Furosemide
(ZZUFCTLCJUWOSV-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)c1cc(c(cc1NCc1ccco1)Cl)S(=O)(=O)N
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- C03CA01; C03CB01; C03EB01; G01AE10
- Molecular Formula:
- C12H11ClN2O5S
- Molecular Weight:
- 330.744
- Log P:
- 3.7448
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 131.01
- CAS Number(s):
- 54-31-9; 106391-48-4
Synonym(s)
1.
Furosemide
2.
Frusemide
3.
Fursemide
4.
Errolon
5.
Frusemid
6.
Furanthril
7.
Furantral
8.
Furosemide Monohydrochloride
9.
Furosemide Monosodium Salt
10.
Fusid
11.
Lasix
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 212 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 2 | Acute kidney injury | FAERS: 115 Canada Vigilance: 16 |
513486
686175 735158 958099 1300436 1769878 2048579 2280884 2827563 3013264 3015452 5074752 8164396 8577126 9284855 10599213 12243603 14575286 15351602 19031110 29860548 | CTD Canada Vigilance US FAERS |
| 3 | Dehydration | FAERS: 91 Canada Vigilance: 2 | 657047 7035987 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Dizziness | FAERS: 85 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 5 | Hypotension | FAERS: 84 Canada Vigilance: 5 | CTD SIDER Canada Vigilance US FAERS | |
| 6 | Drug abuse | FAERS: 73 | US FAERS | |
| 7 | Syncope | FAERS: 69 | 15939116 | CTD US FAERS |
| 8 | Metabolic alkalosis | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Pharmaceutical product complaint | FAERS: 55 | US FAERS | |
| 10 | Asthenia | FAERS: 46 Canada Vigilance: 9 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Nephrocalcinosis | FAERS: 38 |
1622512
1815176 2264472 3084585 3279919 3290820 3924971 6392586 8021767 8703710 8996656 9573460 9636745 10207925 10445348 10654327 10671031 11096312 11328921 15086907 19460127 | CTD SIDER US FAERS |
| 12 | Nausea | FAERS: 37 Canada Vigilance: 6 | 10344374 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Polyuria | FAERS: 36 Canada Vigilance: 6 | 319569 12087585 17945291 | CTD SIDER Canada Vigilance US FAERS |
| 14 | Pseudo-Bartter syndrome | FAERS: 32 | SIDER US FAERS | |
| 15 | Vomiting | FAERS: 31 Canada Vigilance: 2 | 10344374 | CTD SIDER Canada Vigilance US FAERS |
| 16 | Blood creatinine increased | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Blood potassium decreased | FAERS: 30 | OFFSIDES US FAERS | |
| 18 | Product substitution issue | FAERS: 29 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 19 | Fatigue | FAERS: 28 | 3769383 | CTD SIDER US FAERS |
| 20 | Rhabdomyolysis | FAERS: 28 | 2280884 8492347 12243603 | CTD OFFSIDES US FAERS |
| 21 | Headache | FAERS: 27 Canada Vigilance: 8 | 10344374 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Medication Error | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Swelling | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Weight decreased | FAERS: 27 | US FAERS | |
| 25 | Product quality issue | FAERS: 25 | US FAERS | |
| 26 | Malaise | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Peripheral swelling | FAERS: 24 | US FAERS | |
| 28 | Somnolence | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Blood urea increased | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 30 | Chest Pain | FAERS: 20 | OFFSIDES US FAERS | |
| 31 | Myalgia | FAERS: 20 | US FAERS | |
| 32 | Overdose | FAERS: 20 | US FAERS | |
| 33 | Cardiac Arrest | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Pain | FAERS: 17 Canada Vigilance: 2 | 4123438 | CTD SIDER Canada Vigilance US FAERS |
| 35 | Pruritus | FAERS: 17 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 36 | Pseudoporphyria | FAERS: 17 | US FAERS | |
| 37 | Therapeutic response unexpected with drug substitution | FAERS: 17 | US FAERS | |
| 38 | Unevaluable event | FAERS: 17 | US FAERS | |
| 39 | Drug dispensing error | FAERS: 16 | US FAERS | |
| 40 | Pancytopenia | FAERS: 16 | US FAERS | |
| 41 | Toxic Epidermal Necrolysis | FAERS: 16 | SIDER US FAERS | |
| 42 | Atrial Fibrillation | FAERS: 15 | 8161643 | CTD US FAERS |
| 43 | Hypercalciuria | FAERS: 15 | CTD US FAERS | |
| 44 | Hypersensitivity | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 45 | Incorrect dose administered | FAERS: 15 | US FAERS | |
| 46 | Abdominal Pain | FAERS: 14 Canada Vigilance: 3 | 4755205 10344374 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 47 | Arthralgia | FAERS: 14 | US FAERS | |
| 48 | Blood creatine phosphokinase increased | FAERS: 14 | US FAERS | |
| 49 | Urinary Retention | FAERS: 13 | SIDER US FAERS | |
| 50 | Ventricular Fibrillation | FAERS: 13 | US FAERS | |
| 51 | Electrolyte imbalance | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Gout | FAERS: 12 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 53 | Hepatitis | FAERS: 12 | 12243603 | CTD US FAERS |
| 54 | Acute respiratory failure | FAERS: 11 | US FAERS | |
| 55 | Back Pain | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Constipation | FAERS: 11 | SIDER US FAERS | |
| 57 | Infection | FAERS: 11 | OFFSIDES US FAERS | |
| 58 | Palpitations | FAERS: 11 | US FAERS | |
| 59 | Pneumonia | FAERS: 11 | US FAERS | |
| 60 | Respiratory Failure | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 61 | Shock | FAERS: 11 | SIDER US FAERS | |
| 62 | Tachycardia | FAERS: 11 | 877641 | CTD US FAERS |
| 63 | Tinnitus | FAERS: 11 | 4107436 5445527 | CTD SIDER US FAERS |
| 64 | Tremor | FAERS: 11 | US FAERS | |
| 65 | Abdominal discomfort | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 66 | Acrodermatitis enteropathica | FAERS: 10 | US FAERS | |
| 67 | Anuria | FAERS: 10 | OFFSIDES US FAERS | |
| 68 | Delirium | FAERS: 10 | 21184391 | CTD US FAERS |
| 69 | Drug Dependence | FAERS: 10 | US FAERS | |
| 70 | Dysuria | FAERS: 10 | OFFSIDES US FAERS | |
| 71 | Feeling abnormal | FAERS: 10 | SIDER US FAERS | |
| 72 | Fluid overload | FAERS: 10 | OFFSIDES US FAERS | |
| 73 | Rash erythematous | FAERS: 10 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 74 | Abasia | FAERS: 9 | US FAERS | |
| 75 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 76 | Bradycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 77 | Deafness | FAERS: 9 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 78 | Electrocardiogram abnormal | FAERS: 9 | US FAERS | |
| 79 | Eosinophilia | FAERS: 9 | SIDER US FAERS | |
| 80 | Presyncope | FAERS: 9 | US FAERS | |
| 81 | Urticaria | FAERS: 9 Canada Vigilance: 2 | 11792017 | CTD SIDER Canada Vigilance US FAERS |
| 82 | Angioedema | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 83 | Electrocardiogram ST segment abnormal | FAERS: 8 | US FAERS | |
| 84 | Hypophagia | FAERS: 8 | OFFSIDES US FAERS | |
| 85 | Joint swelling | FAERS: 8 | US FAERS | |
| 86 | Mental status changes | FAERS: 8 | OFFSIDES US FAERS | |
| 87 | Nephrolithiasis | FAERS: 8 | CTD SIDER US FAERS | |
| 88 | Renal cyst | FAERS: 8 | US FAERS | |
| 89 | Restlessness | FAERS: 8 | US FAERS | |
| 90 | Septic Shock | FAERS: 8 | OFFSIDES US FAERS | |
| 91 | Thrombocytopenia | FAERS: 8 Canada Vigilance: 2 | 15468582 | CTD SIDER Canada Vigilance US FAERS |
| 92 | Urinary tract infection | FAERS: 8 | US FAERS | |
| 93 | Vertigo | FAERS: 8 | 5445527 | CTD SIDER US FAERS |
| 94 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 95 | Anxiety | FAERS: 7 | US FAERS | |
| 96 | Burning sensation | FAERS: 7 | US FAERS | |
| 97 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 98 | Drug administration error | FAERS: 7 | US FAERS | |
| 99 | Electrocardiogram repolarisation abnormality | FAERS: 7 | US FAERS | |
| 100 | Erythema | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 101 | General physical health deterioration | FAERS: 7 | OFFSIDES US FAERS | |
| 102 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 103 | Metabolic acidosis | FAERS: 7 | SIDER US FAERS | |
| 104 | Prerenal failure | FAERS: 7 | US FAERS | |
| 105 | Product use issue | FAERS: 7 | US FAERS | |
| 106 | Sinus Tachycardia | FAERS: 7 | US FAERS | |
| 107 | Thirst | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 108 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 109 | Cardiac Tamponade | FAERS: 6 | US FAERS | |
| 110 | Choroidal Detachment | FAERS: 6 | US FAERS | |
| 111 | Deafness Neurosensory | FAERS: 6 | US FAERS | |
| 112 | Dry skin | FAERS: 6 | US FAERS | |
| 113 | Hypercapnia | FAERS: 6 | US FAERS | |
| 114 | Hyperparathyroidism | FAERS: 6 | US FAERS | |
| 115 | Oliguria | FAERS: 6 | OFFSIDES US FAERS | |
| 116 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 117 | Respiratory Depression | FAERS: 6 | US FAERS | |
| 118 | Sopor | FAERS: 6 | US FAERS | |
| 119 | Wheezing | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 120 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 121 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 122 | Blood creatine increased | FAERS: 5 | OFFSIDES US FAERS | |
| 123 | Blood parathyroid hormone increased | FAERS: 5 | US FAERS | |
| 124 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 125 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 126 | Drug toxicity | FAERS: 5 | US FAERS | |
| 127 | Ejection Fraction Decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 128 | Episcleritis | FAERS: 5 | US FAERS | |
| 129 | Iritis | FAERS: 5 | US FAERS | |
| 130 | Lip swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 132 | Pericardial effusion | FAERS: 5 | OFFSIDES US FAERS | |
| 133 | Product administration error | FAERS: 5 | US FAERS | |
| 134 | Stevens-Johnson Syndrome | FAERS: 5 | 25811541 | CTD SIDER US FAERS |
| 135 | Sudden Cardiac Death | FAERS: 5 | US FAERS | |
| 136 | Urinary Incontinence | FAERS: 5 Canada Vigilance: 10 | 3769383 | CTD Canada Vigilance US FAERS |
| 137 | Visual Impairment | FAERS: 5 | SIDER US FAERS | |
| 138 | Vitamin B1 decreased | FAERS: 5 | US FAERS | |
| 139 | Acute prerenal failure | FAERS: 4 | US FAERS | |
| 140 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 141 | Anorexia | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 142 | Blindness | FAERS: 4 | US FAERS | |
| 143 | Blood chloride decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Blood electrolytes decreased | FAERS: 4 | US FAERS | |
| 145 | Blood lactate dehydrogenase increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 146 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 147 | Blood zinc decreased | FAERS: 4 | US FAERS | |
| 148 | Bone density decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 149 | Depressed Level of Consciousness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 150 | Drug Tolerance | FAERS: 4 | US FAERS | |
| 151 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 152 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 153 | Eczema | FAERS: 4 | US FAERS | |
| 154 | Epilepsy | FAERS: 4 | US FAERS | |
| 155 | Expired product administered | FAERS: 4 | US FAERS | |
| 156 | Fracture | FAERS: 4 | US FAERS | |
| 157 | Hepatoblastoma | FAERS: 4 | US FAERS | |
| 158 | Hydronephrosis | FAERS: 4 | SIDER US FAERS | |
| 159 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 160 | Intercepted drug dispensing error | FAERS: 4 | US FAERS | |
| 161 | Lethargy | FAERS: 4 Canada Vigilance: 1 | 3769383 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 162 | Mood swings | FAERS: 4 | US FAERS | |
| 163 | Myoclonus | FAERS: 4 | US FAERS | |
| 164 | Nephrotic Syndrome | FAERS: 4 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 165 | No adverse event | FAERS: 4 | US FAERS | |
| 166 | Nocturia | FAERS: 4 | US FAERS | |
| 167 | Ototoxicity | FAERS: 4 | SIDER US FAERS | |
| 168 | Photophobia | FAERS: 4 | US FAERS | |
| 169 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 170 | Product physical issue | FAERS: 4 | US FAERS | |
| 171 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 172 | Proteinuria | FAERS: 4 | 2080003 | CTD US FAERS |
| 173 | Purpura | FAERS: 4 Canada Vigilance: 2 | 15468582 | CTD SIDER Canada Vigilance US FAERS |
| 174 | Right ventricular failure | FAERS: 4 | US FAERS | |
| 175 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 176 | Transcription medication error | FAERS: 4 | US FAERS | |
| 177 | Zinc deficiency | FAERS: 4 | US FAERS | |
| 178 | treatment failure | FAERS: 4 | US FAERS | |
| 179 | Accidental exposure to product | FAERS: 3 | SIDER US FAERS | |
| 180 | Accidental exposure | FAERS: 3 | US FAERS | |
| 181 | Acidosis | FAERS: 3 | 3769383 | CTD OFFSIDES US FAERS |
| 182 | Adverse event | FAERS: 3 | OFFSIDES US FAERS | |
| 183 | Ascites | FAERS: 3 | 6476994 11356442 | CTD OFFSIDES US FAERS |
| 184 | Blood aldosterone increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Blood osmolarity increased | FAERS: 3 | US FAERS | |
| 186 | Chest discomfort | FAERS: 3 | US FAERS | |
| 187 | Chills | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Choking | FAERS: 3 | US FAERS | |
| 189 | Dermatitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 190 | Diabetes Mellitus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 191 | Discomfort | FAERS: 3 | US FAERS | |
| 192 | Disease recurrence | FAERS: 3 | US FAERS | |
| 193 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 194 | Epistaxis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 195 | Erythema Multiforme | FAERS: 3 | SIDER US FAERS | |
| 196 | Feeling Cold | FAERS: 3 | US FAERS | |
| 197 | Hypersomnia | FAERS: 3 | US FAERS | |
| 198 | Hypoaldosteronism | FAERS: 3 | US FAERS | |
| 199 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 200 | Long QT Syndrome | FAERS: 3 | US FAERS | |
| 201 | Malnutrition | FAERS: 3 | SIDER US FAERS | |
| 202 | Orthostatic intolerance | FAERS: 3 | SIDER US FAERS | |
| 203 | Pemphigus | FAERS: 3 | US FAERS | |
| 204 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 205 | Product dispensing error | FAERS: 3 | US FAERS | |
| 206 | Product dose omission | FAERS: 3 | US FAERS | |
| 207 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 208 | Quadriplegia | FAERS: 3 | 2486385 | CTD US FAERS |
| 209 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 210 | Renal tubular disorder | FAERS: 3 | US FAERS | |
| 211 | Sepsis | FAERS: 3 | US FAERS | |
| 212 | Shoshin beriberi | FAERS: 3 | US FAERS | |
| 213 | Sudden death | FAERS: 3 | US FAERS | |
| 214 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 215 | Troponin T increased | FAERS: 3 | US FAERS | |
| 216 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 217 | Urine calcium/creatinine ratio increased | FAERS: 3 | US FAERS | |
| 218 | jaundice | FAERS: 3 | US FAERS | |
| 219 | Acne | FAERS: 2 | US FAERS | |
| 220 | Agitation | FAERS: 2 | SIDER US FAERS | |
| 221 | Agranulocytosis | FAERS: 2 | SIDER US FAERS | |
| 222 | Alkalosis | FAERS: 2 | CTD US FAERS | |
| 223 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 224 | Amnesia | FAERS: 2 | US FAERS | |
| 225 | Anaphylactic shock | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 226 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 227 | Aphagia | FAERS: 2 | US FAERS | |
| 228 | Aphonia | FAERS: 2 | US FAERS | |
| 229 | Arthropathy | FAERS: 2 | US FAERS | |
| 230 | Atrioventricular Block | FAERS: 2 | 3711429 | CTD US FAERS |
| 231 | Blood parathyroid hormone abnormal | FAERS: 2 | US FAERS | |
| 232 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 233 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 234 | Blood urine present | FAERS: 2 | US FAERS | |
| 235 | Bone pain | FAERS: 2 | OFFSIDES US FAERS | |
| 236 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 237 | Calcinosis | FAERS: 2 | 1552401 3275932 6637931 | CTD US FAERS |
| 238 | Cardiac ventricular disorder | FAERS: 2 | US FAERS | |
| 239 | Cataract operation | FAERS: 2 | OFFSIDES US FAERS | |
| 240 | Cataract | FAERS: 2 | US FAERS | |
| 241 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 242 | Cyanosis | FAERS: 2 | US FAERS | |
| 243 | Dementia | FAERS: 2 | US FAERS | |
| 244 | Dental caries | FAERS: 2 | US FAERS | |
| 245 | Depressed mood | FAERS: 2 | US FAERS | |
| 246 | Diffuse large B-cell lymphoma recurrent | FAERS: 2 | US FAERS | |
| 247 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 248 | Drug abuser | FAERS: 2 | US FAERS | |
| 249 | Drug dose omission | FAERS: 2 | US FAERS | |
| 250 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 251 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 252 | Drug resistance | FAERS: 2 | US FAERS | |
| 253 | Dysarthria | FAERS: 2 | 2486385 | CTD US FAERS |
| 254 | Dysgeusia | FAERS: 2 | SIDER US FAERS | |
| 255 | Ear congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 256 | Erythrodermic psoriasis | FAERS: 2 | US FAERS | |
| 257 | Femoral artery occlusion | FAERS: 2 | US FAERS | |
| 258 | Fixed eruption | FAERS: 2 | US FAERS | |
| 259 | Flatulence | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 260 | Foreign body aspiration | FAERS: 2 | US FAERS | |
| 261 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 262 | Gastritis | FAERS: 2 | US FAERS | |
| 263 | Haemorrhagic Necrotic Pancreatitis | FAERS: 2 | US FAERS | |
| 264 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 265 | Hypoxia | FAERS: 2 | OFFSIDES US FAERS | |
| 266 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 267 | Joint injury | FAERS: 2 | US FAERS | |
| 268 | Leukocytosis | FAERS: 2 | US FAERS | |
| 269 | Leukopenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 270 | Limb discomfort | FAERS: 2 | US FAERS | |
| 271 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 272 | Mental impairment | FAERS: 2 | US FAERS | |
| 273 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 274 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 275 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 276 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 277 | Neck Pain | FAERS: 2 | US FAERS | |
| 278 | Nervousness | FAERS: 2 | US FAERS | |
| 279 | Neuralgia | FAERS: 2 | US FAERS | |
| 280 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 281 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 282 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 283 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 284 | Oropharyngeal pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Pallor | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 286 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 287 | Parakeratosis | FAERS: 2 | US FAERS | |
| 288 | Perinephric collection | FAERS: 2 | US FAERS | |
| 289 | Petechiae | FAERS: 2 | US FAERS | |
| 290 | Post procedural complication | FAERS: 2 | US FAERS | |
| 291 | Product availability issue | FAERS: 2 | US FAERS | |
| 292 | Product container issue | FAERS: 2 | US FAERS | |
| 293 | Product container seal issue | FAERS: 2 | US FAERS | |
| 294 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 295 | Productive Cough | FAERS: 2 | OFFSIDES US FAERS | |
| 296 | Protein urine present | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 297 | Pulmonary Infarction | FAERS: 2 | US FAERS | |
| 298 | Pyelocaliectasis | FAERS: 2 | US FAERS | |
| 299 | Rebound effect | FAERS: 2 | US FAERS | |
| 300 | Renal Colic | FAERS: 2 | US FAERS | |
| 301 | Renal pain | FAERS: 2 | US FAERS | |
| 302 | Renal tubular acidosis | FAERS: 2 | US FAERS | |
| 303 | Respiratory distress | FAERS: 2 | US FAERS | |
| 304 | Skin Erosion | FAERS: 2 | US FAERS | |
| 305 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 306 | Spinal column stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 307 | Stupor | FAERS: 2 | US FAERS | |
| 308 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 309 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 310 | Transaminases increased | FAERS: 2 | US FAERS | |
| 311 | Ulcer | FAERS: 2 | OFFSIDES US FAERS | |
| 312 | Urine calcium decreased | FAERS: 2 | US FAERS | |
| 313 | Urinoma | FAERS: 2 | 15351602 | CTD US FAERS |
| 314 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 315 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 316 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 317 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 318 | Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 319 | Accidental overdose | FAERS: 1 | US FAERS | |
| 320 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 321 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 322 | Alveolitis | FAERS: 1 | US FAERS | |
| 323 | Amputation | FAERS: 1 | US FAERS | |
| 324 | Ankle Fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 325 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 326 | Aphasia | FAERS: 1 | US FAERS | |
| 327 | Arthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 328 | Asphyxia | FAERS: 1 | US FAERS | |
| 329 | Asterixis | FAERS: 1 | US FAERS | |
| 330 | Asthma | FAERS: 1 | US FAERS | |
| 331 | Ataxia | FAERS: 1 | US FAERS | |
| 332 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 333 | Auricular swelling | FAERS: 1 | US FAERS | |
| 334 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 335 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 336 | Autonomic Dysreflexia | FAERS: 1 | US FAERS | |
| 337 | Bedridden | FAERS: 1 | US FAERS | |
| 338 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 339 | Biopsy kidney abnormal | FAERS: 1 | US FAERS | |
| 340 | Bladder discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 341 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 342 | Blood amylase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 343 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 344 | Blood osmolarity decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 346 | Blood pH increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 347 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 348 | Bone erosion | FAERS: 1 | US FAERS | |
| 349 | Bone lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 350 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 351 | Bronchospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 353 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 354 | Candida sepsis | FAERS: 1 | US FAERS | |
| 355 | Cardiac infection | FAERS: 1 | US FAERS | |
| 356 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 357 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 358 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 360 | Cholestasis | FAERS: 1 | SIDER US FAERS | |
| 361 | Chromatopsia | FAERS: 1 | US FAERS | |
| 362 | Chromaturia | FAERS: 1 | US FAERS | |
| 363 | Cleft Palate | FAERS: 1 | US FAERS | |
| 364 | Clostridium difficile colitis | FAERS: 1 | OFFSIDES US FAERS | |
| 365 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 366 | Cold sweat | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Coronary Artery Disease | FAERS: 1 | 758516 | CTD US FAERS |
| 368 | Crying | FAERS: 1 | US FAERS | |
| 369 | Crystalluria | FAERS: 1 | US FAERS | |
| 370 | Cystitis | FAERS: 1 | 12762384 | CTD US FAERS |
| 371 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 372 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 373 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 374 | Device breakage | FAERS: 1 | US FAERS | |
| 375 | Device computer issue | FAERS: 1 | US FAERS | |
| 376 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 377 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 378 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 379 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 380 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 381 | Drug level increased | FAERS: 1 | US FAERS | |
| 382 | Dysphonia | FAERS: 1 | US FAERS | |
| 383 | Ear discomfort | FAERS: 1 | US FAERS | |
| 384 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 385 | Electrocardiogram U-wave abnormality | FAERS: 1 | US FAERS | |
| 386 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 387 | Electrolyte depletion | FAERS: 1 | SIDER US FAERS | |
| 388 | Embolism | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 389 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 390 | Enteritis | FAERS: 1 | US FAERS | |
| 391 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 392 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 393 | Expired drug administered | FAERS: 1 | US FAERS | |
| 394 | Extra dose administered | FAERS: 1 | US FAERS | |
| 395 | Fear of falling | FAERS: 1 | US FAERS | |
| 396 | Feeling jittery | FAERS: 1 | US FAERS | |
| 397 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 398 | Flank Pain | FAERS: 1 | US FAERS | |
| 399 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 400 | Flushing | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 402 | Gangrene | FAERS: 1 | US FAERS | |
| 403 | Gastroduodenitis | FAERS: 1 | US FAERS | |
| 404 | Gastroenteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 405 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 406 | Gastrointestinal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 407 | Genital pain | FAERS: 1 | US FAERS | |
| 408 | Genital swelling | FAERS: 1 | US FAERS | |
| 409 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 410 | Glaucoma | FAERS: 1 | US FAERS | |
| 411 | Granulocytosis | FAERS: 1 | OFFSIDES US FAERS | |
| 412 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 413 | Head Banging | FAERS: 1 | US FAERS | |
| 414 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 415 | Hepatitis C | FAERS: 1 | OFFSIDES US FAERS | |
| 416 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 417 | Hernia | FAERS: 1 | US FAERS | |
| 418 | Histone antibody positive | FAERS: 1 | US FAERS | |
| 419 | Hyperphagia | FAERS: 1 | US FAERS | |
| 420 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 421 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 422 | Hyperventilation | FAERS: 1 | US FAERS | |
| 423 | Hypoaesthesia facial | FAERS: 1 | OFFSIDES US FAERS | |
| 424 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 425 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 426 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 427 | Hypoventilation | FAERS: 1 | US FAERS | |
| 428 | Incoherent | FAERS: 1 | US FAERS | |
| 429 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 430 | Initial insomnia | FAERS: 1 | US FAERS | |
| 431 | Intentional misuse | FAERS: 1 | US FAERS | |
| 432 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 433 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 434 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 435 | Laziness | FAERS: 1 | US FAERS | |
| 436 | Left Ventricular Hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 437 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 438 | Limb injury | FAERS: 1 | US FAERS | |
| 439 | Lipase increased | FAERS: 1 | US FAERS | |
| 440 | Liver palpable subcostal | FAERS: 1 | US FAERS | |
| 441 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 442 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 443 | Melanosis coli | FAERS: 1 | US FAERS | |
| 444 | Memory impairment | FAERS: 1 | US FAERS | |
| 445 | Micturition frequency decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 446 | Mucosal erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 447 | Muscle hypertrophy | FAERS: 1 | US FAERS | |
| 448 | Myocardial rupture | FAERS: 1 | US FAERS | |
| 449 | Myocarditis | FAERS: 1 | US FAERS | |
| 450 | Myopathy | FAERS: 1 | US FAERS | |
| 451 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 452 | Necrosis | FAERS: 1 | 616978 7256783 24813929 | CTD US FAERS |
| 453 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 454 | Nephritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 455 | Nerve injury | FAERS: 1 | US FAERS | |
| 456 | No adverse effect | FAERS: 1 | US FAERS | |
| 457 | Nodule | FAERS: 1 | US FAERS | |
| 458 | Nystagmus | FAERS: 1 | US FAERS | |
| 459 | Onychoclasis | FAERS: 1 | US FAERS | |
| 460 | Osteolysis | FAERS: 1 | US FAERS | |
| 461 | Osteomalacia | FAERS: 1 | US FAERS | |
| 462 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 463 | Osteoporosis | FAERS: 1 | OFFSIDES US FAERS | |
| 464 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 465 | PO2 decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 466 | Pain of skin | FAERS: 1 | US FAERS | |
| 467 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 468 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 469 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 470 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 471 | Pneumonitis | FAERS: 1 | US FAERS | |
| 472 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 473 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 474 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 475 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 476 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 477 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 478 | Product label issue | FAERS: 1 | US FAERS | |
| 479 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 480 | Product size issue | FAERS: 1 | US FAERS | |
| 481 | Protein-losing gastroenteropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 482 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 483 | Pulmonary congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 484 | Purging | FAERS: 1 | US FAERS | |
| 485 | Pyeloplasty | FAERS: 1 | US FAERS | |
| 486 | Pyuria | FAERS: 1 | US FAERS | |
| 487 | Radiation injury | FAERS: 1 | US FAERS | |
| 488 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 489 | Renal abscess | FAERS: 1 | US FAERS | |
| 490 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 491 | Renin decreased | FAERS: 1 | US FAERS | |
| 492 | Renin increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 493 | Respiratory Paralysis | FAERS: 1 | US FAERS | |
| 494 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 495 | Retching | FAERS: 1 | US FAERS | |
| 496 | Reticulocyte count increased | FAERS: 1 | US FAERS | |
| 497 | Rheumatic Heart Disease | FAERS: 1 | US FAERS | |
| 498 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 499 | Rhinitis | FAERS: 1 | OFFSIDES US FAERS | |
| 500 | Scab | FAERS: 1 | US FAERS | |
| 501 | Scatolia | FAERS: 1 | US FAERS | |
| 502 | Sensitive skin | FAERS: 1 | US FAERS | |
| 503 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 504 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 505 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 506 | Skin laceration | FAERS: 1 | US FAERS | |
| 507 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 508 | Skin test positive | FAERS: 1 | US FAERS | |
| 509 | Skin tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 510 | Sluggishness | FAERS: 1 | US FAERS | |
| 511 | Spastic paralysis | FAERS: 1 | US FAERS | |
| 512 | Splenic necrosis | FAERS: 1 | US FAERS | |
| 513 | Staring | FAERS: 1 | US FAERS | |
| 514 | Stridor | FAERS: 1 | US FAERS | |
| 515 | Suicide attempt | FAERS: 1 | US FAERS | |
| 516 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 517 | Tension | FAERS: 1 | US FAERS | |
| 518 | Tetany | FAERS: 1 | 3119128 5131199 8492347 | CTD OFFSIDES SIDER US FAERS |
| 519 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 520 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 521 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 522 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 523 | Therapy cessation | FAERS: 1 | US FAERS | |
| 524 | Therapy change | FAERS: 1 | US FAERS | |
| 525 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 526 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 527 | Thrombosis | FAERS: 1 | SIDER US FAERS | |
| 528 | Tooth Loss | FAERS: 1 | US FAERS | |
| 529 | Transplant | FAERS: 1 | US FAERS | |
| 530 | Troponin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 531 | Urate nephropathy | FAERS: 1 | US FAERS | |
| 532 | Urine chloride increased | FAERS: 1 | US FAERS | |
| 533 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 534 | Urine phosphorus decreased | FAERS: 1 | US FAERS | |
| 535 | Urine phosphorus increased | FAERS: 1 | US FAERS | |
| 536 | Urine potassium increased | FAERS: 1 | US FAERS | |
| 537 | Vascular pain | FAERS: 1 | US FAERS | |
| 538 | Vasculitis | FAERS: 1 | CTD SIDER US FAERS | |
| 539 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 540 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 541 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 542 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 543 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 544 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 545 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 546 | AGEP | SIDER | ||
| 547 | Abdominal bloating | SIDER | ||
| 548 | Abdominal tenderness | OFFSIDES | ||
| 549 | Acanthoma | OFFSIDES | ||
| 550 | Accidental ingestion | SIDER | ||
| 551 | Acid reflux | OFFSIDES | ||
| 552 | Actinomycosis | OFFSIDES | ||
| 553 | Acute bronchitis | OFFSIDES | ||
| 554 | Acute retention of urine | SIDER | ||
| 555 | Acute sinusitis | OFFSIDES | ||
| 556 | Adenoma | OFFSIDES | ||
| 557 | Ageusia | OFFSIDES | ||
| 558 | Ammonia increased | OFFSIDES | ||
| 559 | Anaphylactoid Reaction | SIDER | ||
| 560 | Anemia, Hemolytic | 958099 | CTD | |
| 561 | Aortitis | 6546667 | CTD | |
| 562 | Apathy | OFFSIDES SIDER | ||
| 563 | Application site pain | SIDER | ||
| 564 | Application site vesicles | OFFSIDES | ||
| 565 | Aspiration Pneumonia | OFFSIDES | ||
| 566 | Atelectasis | OFFSIDES | ||
| 567 | Atherosclerosis | OFFSIDES | ||
| 568 | Atrial tachycardia | OFFSIDES | ||
| 569 | Azotemia | 946513 | CTD | |
| 570 | Bacterial Endocarditis | OFFSIDES | ||
| 571 | Benign Prostatic Hyperplasia | SIDER | ||
| 572 | Biopsy breast abnormal | OFFSIDES | ||
| 573 | Biopsy liver abnormal | OFFSIDES | ||
| 574 | Bipolar I disorder | OFFSIDES | ||
| 575 | Bladder cyst | OFFSIDES | ||
| 576 | Bladder pain | SIDER | ||
| 577 | Bladder spasm | SIDER | ||
| 578 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 579 | Blood Glucose | OFFSIDES | ||
| 580 | Blood albumin decreased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 581 | Blood and lymphatic system disorders | SIDER | ||
| 582 | Blood cholesterol increased | SIDER | ||
| 583 | Blood cholesterol | OFFSIDES | ||
| 584 | Blood cholinesterase decreased | OFFSIDES | ||
| 585 | Blood glucose decreased | OFFSIDES | ||
| 586 | Blood magnesium decreased | OFFSIDES | ||
| 587 | Blood pressure immeasurable | OFFSIDES | ||
| 588 | Blood triglycerides increased | SIDER | ||
| 589 | Blood uric acid | OFFSIDES | ||
| 590 | Bone Demineralization, Pathologic | 3084585 | CTD | |
| 591 | Bone Diseases | 6637931 | CTD | |
| 592 | Bone swelling | OFFSIDES | ||
| 593 | Brain Abscess | OFFSIDES | ||
| 594 | Brain Diseases | 14970374 | CTD | |
| 595 | Breast cancer recurrent | OFFSIDES | ||
| 596 | Bronchitis | OFFSIDES | ||
| 597 | Bronchopneumonia | 958099 | CTD OFFSIDES | |
| 598 | Bronchopulmonary Dysplasia | CTD | ||
| 599 | Bullous eruption | SIDER | ||
| 600 | Bursitis | OFFSIDES | ||
| 601 | Capillary Leak Syndrome | OFFSIDES | ||
| 602 | Cardiac enzymes increased | OFFSIDES | ||
| 603 | Cardiomyopathy, Dilated | 9838955 18628775 | CTD | |
| 604 | Cardiovascular Diseases | 24813929 | CTD | |
| 605 | Catheter placement | OFFSIDES | ||
| 606 | Catheter sepsis | OFFSIDES | ||
| 607 | Central line infection | OFFSIDES | ||
| 608 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 609 | Cerebral Hemorrhage | 1622512 15468582 | CTD | |
| 610 | Cerebral Infarction | 9143594 | CTD | |
| 611 | Cerebral artery occlusion | OFFSIDES | ||
| 612 | Cerebral artery stenosis | OFFSIDES | ||
| 613 | Chemical and Drug Induced Liver Injury | CTD | ||
| 614 | Cholangiolitis | OFFSIDES | ||
| 615 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 616 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 617 | Chronic diarrhea | SIDER | ||
| 618 | Chronic left ventricular failure | OFFSIDES | ||
| 619 | Cochlear Diseases | 21216844 | CTD | |
| 620 | Colitis | OFFSIDES | ||
| 621 | Confabulation | OFFSIDES | ||
| 622 | Confusion | 3769383 | CTD | |
| 623 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 624 | Conjunctival deposit | OFFSIDES | ||
| 625 | Corneal epithelium defect | OFFSIDES | ||
| 626 | Corneal pigmentation | OFFSIDES | ||
| 627 | Cramps of lower extremities | SIDER | ||
| 628 | Cryotherapy | OFFSIDES | ||
| 629 | Cystocele | OFFSIDES | ||
| 630 | Deafness Permanent | SIDER | ||
| 631 | Deglutition Disorders | 2486385 | CTD | |
| 632 | Dental Fistula | OFFSIDES | ||
| 633 | Dental abscess | OFFSIDES | ||
| 634 | Dental discomfort | OFFSIDES | ||
| 635 | Device related infection | OFFSIDES | ||
| 636 | Diabetes | OFFSIDES | ||
| 637 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 638 | Diabetic Nephropathy | OFFSIDES | ||
| 639 | Diarrhea | OFFSIDES | ||
| 640 | Diuresis | SIDER | ||
| 641 | Drowsiness | SIDER | ||
| 642 | Drug Eruptions | 11792017 | CTD | |
| 643 | Dyspnea | 15564710 16935035 | CTD | |
| 644 | Ear Diseases | 5579772 6653051 19644644 | CTD | |
| 645 | Ear and labyrinth disorders | SIDER | ||
| 646 | Edema | CTD | ||
| 647 | Electrocardiogram U wave present | Canada Vigilance: 1 | Canada Vigilance | |
| 648 | Enterococcal sepsis | OFFSIDES | ||
| 649 | Epidermolysis Bullosa | SIDER | ||
| 650 | Epigastric discomfort | SIDER | ||
| 651 | Eye pain | Canada Vigilance: 1 | Canada Vigilance | |
| 652 | Fatty Liver | OFFSIDES | ||
| 653 | Flat affect | SIDER | ||
| 654 | Gastric irritation | SIDER | ||
| 655 | Gastrointestinal sounds abnormal | OFFSIDES | ||
| 656 | Globulinuria | OFFSIDES | ||
| 657 | Glomerulonephritis | 4130841 8577126 | CTD | |
| 658 | Glycosuria | SIDER | ||
| 659 | Gout attack | SIDER | ||
| 660 | Granuloma | 3822042 | CTD | |
| 661 | Hand Dermatoses | 9812036 | CTD | |
| 662 | Hearing Loss, Bilateral | 11895059 | CTD | |
| 663 | Hearing Loss | CTD | ||
| 664 | Heart failure |
62899
499643 517886 642984 2277481 3013264 3080299 3341836 6372839 6544206 6684503 6788266 6798885 7018361 7220787 8021767 8161643 8561216 9284855 10445348 12660669 12676739 14524653 14713176 16011733 16845234 19838493 19843838 | CTD | |
| 665 | Hematuria | 8021767 | CTD | |
| 666 | Hemorrhage | 12762384 | CTD | |
| 667 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 668 | Hepatic Encephalopathy | SIDER | ||
| 669 | Hernia obstructive | OFFSIDES | ||
| 670 | Histoplasmosis | OFFSIDES | ||
| 671 | Hydrocephalus | 1622512 10207925 | CTD | |
| 672 | Hyperaldosteronism | 6387403 | CTD | |
| 673 | Hypercalcemia | 451712 16006300 17652376 | CTD | |
| 674 | Hyperkalemia | 1605901 8606734 | CTD | |
| 675 | Hyperparathyroidism, Secondary | 6637931 15086907 | CTD | |
| 676 | Hypokalemia |
62899
657047 759067 2264472 3572225 3885386 6708393 6883959 7182184 8595691 8996656 9284855 9533377 10437370 11749789 16404129 17879355 18259658 | CTD | |
| 677 | Hyponatremia | CTD | ||
| 678 | Hypoproteinemia | 16096441 | CTD | |
| 679 | Hypotension, Orthostatic | 15811171 | CTD | |
| 680 | Hypotensive | SIDER | ||
| 681 | Hypovolemia | 888101 18259658 | CTD | |
| 682 | Immunosuppression | OFFSIDES | ||
| 683 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 684 | Incontinence | OFFSIDES SIDER | ||
| 685 | Increased bronchial secretion | OFFSIDES | ||
| 686 | Infant, Premature, Diseases | CTD | ||
| 687 | Injection Site Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 688 | Injection site pain | SIDER | ||
| 689 | Instillation site pain | SIDER | ||
| 690 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 691 | Intravenous catheter management | OFFSIDES | ||
| 692 | Joint prosthesis user | OFFSIDES | ||
| 693 | Kidney Calculi | CTD | ||
| 694 | Kidney Diseases | CTD | ||
| 695 | Kidney Failure, Chronic | 786692 | CTD | |
| 696 | Kidney Failure | OFFSIDES | ||
| 697 | Laceration | OFFSIDES | ||
| 698 | Leukoencephalopathy | OFFSIDES | ||
| 699 | Lightheadedness | SIDER | ||
| 700 | Liver Cirrhosis | 634773 759067 | CTD | |
| 701 | Liver diseases | 2894691 3148942 | CTD | |
| 702 | Local reaction | SIDER | ||
| 703 | Loose tooth | OFFSIDES | ||
| 704 | Lower respiratory tract infection viral | OFFSIDES | ||
| 705 | Lung consolidation | OFFSIDES | ||
| 706 | Malignant neoplasm progression | OFFSIDES | ||
| 707 | Mammary Neoplasms, Experimental | 2254589 | CTD | |
| 708 | Mastectomy | OFFSIDES | ||
| 709 | Mastication disorder | OFFSIDES | ||
| 710 | Metastatic Renal Cell Carcinoma | OFFSIDES | ||
| 711 | Mitral Valve Insufficiency | 9838955 | CTD | |
| 712 | Monoclonal immunoglobulin present | OFFSIDES | ||
| 713 | Mouth cyst | OFFSIDES | ||
| 714 | Moyamoya Disease | 9143594 | CTD | |
| 715 | Multiple Myeloma | OFFSIDES | ||
| 716 | Multiple drug overdose | OFFSIDES | ||
| 717 | Myelinolysis, Central Pontine | 2486385 | CTD | |
| 718 | Myocardial fibrosis | OFFSIDES | ||
| 719 | Neonatal anuria | OFFSIDES | ||
| 720 | Nephritis, Interstitial | CTD | ||
| 721 | Nephrogenic Diabetes Insipidus | OFFSIDES | ||
| 722 | Nephrosis | 2254589 | CTD | |
| 723 | Neurologic Manifestations | 14970374 | CTD | |
| 724 | Neuropathic pain | OFFSIDES | ||
| 725 | Neutropenia | Canada Vigilance: 1 | Canada Vigilance | |
| 726 | Ocular Hypertension | OFFSIDES | ||
| 727 | Osteitis Deformans | OFFSIDES | ||
| 728 | Osteomyelitis | OFFSIDES | ||
| 729 | PCO2 increased | Canada Vigilance: 1 | Canada Vigilance | |
| 730 | Paranoia | OFFSIDES | ||
| 731 | Paraplegia | OFFSIDES | ||
| 732 | Paresthesia | 5088026 10437370 | CTD | |
| 733 | Patent ductus arteriosus | SIDER | ||
| 734 | Phlebitis | OFFSIDES | ||
| 735 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 736 | Polydipsia | SIDER | ||
| 737 | Porphyria Cutanea Tarda | 9812036 | CTD | |
| 738 | Portal Hypertension | OFFSIDES | ||
| 739 | Postmenopausal bleeding | OFFSIDES | ||
| 740 | Primary sequestrum | OFFSIDES | ||
| 741 | Prostatic Hypertrophy | SIDER | ||
| 742 | Prothrombin level decreased | OFFSIDES | ||
| 743 | Pseudarthrosis | OFFSIDES | ||
| 744 | Pulmonary Edema | 8001214 9645186 | CTD | |
| 745 | Pulmonary thrombosis | OFFSIDES | ||
| 746 | Purulent discharge | OFFSIDES | ||
| 747 | Rales | OFFSIDES | ||
| 748 | Rectal tenesmus | Canada Vigilance: 1 | Canada Vigilance | |
| 749 | Renal Insufficiency | CTD | ||
| 750 | Reperfusion Injury | 16526316 | CTD | |
| 751 | Respiratory Distress Syndrome, Adult | 12394941 15912074 16096441 | CTD | |
| 752 | Respiratory Sounds | 3572225 | CTD | |
| 753 | Risus sardonicus | OFFSIDES | ||
| 754 | Sequestrectomy | OFFSIDES | ||
| 755 | Staphylococcal abscess | OFFSIDES | ||
| 756 | Stomach Neoplasms | 17052386 | CTD | |
| 757 | Supraventricular tachycardia | OFFSIDES | ||
| 758 | Sweating | SIDER | ||
| 759 | Taste sweet | SIDER | ||
| 760 | Temperature intolerance | OFFSIDES | ||
| 761 | Tendinitis | OFFSIDES | ||
| 762 | Thrombophilia | SIDER | ||
| 763 | Thrombophlebitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 764 | Tooth Extraction | OFFSIDES | ||
| 765 | Torsades de Pointes | 8595691 | CTD | |
| 766 | Tracheobronchitis | OFFSIDES | ||
| 767 | Uremia | 5523460 | CTD | |
| 768 | Urine flow decreased | OFFSIDES | ||
| 769 | Urine output increased | SIDER | ||
| 770 | Urolithiasis | 6726969 | CTD | |
| 771 | Vascular purpura | SIDER | ||
| 772 | Vasculitis, Leukocytoclastic, Cutaneous | 3173831 | CTD | |
| 773 | Venous thrombosis limb | OFFSIDES | ||
| 774 | Walking aid user | OFFSIDES | ||
| 775 | Wheelchair user | OFFSIDES | ||
| 776 | Xanthopsia | SIDER | ||
| 777 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.