valdecoxib
(LNPDTQAFDNKSHK-UHFFFAOYSA-N)
Structure
- SMILES
- Cc1onc(c1c1ccc(cc1)S(=O)(=O)N)c1ccccc1
- Type(s)
- Approved; Investigational; Withdrawn
- ATC code(s)
- M01AH03
- Molecular Formula:
- C16H14N2O3S
- Molecular Weight:
- 314.359
- Log P:
- 4.7455
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 94.57
- CAS Number(s):
- 181695-72-7
Synonym(s)
1.
valdecoxib
2.
Bextra
3.
SC 65872
4.
SC-65872
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myocardial Infarction | FAERS: 2797 Canada Vigilance: 5 | 17457957 17955500 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Cerebrovascular accident | FAERS: 2073 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Stevens-Johnson Syndrome | FAERS: 1719 Canada Vigilance: 3 | 25811541 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Thrombosis | FAERS: 495 | SIDER US FAERS | |
| 5 | Pulmonary Embolism | FAERS: 384 | SIDER US FAERS | |
| 6 | Anxiety | FAERS: 350 | SIDER US FAERS | |
| 7 | Acute myocardial infarction | FAERS: 143 | US FAERS | |
| 8 | Amnesia | FAERS: 142 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 9 | Chest Pain | FAERS: 126 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 10 | Pruritus | FAERS: 117 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Hypersensitivity | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Headache | FAERS: 94 | SIDER US FAERS | |
| 13 | Pain | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Cardiac Arrest | FAERS: 87 | US FAERS | |
| 15 | Coronary Artery Disease | FAERS: 77 | SIDER US FAERS | |
| 16 | Deep Vein Thrombosis | FAERS: 71 | US FAERS | |
| 17 | Nausea | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Dizziness | FAERS: 66 | SIDER US FAERS | |
| 19 | Skin reaction | FAERS: 66 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 20 | Drug ineffective | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Asthenia | FAERS: 60 | SIDER US FAERS | |
| 22 | Angina Pectoris | FAERS: 59 | SIDER US FAERS | |
| 23 | Fatigue | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Feeling abnormal | FAERS: 50 | SIDER US FAERS | |
| 25 | Urticaria | FAERS: 50 Canada Vigilance: 5 | 15702813 | CTD SIDER Canada Vigilance US FAERS |
| 26 | Cerebral Infarction | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Erythema | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 28 | Erythema Multiforme | FAERS: 41 | OFFSIDES SIDER US FAERS | |
| 29 | Abdominal Pain | FAERS: 40 | SIDER US FAERS | |
| 30 | Malaise | FAERS: 40 | SIDER US FAERS | |
| 31 | Vomiting | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Atrial Fibrillation | FAERS: 38 | SIDER US FAERS | |
| 33 | Diabetes Mellitus | FAERS: 37 | SIDER US FAERS | |
| 34 | Back Pain | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Blood cholesterol increased | FAERS: 35 | US FAERS | |
| 36 | Skin lesion | FAERS: 34 | OFFSIDES US FAERS | |
| 37 | Blindness | FAERS: 33 | US FAERS | |
| 38 | Nervousness | FAERS: 32 | SIDER US FAERS | |
| 39 | Palpitations | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Arteriosclerosis | FAERS: 30 | US FAERS | |
| 41 | Arthralgia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Dyspepsia | FAERS: 30 | SIDER US FAERS | |
| 43 | Rash erythematous | FAERS: 29 | SIDER US FAERS | |
| 44 | Memory impairment | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Stress | FAERS: 25 | US FAERS | |
| 46 | Unevaluable event | FAERS: 25 | OFFSIDES US FAERS | |
| 47 | Dermatitis | FAERS: 24 | SIDER US FAERS | |
| 48 | Toxic Epidermal Necrolysis | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 49 | Visual disturbance | FAERS: 23 | US FAERS | |
| 50 | Arthritis | FAERS: 22 | US FAERS | |
| 51 | Syncope | FAERS: 22 | SIDER US FAERS | |
| 52 | Embolism | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 53 | Swelling | FAERS: 21 | US FAERS | |
| 54 | Chest discomfort | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Chills | FAERS: 20 | SIDER US FAERS | |
| 56 | Eczema | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 57 | Hemiparesis | FAERS: 20 | US FAERS | |
| 58 | Tachycardia | FAERS: 20 | SIDER US FAERS | |
| 59 | Respiratory Failure | FAERS: 18 | SIDER US FAERS | |
| 60 | Acne | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 61 | Asthma | FAERS: 15 | US FAERS | |
| 62 | Dry skin | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 63 | Flatulence | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 64 | Muscle Cramp | FAERS: 15 | US FAERS | |
| 65 | Post procedural complication | FAERS: 15 | OFFSIDES US FAERS | |
| 66 | Dysgeusia | FAERS: 14 | SIDER US FAERS | |
| 67 | Weight decreased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 68 | Cellulitis | FAERS: 13 | SIDER US FAERS | |
| 69 | Myalgia | FAERS: 13 | SIDER US FAERS | |
| 70 | Ocular vascular disorder | FAERS: 13 | OFFSIDES US FAERS | |
| 71 | Pain of skin | FAERS: 13 | OFFSIDES US FAERS | |
| 72 | Pharmaceutical product complaint | FAERS: 13 | US FAERS | |
| 73 | Skin Ulcer | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 74 | Tinnitus | FAERS: 13 | SIDER US FAERS | |
| 75 | Impaired work ability | FAERS: 12 | US FAERS | |
| 76 | Neck Pain | FAERS: 12 | US FAERS | |
| 77 | Sepsis | FAERS: 12 | SIDER US FAERS | |
| 78 | Skin irritation | FAERS: 12 | US FAERS | |
| 79 | Tremor | FAERS: 12 | SIDER US FAERS | |
| 80 | Emotional disorder | FAERS: 11 | US FAERS | |
| 81 | Emotional distress | FAERS: 11 | US FAERS | |
| 82 | Hemiplegia | FAERS: 11 | OFFSIDES US FAERS | |
| 83 | Joint swelling | FAERS: 11 | US FAERS | |
| 84 | Pneumonia | FAERS: 11 | SIDER US FAERS | |
| 85 | Ulcer | FAERS: 11 | OFFSIDES US FAERS | |
| 86 | Arthropathy | FAERS: 10 | US FAERS | |
| 87 | Atrioventricular Block | FAERS: 10 | SIDER US FAERS | |
| 88 | Bipolar Disorder | FAERS: 10 | US FAERS | |
| 89 | Cerebral Thrombosis | FAERS: 10 | OFFSIDES US FAERS | |
| 90 | Ejection Fraction Decreased | FAERS: 10 | US FAERS | |
| 91 | Epistaxis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 92 | Urinary tract infection | FAERS: 10 | SIDER US FAERS | |
| 93 | Ventricular Fibrillation | FAERS: 10 | SIDER US FAERS | |
| 94 | Alopecia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 95 | Blood creatinine increased | FAERS: 9 | SIDER US FAERS | |
| 96 | Cardiomegaly | FAERS: 9 | US FAERS | |
| 97 | Carotid artery occlusion | FAERS: 9 | US FAERS | |
| 98 | Deafness | FAERS: 9 | US FAERS | |
| 99 | Dehydration | FAERS: 9 | SIDER US FAERS | |
| 100 | Gastric ulcer | FAERS: 9 | SIDER US FAERS | |
| 101 | Nerve injury | FAERS: 9 | US FAERS | |
| 102 | Neurodermatitis | FAERS: 9 | OFFSIDES US FAERS | |
| 103 | No adverse event | FAERS: 9 | US FAERS | |
| 104 | Pulmonary Hypertension | FAERS: 9 | US FAERS | |
| 105 | Stomatitis | FAERS: 9 | SIDER US FAERS | |
| 106 | Sudden death | FAERS: 9 | US FAERS | |
| 107 | Wheezing | FAERS: 9 | US FAERS | |
| 108 | furuncle | FAERS: 9 | OFFSIDES US FAERS | |
| 109 | Abasia | FAERS: 8 | US FAERS | |
| 110 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 111 | Ageusia | FAERS: 8 | OFFSIDES US FAERS | |
| 112 | Burning sensation | FAERS: 8 | US FAERS | |
| 113 | Cerebral disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 114 | Constipation | FAERS: 8 | SIDER US FAERS | |
| 115 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 116 | Limb injury | FAERS: 8 | US FAERS | |
| 117 | Musculoskeletal stiffness | FAERS: 8 | SIDER US FAERS | |
| 118 | Psoriasis | FAERS: 8 | US FAERS | |
| 119 | Sudden Cardiac Death | FAERS: 8 | OFFSIDES US FAERS | |
| 120 | Ventricular hypertrophy | FAERS: 8 | US FAERS | |
| 121 | Acute Coronary Syndrome | FAERS: 7 | SIDER US FAERS | |
| 122 | Aphasia | FAERS: 7 | US FAERS | |
| 123 | Bronchospasm | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 124 | Dysarthria | FAERS: 7 | US FAERS | |
| 125 | Dysuria | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 126 | Infection | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 127 | Inflammation | FAERS: 7 | US FAERS | |
| 128 | Lymphadenopathy | FAERS: 7 | SIDER US FAERS | |
| 129 | No adverse effect | FAERS: 7 | OFFSIDES US FAERS | |
| 130 | Oral pain | FAERS: 7 | US FAERS | |
| 131 | Petechiae | FAERS: 7 | US FAERS | |
| 132 | Retinal Vein Occlusion | FAERS: 7 | US FAERS | |
| 133 | Somnolence | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 134 | Throat irritation | FAERS: 7 | US FAERS | |
| 135 | Bradycardia | FAERS: 6 | SIDER US FAERS | |
| 136 | Cerebellar infarction | FAERS: 6 | US FAERS | |
| 137 | Gastritis | FAERS: 6 | SIDER US FAERS | |
| 138 | Hypotension | FAERS: 6 | SIDER US FAERS | |
| 139 | Lichen Planus | FAERS: 6 | OFFSIDES US FAERS | |
| 140 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 141 | Retinal vascular occlusion | FAERS: 6 | OFFSIDES US FAERS | |
| 142 | Sexual Dysfunction | FAERS: 6 | US FAERS | |
| 143 | Shoulder Pain | FAERS: 6 | US FAERS | |
| 144 | Silent myocardial infarction | FAERS: 6 | US FAERS | |
| 145 | Urinary Incontinence | FAERS: 6 | SIDER US FAERS | |
| 146 | Vertigo | FAERS: 6 | SIDER US FAERS | |
| 147 | Visual Impairment | FAERS: 6 | SIDER US FAERS | |
| 148 | Adverse event | FAERS: 5 | US FAERS | |
| 149 | Anhedonia | FAERS: 5 | OFFSIDES US FAERS | |
| 150 | Back disorder | FAERS: 5 | US FAERS | |
| 151 | Carpal Tunnel Syndrome | FAERS: 5 | US FAERS | |
| 152 | Cerebral atrophy | FAERS: 5 | US FAERS | |
| 153 | Discomfort | FAERS: 5 | SIDER US FAERS | |
| 154 | Disease recurrence | FAERS: 5 | US FAERS | |
| 155 | Disorientation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Drug exposure during pregnancy | FAERS: 5 | US FAERS | |
| 157 | Erectile dysfunction | FAERS: 5 | SIDER US FAERS | |
| 158 | Hypertensive crisis | FAERS: 5 | US FAERS | |
| 159 | Hysterectomy | FAERS: 5 | US FAERS | |
| 160 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 161 | Leukocytosis | FAERS: 5 | SIDER US FAERS | |
| 162 | Medication Error | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Monoplegia | FAERS: 5 | US FAERS | |
| 164 | Muscle Rigidity | FAERS: 5 | US FAERS | |
| 165 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 166 | Nephrolithiasis | FAERS: 5 | SIDER US FAERS | |
| 167 | Pharyngitis | FAERS: 5 | SIDER US FAERS | |
| 168 | Renal pain | FAERS: 5 | US FAERS | |
| 169 | Rotator cuff syndrome | FAERS: 5 | US FAERS | |
| 170 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 171 | Thrombocytopenia | FAERS: 5 | SIDER US FAERS | |
| 172 | Vascular bypass graft | FAERS: 5 | OFFSIDES US FAERS | |
| 173 | Ventricular Dysfunction | FAERS: 5 | US FAERS | |
| 174 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 175 | Acarodermatitis | FAERS: 4 | US FAERS | |
| 176 | Anoxic Encephalopathy | FAERS: 4 | US FAERS | |
| 177 | Bipolar I disorder | FAERS: 4 | US FAERS | |
| 178 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 179 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 180 | Drug toxicity | FAERS: 4 | US FAERS | |
| 181 | Duodenal Ulcer | FAERS: 4 | SIDER US FAERS | |
| 182 | Economic problem | FAERS: 4 | OFFSIDES US FAERS | |
| 183 | Electrocardiogram abnormal | FAERS: 4 | SIDER US FAERS | |
| 184 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 185 | Formication | FAERS: 4 | US FAERS | |
| 186 | Frustration | FAERS: 4 | US FAERS | |
| 187 | Guttate psoriasis | FAERS: 4 | OFFSIDES US FAERS | |
| 188 | Hoarseness | FAERS: 4 | OFFSIDES US FAERS | |
| 189 | Hypoxia | FAERS: 4 | US FAERS | |
| 190 | Infarction | FAERS: 4 | US FAERS | |
| 191 | Intervertebral disc disorder | FAERS: 4 | US FAERS | |
| 192 | Intracranial Aneurysm | FAERS: 4 | US FAERS | |
| 193 | Mental impairment | FAERS: 4 | US FAERS | |
| 194 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 195 | Pancreatitis | FAERS: 4 | SIDER US FAERS | |
| 196 | Poor peripheral circulation | FAERS: 4 | US FAERS | |
| 197 | Post-Traumatic Stress Disorder | FAERS: 4 | US FAERS | |
| 198 | Respiratory distress | FAERS: 4 | US FAERS | |
| 199 | Restlessness | FAERS: 4 | US FAERS | |
| 200 | Scab | FAERS: 4 | OFFSIDES US FAERS | |
| 201 | Sinusitis | FAERS: 4 | SIDER US FAERS | |
| 202 | Stupor | FAERS: 4 | US FAERS | |
| 203 | Thalamic infarction | FAERS: 4 | US FAERS | |
| 204 | Walking aid user | FAERS: 4 | OFFSIDES US FAERS | |
| 205 | Agitation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 207 | Angioplasty | FAERS: 3 | US FAERS | |
| 208 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 209 | Aphonia | FAERS: 3 | US FAERS | |
| 210 | Aphthous Stomatitis | FAERS: 3 | US FAERS | |
| 211 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 212 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 213 | Blood urea increased | FAERS: 3 | SIDER US FAERS | |
| 214 | Cataract | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 215 | Cerebral artery occlusion | FAERS: 3 | US FAERS | |
| 216 | Cerebral artery stenosis | FAERS: 3 | US FAERS | |
| 217 | Choking sensation | FAERS: 3 | US FAERS | |
| 218 | Chromaturia | FAERS: 3 | US FAERS | |
| 219 | Cold sweat | FAERS: 3 | US FAERS | |
| 220 | Dementia | FAERS: 3 | US FAERS | |
| 221 | Drug Dependence | FAERS: 3 | US FAERS | |
| 222 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 223 | Drug exposure via breast milk | FAERS: 3 | US FAERS | |
| 224 | Dysphasia | FAERS: 3 | US FAERS | |
| 225 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 226 | Eye irritation | FAERS: 3 | US FAERS | |
| 227 | Feeling jittery | FAERS: 3 | US FAERS | |
| 228 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 229 | Glossitis | FAERS: 3 | OFFSIDES US FAERS | |
| 230 | Hypertensive heart disease | FAERS: 3 | US FAERS | |
| 231 | Hypokinesia | FAERS: 3 | US FAERS | |
| 232 | Impetigo | FAERS: 3 | OFFSIDES US FAERS | |
| 233 | Incontinence | FAERS: 3 | US FAERS | |
| 234 | Joint stiffness | FAERS: 3 | US FAERS | |
| 235 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 236 | Lip swelling | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Malnutrition | FAERS: 3 | US FAERS | |
| 238 | Mental status changes | FAERS: 3 | US FAERS | |
| 239 | Micturition frequency decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 240 | Mood swings | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 241 | Multi-organ disorder | FAERS: 3 | US FAERS | |
| 242 | Neuropathic pain | FAERS: 3 | US FAERS | |
| 243 | Neuropathy | FAERS: 3 | SIDER US FAERS | |
| 244 | Obesity | FAERS: 3 | US FAERS | |
| 245 | Obsessive-Compulsive Disorder | FAERS: 3 | US FAERS | |
| 246 | Periarthritis | FAERS: 3 | US FAERS | |
| 247 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 248 | Phlebitis | FAERS: 3 | US FAERS | |
| 249 | Postoperative infection | FAERS: 3 | OFFSIDES US FAERS | |
| 250 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 251 | Rhinitis | FAERS: 3 | SIDER US FAERS | |
| 252 | Ruptured cerebral aneurysm | FAERS: 3 | US FAERS | |
| 253 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 254 | Skin Papilloma | FAERS: 3 | US FAERS | |
| 255 | Sneezing | FAERS: 3 | US FAERS | |
| 256 | Therapy non-responder | FAERS: 3 | OFFSIDES US FAERS | |
| 257 | Thrombotic stroke | FAERS: 3 | US FAERS | |
| 258 | Vascular occlusion | FAERS: 3 | US FAERS | |
| 259 | Vasculitis | FAERS: 3 | US FAERS | |
| 260 | Wound Infection | FAERS: 3 | US FAERS | |
| 261 | nervous system disorder | FAERS: 3 | US FAERS | |
| 262 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 263 | Abscess | FAERS: 2 | US FAERS | |
| 264 | Actinic keratosis | FAERS: 2 | US FAERS | |
| 265 | Akinesia | FAERS: 2 | US FAERS | |
| 266 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 267 | Anger | FAERS: 2 | US FAERS | |
| 268 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 269 | Anuria | FAERS: 2 | US FAERS | |
| 270 | Aortic Injury | FAERS: 2 | US FAERS | |
| 271 | Arterial Injury | FAERS: 2 | US FAERS | |
| 272 | Atelectasis | FAERS: 2 | US FAERS | |
| 273 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 274 | Auricular swelling | FAERS: 2 | US FAERS | |
| 275 | Basal cell carcinoma | FAERS: 2 | SIDER US FAERS | |
| 276 | Blood alkaline phosphatase increased | FAERS: 2 | SIDER US FAERS | |
| 277 | Blood blister | FAERS: 2 | OFFSIDES US FAERS | |
| 278 | Blood lactate dehydrogenase increased | FAERS: 2 | SIDER US FAERS | |
| 279 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 280 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 281 | Blood urine present | FAERS: 2 | US FAERS | |
| 282 | Boredom | FAERS: 2 | OFFSIDES US FAERS | |
| 283 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 284 | Breast tenderness | FAERS: 2 | OFFSIDES US FAERS | |
| 285 | Bronchitis | FAERS: 2 | SIDER US FAERS | |
| 286 | Candidiasis | FAERS: 2 | US FAERS | |
| 287 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 288 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 289 | Cataract operation | FAERS: 2 | OFFSIDES US FAERS | |
| 290 | Cheilitis | FAERS: 2 | US FAERS | |
| 291 | Cholestasis | FAERS: 2 | US FAERS | |
| 292 | Clubbing | FAERS: 2 | OFFSIDES US FAERS | |
| 293 | Colitis | FAERS: 2 | US FAERS | |
| 294 | Comedone | FAERS: 2 | US FAERS | |
| 295 | Demyelination | FAERS: 2 | OFFSIDES US FAERS | |
| 296 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 297 | Device related infection | FAERS: 2 | OFFSIDES US FAERS | |
| 298 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 299 | Diplopia | FAERS: 2 | US FAERS | |
| 300 | Diverticulum | FAERS: 2 | SIDER US FAERS | |
| 301 | Drug administration error | FAERS: 2 | US FAERS | |
| 302 | Duodenitis | FAERS: 2 | SIDER US FAERS | |
| 303 | Echocardiogram abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 304 | Electrocardiogram poor R-wave progression | FAERS: 2 | US FAERS | |
| 305 | Endocarditis | FAERS: 2 | US FAERS | |
| 306 | Erythema Nodosum | FAERS: 2 | OFFSIDES US FAERS | |
| 307 | Excoriation | FAERS: 2 | US FAERS | |
| 308 | Eye Redness | FAERS: 2 | OFFSIDES US FAERS | |
| 309 | Eye pain | FAERS: 2 | SIDER US FAERS | |
| 310 | False positive laboratory result | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Folliculitis | FAERS: 2 | OFFSIDES US FAERS | |
| 312 | Fracture | FAERS: 2 | SIDER US FAERS | |
| 313 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 314 | Gangrene | FAERS: 2 | US FAERS | |
| 315 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 316 | Gastric pH increased | FAERS: 2 | OFFSIDES US FAERS | |
| 317 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 318 | Genital rash | FAERS: 2 | US FAERS | |
| 319 | Glomerulonephritis | FAERS: 2 | OFFSIDES US FAERS | |
| 320 | Gout | FAERS: 2 | SIDER US FAERS | |
| 321 | Hernia | FAERS: 2 | US FAERS | |
| 322 | Hip surgery | FAERS: 2 | OFFSIDES US FAERS | |
| 323 | Hip swelling | FAERS: 2 | OFFSIDES US FAERS | |
| 324 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 325 | Immobile | FAERS: 2 | US FAERS | |
| 326 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 327 | Incision site complication | FAERS: 2 | OFFSIDES US FAERS | |
| 328 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 329 | Influenza | FAERS: 2 | US FAERS | |
| 330 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 331 | Joint injury | FAERS: 2 | US FAERS | |
| 332 | Laceration | FAERS: 2 | US FAERS | |
| 333 | Limb discomfort | FAERS: 2 | US FAERS | |
| 334 | Limb operation | FAERS: 2 | US FAERS | |
| 335 | Living in residential institution | FAERS: 2 | OFFSIDES US FAERS | |
| 336 | Lymphangitis | FAERS: 2 | SIDER US FAERS | |
| 337 | Lymphocyte count decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 338 | Lymphoma | FAERS: 2 | US FAERS | |
| 339 | Lymphopenia | FAERS: 2 | SIDER US FAERS | |
| 340 | Male sexual dysfunction | FAERS: 2 | OFFSIDES US FAERS | |
| 341 | Metastatic Neoplasm | FAERS: 2 | OFFSIDES US FAERS | |
| 342 | Muscle strain | FAERS: 2 | US FAERS | |
| 343 | Muscle tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 344 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 345 | Musculoskeletal discomfort | FAERS: 2 | SIDER US FAERS | |
| 346 | Mydriasis | FAERS: 2 | US FAERS | |
| 347 | Nephrectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 348 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 349 | No adverse reaction | FAERS: 2 | US FAERS | |
| 350 | Open wound | FAERS: 2 | US FAERS | |
| 351 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 352 | Osteomyelitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 353 | Osteoporosis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 354 | Pallor | FAERS: 2 | US FAERS | |
| 355 | Paranoia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 356 | Partner stress | FAERS: 2 | OFFSIDES US FAERS | |
| 357 | Perivascular dermatitis | FAERS: 2 | US FAERS | |
| 358 | Physical disability | FAERS: 2 | OFFSIDES US FAERS | |
| 359 | Pregnancy | FAERS: 2 | US FAERS | |
| 360 | Procedural complication | FAERS: 2 | US FAERS | |
| 361 | Pulmonary Infarction | FAERS: 2 | SIDER US FAERS | |
| 362 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 363 | Purpura | FAERS: 2 | US FAERS | |
| 364 | Purulence | FAERS: 2 | US FAERS | |
| 365 | Quadriplegia | FAERS: 2 | US FAERS | |
| 366 | Rash scaly | FAERS: 2 | US FAERS | |
| 367 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 368 | Rosacea | FAERS: 2 | US FAERS | |
| 369 | Septic Shock | FAERS: 2 | US FAERS | |
| 370 | Sick Sinus Syndrome | FAERS: 2 | US FAERS | |
| 371 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 372 | Stent occlusion | FAERS: 2 | US FAERS | |
| 373 | Thrombophlebitis | FAERS: 2 | SIDER US FAERS | |
| 374 | Tongue blistering | FAERS: 2 | US FAERS | |
| 375 | Toxic Shock Syndrome | FAERS: 2 | US FAERS | |
| 376 | Triple vessel bypass graft | FAERS: 2 | US FAERS | |
| 377 | Vasospasm | FAERS: 2 | SIDER US FAERS | |
| 378 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 379 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 380 | West Nile viral infection | FAERS: 2 | US FAERS | |
| 381 | Wheelchair user | FAERS: 2 | OFFSIDES US FAERS | |
| 382 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 383 | jaundice | FAERS: 2 | US FAERS | |
| 384 | Acidosis | FAERS: 1 | US FAERS | |
| 385 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 386 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 387 | Allergy to animal | FAERS: 1 | US FAERS | |
| 388 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 389 | Amputation | FAERS: 1 | US FAERS | |
| 390 | Analgesic intervention supportive therapy | FAERS: 1 | US FAERS | |
| 391 | Aneurysm | FAERS: 1 | SIDER US FAERS | |
| 392 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 393 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 394 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 395 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 396 | Apathy | FAERS: 1 | US FAERS | |
| 397 | Apolipoprotein increased | FAERS: 1 | US FAERS | |
| 398 | Application site irritation | FAERS: 1 | US FAERS | |
| 399 | Arterial restenosis | FAERS: 1 | US FAERS | |
| 400 | Arteriovenous fistula | FAERS: 1 | US FAERS | |
| 401 | Arthroscopy | FAERS: 1 | OFFSIDES US FAERS | |
| 402 | Aspartate Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 403 | Aura | FAERS: 1 | US FAERS | |
| 404 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 405 | Bacteria wound identified | FAERS: 1 | US FAERS | |
| 406 | Bedridden | FAERS: 1 | US FAERS | |
| 407 | Bile duct pressure increased | FAERS: 1 | US FAERS | |
| 408 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 409 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 410 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 411 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 412 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 413 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 414 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 415 | Blood thrombin abnormal | FAERS: 1 | US FAERS | |
| 416 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 417 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 418 | Bone fissure | FAERS: 1 | US FAERS | |
| 419 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 420 | Bowen's Disease | FAERS: 1 | US FAERS | |
| 421 | Brain Abscess | FAERS: 1 | US FAERS | |
| 422 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 423 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 424 | Breast cancer recurrent | FAERS: 1 | OFFSIDES US FAERS | |
| 425 | Breast engorgement | FAERS: 1 | US FAERS | |
| 426 | Bunion | FAERS: 1 | US FAERS | |
| 427 | Bursitis | FAERS: 1 | US FAERS | |
| 428 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 429 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 430 | Carcinoma | FAERS: 1 | SIDER US FAERS | |
| 431 | Cardiac infection | FAERS: 1 | US FAERS | |
| 432 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 433 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 434 | Carotid Endarterectomy | FAERS: 1 | US FAERS | |
| 435 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 436 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 437 | Cholelithiasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 438 | Chondromalacia | FAERS: 1 | OFFSIDES US FAERS | |
| 439 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 440 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 441 | Concomitant disease progression | FAERS: 1 | OFFSIDES US FAERS | |
| 442 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 443 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 444 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 445 | Cyst | FAERS: 1 | US FAERS | |
| 446 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 447 | Depressed mood | FAERS: 1 | US FAERS | |
| 448 | Dermatophytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 449 | Dermoid Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 450 | Diabetic Nephropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 451 | Difficult to wean from ventilator | FAERS: 1 | US FAERS | |
| 452 | Disability | FAERS: 1 | US FAERS | |
| 453 | Disease Progression | FAERS: 1 | US FAERS | |
| 454 | Disease complication | FAERS: 1 | US FAERS | |
| 455 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 456 | Diuretic Effect | FAERS: 1 | US FAERS | |
| 457 | Diverticulitis | FAERS: 1 | US FAERS | |
| 458 | Drug abuser | FAERS: 1 | US FAERS | |
| 459 | Drug dose omission | FAERS: 1 | US FAERS | |
| 460 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 461 | Drug level increased | FAERS: 1 | US FAERS | |
| 462 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 463 | Drug screen positive | FAERS: 1 | US FAERS | |
| 464 | Dyslexia | FAERS: 1 | US FAERS | |
| 465 | Dysphemia | FAERS: 1 | US FAERS | |
| 466 | Dyspnoea exacerbated | FAERS: 1 | OFFSIDES US FAERS | |
| 467 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 468 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 469 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 470 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 471 | Embolic stroke | FAERS: 1 | US FAERS | |
| 472 | Encephalitis | FAERS: 1 | US FAERS | |
| 473 | Eosinophil cationic protein increased | FAERS: 1 | US FAERS | |
| 474 | Epicondylitis | FAERS: 1 | US FAERS | |
| 475 | Epidermolysis | FAERS: 1 | US FAERS | |
| 476 | Eructation | FAERS: 1 | SIDER US FAERS | |
| 477 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 478 | Excitability | FAERS: 1 | US FAERS | |
| 479 | Extravasation | FAERS: 1 | US FAERS | |
| 480 | Facial Paresis | FAERS: 1 | US FAERS | |
| 481 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 482 | Feeling Cold | FAERS: 1 | US FAERS | |
| 483 | Femoral artery occlusion | FAERS: 1 | US FAERS | |
| 484 | Flank Pain | FAERS: 1 | US FAERS | |
| 485 | Flat affect | FAERS: 1 | US FAERS | |
| 486 | Food Allergy | FAERS: 1 | OFFSIDES US FAERS | |
| 487 | Frostbite | FAERS: 1 | US FAERS | |
| 488 | Gallop rhythm present | FAERS: 1 | OFFSIDES US FAERS | |
| 489 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 490 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 491 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 492 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 493 | Gastrointestinal ulcer perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 494 | Gaze palsy | FAERS: 1 | US FAERS | |
| 495 | Genitourinary tract infection | FAERS: 1 | US FAERS | |
| 496 | Glaucoma | FAERS: 1 | US FAERS | |
| 497 | Head discomfort | FAERS: 1 | US FAERS | |
| 498 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 499 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 500 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 501 | Hypersomnia | FAERS: 1 | US FAERS | |
| 502 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 503 | Hyperventilation | FAERS: 1 | US FAERS | |
| 504 | Hypoaesthesia facial | FAERS: 1 | OFFSIDES US FAERS | |
| 505 | Idiopathic urticaria | FAERS: 1 | OFFSIDES US FAERS | |
| 506 | Impaired self-care | FAERS: 1 | US FAERS | |
| 507 | Implant site infection | FAERS: 1 | OFFSIDES US FAERS | |
| 508 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 509 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 510 | Increased upper airway secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 511 | Inguinal mass | FAERS: 1 | US FAERS | |
| 512 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 513 | Intestinal Obstruction | FAERS: 1 | SIDER US FAERS | |
| 514 | Iodine allergy | FAERS: 1 | US FAERS | |
| 515 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 516 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 517 | Joint sprain | FAERS: 1 | US FAERS | |
| 518 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 519 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 520 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 521 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 522 | Laryngitis | FAERS: 1 | SIDER US FAERS | |
| 523 | Latex allergy | FAERS: 1 | OFFSIDES US FAERS | |
| 524 | Lethargy | FAERS: 1 | US FAERS | |
| 525 | Lichenification | FAERS: 1 | US FAERS | |
| 526 | Lipase increased | FAERS: 1 | US FAERS | |
| 527 | Lipoma | FAERS: 1 | SIDER US FAERS | |
| 528 | Liver Abscess | FAERS: 1 | US FAERS | |
| 529 | Lymphomatoid Papulosis | FAERS: 1 | US FAERS | |
| 530 | Macular degeneration | FAERS: 1 | US FAERS | |
| 531 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 532 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 533 | Medical device complication | FAERS: 1 | US FAERS | |
| 534 | Meningitis herpes | FAERS: 1 | US FAERS | |
| 535 | Meningitis | FAERS: 1 | US FAERS | |
| 536 | Menorrhagia | FAERS: 1 | SIDER US FAERS | |
| 537 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 538 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 539 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 540 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 541 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 542 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 543 | Multiple allergies | FAERS: 1 | US FAERS | |
| 544 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 545 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 546 | Myopathy | FAERS: 1 | US FAERS | |
| 547 | Myopia | FAERS: 1 | US FAERS | |
| 548 | Myositis | FAERS: 1 | US FAERS | |
| 549 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 550 | Necrosis | FAERS: 1 | US FAERS | |
| 551 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 552 | Nephritis | FAERS: 1 | US FAERS | |
| 553 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 554 | Neuralgia | FAERS: 1 | SIDER US FAERS | |
| 555 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 556 | Nocturia | FAERS: 1 | US FAERS | |
| 557 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 558 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 559 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 560 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 561 | Overweight | FAERS: 1 | US FAERS | |
| 562 | Pain inflammation activated | FAERS: 1 | US FAERS | |
| 563 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 564 | Pancytopenia | FAERS: 1 | SIDER US FAERS | |
| 565 | Paresis | FAERS: 1 | US FAERS | |
| 566 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 567 | Pathological fracture | FAERS: 1 | US FAERS | |
| 568 | Pemphigus | FAERS: 1 | US FAERS | |
| 569 | Performance status decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 570 | Personality Change | FAERS: 1 | US FAERS | |
| 571 | Photodermatosis | FAERS: 1 | OFFSIDES US FAERS | |
| 572 | Platelet aggregation | FAERS: 1 | US FAERS | |
| 573 | Pleurisy | FAERS: 1 | SIDER US FAERS | |
| 574 | Pneumonitis | FAERS: 1 | US FAERS | |
| 575 | Polyarthritis | FAERS: 1 | US FAERS | |
| 576 | Polydipsia | FAERS: 1 | US FAERS | |
| 577 | Polyuria | FAERS: 1 | US FAERS | |
| 578 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 579 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 580 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 581 | Post inflammatory pigmentation change | FAERS: 1 | OFFSIDES US FAERS | |
| 582 | Postoperative thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 583 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 584 | Precancerous skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 585 | Pregnancy test positive | FAERS: 1 | US FAERS | |
| 586 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 587 | Productive Cough | FAERS: 1 | US FAERS | |
| 588 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 589 | Prothrombin level abnormal | FAERS: 1 | US FAERS | |
| 590 | Rales | FAERS: 1 | US FAERS | |
| 591 | Refusal of treatment by relative | FAERS: 1 | OFFSIDES US FAERS | |
| 592 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 593 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 594 | Retching | FAERS: 1 | US FAERS | |
| 595 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 596 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 597 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 598 | Salpingo-oophorectomy | FAERS: 1 | US FAERS | |
| 599 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 600 | Schizophrenia | FAERS: 1 | US FAERS | |
| 601 | Sciatica | FAERS: 1 | US FAERS | |
| 602 | Seasonal Affective Disorder | FAERS: 1 | US FAERS | |
| 603 | Secretion discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 604 | Serum Sickness | FAERS: 1 | US FAERS | |
| 605 | Sexual inhibition | FAERS: 1 | US FAERS | |
| 606 | Shock | FAERS: 1 | SIDER US FAERS | |
| 607 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 608 | Single functional kidney | FAERS: 1 | OFFSIDES US FAERS | |
| 609 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 610 | Sinus pain | FAERS: 1 | US FAERS | |
| 611 | Skin Induration | FAERS: 1 | US FAERS | |
| 612 | Skin hypertrophy | FAERS: 1 | SIDER US FAERS | |
| 613 | Skin necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 614 | Skin nodule | FAERS: 1 | US FAERS | |
| 615 | Smoker | FAERS: 1 | US FAERS | |
| 616 | Sodium retention | FAERS: 1 | US FAERS | |
| 617 | Solar elastosis | FAERS: 1 | US FAERS | |
| 618 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 619 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 620 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 621 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 622 | Sunburn | FAERS: 1 | US FAERS | |
| 623 | Superinfection | FAERS: 1 | US FAERS | |
| 624 | Suture related complication | FAERS: 1 | OFFSIDES US FAERS | |
| 625 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 626 | Tetany | FAERS: 1 | US FAERS | |
| 627 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 628 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 629 | Thermal burn | FAERS: 1 | US FAERS | |
| 630 | Thromboembolic stroke | FAERS: 1 | US FAERS | |
| 631 | Tobacco user | FAERS: 1 | US FAERS | |
| 632 | Tongue biting | FAERS: 1 | US FAERS | |
| 633 | Tongue eruption | FAERS: 1 | OFFSIDES US FAERS | |
| 634 | Toothache | FAERS: 1 | US FAERS | |
| 635 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 636 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 637 | Tuberculosis | FAERS: 1 | US FAERS | |
| 638 | Ultrasound Doppler abnormal | FAERS: 1 | US FAERS | |
| 639 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 640 | Underweight | FAERS: 1 | US FAERS | |
| 641 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 642 | Urinary Retention | FAERS: 1 | US FAERS | |
| 643 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 644 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 645 | Urine output increased | FAERS: 1 | US FAERS | |
| 646 | Uterine contractions during pregnancy | FAERS: 1 | US FAERS | |
| 647 | Vaginal Discharge | FAERS: 1 | SIDER US FAERS | |
| 648 | Vaginal burning sensation | FAERS: 1 | US FAERS | |
| 649 | Vascular bypass dysfunction | FAERS: 1 | US FAERS | |
| 650 | Vascular rupture | FAERS: 1 | OFFSIDES US FAERS | |
| 651 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 652 | Venous occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 653 | Venous stenosis | FAERS: 1 | US FAERS | |
| 654 | Viral upper respiratory tract infection | FAERS: 1 | OFFSIDES US FAERS | |
| 655 | Wound Complication | FAERS: 1 | US FAERS | |
| 656 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 657 | Xanthopsia | FAERS: 1 | US FAERS | |
| 658 | Yawning | FAERS: 1 | US FAERS | |
| 659 | colonoscopy | FAERS: 1 | US FAERS | |
| 660 | muscle injury | FAERS: 1 | US FAERS | |
| 661 | Abdominal bloating | SIDER | ||
| 662 | Abnormal cervical smear | OFFSIDES | ||
| 663 | Abnormal vision | SIDER | ||
| 664 | Actinomycosis | OFFSIDES | ||
| 665 | Acute otitis media | OFFSIDES | ||
| 666 | Administration site infection | OFFSIDES | ||
| 667 | Adnexa uteri cyst | OFFSIDES | ||
| 668 | Albumin globulin ratio decreased | OFFSIDES | ||
| 669 | Albuminuria | SIDER | ||
| 670 | Alcohol interaction | Canada Vigilance: 1 | Canada Vigilance | |
| 671 | Allergic sinusitis | OFFSIDES | ||
| 672 | Allergy aggravated | SIDER | ||
| 673 | Alveoloplasty | OFFSIDES | ||
| 674 | Amylase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 675 | Anal candidiasis | OFFSIDES | ||
| 676 | Anal discomfort | OFFSIDES | ||
| 677 | Anastomotic ulcer | OFFSIDES | ||
| 678 | Angioedema | SIDER | ||
| 679 | Anhidrosis | OFFSIDES | ||
| 680 | Anorectal discomfort | SIDER | ||
| 681 | Antimicrobial susceptibility test resistant | OFFSIDES | ||
| 682 | Aortic Valve Stenosis | SIDER | ||
| 683 | Aphagia | OFFSIDES | ||
| 684 | Appendectomy | OFFSIDES | ||
| 685 | Appendicitis | OFFSIDES SIDER | ||
| 686 | Arachnoiditis | OFFSIDES | ||
| 687 | Arterial bypass operation | OFFSIDES | ||
| 688 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 689 | Asterixis | OFFSIDES | ||
| 690 | Astigmatism | OFFSIDES | ||
| 691 | Autologous bone marrow transplantation therapy | OFFSIDES | ||
| 692 | Autonomic neuropathy | SIDER | ||
| 693 | B-cell lymphoma stage I | OFFSIDES | ||
| 694 | B-cell small lymphocytic lymphoma stage IV | OFFSIDES | ||
| 695 | B-cell unclassifiable lymphoma low grade | OFFSIDES | ||
| 696 | Bacterial disease carrier | OFFSIDES | ||
| 697 | Bacterial test positive | OFFSIDES | ||
| 698 | Benign neoplasm of spinal cord | OFFSIDES | ||
| 699 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 700 | Biliary adenoma | OFFSIDES | ||
| 701 | Biopsy bone abnormal | OFFSIDES | ||
| 702 | Biopsy breast abnormal | OFFSIDES | ||
| 703 | Biopsy | OFFSIDES | ||
| 704 | Bladder calculus removal | OFFSIDES | ||
| 705 | Bladder pain | SIDER | ||
| 706 | Blood chloride decreased | OFFSIDES | ||
| 707 | Blood creatine phosphokinase increased | SIDER | ||
| 708 | Blood creatinine decreased | OFFSIDES | ||
| 709 | Blood follicle stimulating hormone decreased | OFFSIDES | ||
| 710 | Blood osmolarity decreased | OFFSIDES | ||
| 711 | Blood pressure immeasurable | OFFSIDES | ||
| 712 | Blood thyroid stimulating hormone abnormal | OFFSIDES | ||
| 713 | Bone density increased | OFFSIDES | ||
| 714 | Bone erosion | OFFSIDES | ||
| 715 | Bone fragmentation | OFFSIDES | ||
| 716 | Bone lesion | OFFSIDES | ||
| 717 | Bone swelling | OFFSIDES | ||
| 718 | Bronchopleural Fistula | OFFSIDES | ||
| 719 | Bronchopneumonia | OFFSIDES | ||
| 720 | Bunion operation | OFFSIDES | ||
| 721 | Burn infection | OFFSIDES | ||
| 722 | CREST Syndrome | OFFSIDES | ||
| 723 | Calciphylaxis | OFFSIDES | ||
| 724 | Carcinoma of lung | SIDER | ||
| 725 | Cardiac enzymes increased | OFFSIDES | ||
| 726 | Cardiac neoplasm unspecified | OFFSIDES | ||
| 727 | Carotid pulse decreased | OFFSIDES | ||
| 728 | Cartilage atrophy | OFFSIDES | ||
| 729 | Cartilage injury | OFFSIDES | ||
| 730 | Cerebral circulatory failure | OFFSIDES | ||
| 731 | Cervical dysplasia | OFFSIDES SIDER | ||
| 732 | Cervical myelopathy | OFFSIDES | ||
| 733 | Chondrectomy | OFFSIDES | ||
| 734 | Chondroplasty | OFFSIDES | ||
| 735 | Chronic ulcerative colitis | OFFSIDES | ||
| 736 | Complement factor C1 decreased | OFFSIDES | ||
| 737 | Congenital cystic kidney disease | OFFSIDES | ||
| 738 | Conjunctivitis | 16476901 | CTD SIDER | |
| 739 | Corneal Ulcer | OFFSIDES | ||
| 740 | Corneal dystrophy | OFFSIDES | ||
| 741 | Corneal exfoliation | OFFSIDES | ||
| 742 | Corneal thinning | OFFSIDES | ||
| 743 | Creatine Phosphokinase Increased | SIDER | ||
| 744 | Creatinine increased | SIDER | ||
| 745 | Cryotherapy | OFFSIDES | ||
| 746 | Cyclothymic Disorder | OFFSIDES | ||
| 747 | Cystitis escherichia | OFFSIDES | ||
| 748 | Cystitis | SIDER | ||
| 749 | Death of child | OFFSIDES | ||
| 750 | Death of relative | OFFSIDES | ||
| 751 | Debridement | OFFSIDES | ||
| 752 | Delusional disorder, erotomanic type | OFFSIDES | ||
| 753 | Delusional disorder, unspecified type | OFFSIDES | ||
| 754 | Dental abscess | OFFSIDES | ||
| 755 | Denture wearer | OFFSIDES | ||
| 756 | Dependence on enabling machine or device | OFFSIDES | ||
| 757 | Depression aggravated | SIDER | ||
| 758 | Device Failure | OFFSIDES | ||
| 759 | Device migration | OFFSIDES | ||
| 760 | Drug Tolerance | OFFSIDES | ||
| 761 | Dry gangrene | OFFSIDES | ||
| 762 | Dyschezia | OFFSIDES | ||
| 763 | Dysgraphia | OFFSIDES | ||
| 764 | Dyspareunia | OFFSIDES | ||
| 765 | Early satiety | OFFSIDES | ||
| 766 | Empyema | OFFSIDES | ||
| 767 | Endodontic procedure | OFFSIDES | ||
| 768 | Endometrial hypertrophy | OFFSIDES | ||
| 769 | Enteritis | OFFSIDES | ||
| 770 | Enterococcal infection | OFFSIDES | ||
| 771 | Eosinophilia | SIDER | ||
| 772 | Epiploic appendagitis | OFFSIDES | ||
| 773 | Escherichia infection | OFFSIDES | ||
| 774 | Escherichia sepsis | OFFSIDES | ||
| 775 | Escherichia urinary tract infection | OFFSIDES | ||
| 776 | Eye laser surgery | OFFSIDES | ||
| 777 | Eyelid Diseases | OFFSIDES | ||
| 778 | Eyelid margin crusting | OFFSIDES | ||
| 779 | Facial Neuralgia | OFFSIDES | ||
| 780 | Fat necrosis | OFFSIDES | ||
| 781 | Feelings of worthlessness | OFFSIDES | ||
| 782 | Fistula discharge | OFFSIDES | ||
| 783 | Fullness abdominal | SIDER | ||
| 784 | Gambling | OFFSIDES | ||
| 785 | Gastroduodenitis | OFFSIDES | ||
| 786 | Gastroenteritis helicobacter | OFFSIDES | ||
| 787 | Gastroenteritis | SIDER | ||
| 788 | Genital Herpes | OFFSIDES | ||
| 789 | Gingival Hypertrophy | Canada Vigilance: 1 | Canada Vigilance | |
| 790 | Gingival blister | OFFSIDES | ||
| 791 | Glycosuria | SIDER | ||
| 792 | Graft infection | OFFSIDES | ||
| 793 | Granulomatous liver disease | OFFSIDES | ||
| 794 | Granuloma | OFFSIDES | ||
| 795 | Hemangioma acquired | SIDER | ||
| 796 | Hemorrhagic colitis | SIDER | ||
| 797 | Hepatitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 798 | Hiccough | OFFSIDES | ||
| 799 | Histoplasmosis | OFFSIDES | ||
| 800 | Hordeolum | OFFSIDES | ||
| 801 | Hydropneumothorax | OFFSIDES | ||
| 802 | Hyperkeratosis | OFFSIDES | ||
| 803 | Hyperparathyroidism | OFFSIDES SIDER | ||
| 804 | Hyperpigmentation | OFFSIDES | ||
| 805 | Hypertension worsened | SIDER | ||
| 806 | Hypertensive Encephalopathy | SIDER | ||
| 807 | Hypertrophic Cardiomyopathy | OFFSIDES | ||
| 808 | Hypocalciuria | OFFSIDES | ||
| 809 | Hypoplastic Left Heart Syndrome | OFFSIDES | ||
| 810 | Ileus | SIDER | ||
| 811 | Implant site reaction | OFFSIDES | ||
| 812 | Implantable defibrillator malfunction | OFFSIDES | ||
| 813 | Incision site infection | OFFSIDES | ||
| 814 | Increased thirst | SIDER | ||
| 815 | Induration | OFFSIDES | ||
| 816 | Infected insect bite | OFFSIDES | ||
| 817 | Influenza-like symptoms | SIDER | ||
| 818 | Injection site discomfort | OFFSIDES | ||
| 819 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 820 | Intermittent Claudication | SIDER | ||
| 821 | Joint abscess | OFFSIDES | ||
| 822 | Joint prosthesis user | OFFSIDES | ||
| 823 | Keratitis | SIDER | ||
| 824 | Lactic dehydrogenase activity increased | SIDER | ||
| 825 | Laparotomy | OFFSIDES | ||
| 826 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 827 | Legionella | OFFSIDES | ||
| 828 | Lesion excision | OFFSIDES | ||
| 829 | Leukodystrophy | OFFSIDES | ||
| 830 | Leukopenia | SIDER | ||
| 831 | Leukorrhea | SIDER | ||
| 832 | Life expectancy shortened | OFFSIDES | ||
| 833 | Light chain analysis increased | OFFSIDES | ||
| 834 | Lipomatous hypertrophy of the interatrial septum | OFFSIDES | ||
| 835 | Lupus-like syndrome | OFFSIDES | ||
| 836 | Lymph node palpable | OFFSIDES | ||
| 837 | Malignant ovarian cyst | SIDER | ||
| 838 | Malocclusion | OFFSIDES | ||
| 839 | Manic psychosis | SIDER | ||
| 840 | Marasmus | OFFSIDES | ||
| 841 | Mass excision | OFFSIDES | ||
| 842 | Mastication disorder | OFFSIDES | ||
| 843 | Mastitis | SIDER | ||
| 844 | Maxillofacial operation | OFFSIDES | ||
| 845 | Mediastinitis | OFFSIDES | ||
| 846 | Medical device removal | OFFSIDES | ||
| 847 | Medical diet | OFFSIDES | ||
| 848 | Meniscus removal | OFFSIDES | ||
| 849 | Migration of implant | OFFSIDES | ||
| 850 | Mixed Connective Tissue Disease | OFFSIDES | ||
| 851 | Mononeuritis | OFFSIDES | ||
| 852 | Morphea | OFFSIDES | ||
| 853 | Motor retardation | OFFSIDES | ||
| 854 | Multiple Myeloma | OFFSIDES | ||
| 855 | Muscle flap operation | OFFSIDES | ||
| 856 | Muscle necrosis | OFFSIDES | ||
| 857 | Myelomalacia | OFFSIDES | ||
| 858 | Nasal discomfort | OFFSIDES | ||
| 859 | Nasal sinus drainage | OFFSIDES | ||
| 860 | Neck stiffness | SIDER | ||
| 861 | Neurological infection | OFFSIDES | ||
| 862 | Neutropenia | Canada Vigilance: 1 | Canada Vigilance | |
| 863 | Non-small cell lung cancer recurrent | OFFSIDES | ||
| 864 | Nuchal Rigidity | SIDER | ||
| 865 | Oligomenorrhea | OFFSIDES | ||
| 866 | Open reduction of fracture | OFFSIDES | ||
| 867 | Oral Cavity Fistula | OFFSIDES | ||
| 868 | Oral discharge | OFFSIDES | ||
| 869 | Oral polypectomy | OFFSIDES | ||
| 870 | Osteitis Deformans | OFFSIDES | ||
| 871 | Osteolysis | OFFSIDES | ||
| 872 | Osteopenia | OFFSIDES | ||
| 873 | Osteoradionecrosis | OFFSIDES | ||
| 874 | Osteosclerosis | OFFSIDES | ||
| 875 | Otitis Media | SIDER | ||
| 876 | Ovarian enlargement | OFFSIDES | ||
| 877 | Pancreatic Cyst | OFFSIDES | ||
| 878 | Parotidectomy | OFFSIDES | ||
| 879 | Parotitis | OFFSIDES | ||
| 880 | Patient restraint | OFFSIDES | ||
| 881 | Pericarditis | SIDER | ||
| 882 | Pericoronitis | OFFSIDES | ||
| 883 | Periodontal destruction | OFFSIDES | ||
| 884 | Periodontitis | OFFSIDES | ||
| 885 | Periorbital swelling | SIDER | ||
| 886 | Peritonitis | SIDER | ||
| 887 | Pharyngeal lesion | OFFSIDES | ||
| 888 | Pharyngeal swelling | Canada Vigilance: 3 | Canada Vigilance | |
| 889 | Photosensitivity allergic reaction | SIDER | ||
| 890 | Pityriasis Rubra Pilaris | OFFSIDES | ||
| 891 | Plasmacytoma | OFFSIDES | ||
| 892 | Pleurodesis | OFFSIDES | ||
| 893 | Poikilocytosis | OFFSIDES | ||
| 894 | Polymyalgia Rheumatica | OFFSIDES | ||
| 895 | Poor dental condition | OFFSIDES | ||
| 896 | Post procedural discharge | OFFSIDES | ||
| 897 | Post procedural pain | OFFSIDES | ||
| 898 | Postmenopause | OFFSIDES | ||
| 899 | Postpericardiotomy Syndrome | OFFSIDES | ||
| 900 | Precancerous cells present | OFFSIDES | ||
| 901 | Presbyopia | OFFSIDES | ||
| 902 | Prostate carcinoma | SIDER | ||
| 903 | Pseudolymphoma | SIDER | ||
| 904 | Pseudophakia | OFFSIDES | ||
| 905 | Psychiatric symptom | OFFSIDES | ||
| 906 | Pulmonary Fibrosis | SIDER | ||
| 907 | Pulmonary arterial pressure | OFFSIDES | ||
| 908 | Purulent discharge | OFFSIDES | ||
| 909 | Pyelonephritis | SIDER | ||
| 910 | Pyogenic granuloma | OFFSIDES | ||
| 911 | Pyuria | SIDER | ||
| 912 | Radiation Fibrosis | OFFSIDES | ||
| 913 | Radicular Cyst | OFFSIDES | ||
| 914 | Reaction to medical agent preservatives | OFFSIDES | ||
| 915 | Rectal tenesmus | SIDER | ||
| 916 | Red blood cell schistocytes present | OFFSIDES | ||
| 917 | Refusal of examination | OFFSIDES | ||
| 918 | Renal aneurysm | OFFSIDES | ||
| 919 | Renal tubular acidosis | OFFSIDES | ||
| 920 | Respiratory Insufficiency | SIDER | ||
| 921 | Retinal Detachment | SIDER | ||
| 922 | Retrocollis | OFFSIDES | ||
| 923 | Risus sardonicus | OFFSIDES | ||
| 924 | Scan abdomen abnormal | OFFSIDES | ||
| 925 | Scan bone marrow abnormal | OFFSIDES | ||
| 926 | Scleroderma | OFFSIDES | ||
| 927 | Senile dementia | OFFSIDES | ||
| 928 | Septic rash | OFFSIDES | ||
| 929 | Sequestrectomy | OFFSIDES | ||
| 930 | Sinus headache | OFFSIDES | ||
| 931 | Sinus operation | OFFSIDES | ||
| 932 | Sjogren's Syndrome | OFFSIDES | ||
| 933 | Skin Wrinkling | OFFSIDES | ||
| 934 | Soft Tissue Infection | SIDER | ||
| 935 | Spontaneous penile erection | OFFSIDES | ||
| 936 | Stem cell transplant | OFFSIDES | ||
| 937 | Superior Mesenteric Artery Syndrome | OFFSIDES | ||
| 938 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 939 | Synovial fluid white blood cells positive | OFFSIDES | ||
| 940 | Synovitis | SIDER | ||
| 941 | Tardive Dyskinesia | OFFSIDES | ||
| 942 | Tension | SIDER | ||
| 943 | Thirst | SIDER | ||
| 944 | Thoracotomy | OFFSIDES | ||
| 945 | Toe operation | OFFSIDES | ||
| 946 | Tooth Erosion | OFFSIDES | ||
| 947 | Tooth Extraction | OFFSIDES | ||
| 948 | Tooth Infection | OFFSIDES | ||
| 949 | Tracheitis | OFFSIDES | ||
| 950 | Trichorrhexis | OFFSIDES | ||
| 951 | Ulnar Nerve Palsy | OFFSIDES | ||
| 952 | Upper airway obstruction | OFFSIDES | ||
| 953 | Urethral Stenosis | OFFSIDES | ||
| 954 | Urinary tract infection staphylococcal | OFFSIDES | ||
| 955 | Urine leukocyte esterase | OFFSIDES | ||
| 956 | Uterine Perforation | OFFSIDES | ||
| 957 | Vascular fragility | OFFSIDES | ||
| 958 | Vasculitic rash | OFFSIDES | ||
| 959 | Venous thrombosis limb | OFFSIDES | ||
| 960 | Vertebroplasty | OFFSIDES | ||
| 961 | Vision Disorders | 16476901 | CTD | |
| 962 | Vitreous Detachment | OFFSIDES | ||
| 963 | Vocal cord cyst | OFFSIDES | ||
| 964 | Wound Debridement | OFFSIDES | ||
| 965 | Wound infection staphylococcal | OFFSIDES | ||
| 966 | Xerophthalmia | SIDER | ||
| 967 | carbuncle | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.