAERS | |
| 99 | Pruritus | FAERS: 26 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 100 | Acute myocardial infarction | FAERS: 25 | US FAERS | |
| 101 | Macular degeneration | FAERS: 25 | US FAERS | |
| 102 | Abdominal discomfort | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 103 | Aphonia | FAERS: 24 | OFFSIDES US FAERS | |
| 104 | Arthralgia | FAERS: 23 | SIDER US FAERS | |
| 105 | Back Pain | FAERS: 23 | SIDER US FAERS | |
| 106 | Blindness | FAERS: 23 | US FAERS | |
| 107 | Infection | FAERS: 23 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 108 | Respiratory arrest | FAERS: 23 | US FAERS | |
| 109 | Blood glucose increased | FAERS: 22 | US FAERS | |
| 110 | Device Failure | FAERS: 22 | US FAERS | |
| 111 | Increased upper airway secretion | FAERS: 22 | OFFSIDES US FAERS | |
| 112 | Syncope | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 113 | Cyanosis | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Drug Dependence | FAERS: 21 | US FAERS | |
| 115 | Drug administered at inappropriate site | FAERS: 21 | US FAERS | |
| 116 | Poor quality product administered | FAERS: 21 | US FAERS | |
| 117 | Therapeutic product effect incomplete | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 118 | Incorrect dose administered by device | FAERS: 20 | US FAERS | |
| 119 | Laryngitis | FAERS: 20 | SIDER US FAERS | |
| 120 | Product cleaning inadequate | FAERS: 20 | US FAERS | |
| 121 | Stress | FAERS: 20 | OFFSIDES US FAERS | |
| 122 | Cardiac Arrest | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 123 | Dementia | FAERS: 19 | US FAERS | |
| 124 | Disability | FAERS: 19 | US FAERS | |
| 125 | Epistaxis | FAERS: 19 | SIDER US FAERS | |
| 126 | General physical health deterioration | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Incorrect drug administration rate | FAERS: 19 | US FAERS | |
| 128 | Oral pain | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Pharyngolaryngeal Pain | FAERS: 19 | OFFSIDES US FAERS | |
| 130 | Supraventricular tachycardia | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 131 | Glaucoma | FAERS: 18 | US FAERS | |
| 132 | Joint injury | FAERS: 18 | US FAERS | |
| 133 | Secretion discharge | FAERS: 18 | US FAERS | |
| 134 | Weight decreased | FAERS: 18 | US FAERS | |
| 135 | Abdominal Pain | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 136 | Angina Pectoris | FAERS: 17 | 6811006 | CTD SIDER US FAERS |
| 137 | Chills | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 138 | Drug administered to patient of inappropriate age | FAERS: 17 | US FAERS | |
| 139 | Emotional distress | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 140 | Hypotension | FAERS: 17 | 4843699 12970051 | CTD SIDER US FAERS |
| 141 | Hypoxia | FAERS: 17 | OFFSIDES US FAERS | |
| 142 | Amnesia | FAERS: 16 | OFFSIDES US FAERS | |
| 143 | Discomfort | FAERS: 16 | SIDER US FAERS | |
| 144 | Disorientation | FAERS: 16 | US FAERS | |
| 145 | Osteoporosis | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 146 | Ageusia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Choking sensation | FAERS: 15 | OFFSIDES US FAERS | |
| 148 | Drug effect delayed | FAERS: 15 | US FAERS | |
| 149 | Product lot number issue | FAERS: 15 | US FAERS | |
| 150 | Toxicity to various agents | FAERS: 15 | US FAERS | |
| 151 | Urinary tract infection | FAERS: 15 | SIDER US FAERS | |
| 152 | Angioedema | FAERS: 14 | 6476995 | CTD SIDER US FAERS |
| 153 | Constipation | FAERS: 14 | SIDER US FAERS | |
| 154 | Crying | FAERS: 14 | US FAERS | |
| 155 | Device defective | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Drug exposure during pregnancy | FAERS: 14 | US FAERS | |
| 157 | Sinus Tachycardia | FAERS: 14 | US FAERS | |
| 158 | Suicide attempt | FAERS: 14 | US FAERS | |
| 159 | Accidental exposure | FAERS: 13 | US FAERS | |
| 160 | Drug dispensing error | FAERS: 13 | US FAERS | |
| 161 | Dysuria | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 162 | Fibromyalgia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 163 | Middle insomnia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Presyncope | FAERS: 13 | US FAERS | |
| 165 | Product availability issue | FAERS: 13 | US FAERS | |
| 166 | Respiratory tract congestion | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Sneezing | FAERS: 13 | US FAERS | |
| 168 | Thrombosis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Alopecia | FAERS: 12 | US FAERS | |
| 170 | Arthropathy | FAERS: 12 | US FAERS | |
| 171 | Back disorder | FAERS: 12 | US FAERS | |
| 172 | Deafness | FAERS: 12 | OFFSIDES US FAERS | |
| 173 | Dehydration | FAERS: 12 | OFFSIDES US FAERS | |
| 174 | Depressed Level of Consciousness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 175 | Dose calculation error | FAERS: 12 | US FAERS | |
| 176 | Drug screen positive | FAERS: 12 | US FAERS | |
| 177 | Eye irritation | FAERS: 12 | US FAERS | |
| 178 | Nasal Polyps | FAERS: 12 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 179 | Shock | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 180 | Stomatitis | FAERS: 12 | SIDER US FAERS | |
| 181 | Urinary Retention | FAERS: 12 | US FAERS | |
| 182 | Asphyxia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 183 | Blood cholesterol increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Blood potassium decreased | FAERS: 11 | US FAERS | |
| 185 | Dependence | FAERS: 11 | US FAERS | |
| 186 | Eosinophilic granulomatosis with polyangiitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Lip swelling | FAERS: 11 | US FAERS | |
| 188 | Product physical issue | FAERS: 11 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 189 | Product storage error | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Somnolence | FAERS: 11 | SIDER US FAERS | |
| 191 | Therapeutic response unexpected with drug substitution | FAERS: 11 | US FAERS | |
| 192 | Accidental underdose | FAERS: 10 | US FAERS | |
| 193 | Acute respiratory failure | FAERS: 10 | OFFSIDES US FAERS | |
| 194 | Anger | FAERS: 10 | OFFSIDES US FAERS | |
| 195 | Chronic sinusitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 196 | Incorrect drug administration duration | FAERS: 10 | US FAERS | |
| 197 | Incorrect product storage | FAERS: 10 | US FAERS | |
| 198 | Peripheral swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Pulmonary Embolism | FAERS: 10 | US FAERS | |
| 200 | Rheumatoid Arthritis | FAERS: 10 | US FAERS | |
| 201 | Vertigo | FAERS: 10 | SIDER US FAERS | |
| 202 | Abasia | FAERS: 9 | OFFSIDES US FAERS | |
| 203 | Activities of daily living impaired | FAERS: 9 | US FAERS | |
| 204 | Ankle Fracture | FAERS: 9 | US FAERS | |
| 205 | Coronary Artery Disease | FAERS: 9 | 6706438 | CTD US FAERS |
| 206 | Eye pain | FAERS: 9 | US FAERS | |
| 207 | Increased bronchial secretion | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 208 | Musculoskeletal Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 209 | Myalgia | FAERS: 9 | SIDER US FAERS | |
| 210 | Pallor | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 211 | Poor quality sleep | FAERS: 9 | US FAERS | |
| 212 | Restlessness | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | Swelling | FAERS: 9 | US FAERS | |
| 214 | Throat cancer | FAERS: 9 | US FAERS | |
| 215 | Tinnitus | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 216 | Apparent death | FAERS: 8 | US FAERS | |
| 217 | Atrial Flutter | FAERS: 8 | 9166355 | CTD US FAERS |
| 218 | Breath alcohol test positive | FAERS: 8 | US FAERS | |
| 219 | Cold sweat | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Diverticulitis | FAERS: 8 | US FAERS | |
| 221 | Flushing | FAERS: 8 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 222 | Gout | FAERS: 8 | US FAERS | |
| 223 | Impaired work ability | FAERS: 8 | OFFSIDES US FAERS | |
| 224 | Leukocytosis | FAERS: 8 | US FAERS | |
| 225 | Mental impairment | FAERS: 8 | US FAERS | |
| 226 | Therapeutic product ineffective | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Therapy change | FAERS: 8 | US FAERS | |
| 228 | Cellulitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 229 | Cholelithiasis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Device breakage | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Device ineffective | FAERS: 7 | US FAERS | |
| 232 | Device occlusion | FAERS: 7 | US FAERS | |
| 233 | Drug ineffective for unapproved indication | FAERS: 7 | US FAERS | |
| 234 | Euphoric mood | FAERS: 7 | SIDER US FAERS | |
| 235 | Feeling Cold | FAERS: 7 | US FAERS | |
| 236 | Food Allergy | FAERS: 7 | US FAERS | |
| 237 | Foreign body in respiratory tract | FAERS: 7 | US FAERS | |
| 238 | Foreign body trauma | FAERS: 7 | US FAERS | |
| 239 | Frustration tolerance decreased | FAERS: 7 | US FAERS | |
| 240 | Inability to afford medication | FAERS: 7 | US FAERS | |
| 241 | Incorrect dose administered by product | FAERS: 7 | US FAERS | |
| 242 | Incorrect route of product administration | FAERS: 7 | US FAERS | |
| 243 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 244 | Joint swelling | FAERS: 7 | US FAERS | |
| 245 | Medical device complication | FAERS: 7 | US FAERS | |
| 246 | Musculoskeletal chest pain | FAERS: 7 | US FAERS | |
| 247 | Musculoskeletal discomfort | FAERS: 7 | SIDER US FAERS | |
| 248 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES US FAERS | |
| 249 | Pleurisy | FAERS: 7 | US FAERS | |
| 250 | Product label issue | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Pulmonary Hypertension | FAERS: 7 | US FAERS | |
| 252 | Respiratory tract irritation | FAERS: 7 | US FAERS | |
| 253 | Tachyarrhythmia | FAERS: 7 | US FAERS | |
| 254 | Ventricular Fibrillation | FAERS: 7 | US FAERS | |
| 255 | Alcohol test false positive | FAERS: 6 | US FAERS | |
| 256 | Anaphylactic shock | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 257 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 258 | Bronchial Obstruction | FAERS: 6 | US FAERS | |
| 259 | Bronchiectasis | FAERS: 6 | US FAERS | |
| 260 | Carpal Tunnel Syndrome | FAERS: 6 | US FAERS | |
| 261 | Cataract operation | FAERS: 6 | US FAERS | |
| 262 | Depressed mood | FAERS: 6 | US FAERS | |
| 263 | Feeling of body temperature change | FAERS: 6 | US FAERS | |
| 264 | Hypothyroidism | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Laceration | FAERS: 6 | US FAERS | |
| 266 | Lymphadenopathy | FAERS: 6 | SIDER US FAERS | |
| 267 | Neck Pain | FAERS: 6 | US FAERS | |
| 268 | Pharyngitis | FAERS: 6 | SIDER US FAERS | |
| 269 | Physical product label issue | FAERS: 6 | US FAERS | |
| 270 | Pleuritic pain | FAERS: 6 | US FAERS | |
| 271 | Polyuria | FAERS: 6 | US FAERS | |
| 272 | Prescription drug used without a prescription | FAERS: 6 | US FAERS | |
| 273 | Product contamination physical | FAERS: 6 | US FAERS | |
| 274 | Product expiration date issue | FAERS: 6 | US FAERS | |
| 275 | Product packaging issue | FAERS: 6 | US FAERS | |
| 276 | Product quality control issue | FAERS: 6 | US FAERS | |
| 277 | Rhinitis | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 278 | Sepsis | FAERS: 6 | US FAERS | |
| 279 | Sleep disorder due to a general medical condition | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Tension | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 281 | Therapeutic response delayed | FAERS: 6 | US FAERS | |
| 282 | Tooth Loss | FAERS: 6 | US FAERS | |
| 283 | Unresponsive to stimuli | FAERS: 6 | US FAERS | |
| 284 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 285 | Amphetamines positive | FAERS: 5 | US FAERS | |
| 286 | Anosmia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 288 | Aphthous Stomatitis | FAERS: 5 | US FAERS | |
| 289 | Atypical pneumonia | FAERS: 5 | US FAERS | |
| 290 | Bronchopulmonary Aspergillosis | FAERS: 5 | US FAERS | |
| 291 | Carotid artery occlusion | FAERS: 5 | US FAERS | |
| 292 | Cystitis | FAERS: 5 | US FAERS | |
| 293 | Delirium | FAERS: 5 | US FAERS | |
| 294 | Device difficult to use | FAERS: 5 | US FAERS | |
| 295 | Drug abuser | FAERS: 5 | US FAERS | |
| 296 | Dyspepsia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 297 | Emergency care examination | FAERS: 5 | US FAERS | |
| 298 | Flatulence | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 299 | Gait inability | FAERS: 5 | US FAERS | |
| 300 | Head discomfort | FAERS: 5 | US FAERS | |
| 301 | Hernia | FAERS: 5 | US FAERS | |
| 302 | Hypokinesia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Hypoventilation | FAERS: 5 | US FAERS | |
| 304 | Intentional device misuse | FAERS: 5 | US FAERS | |
| 305 | Intestinal Obstruction | FAERS: 5 | US FAERS | |
| 306 | Lethargy | FAERS: 5 | 3769383 | CTD US FAERS |
| 307 | Limb injury | FAERS: 5 | US FAERS | |
| 308 | Lung hyperinflation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 310 | Multiple allergies | FAERS: 5 | US FAERS | |
| 311 | Myoclonus | FAERS: 5 | 10822452 | CTD US FAERS |
| 312 | Nephrolithiasis | FAERS: 5 | US FAERS | |
| 313 | Nonspecific reaction | FAERS: 5 | US FAERS | |
| 314 | Oxygen saturation abnormal | FAERS: 5 | US FAERS | |
| 315 | Oxygen supplementation | FAERS: 5 | US FAERS | |
| 316 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 317 | Pneumonitis | FAERS: 5 | US FAERS | |
| 318 | Post-Traumatic Stress Disorder | FAERS: 5 | US FAERS | |
| 319 | Product formulation issue | FAERS: 5 | US FAERS | |
| 320 | Product prescribing error | FAERS: 5 | US FAERS | |
| 321 | Pulmonary function test decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Pulmonary pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Reaction to drug excipients | FAERS: 5 | US FAERS | |
| 324 | Sinus operation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | Skin discomfort | FAERS: 5 | US FAERS | |
| 326 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 327 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 328 | Aneurysm | FAERS: 4 | US FAERS | |
| 329 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 330 | Bedridden | FAERS: 4 | US FAERS | |
| 331 | Bipolar Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 332 | Blood immunoglobulin E increased | FAERS: 4 | US FAERS | |
| 333 | Cervix carcinoma | FAERS: 4 | US FAERS | |
| 334 | Chemical burn of skin | FAERS: 4 | US FAERS | |
| 335 | Circumstance or information capable of leading to device use error | FAERS: 4 | US FAERS | |
| 336 | Dental caries | FAERS: 4 | US FAERS | |
| 337 | Device use issue | FAERS: 4 | US FAERS | |
| 338 | Diabetic Ketoacidosis | FAERS: 4 | US FAERS | |
| 339 | Drug toxicity | FAERS: 4 | US FAERS | |
| 340 | Emotional disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 341 | Familial Periodic Paralysis | FAERS: 4 | US FAERS | |
| 342 | Glycosuria | FAERS: 4 | SIDER US FAERS | |
| 343 | Hospice Care | FAERS: 4 | US FAERS | |
| 344 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 345 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 346 | Initial insomnia | FAERS: 4 | US FAERS | |
| 347 | Intervertebral Disc Degeneration | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 348 | Intracranial Aneurysm | FAERS: 4 | US FAERS | |
| 349 | Lung cyst benign | FAERS: 4 | US FAERS | |
| 350 | Lymphoma | FAERS: 4 | US FAERS | |
| 351 | Mesothelioma | FAERS: 4 | US FAERS | |
| 352 | Mydriasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 353 | Oral candidiasis | FAERS: 4 | US FAERS | |
| 354 | Paranasal sinus polypectomy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 355 | Prescribed underdose | FAERS: 4 | US FAERS | |
| 356 | Product administration error | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 357 | Product distribution issue | FAERS: 4 | US FAERS | |
| 358 | Product leakage | FAERS: 4 | US FAERS | |
| 359 | Rales | FAERS: 4 | US FAERS | |
| 360 | Rash erythematous | FAERS: 4 | US FAERS | |
| 361 | Regurgitation | FAERS: 4 | US FAERS | |
| 362 | Rotator cuff syndrome | FAERS: 4 | US FAERS | |
| 363 | Sarcoidosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Screaming | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Sinus polyp | FAERS: 4 | US FAERS | |
| 366 | Spinal column injury | FAERS: 4 | US FAERS | |
| 367 | Spinal column stenosis | FAERS: 4 | OFFSIDES US FAERS | |
| 368 | Subcutaneous Emphysema | FAERS: 4 | US FAERS | |
| 369 | Tongue blistering | FAERS: 4 | US FAERS | |
| 370 | Troponin increased | FAERS: 4 | US FAERS | |
| 371 | Umbilical hernia | FAERS: 4 | US FAERS | |
| 372 | Upper-airway cough syndrome | FAERS: 4 | US FAERS | |
| 373 | Vasculitis | FAERS: 4 | US FAERS | |
| 374 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 375 | Abdominal adhesions | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 376 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 377 | Alcohol poisoning | FAERS: 3 | US FAERS | |
| 378 | Application site burn | FAERS: 3 | US FAERS | |
| 379 | Artificial crown procedure | FAERS: 3 | US FAERS | |
| 380 | Bladder pain | FAERS: 3 | US FAERS | |
| 381 | Blood alcohol increased | FAERS: 3 | US FAERS | |
| 382 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 383 | Blood glucose abnormal | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 384 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 385 | Breast Feeding | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 386 | Bronchial Hyperreactivity | FAERS: 3 | US FAERS | |
| 387 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 388 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 389 | Completed Suicide | FAERS: 3 | US FAERS | |
| 390 | Cystic Fibrosis | FAERS: 3 | US FAERS | |
| 391 | Device lead damage | FAERS: 3 | US FAERS | |
| 392 | Documented hypersensitivity to administered product | FAERS: 3 | US FAERS | |
| 393 | Dysarthria | FAERS: 3 | US FAERS | |
| 394 | Ear discomfort | FAERS: 3 | US FAERS | |
| 395 | Eczema | FAERS: 3 | SIDER US FAERS | |
| 396 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 397 | Electrocardiogram ST segment abnormal | FAERS: 3 | US FAERS | |
| 398 | Emergency Care | FAERS: 3 | US FAERS | |
| 399 | Endotracheal intubation complication | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 400 | Gingival Recession | FAERS: 3 | US FAERS | |
| 401 | Hemiparesis | FAERS: 3 | US FAERS | |
| 402 | Immobile | FAERS: 3 | US FAERS | |
| 403 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 404 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 405 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 406 | Lower respiratory tract congestion | FAERS: 3 | US FAERS | |
| 407 | Malignant neoplasm progression | FAERS: 3 | US FAERS | |
| 408 | Mouth swelling | FAERS: 3 | US FAERS | |
| 409 | Mycotic allergy | FAERS: 3 | US FAERS | |
| 410 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 411 | Obstruction | FAERS: 3 | US FAERS | |
| 412 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 413 | Paradoxical drug reaction | FAERS: 3 | US FAERS | |
| 414 | Pericarditis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 415 | Poisoning | FAERS: 3 | US FAERS | |
| 416 | Post procedural complication | FAERS: 3 | US FAERS | |
| 417 | Product use complaint | FAERS: 3 | US FAERS | |
| 418 | Product used for unknown indication | FAERS: 3 | US FAERS | |
| 419 | Prolonged expiration | FAERS: 3 | US FAERS | |
| 420 | Psoriasis | FAERS: 3 | US FAERS | |
| 421 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 422 | Quality of life decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 423 | Restrictive pulmonary disease | FAERS: 3 | US FAERS | |
| 424 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 425 | Therapy cessation | FAERS: 3 | US FAERS | |
| 426 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 427 | Ulcer | FAERS: 3 | US FAERS | |
| 428 | Urinary Incontinence | FAERS: 3 | 3769383 | CTD US FAERS |
| 429 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 430 | Visual disturbance | FAERS: 3 | US FAERS | |
| 431 | Walking aid user | FAERS: 3 | OFFSIDES US FAERS | |
| 432 | Wheelchair user | FAERS: 3 | US FAERS | |
| 433 | Wrong patient received medication | FAERS: 3 | US FAERS | |
| 434 | treatment failure | FAERS: 3 | US FAERS | |
| 435 | Abdominal strangulated hernia | FAERS: 2 | US FAERS | |
| 436 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 437 | Adenoid Cystic Carcinoma | FAERS: 2 | US FAERS | |
| 438 | Allergic sinusitis | FAERS: 2 | US FAERS | |
| 439 | Anorexia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 440 | Anticholinergic Syndrome | FAERS: 2 | US FAERS | |
| 441 | Aortic Valve Stenosis | FAERS: 2 | US FAERS | |
| 442 | Aphagia | FAERS: 2 | US FAERS | |
| 443 | Aphasia | FAERS: 2 | US FAERS | |
| 444 | Appendicitis | FAERS: 2 | US FAERS | |
| 445 | Application site erythema | FAERS: 2 | US FAERS | |
| 446 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 447 | Arthropod bite | FAERS: 2 | US FAERS | |
| 448 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 449 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 450 | Blood urine present | FAERS: 2 | US FAERS | |
| 451 | Bradycardia | FAERS: 2 | US FAERS | |
| 452 | Brain Death | FAERS: 2 | US FAERS | |
| 453 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 454 | Breast hyperplasia | FAERS: 2 | US FAERS | |
| 455 | Bronchial irritation | FAERS: 2 | US FAERS | |
| 456 | Bruxism | FAERS: 2 | US FAERS | |
| 457 | Candidiasis | FAERS: 2 | US FAERS | |
| 458 | Carbon dioxide increased | FAERS: 2 | US FAERS | |
| 459 | Cardiac autonomic neuropathy | FAERS: 2 | US FAERS | |
| 460 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 461 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 462 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 463 | Cartilage injury | FAERS: 2 | US FAERS | |
| 464 | Cheilitis | FAERS: 2 | US FAERS | |
| 465 | Chemical injury | FAERS: 2 | US FAERS | |
| 466 | Chronic Spontaneous Urticaria | FAERS: 2 | US FAERS | |
| 467 | Colonic perforation postoperative | FAERS: 2 | US FAERS | |
| 468 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 469 | Conjunctivitis | FAERS: 2 | SIDER US FAERS | |
| 470 | Conversion disorder | FAERS: 2 | US FAERS | |
| 471 | Cortisol decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 472 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 473 | Delayed delivery | FAERS: 2 | US FAERS | |
| 474 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 475 | Device leakage | FAERS: 2 | US FAERS | |
| 476 | Diabetes mellitus inadequate control | FAERS: 2 | OFFSIDES US FAERS | |
| 477 | Diplegia | FAERS: 2 | US FAERS | |
| 478 | Disease complication | FAERS: 2 | US FAERS | |
| 479 | Drug dose omission by device | FAERS: 2 | US FAERS | |
| 480 | Drug resistance | FAERS: 2 | US FAERS | |
| 481 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 482 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 483 | Dry age-related macular degeneration | FAERS: 2 | US FAERS | |
| 484 | Dysphemia | FAERS: 2 | US FAERS | |
| 485 | Dysplasia | FAERS: 2 | US FAERS | |
| 486 | Ear congestion | FAERS: 2 | US FAERS | |
| 487 | Economic problem | FAERS: 2 | OFFSIDES US FAERS | |
| 488 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 489 | Endometriosis | FAERS: 2 | US FAERS | |
| 490 | Epilepsy | FAERS: 2 | US FAERS | |
| 491 | Exposure via skin contact | FAERS: 2 | US FAERS | |
| 492 | Eye Infection | FAERS: 2 | US FAERS | |
| 493 | Eye inflammation | FAERS: 2 | US FAERS | |
| 494 | Fibromatosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 495 | Fracture | FAERS: 2 | US FAERS | |
| 496 | Frustration | FAERS: 2 | OFFSIDES US FAERS | |
| 497 | Fungal pharyngitis | FAERS: 2 | US FAERS | |
| 498 | Gangrene | FAERS: 2 | OFFSIDES US FAERS | |
| 499 | Gastric hypomotility | FAERS: 2 | US FAERS | |
| 500 | Gastric ulcer | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 501 | Gastritis | FAERS: 2 | US FAERS | |
| 502 | Gastroenteritis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 503 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 504 | Gingivitis | FAERS: 2 | US FAERS | |
| 505 | Glossitis | FAERS: 2 | SIDER US FAERS | |
| 506 | Granulomatosis with polyangiitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 507 | Hemiplegia | FAERS: 2 | US FAERS | |
| 508 | Hydronephrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 509 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 510 | Hypersomnia | FAERS: 2 | US FAERS | |
| 511 | Hypervigilance | FAERS: 2 | US FAERS | |
| 512 | Hysterectomy | FAERS: 2 | US FAERS | |
| 513 | Immunosuppression | FAERS: 2 | US FAERS | |
| 514 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 515 | Incoherent | FAERS: 2 | US FAERS | |
| 516 | Incontinence | FAERS: 2 | US FAERS | |
| 517 | Infarction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 518 | Injury associated with device | FAERS: 2 | US FAERS | |
| 519 | Inspiratory capacity decreased | FAERS: 2 | US FAERS | |
| 520 | Intentional misuse | FAERS: 2 | US FAERS | |
| 521 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 522 | Intestinal Perforation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 523 | Intestinal metaplasia | FAERS: 2 | US FAERS | |
| 524 | Intra-abdominal fluid collection | FAERS: 2 | US FAERS | |
| 525 | Irregular breathing | FAERS: 2 | US FAERS | |
| 526 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 527 | Limb operation | FAERS: 2 | US FAERS | |
| 528 | Live Birth | FAERS: 2 | US FAERS | |
| 529 | Lower respiratory tract infection bacterial | FAERS: 2 | US FAERS | |
| 530 | Mastectomy | FAERS: 2 | US FAERS | |
| 531 | Medical induction of coma | FAERS: 2 | US FAERS | |
| 532 | Microbiology test abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 533 | Muscle tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 534 | Myotonic Dystrophy | FAERS: 2 | US FAERS | |
| 535 | Necrosis | FAERS: 2 | US FAERS | |
| 536 | Nerve injury | FAERS: 2 | US FAERS | |
| 537 | Obesity | FAERS: 2 | US FAERS | |
| 538 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 539 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 540 | Oropharyngeal swelling | FAERS: 2 | SIDER US FAERS | |
| 541 | Osteomyelitis | FAERS: 2 | OFFSIDES US FAERS | |
| 542 | Osteopenia | FAERS: 2 | US FAERS | |
| 543 | Oxygen consumption decreased | FAERS: 2 | US FAERS | |
| 544 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 545 | Paranasal biopsy | FAERS: 2 | US FAERS | |
| 546 | Paranoia | FAERS: 2 | US FAERS | |
| 547 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 548 | Peripheral arthritis | FAERS: 2 | US FAERS | |
| 549 | Phimosis | FAERS: 2 | US FAERS | |
| 550 | Post procedural infection | FAERS: 2 | OFFSIDES US FAERS | |
| 551 | Postoperative ileus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 552 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 553 | Procedural complication | FAERS: 2 | US FAERS | |
| 554 | Product coating issue | FAERS: 2 | US FAERS | |
| 555 | Product design confusion | FAERS: 2 | US FAERS | |
| 556 | Product design issue | FAERS: 2 | US FAERS | |
| 557 | Product dosage form issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 558 | Product impurity | FAERS: 2 | US FAERS | |
| 559 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 560 | Product outer packaging issue | FAERS: 2 | US FAERS | |
| 561 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 562 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 563 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 564 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 565 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 566 | Respiratory complication associated with device | FAERS: 2 | US FAERS | |
| 567 | Restless Legs Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 568 | Root canal infection | FAERS: 2 | US FAERS | |
| 569 | Scab | FAERS: 2 | US FAERS | |
| 570 | Self-induced vomiting | FAERS: 2 | US FAERS | |
| 571 | Serotonin Syndrome | FAERS: 2 | US FAERS | |
| 572 | Single functional kidney | FAERS: 2 | US FAERS | |
| 573 | Sinus headache | FAERS: 2 | US FAERS | |
| 574 | Sinusitis aspergillus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 576 | Sputum retention | FAERS: 2 | US FAERS | |
| 577 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 578 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 579 | Stridor | FAERS: 2 | US FAERS | |
| 580 | Sudden death | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 581 | Superinfection | FAERS: 2 | US FAERS | |
| 582 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 583 | Therapeutic product effect decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 584 | Therapeutic response changed | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 585 | Thirst | FAERS: 2 | US FAERS | |
| 586 | Thymoma | FAERS: 2 | US FAERS | |
| 587 | Thyroidectomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 588 | Thyrotoxic periodic paralysis | FAERS: 2 | US FAERS | |
| 589 | Toothache | FAERS: 2 | US FAERS | |
| 590 | Total lung capacity abnormal | FAERS: 2 | US FAERS | |
| 591 | Tracheal pain | FAERS: 2 | US FAERS | |
| 592 | Troponin I increased | FAERS: 2 | US FAERS | |
| 593 | Urine alcohol test positive | FAERS: 2 | US FAERS | |
| 594 | Victim of homicide | FAERS: 2 | US FAERS | |
| 595 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 596 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 597 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 598 | cancer surgery | FAERS: 2 | US FAERS | |
| 599 | furuncle | FAERS: 2 | OFFSIDES US FAERS | |
| 600 | skin abrasion | FAERS: 2 | US FAERS | |
| 601 | Abdominal hernia gangrenous | FAERS: 1 | US FAERS | |
| 602 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 603 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 604 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 605 | Abscess | FAERS: 1 | US FAERS | |
| 606 | Accidental device ingestion | FAERS: 1 | US FAERS | |
| 607 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 608 | Acidosis | FAERS: 1 | 3769383 | CTD US FAERS |
| 609 | Acne | FAERS: 1 | US FAERS | |
| 610 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 611 | Agoraphobia | FAERS: 1 | US FAERS | |
| 612 | Albuminuria | FAERS: 1 | US FAERS | |
| 613 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 614 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 615 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 616 | Amblyopia | FAERS: 1 | US FAERS | |
| 617 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 618 | Animal scratch | FAERS: 1 | US FAERS | |
| 619 | Anoxia | FAERS: 1 | US FAERS | |
| 620 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 621 | Application site necrosis | FAERS: 1 | US FAERS | |
| 622 | Application site pain | FAERS: 1 | US FAERS | |
| 623 | Application site vesicles | FAERS: 1 | US FAERS | |
| 624 | Arthropod sting | FAERS: 1 | US FAERS | |
| 625 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 626 | Asterixis | FAERS: 1 | US FAERS | |
| 627 | Asthenopia | FAERS: 1 | US FAERS | |
| 628 | Astigmatism | FAERS: 1 | US FAERS | |
| 629 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 630 | Bacteriuria | FAERS: 1 | US FAERS | |
| 631 | Bladder neck obstruction | FAERS: 1 | US FAERS | |
| 632 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 633 | Blepharitis | FAERS: 1 | US FAERS | |
| 634 | Blepharochalasis | FAERS: 1 | US FAERS | |
| 635 | Blepharospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 636 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 637 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 638 | Blood calcium abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 639 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 640 | Blood immunoglobulin E abnormal | FAERS: 1 | US FAERS | |
| 641 | Blood pH increased | FAERS: 1 | US FAERS | |
| 642 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 643 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 644 | Bone abscess | FAERS: 1 | US FAERS | |
| 645 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 646 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 647 | Breech Presentation | FAERS: 1 | US FAERS | |
| 648 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 649 | Burn infection | FAERS: 1 | US FAERS | |
| 650 | Bursitis | FAERS: 1 | US FAERS | |
| 651 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 652 | Cardiac Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 653 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 654 | Cardiac ventriculogram left abnormal | FAERS: 1 | US FAERS | |
| 655 | Cavernous Sinus Thrombosis | FAERS: 1 | US FAERS | |
| 656 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 657 | Cerebral congestion | FAERS: 1 | US FAERS | |
| 658 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 659 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 660 | Cholestasis | FAERS: 1 | US FAERS | |
| 661 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 662 | Claustrophobia | FAERS: 1 | US FAERS | |
| 663 | Cleft Palate | FAERS: 1 | US FAERS | |
| 664 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 665 | Cognitive deterioration | FAERS: 1 | US FAERS | |
| 666 | Colitis | FAERS: 1 | OFFSIDES US FAERS | |
| 667 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 668 | Complication associated with device | FAERS: 1 | US FAERS | |
| 669 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 670 | Croup infectious | FAERS: 1 | US FAERS | |
| 671 | Culture urine positive | FAERS: 1 | US FAERS | |
| 672 | Cyst | FAERS: 1 | US FAERS | |
| 673 | Dependence on oxygen therapy | FAERS: 1 | US FAERS | |
| 674 | Device damage | FAERS: 1 | US FAERS | |
| 675 | Device priming | FAERS: 1 | US FAERS | |
| 676 | Device related infection | FAERS: 1 | US FAERS | |
| 677 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 678 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 679 | Disease susceptibility | FAERS: 1 | US FAERS | |
| 680 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 681 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 682 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 683 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 684 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 685 | Drug effect variable | FAERS: 1 | US FAERS | |
| 686 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 687 | Drug level changed | FAERS: 1 | US FAERS | |
| 688 | Drug level increased | FAERS: 1 | US FAERS | |
| 689 | Dry lung syndrome | FAERS: 1 | US FAERS | |
| 690 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 691 | Dyslexia | FAERS: 1 | US FAERS | |
| 692 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 693 | Dystonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 694 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 695 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 696 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 697 | Eosinophilia | FAERS: 1 | US FAERS | |
| 698 | Eosinophilic bronchitis | FAERS: 1 | US FAERS | |
| 699 | Erectile dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 700 | Exophthalmos | FAERS: 1 | US FAERS | |
| 701 | Exposure to allergen | FAERS: 1 | US FAERS | |
| 702 | Exposure to chemical pollution | FAERS: 1 | US FAERS | |
| 703 | Exposure via contaminated device | FAERS: 1 | US FAERS | |
| 704 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 705 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 706 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 707 | Eye Burns | FAERS: 1 | US FAERS | |
| 708 | Eye Redness | FAERS: 1 | US FAERS | |
| 709 | Facial paralysis | FAERS: 1 | US FAERS | |
| 710 | Failure of implant | FAERS: 1 | US FAERS | |
| 711 | False positive investigation result | FAERS: 1 | US FAERS | |
| 712 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 713 | Feeding tube user | FAERS: 1 | US FAERS | |
| 714 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 715 | Flank Pain | FAERS: 1 | US FAERS | |
| 716 | Forced expiratory volume increased | FAERS: 1 | US FAERS | |
| 717 | Gastrectomy | FAERS: 1 | US FAERS | |
| 718 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 719 | Gaze palsy | FAERS: 1 | US FAERS | |
| 720 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 721 | Genital rash | FAERS: 1 | OFFSIDES US FAERS | |
| 722 | Gingival erythema | FAERS: 1 | US FAERS | |
| 723 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 724 | Growth retardation | FAERS: 1 | US FAERS | |
| 725 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 726 | Hand-Arm Vibration Syndrome | FAERS: 1 | US FAERS | |
| 727 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 728 | Hepatitis C | FAERS: 1 | US FAERS | |
| 729 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 730 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 731 | Hip surgery | FAERS: 1 | US FAERS | |
| 732 | Hoarseness | FAERS: 1 | SIDER US FAERS | |
| 733 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 734 | Hyperacusis | FAERS: 1 | US FAERS | |
| 735 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 736 | Hyperoxia | FAERS: 1 | US FAERS | |
| 737 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 738 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 739 | Hypertrophy of tongue papillae | FAERS: 1 | US FAERS | |
| 740 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 741 | Hypophagia | FAERS: 1 | OFFSIDES US FAERS | |
| 742 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 743 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 744 | Inadequate aseptic technique in use of product | FAERS: 1 | US FAERS | |
| 745 | Inappropriate Prescribing | FAERS: 1 | US FAERS | |
| 746 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 747 | Inappropriate release of product for distribution | FAERS: 1 | US FAERS | |
| 748 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 749 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 750 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 751 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 752 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 753 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 754 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 755 | Inflammation | FAERS: 1 | SIDER US FAERS | |
| 756 | Injection | FAERS: 1 | US FAERS | |
| 757 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 758 | Intentional misuse of drug delivery system | FAERS: 1 | US FAERS | |
| 759 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 760 | Intervertebral disc disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 761 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 762 | Intussusception | FAERS: 1 | US FAERS | |
| 763 | Ketonuria | FAERS: 1 | US FAERS | |
| 764 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 765 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 766 | Laryngitis fungal | FAERS: 1 | US FAERS | |
| 767 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 768 | Libido disorder | FAERS: 1 | US FAERS | |
| 769 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 770 | Limb discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 771 | Lip pruritus | FAERS: 1 | US FAERS | |
| 772 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 773 | Livedo Reticularis | FAERS: 1 | OFFSIDES US FAERS | |
| 774 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 775 | Lower respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 776 | Lyme Disease | FAERS: 1 | US FAERS | |
| 777 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 778 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 779 | Mastication disorder | FAERS: 1 | US FAERS | |
| 780 | Measles | FAERS: 1 | US FAERS | |
| 781 | Meniscus injury | FAERS: 1 | US FAERS | |
| 782 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 783 | Milk Allergy | FAERS: 1 | US FAERS | |
| 784 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 785 | Monoplegia | FAERS: 1 | US FAERS | |
| 786 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 787 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 788 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 789 | Muscle Rigidity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 790 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 791 | Muscle strain | FAERS: 1 | US FAERS | |
| 792 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 793 | Myocardial bridging | FAERS: 1 | US FAERS | |
| 794 | Nasal Flaring | FAERS: 1 | US FAERS | |
| 795 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 796 | Nipple pain | FAERS: 1 | US FAERS | |
| 797 | No adverse effect | FAERS: 1 | US FAERS | |
| 798 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 799 | Nocturia | FAERS: 1 | US FAERS | |
| 800 | Nodule | FAERS: 1 | US FAERS | |
| 801 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 802 | Occupational exposure to air contaminants | FAERS: 1 | US FAERS | |
| 803 | Occupational exposure to dust | FAERS: 1 | US FAERS | |
| 804 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 805 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 806 | Oncologic complication | FAERS: 1 | US FAERS | |
| 807 | Onychomycosis | FAERS: 1 | US FAERS | |
| 808 | Opiates positive | FAERS: 1 | US FAERS | |
| 809 | Oral administration complication | FAERS: 1 | US FAERS | |
| 810 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 811 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 812 | Oral pruritus | FAERS: 1 | US FAERS | |
| 813 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 814 | Orthosis user | FAERS: 1 | US FAERS | |
| 815 | Otitis Media | FAERS: 1 | SIDER US FAERS | |
| 816 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 817 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 818 | Pancreatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 819 | Panic Disorder | FAERS: 1 | US FAERS | |
| 820 | Performance status decreased | FAERS: 1 | US FAERS | |
| 821 | Perineal pain | FAERS: 1 | US FAERS | |
| 822 | Periodontal infection | FAERS: 1 | US FAERS | |
| 823 | Periodontitis | FAERS: 1 | OFFSIDES US FAERS | |
| 824 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 825 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 826 | Peritonitis | FAERS: 1 | OFFSIDES US FAERS | |
| 827 | Pertussis identification test positive | FAERS: 1 | US FAERS | |
| 828 | Pertussis | FAERS: 1 | US FAERS | |
| 829 | Petechiae | FAERS: 1 | US FAERS | |
| 830 | Pharyngeal swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 831 | Photophobia | FAERS: 1 | US FAERS | |
| 832 | Pituitary cyst | FAERS: 1 | US FAERS | |
| 833 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 834 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 835 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 836 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 837 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 838 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 839 | Product counterfeit | FAERS: 1 | US FAERS | |
| 840 | Product deposit | FAERS: 1 | US FAERS | |
| 841 | Product dispensing error | FAERS: 1 | US FAERS | |
| 842 | Product preparation error | FAERS: 1 | US FAERS | |
| 843 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 844 | Product residue present | FAERS: 1 | US FAERS | |
| 845 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 846 | Proteinuria | FAERS: 1 | US FAERS | |
| 847 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 848 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 849 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 850 | Purulence | FAERS: 1 | US FAERS | |
| 851 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 852 | Quadriplegia | FAERS: 1 | US FAERS | |
| 853 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 854 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 855 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 856 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 857 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 858 | Resting Tremor | FAERS: 1 | US FAERS | |
| 859 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 860 | Retinoschisis | FAERS: 1 | US FAERS | |
| 861 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 862 | Sarcoma | FAERS: 1 | US FAERS | |
| 863 | Semen volume decreased | FAERS: 1 | US FAERS | |
| 864 | Senile dementia | FAERS: 1 | US FAERS | |
| 865 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 866 | Sialometaplasia | FAERS: 1 | US FAERS | |
| 867 | Skeletal injury | FAERS: 1 | US FAERS | |
| 868 | Skin Ulcer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 869 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 870 | Skin irritation | FAERS: 1 | US FAERS | |
| 871 | Skin lesion | FAERS: 1 | US FAERS | |
| 872 | Small cell lung cancer metastatic | FAERS: 1 | US FAERS | |
| 873 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 874 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 875 | Starvation | FAERS: 1 | US FAERS | |
| 876 | Status Asthmaticus | FAERS: 1 | 114264 7427548 | CTD US FAERS |
| 877 | Strangulated hernia | FAERS: 1 | US FAERS | |
| 878 | Subclavian artery occlusion | FAERS: 1 | US FAERS | |
| 879 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 880 | Sunburn | FAERS: 1 | US FAERS | |
| 881 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 882 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 883 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 884 | Tardive Dyskinesia | FAERS: 1 | OFFSIDES US FAERS | |
| 885 | Terminal state | FAERS: 1 | US FAERS | |
| 886 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 887 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 888 | Thoracic vertebral fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 889 | Throat clearing | FAERS: 1 | US FAERS | |
| 890 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 891 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 892 | Tobacco user | FAERS: 1 | US FAERS | |
| 893 | Tongue biting | FAERS: 1 | US FAERS | |
| 894 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 895 | Tonsillitis | FAERS: 1 | OFFSIDES US FAERS | |
| 896 | Tooth Erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 897 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 898 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 899 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 900 | Unemployment | FAERS: 1 | US FAERS | |
| 901 | Unilateral bronchospasm | FAERS: 1 | US FAERS | |
| 902 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 903 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 904 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 905 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 906 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 907 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 908 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 909 | Vertebral Artery Dissection | FAERS: 1 | US FAERS | |
| 910 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 911 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 912 | Walking distance test abnormal | FAERS: 1 | US FAERS | |
| 913 | Wound Complication | FAERS: 1 | US FAERS | |
| 914 | intensive care | FAERS: 1 | US FAERS | |
| 915 | Abdominal bloating | SIDER | ||
| 916 | Acid reflux | OFFSIDES | ||
| 917 | Acute kidney injury | 2870244 | CTD | |
| 918 | Agraphia | OFFSIDES | ||
| 919 | Akinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 920 | Altered bowel function | OFFSIDES | ||
| 921 | Alveolitis | OFFSIDES | ||
| 922 | Ammonia increased | OFFSIDES | ||
| 923 | Amputation | OFFSIDES | ||
| 924 | Anal Fissure | OFFSIDES | ||
| 925 | Anhedonia | OFFSIDES | ||
| 926 | Anoxic Encephalopathy | OFFSIDES | ||
| 927 | Apathy | OFFSIDES | ||
| 928 | Application site reaction | SIDER | ||
| 929 | Arthritis, Experimental | 10229875 | CTD | |
| 930 | Ataxia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 931 | Atelectasis | OFFSIDES | ||
| 932 | Atherosclerosis | OFFSIDES | ||
| 933 | Atrial Premature Complexes | 2462383 | CTD | |
| 934 | Atrial tachycardia | OFFSIDES | ||
| 935 | Aura | OFFSIDES | ||
| 936 | Autoimmune inner ear disease | OFFSIDES | ||
| 937 | Autonomic neuropathy | SIDER | ||
| 938 | Biliary dilatation | OFFSIDES | ||
| 939 | Blood Glucose | OFFSIDES | ||
| 940 | Blood sodium increased | OFFSIDES | ||
| 941 | Blood sodium | OFFSIDES | ||
| 942 | Blood triglycerides increased | OFFSIDES | ||
| 943 | Blurred vision | OFFSIDES | ||
| 944 | Bone density decreased | OFFSIDES | ||
| 945 | Bronchitis, Chronic | 3311117 | CTD | |
| 946 | Bronchospasm aggravated | SIDER | ||
| 947 | Capillary Fragility | OFFSIDES | ||
| 948 | Cardiomyopathies | 6625250 | CTD | |
| 949 | Cardiomyopathy, Dilated | 19081299 | CTD | |
| 950 | Carotid bruit | OFFSIDES | ||
| 951 | Central line infection | OFFSIDES | ||
| 952 | Cerebellar infarction | OFFSIDES | ||
| 953 | Cervical dysplasia | OFFSIDES | ||
| 954 | Cervicobrachial syndrome | OFFSIDES | ||
| 955 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 956 | Clostridium colitis | OFFSIDES | ||
| 957 | Cold symptoms | SIDER | ||
| 958 | Compression fracture | OFFSIDES | ||
| 959 | Compulsive shopping | OFFSIDES | ||
| 960 | Confabulation | OFFSIDES | ||
| 961 | Confusion | 3769383 | CTD | |
| 962 | Continuous Positive Airway Pressure | OFFSIDES | ||
| 963 | Cramps of lower extremities | SIDER | ||
| 964 | Culture positive | OFFSIDES | ||
| 965 | Demyelination | OFFSIDES | ||
| 966 | Dental abscess | OFFSIDES | ||
| 967 | Diabetes | OFFSIDES | ||
| 968 | Diabetic Nephropathy | OFFSIDES | ||
| 969 | Diaphragmatic Hernia | OFFSIDES | ||
| 970 | Diarrhea | OFFSIDES | ||
| 971 | Diverticulum | OFFSIDES | ||
| 972 | Drowsiness | SIDER | ||
| 973 | Drug withdrawal headache | OFFSIDES | ||
| 974 | Duodenitis | OFFSIDES | ||
| 975 | Dyspareunia | OFFSIDES | ||
| 976 | Dyspnea | 12970051 20016425 | CTD | |
| 977 | Dysthymic Disorder | OFFSIDES | ||
| 978 | Electrocardiogram abnormal | SIDER | ||
| 979 | Electrocardiogram change | SIDER | ||
| 980 | Embolic stroke | OFFSIDES | ||
| 981 | Encephalomalacia | OFFSIDES | ||
| 982 | Epigastric distress | SIDER | ||
| 983 | Epigastric pain | SIDER | ||
| 984 | Eructation | SIDER | ||
| 985 | Exacerbation of asthma | SIDER | ||
| 986 | Extremity necrosis | OFFSIDES | ||
| 987 | Febrile Neutropenia | OFFSIDES | ||
| 988 | Feeling tense | SIDER | ||
| 989 | Fibrosis | 15467267 | CTD | |
| 990 | Fluid overload | SIDER | ||
| 991 | Formication | OFFSIDES | ||
| 992 | Gagging | SIDER | ||
| 993 | Gambling | OFFSIDES | ||
| 994 | Gammopathy | OFFSIDES | ||
| 995 | Gas Poisoning | 20016425 | CTD | |
| 996 | Gastrointestinal Pain | SIDER | ||
| 997 | Granulocytosis | OFFSIDES | ||
| 998 | Heart failure | CTD | ||
| 999 | Heartburn | SIDER | ||
| 1000 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 1001 | Hepatic congestion | OFFSIDES | ||
| 1002 | Hordeolum | OFFSIDES | ||
| 1003 | Hostility | OFFSIDES | ||
| 1004 | Human papilloma virus test positive | OFFSIDES | ||
| 1005 | Hyperglycemia | CTD | ||
| 1006 | Hyperinsulinism | 8098220 | CTD | |
| 1007 | Hyperkalemia | 2384735 6114774 | CTD | |
| 1008 | Hyperkinesia | SIDER | ||
| 1009 | Hypertensive heart disease | OFFSIDES | ||
| 1010 | Hypoglycemia | 15232249 | CTD | |
| 1011 | Hypokalemia |
92737
719960 2209135 2567672 2575521 2712984 2729315 2762609 2829953 2876313 3320735 3330186 3408637 3545273 3956296 7867231 7893301 8098220 8285977 8681661 9311181 9583400 9616533 10023788 11729705 12972899 15232249 18412527 | CTD | |
| 1012 | Hypotension, Orthostatic | 6476995 | CTD | |
| 1013 | Ileus | SIDER | ||
| 1014 | Implant site infection | OFFSIDES | ||
| 1015 | Infusion site mobility decreased | OFFSIDES | ||
| 1016 | Intention tremor | OFFSIDES | ||
| 1017 | Joint Instability | OFFSIDES | ||
| 1018 | Joint Range of Motion Decreased | OFFSIDES | ||
| 1019 | Joint stiffness | OFFSIDES | ||
| 1020 | Keratitis | Canada Vigilance: 1 | Canada Vigilance | |
| 1021 | Ketosis | SIDER | ||
| 1022 | Kidney Diseases | 16428940 | CTD | |
| 1023 | Kidney Failure, Chronic | 2384735 | CTD | |
| 1024 | Kidney Failure | OFFSIDES | ||
| 1025 | Laryngospasm | OFFSIDES | ||
| 1026 | Lichenification | OFFSIDES | ||
| 1027 | Lightheadedness | SIDER | ||
| 1028 | Long QT Syndrome | 9244742 | CTD | |
| 1029 | Loop electrosurgical excision procedure | OFFSIDES | ||
| 1030 | Lung Diseases, Obstructive | 2462383 | CTD | |
| 1031 | Lung diseases | 14984458 | CTD | |
| 1032 | Malnutrition | SIDER | ||
| 1033 | Mastoiditis | OFFSIDES | ||
| 1034 | Mechanical urticaria | OFFSIDES | ||
| 1035 | Medical device removal | OFFSIDES | ||
| 1036 | Mental status changes | OFFSIDES | ||
| 1037 | Mesenteric vascular insufficiency | OFFSIDES | ||
| 1038 | Metatarsalgia | OFFSIDES | ||
| 1039 | Mood swings | SIDER | ||
| 1040 | Multi-organ disorder | OFFSIDES | ||
| 1041 | Multiple Pregnancy | SIDER | ||
| 1042 | Muscle Cramp | 698761 | CTD | |
| 1043 | Muscle Weakness | OFFSIDES | ||
| 1044 | Muscle fibrosis | OFFSIDES | ||
| 1045 | Myocardial Ischemia | 90996 15699818 | CTD | |
| 1046 | Myocarditis | 16908771 | CTD | |
| 1047 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1048 | Neutropenic colitis | OFFSIDES | ||
| 1049 | Neutropenic sepsis | OFFSIDES | ||
| 1050 | Orthopnea | OFFSIDES | ||
| 1051 | Paresis | 18412527 | CTD | |
| 1052 | Penile swelling | OFFSIDES | ||
| 1053 | Peripheral embolism | OFFSIDES | ||
| 1054 | Peripheral occlusive disease | OFFSIDES | ||
| 1055 | Peripheral vasodilatation | SIDER | ||
| 1056 | Physical disability | OFFSIDES | ||
| 1057 | Platybasia | OFFSIDES | ||
| 1058 | Post procedural pneumonia | OFFSIDES | ||
| 1059 | Pre-Eclampsia | SIDER | ||
| 1060 | Protein C Deficiency | OFFSIDES | ||
| 1061 | Pyuria | OFFSIDES | ||
| 1062 | Radiation associated pain | OFFSIDES | ||
| 1063 | Radical hysterectomy | OFFSIDES | ||
| 1064 | Radiculitis | OFFSIDES | ||
| 1065 | Rectal fissure | OFFSIDES | ||
| 1066 | Reflux gastritis | OFFSIDES | ||
| 1067 | Renal cyst | OFFSIDES | ||
| 1068 | Renal tubular necrosis | OFFSIDES | ||
| 1069 | Respiratory Sounds | 9166355 16101941 | CTD | |
| 1070 | Respiratory Tract Infections | 16205517 | CTD | |
| 1071 | Rhonchi | OFFSIDES | ||
| 1072 | Risus sardonicus | OFFSIDES | ||
| 1073 | Saliva altered | SIDER | ||
| 1074 | Schizophrenia | OFFSIDES | ||
| 1075 | Seizures | 9190242 | CTD | |
| 1076 | Self Mutilation | OFFSIDES | ||
| 1077 | Sensation of warmth | SIDER | ||
| 1078 | Septic Shock | OFFSIDES | ||
| 1079 | Silent myocardial infarction | OFFSIDES | ||
| 1080 | Skin Induration | OFFSIDES | ||
| 1081 | Skin hypertrophy | OFFSIDES | ||
| 1082 | Skin tightness | OFFSIDES | ||
| 1083 | Soft Tissue Injuries | OFFSIDES | ||
| 1084 | Spasm | 8680739 | CTD | |
| 1085 | Stomach ache | SIDER | ||
| 1086 | Subcutaneous nodule | OFFSIDES | ||
| 1087 | Sudden Cardiac Death | OFFSIDES | ||
| 1088 | Sweating | SIDER | ||
| 1089 | Tachycardia, Ventricular | 3984838 | CTD | |
| 1090 | Temporal Arteritis | OFFSIDES | ||
| 1091 | Tongue discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 1092 | Tracheitis | SIDER | ||
| 1093 | Tremor of hands | SIDER | ||
| 1094 | Urination Disorders | 18225795 | CTD | |
| 1095 | Vasodilation procedure | SIDER | ||
| 1096 | Vasodilation | SIDER | ||
| 1097 | Venoocclusive disease | OFFSIDES | ||
| 1098 | Ventricular Dysfunction, Left | 2364580 6706438 | CTD | |
| 1099 | Ventricular Outflow Obstruction | 12970051 | CTD | |
| 1100 | Vitamin K Deficiency | OFFSIDES | ||
| 1101 | Vocal Cord Paralysis | OFFSIDES | ||
| 1102 | Vulvovaginal mycotic infection | SIDER | ||
| 1103 | Weight Gain | OFFSIDES | ||
| 1104 | Wound infection staphylococcal | OFFSIDES | ||
| 1105 | anaphylaxis | 12637407 16101941 | CTD | |
| 1106 | jaundice | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.