carbidopa, levodopa drug combination
(IVTMXOXVAHXCHI-YXLMWLKOSA-N)
Structure
- SMILES
- OC(=O)[C@H](Cc1ccc(c(c1)O)O)N.NN[C@](C(=O)O)(Cc1ccc(c(c1)O)O)C
- Molecular Formula:
- C19H25N3O8
- Molecular Weight:
- 423.417
- Log P:
- 1.7906
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 9
- TPSA:
- 219.59
- CAS Number(s):
- 57308-51-7; 500019-90-9
Synonym(s)
1.
carbidopa, levodopa drug combination
2.
Grifoparkin
3.
IPX066
4.
Nacom
5.
Nakom
6.
Numient
7.
Parcopa
8.
Rytary
9.
Sinemet
10.
Sinemet CR
11.
Sinemet CR4
12.
carbidopa - levodopa
13.
duodopa
14.
tidomed
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | General physical health deterioration | FAERS: 611 | US FAERS | |
| 2 | Drug ineffective | FAERS: 605 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 3 | Pneumonia | FAERS: 554 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Device dislocation | FAERS: 514 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 5 | Tremor | FAERS: 513 | US FAERS | |
| 6 | Weight decreased | FAERS: 404 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Stoma site discharge | FAERS: 332 | US FAERS | |
| 8 | Malaise | FAERS: 311 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 9 | Fatigue | FAERS: 306 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Freezing phenomenon | FAERS: 302 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Urinary tract infection | FAERS: 274 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Asthenia | FAERS: 257 | US FAERS | |
| 13 | Dizziness | FAERS: 251 Canada Vigilance: 1 | 17134849 | CTD Canada Vigilance US FAERS |
| 14 | Stoma site erythema | FAERS: 249 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Nausea | FAERS: 221 Canada Vigilance: 2 | 1101099 17134849 | CTD Canada Vigilance US FAERS |
| 16 | Device occlusion | FAERS: 207 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 17 | Somnolence | FAERS: 207 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Abdominal Pain | FAERS: 200 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 19 | Prescribed overdose | FAERS: 200 | US FAERS | |
| 20 | Stoma Site Infection | FAERS: 194 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Drug effect incomplete | FAERS: 193 | US FAERS | |
| 22 | Adverse event | FAERS: 182 | US FAERS | |
| 23 | Anxiety | FAERS: 181 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Pain | FAERS: 181 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Musculoskeletal stiffness | FAERS: 180 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Cardiac Arrest | FAERS: 178 | US FAERS | |
| 27 | Constipation | FAERS: 175 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Vomiting | FAERS: 170 | 1101099 9266731 | CTD US FAERS |
| 29 | Feeling abnormal | FAERS: 168 | US FAERS | |
| 30 | Muscle Rigidity | FAERS: 157 | 3173366 | CTD US FAERS |
| 31 | Hyperkinesia | FAERS: 156 | US FAERS | |
| 32 | Stoma site pain | FAERS: 149 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Memory impairment | FAERS: 142 | US FAERS | |
| 34 | Hypophagia | FAERS: 138 | US FAERS | |
| 35 | Hypotension | FAERS: 131 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Bradykinesia | FAERS: 111 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Cerebrovascular accident | FAERS: 108 | US FAERS | |
| 38 | Incorrect route of drug administration | FAERS: 106 | US FAERS | |
| 39 | Infection | FAERS: 106 | US FAERS | |
| 40 | Embedded device | FAERS: 97 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Dehydration | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Dystonia | FAERS: 94 | CTD US FAERS | |
| 43 | Stoma site inflammation | FAERS: 94 | US FAERS | |
| 44 | Sepsis | FAERS: 91 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Syncope | FAERS: 91 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Dementia | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Device connection issue | FAERS: 88 | US FAERS | |
| 48 | Disorientation | FAERS: 87 | US FAERS | |
| 49 | Stoma site reaction | FAERS: 82 | US FAERS | |
| 50 | Stoma site hypergranulation | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 51 | Drug effect variable | FAERS: 78 | US FAERS | |
| 52 | Headache | FAERS: 77 | US FAERS | |
| 53 | Hypokinesia | FAERS: 77 | 9416775 | CTD US FAERS |
| 54 | Restlessness | FAERS: 77 | US FAERS | |
| 55 | Gait inability | FAERS: 76 | US FAERS | |
| 56 | Peritonitis | FAERS: 74 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 57 | Device alarm issue | FAERS: 72 | US FAERS | |
| 58 | Incorrect dose administered | FAERS: 71 | US FAERS | |
| 59 | Myocardial Infarction | FAERS: 71 | US FAERS | |
| 60 | Intestinal Obstruction | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Back Pain | FAERS: 68 | US FAERS | |
| 62 | Agitation | FAERS: 67 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Stoma site extravasation | FAERS: 66 | US FAERS | |
| 64 | Unintentional medical device removal | FAERS: 65 | US FAERS | |
| 65 | fibroma | FAERS: 65 | US FAERS | |
| 66 | Delirium | FAERS: 63 Canada Vigilance: 1 | 18303133 | CTD Canada Vigilance US FAERS |
| 67 | Stoma site irritation | FAERS: 63 | US FAERS | |
| 68 | Akinesia | FAERS: 62 | US FAERS | |
| 69 | Device breakage | FAERS: 62 | US FAERS | |
| 70 | Pulmonary Embolism | FAERS: 61 | US FAERS | |
| 71 | Arthralgia | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Device leakage | FAERS: 59 | US FAERS | |
| 73 | Tension | FAERS: 59 | US FAERS | |
| 74 | Device kink | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Respiratory Failure | FAERS: 57 | US FAERS | |
| 76 | Stress | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Bedridden | FAERS: 53 | US FAERS | |
| 78 | Cataract | FAERS: 52 | US FAERS | |
| 79 | Polyneuropathy | FAERS: 50 | US FAERS | |
| 80 | Bronchitis | FAERS: 48 | US FAERS | |
| 81 | Chest Pain | FAERS: 48 | US FAERS | |
| 82 | Drug effect delayed | FAERS: 47 | US FAERS | |
| 83 | Influenza | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Nervousness | FAERS: 47 | US FAERS | |
| 85 | Overdose | FAERS: 47 | US FAERS | |
| 86 | Aphasia | FAERS: 46 | US FAERS | |
| 87 | Intentional medical device removal by patient | FAERS: 46 | US FAERS | |
| 88 | Terminal state | FAERS: 46 | US FAERS | |
| 89 | Wrong technique in product usage process | FAERS: 46 | US FAERS | |
| 90 | Abdominal discomfort | FAERS: 45 | US FAERS | |
| 91 | Depressed mood | FAERS: 45 | US FAERS | |
| 92 | Epilepsy | FAERS: 44 | 2265898 | CTD US FAERS |
| 93 | Mental impairment | FAERS: 42 | US FAERS | |
| 94 | Pneumoperitoneum | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Drug dose omission | FAERS: 41 | US FAERS | |
| 96 | Wrong technique in device usage process | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Granuloma | FAERS: 40 | US FAERS | |
| 98 | Malnutrition | FAERS: 40 | US FAERS | |
| 99 | Dysphonia | FAERS: 38 | US FAERS | |
| 100 | Emotional disorder | FAERS: 38 | US FAERS | |
| 101 | Device damage | FAERS: 36 | US FAERS | |
| 102 | Loss of personal independence in daily activities | FAERS: 36 | US FAERS | |
| 103 | Middle insomnia | FAERS: 36 | US FAERS | |
| 104 | Product substitution issue | FAERS: 36 | US FAERS | |
| 105 | Choking | FAERS: 35 | US FAERS | |
| 106 | Unevaluable event | FAERS: 35 | US FAERS | |
| 107 | Unresponsive to stimuli | FAERS: 35 | US FAERS | |
| 108 | Visual Impairment | FAERS: 35 | US FAERS | |
| 109 | Depressed Level of Consciousness | FAERS: 34 | US FAERS | |
| 110 | Flatulence | FAERS: 34 | US FAERS | |
| 111 | Gastrointestinal stoma complication | FAERS: 34 | US FAERS | |
| 112 | Peripheral swelling | FAERS: 34 | US FAERS | |
| 113 | Post procedural complication | FAERS: 34 | US FAERS | |
| 114 | Abasia | FAERS: 33 | US FAERS | |
| 115 | Intentional product use issue | FAERS: 33 | US FAERS | |
| 116 | Urinary Retention | FAERS: 33 | US FAERS | |
| 117 | Atrial Fibrillation | FAERS: 32 | US FAERS | |
| 118 | Nasopharyngitis | FAERS: 32 | US FAERS | |
| 119 | Intentional product misuse | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Deep Brain Stimulation | FAERS: 30 | US FAERS | |
| 121 | Gastric ulcer | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Incorrect route of product administration | FAERS: 29 | US FAERS | |
| 123 | Therapy cessation | FAERS: 29 | US FAERS | |
| 124 | Amnesia | FAERS: 28 | US FAERS | |
| 125 | Poor quality sleep | FAERS: 28 | US FAERS | |
| 126 | Complication of device insertion | FAERS: 27 | US FAERS | |
| 127 | Device difficult to use | FAERS: 27 | US FAERS | |
| 128 | Nocturia | FAERS: 27 | US FAERS | |
| 129 | Apathy | FAERS: 26 | US FAERS | |
| 130 | Device deployment issue | FAERS: 26 | US FAERS | |
| 131 | Discomfort | FAERS: 26 | US FAERS | |
| 132 | Ileus | FAERS: 26 | US FAERS | |
| 133 | Cholelithiasis | FAERS: 25 | US FAERS | |
| 134 | Device related infection | FAERS: 25 | US FAERS | |
| 135 | Diplopia | FAERS: 25 | US FAERS | |
| 136 | Extra dose administered | FAERS: 25 | US FAERS | |
| 137 | Activities of daily living impaired | FAERS: 24 | US FAERS | |
| 138 | Chest discomfort | FAERS: 24 | US FAERS | |
| 139 | Dysgraphia | FAERS: 24 | US FAERS | |
| 140 | Hernia | FAERS: 24 | US FAERS | |
| 141 | Intestinal Perforation | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Musculoskeletal Pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Urinary Incontinence | FAERS: 24 | US FAERS | |
| 144 | Dopamine dysregulation syndrome | FAERS: 23 | US FAERS | |
| 145 | Dysarthria | FAERS: 23 | US FAERS | |
| 146 | Dyspepsia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Incontinence | FAERS: 23 | US FAERS | |
| 148 | Pre-existing condition improved | FAERS: 23 | US FAERS | |
| 149 | Thrombosis | FAERS: 23 | US FAERS | |
| 150 | Wheelchair user | FAERS: 23 | US FAERS | |
| 151 | Device use error | FAERS: 22 | US FAERS | |
| 152 | Duodenal Ulcer | FAERS: 22 | US FAERS | |
| 153 | Neck Pain | FAERS: 22 | US FAERS | |
| 154 | Sluggishness | FAERS: 22 | US FAERS | |
| 155 | Ageusia | FAERS: 21 | US FAERS | |
| 156 | Complication associated with device | FAERS: 21 | US FAERS | |
| 157 | Laceration | FAERS: 21 | US FAERS | |
| 158 | Limb discomfort | FAERS: 21 | US FAERS | |
| 159 | Lower respiratory tract infection | FAERS: 21 | US FAERS | |
| 160 | Myalgia | FAERS: 21 | US FAERS | |
| 161 | Rehabilitation therapy | FAERS: 21 | US FAERS | |
| 162 | Restless Legs Syndrome | FAERS: 21 | 8723377 14592347 18303133 | CTD US FAERS |
| 163 | Acute kidney injury | FAERS: 20 | US FAERS | |
| 164 | Arthropathy | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Paranoia | FAERS: 20 | US FAERS | |
| 166 | Productive Cough | FAERS: 20 | US FAERS | |
| 167 | Stoma site induration | FAERS: 20 | US FAERS | |
| 168 | Anger | FAERS: 19 | US FAERS | |
| 169 | Device loosening | FAERS: 19 | US FAERS | |
| 170 | Dysuria | FAERS: 19 | US FAERS | |
| 171 | Emotional distress | FAERS: 19 | US FAERS | |
| 172 | Inflammation | FAERS: 19 | US FAERS | |
| 173 | Lethargy | FAERS: 19 | US FAERS | |
| 174 | Vertigo | FAERS: 19 | US FAERS | |
| 175 | Cellulitis | FAERS: 18 | US FAERS | |
| 176 | Dysgeusia | FAERS: 18 | US FAERS | |
| 177 | Gastroenteritis | FAERS: 18 | US FAERS | |
| 178 | General physical condition abnormal | FAERS: 18 | US FAERS | |
| 179 | Hypersomnia | FAERS: 18 | US FAERS | |
| 180 | Initial insomnia | FAERS: 18 | US FAERS | |
| 181 | Limb injury | FAERS: 18 | US FAERS | |
| 182 | Respiratory arrest | FAERS: 18 | US FAERS | |
| 183 | Stoma complication | FAERS: 18 | US FAERS | |
| 184 | Cachexia | FAERS: 17 | US FAERS | |
| 185 | Drug administration error | FAERS: 17 | US FAERS | |
| 186 | Hypersensitivity | FAERS: 17 | US FAERS | |
| 187 | Product quality issue | FAERS: 17 | US FAERS | |
| 188 | Pruritus | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Septic Shock | FAERS: 17 | US FAERS | |
| 190 | Stoma site abscess | FAERS: 17 | US FAERS | |
| 191 | Abscess | FAERS: 16 | US FAERS | |
| 192 | Deep Vein Thrombosis | FAERS: 16 | US FAERS | |
| 193 | Disease Progression | FAERS: 16 | US FAERS | |
| 194 | Fracture | FAERS: 16 | US FAERS | |
| 195 | Hip surgery | FAERS: 16 | US FAERS | |
| 196 | Inappropriate schedule of drug administration | FAERS: 16 | US FAERS | |
| 197 | Medical device discomfort | FAERS: 16 | US FAERS | |
| 198 | Medication Error | FAERS: 16 | US FAERS | |
| 199 | Suicide attempt | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Therapeutic product effect incomplete | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 201 | Gastritis | FAERS: 15 | US FAERS | |
| 202 | Gastrointestinal infection | FAERS: 15 | US FAERS | |
| 203 | Stoma site discomfort | FAERS: 15 | US FAERS | |
| 204 | Abdominal Infection | FAERS: 14 | US FAERS | |
| 205 | Cystitis | FAERS: 14 | US FAERS | |
| 206 | Infrequent bowel movements | FAERS: 14 | US FAERS | |
| 207 | Joint injury | FAERS: 14 | US FAERS | |
| 208 | Joint stiffness | FAERS: 14 | US FAERS | |
| 209 | Medical device change | FAERS: 14 | US FAERS | |
| 210 | Product physical issue | FAERS: 14 | US FAERS | |
| 211 | Respiratory distress | FAERS: 14 | US FAERS | |
| 212 | Abdominal rigidity | FAERS: 13 | US FAERS | |
| 213 | Acute myocardial infarction | FAERS: 13 | US FAERS | |
| 214 | Back disorder | FAERS: 13 | US FAERS | |
| 215 | Blindness | FAERS: 13 | US FAERS | |
| 216 | Blood pressure fluctuation | FAERS: 13 | US FAERS | |
| 217 | Device use issue | FAERS: 13 | US FAERS | |
| 218 | Dyschezia | FAERS: 13 | US FAERS | |
| 219 | Erythema | FAERS: 13 | US FAERS | |
| 220 | Impaired self-care | FAERS: 13 | US FAERS | |
| 221 | Medical device removal | FAERS: 13 | US FAERS | |
| 222 | Pallor | FAERS: 13 | US FAERS | |
| 223 | Product dose omission | FAERS: 13 | US FAERS | |
| 224 | Alopecia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 225 | Catheter site discharge | FAERS: 12 | US FAERS | |
| 226 | Completed Suicide | FAERS: 12 | US FAERS | |
| 227 | Drug ineffective for unapproved indication | FAERS: 12 | US FAERS | |
| 228 | Euthanasia | FAERS: 12 | US FAERS | |
| 229 | Intentional device misuse | FAERS: 12 | US FAERS | |
| 230 | Medical device site ulcer | FAERS: 12 | US FAERS | |
| 231 | Muscle tightness | FAERS: 12 | US FAERS | |
| 232 | Nephrolithiasis | FAERS: 12 | US FAERS | |
| 233 | Obsessive-Compulsive Disorder | FAERS: 12 | US FAERS | |
| 234 | Palpitations | FAERS: 12 | US FAERS | |
| 235 | Procedural complication | FAERS: 12 | US FAERS | |
| 236 | Screaming | FAERS: 12 | US FAERS | |
| 237 | Stoma site cellulitis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Swelling | FAERS: 12 | US FAERS | |
| 239 | Aphonia | FAERS: 11 | US FAERS | |
| 240 | Bradyphrenia | FAERS: 11 | US FAERS | |
| 241 | Cerebral Infarction | FAERS: 11 | US FAERS | |
| 242 | Incoherent | FAERS: 11 | US FAERS | |
| 243 | Inflammatory marker increased | FAERS: 11 | US FAERS | |
| 244 | Mood swings | FAERS: 11 | US FAERS | |
| 245 | Product storage error | FAERS: 11 | US FAERS | |
| 246 | Psychiatric symptom | FAERS: 11 | US FAERS | |
| 247 | Reduced facial expression | FAERS: 11 | US FAERS | |
| 248 | Secretion discharge | FAERS: 11 | US FAERS | |
| 249 | Stoma site ulcer | FAERS: 11 | US FAERS | |
| 250 | Sudden death | FAERS: 11 | US FAERS | |
| 251 | Tachycardia | FAERS: 11 | US FAERS | |
| 252 | Ulcer | FAERS: 11 | US FAERS | |
| 253 | Wrong technique in drug usage process | FAERS: 11 | US FAERS | |
| 254 | Abdominal Abscess | FAERS: 10 | US FAERS | |
| 255 | Accidental underdose | FAERS: 10 | US FAERS | |
| 256 | Basal cell carcinoma | FAERS: 10 | US FAERS | |
| 257 | Crying | FAERS: 10 | US FAERS | |
| 258 | Diverticulitis | FAERS: 10 | US FAERS | |
| 259 | Feeling jittery | FAERS: 10 | US FAERS | |
| 260 | Hyperventilation | FAERS: 10 | US FAERS | |
| 261 | Medical device pain | FAERS: 10 | US FAERS | |
| 262 | Oromandibular dystonia | FAERS: 10 | US FAERS | |
| 263 | Pharmaceutical product complaint | FAERS: 10 | US FAERS | |
| 264 | Product use in unapproved indication | FAERS: 10 | US FAERS | |
| 265 | Purulence | FAERS: 10 | US FAERS | |
| 266 | Purulent discharge | FAERS: 10 | US FAERS | |
| 267 | Retinal Detachment | FAERS: 10 | US FAERS | |
| 268 | Staring | FAERS: 10 | US FAERS | |
| 269 | Stoma site pruritus | FAERS: 10 | US FAERS | |
| 270 | Therapeutic response unexpected | FAERS: 10 | US FAERS | |
| 271 | Asthma | FAERS: 9 | US FAERS | |
| 272 | Chills | FAERS: 9 | US FAERS | |
| 273 | Drooling | FAERS: 9 | US FAERS | |
| 274 | Gastrointestinal perforation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Glaucoma | FAERS: 9 | US FAERS | |
| 276 | Guillain-Barre Syndrome | FAERS: 9 | US FAERS | |
| 277 | Hemiparesis | FAERS: 9 | US FAERS | |
| 278 | Immobile | FAERS: 9 | US FAERS | |
| 279 | Infarction | FAERS: 9 | US FAERS | |
| 280 | Intussusception | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Joint swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Mastication disorder | FAERS: 9 | US FAERS | |
| 283 | Pancreatic carcinoma | FAERS: 9 | US FAERS | |
| 284 | Product use issue | FAERS: 9 | US FAERS | |
| 285 | Sciatica | FAERS: 9 | US FAERS | |
| 286 | Skin irritation | FAERS: 9 | US FAERS | |
| 287 | Underweight | FAERS: 9 | US FAERS | |
| 288 | Altered state of consciousness | FAERS: 8 | US FAERS | |
| 289 | Arthritis | FAERS: 8 | US FAERS | |
| 290 | Blood glucose increased | FAERS: 8 | US FAERS | |
| 291 | Blood potassium decreased | FAERS: 8 | US FAERS | |
| 292 | Blood urine present | FAERS: 8 | US FAERS | |
| 293 | Burning sensation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Clostridium difficile infection | FAERS: 8 | US FAERS | |
| 295 | Device expulsion | FAERS: 8 | US FAERS | |
| 296 | Expired product administered | FAERS: 8 | US FAERS | |
| 297 | Gastrointestinal complication associated with device | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 298 | Gastrointestinal inflammation | FAERS: 8 | US FAERS | |
| 299 | Head discomfort | FAERS: 8 | US FAERS | |
| 300 | Medical device site dryness | FAERS: 8 | US FAERS | |
| 301 | Medical device site infection | FAERS: 8 | US FAERS | |
| 302 | Personality Change | FAERS: 8 | US FAERS | |
| 303 | Product administration error | FAERS: 8 | US FAERS | |
| 304 | Product use complaint | FAERS: 8 | US FAERS | |
| 305 | Therapy change | FAERS: 8 | US FAERS | |
| 306 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 307 | Ascites | FAERS: 7 | US FAERS | |
| 308 | Carpal Tunnel Syndrome | FAERS: 7 | US FAERS | |
| 309 | Cholecystitis | FAERS: 7 | US FAERS | |
| 310 | Chromaturia | FAERS: 7 | US FAERS | |
| 311 | Cogwheel Rigidity | FAERS: 7 | US FAERS | |
| 312 | Colitis | FAERS: 7 | US FAERS | |
| 313 | Drug dispensing error | FAERS: 7 | US FAERS | |
| 314 | Enuresis | FAERS: 7 | US FAERS | |
| 315 | Euphoric mood | FAERS: 7 | US FAERS | |
| 316 | Flushing | FAERS: 7 | US FAERS | |
| 317 | Gastrointestinal Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 318 | Gastrostomy | FAERS: 7 | US FAERS | |
| 319 | Hypogeusia | FAERS: 7 | US FAERS | |
| 320 | Hyporeflexia | FAERS: 7 | US FAERS | |
| 321 | Hypoxia | FAERS: 7 | US FAERS | |
| 322 | Impaired gastric emptying | FAERS: 7 | US FAERS | |
| 323 | Intentional self-injury | FAERS: 7 | US FAERS | |
| 324 | Intra-abdominal fluid collection | FAERS: 7 | US FAERS | |
| 325 | Kinesiophobia | FAERS: 7 | US FAERS | |
| 326 | Medical device site injury | FAERS: 7 | US FAERS | |
| 327 | Neuroleptic Malignant Syndrome | FAERS: 7 | 8101521 | CTD US FAERS |
| 328 | No adverse event | FAERS: 7 | US FAERS | |
| 329 | Post procedural infection | FAERS: 7 | US FAERS | |
| 330 | Protein total decreased | FAERS: 7 | US FAERS | |
| 331 | Spinal column stenosis | FAERS: 7 | US FAERS | |
| 332 | Therapeutic response unexpected with drug substitution | FAERS: 7 | US FAERS | |
| 333 | Thermal burn | FAERS: 7 | US FAERS | |
| 334 | Wound Complication | FAERS: 7 | US FAERS | |
| 335 | nervous system disorder | FAERS: 7 | US FAERS | |
| 336 | Arteriosclerosis | FAERS: 6 | US FAERS | |
| 337 | Blood creatinine increased | FAERS: 6 | US FAERS | |
| 338 | Bowel movement irregularity | FAERS: 6 | US FAERS | |
| 339 | Cardiovascular insufficiency | FAERS: 6 | US FAERS | |
| 340 | Deafness | FAERS: 6 | US FAERS | |
| 341 | Dependent Personality Disorder | FAERS: 6 | US FAERS | |
| 342 | Device programming error | FAERS: 6 | US FAERS | |
| 343 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 344 | Disability | FAERS: 6 | US FAERS | |
| 345 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 346 | Duodenal perforation | FAERS: 6 | US FAERS | |
| 347 | Feeling Cold | FAERS: 6 | US FAERS | |
| 348 | Food Allergy | FAERS: 6 | US FAERS | |
| 349 | Gastrointestinal carcinoma | FAERS: 6 | US FAERS | |
| 350 | Hepatitis | FAERS: 6 | US FAERS | |
| 351 | Hyperthyroidism | FAERS: 6 | US FAERS | |
| 352 | Inappropriate schedule of product administration | FAERS: 6 | US FAERS | |
| 353 | Joint Range of Motion Decreased | FAERS: 6 | US FAERS | |
| 354 | Medical device site erosion | FAERS: 6 | US FAERS | |
| 355 | Medical device site pain | FAERS: 6 | US FAERS | |
| 356 | Multimorbidity | FAERS: 6 | US FAERS | |
| 357 | Multiple System Atrophy | FAERS: 6 | US FAERS | |
| 358 | Neuralgia | FAERS: 6 | US FAERS | |
| 359 | Palliative Care | FAERS: 6 | US FAERS | |
| 360 | Pancreatitis | FAERS: 6 | US FAERS | |
| 361 | Slow speech | FAERS: 6 | US FAERS | |
| 362 | Spinal column injury | FAERS: 6 | US FAERS | |
| 363 | Stoma site hypersensitivity | FAERS: 6 | US FAERS | |
| 364 | Stupor | FAERS: 6 | US FAERS | |
| 365 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 366 | Wound Infection | FAERS: 6 | US FAERS | |
| 367 | Abdominal tenderness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 368 | Acquired diaphragmatic eventration | FAERS: 5 | US FAERS | |
| 369 | Akathisia | FAERS: 5 | US FAERS | |
| 370 | Ankle Fracture | FAERS: 5 | US FAERS | |
| 371 | Asphyxia | FAERS: 5 | US FAERS | |
| 372 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 373 | Bursitis | FAERS: 5 | US FAERS | |
| 374 | Catheter site infection | FAERS: 5 | US FAERS | |
| 375 | Cerebral Thrombosis | FAERS: 5 | US FAERS | |
| 376 | Cerebral atrophy | FAERS: 5 | US FAERS | |
| 377 | Cholecystitis infective | FAERS: 5 | US FAERS | |
| 378 | Clostridium difficile colitis | FAERS: 5 | US FAERS | |
| 379 | Cold sweat | FAERS: 5 | US FAERS | |
| 380 | Device physical property issue | FAERS: 5 | US FAERS | |
| 381 | Diet refusal | FAERS: 5 | US FAERS | |
| 382 | Drug Dependence | FAERS: 5 | US FAERS | |
| 383 | Drug abuse | FAERS: 5 | US FAERS | |
| 384 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 385 | Eructation | FAERS: 5 | US FAERS | |
| 386 | Facial paralysis | FAERS: 5 | US FAERS | |
| 387 | Frustration tolerance decreased | FAERS: 5 | US FAERS | |
| 388 | Gangrene | FAERS: 5 | US FAERS | |
| 389 | Gastric infection | FAERS: 5 | US FAERS | |
| 390 | Inability to afford medication | FAERS: 5 | US FAERS | |
| 391 | Incorrect drug administration duration | FAERS: 5 | US FAERS | |
| 392 | Incorrect product administration duration | FAERS: 5 | US FAERS | |
| 393 | Iron deficiency | FAERS: 5 | US FAERS | |
| 394 | Macular degeneration | FAERS: 5 | US FAERS | |
| 395 | Mechanical ventilation | FAERS: 5 | US FAERS | |
| 396 | Mental status changes | FAERS: 5 | US FAERS | |
| 397 | Musculoskeletal chest pain | FAERS: 5 | US FAERS | |
| 398 | Myopathy | FAERS: 5 | US FAERS | |
| 399 | Nephritis | FAERS: 5 | US FAERS | |
| 400 | Obstruction | FAERS: 5 | US FAERS | |
| 401 | Osteomyelitis | FAERS: 5 | US FAERS | |
| 402 | Pneumothorax | FAERS: 5 | US FAERS | |
| 403 | Psychiatric decompensation | FAERS: 5 | US FAERS | |
| 404 | Pyelonephritis | FAERS: 5 | US FAERS | |
| 405 | Pyloric Stenosis | FAERS: 5 | US FAERS | |
| 406 | Quality of life decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 407 | Retching | FAERS: 5 | US FAERS | |
| 408 | Skin laceration | FAERS: 5 | US FAERS | |
| 409 | Slow response to stimuli | FAERS: 5 | US FAERS | |
| 410 | Stoma site candida | FAERS: 5 | US FAERS | |
| 411 | Therapeutic product effect decreased | FAERS: 5 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 412 | Throat irritation | FAERS: 5 | US FAERS | |
| 413 | Tooth Loss | FAERS: 5 | US FAERS | |
| 414 | Toothache | FAERS: 5 | US FAERS | |
| 415 | Walking aid user | FAERS: 5 | US FAERS | |
| 416 | Abdominal wall infection | FAERS: 4 | US FAERS | |
| 417 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 418 | Aneurysm | FAERS: 4 | US FAERS | |
| 419 | Ataxia | FAERS: 4 | US FAERS | |
| 420 | Athetosis | FAERS: 4 | 11498717 | CTD US FAERS |
| 421 | Bladder Neoplasm | FAERS: 4 | US FAERS | |
| 422 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 423 | Blood folate decreased | FAERS: 4 | US FAERS | |
| 424 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 425 | Body temperature fluctuation | FAERS: 4 | US FAERS | |
| 426 | Bronchopneumonia | FAERS: 4 | US FAERS | |
| 427 | Bronchospasm | FAERS: 4 | US FAERS | |
| 428 | Cataract operation | FAERS: 4 | US FAERS | |
| 429 | Catatonia | FAERS: 4 | 12597016 | CTD US FAERS |
| 430 | Choking sensation | FAERS: 4 | US FAERS | |
| 431 | Chorea | FAERS: 4 | 11498717 | CTD US FAERS |
| 432 | Clostridium test positive | FAERS: 4 | US FAERS | |
| 433 | Conversion disorder | FAERS: 4 | US FAERS | |
| 434 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 435 | Device adhesion issue | FAERS: 4 | US FAERS | |
| 436 | Device battery issue | FAERS: 4 | US FAERS | |
| 437 | Device infusion issue | FAERS: 4 | US FAERS | |
| 438 | Disease complication | FAERS: 4 | US FAERS | |
| 439 | Drug level decreased | FAERS: 4 | US FAERS | |
| 440 | Dysphemia | FAERS: 4 | US FAERS | |
| 441 | Electroencephalogram abnormal | FAERS: 4 | US FAERS | |
| 442 | Enteral Nutrition | FAERS: 4 | US FAERS | |
| 443 | Epistaxis | FAERS: 4 | US FAERS | |
| 444 | Exophthalmos | FAERS: 4 | US FAERS | |
| 445 | Eye irritation | FAERS: 4 | US FAERS | |
| 446 | Full blood count decreased | FAERS: 4 | US FAERS | |
| 447 | Gastric Fistula | FAERS: 4 | US FAERS | |
| 448 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 449 | Incorrect product storage | FAERS: 4 | US FAERS | |
| 450 | Increased bronchial secretion | FAERS: 4 | US FAERS | |
| 451 | Intestinal infarction | FAERS: 4 | US FAERS | |
| 452 | Irregular sleep wake rhythm disorder | FAERS: 4 | US FAERS | |
| 453 | Jealous delusion | FAERS: 4 | US FAERS | |
| 454 | Leukocytosis | FAERS: 4 | US FAERS | |
| 455 | Limb operation | FAERS: 4 | US FAERS | |
| 456 | Medical device site abscess | FAERS: 4 | US FAERS | |
| 457 | Medical induction of coma | FAERS: 4 | US FAERS | |
| 458 | Medication residue present | FAERS: 4 | US FAERS | |
| 459 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 460 | Musculoskeletal discomfort | FAERS: 4 | US FAERS | |
| 461 | Myoclonus | FAERS: 4 | 3401861 9048728 | CTD US FAERS |
| 462 | Negative thoughts | FAERS: 4 | US FAERS | |
| 463 | Night sweats | FAERS: 4 | US FAERS | |
| 464 | Nutritional condition abnormal | FAERS: 4 | US FAERS | |
| 465 | Obsessive thoughts | FAERS: 4 | US FAERS | |
| 466 | Orthostatic intolerance | FAERS: 4 | US FAERS | |
| 467 | Osteoporosis | FAERS: 4 | US FAERS | |
| 468 | Paraplegia | FAERS: 4 | US FAERS | |
| 469 | Partner stress | FAERS: 4 | US FAERS | |
| 470 | Post procedural stroke | FAERS: 4 | US FAERS | |
| 471 | Postoperative wound complication | FAERS: 4 | US FAERS | |
| 472 | Presyncope | FAERS: 4 | US FAERS | |
| 473 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 474 | Reaction to drug excipients | FAERS: 4 | US FAERS | |
| 475 | Renal cancer metastatic | FAERS: 4 | US FAERS | |
| 476 | Respiratory dyskinesia | FAERS: 4 | US FAERS | |
| 477 | Respiratory fatigue | FAERS: 4 | US FAERS | |
| 478 | Shock | FAERS: 4 | US FAERS | |
| 479 | Skin lesion | FAERS: 4 | US FAERS | |
| 480 | Sputum retention | FAERS: 4 | US FAERS | |
| 481 | Stoma site rash | FAERS: 4 | US FAERS | |
| 482 | Stomatitis | FAERS: 4 | US FAERS | |
| 483 | Subileus | FAERS: 4 | US FAERS | |
| 484 | Thoracic vertebral fracture | FAERS: 4 | US FAERS | |
| 485 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 486 | Torticollis | FAERS: 4 | US FAERS | |
| 487 | Umbilical hernia | FAERS: 4 | US FAERS | |
| 488 | Viral upper respiratory tract infection | FAERS: 4 | US FAERS | |
| 489 | Wound infection staphylococcal | FAERS: 4 | US FAERS | |
| 490 | Wrong dose | FAERS: 4 | US FAERS | |
| 491 | Abdominal adhesions | FAERS: 3 | US FAERS | |
| 492 | Accidental overdose | FAERS: 3 | US FAERS | |
| 493 | Anuria | FAERS: 3 | US FAERS | |
| 494 | Atelectasis | FAERS: 3 | US FAERS | |
| 495 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 496 | Autonomic nervous system imbalance | FAERS: 3 | US FAERS | |
| 497 | Bacterial test positive | FAERS: 3 | US FAERS | |
| 498 | Benign Prostatic Hyperplasia | FAERS: 3 | US FAERS | |
| 499 | Biliary Colic | FAERS: 3 | US FAERS | |
| 500 | Blood homocysteine increased | FAERS: 3 | US FAERS | |
| 501 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 502 | Blood pressure orthostatic decreased | FAERS: 3 | US FAERS | |
| 503 | Bradycardia | FAERS: 3 | US FAERS | |
| 504 | Bruxism | FAERS: 3 | US FAERS | |
| 505 | Burn infection | FAERS: 3 | US FAERS | |
| 506 | Catheter site dryness | FAERS: 3 | US FAERS | |
| 507 | Catheter site erosion | FAERS: 3 | US FAERS | |
| 508 | Catheter site scab | FAERS: 3 | US FAERS | |
| 509 | Catheter site swelling | FAERS: 3 | US FAERS | |
| 510 | Cyst | FAERS: 3 | US FAERS | |
| 511 | Dental caries | FAERS: 3 | US FAERS | |
| 512 | Dependence | FAERS: 3 | US FAERS | |
| 513 | Device computer issue | FAERS: 3 | US FAERS | |
| 514 | Device defective | FAERS: 3 | US FAERS | |
| 515 | Device extension damage | FAERS: 3 | US FAERS | |
| 516 | Device material issue | FAERS: 3 | US FAERS | |
| 517 | Disease recurrence | FAERS: 3 | US FAERS | |
| 518 | Diverticulum | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 519 | Drug therapy enhancement | FAERS: 3 | US FAERS | |
| 520 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 521 | Duodenal Obstruction | FAERS: 3 | US FAERS | |
| 522 | Eczema | FAERS: 3 | US FAERS | |
| 523 | Embolism | FAERS: 3 | US FAERS | |
| 524 | Erysipelas | FAERS: 3 | US FAERS | |
| 525 | Eschar | FAERS: 3 | US FAERS | |
| 526 | Escherichia infection | FAERS: 3 | US FAERS | |
| 527 | Escherichia urinary tract infection | FAERS: 3 | US FAERS | |
| 528 | Fear of falling | FAERS: 3 | US FAERS | |
| 529 | Flat affect | FAERS: 3 | US FAERS | |
| 530 | Food Poisoning | FAERS: 3 | US FAERS | |
| 531 | Gastric Dilatation | FAERS: 3 | US FAERS | |
| 532 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 533 | General symptom | FAERS: 3 | US FAERS | |
| 534 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 535 | Hospice Care | FAERS: 3 | US FAERS | |
| 536 | Hypercapnia | FAERS: 3 | US FAERS | |
| 537 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 538 | Hyperphagia | FAERS: 3 | US FAERS | |
| 539 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 540 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 541 | Incorrect drug administration rate | FAERS: 3 | US FAERS | |
| 542 | Increased upper airway secretion | FAERS: 3 | US FAERS | |
| 543 | Injection site inflammation | FAERS: 3 | US FAERS | |
| 544 | Laziness | FAERS: 3 | US FAERS | |
| 545 | Lip swelling | FAERS: 3 | US FAERS | |
| 546 | Malabsorption | FAERS: 3 | US FAERS | |
| 547 | Mantle cell lymphoma recurrent | FAERS: 3 | US FAERS | |
| 548 | Mantle cell lymphoma | FAERS: 3 | US FAERS | |
| 549 | Medical device battery replacement | FAERS: 3 | US FAERS | |
| 550 | Medical device complication | FAERS: 3 | US FAERS | |
| 551 | Medical device site necrosis | FAERS: 3 | US FAERS | |
| 552 | Medical device site warmth | FAERS: 3 | US FAERS | |
| 553 | Mixed dementia | FAERS: 3 | US FAERS | |
| 554 | Neurological Rehabilitation | FAERS: 3 | US FAERS | |
| 555 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 556 | Overconfidence | FAERS: 3 | US FAERS | |
| 557 | Pancytopenia | FAERS: 3 | US FAERS | |
| 558 | Paresis | FAERS: 3 | US FAERS | |
| 559 | Parkinson's disease psychosis | FAERS: 3 | US FAERS | |
| 560 | Parkinsonian crisis | FAERS: 3 | US FAERS | |
| 561 | Patient uncooperative | FAERS: 3 | US FAERS | |
| 562 | Pharyngeal Stenosis | FAERS: 3 | US FAERS | |
| 563 | Physical disability | FAERS: 3 | US FAERS | |
| 564 | Poor personal hygiene | FAERS: 3 | US FAERS | |
| 565 | Post procedural sepsis | FAERS: 3 | US FAERS | |
| 566 | Postural reflex impairment | FAERS: 3 | US FAERS | |
| 567 | Product administered at inappropriate site | FAERS: 3 | US FAERS | |
| 568 | Product administration interrupted | FAERS: 3 | US FAERS | |
| 569 | Product dispensing error | FAERS: 3 | US FAERS | |
| 570 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 571 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 572 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 573 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 574 | Sinusitis | FAERS: 3 | US FAERS | |
| 575 | Spinal synovial cyst | FAERS: 3 | US FAERS | |
| 576 | Stoma site thrombosis | FAERS: 3 | US FAERS | |
| 577 | Sudden onset of sleep | FAERS: 3 | US FAERS | |
| 578 | Surgical failure | FAERS: 3 | US FAERS | |
| 579 | Tardive Dyskinesia | FAERS: 3 | US FAERS | |
| 580 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 581 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 582 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 583 | Time perception altered | FAERS: 3 | US FAERS | |
| 584 | Tinnitus | FAERS: 3 | US FAERS | |
| 585 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 586 | Troponin increased | FAERS: 3 | US FAERS | |
| 587 | Tuberculosis | FAERS: 3 | US FAERS | |
| 588 | Urinary bladder polyp | FAERS: 3 | US FAERS | |
| 589 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 590 | Wheezing | FAERS: 3 | US FAERS | |
| 591 | Wound dehiscence | FAERS: 3 | US FAERS | |
| 592 | prostatitis | FAERS: 3 | US FAERS | |
| 593 | treatment failure | FAERS: 3 | US FAERS | |
| 594 | Accidental exposure | FAERS: 2 | US FAERS | |
| 595 | Acute polyneuropathy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 596 | Acute psychosis | FAERS: 2 | US FAERS | |
| 597 | Administration site dryness | FAERS: 2 | US FAERS | |
| 598 | Anal Fistula | FAERS: 2 | US FAERS | |
| 599 | Aortic Aneurysm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 600 | Apallic syndrome | FAERS: 2 | US FAERS | |
| 601 | Appendicitis | FAERS: 2 | US FAERS | |
| 602 | Application site laceration | FAERS: 2 | US FAERS | |
| 603 | Bile duct stent insertion | FAERS: 2 | US FAERS | |
| 604 | Biliary tract infection | FAERS: 2 | US FAERS | |
| 605 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 606 | Blood bilirubin decreased | FAERS: 2 | US FAERS | |
| 607 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 608 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 609 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 610 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 611 | Blood urea increased | FAERS: 2 | US FAERS | |
| 612 | Blood zinc decreased | FAERS: 2 | US FAERS | |
| 613 | Bone pain | FAERS: 2 | US FAERS | |
| 614 | Bronchial secretion retention | FAERS: 2 | US FAERS | |
| 615 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 616 | C-reactive protein abnormal | FAERS: 2 | US FAERS | |
| 617 | Calcinosis | FAERS: 2 | US FAERS | |
| 618 | Carbon dioxide abnormal | FAERS: 2 | US FAERS | |
| 619 | Cardiac Death | FAERS: 2 | US FAERS | |
| 620 | Cartilage atrophy | FAERS: 2 | US FAERS | |
| 621 | Catheter site erythema | FAERS: 2 | US FAERS | |
| 622 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 623 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 624 | Clostridial sepsis | FAERS: 2 | US FAERS | |
| 625 | Clumsiness | FAERS: 2 | US FAERS | |
| 626 | Compression fracture | FAERS: 2 | US FAERS | |
| 627 | Coronary angioplasty | FAERS: 2 | US FAERS | |
| 628 | Critical Illness | FAERS: 2 | US FAERS | |
| 629 | Cytomegalovirus gastrointestinal infection | FAERS: 2 | US FAERS | |
| 630 | Decreased eye contact | FAERS: 2 | US FAERS | |
| 631 | Deformity | FAERS: 2 | US FAERS | |
| 632 | Delusion of replacement | FAERS: 2 | US FAERS | |
| 633 | Delusional disorder, unspecified type | FAERS: 2 | US FAERS | |
| 634 | Demyelination | FAERS: 2 | US FAERS | |
| 635 | Dermatitis | FAERS: 2 | US FAERS | |
| 636 | Device effect variable | FAERS: 2 | US FAERS | |
| 637 | Device extrusion | FAERS: 2 | US FAERS | |
| 638 | Device fastener issue | FAERS: 2 | US FAERS | |
| 639 | Device related sepsis | FAERS: 2 | US FAERS | |
| 640 | Device-device incompatibility | FAERS: 2 | US FAERS | |
| 641 | Diaphragmatic Hernia | FAERS: 2 | US FAERS | |
| 642 | Disease risk factor | FAERS: 2 | US FAERS | |
| 643 | Drug level fluctuating | FAERS: 2 | US FAERS | |
| 644 | Dry skin | FAERS: 2 | US FAERS | |
| 645 | Duodenitis | FAERS: 2 | US FAERS | |
| 646 | Encephalitis | FAERS: 2 | US FAERS | |
| 647 | Endocarditis | FAERS: 2 | US FAERS | |
| 648 | Enterocutaneous Fistula | FAERS: 2 | US FAERS | |
| 649 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 650 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 651 | Expired device used | FAERS: 2 | US FAERS | |
| 652 | Eye inflammation | FAERS: 2 | US FAERS | |
| 653 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 654 | Febrile infection | FAERS: 2 | US FAERS | |
| 655 | Feeding tube user | FAERS: 2 | US FAERS | |
| 656 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 657 | Fistula of small intestine | FAERS: 2 | US FAERS | |
| 658 | Fixed bowel loop | FAERS: 2 | US FAERS | |
| 659 | Flank Pain | FAERS: 2 | US FAERS | |
| 660 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 661 | Formication | FAERS: 2 | US FAERS | |
| 662 | Fracture pain | FAERS: 2 | US FAERS | |
| 663 | Gastric mucosal lesion | FAERS: 2 | US FAERS | |
| 664 | Gastrointestinal examination | FAERS: 2 | US FAERS | |
| 665 | Gastrointestinal procedural complication | FAERS: 2 | US FAERS | |
| 666 | Gastrointestinal ulcer perforation | FAERS: 2 | US FAERS | |
| 667 | Gastrointestinal ulcer | FAERS: 2 | US FAERS | |
| 668 | Gastrointestinal viral infection | FAERS: 2 | US FAERS | |
| 669 | Gastrointestinal wall thickening | FAERS: 2 | US FAERS | |
| 670 | Gastrostomy tube site complication | FAERS: 2 | US FAERS | |
| 671 | Gaze palsy | FAERS: 2 | US FAERS | |
| 672 | General physical condition decreased | FAERS: 2 | US FAERS | |
| 673 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 674 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 675 | Hernia pain | FAERS: 2 | US FAERS | |
| 676 | Hypomania | FAERS: 2 | US FAERS | |
| 677 | Hyporesponsive to stimuli | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 678 | Hypoventilation | FAERS: 2 | US FAERS | |
| 679 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 680 | Impaired quality of life | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 681 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 682 | Incorrect dose administered by device | FAERS: 2 | US FAERS | |
| 683 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 684 | Insurance issue | FAERS: 2 | US FAERS | |
| 685 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 686 | Intestinal Pseudo-Obstruction | FAERS: 2 | US FAERS | |
| 687 | Intestinal resection | FAERS: 2 | US FAERS | |
| 688 | Intestinal scarring | FAERS: 2 | US FAERS | |
| 689 | Intestinal sepsis | FAERS: 2 | US FAERS | |
| 690 | Joint destruction | FAERS: 2 | US FAERS | |
| 691 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 692 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 693 | Life expectancy shortened | FAERS: 2 | US FAERS | |
| 694 | Liver Abscess | FAERS: 2 | US FAERS | |
| 695 | Localised intraabdominal fluid collection | FAERS: 2 | US FAERS | |
| 696 | Lung consolidation | FAERS: 2 | US FAERS | |
| 697 | Lymphoma | FAERS: 2 | US FAERS | |
| 698 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 699 | Mastectomy | FAERS: 2 | US FAERS | |
| 700 | Mechanical ileus | FAERS: 2 | US FAERS | |
| 701 | Medical device site discharge | FAERS: 2 | US FAERS | |
| 702 | Medical device site granuloma | FAERS: 2 | US FAERS | |
| 703 | Medical device site inflammation | FAERS: 2 | US FAERS | |
| 704 | Medical device site papule | FAERS: 2 | US FAERS | |
| 705 | Medical device site vesicles | FAERS: 2 | US FAERS | |
| 706 | Megacolon | FAERS: 2 | US FAERS | |
| 707 | Meningioma | FAERS: 2 | US FAERS | |
| 708 | Meniscus injury | FAERS: 2 | US FAERS | |
| 709 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 710 | Moaning | FAERS: 2 | US FAERS | |
| 711 | Morbid thoughts | FAERS: 2 | US FAERS | |
| 712 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 713 | Muscle strain | FAERS: 2 | US FAERS | |
| 714 | Myocardial necrosis | FAERS: 2 | US FAERS | |
| 715 | Nail Infection | FAERS: 2 | US FAERS | |
| 716 | Nephrectomy | FAERS: 2 | US FAERS | |
| 717 | Norovirus test positive | FAERS: 2 | US FAERS | |
| 718 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 719 | Onychomycosis | FAERS: 2 | US FAERS | |
| 720 | Ophthalmic vein thrombosis | FAERS: 2 | US FAERS | |
| 721 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 722 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 723 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 724 | Oxalosis | FAERS: 2 | US FAERS | |
| 725 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 726 | Parkinsonism hyperpyrexia syndrome | FAERS: 2 | US FAERS | |
| 727 | Peripheral arthritis | FAERS: 2 | US FAERS | |
| 728 | Phlebitis | FAERS: 2 | US FAERS | |
| 729 | Photophobia | FAERS: 2 | US FAERS | |
| 730 | Physical assault | FAERS: 2 | US FAERS | |
| 731 | Pleurisy | FAERS: 2 | US FAERS | |
| 732 | Pleurothotonus | FAERS: 2 | US FAERS | |
| 733 | Polyneuropathy chronic | FAERS: 2 | US FAERS | |
| 734 | Polyuria | FAERS: 2 | US FAERS | |
| 735 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 736 | Post procedural discomfort | FAERS: 2 | US FAERS | |
| 737 | Post procedural pneumonia | FAERS: 2 | US FAERS | |
| 738 | Postoperative ileus | FAERS: 2 | US FAERS | |
| 739 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 740 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 741 | Procedural intestinal perforation | FAERS: 2 | US FAERS | |
| 742 | Procedural vomiting | FAERS: 2 | US FAERS | |
| 743 | Proctitis | FAERS: 2 | US FAERS | |
| 744 | Product container seal issue | FAERS: 2 | US FAERS | |
| 745 | Product formulation issue | FAERS: 2 | US FAERS | |
| 746 | Product leakage | FAERS: 2 | US FAERS | |
| 747 | Product residue present | FAERS: 2 | US FAERS | |
| 748 | Product size issue | FAERS: 2 | US FAERS | |
| 749 | Product supply issue | FAERS: 2 | US FAERS | |
| 750 | Psychosis postoperative | FAERS: 2 | US FAERS | |
| 751 | Pulmonary sepsis | FAERS: 2 | US FAERS | |
| 752 | Quadriparesis | FAERS: 2 | US FAERS | |
| 753 | Quadriplegia | FAERS: 2 | US FAERS | |
| 754 | Rales | FAERS: 2 | US FAERS | |
| 755 | Reaction to excipient | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 756 | Rectal Prolapse | FAERS: 2 | US FAERS | |
| 757 | Rectal discharge | FAERS: 2 | US FAERS | |
| 758 | Renal cyst | FAERS: 2 | US FAERS | |
| 759 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 760 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 761 | Saliva altered | FAERS: 2 | US FAERS | |
| 762 | Scan abnormal | FAERS: 2 | US FAERS | |
| 763 | Seasonal Affective Disorder | FAERS: 2 | US FAERS | |
| 764 | Senile dementia | FAERS: 2 | US FAERS | |
| 765 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 766 | Skeletal injury | FAERS: 2 | US FAERS | |
| 767 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 768 | Skin necrosis | FAERS: 2 | US FAERS | |
| 769 | Sleep Talking | FAERS: 2 | US FAERS | |
| 770 | Sneezing | FAERS: 2 | US FAERS | |
| 771 | Spondylitis | FAERS: 2 | US FAERS | |
| 772 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 773 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 774 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 775 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 776 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 777 | Talipes | FAERS: 2 | US FAERS | |
| 778 | Therapeutic product effect variable | FAERS: 2 | US FAERS | |
| 779 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 780 | Tongue biting | FAERS: 2 | US FAERS | |
| 781 | Tooth Infection | FAERS: 2 | US FAERS | |
| 782 | Traumatic fracture | FAERS: 2 | US FAERS | |
| 783 | Trichotillomania | FAERS: 2 | US FAERS | |
| 784 | Urethral Stenosis | FAERS: 2 | US FAERS | |
| 785 | Urticaria | FAERS: 2 | US FAERS | |
| 786 | Uterine Prolapse | FAERS: 2 | US FAERS | |
| 787 | Vaginal Prolapse | FAERS: 2 | US FAERS | |
| 788 | Varicocele | FAERS: 2 | US FAERS | |
| 789 | Venous aneurysm | FAERS: 2 | US FAERS | |
| 790 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 791 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 792 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 793 | Wound abscess | FAERS: 2 | US FAERS | |
| 794 | Wound sepsis | FAERS: 2 | US FAERS | |
| 795 | Writer's Cramp | FAERS: 2 | US FAERS | |
| 796 | Wrong device used | FAERS: 2 | US FAERS | |
| 797 | furuncle | FAERS: 2 | US FAERS | |
| 798 | intensive care | FAERS: 2 | US FAERS | |
| 799 | skin abrasion | FAERS: 2 | US FAERS | |
| 800 | Abdominal mass | FAERS: 1 | US FAERS | |
| 801 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 802 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 803 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 804 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 805 | Acute cardiac event | FAERS: 1 | US FAERS | |
| 806 | Agoraphobia | FAERS: 1 | US FAERS | |
| 807 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 808 | Albumin globulin ratio increased | FAERS: 1 | US FAERS | |
| 809 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 810 | Alcohol problem | FAERS: 1 | US FAERS | |
| 811 | Amimia | FAERS: 1 | US FAERS | |
| 812 | Ammonia increased | FAERS: 1 | US FAERS | |
| 813 | Amylase abnormal | FAERS: 1 | US FAERS | |
| 814 | Anal abscess | FAERS: 1 | US FAERS | |
| 815 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 816 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 817 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 818 | Angioedema | FAERS: 1 | US FAERS | |
| 819 | Anorexia | FAERS: 1 | 1101099 | CTD US FAERS |
| 820 | Anticipatory anxiety | FAERS: 1 | US FAERS | |
| 821 | Aortic Injury | FAERS: 1 | US FAERS | |
| 822 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 823 | Aphagia | FAERS: 1 | US FAERS | |
| 824 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 825 | Arthropod bite | FAERS: 1 | US FAERS | |
| 826 | Arthropod sting | FAERS: 1 | US FAERS | |
| 827 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 828 | Asymptomatic bacteriuria | FAERS: 1 | US FAERS | |
| 829 | Atlantoaxial instability | FAERS: 1 | US FAERS | |
| 830 | Autonomic failure syndrome | FAERS: 1 | US FAERS | |
| 831 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 832 | Autophobia | FAERS: 1 | US FAERS | |
| 833 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 834 | B-cell lymphoma stage IV | FAERS: 1 | US FAERS | |
| 835 | Bacterial abdominal infection | FAERS: 1 | US FAERS | |
| 836 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 837 | Barium swallow | FAERS: 1 | US FAERS | |
| 838 | Belligerence | FAERS: 1 | US FAERS | |
| 839 | Benign bone neoplasm | FAERS: 1 | US FAERS | |
| 840 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 841 | Bladder pain | FAERS: 1 | US FAERS | |
| 842 | Blepharospasm | FAERS: 1 | US FAERS | |
| 843 | Blister rupture | FAERS: 1 | US FAERS | |
| 844 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 845 | Blood blister | FAERS: 1 | US FAERS | |
| 846 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 847 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 848 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 849 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 850 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 851 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 852 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 853 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 854 | Bone contusion | FAERS: 1 | US FAERS | |
| 855 | Bowen's Disease | FAERS: 1 | US FAERS | |
| 856 | Brain Contusion | FAERS: 1 | US FAERS | |
| 857 | Brain Death | FAERS: 1 | US FAERS | |
| 858 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 859 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 860 | Breast discomfort | FAERS: 1 | US FAERS | |
| 861 | Bronchopulmonary disease | FAERS: 1 | US FAERS | |
| 862 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 863 | Bursa injury | FAERS: 1 | US FAERS | |
| 864 | Camptocormia | FAERS: 1 | US FAERS | |
| 865 | Cardioactive drug level increased | FAERS: 1 | US FAERS | |
| 866 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 867 | Catheter site abscess | FAERS: 1 | US FAERS | |
| 868 | Catheter site dermatitis | FAERS: 1 | US FAERS | |
| 869 | Catheter site injury | FAERS: 1 | US FAERS | |
| 870 | Catheter site necrosis | FAERS: 1 | US FAERS | |
| 871 | Catheter site pain | FAERS: 1 | US FAERS | |
| 872 | Catheter site phlebitis | FAERS: 1 | US FAERS | |
| 873 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 874 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 875 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 876 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 877 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 878 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 879 | Charles Bonnet Syndrome | FAERS: 1 | US FAERS | |
| 880 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 881 | Chemical peritonitis | FAERS: 1 | US FAERS | |
| 882 | Cholangitis | FAERS: 1 | US FAERS | |
| 883 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 884 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 885 | Citrobacter infection | FAERS: 1 | US FAERS | |
| 886 | Colectomy | FAERS: 1 | US FAERS | |
| 887 | Colon cancer recurrent | FAERS: 1 | US FAERS | |
| 888 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 889 | Complicated fracture | FAERS: 1 | US FAERS | |
| 890 | Compulsive lip biting | FAERS: 1 | US FAERS | |
| 891 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 892 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 893 | Cyanosis | FAERS: 1 | US FAERS | |
| 894 | Decreased vibratory sense | FAERS: 1 | US FAERS | |
| 895 | Dental discomfort | FAERS: 1 | US FAERS | |
| 896 | Device Failure | FAERS: 1 | US FAERS | |
| 897 | Device allergy | FAERS: 1 | US FAERS | |
| 898 | Device ineffective | FAERS: 1 | US FAERS | |
| 899 | Device intolerance | FAERS: 1 | US FAERS | |
| 900 | Device lead issue | FAERS: 1 | US FAERS | |
| 901 | Device material opacification | FAERS: 1 | US FAERS | |
| 902 | Device power source issue | FAERS: 1 | US FAERS | |
| 903 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 904 | Dissociation | FAERS: 1 | US FAERS | |
| 905 | Dolichocolon acquired | FAERS: 1 | US FAERS | |
| 906 | Drowning | FAERS: 1 | US FAERS | |
| 907 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 908 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 909 | Drug delivery device implantation | FAERS: 1 | US FAERS | |
| 910 | Drug dose omission by device | FAERS: 1 | US FAERS | |
| 911 | Drug resistance | FAERS: 1 | US FAERS | |
| 912 | Drug-device incompatibility | FAERS: 1 | US FAERS | |
| 913 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 914 | Duodenostomy | FAERS: 1 | US FAERS | |
| 915 | Dust inhalation pneumopathy | FAERS: 1 | US FAERS | |
| 916 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 917 | Ecchymosis | FAERS: 1 | US FAERS | |
| 918 | Economic problem | FAERS: 1 | US FAERS | |
| 919 | Elective procedure | FAERS: 1 | US FAERS | |
| 920 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 921 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 922 | Emergency Care | FAERS: 1 | US FAERS | |
| 923 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 924 | Endocrine test abnormal | FAERS: 1 | US FAERS | |
| 925 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 1 | US FAERS | |
| 926 | Enteritis | FAERS: 1 | US FAERS | |
| 927 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 928 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 929 | Epidural empyema | FAERS: 1 | US FAERS | |
| 930 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 931 | Erection increased | FAERS: 1 | US FAERS | |
| 932 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 933 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 934 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 935 | Exhibitionism | FAERS: 1 | US FAERS | |
| 936 | Expired drug administered | FAERS: 1 | US FAERS | |
| 937 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 938 | Eye Infection | FAERS: 1 | US FAERS | |
| 939 | Eye pain | FAERS: 1 | US FAERS | |
| 940 | Facial Paresis | FAERS: 1 | US FAERS | |
| 941 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 942 | Fascial infection | FAERS: 1 | US FAERS | |
| 943 | Fasting | FAERS: 1 | US FAERS | |
| 944 | Feeding intolerance | FAERS: 1 | US FAERS | |
| 945 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 946 | Femoral hernia incarcerated | FAERS: 1 | US FAERS | |
| 947 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 948 | Fistula discharge | FAERS: 1 | US FAERS | |
| 949 | Floppy iris syndrome | FAERS: 1 | US FAERS | |
| 950 | Fluid overload | FAERS: 1 | US FAERS | |
| 951 | Folliculitis | FAERS: 1 | US FAERS | |
| 952 | Food craving | FAERS: 1 | US FAERS | |
| 953 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 954 | Gambling | FAERS: 1 | US FAERS | |
| 955 | Gastric Lavage | FAERS: 1 | US FAERS | |
| 956 | Gastric Stenosis | FAERS: 1 | US FAERS | |
| 957 | Gastric adenoma | FAERS: 1 | US FAERS | |
| 958 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 959 | Gastrointestinal dysplasia | FAERS: 1 | US FAERS | |
| 960 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 961 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 962 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 963 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 964 | Gastrointestinal stoma output decreased | FAERS: 1 | US FAERS | |
| 965 | Gastrointestinal tract adenoma | FAERS: 1 | US FAERS | |
| 966 | Gastrointestinal tube removal | FAERS: 1 | US FAERS | |
| 967 | Gastrostomy failure | FAERS: 1 | US FAERS | |
| 968 | Gene Mutation | FAERS: 1 | US FAERS | |
| 969 | General physical condition | FAERS: 1 | US FAERS | |
| 970 | Gliosis | FAERS: 1 | US FAERS | |
| 971 | Glossitis | FAERS: 1 | US FAERS | |
| 972 | Grief reaction | FAERS: 1 | US FAERS | |
| 973 | Hair injury | FAERS: 1 | US FAERS | |
| 974 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 975 | Hanging | FAERS: 1 | US FAERS | |
| 976 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 977 | Heat Stroke | FAERS: 1 | US FAERS | |
| 978 | Heat illness | FAERS: 1 | US FAERS | |
| 979 | Hemiplegia | FAERS: 1 | US FAERS | |
| 980 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 981 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 982 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 983 | Hirsutism | FAERS: 1 | US FAERS | |
| 984 | Hunger | FAERS: 1 | US FAERS | |
| 985 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 986 | Hypersplenism | FAERS: 1 | US FAERS | |
| 987 | Hysterectomy | FAERS: 1 | US FAERS | |
| 988 | Hysteroscopy | FAERS: 1 | US FAERS | |
| 989 | Illogical thinking | FAERS: 1 | US FAERS | |
| 990 | Immunosuppression | FAERS: 1 | US FAERS | |
| 991 | Implant site dehiscence | FAERS: 1 | US FAERS | |
| 992 | Implant site dermatitis | FAERS: 1 | US FAERS | |
| 993 | Implant site extravasation | FAERS: 1 | US FAERS | |
| 994 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 995 | Incision site abscess | FAERS: 1 | US FAERS | |
| 996 | Incision site erythema | FAERS: 1 | US FAERS | |
| 997 | Incision site pain | FAERS: 1 | US FAERS | |
| 998 | Incision site swelling | FAERS: 1 | US FAERS | |
| 999 | Incisional hernia | FAERS: 1 | US FAERS | |
| 1000 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 1001 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 1002 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 1003 | Induration | FAERS: 1 | US FAERS | |
| 1004 | Infective spondylitis | FAERS: 1 | US FAERS | |
| 1005 | Inflammatory marker test | FAERS: 1 | US FAERS | |
| 1006 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 1007 | Infusion site vesicles | FAERS: 1 | US FAERS | |
| 1008 | Inguinal hernia perforation | FAERS: 1 | US FAERS | |
| 1009 | Injection site mass | FAERS: 1 | US FAERS | |
| 1010 | Injury associated with device | FAERS: 1 | US FAERS | |
| 1011 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 1012 | Intertrigo | FAERS: 1 | US FAERS | |
| 1013 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 1014 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 1015 | Intestinal smooth muscle hypertrophy | FAERS: 1 | US FAERS | |
| 1016 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 1017 | Isosporiasis | FAERS: 1 | US FAERS | |
| 1018 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 1019 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 1020 | Laryngeal neoplasm | FAERS: 1 | US FAERS | |
| 1021 | Laryngitis | FAERS: 1 | US FAERS | |
| 1022 | Lateral Medullary Syndrome | FAERS: 1 | US FAERS | |
| 1023 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 1024 | Leukopenia | FAERS: 1 | US FAERS | |
| 1025 | Ligament rupture | FAERS: 1 | US FAERS | |
| 1026 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 1027 | Lipase abnormal | FAERS: 1 | US FAERS | |
| 1028 | Lithotripsy | FAERS: 1 | US FAERS | |
| 1029 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 1030 | Loose tooth | FAERS: 1 | US FAERS | |
| 1031 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1032 | Lumbar radiculopathy | FAERS: 1 | US FAERS | |
| 1033 | Lung Abscess | FAERS: 1 | US FAERS | |
| 1034 | Lung perforation | FAERS: 1 | US FAERS | |
| 1035 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 1036 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 1037 | Marasmus | FAERS: 1 | US FAERS | |
| 1038 | Mastitis | FAERS: 1 | US FAERS | |
| 1039 | Medical device implantation | FAERS: 1 | US FAERS | |
| 1040 | Medical device repositioning | FAERS: 1 | US FAERS | |
| 1041 | Medical device site burn | FAERS: 1 | US FAERS | |
| 1042 | Medical device site calcification | FAERS: 1 | US FAERS | |
| 1043 | Medical device site discomfort | FAERS: 1 | US FAERS | |
| 1044 | Medical device site irritation | FAERS: 1 | US FAERS | |
| 1045 | Medical device site mass | FAERS: 1 | US FAERS | |
| 1046 | Medical device site reaction | FAERS: 1 | US FAERS | |
| 1047 | Medical device site scab | FAERS: 1 | US FAERS | |
| 1048 | Medical device site swelling | FAERS: 1 | US FAERS | |
| 1049 | Medical procedure | FAERS: 1 | US FAERS | |
| 1050 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 1051 | Meningitis | FAERS: 1 | US FAERS | |
| 1052 | Menorrhagia | FAERS: 1 | US FAERS | |
| 1053 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 1054 | Merycism | FAERS: 1 | US FAERS | |
| 1055 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 1056 | Metastasis | FAERS: 1 | US FAERS | |
| 1057 | Metastatic uterine cancer | FAERS: 1 | US FAERS | |
| 1058 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 1059 | Monoparesis | FAERS: 1 | US FAERS | |
| 1060 | Monoplegia | FAERS: 1 | US FAERS | |
| 1061 | Mood disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1062 | Mouth swelling | FAERS: 1 | US FAERS | |
| 1063 | Mucosal necrosis | FAERS: 1 | US FAERS | |
| 1064 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 1065 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 1066 | Musculoskeletal foreign body | FAERS: 1 | US FAERS | |
| 1067 | Mutism | FAERS: 1 | US FAERS | |
| 1068 | Narcolepsy | FAERS: 1 | US FAERS | |
| 1069 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 1070 | Near Drowning | FAERS: 1 | US FAERS | |
| 1071 | Necrosis | FAERS: 1 | US FAERS | |
| 1072 | Negativism | FAERS: 1 | US FAERS | |
| 1073 | Nerve Block | FAERS: 1 | US FAERS | |
| 1074 | Nerve injury | FAERS: 1 | US FAERS | |
| 1075 | Nerve stimulation test abnormal | FAERS: 1 | US FAERS | |
| 1076 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 1077 | Neutrophil morphology abnormal | FAERS: 1 | US FAERS | |
| 1078 | Nodule | FAERS: 1 | US FAERS | |
| 1079 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 1080 | Nuclear magnetic resonance imaging joint | FAERS: 1 | US FAERS | |
| 1081 | Nystagmus | FAERS: 1 | US FAERS | |
| 1082 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 1083 | Off label use of device | FAERS: 1 | US FAERS | |
| 1084 | Oliguria | FAERS: 1 | US FAERS | |
| 1085 | Oral discharge | FAERS: 1 | US FAERS | |
| 1086 | Orchitis | FAERS: 1 | US FAERS | |
| 1087 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 1088 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 1089 | Osteitis | FAERS: 1 | US FAERS | |
| 1090 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 1091 | Pain of skin | FAERS: 1 | US FAERS | |
| 1092 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 1093 | Paranasal cyst | FAERS: 1 | US FAERS | |
| 1094 | Paraparesis | FAERS: 1 | US FAERS | |
| 1095 | Paresis anal sphincter | FAERS: 1 | US FAERS | |
| 1096 | Paroxysmal arrhythmia | FAERS: 1 | US FAERS | |
| 1097 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 1098 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 1099 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 1100 | Pelvic prolapse | FAERS: 1 | US FAERS | |
| 1101 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 1102 | Periarthritis | FAERS: 1 | US FAERS | |
| 1103 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 1104 | Pericarditis | FAERS: 1 | US FAERS | |
| 1105 | Perihepatic abscess | FAERS: 1 | US FAERS | |
| 1106 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 1107 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 1108 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 1109 | Peritoneal Fibrosis | FAERS: 1 | US FAERS | |
| 1110 | Peritoneal perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1111 | Personality change due to a general medical condition | FAERS: 1 | US FAERS | |
| 1112 | Pharyngitis | FAERS: 1 | US FAERS | |
| 1113 | Pilonidal Cyst | FAERS: 1 | US FAERS | |
| 1114 | Platelet distribution width increased | FAERS: 1 | US FAERS | |
| 1115 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 1116 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 1117 | Post lumbar puncture syndrome | FAERS: 1 | US FAERS | |
| 1118 | Post procedural fistula | FAERS: 1 | US FAERS | |
| 1119 | Post procedural pulmonary embolism | FAERS: 1 | US FAERS | |
| 1120 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 1121 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 1122 | Postoperative Care | FAERS: 1 | US FAERS | |
| 1123 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 1124 | Postoperative delirium | FAERS: 1 | US FAERS | |
| 1125 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 1126 | Poverty of speech | FAERS: 1 | US FAERS | |
| 1127 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 1128 | Prerenal failure | FAERS: 1 | US FAERS | |
| 1129 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 1130 | Priapism | FAERS: 1 | US FAERS | |
| 1131 | Procedural anxiety | FAERS: 1 | US FAERS | |
| 1132 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 1133 | Product availability issue | FAERS: 1 | US FAERS | |
| 1134 | Product commingling | FAERS: 1 | US FAERS | |
| 1135 | Product contamination physical | FAERS: 1 | US FAERS | |
| 1136 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 1137 | Product lot number issue | FAERS: 1 | US FAERS | |
| 1138 | Product packaging issue | FAERS: 1 | US FAERS | |
| 1139 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 1140 | Prosopagnosia | FAERS: 1 | US FAERS | |
| 1141 | Prostatectomy | FAERS: 1 | US FAERS | |
| 1142 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 1143 | Proteinuria | FAERS: 1 | US FAERS | |
| 1144 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 1145 | Psoriasis | FAERS: 1 | US FAERS | |
| 1146 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 1147 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 1148 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 1149 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1150 | Puncture site erythema | FAERS: 1 | US FAERS | |
| 1151 | Pyelocystitis | FAERS: 1 | US FAERS | |
| 1152 | Radiculopathy | FAERS: 1 | US FAERS | |
| 1153 | Rash erythematous | FAERS: 1 | US FAERS | |
| 1154 | Rectal abscess | FAERS: 1 | US FAERS | |
| 1155 | Rectal injury | FAERS: 1 | US FAERS | |
| 1156 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 1157 | Rectocele | FAERS: 1 | US FAERS | |
| 1158 | Refeeding Syndrome | FAERS: 1 | US FAERS | |
| 1159 | Renal mass | FAERS: 1 | US FAERS | |
| 1160 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 1161 | Respiratory Paralysis | FAERS: 1 | US FAERS | |
| 1162 | Resting Tremor | FAERS: 1 | US FAERS | |
| 1163 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 1164 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 1165 | Rhonchi | FAERS: 1 | US FAERS | |
| 1166 | Scab | FAERS: 1 | US FAERS | |
| 1167 | Selective eating disorder | FAERS: 1 | US FAERS | |
| 1168 | Seminoma | FAERS: 1 | US FAERS | |
| 1169 | Sense of oppression | FAERS: 1 | US FAERS | |
| 1170 | Serotonin Syndrome | FAERS: 1 | 9048728 | CTD US FAERS |
| 1171 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 1172 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 1173 | Skin Erosion | FAERS: 1 | US FAERS | |
| 1174 | Skin reaction | FAERS: 1 | US FAERS | |
| 1175 | Small Intestinal Stenosis | FAERS: 1 | US FAERS | |
| 1176 | Snoring | FAERS: 1 | US FAERS | |
| 1177 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 1178 | Somnambulism | FAERS: 1 | US FAERS | |
| 1179 | Sopor | FAERS: 1 | US FAERS | |
| 1180 | Spinal cord abscess | FAERS: 1 | US FAERS | |
| 1181 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 1182 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 1183 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 1184 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1185 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 1186 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 1187 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1188 | Stenosis | FAERS: 1 | US FAERS | |
| 1189 | Stoma closure | FAERS: 1 | US FAERS | |
| 1190 | Stomal hernia | FAERS: 1 | US FAERS | |
| 1191 | Strabismus | FAERS: 1 | US FAERS | |
| 1192 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 1193 | Superinfection | FAERS: 1 | US FAERS | |
| 1194 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 1195 | Suture rupture | FAERS: 1 | US FAERS | |
| 1196 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1197 | Synovitis | FAERS: 1 | US FAERS | |
| 1198 | Taciturnity | FAERS: 1 | US FAERS | |
| 1199 | Testicular cancer metastatic | FAERS: 1 | US FAERS | |
| 1200 | Testicular hypertrophy | FAERS: 1 | US FAERS | |
| 1201 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 1202 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1203 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 1204 | Thirst | FAERS: 1 | US FAERS | |
| 1205 | Throat cancer | FAERS: 1 | US FAERS | |
| 1206 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1207 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 1208 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1209 | Tongue blistering | FAERS: 1 | US FAERS | |
| 1210 | Tongue eruption | FAERS: 1 | US FAERS | |
| 1211 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 1212 | Traumatic liver injury | FAERS: 1 | US FAERS | |
| 1213 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1214 | Trismus | FAERS: 1 | US FAERS | |
| 1215 | Ultrasound Doppler abnormal | FAERS: 1 | US FAERS | |
| 1216 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 1217 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1218 | Uterine Perforation | FAERS: 1 | US FAERS | |
| 1219 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1220 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1221 | Vertebral foraminal stenosis | FAERS: 1 | US FAERS | |
| 1222 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 1223 | Vessel perforation | FAERS: 1 | US FAERS | |
| 1224 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 1225 | Victim of spousal abuse | FAERS: 1 | US FAERS | |
| 1226 | Viral test positive | FAERS: 1 | US FAERS | |
| 1227 | Visual disturbance | FAERS: 1 | US FAERS | |
| 1228 | Vitamin B12 abnormal | FAERS: 1 | US FAERS | |
| 1229 | Vitamin B6 abnormal | FAERS: 1 | US FAERS | |
| 1230 | Vitamin B6 decreased | FAERS: 1 | US FAERS | |
| 1231 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 1232 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1233 | Wound infection bacterial | FAERS: 1 | US FAERS | |
| 1234 | Wound infection pseudomonas | FAERS: 1 | US FAERS | |
| 1235 | Wound necrosis | FAERS: 1 | US FAERS | |
| 1236 | Wrong dosage form | FAERS: 1 | US FAERS | |
| 1237 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 1238 | Wrong product administered | FAERS: 1 | US FAERS | |
| 1239 | colonoscopy | FAERS: 1 | US FAERS | |
| 1240 | jaundice | FAERS: 1 | US FAERS | |
| 1241 | kyphosis | FAERS: 1 | US FAERS | |
| 1242 | oligodendroglioma | FAERS: 1 | US FAERS | |
| 1243 | Amblyopia | 7557504 | CTD | |
| 1244 | Bipolar Disorder | 6122382 | CTD | |
| 1245 | Catalepsy | 9416775 | CTD | |
| 1246 | Catheter site nodule | Canada Vigilance: 1 | Canada Vigilance | |
| 1247 | Cholestasis | 3419093 | CTD | |
| 1248 | Confusion | CTD | ||
| 1249 | Device malfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 1250 | Diarrhea | 9048728 | CTD | |
| 1251 | Disruptive, Impulse Control, and Conduct Disorders | 9613761 | CTD | |
| 1252 | Dyskinesia, Drug-Induced |
48968
847450 1172755 2272024 2320253 2576311 2611764 3002197 7806739 8749992 9266731 10496290 10762340 10762498 11168568 14743355 15721172 15802193 16258207 16684788 17222394 17588764 17960553 | CTD | |
| 1253 | Gastrointestinal Diseases | 847450 | CTD | |
| 1254 | Hallucinations | CTD | ||
| 1255 | Hyperprolactinemia | 7105431 | CTD | |
| 1256 | Immune-mediated adverse reaction | Canada Vigilance: 3 | Canada Vigilance | |
| 1257 | Movement Disorders | 1101099 | CTD | |
| 1258 | Muscle hypotonia | 847450 | CTD | |
| 1259 | Nocturnal Myoclonus Syndrome | 14592347 | CTD | |
| 1260 | Orchitis noninfective | Canada Vigilance: 1 | Canada Vigilance | |
| 1261 | Papilledema | 454080 | CTD | |
| 1262 | Parkinson Disease |
71602
104005 388600 454080 778880 818540 847450 1095374 1101099 1172755 1469397 2044308 2969951 3002197 3185626 3401861 3401862 3658164 3808304 6110850 6622345 7103786 7159813 7806739 8117413 8242964 8440292 8726538 9221983 9613761 9921882 10496290 10751276 10994027 11261747 11437169 11938583 12165940 14609812 16258207 16534128 18361473 19795477 | CTD | |
| 1263 | Parkinsonian Disorders | CTD | ||
| 1264 | Psychoses, Substance-Induced | 60643 847450 10994027 | CTD | |
| 1265 | Seizures | 3758188 | CTD | |
| 1266 | Sleep Wake Disorders | 11437169 | CTD | |
| 1267 | Stereotypic Movement Disorder | 9266731 | CTD | |
| 1268 | Substance Withdrawal Syndrome | 3401861 3797365 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.