Budesonide
(VOVIALXJUBGFJZ-KWVAZRHASA-N)
Structure
- SMILES
- CCCC1O[C@H]2[C@](O1)(C(=O)CO)[C@@]1([C@@H](C2)[C@@H]2CCC3=CC(=O)C=C[C@@]3([C@H]2[C@H](C1)O)C)C
- Type(s)
- Approved
- ATC code(s)
- A07EA06; D07AC09; R01AD05; R03AK07; R03AK12; R03BA02
- Molecular Formula:
- C25H34O6
- Molecular Weight:
- 430.534
- Log P:
- 2.7168
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 93.06
- CAS Number(s):
- 51333-22-3; 51372-29-3
Synonym(s)
1.
Budesonide
2.
Budesonide, (R)-Isomer
3.
Budesonide, (S)-Isomer
4.
Horacort
5.
Pulmicort
6.
Rhinocort
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 468 | OFFSIDES US FAERS | |
| 2 | Drug ineffective | FAERS: 430 Canada Vigilance: 65 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Asthma | FAERS: 396 Canada Vigilance: 5 |
6958474
9701427 10347961 10400838 10806605 10893010 10894975 11555383 11694816 12113382 12604023 14641354 15136378 15341026 15572850 18489783 20004779 22607479 | CTD OFFSIDES Canada Vigilance US FAERS |
| 4 | Intentional product misuse | FAERS: 275 | US FAERS | |
| 5 | Malaise | FAERS: 274 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Circumstance or information capable of leading to medication error | FAERS: 182 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Product use issue | FAERS: 171 | US FAERS | |
| 8 | Product quality issue | FAERS: 170 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 9 | Device malfunction | FAERS: 126 Canada Vigilance: 14 | Canada Vigilance OFFSIDES US FAERS | |
| 10 | Headache | FAERS: 115 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Product use in unapproved indication | FAERS: 108 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Feeling abnormal | FAERS: 99 | SIDER US FAERS | |
| 13 | Dizziness | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Wheezing | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Dysphonia | FAERS: 86 | 6648863 7664859 | CTD OFFSIDES SIDER US FAERS |
| 16 | Chest discomfort | FAERS: 85 | US FAERS | |
| 17 | Device Failure | FAERS: 85 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Pneumonia | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Fatigue | FAERS: 74 Canada Vigilance: 1 | 16270719 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 20 | Hypersensitivity | FAERS: 69 | SIDER US FAERS | |
| 21 | Nausea | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Intentional drug misuse | FAERS: 67 | OFFSIDES US FAERS | |
| 23 | Dysgeusia | FAERS: 64 | OFFSIDES SIDER US FAERS | |
| 24 | Incorrect dose administered | FAERS: 64 | OFFSIDES US FAERS | |
| 25 | Nasopharyngitis | FAERS: 64 | OFFSIDES SIDER US FAERS | |
| 26 | Adverse event | FAERS: 60 | US FAERS | |
| 27 | Throat irritation | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Bronchitis | FAERS: 57 | OFFSIDES SIDER US FAERS | |
| 29 | Oropharyngeal pain | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 30 | Sinusitis | FAERS: 53 | OFFSIDES SIDER US FAERS | |
| 31 | Weight decreased | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Pruritus | FAERS: 50 | SIDER US FAERS | |
| 33 | Anxiety | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 34 | Intentional device misuse | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Medication Error | FAERS: 49 | US FAERS | |
| 36 | Epistaxis | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 37 | Pain | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 38 | Nervousness | FAERS: 44 | SIDER US FAERS | |
| 39 | Chest Pain | FAERS: 41 | OFFSIDES SIDER US FAERS | |
| 40 | Vomiting | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Wrong technique in product usage process | FAERS: 39 | US FAERS | |
| 42 | Asthenia | FAERS: 38 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 43 | Multiple allergies | FAERS: 37 | OFFSIDES US FAERS | |
| 44 | Nasal discomfort | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 45 | Drug ineffective for unapproved indication | FAERS: 31 | US FAERS | |
| 46 | Erythema | FAERS: 30 | US FAERS | |
| 47 | Memory impairment | FAERS: 30 | US FAERS | |
| 48 | Palpitations | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 49 | Therapeutic response unexpected | FAERS: 29 | US FAERS | |
| 50 | Drug exposure during pregnancy | FAERS: 28 | OFFSIDES US FAERS | |
| 51 | Product dose omission | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Drug administered to patient of inappropriate age | FAERS: 26 | US FAERS | |
| 53 | Drug administration error | FAERS: 26 | US FAERS | |
| 54 | Drug prescribing error | FAERS: 26 | US FAERS | |
| 55 | Tremor | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 56 | Urticaria | FAERS: 25 | SIDER US FAERS | |
| 57 | Visual Impairment | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Wrong technique in drug usage process | FAERS: 24 | US FAERS | |
| 59 | Abdominal Pain | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 60 | Abdominal discomfort | FAERS: 23 | OFFSIDES US FAERS | |
| 61 | Cataract | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 62 | Colitis | FAERS: 23 | OFFSIDES US FAERS | |
| 63 | Product taste abnormal | FAERS: 23 | US FAERS | |
| 64 | Somnolence | FAERS: 23 | SIDER US FAERS | |
| 65 | Stomatitis | FAERS: 23 | US FAERS | |
| 66 | Increased upper airway secretion | FAERS: 22 | OFFSIDES US FAERS | |
| 67 | Therapy cessation | FAERS: 22 | US FAERS | |
| 68 | Arthralgia | FAERS: 21 | SIDER US FAERS | |
| 69 | Blood glucose increased | FAERS: 21 | US FAERS | |
| 70 | Bronchospasm | FAERS: 21 | SIDER US FAERS | |
| 71 | Influenza | FAERS: 21 | SIDER US FAERS | |
| 72 | Product substitution issue | FAERS: 21 | US FAERS | |
| 73 | Discomfort | FAERS: 20 | SIDER US FAERS | |
| 74 | General physical health deterioration | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Myalgia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 76 | Wrong technique in device usage process | FAERS: 20 | US FAERS | |
| 77 | Alopecia | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 78 | Laryngitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | No adverse event | FAERS: 19 | US FAERS | |
| 80 | Aphonia | FAERS: 18 | OFFSIDES US FAERS | |
| 81 | Burning sensation | FAERS: 18 | US FAERS | |
| 82 | Drug effect incomplete | FAERS: 18 | US FAERS | |
| 83 | Expired drug administered | FAERS: 18 | OFFSIDES US FAERS | |
| 84 | Skin laceration | FAERS: 18 | OFFSIDES US FAERS | |
| 85 | Back Pain | FAERS: 17 | SIDER US FAERS | |
| 86 | Restlessness | FAERS: 17 | US FAERS | |
| 87 | Sneezing | FAERS: 17 | SIDER US FAERS | |
| 88 | Diabetes Mellitus | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 89 | Intentional product use issue | FAERS: 16 | US FAERS | |
| 90 | Osteoporosis | FAERS: 16 | SIDER US FAERS | |
| 91 | Agitation | FAERS: 15 | SIDER US FAERS | |
| 92 | Anger | FAERS: 15 | OFFSIDES US FAERS | |
| 93 | Dehydration | FAERS: 15 | OFFSIDES US FAERS | |
| 94 | Drug dispensing error | FAERS: 15 | US FAERS | |
| 95 | Pharmaceutical product complaint | FAERS: 15 | OFFSIDES US FAERS | |
| 96 | Productive Cough | FAERS: 15 | US FAERS | |
| 97 | Pulmonary congestion | FAERS: 15 | OFFSIDES US FAERS | |
| 98 | Sinus headache | FAERS: 15 | OFFSIDES US FAERS | |
| 99 | Activities of daily living impaired | FAERS: 14 | OFFSIDES US FAERS | |
| 100 | Constipation | FAERS: 14 | SIDER US FAERS | |
| 101 | Crying | FAERS: 14 | US FAERS | |
| 102 | Disease recurrence | FAERS: 14 | US FAERS | |
| 103 | Expired product administered | FAERS: 14 | US FAERS | |
| 104 | Inappropriate schedule of drug administration | FAERS: 14 | US FAERS | |
| 105 | Overdose | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 106 | Accidental exposure | FAERS: 13 | OFFSIDES US FAERS | |
| 107 | Ageusia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 108 | Incorrect route of drug administration | FAERS: 13 | US FAERS | |
| 109 | Infection | FAERS: 13 | SIDER US FAERS | |
| 110 | Joint swelling | FAERS: 13 | SIDER US FAERS | |
| 111 | Choking | FAERS: 12 | US FAERS | |
| 112 | Device defective | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 113 | Eye irritation | FAERS: 12 | US FAERS | |
| 114 | Feeling jittery | FAERS: 12 | US FAERS | |
| 115 | Glaucoma | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 116 | Retching | FAERS: 12 | US FAERS | |
| 117 | Amnesia | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 118 | Circumstance or information capable of leading to device use error | FAERS: 11 | US FAERS | |
| 119 | Dyspepsia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 120 | Flatulence | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 121 | Medication residue present | FAERS: 11 | US FAERS | |
| 122 | Neck Pain | FAERS: 11 | SIDER US FAERS | |
| 123 | Oral candidiasis | FAERS: 11 | SIDER US FAERS | |
| 124 | Oral pain | FAERS: 11 | US FAERS | |
| 125 | Pharyngolaryngeal Pain | FAERS: 11 | OFFSIDES US FAERS | |
| 126 | Swelling | FAERS: 11 | SIDER US FAERS | |
| 127 | Acne | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 128 | Anosmia | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 129 | Arthritis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 130 | Candidiasis | FAERS: 10 | US FAERS | |
| 131 | Dental caries | FAERS: 10 | US FAERS | |
| 132 | Depressed mood | FAERS: 10 | OFFSIDES US FAERS | |
| 133 | Lethargy | FAERS: 10 | US FAERS | |
| 134 | Macular degeneration | FAERS: 10 | US FAERS | |
| 135 | Pharyngitis | FAERS: 10 | SIDER US FAERS | |
| 136 | Respiratory tract congestion | FAERS: 10 | OFFSIDES US FAERS | |
| 137 | Rhinalgia | FAERS: 10 | US FAERS | |
| 138 | Syncope | FAERS: 10 | SIDER US FAERS | |
| 139 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 140 | Growth retardation | FAERS: 9 | SIDER US FAERS | |
| 141 | Head discomfort | FAERS: 9 | US FAERS | |
| 142 | Incorrect drug administration duration | FAERS: 9 | US FAERS | |
| 143 | Maternal exposure during pregnancy | FAERS: 9 | US FAERS | |
| 144 | Myocardial Infarction | FAERS: 9 | US FAERS | |
| 145 | Secretion discharge | FAERS: 9 | US FAERS | |
| 146 | Accidental overdose | FAERS: 8 | US FAERS | |
| 147 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 148 | Eczema | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 149 | Extra dose administered | FAERS: 8 | US FAERS | |
| 150 | Incorrect product storage | FAERS: 8 | US FAERS | |
| 151 | Lactose Intolerance | FAERS: 8 | US FAERS | |
| 152 | Lip swelling | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | Peripheral swelling | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Tachycardia | FAERS: 8 | SIDER US FAERS | |
| 155 | Thirst | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 156 | Tinnitus | FAERS: 8 | US FAERS | |
| 157 | Unevaluable event | FAERS: 8 | OFFSIDES US FAERS | |
| 158 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 159 | Blindness | FAERS: 7 | US FAERS | |
| 160 | Blood potassium decreased | FAERS: 7 | OFFSIDES US FAERS | |
| 161 | Bone density decreased | FAERS: 7 | OFFSIDES US FAERS | |
| 162 | Dry skin | FAERS: 7 | OFFSIDES US FAERS | |
| 163 | Ear discomfort | FAERS: 7 | OFFSIDES US FAERS | |
| 164 | Eye pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 165 | Frustration | FAERS: 7 | OFFSIDES US FAERS | |
| 166 | Hypotension | FAERS: 7 | US FAERS | |
| 167 | Laceration | FAERS: 7 | OFFSIDES US FAERS | |
| 168 | Product physical issue | FAERS: 7 | US FAERS | |
| 169 | Pulmonary function test decreased | FAERS: 7 | OFFSIDES US FAERS | |
| 170 | Sepsis | FAERS: 7 | US FAERS | |
| 171 | Stress | FAERS: 7 | OFFSIDES US FAERS | |
| 172 | Thrombosis | FAERS: 7 | US FAERS | |
| 173 | Ulcer | FAERS: 7 | SIDER US FAERS | |
| 174 | Asphyxia | FAERS: 6 | US FAERS | |
| 175 | Chills | FAERS: 6 | US FAERS | |
| 176 | Dementia | FAERS: 6 | 16924038 | CTD US FAERS |
| 177 | Dermatitis | FAERS: 6 | SIDER US FAERS | |
| 178 | Emotional disorder | FAERS: 6 | US FAERS | |
| 179 | Emotional distress | FAERS: 6 | OFFSIDES US FAERS | |
| 180 | Flushing | FAERS: 6 | SIDER US FAERS | |
| 181 | Hunger | FAERS: 6 | US FAERS | |
| 182 | Incorrect dose administered by device | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Inflammation | FAERS: 6 | US FAERS | |
| 184 | Insurance issue | FAERS: 6 | US FAERS | |
| 185 | Nasal mucosal disorder | FAERS: 6 | US FAERS | |
| 186 | Pneumonitis | FAERS: 6 | US FAERS | |
| 187 | Poor quality sleep | FAERS: 6 | US FAERS | |
| 188 | Product container issue | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Rhinitis | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 190 | Sleep disorder due to general medical condition, insomnia type | FAERS: 6 | US FAERS | |
| 191 | Symptom recurrence | FAERS: 6 | US FAERS | |
| 192 | Aphagia | FAERS: 5 | US FAERS | |
| 193 | Bedridden | FAERS: 5 | US FAERS | |
| 194 | Bone pain | FAERS: 5 | OFFSIDES US FAERS | |
| 195 | Clostridium difficile infection | FAERS: 5 | US FAERS | |
| 196 | Conjunctivitis | FAERS: 5 | SIDER US FAERS | |
| 197 | Cyanosis | FAERS: 5 | OFFSIDES US FAERS | |
| 198 | Cystitis | FAERS: 5 | US FAERS | |
| 199 | Device breakage | FAERS: 5 | OFFSIDES US FAERS | |
| 200 | Disease Progression | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Drug dose omission by device | FAERS: 5 | US FAERS | |
| 202 | Dysphemia | FAERS: 5 | OFFSIDES US FAERS | |
| 203 | Dysuria | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 204 | Frustration tolerance decreased | FAERS: 5 | US FAERS | |
| 205 | Hepatitis B | FAERS: 5 | US FAERS | |
| 206 | Hypothyroidism | FAERS: 5 | US FAERS | |
| 207 | Inability to afford medication | FAERS: 5 | US FAERS | |
| 208 | Joint injury | FAERS: 5 | OFFSIDES US FAERS | |
| 209 | Limb injury | FAERS: 5 | OFFSIDES US FAERS | |
| 210 | Mental impairment | FAERS: 5 | OFFSIDES US FAERS | |
| 211 | Mood swings | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 212 | Musculoskeletal discomfort | FAERS: 5 | SIDER US FAERS | |
| 213 | Product availability issue | FAERS: 5 | US FAERS | |
| 214 | Product supply issue | FAERS: 5 | US FAERS | |
| 215 | Rales | FAERS: 5 | US FAERS | |
| 216 | Reaction to drug excipients | FAERS: 5 | US FAERS | |
| 217 | Respiratory tract irritation | FAERS: 5 | US FAERS | |
| 218 | Rheumatoid Arthritis | FAERS: 5 | US FAERS | |
| 219 | Rotator cuff syndrome | FAERS: 5 | US FAERS | |
| 220 | Sleep disorder due to a general medical condition | FAERS: 5 | US FAERS | |
| 221 | Upper-airway cough syndrome | FAERS: 5 | US FAERS | |
| 222 | Wrong drug administered | FAERS: 5 | OFFSIDES US FAERS | |
| 223 | Abasia | FAERS: 4 | US FAERS | |
| 224 | Angioedema | FAERS: 4 | 14641354 | CTD SIDER US FAERS |
| 225 | Anorectal discomfort | FAERS: 4 | OFFSIDES US FAERS | |
| 226 | Arthropathy | FAERS: 4 | OFFSIDES US FAERS | |
| 227 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 228 | Bronchial Hyperreactivity | FAERS: 4 | 30189237 | CTD US FAERS |
| 229 | Cachexia | FAERS: 4 | US FAERS | |
| 230 | Cystic Fibrosis | FAERS: 4 | US FAERS | |
| 231 | Device difficult to use | FAERS: 4 | US FAERS | |
| 232 | Device use issue | FAERS: 4 | US FAERS | |
| 233 | Diverticulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 234 | Food Allergy | FAERS: 4 | OFFSIDES US FAERS | |
| 235 | General symptom | FAERS: 4 | US FAERS | |
| 236 | Hypersomnia | FAERS: 4 | US FAERS | |
| 237 | Hypomania | FAERS: 4 | US FAERS | |
| 238 | Impaired work ability | FAERS: 4 | US FAERS | |
| 239 | Intestinal Obstruction | FAERS: 4 | SIDER US FAERS | |
| 240 | Laryngospasm | FAERS: 4 | US FAERS | |
| 241 | Limb discomfort | FAERS: 4 | US FAERS | |
| 242 | Liquid product physical issue | FAERS: 4 | US FAERS | |
| 243 | Medical device complication | FAERS: 4 | OFFSIDES US FAERS | |
| 244 | Mental status changes | FAERS: 4 | US FAERS | |
| 245 | Nasal Polyps | FAERS: 4 | US FAERS | |
| 246 | Necrosis | FAERS: 4 | US FAERS | |
| 247 | Off label use of device | FAERS: 4 | US FAERS | |
| 248 | Product use complaint | FAERS: 4 | US FAERS | |
| 249 | Pulmonary pain | FAERS: 4 | US FAERS | |
| 250 | Respiratory Failure | FAERS: 4 | OFFSIDES US FAERS | |
| 251 | Sarcoidosis | FAERS: 4 | US FAERS | |
| 252 | Terminal state | FAERS: 4 | US FAERS | |
| 253 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 254 | Urinary tract infection | FAERS: 4 | SIDER US FAERS | |
| 255 | Vocal Cord Paralysis | FAERS: 4 | US FAERS | |
| 256 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 257 | Anorexia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 258 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 259 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 260 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 261 | Bradycardia | FAERS: 3 | US FAERS | |
| 262 | Bronchiectasis | FAERS: 3 | US FAERS | |
| 263 | Deafness | FAERS: 3 | US FAERS | |
| 264 | Device use error | FAERS: 3 | US FAERS | |
| 265 | Disability | FAERS: 3 | US FAERS | |
| 266 | Disorientation | FAERS: 3 | US FAERS | |
| 267 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 268 | Double Outlet Right Ventricle | FAERS: 3 | OFFSIDES US FAERS | |
| 269 | Drug abuse | FAERS: 3 | US FAERS | |
| 270 | Drug withdrawal syndrome | FAERS: 3 | SIDER US FAERS | |
| 271 | Ear congestion | FAERS: 3 | US FAERS | |
| 272 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 273 | Enuresis | FAERS: 3 | 15341026 | CTD OFFSIDES US FAERS |
| 274 | Eructation | FAERS: 3 | US FAERS | |
| 275 | Euphoric mood | FAERS: 3 | US FAERS | |
| 276 | Eye Infection | FAERS: 3 | SIDER US FAERS | |
| 277 | Feeling Cold | FAERS: 3 | US FAERS | |
| 278 | Gastritis | FAERS: 3 | US FAERS | |
| 279 | Head Banging | FAERS: 3 | US FAERS | |
| 280 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 281 | Hypogeusia | FAERS: 3 | US FAERS | |
| 282 | Inappropriate Prescribing | FAERS: 3 | US FAERS | |
| 283 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 284 | Incorrect product administration duration | FAERS: 3 | US FAERS | |
| 285 | JC virus infection | FAERS: 3 | US FAERS | |
| 286 | Laryngotracheitis obstructive | FAERS: 3 | US FAERS | |
| 287 | Leukopenia | FAERS: 3 | US FAERS | |
| 288 | Lichen Planus | FAERS: 3 | US FAERS | |
| 289 | Macroglossia | FAERS: 3 | US FAERS | |
| 290 | Medication residue | FAERS: 3 | US FAERS | |
| 291 | Menorrhagia | FAERS: 3 | US FAERS | |
| 292 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 293 | Middle insomnia | FAERS: 3 | OFFSIDES US FAERS | |
| 294 | Milk Allergy | FAERS: 3 | US FAERS | |
| 295 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 296 | Muscle tightness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 297 | Myopathy | FAERS: 3 | US FAERS | |
| 298 | Neutropenia | FAERS: 3 | US FAERS | |
| 299 | Overweight | FAERS: 3 | US FAERS | |
| 300 | Paranasal sinus hypersecretion | FAERS: 3 | OFFSIDES US FAERS | |
| 301 | Pertussis | FAERS: 3 | US FAERS | |
| 302 | Photophobia | FAERS: 3 | US FAERS | |
| 303 | Physical product label issue | FAERS: 3 | US FAERS | |
| 304 | Pneumothorax | FAERS: 3 | OFFSIDES US FAERS | |
| 305 | Precancerous cells present | FAERS: 3 | US FAERS | |
| 306 | Product administration error | FAERS: 3 | US FAERS | |
| 307 | Product deposit | FAERS: 3 | US FAERS | |
| 308 | Product package associated injury | FAERS: 3 | US FAERS | |
| 309 | Product packaging issue | FAERS: 3 | US FAERS | |
| 310 | Product prescribing error | FAERS: 3 | US FAERS | |
| 311 | Prostate cancer recurrent | FAERS: 3 | OFFSIDES US FAERS | |
| 312 | Psoriasis | FAERS: 3 | US FAERS | |
| 313 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 314 | Rash erythematous | FAERS: 3 | US FAERS | |
| 315 | Scab | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 316 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 317 | Therapy regimen changed | FAERS: 3 | US FAERS | |
| 318 | Vertigo | FAERS: 3 | SIDER US FAERS | |
| 319 | Visual disturbance | FAERS: 3 | US FAERS | |
| 320 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 321 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 322 | Accidental exposure to product packaging | FAERS: 2 | US FAERS | |
| 323 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 324 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 325 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 326 | Ankylosing spondylitis | FAERS: 2 | US FAERS | |
| 327 | Anoxia | FAERS: 2 | OFFSIDES US FAERS | |
| 328 | Apathy | FAERS: 2 | US FAERS | |
| 329 | Aphasia | FAERS: 2 | US FAERS | |
| 330 | Bladder dysfunction | FAERS: 2 | US FAERS | |
| 331 | Bladder pain | FAERS: 2 | US FAERS | |
| 332 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 333 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 334 | Blood corticotrophin increased | FAERS: 2 | US FAERS | |
| 335 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 336 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 337 | Budd-Chiari Syndrome | FAERS: 2 | US FAERS | |
| 338 | Carbon dioxide increased | FAERS: 2 | US FAERS | |
| 339 | Cellulitis | FAERS: 2 | US FAERS | |
| 340 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 341 | Cheilitis | FAERS: 2 | US FAERS | |
| 342 | Claustrophobia | FAERS: 2 | OFFSIDES US FAERS | |
| 343 | Cold sweat | FAERS: 2 | US FAERS | |
| 344 | Colectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 345 | Croup infectious | FAERS: 2 | US FAERS | |
| 346 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 347 | Device ineffective | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 348 | Device leakage | FAERS: 2 | US FAERS | |
| 349 | Drug administered in wrong device | FAERS: 2 | US FAERS | |
| 350 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 351 | Drug exposure via breast milk | FAERS: 2 | US FAERS | |
| 352 | Dysgraphia | FAERS: 2 | US FAERS | |
| 353 | Epilepsy | FAERS: 2 | OFFSIDES US FAERS | |
| 354 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 355 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 356 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 357 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 358 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 359 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 360 | Gingivitis | FAERS: 2 | US FAERS | |
| 361 | Glossitis | FAERS: 2 | SIDER US FAERS | |
| 362 | Hearing disability | FAERS: 2 | US FAERS | |
| 363 | Hospice Care | FAERS: 2 | US FAERS | |
| 364 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 365 | Infectious colitis | FAERS: 2 | US FAERS | |
| 366 | Infective exacerbation of chronic obstructive airways disease | FAERS: 2 | US FAERS | |
| 367 | Intestinal metaplasia | FAERS: 2 | US FAERS | |
| 368 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 369 | Leukocytosis | FAERS: 2 | SIDER US FAERS | |
| 370 | Loose tooth | FAERS: 2 | US FAERS | |
| 371 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 372 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 373 | Lymphadenopathy | FAERS: 2 | SIDER US FAERS | |
| 374 | Lymphoma | FAERS: 2 | US FAERS | |
| 375 | Mouth swelling | FAERS: 2 | US FAERS | |
| 376 | Muscle strain | FAERS: 2 | US FAERS | |
| 377 | Musculoskeletal chest pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 379 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 380 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 381 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 382 | Oxygen supplementation | FAERS: 2 | US FAERS | |
| 383 | Pallor | FAERS: 2 | US FAERS | |
| 384 | Pancreatitis | FAERS: 2 | US FAERS | |
| 385 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 386 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 387 | Precancerous mucosal lesion | FAERS: 2 | US FAERS | |
| 388 | Presyncope | FAERS: 2 | US FAERS | |
| 389 | Proctitis | FAERS: 2 | US FAERS | |
| 390 | Product closure removal difficult | FAERS: 2 | US FAERS | |
| 391 | Product dispensing error | FAERS: 2 | US FAERS | |
| 392 | Product label issue | FAERS: 2 | US FAERS | |
| 393 | Product packaging quantity issue | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 394 | Product preparation error | FAERS: 2 | US FAERS | |
| 395 | Product storage error | FAERS: 2 | US FAERS | |
| 396 | Prostatic pain | FAERS: 2 | US FAERS | |
| 397 | Respiratory distress | FAERS: 2 | US FAERS | |
| 398 | Septic Shock | FAERS: 2 | US FAERS | |
| 399 | Skin irritation | FAERS: 2 | SIDER US FAERS | |
| 400 | Skin reaction | FAERS: 2 | US FAERS | |
| 401 | Suicide attempt | FAERS: 2 | US FAERS | |
| 402 | Tension | FAERS: 2 | SIDER US FAERS | |
| 403 | Therapeutic product contamination | FAERS: 2 | US FAERS | |
| 404 | Therapeutic product effective for unapproved indication | FAERS: 2 | US FAERS | |
| 405 | Therapeutic product ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 406 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 407 | Tonsillitis fungal | FAERS: 2 | US FAERS | |
| 408 | Tonsillitis | FAERS: 2 | US FAERS | |
| 409 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 410 | Toothache | FAERS: 2 | US FAERS | |
| 411 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 412 | Urinary Retention | FAERS: 2 | US FAERS | |
| 413 | treatment failure | FAERS: 2 | US FAERS | |
| 414 | Abscess | FAERS: 1 | SIDER US FAERS | |
| 415 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 416 | Actinomycosis | FAERS: 1 | US FAERS | |
| 417 | Acute myocardial infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Adherent leukoma | FAERS: 1 | US FAERS | |
| 419 | Adrenocortical insufficiency neonatal | FAERS: 1 | US FAERS | |
| 420 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 421 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 422 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 423 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 424 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 425 | Anastomotic Leak | FAERS: 1 | US FAERS | |
| 426 | Aneurysm | FAERS: 1 | US FAERS | |
| 427 | Anogenital dysplasia | FAERS: 1 | US FAERS | |
| 428 | Anorectal infection | FAERS: 1 | US FAERS | |
| 429 | Apallic syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 430 | Aphthous Stomatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 431 | Application site burn | FAERS: 1 | US FAERS | |
| 432 | Application site pain | FAERS: 1 | US FAERS | |
| 433 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 434 | Arthropod bite | FAERS: 1 | US FAERS | |
| 435 | Asthenopia | FAERS: 1 | US FAERS | |
| 436 | Asthma prophylaxis | FAERS: 1 | US FAERS | |
| 437 | Aura | FAERS: 1 | OFFSIDES US FAERS | |
| 438 | Auscultation | FAERS: 1 | US FAERS | |
| 439 | Autoimmune colitis | FAERS: 1 | US FAERS | |
| 440 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 441 | Back disorder | FAERS: 1 | US FAERS | |
| 442 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 443 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 444 | Benign breast lump removal | FAERS: 1 | US FAERS | |
| 445 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 446 | Blepharitis | FAERS: 1 | US FAERS | |
| 447 | Blood cortisol abnormal | FAERS: 1 | US FAERS | |
| 448 | Blood cortisol decreased | FAERS: 1 | SIDER US FAERS | |
| 449 | Blood glucose fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 450 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 451 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 452 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 453 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 454 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 455 | Body height below normal | FAERS: 1 | US FAERS | |
| 456 | Bone marrow depression | FAERS: 1 | US FAERS | |
| 457 | Breast Cyst | FAERS: 1 | US FAERS | |
| 458 | Bronchial Obstruction | FAERS: 1 | OFFSIDES US FAERS | |
| 459 | Bronchiolitis | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 461 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 462 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 463 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 464 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 465 | Cerebral atrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 466 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 467 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 468 | Chromoblastomycosis | FAERS: 1 | US FAERS | |
| 469 | Chromosomal mutation | FAERS: 1 | US FAERS | |
| 470 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 471 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 472 | Chronic sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 473 | Cleft Palate | FAERS: 1 | OFFSIDES US FAERS | |
| 474 | Clostridium difficile colitis | FAERS: 1 | OFFSIDES US FAERS | |
| 475 | Cluster Headache | FAERS: 1 | OFFSIDES US FAERS | |
| 476 | Combined immunodeficiency | FAERS: 1 | US FAERS | |
| 477 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 478 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 479 | Corneal Ulcer | FAERS: 1 | US FAERS | |
| 480 | Corneal thinning | FAERS: 1 | US FAERS | |
| 481 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 482 | Culture positive | FAERS: 1 | US FAERS | |
| 483 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 484 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 485 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 486 | Diabetic Retinopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 487 | Diplopia | FAERS: 1 | US FAERS | |
| 488 | Disuse syndrome | FAERS: 1 | US FAERS | |
| 489 | Drug Dependence | FAERS: 1 | US FAERS | |
| 490 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 491 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 492 | Drug resistance | FAERS: 1 | US FAERS | |
| 493 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 494 | Drug screen positive | FAERS: 1 | OFFSIDES US FAERS | |
| 495 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 496 | Dysarthria | FAERS: 1 | US FAERS | |
| 497 | Dysentery | FAERS: 1 | US FAERS | |
| 498 | Dystonia | FAERS: 1 | US FAERS | |
| 499 | Educational problem | FAERS: 1 | OFFSIDES US FAERS | |
| 500 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 501 | Emotional poverty | FAERS: 1 | US FAERS | |
| 502 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 503 | Enterocolitis | FAERS: 1 | US FAERS | |
| 504 | Escherichia infection | FAERS: 1 | OFFSIDES US FAERS | |
| 505 | Eustachian tube disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 506 | Excoriation | FAERS: 1 | OFFSIDES US FAERS | |
| 507 | Expired device used | FAERS: 1 | US FAERS | |
| 508 | Exposure to contaminated device | FAERS: 1 | US FAERS | |
| 509 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 510 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 511 | Eye inflammation | FAERS: 1 | US FAERS | |
| 512 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 513 | Eye prosthesis user | FAERS: 1 | US FAERS | |
| 514 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 515 | Facial Pain | FAERS: 1 | US FAERS | |
| 516 | Failure to Thrive | FAERS: 1 | OFFSIDES US FAERS | |
| 517 | Fat redistribution | FAERS: 1 | US FAERS | |
| 518 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 519 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 520 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 521 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 522 | Foreign body aspiration | FAERS: 1 | OFFSIDES US FAERS | |
| 523 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 524 | Formication | FAERS: 1 | US FAERS | |
| 525 | Fracture | FAERS: 1 | SIDER US FAERS | |
| 526 | Fungal rhinitis | FAERS: 1 | US FAERS | |
| 527 | Gastric ileus | FAERS: 1 | US FAERS | |
| 528 | Gastric ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 529 | Gastroenteritis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 530 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 531 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 532 | Gingival Recession | FAERS: 1 | US FAERS | |
| 533 | Glioma | FAERS: 1 | US FAERS | |
| 534 | Glucocorticoids decreased | FAERS: 1 | US FAERS | |
| 535 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 536 | Gout | FAERS: 1 | OFFSIDES US FAERS | |
| 537 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 538 | Granuloma | FAERS: 1 | US FAERS | |
| 539 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 540 | Growth failure | FAERS: 1 | US FAERS | |
| 541 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 542 | Hepatitis C | FAERS: 1 | OFFSIDES US FAERS | |
| 543 | Hepatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 544 | Hernia | FAERS: 1 | US FAERS | |
| 545 | Hip surgery | FAERS: 1 | US FAERS | |
| 546 | Hirsutism | FAERS: 1 | SIDER US FAERS | |
| 547 | Humidity intolerance | FAERS: 1 | US FAERS | |
| 548 | Hyperventilation | FAERS: 1 | US FAERS | |
| 549 | Hypoaldosteronism | FAERS: 1 | US FAERS | |
| 550 | Hypocoagulable state | FAERS: 1 | US FAERS | |
| 551 | Hypokinesia | FAERS: 1 | US FAERS | |
| 552 | Hypophagia | FAERS: 1 | OFFSIDES US FAERS | |
| 553 | Hyporeflexia | FAERS: 1 | OFFSIDES US FAERS | |
| 554 | Hypoventilation | FAERS: 1 | US FAERS | |
| 555 | Hysterectomy | FAERS: 1 | US FAERS | |
| 556 | Ileal Stenosis | FAERS: 1 | US FAERS | |
| 557 | Ileus | FAERS: 1 | US FAERS | |
| 558 | Immunosuppression | FAERS: 1 | US FAERS | |
| 559 | Impaired self-care | FAERS: 1 | US FAERS | |
| 560 | Impatience | FAERS: 1 | US FAERS | |
| 561 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 562 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 563 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 564 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 565 | Infectious Mononucleosis | FAERS: 1 | OFFSIDES US FAERS | |
| 566 | Infective pulmonary exacerbation of cystic fibrosis | FAERS: 1 | US FAERS | |
| 567 | Infertility | FAERS: 1 | US FAERS | |
| 568 | Initial insomnia | FAERS: 1 | OFFSIDES US FAERS | |
| 569 | Injury associated with device | FAERS: 1 | US FAERS | |
| 570 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 571 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 572 | Intussusception | FAERS: 1 | US FAERS | |
| 573 | Iritis | FAERS: 1 | US FAERS | |
| 574 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 575 | Joint prosthesis user | FAERS: 1 | US FAERS | |
| 576 | Keratitis | FAERS: 1 | US FAERS | |
| 577 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 578 | Limb operation | FAERS: 1 | US FAERS | |
| 579 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 580 | Lipase increased | FAERS: 1 | US FAERS | |
| 581 | Lipohypertrophy | FAERS: 1 | SIDER US FAERS | |
| 582 | Liver Abscess | FAERS: 1 | US FAERS | |
| 583 | Living in residential institution | FAERS: 1 | US FAERS | |
| 584 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 585 | Malabsorption | FAERS: 1 | US FAERS | |
| 586 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 587 | Manufacturing production issue | FAERS: 1 | US FAERS | |
| 588 | Medication tampering | FAERS: 1 | US FAERS | |
| 589 | Meningioma | FAERS: 1 | US FAERS | |
| 590 | Meningitis | FAERS: 1 | US FAERS | |
| 591 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 592 | Mental Retardation | FAERS: 1 | US FAERS | |
| 593 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 594 | Metrorrhagia | FAERS: 1 | SIDER US FAERS | |
| 595 | Microcephaly | FAERS: 1 | US FAERS | |
| 596 | Miliaria | FAERS: 1 | US FAERS | |
| 597 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 598 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 599 | Musculoskeletal Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 600 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 601 | Myositis | FAERS: 1 | US FAERS | |
| 602 | Nasal decongestion therapy | FAERS: 1 | US FAERS | |
| 603 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 604 | Near Drowning | FAERS: 1 | US FAERS | |
| 605 | Negativism | FAERS: 1 | US FAERS | |
| 606 | Neonatal tachycardia | FAERS: 1 | US FAERS | |
| 607 | Nephroblastoma | FAERS: 1 | US FAERS | |
| 608 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 609 | Night sweats | FAERS: 1 | US FAERS | |
| 610 | Nocturia | FAERS: 1 | SIDER US FAERS | |
| 611 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 612 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 613 | Ocular Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 614 | Oppositional Defiant Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 615 | Oral fungal infection | FAERS: 1 | OFFSIDES US FAERS | |
| 616 | Oral infection | FAERS: 1 | US FAERS | |
| 617 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 618 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 619 | Oral pruritus | FAERS: 1 | US FAERS | |
| 620 | Oropharyngeal candidiasis | FAERS: 1 | SIDER US FAERS | |
| 621 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 622 | Osteomyelitis | FAERS: 1 | OFFSIDES US FAERS | |
| 623 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 624 | Otitis Media | FAERS: 1 | SIDER US FAERS | |
| 625 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 626 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 627 | Oxygen saturation increased | FAERS: 1 | US FAERS | |
| 628 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 629 | Papule | FAERS: 1 | US FAERS | |
| 630 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 631 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 632 | Paranoia | FAERS: 1 | US FAERS | |
| 633 | Pectus excavatum | FAERS: 1 | US FAERS | |
| 634 | Peptic ulcer reactivated | FAERS: 1 | US FAERS | |
| 635 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 636 | Petechiae | FAERS: 1 | US FAERS | |
| 637 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 638 | Physical assault | FAERS: 1 | US FAERS | |
| 639 | Pleurisy | FAERS: 1 | US FAERS | |
| 640 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 641 | Polydipsia | FAERS: 1 | US FAERS | |
| 642 | Post abortion complication | FAERS: 1 | US FAERS | |
| 643 | Pouchitis | FAERS: 1 | OFFSIDES US FAERS | |
| 644 | Pre-Eclampsia | FAERS: 1 | OFFSIDES US FAERS | |
| 645 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 646 | Pregnancy | FAERS: 1 | US FAERS | |
| 647 | Product adhesion issue | FAERS: 1 | US FAERS | |
| 648 | Product barcode issue | FAERS: 1 | US FAERS | |
| 649 | Product cleaning inadequate | FAERS: 1 | US FAERS | |
| 650 | Product container seal issue | FAERS: 1 | US FAERS | |
| 651 | Product contamination | FAERS: 1 | US FAERS | |
| 652 | Product counterfeit | FAERS: 1 | US FAERS | |
| 653 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 654 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 655 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 656 | Product impurity | FAERS: 1 | US FAERS | |
| 657 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 658 | Product size issue | FAERS: 1 | US FAERS | |
| 659 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 660 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 661 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 662 | Proteinuria | FAERS: 1 | US FAERS | |
| 663 | Psychiatric symptom | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 664 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 665 | Pulmonary Fibrosis | FAERS: 1 | 30189237 | CTD US FAERS |
| 666 | Purple glove syndrome | FAERS: 1 | US FAERS | |
| 667 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 668 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 669 | Radiotherapy to brain | FAERS: 1 | US FAERS | |
| 670 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 671 | Rectal abscess | FAERS: 1 | US FAERS | |
| 672 | Rectal discharge | FAERS: 1 | US FAERS | |
| 673 | Rectal spasm | FAERS: 1 | US FAERS | |
| 674 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 675 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 676 | Respiratory arrest | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 677 | Respiratory muscle weakness | FAERS: 1 | US FAERS | |
| 678 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 679 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 680 | Rhabdomyolysis | FAERS: 1 | OFFSIDES US FAERS | |
| 681 | Screaming | FAERS: 1 | US FAERS | |
| 682 | Senile dementia | FAERS: 1 | OFFSIDES US FAERS | |
| 683 | Sense of oppression | FAERS: 1 | US FAERS | |
| 684 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 685 | Sexual Dysfunction | FAERS: 1 | SIDER US FAERS | |
| 686 | Sinus operation | FAERS: 1 | OFFSIDES US FAERS | |
| 687 | Sinus pain | FAERS: 1 | US FAERS | |
| 688 | Sinus polyp | FAERS: 1 | US FAERS | |
| 689 | Sjogren's Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 690 | Skeletal injury | FAERS: 1 | OFFSIDES US FAERS | |
| 691 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 692 | Skin test positive | FAERS: 1 | US FAERS | |
| 693 | Skin tightness | FAERS: 1 | US FAERS | |
| 694 | Slow speech | FAERS: 1 | US FAERS | |
| 695 | Sluggishness | FAERS: 1 | US FAERS | |
| 696 | Somnambulism | FAERS: 1 | US FAERS | |
| 697 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 698 | Spermatozoa progressive motility abnormal | FAERS: 1 | US FAERS | |
| 699 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 700 | Staring | FAERS: 1 | US FAERS | |
| 701 | Steroid withdrawal syndrome | FAERS: 1 | US FAERS | |
| 702 | Stevens-Johnson Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 703 | Strabismus | FAERS: 1 | US FAERS | |
| 704 | Superinfection | FAERS: 1 | US FAERS | |
| 705 | Suture insertion | FAERS: 1 | US FAERS | |
| 706 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 707 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 708 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 709 | Tension Headache | FAERS: 1 | US FAERS | |
| 710 | Tetany | FAERS: 1 | US FAERS | |
| 711 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 712 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 713 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 714 | Tongue blistering | FAERS: 1 | US FAERS | |
| 715 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 716 | Tongue eruption | FAERS: 1 | US FAERS | |
| 717 | Tongue pigmentation | FAERS: 1 | US FAERS | |
| 718 | Tongue spasm | FAERS: 1 | US FAERS | |
| 719 | Tooth Loss | FAERS: 1 | US FAERS | |
| 720 | Torticollis | FAERS: 1 | US FAERS | |
| 721 | Tracheal Stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 722 | Transcription medication error | FAERS: 1 | US FAERS | |
| 723 | Trichiasis | FAERS: 1 | US FAERS | |
| 724 | Tuberculin test false positive | FAERS: 1 | US FAERS | |
| 725 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 726 | Vaginal pain | FAERS: 1 | US FAERS | |
| 727 | Vasculitis | FAERS: 1 | US FAERS | |
| 728 | Viral upper respiratory tract infection | FAERS: 1 | SIDER US FAERS | |
| 729 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 730 | Vulvovaginal dryness | FAERS: 1 | OFFSIDES US FAERS | |
| 731 | Walking aid user | FAERS: 1 | US FAERS | |
| 732 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 733 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 734 | Wrong device used | FAERS: 1 | US FAERS | |
| 735 | carbuncle | FAERS: 1 | OFFSIDES US FAERS | |
| 736 | effusion | FAERS: 1 | US FAERS | |
| 737 | muscle injury | FAERS: 1 | OFFSIDES US FAERS | |
| 738 | Abdominal Abscess | OFFSIDES | ||
| 739 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 740 | Abdominal adhesions | OFFSIDES | ||
| 741 | Abdominal rigidity | OFFSIDES | ||
| 742 | Abdominal sepsis | OFFSIDES | ||
| 743 | Abdominal strangulated hernia | OFFSIDES | ||
| 744 | Abdominal tenderness | OFFSIDES | ||
| 745 | Abnormal vision | SIDER | ||
| 746 | Abuse | OFFSIDES | ||
| 747 | Accidental needle stick | OFFSIDES | ||
| 748 | Ache | SIDER | ||
| 749 | Acid reflux | OFFSIDES | ||
| 750 | Acromegaly | OFFSIDES | ||
| 751 | Acute otitis media | OFFSIDES | ||
| 752 | Acute psychosis | OFFSIDES | ||
| 753 | Acute sinusitis | OFFSIDES | ||
| 754 | Adenitis | OFFSIDES | ||
| 755 | Adjustment disorder with depressed mood | OFFSIDES | ||
| 756 | Agoraphobia | OFFSIDES | ||
| 757 | Airway Obstruction | 30189237 | CTD | |
| 758 | Alcohol consumption | OFFSIDES | ||
| 759 | Allergy test positive | OFFSIDES | ||
| 760 | Amenorrhea | OFFSIDES | ||
| 761 | Anal Fistula | OFFSIDES | ||
| 762 | Anastomotic stenosis | OFFSIDES | ||
| 763 | Androgenetic Alopecia | OFFSIDES | ||
| 764 | Anhedonia | OFFSIDES | ||
| 765 | Anhidrosis | OFFSIDES | ||
| 766 | Anoxic Encephalopathy | OFFSIDES | ||
| 767 | Anti-platelet antibody positive | OFFSIDES | ||
| 768 | Aortic Aneurysm | OFFSIDES | ||
| 769 | Aortic valve calcification | OFFSIDES | ||
| 770 | Appendicitis | OFFSIDES | ||
| 771 | Arthritis aggravated | SIDER | ||
| 772 | Arthroscopy | OFFSIDES | ||
| 773 | Ascites infection | OFFSIDES | ||
| 774 | Atelectasis | OFFSIDES | ||
| 775 | Atherosclerosis | OFFSIDES | ||
| 776 | Atrial hypertrophy | OFFSIDES | ||
| 777 | Atrial tachycardia | OFFSIDES | ||
| 778 | Autoimmune hepatitis | OFFSIDES | ||
| 779 | Barium swallow abnormal | OFFSIDES | ||
| 780 | Basal cell carcinoma | OFFSIDES | ||
| 781 | Biopsy bone abnormal | OFFSIDES | ||
| 782 | Biopsy breast abnormal | OFFSIDES | ||
| 783 | Biopsy gingival | OFFSIDES | ||
| 784 | Biopsy liver abnormal | OFFSIDES | ||
| 785 | Biopsy site unspecified abnormal | OFFSIDES | ||
| 786 | Blood Glucose | OFFSIDES | ||
| 787 | Blood albumin decreased | OFFSIDES | ||
| 788 | Blood alkaline phosphatase increased | SIDER | ||
| 789 | Blood and lymphatic system disorders | SIDER | ||
| 790 | Blood blister | OFFSIDES | ||
| 791 | Blood cholesterol | OFFSIDES | ||
| 792 | Blood creatine phosphokinase MB increased | OFFSIDES | ||
| 793 | Blood follicle stimulating hormone decreased | OFFSIDES | ||
| 794 | Blood glucose abnormal | OFFSIDES | ||
| 795 | Blood pH decreased | OFFSIDES | ||
| 796 | Blood phosphorus increased | OFFSIDES | ||
| 797 | Blood prolactin increased | OFFSIDES | ||
| 798 | Blood triglycerides increased | OFFSIDES | ||
| 799 | Bone infarction | OFFSIDES | ||
| 800 | Bradyphrenia | Canada Vigilance: 1 | Canada Vigilance | |
| 801 | Brain Concussion | OFFSIDES | ||
| 802 | Breast hyperplasia | OFFSIDES | ||
| 803 | Breast tenderness | OFFSIDES | ||
| 804 | Breathing-related sleep disorder | OFFSIDES | ||
| 805 | Bronchoconstriction | SIDER | ||
| 806 | Bronchopulmonary Dysplasia | 11158452 | CTD | |
| 807 | Bronchoscopy | OFFSIDES | ||
| 808 | Buffalo hump | SIDER | ||
| 809 | Bunion operation | OFFSIDES | ||
| 810 | Bunion | OFFSIDES | ||
| 811 | Bursitis | OFFSIDES | ||
| 812 | Cardiac Flutter | OFFSIDES | ||
| 813 | Cardioactive drug level increased | OFFSIDES | ||
| 814 | Catatonia | OFFSIDES | ||
| 815 | Catheter bacteraemia | OFFSIDES | ||
| 816 | Catheter related infection | OFFSIDES | ||
| 817 | Cauda Equina Syndrome | OFFSIDES | ||
| 818 | Cerebral Thrombosis | OFFSIDES | ||
| 819 | Cervical dysplasia | OFFSIDES | ||
| 820 | Cervical laser therapy | OFFSIDES | ||
| 821 | Chemical and Drug Induced Liver Injury | 12004282 | CTD | |
| 822 | Cholecystitis | OFFSIDES | ||
| 823 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 824 | Chronic ulcerative colitis | OFFSIDES | ||
| 825 | Clubbing | OFFSIDES | ||
| 826 | Clumsiness | OFFSIDES | ||
| 827 | Confabulation | OFFSIDES | ||
| 828 | Congenital heart disease | OFFSIDES | ||
| 829 | Congenital mitochondrial cytopathy | OFFSIDES | ||
| 830 | Congenital tracheomalacia | OFFSIDES | ||
| 831 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 832 | Crohn Disease | 11417618 | CTD | |
| 833 | Crohns disease aggravated | SIDER | ||
| 834 | Cyst | OFFSIDES | ||
| 835 | Debridement | OFFSIDES | ||
| 836 | Decreased Libido | OFFSIDES | ||
| 837 | Deglutition Disorders | 14641354 | CTD | |
| 838 | Dental prosthesis placement | OFFSIDES | ||
| 839 | Denture wearer | OFFSIDES | ||
| 840 | Dependence | OFFSIDES | ||
| 841 | Dermatitis, Allergic Contact | CTD | ||
| 842 | Device damage | Canada Vigilance: 1 | Canada Vigilance | |
| 843 | Device dislocation | OFFSIDES | ||
| 844 | Diabetes | OFFSIDES | ||
| 845 | Diabetic Foot | OFFSIDES | ||
| 846 | Diabetic Nephropathy | OFFSIDES | ||
| 847 | Diarrhea | OFFSIDES | ||
| 848 | Diverticulosis | OFFSIDES | ||
| 849 | Diverticulum | OFFSIDES | ||
| 850 | Drowsiness | OFFSIDES | ||
| 851 | Drug Eruptions | 14641354 | CTD | |
| 852 | Drug addict | OFFSIDES | ||
| 853 | Drug withdrawal headache | OFFSIDES | ||
| 854 | Duodenal Ulcer | OFFSIDES | ||
| 855 | Dyspnea | 20016425 | CTD | |
| 856 | Ear and labyrinth disorders | SIDER | ||
| 857 | Ecchymosis | SIDER | ||
| 858 | Ejection Fraction Decreased | OFFSIDES | ||
| 859 | Embolic stroke | OFFSIDES | ||
| 860 | Endocarditis | OFFSIDES | ||
| 861 | Enteritis | SIDER | ||
| 862 | Enterococcal infection | OFFSIDES | ||
| 863 | Enterovesical Fistula | OFFSIDES | ||
| 864 | Eosinophilic myocarditis | OFFSIDES | ||
| 865 | Epididymitis | OFFSIDES | ||
| 866 | Epigastric pain | SIDER | ||
| 867 | Erectile dysfunction | OFFSIDES | ||
| 868 | Esophageal Stenosis | OFFSIDES | ||
| 869 | Exanthema | 10894975 | CTD | |
| 870 | Fatty Liver | OFFSIDES | ||
| 871 | Flank Pain | OFFSIDES | ||
| 872 | Flight of ideas | OFFSIDES | ||
| 873 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 874 | Galactorrhea | OFFSIDES | ||
| 875 | Gambling | OFFSIDES | ||
| 876 | Gammopathy | OFFSIDES | ||
| 877 | Gas Poisoning | 20016425 | CTD | |
| 878 | Gastric Bypass | OFFSIDES | ||
| 879 | Gastrointestinal Diseases | 20223723 21885873 | CTD | |
| 880 | Gastrointestinal erosion | OFFSIDES | ||
| 881 | Gestational Diabetes | OFFSIDES | ||
| 882 | Gingival Hyperplasia | OFFSIDES | ||
| 883 | Glycosuria | 10489860 | CTD | |
| 884 | Goiter | OFFSIDES | ||
| 885 | Granulomatous liver disease | OFFSIDES | ||
| 886 | Grip strength | OFFSIDES | ||
| 887 | Hay fever | OFFSIDES | ||
| 888 | Hepatic Infarction | OFFSIDES | ||
| 889 | Hepatic congestion | OFFSIDES | ||
| 890 | Hepatic necrosis | OFFSIDES | ||
| 891 | Hepatic siderosis | OFFSIDES | ||
| 892 | Hepatotoxicity | OFFSIDES | ||
| 893 | Herpes Zoster Oticus | OFFSIDES | ||
| 894 | Histoplasmosis | OFFSIDES | ||
| 895 | Hoarseness | SIDER | ||
| 896 | House dust allergy | OFFSIDES | ||
| 897 | Human papilloma virus test positive | OFFSIDES | ||
| 898 | Hyperdynamic left ventricle | OFFSIDES | ||
| 899 | Hyperkeratosis | OFFSIDES | ||
| 900 | Hyperkinesia | SIDER | ||
| 901 | Hypertensive cardiomyopathy | OFFSIDES | ||
| 902 | Hypertensive heart disease | OFFSIDES | ||
| 903 | Hypokalemia | 9138184 | CTD | |
| 904 | Hypometabolism | OFFSIDES | ||
| 905 | Hypoxia | OFFSIDES | ||
| 906 | Impaired driving ability | OFFSIDES | ||
| 907 | Infected bunion | OFFSIDES | ||
| 908 | Infestation | SIDER | ||
| 909 | Infusion site phlebitis | OFFSIDES | ||
| 910 | Injection site burning | OFFSIDES | ||
| 911 | Injection site dermatitis | OFFSIDES | ||
| 912 | Injection site discomfort | OFFSIDES | ||
| 913 | Injection site erythema | OFFSIDES | ||
| 914 | Injection site stinging | OFFSIDES | ||
| 915 | Injection site urticaria | OFFSIDES | ||
| 916 | Injection site vesicles | OFFSIDES | ||
| 917 | Intention tremor | OFFSIDES | ||
| 918 | Intentional misuse | OFFSIDES | ||
| 919 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 920 | Intervertebral disc disorder | OFFSIDES | ||
| 921 | Intestinal anastomosis complication | OFFSIDES | ||
| 922 | Intestinal resection | OFFSIDES | ||
| 923 | Intestinal stoma | OFFSIDES | ||
| 924 | Intraocular pressure test | OFFSIDES | ||
| 925 | Iridocyclitis | OFFSIDES | ||
| 926 | Keratitis sicca | OFFSIDES | ||
| 927 | Kidney Failure | OFFSIDES | ||
| 928 | Labile blood pressure | OFFSIDES | ||
| 929 | Lactescent serum | OFFSIDES | ||
| 930 | Left ventricular heave | OFFSIDES | ||
| 931 | Leukocytoclastic vasculitis | SIDER | ||
| 932 | Life expectancy shortened | OFFSIDES | ||
| 933 | Lightheadedness | SIDER | ||
| 934 | Liver Neoplasms, Experimental | 1411124 | CTD | |
| 935 | Local reaction | SIDER | ||
| 936 | Lumbar spine flattening | OFFSIDES | ||
| 937 | Lung Diseases, Obstructive | 9232087 | CTD | |
| 938 | Lung Injury | 25313925 | CTD | |
| 939 | Lung Neoplasms | 12117777 16733249 17163412 | CTD | |
| 940 | Lung hyperinflation | OFFSIDES | ||
| 941 | Lupus-like syndrome | OFFSIDES | ||
| 942 | Magnesium Deficiency | OFFSIDES | ||
| 943 | Malnutrition | SIDER | ||
| 944 | Maxillofacial operation | OFFSIDES | ||
| 945 | Meconium abnormal | OFFSIDES | ||
| 946 | Medical device removal | OFFSIDES | ||
| 947 | Medical observation | OFFSIDES | ||
| 948 | Megakaryocytes increased | OFFSIDES | ||
| 949 | Meniscus operation | OFFSIDES | ||
| 950 | Metatarsalgia | OFFSIDES | ||
| 951 | Moaning | OFFSIDES | ||
| 952 | Mood Disorders | 15341026 | CTD | |
| 953 | Multiple sclerosis relapse | OFFSIDES | ||
| 954 | Mycosis Fungoides | OFFSIDES | ||
| 955 | Myoglobinaemia | OFFSIDES | ||
| 956 | Nervous tension | OFFSIDES | ||
| 957 | Neurodermatitis | OFFSIDES | ||
| 958 | Nodule | OFFSIDES | ||
| 959 | Obsessive thoughts | OFFSIDES | ||
| 960 | Open wound | OFFSIDES | ||
| 961 | Optic Neuritis | OFFSIDES | ||
| 962 | Oropharyngeal discomfort | SIDER | ||
| 963 | Oropharyngeal plaque | OFFSIDES | ||
| 964 | Orthopnea | OFFSIDES | ||
| 965 | Osteolysis | OFFSIDES | ||
| 966 | Pain of skin | OFFSIDES | ||
| 967 | Pancreas lipomatosis | OFFSIDES | ||
| 968 | Parkinsonian Disorders | 16924038 | CTD | |
| 969 | Pelvic mass | OFFSIDES | ||
| 970 | Pelvic prolapse | OFFSIDES | ||
| 971 | Performance status decreased | OFFSIDES | ||
| 972 | Peritonitis | OFFSIDES | ||
| 973 | Personality Change | OFFSIDES | ||
| 974 | Personality Disorders | 15341026 | CTD | |
| 975 | Physical disability | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 976 | Plasmacytosis | OFFSIDES | ||
| 977 | Polyneuropathy | OFFSIDES | ||
| 978 | Polyuria | OFFSIDES | ||
| 979 | Portal Hypertension | OFFSIDES | ||
| 980 | Postoperative abscess | OFFSIDES | ||
| 981 | Pregnancy with contraceptive device | OFFSIDES | ||
| 982 | Presbyopia | OFFSIDES | ||
| 983 | Prescribed overdose | OFFSIDES | ||
| 984 | Procedural complication | SIDER | ||
| 985 | Product complaint | Canada Vigilance: 6 | Canada Vigilance | |
| 986 | Progesterone receptor assay | OFFSIDES | ||
| 987 | Prothrombin level decreased | OFFSIDES | ||
| 988 | Pseudotumor Cerebri | 11417618 | CTD | |
| 989 | Psychomotor skills impaired | OFFSIDES | ||
| 990 | Pulmonary Edema | 11734451 | CTD | |
| 991 | Pulmonary Eosinophilia | 10850854 11734451 | CTD | |
| 992 | Pulmonary artery stenosis | OFFSIDES | ||
| 993 | Purulence | OFFSIDES | ||
| 994 | Pyuria | SIDER | ||
| 995 | Radiculitis | OFFSIDES | ||
| 996 | Rash follicular | Canada Vigilance: 1 | Canada Vigilance | |
| 997 | Rectal polyp | OFFSIDES | ||
| 998 | Renal tubular necrosis | OFFSIDES | ||
| 999 | Respiratory Sounds | 16101941 | CTD | |
| 1000 | Restrictive pulmonary disease | OFFSIDES | ||
| 1001 | Reticulocyte count increased | OFFSIDES | ||
| 1002 | Retinal Vasculitis | OFFSIDES | ||
| 1003 | Retrocollis | OFFSIDES | ||
| 1004 | Rhinorrhea | OFFSIDES | ||
| 1005 | Right Ventricular Hypertrophy | OFFSIDES | ||
| 1006 | Right atrial dilatation | OFFSIDES | ||
| 1007 | Schizophrenia | OFFSIDES | ||
| 1008 | Scleroderma | OFFSIDES | ||
| 1009 | Self Mutilation | OFFSIDES | ||
| 1010 | Shock | SIDER | ||
| 1011 | Sick Sinus Syndrome | OFFSIDES | ||
| 1012 | Sinus antrostomy | OFFSIDES | ||
| 1013 | Skin Induration | OFFSIDES | ||
| 1014 | Skin toxicity | OFFSIDES | ||
| 1015 | Sleep Talking | OFFSIDES | ||
| 1016 | Sleep Wake Disorders | 16270719 | CTD | |
| 1017 | Small intestine carcinoma | OFFSIDES | ||
| 1018 | Sopor | OFFSIDES | ||
| 1019 | Spondylolisthesis | OFFSIDES | ||
| 1020 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 1021 | Stridor | SIDER | ||
| 1022 | Subileus | OFFSIDES | ||
| 1023 | Sudden Cardiac Death | OFFSIDES | ||
| 1024 | Sudden death | OFFSIDES | ||
| 1025 | Tendinitis | OFFSIDES | ||
| 1026 | Therapeutic product ineffective | Canada Vigilance: 1 | Canada Vigilance | |
| 1027 | Thymoma | OFFSIDES | ||
| 1028 | Thyroiditis | OFFSIDES | ||
| 1029 | Tobacco user | OFFSIDES | ||
| 1030 | Toxicity to various agents | Canada Vigilance: 1 | Canada Vigilance | |
| 1031 | Tracheitis | OFFSIDES | ||
| 1032 | Transmission of an infectious agent via a medicinal product | OFFSIDES | ||
| 1033 | Troponin increased | OFFSIDES | ||
| 1034 | Ultrasound breast abnormal | OFFSIDES | ||
| 1035 | Umbilical hernia perforation | OFFSIDES | ||
| 1036 | Unequal Limb Length | OFFSIDES | ||
| 1037 | Urinary tract infection staphylococcal | OFFSIDES | ||
| 1038 | Urine ketone body present | OFFSIDES | ||
| 1039 | Uterine Cancer | OFFSIDES | ||
| 1040 | Vascular purpura | SIDER | ||
| 1041 | Venous stasis | OFFSIDES | ||
| 1042 | Ventricular Fibrillation | OFFSIDES | ||
| 1043 | Ventricular hypokinesia | OFFSIDES | ||
| 1044 | Very low density lipoprotein increased | OFFSIDES | ||
| 1045 | Violence-related symptom | OFFSIDES | ||
| 1046 | Vitritis | OFFSIDES | ||
| 1047 | Vocal cord cyst | OFFSIDES | ||
| 1048 | Vulvovaginal human papilloma virus infection | OFFSIDES | ||
| 1049 | Weight Gain | OFFSIDES | ||
| 1050 | bad taste | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.