Testosterone
(MUMGGOZAMZWBJJ-DYKIIFRCSA-N)
Structure
- SMILES
- O=C1CC[C@]2(C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- G03BA03; G03EA02
- Molecular Formula:
- C19H28O2
- Molecular Weight:
- 288.424
- Log P:
- 3.8792
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 37.3
- CAS Number(s):
- 58-22-0
Synonym(s)
1.
Testosterone
2.
17-beta-Hydroxy-4-Androsten-3-one
3.
17-beta-Hydroxy-8 alpha-4-Androsten-3-one
4.
8-Isotestosterone
5.
AndroGel
6.
Androderm
7.
Andropatch
8.
Androtop
9.
Histerone
10.
Sterotate
11.
Sustanon
12.
Testim
13.
Testoderm
14.
Testolin
15.
Testopel
16.
Testosterone Sulfate
17.
17 beta Hydroxy 4 Androsten 3 one
18.
17 beta Hydroxy 8 alpha 4 Androsten 3 one
19.
8 Isotestosterone
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myocardial Infarction | FAERS: 2105 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 2 | Drug ineffective | FAERS: 1451 Canada Vigilance: 70 | Canada Vigilance US FAERS | |
| 3 | Blood testosterone decreased | FAERS: 1338 Canada Vigilance: 15 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Deep Vein Thrombosis | FAERS: 1250 | SIDER US FAERS | |
| 5 | Cerebrovascular accident | FAERS: 1200 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Pulmonary Embolism | FAERS: 1126 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Pain | FAERS: 999 Canada Vigilance: 2 | 7059952 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 8 | Economic problem | FAERS: 990 | OFFSIDES US FAERS | |
| 9 | Emotional distress | FAERS: 681 | OFFSIDES US FAERS | |
| 10 | Anxiety | FAERS: 590 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Incorrect dose administered | FAERS: 529 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Asthenia | FAERS: 485 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Thrombosis | FAERS: 448 Canada Vigilance: 1 | 20442653 | CTD SIDER Canada Vigilance US FAERS |
| 14 | Application site pain | FAERS: 421 | SIDER US FAERS | |
| 15 | Anhedonia | FAERS: 411 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Impaired work ability | FAERS: 396 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Blood testosterone increased | FAERS: 369 | OFFSIDES SIDER US FAERS | |
| 18 | Acute myocardial infarction | FAERS: 360 | US FAERS | |
| 19 | Fatigue | FAERS: 360 Canada Vigilance: 2 | 12020264 18671790 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 20 | Application site irritation | FAERS: 347 | OFFSIDES SIDER US FAERS | |
| 21 | Drug administered at inappropriate site | FAERS: 338 | OFFSIDES US FAERS | |
| 22 | Physical disability | FAERS: 335 | US FAERS | |
| 23 | Application site rash | FAERS: 327 | OFFSIDES SIDER US FAERS | |
| 24 | Accidental exposure to product | FAERS: 249 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Application site erythema | FAERS: 235 | OFFSIDES SIDER US FAERS | |
| 26 | Headache | FAERS: 228 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 27 | Erectile dysfunction | FAERS: 205 | CTD OFFSIDES SIDER US FAERS | |
| 28 | Drug dose omission | FAERS: 195 | US FAERS | |
| 29 | Acne | FAERS: 180 | SIDER US FAERS | |
| 30 | Emotional disorder | FAERS: 174 | OFFSIDES SIDER US FAERS | |
| 31 | Wrong technique in product usage process | FAERS: 174 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Alopecia | FAERS: 170 | OFFSIDES SIDER US FAERS | |
| 33 | Blood testosterone abnormal | FAERS: 166 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Product quality issue | FAERS: 164 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Nausea | FAERS: 141 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 36 | Application site pruritus | FAERS: 140 | OFFSIDES SIDER US FAERS | |
| 37 | Inappropriate schedule of drug administration | FAERS: 134 | US FAERS | |
| 38 | Pruritus | FAERS: 134 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Feeling abnormal | FAERS: 124 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 40 | Malaise | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Dizziness | FAERS: 111 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 42 | Depressed mood | FAERS: 108 | OFFSIDES US FAERS | |
| 43 | Skin irritation | FAERS: 108 | SIDER US FAERS | |
| 44 | Coronary Artery Disease | FAERS: 107 | SIDER US FAERS | |
| 45 | Erythema | FAERS: 103 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Chest Pain | FAERS: 96 | SIDER US FAERS | |
| 47 | Drug administration error | FAERS: 93 | US FAERS | |
| 48 | Apathy | FAERS: 91 | US FAERS | |
| 49 | Arthralgia | FAERS: 87 | SIDER US FAERS | |
| 50 | Unevaluable event | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Cardiac Arrest | FAERS: 79 | SIDER US FAERS | |
| 52 | Myalgia | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Accidental exposure | FAERS: 76 | US FAERS | |
| 54 | Atrial Fibrillation | FAERS: 76 | US FAERS | |
| 55 | Psychiatric symptom | FAERS: 75 | US FAERS | |
| 56 | Anger | FAERS: 70 | SIDER US FAERS | |
| 57 | Weight decreased | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Memory impairment | FAERS: 67 | US FAERS | |
| 59 | Product deposit | FAERS: 66 | US FAERS | |
| 60 | Joint swelling | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Incorrect route of drug administration | FAERS: 64 | US FAERS | |
| 62 | Intentional product misuse | FAERS: 63 | US FAERS | |
| 63 | Medication Error | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Therapeutic response unexpected | FAERS: 63 | US FAERS | |
| 65 | Burning sensation | FAERS: 62 | OFFSIDES US FAERS | |
| 66 | Mood swings | FAERS: 61 | SIDER US FAERS | |
| 67 | Musculoskeletal Pain | FAERS: 61 | SIDER US FAERS | |
| 68 | Hypersensitivity | FAERS: 57 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 69 | Application site reaction | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 70 | Application site dryness | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 71 | Tension | FAERS: 52 | SIDER US FAERS | |
| 72 | Drug prescribing error | FAERS: 51 | US FAERS | |
| 73 | Dry skin | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 74 | Peripheral swelling | FAERS: 45 | US FAERS | |
| 75 | Agitation | FAERS: 44 | SIDER US FAERS | |
| 76 | Dysuria | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Palpitations | FAERS: 44 | SIDER US FAERS | |
| 78 | Wrong technique in drug usage process | FAERS: 44 | OFFSIDES US FAERS | |
| 79 | Back Pain | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 80 | Urticaria | FAERS: 43 | SIDER US FAERS | |
| 81 | Precocious Puberty | FAERS: 41 | SIDER US FAERS | |
| 82 | Application site exfoliation | FAERS: 40 | SIDER US FAERS | |
| 83 | Drug abuse | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Product physical issue | FAERS: 40 | US FAERS | |
| 85 | Somnolence | FAERS: 40 | US FAERS | |
| 86 | Breast tenderness | FAERS: 39 | OFFSIDES SIDER US FAERS | |
| 87 | Incorrect dose administered by device | FAERS: 39 | US FAERS | |
| 88 | Product physical consistency issue | FAERS: 39 | US FAERS | |
| 89 | Cerebral Infarction | FAERS: 38 | SIDER US FAERS | |
| 90 | Vomiting | FAERS: 38 | SIDER US FAERS | |
| 91 | Application site vesicles | FAERS: 37 | SIDER US FAERS | |
| 92 | Circumstance or information capable of leading to medication error | FAERS: 37 | US FAERS | |
| 93 | Poor quality drug administered | FAERS: 37 | US FAERS | |
| 94 | Body fat disorder | FAERS: 36 | US FAERS | |
| 95 | Chest discomfort | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 96 | Overdose | FAERS: 36 | US FAERS | |
| 97 | Disability | FAERS: 34 | US FAERS | |
| 98 | Product adhesion issue | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 99 | Dysgeusia | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 100 | Lethargy | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Drug dispensing error | FAERS: 32 | US FAERS | |
| 102 | Product administered at inappropriate site | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Nipple pain | FAERS: 31 | SIDER US FAERS | |
| 104 | Product storage error | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Incorrect product storage | FAERS: 30 | US FAERS | |
| 106 | Night sweats | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 107 | Rash erythematous | FAERS: 30 | US FAERS | |
| 108 | Product substitution issue | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 109 | Adverse event | FAERS: 27 | US FAERS | |
| 110 | Amnesia | FAERS: 27 | 14643695 | CTD OFFSIDES SIDER US FAERS |
| 111 | Angina Pectoris | FAERS: 27 Canada Vigilance: 1 | 11034937 | CTD SIDER Canada Vigilance US FAERS |
| 112 | Blood glucose increased | FAERS: 27 | SIDER US FAERS | |
| 113 | Flushing | FAERS: 27 | SIDER US FAERS | |
| 114 | Hirsutism | FAERS: 27 Canada Vigilance: 1 | 17019078 | CTD SIDER Canada Vigilance US FAERS |
| 115 | Nocturia | FAERS: 27 | SIDER US FAERS | |
| 116 | Drug effect incomplete | FAERS: 25 | US FAERS | |
| 117 | Abdominal Pain | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 118 | Prescribed overdose | FAERS: 24 | US FAERS | |
| 119 | Abdominal discomfort | FAERS: 23 | OFFSIDES US FAERS | |
| 120 | Application site burn | FAERS: 23 | SIDER US FAERS | |
| 121 | Expired product administered | FAERS: 23 | US FAERS | |
| 122 | Exposure via partner | FAERS: 23 | US FAERS | |
| 123 | Hypertrichosis | FAERS: 23 | US FAERS | |
| 124 | Arthritis | FAERS: 22 | SIDER US FAERS | |
| 125 | Blood cholesterol increased | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 126 | Injection site pain | FAERS: 22 | SIDER US FAERS | |
| 127 | Pneumonia | FAERS: 22 | SIDER US FAERS | |
| 128 | Sexual Dysfunction | FAERS: 22 | US FAERS | |
| 129 | Sperm concentration decreased | FAERS: 22 | US FAERS | |
| 130 | Diabetes Mellitus | FAERS: 21 | SIDER US FAERS | |
| 131 | Nervousness | FAERS: 21 | SIDER US FAERS | |
| 132 | Accidental exposure to product by child | FAERS: 20 | US FAERS | |
| 133 | Dysphonia | FAERS: 20 | SIDER US FAERS | |
| 134 | Feeling jittery | FAERS: 20 | US FAERS | |
| 135 | Benign Prostatic Hyperplasia | FAERS: 19 | SIDER US FAERS | |
| 136 | Blood testosterone free decreased | FAERS: 19 | US FAERS | |
| 137 | Dermal absorption impaired | FAERS: 19 | US FAERS | |
| 138 | Infarction | FAERS: 19 | US FAERS | |
| 139 | Rotator cuff syndrome | FAERS: 19 | US FAERS | |
| 140 | Azoospermia | FAERS: 18 | SIDER US FAERS | |
| 141 | General physical health deterioration | FAERS: 18 | US FAERS | |
| 142 | Partner stress | FAERS: 18 | US FAERS | |
| 143 | Pulmonary Infarction | FAERS: 18 | US FAERS | |
| 144 | Stress | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Tachycardia | FAERS: 18 | SIDER US FAERS | |
| 146 | Accidental overdose | FAERS: 17 | OFFSIDES US FAERS | |
| 147 | Application site discomfort | FAERS: 17 | US FAERS | |
| 148 | Eye irritation | FAERS: 17 | US FAERS | |
| 149 | Libido disorder | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Musculoskeletal stiffness | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 151 | Portal Vein Thrombosis | FAERS: 17 | OFFSIDES US FAERS | |
| 152 | Retinal Vein Occlusion | FAERS: 17 | US FAERS | |
| 153 | Swelling | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 154 | Tremor | FAERS: 17 | SIDER US FAERS | |
| 155 | Arthropathy | FAERS: 16 | US FAERS | |
| 156 | Chills | FAERS: 16 | SIDER US FAERS | |
| 157 | Embolism | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 158 | Liquid product physical issue | FAERS: 16 | US FAERS | |
| 159 | Mental impairment | FAERS: 16 | US FAERS | |
| 160 | Skin reaction | FAERS: 16 | US FAERS | |
| 161 | Sluggishness | FAERS: 16 | US FAERS | |
| 162 | Sudden Cardiac Death | FAERS: 16 | US FAERS | |
| 163 | Cardiomegaly | FAERS: 15 | US FAERS | |
| 164 | Discomfort | FAERS: 15 | SIDER US FAERS | |
| 165 | Erection increased | FAERS: 15 | US FAERS | |
| 166 | Infertility | FAERS: 15 | US FAERS | |
| 167 | Nasopharyngitis | FAERS: 15 | SIDER US FAERS | |
| 168 | Performance status decreased | FAERS: 15 | US FAERS | |
| 169 | Product use issue | FAERS: 15 | US FAERS | |
| 170 | Pulmonary thrombosis | FAERS: 15 | US FAERS | |
| 171 | Visual Impairment | FAERS: 15 | US FAERS | |
| 172 | nervous system disorder | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 173 | Blood triglycerides increased | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 174 | Cellulitis | FAERS: 14 | OFFSIDES US FAERS | |
| 175 | Constipation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Drug Dependence | FAERS: 14 | US FAERS | |
| 177 | Epistaxis | FAERS: 14 | OFFSIDES US FAERS | |
| 178 | Neck Pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Syncope | FAERS: 14 | SIDER US FAERS | |
| 180 | Application site swelling | FAERS: 13 | US FAERS | |
| 181 | Asthma | FAERS: 13 | SIDER US FAERS | |
| 182 | Dermatitis | FAERS: 13 | SIDER US FAERS | |
| 183 | Device malfunction | FAERS: 13 | US FAERS | |
| 184 | Hemiparesis | FAERS: 13 | US FAERS | |
| 185 | Influenza | FAERS: 13 | SIDER US FAERS | |
| 186 | Nasal discomfort | FAERS: 13 | US FAERS | |
| 187 | Product packaging quantity issue | FAERS: 13 | US FAERS | |
| 188 | Urinary hesitation | FAERS: 13 | SIDER US FAERS | |
| 189 | Ventricular Fibrillation | FAERS: 13 | US FAERS | |
| 190 | Application site urticaria | FAERS: 12 | US FAERS | |
| 191 | Arteriosclerosis | FAERS: 12 | US FAERS | |
| 192 | Blood alcohol increased | FAERS: 12 | US FAERS | |
| 193 | Crying | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Expired drug administered | FAERS: 12 | US FAERS | |
| 195 | Incorrect drug administration duration | FAERS: 12 | US FAERS | |
| 196 | Personality Change | FAERS: 12 | US FAERS | |
| 197 | Quality of life decreased | FAERS: 12 | OFFSIDES US FAERS | |
| 198 | Tinnitus | FAERS: 12 | SIDER US FAERS | |
| 199 | Urine alcohol test positive | FAERS: 12 | US FAERS | |
| 200 | prostatitis | FAERS: 12 | 3969369 20056826 | CTD SIDER US FAERS |
| 201 | Application site warmth | FAERS: 11 | SIDER US FAERS | |
| 202 | Blood urine present | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Disorientation | FAERS: 11 | US FAERS | |
| 204 | Drug-disease interaction | FAERS: 11 | US FAERS | |
| 205 | Embolic stroke | FAERS: 11 | US FAERS | |
| 206 | Exposure via direct contact | FAERS: 11 | US FAERS | |
| 207 | Hypothalamo-pituitary disorder | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 208 | Middle insomnia | FAERS: 11 | US FAERS | |
| 209 | Muscle tightness | FAERS: 11 | US FAERS | |
| 210 | Pharmaceutical product complaint | FAERS: 11 | US FAERS | |
| 211 | Retinal Artery Occlusion | FAERS: 11 | US FAERS | |
| 212 | Blood glucose decreased | FAERS: 10 | OFFSIDES US FAERS | |
| 213 | Bronchitis | FAERS: 10 | SIDER US FAERS | |
| 214 | Disease susceptibility | FAERS: 10 | US FAERS | |
| 215 | Dysarthria | FAERS: 10 | US FAERS | |
| 216 | Eczema | FAERS: 10 | SIDER US FAERS | |
| 217 | Mental status changes | FAERS: 10 | US FAERS | |
| 218 | Nephrolithiasis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 219 | Pre-existing condition improved | FAERS: 10 | US FAERS | |
| 220 | Sexual relationship change | FAERS: 10 | US FAERS | |
| 221 | Sunburn | FAERS: 10 | US FAERS | |
| 222 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 223 | Amaurosis Fugax | FAERS: 9 | US FAERS | |
| 224 | Aortic Aneurysm | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Blood prolactin increased | FAERS: 9 | SIDER US FAERS | |
| 226 | Blood testosterone free increased | FAERS: 9 | SIDER US FAERS | |
| 227 | Cerebellar infarction | FAERS: 9 | US FAERS | |
| 228 | Dihydrotestosterone increased | FAERS: 9 | US FAERS | |
| 229 | Dyspepsia | FAERS: 9 | OFFSIDES US FAERS | |
| 230 | Euphoric mood | FAERS: 9 | US FAERS | |
| 231 | Hormone level abnormal | FAERS: 9 | OFFSIDES US FAERS | |
| 232 | Intentional product use issue | FAERS: 9 | US FAERS | |
| 233 | Intermittent Claudication | FAERS: 9 | US FAERS | |
| 234 | Joint injury | FAERS: 9 | US FAERS | |
| 235 | Lip swelling | FAERS: 9 | SIDER US FAERS | |
| 236 | Medication residue present | FAERS: 9 | US FAERS | |
| 237 | Pulmonary Hypertension | FAERS: 9 | US FAERS | |
| 238 | Sinusitis | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 239 | Spontaneous penile erection | FAERS: 9 | SIDER US FAERS | |
| 240 | Thrombophlebitis | FAERS: 9 | US FAERS | |
| 241 | Urine flow decreased | FAERS: 9 | SIDER US FAERS | |
| 242 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 243 | Acute Coronary Syndrome | FAERS: 8 | SIDER US FAERS | |
| 244 | Alanine Aminotransferase Increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 245 | Application site inflammation | FAERS: 8 | US FAERS | |
| 246 | Bone density decreased | FAERS: 8 | US FAERS | |
| 247 | Cataract | FAERS: 8 | US FAERS | |
| 248 | Dehydration | FAERS: 8 | OFFSIDES US FAERS | |
| 249 | Drug screen positive | FAERS: 8 | US FAERS | |
| 250 | Flatulence | FAERS: 8 | OFFSIDES US FAERS | |
| 251 | Malabsorption from application site | FAERS: 8 | US FAERS | |
| 252 | No adverse event | FAERS: 8 | US FAERS | |
| 253 | Product dose omission | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Product label issue | FAERS: 8 | US FAERS | |
| 255 | Product packaging issue | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Psoriasis | FAERS: 8 | US FAERS | |
| 257 | Therapy change | FAERS: 8 | US FAERS | |
| 258 | Urinary Incontinence | FAERS: 8 | SIDER US FAERS | |
| 259 | Acute respiratory failure | FAERS: 7 | US FAERS | |
| 260 | Aphasia | FAERS: 7 | US FAERS | |
| 261 | Application site erosion | FAERS: 7 | US FAERS | |
| 262 | Carpal Tunnel Syndrome | FAERS: 7 | US FAERS | |
| 263 | Deformity | FAERS: 7 | US FAERS | |
| 264 | Hernia | FAERS: 7 | US FAERS | |
| 265 | Hostility | FAERS: 7 | SIDER US FAERS | |
| 266 | Hypogonadism | FAERS: 7 | CTD SIDER US FAERS | |
| 267 | Hypotension | FAERS: 7 | US FAERS | |
| 268 | Infection | FAERS: 7 | SIDER US FAERS | |
| 269 | Low density lipoprotein increased | FAERS: 7 | US FAERS | |
| 270 | Lymphadenopathy | FAERS: 7 | US FAERS | |
| 271 | Menorrhagia | FAERS: 7 | US FAERS | |
| 272 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 273 | Osteoporosis | FAERS: 7 | SIDER US FAERS | |
| 274 | Peripheral artery thrombosis | FAERS: 7 | US FAERS | |
| 275 | Peripheral embolism | FAERS: 7 | US FAERS | |
| 276 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 277 | Presyncope | FAERS: 7 | US FAERS | |
| 278 | Product administration error | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Product dispensing error | FAERS: 7 | US FAERS | |
| 280 | Product tampering | FAERS: 7 | US FAERS | |
| 281 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 282 | Sperm concentration zero | FAERS: 7 | US FAERS | |
| 283 | Therapeutic response changed | FAERS: 7 | US FAERS | |
| 284 | Throat irritation | FAERS: 7 | US FAERS | |
| 285 | Urinary Retention | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 286 | Vertigo | FAERS: 7 | SIDER US FAERS | |
| 287 | Wrong drug administered | FAERS: 7 | US FAERS | |
| 288 | furuncle | FAERS: 7 | US FAERS | |
| 289 | Administration site rash | FAERS: 6 | US FAERS | |
| 290 | Application site acne | FAERS: 6 | US FAERS | |
| 291 | Arterial thrombosis | FAERS: 6 | US FAERS | |
| 292 | Blindness | FAERS: 6 | US FAERS | |
| 293 | Blood follicle stimulating hormone decreased | FAERS: 6 | US FAERS | |
| 294 | Bone pain | FAERS: 6 | OFFSIDES US FAERS | |
| 295 | Breast discomfort | FAERS: 6 | US FAERS | |
| 296 | Breath alcohol test positive | FAERS: 6 | US FAERS | |
| 297 | Cardiac ventricular thrombosis | FAERS: 6 | US FAERS | |
| 298 | Carotid artery occlusion | FAERS: 6 | US FAERS | |
| 299 | Cold sweat | FAERS: 6 | OFFSIDES US FAERS | |
| 300 | Device leakage | FAERS: 6 | US FAERS | |
| 301 | Disturbance in sexual arousal | FAERS: 6 | SIDER US FAERS | |
| 302 | Drug level increased | FAERS: 6 | US FAERS | |
| 303 | Exposure via father | FAERS: 6 | US FAERS | |
| 304 | Extra dose administered | FAERS: 6 | US FAERS | |
| 305 | Hemiplegia | FAERS: 6 | US FAERS | |
| 306 | Impatience | FAERS: 6 | SIDER US FAERS | |
| 307 | Intentional drug misuse | FAERS: 6 | US FAERS | |
| 308 | Invasive Ductal Breast Carcinoma | FAERS: 6 | US FAERS | |
| 309 | Lack of application site rotation | FAERS: 6 | US FAERS | |
| 310 | Limb discomfort | FAERS: 6 | US FAERS | |
| 311 | Lymphoma | FAERS: 6 | US FAERS | |
| 312 | Multiple use of single-use product | FAERS: 6 | US FAERS | |
| 313 | Musculoskeletal discomfort | FAERS: 6 | SIDER US FAERS | |
| 314 | Pain of skin | FAERS: 6 | US FAERS | |
| 315 | Pathological fracture | FAERS: 6 | US FAERS | |
| 316 | Penile size reduced | FAERS: 6 | US FAERS | |
| 317 | Peripheral venous disease | FAERS: 6 | US FAERS | |
| 318 | Product contamination | FAERS: 6 | US FAERS | |
| 319 | Product formulation issue | FAERS: 6 | US FAERS | |
| 320 | Rheumatoid Arthritis | FAERS: 6 | US FAERS | |
| 321 | Sepsis | FAERS: 6 | US FAERS | |
| 322 | Urinary tract infection | FAERS: 6 | SIDER US FAERS | |
| 323 | Venous Thrombosis | FAERS: 6 | US FAERS | |
| 324 | Wheezing | FAERS: 6 | US FAERS | |
| 325 | Adenocarcinoma | FAERS: 5 | CTD OFFSIDES US FAERS | |
| 326 | Androgenetic Alopecia | FAERS: 5 | SIDER US FAERS | |
| 327 | Application site hypersensitivity | FAERS: 5 | US FAERS | |
| 328 | Blood creatinine increased | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 329 | Cerebral Thrombosis | FAERS: 5 | US FAERS | |
| 330 | Cerebral artery occlusion | FAERS: 5 | US FAERS | |
| 331 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 332 | Chromaturia | FAERS: 5 | US FAERS | |
| 333 | Completed Suicide | FAERS: 5 | OFFSIDES US FAERS | |
| 334 | Device difficult to use | FAERS: 5 | US FAERS | |
| 335 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 336 | Drug level below therapeutic | FAERS: 5 | US FAERS | |
| 337 | Exposure via skin contact | FAERS: 5 | US FAERS | |
| 338 | Feeling Cold | FAERS: 5 | US FAERS | |
| 339 | General symptom | FAERS: 5 | US FAERS | |
| 340 | Genital erythema | FAERS: 5 | US FAERS | |
| 341 | Hypersomnia | FAERS: 5 | US FAERS | |
| 342 | Inappropriate schedule of product administration | FAERS: 5 | US FAERS | |
| 343 | Laceration | FAERS: 5 | US FAERS | |
| 344 | Limb injury | FAERS: 5 | US FAERS | |
| 345 | Malabsorption | FAERS: 5 | US FAERS | |
| 346 | Musculoskeletal chest pain | FAERS: 5 | SIDER US FAERS | |
| 347 | Nerve injury | FAERS: 5 | US FAERS | |
| 348 | Paranoia | FAERS: 5 | US FAERS | |
| 349 | Pericarditis | FAERS: 5 | US FAERS | |
| 350 | Polyuria | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 351 | Priapism | FAERS: 5 | SIDER US FAERS | |
| 352 | Product container issue | FAERS: 5 | US FAERS | |
| 353 | Product gel formation | FAERS: 5 | US FAERS | |
| 354 | Product label confusion | FAERS: 5 | US FAERS | |
| 355 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 356 | Therapy cessation | FAERS: 5 | US FAERS | |
| 357 | Thrombocytopenia | FAERS: 5 | SIDER US FAERS | |
| 358 | Venous thrombosis limb | FAERS: 5 | US FAERS | |
| 359 | Wheelchair user | FAERS: 5 | US FAERS | |
| 360 | Abnormal weight gain | FAERS: 4 | US FAERS | |
| 361 | Abulia | FAERS: 4 | US FAERS | |
| 362 | Akathisia | FAERS: 4 | US FAERS | |
| 363 | Angiofibroma | FAERS: 4 | US FAERS | |
| 364 | Anorgasmia | FAERS: 4 | OFFSIDES US FAERS | |
| 365 | Aspartate Aminotransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 366 | Atrial Flutter | FAERS: 4 | OFFSIDES US FAERS | |
| 367 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 368 | Cardiac Death | FAERS: 4 | US FAERS | |
| 369 | Cerebral disorder | FAERS: 4 | US FAERS | |
| 370 | Cyst | FAERS: 4 | SIDER US FAERS | |
| 371 | Deafness | FAERS: 4 | US FAERS | |
| 372 | Device use error | FAERS: 4 | US FAERS | |
| 373 | Drug level fluctuating | FAERS: 4 | US FAERS | |
| 374 | Essential Hypertension | FAERS: 4 | US FAERS | |
| 375 | Facial paralysis | FAERS: 4 | US FAERS | |
| 376 | Folliculitis | FAERS: 4 | SIDER US FAERS | |
| 377 | Frustration | FAERS: 4 | US FAERS | |
| 378 | Gender Dysphoria | FAERS: 4 | US FAERS | |
| 379 | General physical condition abnormal | FAERS: 4 | US FAERS | |
| 380 | Genital pain | FAERS: 4 | US FAERS | |
| 381 | Gout | FAERS: 4 | US FAERS | |
| 382 | Hidradenitis | FAERS: 4 | US FAERS | |
| 383 | Hypertensive heart disease | FAERS: 4 | US FAERS | |
| 384 | Hypoxia | FAERS: 4 | US FAERS | |
| 385 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 386 | Inflammation | FAERS: 4 | 27866977 30387366 | CTD SIDER US FAERS |
| 387 | Injection site erythema | FAERS: 4 | SIDER US FAERS | |
| 388 | Laziness | FAERS: 4 | US FAERS | |
| 389 | Ligament rupture | FAERS: 4 | US FAERS | |
| 390 | Muscle hypertrophy | FAERS: 4 | US FAERS | |
| 391 | Obesity | FAERS: 4 | US FAERS | |
| 392 | Pancreatitis | FAERS: 4 | OFFSIDES US FAERS | |
| 393 | Peripheral arterial occlusive disease | FAERS: 4 | US FAERS | |
| 394 | Pleurisy | FAERS: 4 | US FAERS | |
| 395 | Product contamination physical | FAERS: 4 | US FAERS | |
| 396 | Product size issue | FAERS: 4 | US FAERS | |
| 397 | Renal pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 398 | Retching | FAERS: 4 | US FAERS | |
| 399 | Semen volume decreased | FAERS: 4 | US FAERS | |
| 400 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 401 | Suicide attempt | FAERS: 4 | US FAERS | |
| 402 | Testis discomfort | FAERS: 4 | US FAERS | |
| 403 | Thalamic infarction | FAERS: 4 | US FAERS | |
| 404 | Therapy responder | FAERS: 4 | US FAERS | |
| 405 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 406 | Vascular occlusion | FAERS: 4 | US FAERS | |
| 407 | Wrong patient received medication | FAERS: 4 | US FAERS | |
| 408 | Abasia | FAERS: 3 | OFFSIDES US FAERS | |
| 409 | Abscess | FAERS: 3 | US FAERS | |
| 410 | Ageusia | FAERS: 3 | US FAERS | |
| 411 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 412 | Aneurysm | FAERS: 3 | US FAERS | |
| 413 | Angioedema | FAERS: 3 | SIDER US FAERS | |
| 414 | Application site discharge | FAERS: 3 | US FAERS | |
| 415 | Application site fissure | FAERS: 3 | US FAERS | |
| 416 | Application site scab | FAERS: 3 | US FAERS | |
| 417 | Asthenopia | FAERS: 3 | US FAERS | |
| 418 | Ataxia | FAERS: 3 | US FAERS | |
| 419 | Aversion | FAERS: 3 | US FAERS | |
| 420 | Back disorder | FAERS: 3 | US FAERS | |
| 421 | Basal ganglia stroke | FAERS: 3 | US FAERS | |
| 422 | Benign Neoplasm | FAERS: 3 | US FAERS | |
| 423 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 424 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 425 | Blood glucose abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 426 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 427 | Blood potassium increased | FAERS: 3 | OFFSIDES US FAERS | |
| 428 | Bradycardia | FAERS: 3 | US FAERS | |
| 429 | Bradyphrenia | FAERS: 3 | US FAERS | |
| 430 | Cataract operation | FAERS: 3 | US FAERS | |
| 431 | Claustrophobia | FAERS: 3 | US FAERS | |
| 432 | Colitis | FAERS: 3 | US FAERS | |
| 433 | Contraindicated product administered | FAERS: 3 | US FAERS | |
| 434 | Coronary bypass thrombosis | FAERS: 3 | US FAERS | |
| 435 | Delayed Puberty | FAERS: 3 | US FAERS | |
| 436 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 437 | Device adhesion issue | FAERS: 3 | US FAERS | |
| 438 | Device defective | FAERS: 3 | US FAERS | |
| 439 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 440 | Drug ineffective for unapproved indication | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | Drug level decreased | FAERS: 3 | US FAERS | |
| 442 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 443 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 444 | Eye pain | FAERS: 3 | US FAERS | |
| 445 | Factor V Leiden mutation | FAERS: 3 | US FAERS | |
| 446 | Genital rash | FAERS: 3 | US FAERS | |
| 447 | Hyperandrogenism | FAERS: 3 | 17019078 | CTD US FAERS |
| 448 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 449 | Hypophagia | FAERS: 3 | US FAERS | |
| 450 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 451 | Implantable defibrillator insertion | FAERS: 3 | US FAERS | |
| 452 | Incoherent | FAERS: 3 | US FAERS | |
| 453 | Injection Site Reaction | FAERS: 3 | SIDER US FAERS | |
| 454 | Injection site irritation | FAERS: 3 | SIDER US FAERS | |
| 455 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 456 | Joint stiffness | FAERS: 3 | OFFSIDES US FAERS | |
| 457 | Laryngitis | FAERS: 3 | US FAERS | |
| 458 | Lipoma | FAERS: 3 | US FAERS | |
| 459 | Meniscus injury | FAERS: 3 | US FAERS | |
| 460 | Menopause | FAERS: 3 | US FAERS | |
| 461 | Oropharyngeal swelling | FAERS: 3 | US FAERS | |
| 462 | Pelvic Pain | FAERS: 3 | SIDER US FAERS | |
| 463 | Peripheral artery occlusion | FAERS: 3 | US FAERS | |
| 464 | Phlebitis | FAERS: 3 | US FAERS | |
| 465 | Post-Traumatic Stress Disorder | FAERS: 3 | US FAERS | |
| 466 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 467 | Product use complaint | FAERS: 3 | US FAERS | |
| 468 | Prostatic pain | FAERS: 3 | US FAERS | |
| 469 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 470 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 471 | Restlessness | FAERS: 3 | US FAERS | |
| 472 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 473 | Retinal vascular occlusion | FAERS: 3 | US FAERS | |
| 474 | Screaming | FAERS: 3 | US FAERS | |
| 475 | Sex hormone binding globulin increased | FAERS: 3 | US FAERS | |
| 476 | Silent myocardial infarction | FAERS: 3 | US FAERS | |
| 477 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 478 | Skin hypertrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 479 | Snoring | FAERS: 3 | SIDER US FAERS | |
| 480 | Spinal fusion surgery | FAERS: 3 | US FAERS | |
| 481 | Sudden death | FAERS: 3 | US FAERS | |
| 482 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 483 | Thermal burn | FAERS: 3 | SIDER US FAERS | |
| 484 | Tonsillectomy | FAERS: 3 | US FAERS | |
| 485 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 486 | Vulvovaginal burning sensation | FAERS: 3 | SIDER US FAERS | |
| 487 | skin abrasion | FAERS: 3 | US FAERS | |
| 488 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 489 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 490 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 491 | Amblyopia | FAERS: 2 | US FAERS | |
| 492 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 493 | Anorexia | FAERS: 2 | US FAERS | |
| 494 | Aortic Valve Stenosis | FAERS: 2 | US FAERS | |
| 495 | Aphonia | FAERS: 2 | US FAERS | |
| 496 | Application site nodule | FAERS: 2 | US FAERS | |
| 497 | Application site papules | FAERS: 2 | US FAERS | |
| 498 | Application site scar | FAERS: 2 | US FAERS | |
| 499 | Arthropod bite | FAERS: 2 | US FAERS | |
| 500 | Atrial thrombosis | FAERS: 2 | US FAERS | |
| 501 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 502 | Bedridden | FAERS: 2 | US FAERS | |
| 503 | Binge Drinking | FAERS: 2 | US FAERS | |
| 504 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 505 | Blood androstenedione increased | FAERS: 2 | US FAERS | |
| 506 | Blood iron increased | FAERS: 2 | US FAERS | |
| 507 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 508 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 509 | Body mass index | FAERS: 2 | US FAERS | |
| 510 | Carbohydrate antigen 19-9 increased | FAERS: 2 | US FAERS | |
| 511 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 512 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 513 | Carotid Artery Thrombosis | FAERS: 2 | US FAERS | |
| 514 | Cerebellar stroke | FAERS: 2 | US FAERS | |
| 515 | Chemical burn of skin | FAERS: 2 | US FAERS | |
| 516 | Circumstance or information capable of leading to device use error | FAERS: 2 | US FAERS | |
| 517 | Cluster Headache | FAERS: 2 | US FAERS | |
| 518 | Compulsive sexual behaviour | FAERS: 2 | US FAERS | |
| 519 | Compulsive shopping | FAERS: 2 | US FAERS | |
| 520 | Confabulation | FAERS: 2 | US FAERS | |
| 521 | Coronary angioplasty | FAERS: 2 | US FAERS | |
| 522 | Device breakage | FAERS: 2 | US FAERS | |
| 523 | Device ineffective | FAERS: 2 | US FAERS | |
| 524 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 525 | Diplopia | FAERS: 2 | SIDER US FAERS | |
| 526 | Disease Progression | FAERS: 2 | US FAERS | |
| 527 | Disease recurrence | FAERS: 2 | US FAERS | |
| 528 | Drug abuser | FAERS: 2 | US FAERS | |
| 529 | Drug administered in wrong device | FAERS: 2 | US FAERS | |
| 530 | Dysphemia | FAERS: 2 | OFFSIDES US FAERS | |
| 531 | Ear discomfort | FAERS: 2 | US FAERS | |
| 532 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 533 | Embolic cerebral infarction | FAERS: 2 | US FAERS | |
| 534 | Eosinophilic myocarditis | FAERS: 2 | US FAERS | |
| 535 | Excoriation | FAERS: 2 | US FAERS | |
| 536 | Exfoliative rash | FAERS: 2 | OFFSIDES US FAERS | |
| 537 | Eye Infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 538 | Eyelid pain | FAERS: 2 | US FAERS | |
| 539 | Feelings of worthlessness | FAERS: 2 | US FAERS | |
| 540 | Femoral artery occlusion | FAERS: 2 | US FAERS | |
| 541 | Fluid overload | FAERS: 2 | US FAERS | |
| 542 | Free prostate-specific antigen increased | FAERS: 2 | SIDER US FAERS | |
| 543 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 544 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 545 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 546 | Growth retardation | FAERS: 2 | US FAERS | |
| 547 | Head discomfort | FAERS: 2 | US FAERS | |
| 548 | Heparin-induced thrombocytopenia | FAERS: 2 | US FAERS | |
| 549 | Hepatic cancer metastatic | FAERS: 2 | US FAERS | |
| 550 | Hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 551 | Homicide | FAERS: 2 | US FAERS | |
| 552 | Homosexuality | FAERS: 2 | US FAERS | |
| 553 | Hyperacusis | FAERS: 2 | US FAERS | |
| 554 | Hyperkeratosis | FAERS: 2 | OFFSIDES US FAERS | |
| 555 | Hypertrophic Cardiomyopathy | FAERS: 2 | US FAERS | |
| 556 | Hypomania | FAERS: 2 | US FAERS | |
| 557 | Impaired self-care | FAERS: 2 | US FAERS | |
| 558 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 559 | Incontinence | FAERS: 2 | SIDER US FAERS | |
| 560 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 561 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 562 | Initial insomnia | FAERS: 2 | US FAERS | |
| 563 | Injection site inflammation | FAERS: 2 | SIDER US FAERS | |
| 564 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 565 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 566 | Joint Range of Motion Decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 567 | Klebsiella sepsis | FAERS: 2 | US FAERS | |
| 568 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 569 | Leukocytosis | FAERS: 2 | US FAERS | |
| 570 | Life expectancy shortened | FAERS: 2 | US FAERS | |
| 571 | Limb operation | FAERS: 2 | US FAERS | |
| 572 | Local reaction | FAERS: 2 | US FAERS | |
| 573 | Localised intraabdominal fluid collection | FAERS: 2 | US FAERS | |
| 574 | Loss of personal independence in daily activities | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Male sexual dysfunction | FAERS: 2 | US FAERS | |
| 576 | Medical device implantation | FAERS: 2 | US FAERS | |
| 577 | Medical observation | FAERS: 2 | US FAERS | |
| 578 | Metabolic acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 579 | Metaplasia | FAERS: 2 | US FAERS | |
| 580 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 581 | Mydriasis | FAERS: 2 | US FAERS | |
| 582 | Myocardial fibrosis | FAERS: 2 | US FAERS | |
| 583 | Nipple inflammation | FAERS: 2 | US FAERS | |
| 584 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 585 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 586 | Ocular icterus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 587 | Open wound | FAERS: 2 | US FAERS | |
| 588 | Osteopenia | FAERS: 2 | SIDER US FAERS | |
| 589 | Pallor | FAERS: 2 | US FAERS | |
| 590 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 591 | Papule | FAERS: 2 | US FAERS | |
| 592 | Paraplegia | FAERS: 2 | US FAERS | |
| 593 | Peliosis Hepatis | FAERS: 2 | SIDER US FAERS | |
| 594 | Penile swelling | FAERS: 2 | OFFSIDES US FAERS | |
| 595 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 596 | Pharyngitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 597 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 598 | Post procedural complication | FAERS: 2 | US FAERS | |
| 599 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 600 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 601 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 602 | Product availability issue | FAERS: 2 | US FAERS | |
| 603 | Product container seal issue | FAERS: 2 | US FAERS | |
| 604 | Product dosage form issue | FAERS: 2 | US FAERS | |
| 605 | Product leakage | FAERS: 2 | US FAERS | |
| 606 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 607 | Productive Cough | FAERS: 2 | US FAERS | |
| 608 | Prostatectomy | FAERS: 2 | US FAERS | |
| 609 | Pulmonary oil microembolism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 610 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 611 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 612 | Rhinalgia | FAERS: 2 | US FAERS | |
| 613 | Scab | FAERS: 2 | US FAERS | |
| 614 | Schizophrenia | FAERS: 2 | US FAERS | |
| 615 | Shoulder Pain | FAERS: 2 | US FAERS | |
| 616 | Shoulder deformity | FAERS: 2 | US FAERS | |
| 617 | Sinus headache | FAERS: 2 | US FAERS | |
| 618 | Skeletal injury | FAERS: 2 | US FAERS | |
| 619 | Skin laceration | FAERS: 2 | US FAERS | |
| 620 | Skin lesion | FAERS: 2 | US FAERS | |
| 621 | Skin tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 622 | Sneezing | FAERS: 2 | US FAERS | |
| 623 | Spinal artery thrombosis | FAERS: 2 | US FAERS | |
| 624 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 625 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 626 | Strabismus | FAERS: 2 | US FAERS | |
| 627 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 628 | Sweat gland infection | FAERS: 2 | US FAERS | |
| 629 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 630 | Tinea cruris | FAERS: 2 | OFFSIDES US FAERS | |
| 631 | Toothache | FAERS: 2 | SIDER US FAERS | |
| 632 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 633 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 634 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 635 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 636 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 637 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 638 | Waist circumference increased | FAERS: 2 | US FAERS | |
| 639 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 640 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 641 | jaundice | FAERS: 2 | SIDER US FAERS | |
| 642 | Abnormal organ growth | FAERS: 1 | US FAERS | |
| 643 | Accidental underdose | FAERS: 1 | US FAERS | |
| 644 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 645 | Actinic keratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 646 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 647 | Administration site hypertrichosis | FAERS: 1 | US FAERS | |
| 648 | Administration site irritation | FAERS: 1 | US FAERS | |
| 649 | Administration site reaction | FAERS: 1 | SIDER US FAERS | |
| 650 | Administration site scar | FAERS: 1 | US FAERS | |
| 651 | Albuminuria | FAERS: 1 | US FAERS | |
| 652 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 653 | Alkalosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 654 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 655 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 656 | Anosmia | FAERS: 1 | US FAERS | |
| 657 | Anosognosia | FAERS: 1 | US FAERS | |
| 658 | Antiandrogen therapy | FAERS: 1 | US FAERS | |
| 659 | Anuria | FAERS: 1 | US FAERS | |
| 660 | Application site abscess | FAERS: 1 | US FAERS | |
| 661 | Application site alopecia | FAERS: 1 | US FAERS | |
| 662 | Application site atrophy | FAERS: 1 | US FAERS | |
| 663 | Application site cellulitis | FAERS: 1 | US FAERS | |
| 664 | Application site excoriation | FAERS: 1 | US FAERS | |
| 665 | Application site folliculitis | FAERS: 1 | US FAERS | |
| 666 | Application site induration | FAERS: 1 | SIDER US FAERS | |
| 667 | Application site infection | FAERS: 1 | US FAERS | |
| 668 | Application site injury | FAERS: 1 | US FAERS | |
| 669 | Application site mass | FAERS: 1 | US FAERS | |
| 670 | Application site necrosis | FAERS: 1 | US FAERS | |
| 671 | Application site perspiration | FAERS: 1 | US FAERS | |
| 672 | Application site ulcer | FAERS: 1 | US FAERS | |
| 673 | Ascites | FAERS: 1 | US FAERS | |
| 674 | Atherectomy | FAERS: 1 | US FAERS | |
| 675 | Atrial natriuretic peptide decreased | FAERS: 1 | US FAERS | |
| 676 | Atrial tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 677 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 678 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 679 | Bed rest | FAERS: 1 | US FAERS | |
| 680 | Belligerence | FAERS: 1 | US FAERS | |
| 681 | Benign neoplasm of skin | FAERS: 1 | US FAERS | |
| 682 | Benign neoplasm of testis | FAERS: 1 | US FAERS | |
| 683 | Biliary dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 684 | Biopsy prostate abnormal | FAERS: 1 | US FAERS | |
| 685 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 686 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 687 | Blood aldosterone increased | FAERS: 1 | US FAERS | |
| 688 | Blood arsenic increased | FAERS: 1 | US FAERS | |
| 689 | Blood cortisol abnormal | FAERS: 1 | US FAERS | |
| 690 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 691 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 692 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 693 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 694 | Blood heavy metal increased | FAERS: 1 | US FAERS | |
| 695 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 696 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 697 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 698 | Blood mercury abnormal | FAERS: 1 | US FAERS | |
| 699 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 700 | Blood testosterone normal | FAERS: 1 | US FAERS | |
| 701 | Blood urea increased | FAERS: 1 | US FAERS | |
| 702 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 703 | Brain Death | FAERS: 1 | US FAERS | |
| 704 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 705 | Bronchospasm | FAERS: 1 | US FAERS | |
| 706 | Bruxism | FAERS: 1 | US FAERS | |
| 707 | Bursitis | FAERS: 1 | US FAERS | |
| 708 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 709 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 710 | Cardiovascular event prophylaxis | FAERS: 1 | US FAERS | |
| 711 | Cartilage injury | FAERS: 1 | US FAERS | |
| 712 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 713 | Chemical burns of eye | FAERS: 1 | US FAERS | |
| 714 | Childhood disintegrative disorder | FAERS: 1 | US FAERS | |
| 715 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 716 | Cholestasis | FAERS: 1 | US FAERS | |
| 717 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 718 | Clumsiness | FAERS: 1 | US FAERS | |
| 719 | Coagulation factor VIII level increased | FAERS: 1 | US FAERS | |
| 720 | Coagulation factor XI level increased | FAERS: 1 | US FAERS | |
| 721 | Cognitive linguistic deficit | FAERS: 1 | US FAERS | |
| 722 | Colectomy | FAERS: 1 | US FAERS | |
| 723 | Congenital hypercoagulation | FAERS: 1 | US FAERS | |
| 724 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 725 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 726 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 727 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 728 | Creatine urine increased | FAERS: 1 | US FAERS | |
| 729 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 730 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 731 | Cystitis | FAERS: 1 | US FAERS | |
| 732 | Dehydroepiandrosterone increased | FAERS: 1 | US FAERS | |
| 733 | Delirium | FAERS: 1 | US FAERS | |
| 734 | Dermatitis acneiform | FAERS: 1 | SIDER US FAERS | |
| 735 | Device Failure | FAERS: 1 | US FAERS | |
| 736 | Device physical property issue | FAERS: 1 | US FAERS | |
| 737 | Device related infection | FAERS: 1 | US FAERS | |
| 738 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 739 | Dissociation | FAERS: 1 | SIDER US FAERS | |
| 740 | Diverticulum | FAERS: 1 | US FAERS | |
| 741 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 742 | Drug effect variable | FAERS: 1 | US FAERS | |
| 743 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 744 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 745 | Drug level changed | FAERS: 1 | US FAERS | |
| 746 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 747 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 748 | Dysgraphia | FAERS: 1 | US FAERS | |
| 749 | Dyslexia | FAERS: 1 | US FAERS | |
| 750 | Dysmorphism | FAERS: 1 | US FAERS | |
| 751 | Dysplasia | FAERS: 1 | US FAERS | |
| 752 | Ear congestion | FAERS: 1 | US FAERS | |
| 753 | Early menarche | FAERS: 1 | US FAERS | |
| 754 | Educational problem | FAERS: 1 | US FAERS | |
| 755 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 756 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 757 | Elevated mood | FAERS: 1 | US FAERS | |
| 758 | Emergency Care | FAERS: 1 | US FAERS | |
| 759 | Emotional poverty | FAERS: 1 | US FAERS | |
| 760 | Encephalitis | FAERS: 1 | US FAERS | |
| 761 | Eosinophilia | FAERS: 1 | US FAERS | |
| 762 | Epicondylitis | FAERS: 1 | US FAERS | |
| 763 | Epilepsy | FAERS: 1 | US FAERS | |
| 764 | Eructation | FAERS: 1 | US FAERS | |
| 765 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 766 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 767 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 768 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 769 | Facial Paresis | FAERS: 1 | US FAERS | |
| 770 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 771 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 772 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 773 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 774 | Flank Pain | FAERS: 1 | US FAERS | |
| 775 | Formication | FAERS: 1 | US FAERS | |
| 776 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 777 | Full blood count increased | FAERS: 1 | US FAERS | |
| 778 | Gangrene | FAERS: 1 | US FAERS | |
| 779 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 780 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 781 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 782 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 783 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 784 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 785 | Genital cyst | FAERS: 1 | US FAERS | |
| 786 | Genital discomfort | FAERS: 1 | US FAERS | |
| 787 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 788 | Genital tract inflammation | FAERS: 1 | US FAERS | |
| 789 | Genitals enlarged | FAERS: 1 | US FAERS | |
| 790 | Gingival Atrophy | FAERS: 1 | US FAERS | |
| 791 | Glaucoma | FAERS: 1 | US FAERS | |
| 792 | Glioblastoma | FAERS: 1 | 17162496 | CTD US FAERS |
| 793 | Graft thrombosis | FAERS: 1 | US FAERS | |
| 794 | Grief reaction | FAERS: 1 | US FAERS | |
| 795 | HER-2 positive breast cancer | FAERS: 1 | US FAERS | |
| 796 | Hair growth rate abnormal | FAERS: 1 | US FAERS | |
| 797 | Heat Stroke | FAERS: 1 | US FAERS | |
| 798 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 799 | Hepatic vascular thrombosis | FAERS: 1 | US FAERS | |
| 800 | Hepatobiliary cancer | FAERS: 1 | US FAERS | |
| 801 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 802 | Hernia perforation | FAERS: 1 | US FAERS | |
| 803 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 804 | Hip surgery | FAERS: 1 | US FAERS | |
| 805 | Histoplasmosis | FAERS: 1 | US FAERS | |
| 806 | Hyperphagia | FAERS: 1 | US FAERS | |
| 807 | Hyperventilation | FAERS: 1 | SIDER US FAERS | |
| 808 | Hypervigilance | FAERS: 1 | US FAERS | |
| 809 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 810 | Hypopituitarism | FAERS: 1 | 15764279 17426086 | CTD US FAERS |
| 811 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 812 | Hysterectomy | FAERS: 1 | US FAERS | |
| 813 | Immobile | FAERS: 1 | US FAERS | |
| 814 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 815 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 816 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 817 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 818 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 819 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 820 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 821 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 822 | Infected dermal cyst | FAERS: 1 | US FAERS | |
| 823 | Injection site abscess | FAERS: 1 | SIDER US FAERS | |
| 824 | Injection site discomfort | FAERS: 1 | SIDER US FAERS | |
| 825 | Injection site infection | FAERS: 1 | US FAERS | |
| 826 | Injection site nodule | FAERS: 1 | US FAERS | |
| 827 | Injection site warmth | FAERS: 1 | US FAERS | |
| 828 | Inspiratory capacity abnormal | FAERS: 1 | US FAERS | |
| 829 | Instillation site complication | FAERS: 1 | US FAERS | |
| 830 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 831 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 832 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 833 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 834 | Intermittent Explosive Disorder | FAERS: 1 | US FAERS | |
| 835 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 836 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 837 | Intestinal resection | FAERS: 1 | US FAERS | |
| 838 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 839 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 840 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 841 | Lack of administration site rotation | FAERS: 1 | US FAERS | |
| 842 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 843 | Laryngectomy | FAERS: 1 | US FAERS | |
| 844 | Laryngospasm | FAERS: 1 | US FAERS | |
| 845 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 846 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 847 | Lip Infection | FAERS: 1 | US FAERS | |
| 848 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 849 | Lung cyst | FAERS: 1 | US FAERS | |
| 850 | Lyme Disease | FAERS: 1 | US FAERS | |
| 851 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 852 | Macrocytosis | FAERS: 1 | US FAERS | |
| 853 | Macule | FAERS: 1 | US FAERS | |
| 854 | Male Orgasmic Disorder | FAERS: 1 | SIDER US FAERS | |
| 855 | Male genital examination abnormal | FAERS: 1 | US FAERS | |
| 856 | Malignant neoplasm progression | FAERS: 1 | OFFSIDES US FAERS | |
| 857 | Mastectomy | FAERS: 1 | US FAERS | |
| 858 | Mastitis | FAERS: 1 | US FAERS | |
| 859 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 860 | Medical diet | FAERS: 1 | US FAERS | |
| 861 | Medication residue | FAERS: 1 | US FAERS | |
| 862 | Meningitis | FAERS: 1 | US FAERS | |
| 863 | Meniscal degeneration | FAERS: 1 | US FAERS | |
| 864 | Mesenteric vascular insufficiency | FAERS: 1 | US FAERS | |
| 865 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 866 | Miliaria | FAERS: 1 | US FAERS | |
| 867 | Monoplegia | FAERS: 1 | US FAERS | |
| 868 | Multiple Sclerosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 869 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 870 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 871 | Muscle strain | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 872 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 873 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 874 | Myocardial strain | FAERS: 1 | US FAERS | |
| 875 | Myofascial spasm | FAERS: 1 | US FAERS | |
| 876 | Myosclerosis | FAERS: 1 | US FAERS | |
| 877 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 878 | Negative thoughts | FAERS: 1 | US FAERS | |
| 879 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 880 | Neuralgia | FAERS: 1 | 17720801 | CTD US FAERS |
| 881 | Neurogenic Bowel | FAERS: 1 | US FAERS | |
| 882 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 883 | Nodule | FAERS: 1 | US FAERS | |
| 884 | Non-economic loss | FAERS: 1 | US FAERS | |
| 885 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 886 | Norepinephrine increased | FAERS: 1 | US FAERS | |
| 887 | Obesity surgery | FAERS: 1 | US FAERS | |
| 888 | Occupational physical problem | FAERS: 1 | US FAERS | |
| 889 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 890 | Oliguria | FAERS: 1 | US FAERS | |
| 891 | Onychomycosis | FAERS: 1 | US FAERS | |
| 892 | Ophthalmic vein thrombosis | FAERS: 1 | US FAERS | |
| 893 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 894 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 895 | Orgasmic sensation decreased | FAERS: 1 | US FAERS | |
| 896 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 897 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 898 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 899 | Overconfidence | FAERS: 1 | US FAERS | |
| 900 | Overweight | FAERS: 1 | US FAERS | |
| 901 | Packaging design issue | FAERS: 1 | US FAERS | |
| 902 | Painful ejaculation | FAERS: 1 | US FAERS | |
| 903 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 904 | Panic Disorder | FAERS: 1 | US FAERS | |
| 905 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 906 | Penis carcinoma | FAERS: 1 | US FAERS | |
| 907 | Perineal pain | FAERS: 1 | US FAERS | |
| 908 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 909 | Phlebitis deep | FAERS: 1 | US FAERS | |
| 910 | Photophobia | FAERS: 1 | US FAERS | |
| 911 | Physical abuse | FAERS: 1 | US FAERS | |
| 912 | Physical product label issue | FAERS: 1 | US FAERS | |
| 913 | Pneumonitis | FAERS: 1 | US FAERS | |
| 914 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 915 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 916 | Porokeratosis | FAERS: 1 | US FAERS | |
| 917 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 918 | Premature Menopause | FAERS: 1 | US FAERS | |
| 919 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 920 | Primary hypogonadism | FAERS: 1 | US FAERS | |
| 921 | Procedural complication | FAERS: 1 | US FAERS | |
| 922 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 923 | Product counterfeit | FAERS: 1 | US FAERS | |
| 924 | Product impurity | FAERS: 1 | US FAERS | |
| 925 | Product intolerance | FAERS: 1 | US FAERS | |
| 926 | Product lot number issue | FAERS: 1 | US FAERS | |
| 927 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 928 | Product packaging difficult to open | FAERS: 1 | US FAERS | |
| 929 | Product preparation error | FAERS: 1 | US FAERS | |
| 930 | Product residue present | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 931 | Promotion of wound healing | FAERS: 1 | US FAERS | |
| 932 | Prostatic specific antigen decreased | FAERS: 1 | US FAERS | |
| 933 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 934 | Proteinuria | FAERS: 1 | US FAERS | |
| 935 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 936 | Pseudostroke | FAERS: 1 | US FAERS | |
| 937 | Puberty | FAERS: 1 | US FAERS | |
| 938 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 939 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 940 | Pump reservoir issue | FAERS: 1 | US FAERS | |
| 941 | Purpura | FAERS: 1 | US FAERS | |
| 942 | Purulence | FAERS: 1 | US FAERS | |
| 943 | Radiation injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 944 | Reperfusion arrhythmia | FAERS: 1 | US FAERS | |
| 945 | Respiratory distress | FAERS: 1 | SIDER US FAERS | |
| 946 | Rosacea | FAERS: 1 | SIDER US FAERS | |
| 947 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 948 | Saliva testosterone abnormal | FAERS: 1 | US FAERS | |
| 949 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 950 | Sciatica | FAERS: 1 | US FAERS | |
| 951 | Scleroderma | FAERS: 1 | US FAERS | |
| 952 | Scrotal cyst | FAERS: 1 | US FAERS | |
| 953 | Scrotal erythema | FAERS: 1 | US FAERS | |
| 954 | Scrotal mass | FAERS: 1 | US FAERS | |
| 955 | Secondary transmission | FAERS: 1 | US FAERS | |
| 956 | Secretion discharge | FAERS: 1 | US FAERS | |
| 957 | Septic Shock | FAERS: 1 | US FAERS | |
| 958 | Seroma | FAERS: 1 | US FAERS | |
| 959 | Sex hormone binding globulin decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 960 | Sexual abuse | FAERS: 1 | US FAERS | |
| 961 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 962 | Sinus pain | FAERS: 1 | US FAERS | |
| 963 | Skeletal muscle enzymes | FAERS: 1 | US FAERS | |
| 964 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 965 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 966 | Skin discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 967 | Skin squamous cell carcinoma metastatic | FAERS: 1 | US FAERS | |
| 968 | Sleep Talking | FAERS: 1 | US FAERS | |
| 969 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 970 | Solar lentigo | FAERS: 1 | US FAERS | |
| 971 | Soliloquy | FAERS: 1 | US FAERS | |
| 972 | Sperm concentration abnormal | FAERS: 1 | US FAERS | |
| 973 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 974 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 975 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 976 | Splenic thrombosis | FAERS: 1 | US FAERS | |
| 977 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 978 | Splenomegaly | FAERS: 1 | US FAERS | |
| 979 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 980 | Stenosis | FAERS: 1 | US FAERS | |
| 981 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 982 | Stress at work | FAERS: 1 | US FAERS | |
| 983 | Subclavian artery thrombosis | FAERS: 1 | US FAERS | |
| 984 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 985 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 986 | Supraventricular tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 987 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 988 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 989 | Suspected transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 990 | Tarsal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 991 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 992 | Terminal dribbling | FAERS: 1 | US FAERS | |
| 993 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 994 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 995 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 996 | Therapy non-responder | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 997 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 998 | Throat cancer | FAERS: 1 | US FAERS | |
| 999 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 1000 | Thrombosed varicose vein | FAERS: 1 | US FAERS | |
| 1001 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 1002 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1003 | Thymus enlargement | FAERS: 1 | US FAERS | |
| 1004 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 1005 | Tinea Capitis | FAERS: 1 | US FAERS | |
| 1006 | Tongue biting | FAERS: 1 | OFFSIDES US FAERS | |
| 1007 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1008 | Tooth Loss | FAERS: 1 | US FAERS | |
| 1009 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 1010 | Transgender hormonal therapy | FAERS: 1 | US FAERS | |
| 1011 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 1012 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 1013 | Troponin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 1014 | Tubular breast carcinoma | FAERS: 1 | US FAERS | |
| 1015 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 1016 | Ulcer | FAERS: 1 | SIDER US FAERS | |
| 1017 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 1018 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 1019 | Upper respiratory tract irritation | FAERS: 1 | US FAERS | |
| 1020 | Urea urine increased | FAERS: 1 | US FAERS | |
| 1021 | Urine electrolytes increased | FAERS: 1 | US FAERS | |
| 1022 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 1023 | Uterine cervix ulcer | FAERS: 1 | US FAERS | |
| 1024 | Varicocele | FAERS: 1 | 17683466 | CTD SIDER US FAERS |
| 1025 | Vascular purpura | FAERS: 1 | US FAERS | |
| 1026 | Vascular stent occlusion | FAERS: 1 | US FAERS | |
| 1027 | Vascular stent thrombosis | FAERS: 1 | US FAERS | |
| 1028 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1029 | Vertebral Artery Dissection | FAERS: 1 | US FAERS | |
| 1030 | Vertebral Artery Stenosis | FAERS: 1 | US FAERS | |
| 1031 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 1032 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 1033 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1034 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 1035 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 1036 | Walking aid user | FAERS: 1 | US FAERS | |
| 1037 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1038 | carbuncle | FAERS: 1 | US FAERS | |
| 1039 | hypertensive nephropathy | FAERS: 1 | US FAERS | |
| 1040 | Abdominal Cramps | SIDER | ||
| 1041 | Abdominal symptom | SIDER | ||
| 1042 | Abnormal clotting factor | SIDER | ||
| 1043 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 1044 | Anaphylactoid Reaction | SIDER | ||
| 1045 | Anticoagulation drug level below therapeutic | OFFSIDES | ||
| 1046 | Antidepressant drug level | OFFSIDES | ||
| 1047 | Antisocial Personality Disorder | 7506515 | CTD | |
| 1048 | Anxiety Disorders | 12020264 | CTD | |
| 1049 | Aortic Aneurysm, Abdominal | 22539767 | CTD | |
| 1050 | Atelectasis | OFFSIDES | ||
| 1051 | Atherosclerosis | 16938416 21982312 22539767 | CTD | |
| 1052 | Benign prostatic hypertrophy | SIDER | ||
| 1053 | Birth Weight | 21812961 | CTD | |
| 1054 | Bladder Neoplasm | OFFSIDES | ||
| 1055 | Blood Glucose | OFFSIDES | ||
| 1056 | Blood and lymphatic system disorders | SIDER | ||
| 1057 | Blood creatine phosphokinase increased | SIDER | ||
| 1058 | Blood electrolytes decreased | OFFSIDES | ||
| 1059 | Blood phosphorus increased | OFFSIDES | ||
| 1060 | Blood urea normal | SIDER | ||
| 1061 | Brain Ischemia | 9689481 | CTD | |
| 1062 | Breast Cyst | SIDER | ||
| 1063 | Bronchial Hyperreactivity | SIDER | ||
| 1064 | Bronchiolitis | OFFSIDES | ||
| 1065 | Buccal inflammation | SIDER | ||
| 1066 | Buccal mucosal roughening | SIDER | ||
| 1067 | Carcinoma | SIDER | ||
| 1068 | Cardiomyopathy, Dilated | 25996886 | CTD | |
| 1069 | Cardiovascular Diseases | 20592293 | CTD | |
| 1070 | Catalepsy | 6303368 | CTD | |
| 1071 | Cellulitis of male external genital organ | OFFSIDES | ||
| 1072 | Cerebral atrophy | OFFSIDES | ||
| 1073 | Cerebrovascular Disorders | 3945252 16006544 | CTD | |
| 1074 | Cerebrovascular Insufficiency | SIDER | ||
| 1075 | Cheilitis | SIDER | ||
| 1076 | Chest tightness | SIDER | ||
| 1077 | Cholecystitis | OFFSIDES | ||
| 1078 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 1079 | Cirrhosis | OFFSIDES | ||
| 1080 | Coagulation factor VIII level decreased | OFFSIDES | ||
| 1081 | Cocaine-Related Disorders | 20932851 | CTD | |
| 1082 | Concomitant disease progression | OFFSIDES | ||
| 1083 | Contact Dermatitis | OFFSIDES | ||
| 1084 | Creatinine increased | SIDER | ||
| 1085 | Cryptorchidism | 15514086 | CTD | |
| 1086 | Debridement | OFFSIDES | ||
| 1087 | Decreased Libido | OFFSIDES | ||
| 1088 | Dental abscess | OFFSIDES | ||
| 1089 | Depression suicidal | SIDER | ||
| 1090 | Depressive disorder | 12020264 20479013 | CTD | |
| 1091 | Detachment psychological | SIDER | ||
| 1092 | Diabetes | OFFSIDES | ||
| 1093 | Diabetic Foot | OFFSIDES | ||
| 1094 | Diarrhea | OFFSIDES | ||
| 1095 | Disorders of Sex Development | 17218470 21401432 | CTD | |
| 1096 | Disruptive, Impulse Control, and Conduct Disorders | 7506515 | CTD | |
| 1097 | Duodenitis | OFFSIDES | ||
| 1098 | Dyskinesia, Drug-Induced | 28790 | CTD | |
| 1099 | Dysthymic Disorder | 9934939 | CTD OFFSIDES | |
| 1100 | Ear and labyrinth disorders | SIDER | ||
| 1101 | Endocarditis | OFFSIDES | ||
| 1102 | Epidermal necrosis | SIDER | ||
| 1103 | Epididymitis | SIDER | ||
| 1104 | Esophageal Stenosis | OFFSIDES | ||
| 1105 | Eye Redness | SIDER | ||
| 1106 | Factor VIII inhibition | OFFSIDES | ||
| 1107 | Familial Testotoxicosis | 16684832 | CTD | |
| 1108 | Fanconi Syndrome | OFFSIDES | ||
| 1109 | Fetal Growth Retardation | 21812961 | CTD | |
| 1110 | Fibromatosis, Aggressive | 21468052 | CTD | |
| 1111 | Fibrosis | 22028442 | CTD | |
| 1112 | Firesetting Behavior | 7506515 | CTD | |
| 1113 | Gambling | OFFSIDES | ||
| 1114 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 1115 | Gastrointestinal hypomotility | SIDER | ||
| 1116 | Genital Diseases, Male | 22112501 | CTD | |
| 1117 | Gingival Recession | SIDER | ||
| 1118 | Gingival blister | SIDER | ||
| 1119 | Gingival erythema | SIDER | ||
| 1120 | Gingivitis | SIDER | ||
| 1121 | Globulinuria | OFFSIDES | ||
| 1122 | Glomerulonephritis | OFFSIDES | ||
| 1123 | Granuloma | OFFSIDES | ||
| 1124 | HIV Wasting Syndrome | 17961146 | CTD | |
| 1125 | Hair discoloration | SIDER | ||
| 1126 | Heart Diseases | 9140897 19755459 | CTD | |
| 1127 | Heart failure | 19665014 | CTD | |
| 1128 | Hepatitis C | OFFSIDES | ||
| 1129 | Hydronephrosis | 3999691 | CTD | |
| 1130 | Hyperalgesia | 7341469 | CTD | |
| 1131 | Hyperkinesia | SIDER | ||
| 1132 | Hyperparathyroidism | SIDER | ||
| 1133 | Hyperpigmentation | OFFSIDES | ||
| 1134 | Hypertension worsened | SIDER | ||
| 1135 | Hypertrophy | 9194572 22138414 | CTD | |
| 1136 | Hypogeusia | SIDER | ||
| 1137 | Hypospadias | 21676446 | CTD | |
| 1138 | Immunosuppressant drug level decreased | OFFSIDES | ||
| 1139 | Induration | SIDER | ||
| 1140 | Infestation | SIDER | ||
| 1141 | Infusion site mobility decreased | OFFSIDES | ||
| 1142 | Insulin Resistance | 21418339 21444647 | CTD | |
| 1143 | Intestinal Obstruction | OFFSIDES | ||
| 1144 | Irritation gum | SIDER | ||
| 1145 | Joint Instability | OFFSIDES | ||
| 1146 | Kidney Failure | OFFSIDES | ||
| 1147 | Klinefelter Syndrome | 14624928 | CTD | |
| 1148 | Lacrimation | SIDER | ||
| 1149 | Leukocytoclastic vasculitis | SIDER | ||
| 1150 | Leukopenia | SIDER | ||
| 1151 | Leukoplakia | SIDER | ||
| 1152 | Leydig Cell Tumor | 7589908 | CTD | |
| 1153 | Lipids abnormal | SIDER | ||
| 1154 | Lithiasis | 21670126 | CTD | |
| 1155 | Liver neoplasms | 9140897 25058030 | CTD | |
| 1156 | Lymphocytosis | OFFSIDES | ||
| 1157 | Lymphoma, Non-Hodgkin | 9140897 | CTD | |
| 1158 | Malaria | 15788153 | CTD | |
| 1159 | Malignant Hypertension | OFFSIDES | ||
| 1160 | Malnutrition | SIDER | ||
| 1161 | Mammary Neoplasms, Experimental | 9131265 | CTD | |
| 1162 | Melanoma, Experimental | 18336327 | CTD | |
| 1163 | Memory Disorders | 24902786 | CTD | |
| 1164 | Mental disorders | 2623062 8724175 17194457 | CTD | |
| 1165 | Metastases to adrenals | OFFSIDES | ||
| 1166 | Microembolism | SIDER | ||
| 1167 | Micronuclei, Chromosome-Defective | 25910915 | CTD | |
| 1168 | Mouth irritation | SIDER | ||
| 1169 | Muscle Weakness | OFFSIDES | ||
| 1170 | Muscular Atrophy | 18436443 21094144 21931329 | CTD | |
| 1171 | Myeloid maturation arrest | OFFSIDES | ||
| 1172 | Myocardial Ischemia | 10190874 11034937 19337562 | CTD | |
| 1173 | Myocarditis | 739565 | CTD | |
| 1174 | Neoplasm Metastasis | 7059952 | CTD | |
| 1175 | Neoplasms | 821748 | CTD | |
| 1176 | Nephritis, Interstitial | 18073317 | CTD | |
| 1177 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 1178 | Neurotoxicity Syndromes | 16642786 | CTD | |
| 1179 | Non-alcoholic Fatty Liver Disease | 23747427 | CTD | |
| 1180 | Oligospermia | SIDER | ||
| 1181 | Oral lesion | SIDER | ||
| 1182 | Oroantral Fistula | OFFSIDES | ||
| 1183 | Pancreatic enzymes increased | OFFSIDES | ||
| 1184 | Paresthesia generalized | SIDER | ||
| 1185 | Parkinson Disease | 12020264 | CTD | |
| 1186 | Pemphigus | OFFSIDES | ||
| 1187 | Pharyngolaryngeal Pain | SIDER | ||
| 1188 | Polycystic Ovary Syndrome | 2777199 20378617 21418339 | CTD | |
| 1189 | Polycythemia | 15161484 19337562 | CTD | |
| 1190 | Portal Hypertension | OFFSIDES | ||
| 1191 | Prenatal Exposure Delayed Effects | CTD | ||
| 1192 | Primary sequestrum | OFFSIDES | ||
| 1193 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 1194 | Prolactinoma | 15829128 | CTD | |
| 1195 | Prostate carcinoma | SIDER | ||
| 1196 | Prostate examination abnormal | OFFSIDES SIDER | ||
| 1197 | Prostate induration | SIDER | ||
| 1198 | Prostatic Adenoma | SIDER | ||
| 1199 | Prostatic Hyperplasia | CTD | ||
| 1200 | Prostatic Neoplasms | CTD | ||
| 1201 | Prostatic dysplasia | SIDER | ||
| 1202 | Pulmonary microemboli | SIDER | ||
| 1203 | Raised serum lipid levels | SIDER | ||
| 1204 | Redness gum | SIDER | ||
| 1205 | Reflux gastritis | OFFSIDES | ||
| 1206 | Renal Colic | SIDER | ||
| 1207 | Renal tubular necrosis | OFFSIDES | ||
| 1208 | Reperfusion Injury | 16682413 | CTD | |
| 1209 | Rhinitis | SIDER | ||
| 1210 | Serum Sickness | SIDER | ||
| 1211 | Serum testosterone decreased | SIDER | ||
| 1212 | Shock, Hemorrhagic | 16617133 | CTD | |
| 1213 | Shock, Traumatic | 16617133 | CTD | |
| 1214 | Shock | SIDER | ||
| 1215 | Sinus operation | OFFSIDES | ||
| 1216 | Sinus rhythm | OFFSIDES | ||
| 1217 | Skin Induration | OFFSIDES | ||
| 1218 | Sleep Apnea, Obstructive | 8306057 | CTD | |
| 1219 | Soft Tissue Injuries | OFFSIDES | ||
| 1220 | Spermatocele | SIDER | ||
| 1221 | Status Epilepticus | 11699190 | CTD | |
| 1222 | Subcutaneous nodule | OFFSIDES | ||
| 1223 | Substance Withdrawal Syndrome | 2623062 | CTD | |
| 1224 | Sweating | SIDER | ||
| 1225 | T-lymphocyte count increased | OFFSIDES | ||
| 1226 | Taste Disorders | SIDER | ||
| 1227 | Testicular mass | OFFSIDES | ||
| 1228 | Thromboembolism | SIDER | ||
| 1229 | Thyroiditis | OFFSIDES | ||
| 1230 | Tooth Extraction | OFFSIDES | ||
| 1231 | Transaminases increased | SIDER | ||
| 1232 | Vaginal burning sensation | SIDER | ||
| 1233 | Vascular calcification | 20048160 | CTD | |
| 1234 | Vasodilation procedure | SIDER | ||
| 1235 | Vasodilation | SIDER | ||
| 1236 | Venous Insufficiency | SIDER | ||
| 1237 | Venous Thromboembolism | SIDER | ||
| 1238 | Vesiculobullous rash | SIDER | ||
| 1239 | Vitreous Detachment | SIDER | ||
| 1240 | Voice Disorders | 10622516 | CTD | |
| 1241 | Weight Gain | 21084444 | CTD OFFSIDES | |
| 1242 | Wernicke-Korsakoff Syndrome | SIDER | ||
| 1243 | bad taste | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.