Oxcarbazepine
(CTRLABGOLIVAIY-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1Cc2ccccc2N(c2c1cccc2)C(=O)N
- Type(s)
- Approved
- ATC code(s)
- N03AF02
- Molecular Formula:
- C15H12N2O2
- Molecular Weight:
- 252.268
- Log P:
- 3.4075
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 63.4
- CAS Number(s):
- 28721-07-5
Synonym(s)
1.
Oxcarbazepine
2.
10,11-Dihydro-10-oxo-5H-dibenz(b,f)azepine-5-carboxamide
3.
GP 47680
4.
Timox
5.
Trileptal
External Link(s)
| MeSH | D000078330 |
| PubChem Compound | 34312 |
| BindingDB | 34179 |
| ChEBI | 7824 |
| CHEMBL | CHEMBL1068 |
| DrugBank | DB00776 |
| DrugCentral | 2017 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7254 |
| KEGG | cpd:C07492 dr:D00533 |
| Therapeutic Target Database | D0QL3P |
| ZINC | 4724 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 171 Canada Vigilance: 7 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 2 | Product substitution issue | FAERS: 157 | US FAERS | |
| 3 | Drug ineffective | FAERS: 134 Canada Vigilance: 21 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Headache | FAERS: 125 Canada Vigilance: 3 | 19401271 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Drug exposure during pregnancy | FAERS: 111 | US FAERS | |
| 6 | Nausea | FAERS: 108 Canada Vigilance: 5 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 7 | Fatigue | FAERS: 107 Canada Vigilance: 2 | 16816222 18268247 19401271 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 8 | Vomiting | FAERS: 102 Canada Vigilance: 2 | 14634926 19401271 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Epilepsy | FAERS: 96 | CTD OFFSIDES US FAERS | |
| 10 | Tremor | FAERS: 85 Canada Vigilance: 1 | 19401271 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Somnolence | FAERS: 84 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 12 | Feeling abnormal | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Malaise | FAERS: 75 | SIDER US FAERS | |
| 14 | Anxiety | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Blood sodium decreased | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Maternal exposure during pregnancy | FAERS: 67 | US FAERS | |
| 17 | Pain | FAERS: 67 Canada Vigilance: 1 | 15100593 16139183 16674606 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 18 | Asthenia | FAERS: 52 | OFFSIDES SIDER US FAERS | |
| 19 | Agitation | FAERS: 48 | SIDER US FAERS | |
| 20 | Cerebrovascular accident | FAERS: 47 | US FAERS | |
| 21 | Diplopia | FAERS: 45 Canada Vigilance: 2 | 16816222 19401271 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 22 | Product quality issue | FAERS: 45 | US FAERS | |
| 23 | Therapeutic response unexpected with drug substitution | FAERS: 45 | US FAERS | |
| 24 | Memory impairment | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Hypersensitivity | FAERS: 39 | SIDER US FAERS | |
| 26 | Overdose | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Stevens-Johnson Syndrome | FAERS: 38 | 20235791 25811541 | CTD SIDER US FAERS |
| 28 | Amnesia | FAERS: 35 | OFFSIDES SIDER US FAERS | |
| 29 | Pruritus | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Pharmaceutical product complaint | FAERS: 34 | US FAERS | |
| 31 | Suicide attempt | FAERS: 33 | US FAERS | |
| 32 | Abdominal Pain | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 33 | Urticaria | FAERS: 31 | SIDER US FAERS | |
| 34 | Syncope | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Nervousness | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Visual Impairment | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 37 | Electroencephalogram abnormal | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Incorrect dose administered | FAERS: 26 | US FAERS | |
| 39 | Arthralgia | FAERS: 25 | SIDER US FAERS | |
| 40 | Product use issue | FAERS: 25 | US FAERS | |
| 41 | Urinary tract infection | FAERS: 23 | SIDER US FAERS | |
| 42 | Crying | FAERS: 22 | OFFSIDES US FAERS | |
| 43 | Disorientation | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Drug dispensing error | FAERS: 22 | OFFSIDES US FAERS | |
| 45 | Pneumonia | FAERS: 22 | SIDER US FAERS | |
| 46 | Weight decreased | FAERS: 22 | SIDER US FAERS | |
| 47 | No adverse event | FAERS: 21 | US FAERS | |
| 48 | Mood swings | FAERS: 20 | SIDER US FAERS | |
| 49 | Myocardial Infarction | FAERS: 20 | US FAERS | |
| 50 | Product use in unapproved indication | FAERS: 20 | US FAERS | |
| 51 | Status Epilepticus | FAERS: 20 | 3269269 | CTD SIDER US FAERS |
| 52 | Stress | FAERS: 19 | OFFSIDES US FAERS | |
| 53 | Diabetes Mellitus | FAERS: 18 | US FAERS | |
| 54 | Erythema | FAERS: 18 | OFFSIDES US FAERS | |
| 55 | Alanine Aminotransferase Increased | FAERS: 17 | US FAERS | |
| 56 | Drug level decreased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Wrong technique in product usage process | FAERS: 17 | US FAERS | |
| 58 | nervous system disorder | FAERS: 17 | SIDER US FAERS | |
| 59 | Bipolar Disorder | FAERS: 16 | 12197457 15643110 17591516 | CTD OFFSIDES US FAERS |
| 60 | Drug Dependence | FAERS: 16 | US FAERS | |
| 61 | Dysgeusia | FAERS: 16 | SIDER US FAERS | |
| 62 | Thrombocytopenia | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 63 | Urinary Retention | FAERS: 16 | US FAERS | |
| 64 | Leukopenia | FAERS: 15 | SIDER US FAERS | |
| 65 | Nasopharyngitis | FAERS: 15 | SIDER US FAERS | |
| 66 | Palpitations | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 67 | Swelling | FAERS: 15 | US FAERS | |
| 68 | Abasia | FAERS: 14 | US FAERS | |
| 69 | Aspartate Aminotransferase Increased | FAERS: 14 | US FAERS | |
| 70 | Blindness | FAERS: 14 | US FAERS | |
| 71 | Constipation | FAERS: 14 | SIDER US FAERS | |
| 72 | Gamma-Glutamyltransferase Increased | FAERS: 14 | SIDER US FAERS | |
| 73 | Hypothyroidism | FAERS: 14 | SIDER US FAERS | |
| 74 | Lymphadenopathy | FAERS: 14 | SIDER US FAERS | |
| 75 | Medication Error | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Neutropenia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Abdominal discomfort | FAERS: 13 | OFFSIDES US FAERS | |
| 78 | Anger | FAERS: 13 | OFFSIDES US FAERS | |
| 79 | Cardiac Arrest | FAERS: 13 | US FAERS | |
| 80 | Chest Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 81 | Discomfort | FAERS: 13 | SIDER US FAERS | |
| 82 | Dysarthria | FAERS: 13 | US FAERS | |
| 83 | Infarction | FAERS: 13 | US FAERS | |
| 84 | Lethargy | FAERS: 13 | 12197457 16804276 | CTD OFFSIDES SIDER US FAERS |
| 85 | Musculoskeletal stiffness | FAERS: 13 | OFFSIDES US FAERS | |
| 86 | Nephrolithiasis | FAERS: 13 | SIDER US FAERS | |
| 87 | Tachycardia | FAERS: 13 | SIDER US FAERS | |
| 88 | Anticonvulsant drug level decreased | FAERS: 12 | US FAERS | |
| 89 | Bradycardia | FAERS: 12 | SIDER US FAERS | |
| 90 | Emotional distress | FAERS: 12 | US FAERS | |
| 91 | Influenza | FAERS: 12 | US FAERS | |
| 92 | Throat irritation | FAERS: 12 | US FAERS | |
| 93 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 94 | Vertigo | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 95 | Accidental overdose | FAERS: 11 | US FAERS | |
| 96 | Blood alkaline phosphatase increased | FAERS: 11 | SIDER US FAERS | |
| 97 | Chromaturia | FAERS: 11 | US FAERS | |
| 98 | Deafness | FAERS: 11 | US FAERS | |
| 99 | Dehydration | FAERS: 11 | US FAERS | |
| 100 | Depressed mood | FAERS: 11 | OFFSIDES US FAERS | |
| 101 | Facial Pain | FAERS: 11 | US FAERS | |
| 102 | Urinary Incontinence | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | White blood cell count decreased | FAERS: 11 | US FAERS | |
| 104 | Atrioventricular Block | FAERS: 10 | SIDER US FAERS | |
| 105 | Aura | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 106 | Back Pain | FAERS: 10 | SIDER US FAERS | |
| 107 | Chest discomfort | FAERS: 10 | US FAERS | |
| 108 | Completed Suicide | FAERS: 10 | US FAERS | |
| 109 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 110 | Drug toxicity | FAERS: 10 | OFFSIDES US FAERS | |
| 111 | Epistaxis | FAERS: 10 | SIDER US FAERS | |
| 112 | Infection | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 113 | Myoclonic Epilepsy | FAERS: 10 | US FAERS | |
| 114 | Alopecia | FAERS: 9 | SIDER US FAERS | |
| 115 | Anorexia | FAERS: 9 | SIDER US FAERS | |
| 116 | Apathy | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 117 | Chills | FAERS: 9 | SIDER US FAERS | |
| 118 | Depressed Level of Consciousness | FAERS: 9 | SIDER US FAERS | |
| 119 | Drug withdrawal syndrome | FAERS: 9 | US FAERS | |
| 120 | Emotional disorder | FAERS: 9 | US FAERS | |
| 121 | Growth retardation | FAERS: 9 | US FAERS | |
| 122 | Hypokinesia | FAERS: 9 Canada Vigilance: 1 | 19401271 | CTD SIDER Canada Vigilance US FAERS |
| 123 | Lipase increased | FAERS: 9 | US FAERS | |
| 124 | Myalgia | FAERS: 9 | SIDER US FAERS | |
| 125 | Myoclonus | FAERS: 9 Canada Vigilance: 2 | 15461683 | CTD Canada Vigilance US FAERS |
| 126 | Pharyngolaryngeal Pain | FAERS: 9 | US FAERS | |
| 127 | Photophobia | FAERS: 9 | SIDER US FAERS | |
| 128 | Rash erythematous | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 129 | Syringe issue | FAERS: 9 | US FAERS | |
| 130 | Visual disturbance | FAERS: 9 | SIDER US FAERS | |
| 131 | Ataxia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 132 | Blood creatinine increased | FAERS: 8 | US FAERS | |
| 133 | Complex partial seizures | FAERS: 8 | OFFSIDES US FAERS | |
| 134 | Drug administration error | FAERS: 8 | US FAERS | |
| 135 | Drug level increased | FAERS: 8 | US FAERS | |
| 136 | Dyspepsia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 137 | Expired product administered | FAERS: 8 | US FAERS | |
| 138 | Gastritis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 139 | Hypersomnia | FAERS: 8 | US FAERS | |
| 140 | Hypotension | FAERS: 8 | SIDER US FAERS | |
| 141 | Neutrophil count decreased | FAERS: 8 | US FAERS | |
| 142 | Retching | FAERS: 8 | SIDER US FAERS | |
| 143 | Sepsis | FAERS: 8 | US FAERS | |
| 144 | Septic Shock | FAERS: 8 | US FAERS | |
| 145 | Stomatitis | FAERS: 8 | SIDER US FAERS | |
| 146 | Thirst | FAERS: 8 | SIDER US FAERS | |
| 147 | Unevaluable event | FAERS: 8 | OFFSIDES US FAERS | |
| 148 | Aphasia | FAERS: 7 | SIDER US FAERS | |
| 149 | Blood cholesterol increased | FAERS: 7 | US FAERS | |
| 150 | Blood creatine phosphokinase increased | FAERS: 7 | US FAERS | |
| 151 | Conjunctivitis | FAERS: 7 | US FAERS | |
| 152 | Cyst | FAERS: 7 | US FAERS | |
| 153 | Drooling | FAERS: 7 | US FAERS | |
| 154 | Drug exposure via breast milk | FAERS: 7 | US FAERS | |
| 155 | Dystonia | FAERS: 7 | US FAERS | |
| 156 | Dysuria | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 157 | Eczema | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 158 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 159 | Exposure via father | FAERS: 7 | US FAERS | |
| 160 | Head discomfort | FAERS: 7 | US FAERS | |
| 161 | Hepatitis | FAERS: 7 | 15350998 | CTD SIDER US FAERS |
| 162 | Inflammation | FAERS: 7 | US FAERS | |
| 163 | Joint swelling | FAERS: 7 | SIDER US FAERS | |
| 164 | Low birth weight baby | FAERS: 7 | US FAERS | |
| 165 | Mental status changes | FAERS: 7 | US FAERS | |
| 166 | Neuralgia | FAERS: 7 | SIDER US FAERS | |
| 167 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 168 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 169 | Product taste abnormal | FAERS: 7 | US FAERS | |
| 170 | Protein urine present | FAERS: 7 | SIDER US FAERS | |
| 171 | Purpura | FAERS: 7 | SIDER US FAERS | |
| 172 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 173 | Schizophrenia | FAERS: 7 | 18774435 | CTD OFFSIDES US FAERS |
| 174 | Sudden death | FAERS: 7 | OFFSIDES US FAERS | |
| 175 | Thrombosis | FAERS: 7 | US FAERS | |
| 176 | Agranulocytosis | FAERS: 6 | SIDER US FAERS | |
| 177 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 178 | Arthritis | FAERS: 6 | OFFSIDES US FAERS | |
| 179 | Blood amylase increased | FAERS: 6 | US FAERS | |
| 180 | Blood potassium decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 181 | Blood urea increased | FAERS: 6 | US FAERS | |
| 182 | Cerebral Infarction | FAERS: 6 | US FAERS | |
| 183 | Choking | FAERS: 6 | US FAERS | |
| 184 | Dysgraphia | FAERS: 6 | US FAERS | |
| 185 | Educational problem | FAERS: 6 | US FAERS | |
| 186 | Eye pain | FAERS: 6 | US FAERS | |
| 187 | Hemiplegia | FAERS: 6 | SIDER US FAERS | |
| 188 | Lack of spontaneous speech | FAERS: 6 | US FAERS | |
| 189 | Lip swelling | FAERS: 6 | US FAERS | |
| 190 | Menorrhagia | FAERS: 6 | SIDER US FAERS | |
| 191 | Mental impairment | FAERS: 6 | US FAERS | |
| 192 | Nystagmus | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 193 | Paranoia | FAERS: 6 | OFFSIDES US FAERS | |
| 194 | Petechiae | FAERS: 6 | US FAERS | |
| 195 | Poor quality drug administered | FAERS: 6 | US FAERS | |
| 196 | Pre-Eclampsia | FAERS: 6 | US FAERS | |
| 197 | Product physical issue | FAERS: 6 | US FAERS | |
| 198 | Proteinuria | FAERS: 6 | SIDER US FAERS | |
| 199 | Psychiatric symptom | FAERS: 6 | US FAERS | |
| 200 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 201 | Burning sensation | FAERS: 5 | US FAERS | |
| 202 | Central nervous system lesion | FAERS: 5 | US FAERS | |
| 203 | Cholelithiasis | FAERS: 5 | SIDER US FAERS | |
| 204 | Cyanosis | FAERS: 5 | US FAERS | |
| 205 | Dementia | FAERS: 5 | US FAERS | |
| 206 | Drug dose omission | FAERS: 5 | US FAERS | |
| 207 | Drug level below therapeutic | FAERS: 5 | US FAERS | |
| 208 | Duodenitis | FAERS: 5 | OFFSIDES US FAERS | |
| 209 | Dysphemia | FAERS: 5 | US FAERS | |
| 210 | Dysphonia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 211 | Eosinophilia | FAERS: 5 | SIDER US FAERS | |
| 212 | Eye irritation | FAERS: 5 | US FAERS | |
| 213 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 214 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 215 | Intestinal intraepithelial lymphocytes increased | FAERS: 5 | US FAERS | |
| 216 | Limb injury | FAERS: 5 | OFFSIDES US FAERS | |
| 217 | Microcephaly | FAERS: 5 | US FAERS | |
| 218 | Multiple Sclerosis | FAERS: 5 | OFFSIDES US FAERS | |
| 219 | Neck Pain | FAERS: 5 | US FAERS | |
| 220 | Pallor | FAERS: 5 | US FAERS | |
| 221 | Personality Change | FAERS: 5 | US FAERS | |
| 222 | Poisoning | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 223 | Precocious Puberty | FAERS: 5 | US FAERS | |
| 224 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 225 | Restlessness | FAERS: 5 | US FAERS | |
| 226 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 227 | Shock | FAERS: 5 | SIDER US FAERS | |
| 228 | Skin lesion | FAERS: 5 | OFFSIDES US FAERS | |
| 229 | Skin reaction | FAERS: 5 | US FAERS | |
| 230 | Stillbirth | FAERS: 5 | US FAERS | |
| 231 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 232 | Tinnitus | FAERS: 5 | SIDER US FAERS | |
| 233 | Trigeminal Neuralgia | FAERS: 5 | 11839425 19401271 | CTD US FAERS |
| 234 | Trisomy 21 | FAERS: 5 | US FAERS | |
| 235 | Unresponsive to stimuli | FAERS: 5 | OFFSIDES US FAERS | |
| 236 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 237 | jaundice | FAERS: 5 | US FAERS | |
| 238 | treatment failure | FAERS: 5 | US FAERS | |
| 239 | Ageusia | FAERS: 4 | US FAERS | |
| 240 | Altered visual depth perception | FAERS: 4 | US FAERS | |
| 241 | Anticonvulsant drug level below therapeutic | FAERS: 4 | US FAERS | |
| 242 | Appendicitis | FAERS: 4 | OFFSIDES US FAERS | |
| 243 | Arthropathy | FAERS: 4 | US FAERS | |
| 244 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 245 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 246 | Blood triglycerides increased | FAERS: 4 | OFFSIDES US FAERS | |
| 247 | Bone marrow depression | FAERS: 4 | SIDER US FAERS | |
| 248 | Boredom | FAERS: 4 | US FAERS | |
| 249 | Breast Feeding | FAERS: 4 | US FAERS | |
| 250 | Bronchitis | FAERS: 4 | SIDER US FAERS | |
| 251 | Cataract | FAERS: 4 | SIDER US FAERS | |
| 252 | Cholestasis | FAERS: 4 | US FAERS | |
| 253 | Cold sweat | FAERS: 4 | US FAERS | |
| 254 | Dengue Fever | FAERS: 4 | US FAERS | |
| 255 | Dissociation | FAERS: 4 | US FAERS | |
| 256 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 257 | Eosinophilic colitis | FAERS: 4 | US FAERS | |
| 258 | Focal dyscognitive seizures | FAERS: 4 | US FAERS | |
| 259 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 260 | Hyperacusis | FAERS: 4 | US FAERS | |
| 261 | Hypophagia | FAERS: 4 | US FAERS | |
| 262 | Immobile | FAERS: 4 | US FAERS | |
| 263 | Impatience | FAERS: 4 | US FAERS | |
| 264 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 265 | Incoherent | FAERS: 4 | US FAERS | |
| 266 | Initial insomnia | FAERS: 4 | US FAERS | |
| 267 | Intentional self-injury | FAERS: 4 | US FAERS | |
| 268 | Joint injury | FAERS: 4 | OFFSIDES US FAERS | |
| 269 | Lymphocytosis | FAERS: 4 | US FAERS | |
| 270 | Macrocytosis | FAERS: 4 | US FAERS | |
| 271 | Malabsorption | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 272 | Metrorrhagia | FAERS: 4 | SIDER US FAERS | |
| 273 | Middle insomnia | FAERS: 4 | US FAERS | |
| 274 | Muscle tightness | FAERS: 4 | US FAERS | |
| 275 | Mutism | FAERS: 4 | US FAERS | |
| 276 | Pancytopenia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 277 | Panic Disorder | FAERS: 4 | SIDER US FAERS | |
| 278 | Patent ductus arteriosus | FAERS: 4 | US FAERS | |
| 279 | Pharyngitis | FAERS: 4 | SIDER US FAERS | |
| 280 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 281 | Respiratory distress | FAERS: 4 | US FAERS | |
| 282 | Reticulocyte count increased | FAERS: 4 | US FAERS | |
| 283 | Sciatica | FAERS: 4 | US FAERS | |
| 284 | Sick Sinus Syndrome | FAERS: 4 | US FAERS | |
| 285 | Sinusitis | FAERS: 4 | SIDER US FAERS | |
| 286 | Skin necrosis | FAERS: 4 | US FAERS | |
| 287 | Spina Bifida | FAERS: 4 | US FAERS | |
| 288 | Tardive Dyskinesia | FAERS: 4 | OFFSIDES US FAERS | |
| 289 | Tension | FAERS: 4 | SIDER US FAERS | |
| 290 | Toothache | FAERS: 4 | SIDER US FAERS | |
| 291 | Toxic Epidermal Necrolysis | FAERS: 4 | SIDER US FAERS | |
| 292 | Transaminases increased | FAERS: 4 | SIDER US FAERS | |
| 293 | Uterine contractions during pregnancy | FAERS: 4 | US FAERS | |
| 294 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 295 | Acne | FAERS: 3 | SIDER US FAERS | |
| 296 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 297 | Allergy to chemicals | FAERS: 3 | US FAERS | |
| 298 | Anhedonia | FAERS: 3 | US FAERS | |
| 299 | Apparent death | FAERS: 3 | US FAERS | |
| 300 | Bilirubin conjugated increased | FAERS: 3 | US FAERS | |
| 301 | Blood amino acid level increased | FAERS: 3 | US FAERS | |
| 302 | Blood chloride decreased | FAERS: 3 | US FAERS | |
| 303 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 304 | Blood immunoglobulin A | FAERS: 3 | US FAERS | |
| 305 | Blood prolactin increased | FAERS: 3 | US FAERS | |
| 306 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 307 | Bradyphrenia | FAERS: 3 | US FAERS | |
| 308 | Brain Hypoxia | FAERS: 3 | US FAERS | |
| 309 | Calcinosis | FAERS: 3 | US FAERS | |
| 310 | Cardiac function test abnormal | FAERS: 3 | US FAERS | |
| 311 | Cerebral Palsy | FAERS: 3 | US FAERS | |
| 312 | Congenital hydronephrosis | FAERS: 3 | US FAERS | |
| 313 | Corneal Scar | FAERS: 3 | US FAERS | |
| 314 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 315 | Demyelination | FAERS: 3 | US FAERS | |
| 316 | Dental caries | FAERS: 3 | US FAERS | |
| 317 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 318 | Diet refusal | FAERS: 3 | OFFSIDES US FAERS | |
| 319 | Disease Progression | FAERS: 3 | US FAERS | |
| 320 | Disease recurrence | FAERS: 3 | US FAERS | |
| 321 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 322 | Drug level changed | FAERS: 3 | US FAERS | |
| 323 | Drug withdrawal convulsions | FAERS: 3 | US FAERS | |
| 324 | Dysmorphism | FAERS: 3 | US FAERS | |
| 325 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 326 | Erythema Multiforme | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 327 | Euphoric mood | FAERS: 3 | SIDER US FAERS | |
| 328 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 329 | Feeling Cold | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 330 | Foaming at mouth | FAERS: 3 | US FAERS | |
| 331 | Hepatitis C | FAERS: 3 | US FAERS | |
| 332 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 333 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 334 | Hyporeflexia | FAERS: 3 | SIDER US FAERS | |
| 335 | Incontinence | FAERS: 3 | US FAERS | |
| 336 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 337 | Keratopathy | FAERS: 3 | US FAERS | |
| 338 | Labyrinthitis | FAERS: 3 | US FAERS | |
| 339 | Lentigo maligna stage unspecified | FAERS: 3 | US FAERS | |
| 340 | Ligament rupture | FAERS: 3 | US FAERS | |
| 341 | Limb discomfort | FAERS: 3 | US FAERS | |
| 342 | Lymphoma | FAERS: 3 | US FAERS | |
| 343 | Mydriasis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 344 | Myocarditis | FAERS: 3 | US FAERS | |
| 345 | Myopia | FAERS: 3 | US FAERS | |
| 346 | Obsessive-Compulsive Disorder | FAERS: 3 | US FAERS | |
| 347 | Osteoporosis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 348 | Pancreatitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 349 | Papule | FAERS: 3 | US FAERS | |
| 350 | Paresis | FAERS: 3 | US FAERS | |
| 351 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 352 | Polydipsia | FAERS: 3 | US FAERS | |
| 353 | Pregnancy | FAERS: 3 | US FAERS | |
| 354 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 355 | Product coating issue | FAERS: 3 | US FAERS | |
| 356 | Product packaging issue | FAERS: 3 | US FAERS | |
| 357 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 358 | Productive Cough | FAERS: 3 | US FAERS | |
| 359 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 360 | Renal hypertension | FAERS: 3 | US FAERS | |
| 361 | Seizure like phenomena | FAERS: 3 | US FAERS | |
| 362 | Simple Partial Seizures | FAERS: 3 | US FAERS | |
| 363 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 364 | Sleep Paralysis | FAERS: 3 | US FAERS | |
| 365 | Sluggishness | FAERS: 3 | US FAERS | |
| 366 | Sneezing | FAERS: 3 | US FAERS | |
| 367 | Temperature intolerance | FAERS: 3 | OFFSIDES US FAERS | |
| 368 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 369 | Thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 370 | Tonsillectomy | FAERS: 3 | US FAERS | |
| 371 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 372 | Uterine Cancer | FAERS: 3 | US FAERS | |
| 373 | Vasculitis | FAERS: 3 | US FAERS | |
| 374 | Wheezing | FAERS: 3 | US FAERS | |
| 375 | Acidosis | FAERS: 2 | US FAERS | |
| 376 | Alice in Wonderland Syndrome | FAERS: 2 | US FAERS | |
| 377 | Anencephaly | FAERS: 2 | US FAERS | |
| 378 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 379 | Anticonvulsant drug level increased | FAERS: 2 | US FAERS | |
| 380 | Aphagia | FAERS: 2 | US FAERS | |
| 381 | Asthma | FAERS: 2 | SIDER US FAERS | |
| 382 | Atelectasis | FAERS: 2 | US FAERS | |
| 383 | Bedridden | FAERS: 2 | OFFSIDES US FAERS | |
| 384 | Bicuspid aortic valve | FAERS: 2 | US FAERS | |
| 385 | Blepharospasm | FAERS: 2 | OFFSIDES US FAERS | |
| 386 | Blood electrolytes abnormal | FAERS: 2 | US FAERS | |
| 387 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 388 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 389 | Blood immunoglobulin A decreased | FAERS: 2 | US FAERS | |
| 390 | Blood immunoglobulin G | FAERS: 2 | US FAERS | |
| 391 | Blood immunoglobulin G decreased | FAERS: 2 | US FAERS | |
| 392 | Blood immunoglobulin M decreased | FAERS: 2 | US FAERS | |
| 393 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 394 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 395 | Blood smear test abnormal | FAERS: 2 | US FAERS | |
| 396 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 397 | Bone density decreased | FAERS: 2 | US FAERS | |
| 398 | Bone pain | FAERS: 2 | OFFSIDES US FAERS | |
| 399 | Breast fibroma | FAERS: 2 | US FAERS | |
| 400 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 401 | Bruxism | FAERS: 2 | OFFSIDES US FAERS | |
| 402 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 403 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 404 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 405 | Cerebral dysgenesis | FAERS: 2 | US FAERS | |
| 406 | Cholecystitis | FAERS: 2 | US FAERS | |
| 407 | Cholelithotomy | FAERS: 2 | US FAERS | |
| 408 | Clonus | FAERS: 2 | US FAERS | |
| 409 | Cluster Headache | FAERS: 2 | US FAERS | |
| 410 | Cogwheel Rigidity | FAERS: 2 | US FAERS | |
| 411 | Coma scale abnormal | FAERS: 2 | US FAERS | |
| 412 | Complication of delivery | FAERS: 2 | US FAERS | |
| 413 | Concomitant disease aggravated | FAERS: 2 | OFFSIDES US FAERS | |
| 414 | Congenital inguinal hernia | FAERS: 2 | US FAERS | |
| 415 | Congenital tricuspid valve incompetence | FAERS: 2 | US FAERS | |
| 416 | Conversion disorder | FAERS: 2 | SIDER US FAERS | |
| 417 | Dacryocystitis | FAERS: 2 | US FAERS | |
| 418 | Deja Vu | FAERS: 2 | US FAERS | |
| 419 | Delirium | FAERS: 2 | SIDER US FAERS | |
| 420 | Depression suicidal | FAERS: 2 | US FAERS | |
| 421 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 422 | Disability | FAERS: 2 | US FAERS | |
| 423 | Diverticulitis | FAERS: 2 | US FAERS | |
| 424 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 425 | Drug level fluctuating | FAERS: 2 | US FAERS | |
| 426 | Drug resistance | FAERS: 2 | US FAERS | |
| 427 | Dry skin | FAERS: 2 | US FAERS | |
| 428 | Enuresis | FAERS: 2 | US FAERS | |
| 429 | Epidermal necrosis | FAERS: 2 | US FAERS | |
| 430 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 431 | Feeding disorder neonatal | FAERS: 2 | US FAERS | |
| 432 | Feeding disorder of infancy OR early childhood | FAERS: 2 | US FAERS | |
| 433 | Feeling jittery | FAERS: 2 | US FAERS | |
| 434 | Fixed eruption | FAERS: 2 | US FAERS | |
| 435 | Flushing | FAERS: 2 | SIDER US FAERS | |
| 436 | Food Allergy | FAERS: 2 | US FAERS | |
| 437 | Fracture | FAERS: 2 | SIDER US FAERS | |
| 438 | Frustration | FAERS: 2 | OFFSIDES US FAERS | |
| 439 | Gastric Bypass | FAERS: 2 | OFFSIDES US FAERS | |
| 440 | Gastroenteritis | FAERS: 2 | OFFSIDES US FAERS | |
| 441 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 442 | Gaze palsy | FAERS: 2 | US FAERS | |
| 443 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 444 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 445 | Hepatitis B | FAERS: 2 | US FAERS | |
| 446 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 447 | Hernia | FAERS: 2 | US FAERS | |
| 448 | Hippocampal sclerosis | FAERS: 2 | US FAERS | |
| 449 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 450 | Hordeolum | FAERS: 2 | US FAERS | |
| 451 | Hostility | FAERS: 2 | OFFSIDES US FAERS | |
| 452 | Hunger | FAERS: 2 | US FAERS | |
| 453 | Impaired work ability | FAERS: 2 | US FAERS | |
| 454 | Impetigo | FAERS: 2 | SIDER US FAERS | |
| 455 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 456 | Intellectual Disability | FAERS: 2 | US FAERS | |
| 457 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 458 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 459 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 460 | Joint stiffness | FAERS: 2 | US FAERS | |
| 461 | Leukocytosis | FAERS: 2 | US FAERS | |
| 462 | Lupus Nephritis | FAERS: 2 | US FAERS | |
| 463 | Lymphocyte count increased | FAERS: 2 | US FAERS | |
| 464 | Mastication disorder | FAERS: 2 | US FAERS | |
| 465 | Medical device implantation | FAERS: 2 | US FAERS | |
| 466 | Medication residue | FAERS: 2 | US FAERS | |
| 467 | Meningioma | FAERS: 2 | US FAERS | |
| 468 | Mental retardation severity unspecified | FAERS: 2 | US FAERS | |
| 469 | Monoplegia | FAERS: 2 | US FAERS | |
| 470 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 471 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 472 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 473 | Musculoskeletal discomfort | FAERS: 2 | SIDER US FAERS | |
| 474 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 475 | Myopathy | FAERS: 2 | US FAERS | |
| 476 | Necrosis | FAERS: 2 | US FAERS | |
| 477 | Nephrectomy | FAERS: 2 | US FAERS | |
| 478 | Obesity surgery | FAERS: 2 | US FAERS | |
| 479 | Obesity | FAERS: 2 | US FAERS | |
| 480 | Ocular icterus | FAERS: 2 | US FAERS | |
| 481 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 482 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 483 | Osteopenia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 484 | Pericarditis | FAERS: 2 | US FAERS | |
| 485 | Polydactyly | FAERS: 2 | US FAERS | |
| 486 | Polymyositis | FAERS: 2 | US FAERS | |
| 487 | Post procedural complication | FAERS: 2 | US FAERS | |
| 488 | Premenstrual syndrome | FAERS: 2 | US FAERS | |
| 489 | Product availability issue | FAERS: 2 | US FAERS | |
| 490 | Product dosage form issue | FAERS: 2 | US FAERS | |
| 491 | Product dose omission | FAERS: 2 | US FAERS | |
| 492 | Product shape issue | FAERS: 2 | US FAERS | |
| 493 | Product supply issue | FAERS: 2 | US FAERS | |
| 494 | Pseudomonal sepsis | FAERS: 2 | US FAERS | |
| 495 | Psychogenic seizure | FAERS: 2 | US FAERS | |
| 496 | Psychomotor skills impaired | FAERS: 2 | US FAERS | |
| 497 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 498 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 499 | Regurgitation | FAERS: 2 | US FAERS | |
| 500 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 501 | Respiratory tract infection viral | FAERS: 2 | US FAERS | |
| 502 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 503 | Rhinitis | FAERS: 2 | SIDER US FAERS | |
| 504 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 505 | Slow speech | FAERS: 2 | US FAERS | |
| 506 | Spermatozoa progressive motility decreased | FAERS: 2 | US FAERS | |
| 507 | Spinal column injury | FAERS: 2 | US FAERS | |
| 508 | Splenectomy | FAERS: 2 | US FAERS | |
| 509 | Splenomegaly | FAERS: 2 | SIDER US FAERS | |
| 510 | Staring | FAERS: 2 | US FAERS | |
| 511 | Strabismus | FAERS: 2 | US FAERS | |
| 512 | Stridor | FAERS: 2 | US FAERS | |
| 513 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 514 | Sunburn | FAERS: 2 | US FAERS | |
| 515 | T-Cell Lymphoma | FAERS: 2 | US FAERS | |
| 516 | Therapy cessation | FAERS: 2 | US FAERS | |
| 517 | Tonsillitis | FAERS: 2 | US FAERS | |
| 518 | Trigeminal Nerve Disorder | FAERS: 2 | US FAERS | |
| 519 | Ulcer | FAERS: 2 | US FAERS | |
| 520 | Ultrasound scan abnormal | FAERS: 2 | US FAERS | |
| 521 | Urine sodium decreased | FAERS: 2 | US FAERS | |
| 522 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 523 | Vanishing bile duct syndrome | FAERS: 2 | US FAERS | |
| 524 | Victim of homicide | FAERS: 2 | US FAERS | |
| 525 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 526 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 527 | White blood cell count abnormal | FAERS: 2 | US FAERS | |
| 528 | Wrong technique in drug usage process | FAERS: 2 | OFFSIDES US FAERS | |
| 529 | furuncle | FAERS: 2 | US FAERS | |
| 530 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 531 | Abortion induced complete | FAERS: 1 | US FAERS | |
| 532 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 533 | Accidental exposure | FAERS: 1 | US FAERS | |
| 534 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 535 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 536 | Adenocarcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 537 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 538 | Akathisia | FAERS: 1 | US FAERS | |
| 539 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 540 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 541 | Alpha 2 globulin increased | FAERS: 1 | US FAERS | |
| 542 | Altered state of consciousness | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 543 | Amblyopia | FAERS: 1 | US FAERS | |
| 544 | Amylase increased | FAERS: 1 | US FAERS | |
| 545 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 546 | Angioedema | FAERS: 1 | 17675030 | CTD SIDER US FAERS |
| 547 | Angle Closure Glaucoma | FAERS: 1 | OFFSIDES US FAERS | |
| 548 | Anorgasmia | FAERS: 1 | US FAERS | |
| 549 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 550 | Anuria | FAERS: 1 | OFFSIDES US FAERS | |
| 551 | Aphonia | FAERS: 1 | US FAERS | |
| 552 | Arterial insufficiency | FAERS: 1 | US FAERS | |
| 553 | Arthropod bite | FAERS: 1 | US FAERS | |
| 554 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 555 | Ascites | FAERS: 1 | US FAERS | |
| 556 | Aspergillosis | FAERS: 1 | OFFSIDES US FAERS | |
| 557 | Asphyxia | FAERS: 1 | US FAERS | |
| 558 | Asthenopia | FAERS: 1 | US FAERS | |
| 559 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 560 | Auricular swelling | FAERS: 1 | US FAERS | |
| 561 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 562 | Barbiturates positive | FAERS: 1 | US FAERS | |
| 563 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 564 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 565 | Bilirubinuria | FAERS: 1 | US FAERS | |
| 566 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 567 | Biopsy | FAERS: 1 | US FAERS | |
| 568 | Bipolar I disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 569 | Blood aldosterone decreased | FAERS: 1 | US FAERS | |
| 570 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 571 | Blood blister | FAERS: 1 | US FAERS | |
| 572 | Blood brain barrier defect | FAERS: 1 | US FAERS | |
| 573 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 574 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 575 | Blood erythropoietin increased | FAERS: 1 | US FAERS | |
| 576 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 577 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 578 | Blood follicle stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 579 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 580 | Blood glucose fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 581 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 582 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 583 | Blood osmolarity abnormal | FAERS: 1 | US FAERS | |
| 584 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 585 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 586 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 587 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 588 | Blood sodium abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 589 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 590 | Bone decalcification | FAERS: 1 | US FAERS | |
| 591 | Bone marrow myelogram abnormal | FAERS: 1 | US FAERS | |
| 592 | Bradykinesia | FAERS: 1 | US FAERS | |
| 593 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 594 | Breech Presentation | FAERS: 1 | US FAERS | |
| 595 | Bronchospasm | FAERS: 1 | SIDER US FAERS | |
| 596 | Burn infection | FAERS: 1 | US FAERS | |
| 597 | Bursitis | FAERS: 1 | US FAERS | |
| 598 | C-reactive protein decreased | FAERS: 1 | US FAERS | |
| 599 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 600 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 601 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 602 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 603 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 604 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 605 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 606 | Catatonia | FAERS: 1 | US FAERS | |
| 607 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 608 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 609 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 610 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 611 | Cholangitis | FAERS: 1 | US FAERS | |
| 612 | Chordee | FAERS: 1 | US FAERS | |
| 613 | Cleft Palate | FAERS: 1 | US FAERS | |
| 614 | Cold exposure injury | FAERS: 1 | US FAERS | |
| 615 | Colitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 616 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 617 | Concomitant disease progression | FAERS: 1 | OFFSIDES US FAERS | |
| 618 | Congenital Hypothyroidism | FAERS: 1 | US FAERS | |
| 619 | Congenital anomaly in offspring | FAERS: 1 | US FAERS | |
| 620 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 621 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 622 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 623 | Craniotomy | FAERS: 1 | US FAERS | |
| 624 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 625 | Culture urine positive | FAERS: 1 | US FAERS | |
| 626 | Cyanopsia | FAERS: 1 | US FAERS | |
| 627 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 628 | Cystitis | FAERS: 1 | US FAERS | |
| 629 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 630 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 631 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 632 | Delayed Puberty | FAERS: 1 | US FAERS | |
| 633 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 634 | Device difficult to use | FAERS: 1 | US FAERS | |
| 635 | Device leakage | FAERS: 1 | US FAERS | |
| 636 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 637 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 638 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 639 | Drug effect variable | FAERS: 1 | US FAERS | |
| 640 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 641 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 642 | Drug screen positive | FAERS: 1 | US FAERS | |
| 643 | Drug therapy changed | FAERS: 1 | US FAERS | |
| 644 | Dry gangrene | FAERS: 1 | US FAERS | |
| 645 | Dyscalculia | FAERS: 1 | US FAERS | |
| 646 | Dysthymic Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 647 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 648 | Electrocardiogram PQ interval prolonged | FAERS: 1 | US FAERS | |
| 649 | Embolism | FAERS: 1 | US FAERS | |
| 650 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 651 | Encephalitis | FAERS: 1 | US FAERS | |
| 652 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 653 | Eosinophilic myocarditis | FAERS: 1 | OFFSIDES US FAERS | |
| 654 | Epileptic aura | FAERS: 1 | US FAERS | |
| 655 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 656 | Excessive eye blinking | FAERS: 1 | OFFSIDES US FAERS | |
| 657 | Exophthalmos | FAERS: 1 | US FAERS | |
| 658 | Eye ulcer | FAERS: 1 | US FAERS | |
| 659 | Feeding intolerance | FAERS: 1 | US FAERS | |
| 660 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 661 | Fight in school | FAERS: 1 | US FAERS | |
| 662 | Flight of ideas | FAERS: 1 | US FAERS | |
| 663 | Fluid overload | FAERS: 1 | US FAERS | |
| 664 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 665 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 666 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 667 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 668 | Gastric infection | FAERS: 1 | US FAERS | |
| 669 | Gastric ulcer | FAERS: 1 | SIDER US FAERS | |
| 670 | Gastrostomy | FAERS: 1 | US FAERS | |
| 671 | General symptom | FAERS: 1 | US FAERS | |
| 672 | Gingivitis | FAERS: 1 | US FAERS | |
| 673 | Glaucoma | FAERS: 1 | US FAERS | |
| 674 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 675 | Glossitis | FAERS: 1 | US FAERS | |
| 676 | Glossopharyngeal Neuralgia | FAERS: 1 | US FAERS | |
| 677 | Granulocytes maturation arrest | FAERS: 1 | US FAERS | |
| 678 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 679 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 680 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 681 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 682 | Hemiparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 683 | Hepatectomy | FAERS: 1 | US FAERS | |
| 684 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 685 | Homicide | FAERS: 1 | US FAERS | |
| 686 | Humoral immune defect | FAERS: 1 | US FAERS | |
| 687 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 688 | Hyperkaliuria | FAERS: 1 | US FAERS | |
| 689 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 690 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 691 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 692 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 693 | Hypospadias | FAERS: 1 | US FAERS | |
| 694 | Hypoventilation | FAERS: 1 | US FAERS | |
| 695 | Hypoxia | FAERS: 1 | US FAERS | |
| 696 | Immature respiratory system | FAERS: 1 | US FAERS | |
| 697 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 698 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 699 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 700 | Impaired self-care | FAERS: 1 | US FAERS | |
| 701 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 702 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 703 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 704 | Infertility | FAERS: 1 | US FAERS | |
| 705 | Intentional misuse | FAERS: 1 | US FAERS | |
| 706 | Internal injury | FAERS: 1 | US FAERS | |
| 707 | Iron deficiency | FAERS: 1 | US FAERS | |
| 708 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 709 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 710 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 711 | Laceration | FAERS: 1 | US FAERS | |
| 712 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 713 | Lentigo | FAERS: 1 | US FAERS | |
| 714 | Libido disorder | FAERS: 1 | US FAERS | |
| 715 | Lichenification | FAERS: 1 | US FAERS | |
| 716 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 717 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 718 | Low set ears | FAERS: 1 | US FAERS | |
| 719 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 720 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 721 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 722 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 723 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 724 | Macular degeneration | FAERS: 1 | US FAERS | |
| 725 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 726 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 727 | Medical device complication | FAERS: 1 | US FAERS | |
| 728 | Medical diet | FAERS: 1 | US FAERS | |
| 729 | Meningitis | FAERS: 1 | US FAERS | |
| 730 | Metabolic acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 731 | Metamorphopsia | FAERS: 1 | OFFSIDES US FAERS | |
| 732 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 733 | Milk Allergy | FAERS: 1 | US FAERS | |
| 734 | Monocytosis | FAERS: 1 | US FAERS | |
| 735 | Mononucleosis heterophile test positive | FAERS: 1 | US FAERS | |
| 736 | Mucopolysaccharidosis II | FAERS: 1 | US FAERS | |
| 737 | Mucosal necrosis | FAERS: 1 | US FAERS | |
| 738 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 739 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 740 | Muscle Rigidity | FAERS: 1 | 19401271 | CTD US FAERS |
| 741 | Muscle Spasticity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 742 | Neonatal respiratory depression | FAERS: 1 | US FAERS | |
| 743 | Nephritis | FAERS: 1 | US FAERS | |
| 744 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 745 | Neuritis | FAERS: 1 | US FAERS | |
| 746 | Neurocysticercosis | FAERS: 1 | US FAERS | |
| 747 | Neuroleptic Malignant Syndrome | FAERS: 1 | 18774435 | CTD US FAERS |
| 748 | Neuromyelitis Optica | FAERS: 1 | US FAERS | |
| 749 | Neuropathy | FAERS: 1 | US FAERS | |
| 750 | Neutrophil percentage decreased | FAERS: 1 | US FAERS | |
| 751 | Nocturia | FAERS: 1 | US FAERS | |
| 752 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 753 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 754 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 755 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 756 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 757 | Opisthotonus | FAERS: 1 | US FAERS | |
| 758 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 759 | Oral discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 760 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 761 | Osmotic demyelination syndrome | FAERS: 1 | US FAERS | |
| 762 | Otitis Media | FAERS: 1 | US FAERS | |
| 763 | Overweight | FAERS: 1 | US FAERS | |
| 764 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 765 | PCO2 increased | FAERS: 1 | US FAERS | |
| 766 | Pachygyria | FAERS: 1 | US FAERS | |
| 767 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 768 | Paraplegia | FAERS: 1 | US FAERS | |
| 769 | Paroxysmal choreoathetosis | FAERS: 1 | US FAERS | |
| 770 | Pathological fracture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 771 | Performance status decreased | FAERS: 1 | US FAERS | |
| 772 | Peritonitis | FAERS: 1 | OFFSIDES US FAERS | |
| 773 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 774 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 775 | Pharyngotonsillitis | FAERS: 1 | US FAERS | |
| 776 | Phimosis | FAERS: 1 | US FAERS | |
| 777 | Phlebitis | FAERS: 1 | US FAERS | |
| 778 | Phonophobia | FAERS: 1 | US FAERS | |
| 779 | Physical abuse | FAERS: 1 | US FAERS | |
| 780 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 781 | Polyarthritis | FAERS: 1 | US FAERS | |
| 782 | Polyneuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 783 | Polyuria | FAERS: 1 | SIDER US FAERS | |
| 784 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 785 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 786 | Porphyrins urine increased | FAERS: 1 | US FAERS | |
| 787 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 788 | Postpartum stress disorder | FAERS: 1 | US FAERS | |
| 789 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 790 | Procedural complication | FAERS: 1 | US FAERS | |
| 791 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 792 | Product commingling | FAERS: 1 | US FAERS | |
| 793 | Product contamination | FAERS: 1 | US FAERS | |
| 794 | Product dropper issue | FAERS: 1 | US FAERS | |
| 795 | Product storage error | FAERS: 1 | US FAERS | |
| 796 | Progeria | FAERS: 1 | US FAERS | |
| 797 | Progressive multiple sclerosis | FAERS: 1 | US FAERS | |
| 798 | Prosopagnosia | FAERS: 1 | US FAERS | |
| 799 | Protein total increased | FAERS: 1 | US FAERS | |
| 800 | Pseudobulbar Palsy | FAERS: 1 | US FAERS | |
| 801 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 802 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 803 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 804 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 805 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 806 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 807 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 808 | Rectal injury | FAERS: 1 | US FAERS | |
| 809 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 810 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 811 | Renin decreased | FAERS: 1 | US FAERS | |
| 812 | Restless Legs Syndrome | FAERS: 1 | 16675374 | CTD US FAERS |
| 813 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 814 | Retrograde ejaculation | FAERS: 1 | US FAERS | |
| 815 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 816 | Scab | FAERS: 1 | US FAERS | |
| 817 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 818 | Screaming | FAERS: 1 | US FAERS | |
| 819 | Semenuria | FAERS: 1 | US FAERS | |
| 820 | Senile dementia | FAERS: 1 | US FAERS | |
| 821 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 822 | Skin laceration | FAERS: 1 | US FAERS | |
| 823 | Soliloquy | FAERS: 1 | US FAERS | |
| 824 | Sopor | FAERS: 1 | US FAERS | |
| 825 | Sperm count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 826 | Spermatozoa progressive motility abnormal | FAERS: 1 | US FAERS | |
| 827 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 828 | Status Migrainosus | FAERS: 1 | US FAERS | |
| 829 | Structural valve deterioration | FAERS: 1 | US FAERS | |
| 830 | Stupor | FAERS: 1 | SIDER US FAERS | |
| 831 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 832 | Suture insertion | FAERS: 1 | US FAERS | |
| 833 | Sweat test abnormal | FAERS: 1 | US FAERS | |
| 834 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 835 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 836 | Tablet issue | FAERS: 1 | US FAERS | |
| 837 | Tetany | FAERS: 1 | SIDER US FAERS | |
| 838 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 839 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 840 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 841 | Thermal burn | FAERS: 1 | US FAERS | |
| 842 | Thymoma malignant recurrent | FAERS: 1 | US FAERS | |
| 843 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 844 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 845 | Tongue biting | FAERS: 1 | US FAERS | |
| 846 | Tongue spasm | FAERS: 1 | US FAERS | |
| 847 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 848 | Tooth Loss | FAERS: 1 | US FAERS | |
| 849 | Trichiasis | FAERS: 1 | US FAERS | |
| 850 | Trichotillomania | FAERS: 1 | US FAERS | |
| 851 | Trismus | FAERS: 1 | US FAERS | |
| 852 | Tuberous Sclerosis | FAERS: 1 | US FAERS | |
| 853 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 854 | Underweight | FAERS: 1 | US FAERS | |
| 855 | Urine iron increased | FAERS: 1 | US FAERS | |
| 856 | Urine osmolarity decreased | FAERS: 1 | US FAERS | |
| 857 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 858 | Uveitis | FAERS: 1 | US FAERS | |
| 859 | Vagal nerve stimulator implantation | FAERS: 1 | US FAERS | |
| 860 | Vaginal Discharge | FAERS: 1 | SIDER US FAERS | |
| 861 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 862 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 863 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 864 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 865 | Vertebral Artery Stenosis | FAERS: 1 | US FAERS | |
| 866 | Viral tonsillitis | FAERS: 1 | US FAERS | |
| 867 | Visual Agnosia | FAERS: 1 | US FAERS | |
| 868 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 869 | Vitiligo | FAERS: 1 | SIDER US FAERS | |
| 870 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 871 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 872 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 873 | Vulvovaginal pruritus | FAERS: 1 | OFFSIDES US FAERS | |
| 874 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 875 | Walking aid user | FAERS: 1 | US FAERS | |
| 876 | Water Intoxication | FAERS: 1 | US FAERS | |
| 877 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 878 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 879 | insulinoma | FAERS: 1 | US FAERS | |
| 880 | oligodendroglioma | FAERS: 1 | US FAERS | |
| 881 | AGEP | SIDER | ||
| 882 | Abdominal adhesions | OFFSIDES | ||
| 883 | Abnormal vision | OFFSIDES SIDER | ||
| 884 | Abuse | OFFSIDES | ||
| 885 | Acid reflux | OFFSIDES | ||
| 886 | Acoustic Neuroma | OFFSIDES | ||
| 887 | Aggressive reaction | SIDER | ||
| 888 | Agraphia | OFFSIDES | ||
| 889 | Amenorrhea | OFFSIDES | ||
| 890 | Amphetamines | OFFSIDES | ||
| 891 | Anaphylactic shock | SIDER | ||
| 892 | Anemia, Hemolytic | 18356642 | CTD | |
| 893 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 894 | Arteriovenous fistula site complication | OFFSIDES | ||
| 895 | Asterixis | OFFSIDES | ||
| 896 | Automatism | OFFSIDES | ||
| 897 | Basal Ganglia Diseases | 7862923 | CTD | |
| 898 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 899 | Biliary Colic | SIDER | ||
| 900 | Biliary Dyskinesia | OFFSIDES | ||
| 901 | Bladder discomfort | OFFSIDES | ||
| 902 | Blood Glucose | OFFSIDES | ||
| 903 | Blood and lymphatic system disorders | SIDER | ||
| 904 | Blood cholesterol | OFFSIDES | ||
| 905 | Blood in stool | SIDER | ||
| 906 | Blood sodium | OFFSIDES | ||
| 907 | Blurred vision | OFFSIDES | ||
| 908 | Body Temperature | OFFSIDES | ||
| 909 | Bone infarction | OFFSIDES | ||
| 910 | Brain Concussion | OFFSIDES | ||
| 911 | Brain Diseases, Metabolic | 1949275 | CTD | |
| 912 | Brain Diseases | 14506441 14970374 | CTD | |
| 913 | Candida sepsis | OFFSIDES | ||
| 914 | Cardiac enzymes increased | OFFSIDES | ||
| 915 | Cardioactive drug level | OFFSIDES | ||
| 916 | Catalepsy | 10871703 | CTD | |
| 917 | Cervical dysplasia | OFFSIDES | ||
| 918 | Chemical and Drug Induced Liver Injury | 14634926 | CTD | |
| 919 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 920 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 921 | Claustrophobia | OFFSIDES | ||
| 922 | Coagulation factor VIII level increased | OFFSIDES | ||
| 923 | Cocaine-Related Disorders | 15643110 18813772 | CTD | |
| 924 | Cognition Disorders | 12791341 | CTD | |
| 925 | Confabulation | OFFSIDES | ||
| 926 | Congenital cystic kidney disease | OFFSIDES | ||
| 927 | Conjunctival deposit | OFFSIDES | ||
| 928 | Convulsions aggravated | SIDER | ||
| 929 | Dawn phenomenon | OFFSIDES | ||
| 930 | Delusional disorder, persecutory type | OFFSIDES | ||
| 931 | Diabetes | OFFSIDES | ||
| 932 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 933 | Diabetic Retinopathy | OFFSIDES | ||
| 934 | Diarrhea | OFFSIDES | ||
| 935 | Disorders of Excessive Somnolence | CTD | ||
| 936 | Disturbance in sexual arousal | SIDER | ||
| 937 | Diverticulum | OFFSIDES | ||
| 938 | Drowsiness | OFFSIDES | ||
| 939 | Drug Eruptions | 29370880 | CTD | |
| 940 | Drug addict | OFFSIDES | ||
| 941 | Drug withdrawal headache | OFFSIDES | ||
| 942 | Duodenal Ulcer | SIDER | ||
| 943 | Ear and labyrinth disorders | SIDER | ||
| 944 | Endodontic procedure | OFFSIDES | ||
| 945 | Enteritis | SIDER | ||
| 946 | Enzyme abnormality | OFFSIDES | ||
| 947 | Epilepsies, Partial | CTD | ||
| 948 | Epilepsy, Complex Partial | 10027656 | CTD | |
| 949 | Erosive gastritis | OFFSIDES | ||
| 950 | Eructation | SIDER | ||
| 951 | Esophageal Stenosis | OFFSIDES | ||
| 952 | Exanthema | 14634926 16816222 | CTD | |
| 953 | Expired drug administered | OFFSIDES | ||
| 954 | Facial Neuralgia | OFFSIDES | ||
| 955 | Facial rash | SIDER | ||
| 956 | Feeling of body temperature change | OFFSIDES | ||
| 957 | Fever | 14634926 | CTD | |
| 958 | Flank Pain | OFFSIDES | ||
| 959 | Flat affect | SIDER | ||
| 960 | Flatulence | SIDER | ||
| 961 | Folliculitis | SIDER | ||
| 962 | Formication | OFFSIDES | ||
| 963 | Gastric Dilatation | OFFSIDES | ||
| 964 | Gastric Lavage | OFFSIDES | ||
| 965 | Gastrointestinal Pain | SIDER | ||
| 966 | Gastrointestinal infection | OFFSIDES | ||
| 967 | Genital Herpes | OFFSIDES | ||
| 968 | Gingival Hyperplasia | SIDER | ||
| 969 | Glomerulonephritis | OFFSIDES | ||
| 970 | Headache Disorders | 17212691 | CTD | |
| 971 | Hepatic Encephalopathy | SIDER | ||
| 972 | Hip surgery | OFFSIDES | ||
| 973 | Hyperalgesia | 16777327 17959985 | CTD | |
| 974 | Hyperkinesia | SIDER | ||
| 975 | Hyperplasia | SIDER | ||
| 976 | Hyperreflexia | SIDER | ||
| 977 | Hypertensive heart disease | OFFSIDES | ||
| 978 | Hypomania | OFFSIDES | ||
| 979 | Hyponatremia | CTD | ||
| 980 | Hysteria | SIDER | ||
| 981 | Impaired gastric emptying | OFFSIDES | ||
| 982 | Infestation | SIDER | ||
| 983 | Infusion site mobility decreased | OFFSIDES | ||
| 984 | Injection site cellulitis | OFFSIDES | ||
| 985 | Injection site dermatitis | OFFSIDES | ||
| 986 | Injection site warmth | OFFSIDES | ||
| 987 | Intention tremor | OFFSIDES | ||
| 988 | Intervertebral disc disorder | OFFSIDES | ||
| 989 | Intubation | OFFSIDES | ||
| 990 | Joint sprain | OFFSIDES | ||
| 991 | Kidney Failure | OFFSIDES | ||
| 992 | Laryngospasm | SIDER | ||
| 993 | Leg edema | SIDER | ||
| 994 | Leukoencephalopathy | OFFSIDES | ||
| 995 | Leukorrhea | SIDER | ||
| 996 | Lupus Erythematosus | SIDER | ||
| 997 | Malignant tumour excision | OFFSIDES | ||
| 998 | Manic psychosis | SIDER | ||
| 999 | Mastectomy | OFFSIDES | ||
| 1000 | Migraine Disorders | 17955169 | CTD | |
| 1001 | Miliaria Rubra | SIDER | ||
| 1002 | Miliaria | SIDER | ||
| 1003 | Muscle relaxant therapy | SIDER | ||
| 1004 | Nephritis, Interstitial | 14634926 | CTD | |
| 1005 | Nervous tension | OFFSIDES | ||
| 1006 | Neurologic Manifestations | 14970374 | CTD | |
| 1007 | Nicotine Dependence | OFFSIDES | ||
| 1008 | Ocular Motility Disorders | 10371552 | CTD | |
| 1009 | Oculogyration | OFFSIDES | ||
| 1010 | Oculogyric crisis | SIDER | ||
| 1011 | Open reduction of fracture | OFFSIDES | ||
| 1012 | Otitis Externa | SIDER | ||
| 1013 | Panic disorder with agoraphobia | OFFSIDES | ||
| 1014 | Periarthritis | OFFSIDES | ||
| 1015 | Pleurisy | SIDER | ||
| 1016 | Polymenorrhea | OFFSIDES | ||
| 1017 | Polysubstance dependence | OFFSIDES | ||
| 1018 | Priapism | 16292111 | CTD SIDER | |
| 1019 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 1020 | Prothrombin level decreased | OFFSIDES | ||
| 1021 | Psoriasis | SIDER | ||
| 1022 | Psychotic Disorders | 20607336 | CTD | |
| 1023 | Pulmonary arterial pressure increased | OFFSIDES | ||
| 1024 | Pyoderma Gangrenosum | OFFSIDES | ||
| 1025 | Reaction to medical agent preservatives | OFFSIDES | ||
| 1026 | Rectal Prolapse | OFFSIDES | ||
| 1027 | Renal cyst | OFFSIDES | ||
| 1028 | Renal pain | SIDER | ||
| 1029 | SUNCT Syndrome | 20656711 | CTD | |
| 1030 | Schizoaffective Disorder | OFFSIDES | ||
| 1031 | Scotoma | SIDER | ||
| 1032 | Seizures | CTD | ||
| 1033 | Serum transaminase increased | SIDER | ||
| 1034 | Speech Disorders | 19401271 | CTD | |
| 1035 | Sprain | SIDER | ||
| 1036 | Substance Withdrawal Syndrome | 18281195 18505998 | CTD | |
| 1037 | Tobacco user | OFFSIDES | ||
| 1038 | Tooth Extraction | OFFSIDES | ||
| 1039 | Trigeminal nerve ablation | OFFSIDES | ||
| 1040 | Ulcerative stomatitis | SIDER | ||
| 1041 | Urethral Stenosis | OFFSIDES | ||
| 1042 | Urinary Tract Pain | SIDER | ||
| 1043 | Urine output increased | SIDER | ||
| 1044 | Vascular purpura | SIDER | ||
| 1045 | Vascular resistance systemic decreased | OFFSIDES | ||
| 1046 | Vascular resistance systemic increased | OFFSIDES | ||
| 1047 | Weight Gain | OFFSIDES | ||
| 1048 | Wheelchair user | OFFSIDES | ||
| 1049 | Xerophthalmia | SIDER | ||
| 1050 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.