Azacitidine
(NMUSYJAQQFHJEW-KVTDHHQDSA-N)
Structure
- SMILES
- OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc(nc1=O)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01BC07
- Molecular Formula:
- C8H12N4O5
- Molecular Weight:
- 244.205
- Log P:
- -2.5868
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 143.72
- CAS Number(s):
- 320-67-2
Synonym(s)
1.
Azacitidine
2.
Azacytidine
3.
5-Azacytidine
4.
NSC-102816
5.
Vidaza
6.
5 Azacytidine
7.
NSC 102816
8.
NSC102816
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 302 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 2 | Febrile Neutropenia | FAERS: 238 Canada Vigilance: 12 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Sepsis | FAERS: 226 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 4 | Infection | FAERS: 223 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | MYELODYSPLASTIC SYNDROME | FAERS: 212 Canada Vigilance: 48 | Canada Vigilance US FAERS | |
| 6 | Thrombocytopenia | FAERS: 207 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 7 | Neutropenia | FAERS: 201 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 8 | Disease Progression | FAERS: 161 Canada Vigilance: 49 | Canada Vigilance OFFSIDES US FAERS | |
| 9 | Pancytopenia | FAERS: 126 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 10 | Nausea | FAERS: 102 Canada Vigilance: 2 | 6178065 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Septic Shock | FAERS: 102 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Vomiting | FAERS: 88 Canada Vigilance: 2 | 6178065 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Myelodysplastic syndrome transformation | FAERS: 85 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Fatigue | FAERS: 71 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Constipation | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | General physical health deterioration | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Respiratory Failure | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Asthenia | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Injection Site Reaction | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 20 | Cerebrovascular accident | FAERS: 47 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | White blood cell count decreased | FAERS: 47 | US FAERS | |
| 22 | Toxicity to various agents | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Urinary tract infection | FAERS: 41 | SIDER US FAERS | |
| 24 | Drug ineffective | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Leukopenia | FAERS: 35 | SIDER US FAERS | |
| 26 | Cellulitis | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Therapy non-responder | FAERS: 33 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 28 | Neutrophil count decreased | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 29 | Malaise | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Haematotoxicity | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 31 | Adverse event | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Full blood count decreased | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Acute kidney injury | FAERS: 28 | US FAERS | |
| 34 | Myocardial Infarction | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 35 | treatment failure | FAERS: 27 | US FAERS | |
| 36 | Blood product transfusion dependent | FAERS: 26 | OFFSIDES US FAERS | |
| 37 | Hypotension | FAERS: 26 | SIDER US FAERS | |
| 38 | Pericarditis | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 39 | Epistaxis | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 40 | Injection site pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Syncope | FAERS: 24 | SIDER US FAERS | |
| 42 | Dizziness | FAERS: 23 | SIDER US FAERS | |
| 43 | Neutropenic sepsis | FAERS: 23 | SIDER US FAERS | |
| 44 | Pericardial effusion | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 45 | Cardiac Arrest | FAERS: 22 | US FAERS | |
| 46 | Colitis | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 47 | Abdominal Pain | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 48 | Bronchopulmonary Aspergillosis | FAERS: 21 | US FAERS | |
| 49 | Dehydration | FAERS: 20 | SIDER US FAERS | |
| 50 | Diabetes Mellitus | FAERS: 20 | US FAERS | |
| 51 | Injection site erythema | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 52 | Pulmonary Embolism | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Weight decreased | FAERS: 20 | SIDER US FAERS | |
| 54 | Erythema | FAERS: 19 | SIDER US FAERS | |
| 55 | Headache | FAERS: 19 | SIDER US FAERS | |
| 56 | Pyoderma Gangrenosum | FAERS: 19 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 57 | Back Pain | FAERS: 18 | SIDER US FAERS | |
| 58 | Leukocytosis | FAERS: 18 | US FAERS | |
| 59 | Atrial Fibrillation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Chills | FAERS: 16 | SIDER US FAERS | |
| 61 | Disseminated Intravascular Coagulation | FAERS: 16 | US FAERS | |
| 62 | Pain | FAERS: 16 | SIDER US FAERS | |
| 63 | Skin necrosis | FAERS: 16 | OFFSIDES US FAERS | |
| 64 | Blood creatinine increased | FAERS: 15 | US FAERS | |
| 65 | Disease recurrence | FAERS: 15 | US FAERS | |
| 66 | Lower respiratory tract infection | FAERS: 15 | US FAERS | |
| 67 | Angina Pectoris | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Chest Pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 69 | Hypoxia | FAERS: 14 | US FAERS | |
| 70 | Malignant neoplasm progression | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Pruritus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 72 | Tachycardia | FAERS: 14 | SIDER US FAERS | |
| 73 | Dementia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Dyspepsia | FAERS: 13 | SIDER US FAERS | |
| 75 | Appendicitis | FAERS: 12 | OFFSIDES US FAERS | |
| 76 | Bronchitis | FAERS: 12 | SIDER US FAERS | |
| 77 | Cytopenia | FAERS: 12 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 78 | Gastroenteritis | FAERS: 12 | US FAERS | |
| 79 | Nasopharyngitis | FAERS: 12 | SIDER US FAERS | |
| 80 | Deep Vein Thrombosis | FAERS: 11 | US FAERS | |
| 81 | Gastrointestinal toxicity | FAERS: 11 | OFFSIDES US FAERS | |
| 82 | Graft versus host disease in gastrointestinal tract | FAERS: 11 | US FAERS | |
| 83 | Myelofibrosis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Pulmonary sepsis | FAERS: 11 | US FAERS | |
| 85 | Shock | FAERS: 11 | SIDER US FAERS | |
| 86 | Skin reaction | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Unevaluable event | FAERS: 11 | US FAERS | |
| 88 | Ascites | FAERS: 10 | US FAERS | |
| 89 | Blast cell count increased | FAERS: 10 | OFFSIDES US FAERS | |
| 90 | Cerebral Infarction | FAERS: 10 | US FAERS | |
| 91 | Influenza | FAERS: 10 | US FAERS | |
| 92 | Pneumonitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Tuberculosis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Acute myocardial infarction | FAERS: 9 | OFFSIDES US FAERS | |
| 95 | Anal abscess | FAERS: 9 | OFFSIDES US FAERS | |
| 96 | Complications of transplant surgery | FAERS: 9 | US FAERS | |
| 97 | Diverticulitis | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 98 | Dysgeusia | FAERS: 9 | US FAERS | |
| 99 | Embolism | FAERS: 9 | OFFSIDES US FAERS | |
| 100 | Febrile bone marrow aplasia | FAERS: 9 | OFFSIDES US FAERS | |
| 101 | Immunosuppression | FAERS: 9 | US FAERS | |
| 102 | Urticaria | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 103 | Agranulocytosis | FAERS: 8 | SIDER US FAERS | |
| 104 | Arthralgia | FAERS: 8 | SIDER US FAERS | |
| 105 | Aspergillosis | FAERS: 8 | OFFSIDES US FAERS | |
| 106 | Cachexia | FAERS: 8 | US FAERS | |
| 107 | Deafness | FAERS: 8 | US FAERS | |
| 108 | Drug toxicity | FAERS: 8 | US FAERS | |
| 109 | Gastrointestinal infection | FAERS: 8 | US FAERS | |
| 110 | Inflammation | FAERS: 8 | SIDER US FAERS | |
| 111 | Skin toxicity | FAERS: 8 | US FAERS | |
| 112 | Somnolence | FAERS: 8 | US FAERS | |
| 113 | Stomatitis | FAERS: 8 | 2410119 | CTD SIDER US FAERS |
| 114 | Urinary Retention | FAERS: 8 | US FAERS | |
| 115 | Clostridium difficile colitis | FAERS: 7 | US FAERS | |
| 116 | Delirium | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Ejection Fraction Decreased | FAERS: 7 | US FAERS | |
| 118 | Erythema Multiforme | FAERS: 7 | US FAERS | |
| 119 | Hepatotoxicity | FAERS: 7 | US FAERS | |
| 120 | Hypersensitivity | FAERS: 7 | SIDER US FAERS | |
| 121 | Injection site abscess | FAERS: 7 | US FAERS | |
| 122 | Injection site necrosis | FAERS: 7 | SIDER US FAERS | |
| 123 | Injection site nodule | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 124 | Intestinal Obstruction | FAERS: 7 | OFFSIDES US FAERS | |
| 125 | Phlebitis | FAERS: 7 | OFFSIDES US FAERS | |
| 126 | Rhabdomyolysis | FAERS: 7 | 8832525 | CTD US FAERS |
| 127 | Skin Ulcer | FAERS: 7 | US FAERS | |
| 128 | Splenomegaly | FAERS: 7 | SIDER US FAERS | |
| 129 | Subileus | FAERS: 7 | US FAERS | |
| 130 | Sudden death | FAERS: 7 | US FAERS | |
| 131 | Swelling | FAERS: 7 | US FAERS | |
| 132 | Thrombocytosis | FAERS: 7 | US FAERS | |
| 133 | Vasculitis | FAERS: 7 | US FAERS | |
| 134 | nervous system disorder | FAERS: 7 | SIDER US FAERS | |
| 135 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 136 | Alopecia | FAERS: 6 | SIDER US FAERS | |
| 137 | Atelectasis | FAERS: 6 | SIDER US FAERS | |
| 138 | Blood lactate dehydrogenase increased | FAERS: 6 | US FAERS | |
| 139 | Bronchopneumonia | FAERS: 6 | US FAERS | |
| 140 | Bursitis | FAERS: 6 | US FAERS | |
| 141 | Cholestasis | FAERS: 6 | US FAERS | |
| 142 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 143 | Endocarditis | FAERS: 6 | OFFSIDES US FAERS | |
| 144 | Extravasation | FAERS: 6 | US FAERS | |
| 145 | Graft versus host disease in liver | FAERS: 6 | US FAERS | |
| 146 | Histiocytosis haematophagic | FAERS: 6 | US FAERS | |
| 147 | Ileus | FAERS: 6 | US FAERS | |
| 148 | Injection site cellulitis | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Injection site infection | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 150 | Neutropenic infection | FAERS: 6 | OFFSIDES US FAERS | |
| 151 | Performance status decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 152 | Pseudomonal sepsis | FAERS: 6 | OFFSIDES US FAERS | |
| 153 | Pulmonary Fibrosis | FAERS: 6 | US FAERS | |
| 154 | Sinusitis | FAERS: 6 | SIDER US FAERS | |
| 155 | Thrombosis | FAERS: 6 | US FAERS | |
| 156 | pseudomembranous colitis | FAERS: 6 | US FAERS | |
| 157 | Abscess | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 158 | Acute graft versus host disease in intestine | FAERS: 5 | US FAERS | |
| 159 | Anal Fissure | FAERS: 5 | OFFSIDES US FAERS | |
| 160 | Arthritis | FAERS: 5 | US FAERS | |
| 161 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 162 | Bacterial sepsis | FAERS: 5 | US FAERS | |
| 163 | Blindness | FAERS: 5 | US FAERS | |
| 164 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 165 | Blood count abnormal | FAERS: 5 | US FAERS | |
| 166 | Blood iron increased | FAERS: 5 | OFFSIDES US FAERS | |
| 167 | Blood urea increased | FAERS: 5 | US FAERS | |
| 168 | Bone marrow necrosis | FAERS: 5 | US FAERS | |
| 169 | Bone pain | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 170 | Cholangitis | FAERS: 5 | US FAERS | |
| 171 | Decreased immune responsiveness | FAERS: 5 | US FAERS | |
| 172 | Erysipelas | FAERS: 5 | OFFSIDES US FAERS | |
| 173 | Erythema Nodosum | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 174 | Fibrosis | FAERS: 5 | US FAERS | |
| 175 | Large intestine perforation | FAERS: 5 | US FAERS | |
| 176 | Liver Abscess | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Lymphopenia | FAERS: 5 | US FAERS | |
| 178 | Medication Error | FAERS: 5 | US FAERS | |
| 179 | Osteomyelitis | FAERS: 5 | US FAERS | |
| 180 | Pancreatic carcinoma | FAERS: 5 | US FAERS | |
| 181 | Petechiae | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 182 | Pharyngitis | FAERS: 5 | SIDER US FAERS | |
| 183 | Polychondritis | FAERS: 5 | US FAERS | |
| 184 | Product quality issue | FAERS: 5 | US FAERS | |
| 185 | Pseudoradicular syndrome | FAERS: 5 | US FAERS | |
| 186 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 187 | Skin lesion | FAERS: 5 | SIDER US FAERS | |
| 188 | Toxoplasmosis | FAERS: 5 | SIDER US FAERS | |
| 189 | Troponin increased | FAERS: 5 | US FAERS | |
| 190 | jaundice | FAERS: 5 | US FAERS | |
| 191 | Accidental exposure | FAERS: 4 | US FAERS | |
| 192 | Acute promyelocytic leukaemia differentiation syndrome | FAERS: 4 | US FAERS | |
| 193 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 194 | Arthropathy | FAERS: 4 | US FAERS | |
| 195 | Cholecystitis | FAERS: 4 | SIDER US FAERS | |
| 196 | Cystitis | FAERS: 4 | US FAERS | |
| 197 | Cytolytic hepatitis | FAERS: 4 | US FAERS | |
| 198 | Device related infection | FAERS: 4 | OFFSIDES US FAERS | |
| 199 | Disorientation | FAERS: 4 | US FAERS | |
| 200 | Epilepsy | FAERS: 4 | US FAERS | |
| 201 | Escherichia infection | FAERS: 4 | OFFSIDES US FAERS | |
| 202 | Febrile infection | FAERS: 4 | OFFSIDES US FAERS | |
| 203 | Feeling abnormal | FAERS: 4 | SIDER US FAERS | |
| 204 | Graft versus host disease in skin | FAERS: 4 | US FAERS | |
| 205 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 206 | Infarction | FAERS: 4 | US FAERS | |
| 207 | Injection site irritation | FAERS: 4 | US FAERS | |
| 208 | Injection site vesicles | FAERS: 4 | US FAERS | |
| 209 | Lymphocyte count decreased | FAERS: 4 | US FAERS | |
| 210 | Monocytosis | FAERS: 4 | US FAERS | |
| 211 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 212 | Myalgia | FAERS: 4 | SIDER US FAERS | |
| 213 | Pleurisy | FAERS: 4 | US FAERS | |
| 214 | Polyneuropathy | FAERS: 4 | OFFSIDES US FAERS | |
| 215 | Presyncope | FAERS: 4 | US FAERS | |
| 216 | Product use issue | FAERS: 4 | US FAERS | |
| 217 | Pulmonary toxicity | FAERS: 4 | US FAERS | |
| 218 | Soft Tissue Infection | FAERS: 4 | OFFSIDES US FAERS | |
| 219 | Splenic Rupture | FAERS: 4 | US FAERS | |
| 220 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 221 | Thrombocytopenic purpura | FAERS: 4 | US FAERS | |
| 222 | Transaminases increased | FAERS: 4 | US FAERS | |
| 223 | Tremor | FAERS: 4 | US FAERS | |
| 224 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 225 | Acute Lung Injury | FAERS: 3 | US FAERS | |
| 226 | Acute graft versus host disease in liver | FAERS: 3 | OFFSIDES US FAERS | |
| 227 | Administration site reaction | FAERS: 3 | US FAERS | |
| 228 | Agitation | FAERS: 3 | US FAERS | |
| 229 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 230 | Aneurysm | FAERS: 3 | US FAERS | |
| 231 | Angioedema | FAERS: 3 | US FAERS | |
| 232 | Anorectal infection | FAERS: 3 | OFFSIDES US FAERS | |
| 233 | Atrial Flutter | FAERS: 3 | OFFSIDES US FAERS | |
| 234 | Atypical pneumonia | FAERS: 3 | US FAERS | |
| 235 | Blastic plasmacytoid dendritic cell neoplasia | FAERS: 3 | US FAERS | |
| 236 | Blood blister | FAERS: 3 | US FAERS | |
| 237 | Bradycardia | FAERS: 3 | US FAERS | |
| 238 | Cardiac Tamponade | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 239 | Chemical burns of eye | FAERS: 3 | OFFSIDES US FAERS | |
| 240 | Completed Suicide | FAERS: 3 | US FAERS | |
| 241 | Concomitant disease aggravated | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Cyst | FAERS: 3 | SIDER US FAERS | |
| 243 | Diffuse Large B-Cell Lymphoma | FAERS: 3 | US FAERS | |
| 244 | Discomfort | FAERS: 3 | SIDER US FAERS | |
| 245 | Ecchymosis | FAERS: 3 | SIDER US FAERS | |
| 246 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 247 | Enteritis | FAERS: 3 | US FAERS | |
| 248 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 3 | US FAERS | |
| 249 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 250 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 251 | Gastritis | FAERS: 3 | US FAERS | |
| 252 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 253 | Hepatic Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 254 | Hepatitis B | FAERS: 3 | OFFSIDES US FAERS | |
| 255 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 256 | Intestinal Perforation | FAERS: 3 | OFFSIDES US FAERS | |
| 257 | Lethargy | FAERS: 3 | SIDER US FAERS | |
| 258 | Leukaemic infiltration brain | FAERS: 3 | US FAERS | |
| 259 | Leukoencephalopathy | FAERS: 3 | OFFSIDES US FAERS | |
| 260 | Lung consolidation | FAERS: 3 | US FAERS | |
| 261 | Memory impairment | FAERS: 3 | US FAERS | |
| 262 | Metastatic Neoplasm | FAERS: 3 | SIDER US FAERS | |
| 263 | Musculoskeletal Pain | FAERS: 3 | SIDER US FAERS | |
| 264 | Myositis | FAERS: 3 | US FAERS | |
| 265 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 266 | Night sweats | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 267 | Osteonecrosis of Jaw | FAERS: 3 | US FAERS | |
| 268 | Overdose | FAERS: 3 | US FAERS | |
| 269 | Panniculitis | FAERS: 3 | US FAERS | |
| 270 | Parotitis | FAERS: 3 | US FAERS | |
| 271 | Peripheral swelling | FAERS: 3 | SIDER US FAERS | |
| 272 | Post procedural complication | FAERS: 3 | US FAERS | |
| 273 | Product physical issue | FAERS: 3 | US FAERS | |
| 274 | Purpura | FAERS: 3 | SIDER US FAERS | |
| 275 | Pyelonephritis | FAERS: 3 | OFFSIDES US FAERS | |
| 276 | Renal tubular acidosis | FAERS: 3 | SIDER US FAERS | |
| 277 | Rheumatic disorder | FAERS: 3 | US FAERS | |
| 278 | Right ventricular failure | FAERS: 3 | US FAERS | |
| 279 | Sarcoma | FAERS: 3 | 2408741 | CTD US FAERS |
| 280 | Sinusitis aspergillus | FAERS: 3 | US FAERS | |
| 281 | Soft tissue necrosis | FAERS: 3 | OFFSIDES US FAERS | |
| 282 | Splenic Infarction | FAERS: 3 | US FAERS | |
| 283 | Stem cell transplant | FAERS: 3 | US FAERS | |
| 284 | Suicide attempt | FAERS: 3 | US FAERS | |
| 285 | Systemic mycosis | FAERS: 3 | US FAERS | |
| 286 | Toothache | FAERS: 3 | US FAERS | |
| 287 | Tracheobronchitis | FAERS: 3 | US FAERS | |
| 288 | Upper respiratory tract inflammation | FAERS: 3 | US FAERS | |
| 289 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 290 | Venous Thrombosis | FAERS: 3 | US FAERS | |
| 291 | Visual Impairment | FAERS: 3 | US FAERS | |
| 292 | Abdominal Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 293 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 294 | Acidosis | FAERS: 2 | US FAERS | |
| 295 | Acute graft versus host disease in skin | FAERS: 2 | US FAERS | |
| 296 | Ageusia | FAERS: 2 | US FAERS | |
| 297 | Amyloidosis | FAERS: 2 | US FAERS | |
| 298 | Anal Fistula | FAERS: 2 | US FAERS | |
| 299 | Anuria | FAERS: 2 | US FAERS | |
| 300 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 301 | Aortic Valve Stenosis | FAERS: 2 | US FAERS | |
| 302 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 303 | Arterial thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 304 | Asthma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Ataxia | FAERS: 2 | US FAERS | |
| 306 | Axonal neuropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 307 | Basal cell carcinoma | FAERS: 2 | OFFSIDES US FAERS | |
| 308 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 309 | Bone marrow reticulin fibrosis | FAERS: 2 | US FAERS | |
| 310 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 311 | Bronchospasm | FAERS: 2 | US FAERS | |
| 312 | Candidiasis | FAERS: 2 | US FAERS | |
| 313 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 314 | Complications of bone marrow transplant | FAERS: 2 | US FAERS | |
| 315 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 316 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 317 | Diabetes Insipidus | FAERS: 2 | OFFSIDES US FAERS | |
| 318 | Diabetes mellitus inadequate control | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 319 | Diverticular perforation | FAERS: 2 | US FAERS | |
| 320 | Drug dose omission | FAERS: 2 | US FAERS | |
| 321 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 322 | Dry skin | FAERS: 2 | SIDER US FAERS | |
| 323 | Dysuria | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 324 | Encephalitis | FAERS: 2 | US FAERS | |
| 325 | Enterococcal infection | FAERS: 2 | US FAERS | |
| 326 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 327 | Epstein-Barr virus associated lymphoma | FAERS: 2 | US FAERS | |
| 328 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 2 | US FAERS | |
| 329 | Flatulence | FAERS: 2 | US FAERS | |
| 330 | Fluid overload | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 331 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 332 | Gastrointestinal inflammation | FAERS: 2 | OFFSIDES US FAERS | |
| 333 | Gingival Hypertrophy | FAERS: 2 | OFFSIDES US FAERS | |
| 334 | Glycosuria | FAERS: 2 | 6160887 | CTD US FAERS |
| 335 | Gout | FAERS: 2 | US FAERS | |
| 336 | Granulocytes abnormal | FAERS: 2 | US FAERS | |
| 337 | Hepatitis C | FAERS: 2 | US FAERS | |
| 338 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 339 | Induration | FAERS: 2 | SIDER US FAERS | |
| 340 | Infusion site phlebitis | FAERS: 2 | US FAERS | |
| 341 | Injection site bruising | FAERS: 2 | SIDER US FAERS | |
| 342 | Injection site exfoliation | FAERS: 2 | US FAERS | |
| 343 | Injection site mass | FAERS: 2 | US FAERS | |
| 344 | Injection site vasculitis | FAERS: 2 | US FAERS | |
| 345 | Iron Overload | FAERS: 2 | OFFSIDES US FAERS | |
| 346 | Joint swelling | FAERS: 2 | US FAERS | |
| 347 | Laryngitis | FAERS: 2 | US FAERS | |
| 348 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 349 | Local reaction | FAERS: 2 | US FAERS | |
| 350 | Lung Abscess | FAERS: 2 | US FAERS | |
| 351 | Lymph Node Tuberculosis | FAERS: 2 | US FAERS | |
| 352 | Lymphangitis | FAERS: 2 | US FAERS | |
| 353 | Lymphoma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 354 | Meningitis herpes | FAERS: 2 | US FAERS | |
| 355 | Meningitis | FAERS: 2 | US FAERS | |
| 356 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 357 | Metastasis | FAERS: 2 | US FAERS | |
| 358 | Monoplegia | FAERS: 2 | US FAERS | |
| 359 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 360 | Myocarditis | FAERS: 2 | US FAERS | |
| 361 | Neck Pain | FAERS: 2 | SIDER US FAERS | |
| 362 | Necrosis | FAERS: 2 | US FAERS | |
| 363 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 364 | Neuropsychiatric syndrome | FAERS: 2 | US FAERS | |
| 365 | Nodule | FAERS: 2 | SIDER US FAERS | |
| 366 | Oliguria | FAERS: 2 | US FAERS | |
| 367 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 368 | Oral infection | FAERS: 2 | OFFSIDES US FAERS | |
| 369 | Oropharyngeal candidiasis | FAERS: 2 | US FAERS | |
| 370 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 371 | Pancreatitis | FAERS: 2 | US FAERS | |
| 372 | Paraplegia | FAERS: 2 | OFFSIDES US FAERS | |
| 373 | Peritonitis | FAERS: 2 | US FAERS | |
| 374 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 375 | Pneumothorax | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 376 | Procedural complication | FAERS: 2 | US FAERS | |
| 377 | Product reconstitution quality issue | FAERS: 2 | US FAERS | |
| 378 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 379 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 380 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 381 | Refractory cytopenia with multilineage dysplasia | FAERS: 2 | US FAERS | |
| 382 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 383 | Rhinitis | FAERS: 2 | SIDER US FAERS | |
| 384 | Septic embolus | FAERS: 2 | US FAERS | |
| 385 | Skeletal injury | FAERS: 2 | US FAERS | |
| 386 | Skin irritation | FAERS: 2 | US FAERS | |
| 387 | Splenic abscess | FAERS: 2 | US FAERS | |
| 388 | Stress | FAERS: 2 | US FAERS | |
| 389 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 390 | Therapy cessation | FAERS: 2 | US FAERS | |
| 391 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 392 | Transplantation complication | FAERS: 2 | US FAERS | |
| 393 | Troponin I increased | FAERS: 2 | US FAERS | |
| 394 | Ulcer | FAERS: 2 | US FAERS | |
| 395 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 396 | Vertigo | FAERS: 2 | US FAERS | |
| 397 | Viral pericarditis | FAERS: 2 | OFFSIDES US FAERS | |
| 398 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 399 | Wound Infection | FAERS: 2 | US FAERS | |
| 400 | Abdominal discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 401 | Accidental death | FAERS: 1 | US FAERS | |
| 402 | Accidental overdose | FAERS: 1 | US FAERS | |
| 403 | Acne | FAERS: 1 | US FAERS | |
| 404 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 405 | Acquired gene mutation | FAERS: 1 | US FAERS | |
| 406 | Acute polyneuropathy | FAERS: 1 | US FAERS | |
| 407 | Administration site bruise | FAERS: 1 | US FAERS | |
| 408 | Administration site erythema | FAERS: 1 | US FAERS | |
| 409 | Air Embolism | FAERS: 1 | US FAERS | |
| 410 | Amnesia | FAERS: 1 | US FAERS | |
| 411 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 412 | Anal inflammation | FAERS: 1 | US FAERS | |
| 413 | Anastomotic complication | FAERS: 1 | US FAERS | |
| 414 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 415 | Angioimmunoblastic T-cell lymphoma refractory | FAERS: 1 | US FAERS | |
| 416 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 417 | Anorexia | FAERS: 1 | SIDER US FAERS | |
| 418 | Anxiety | FAERS: 1 | SIDER US FAERS | |
| 419 | Aortitis | FAERS: 1 | US FAERS | |
| 420 | Aphasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 421 | Application site infection | FAERS: 1 | US FAERS | |
| 422 | Application site inflammation | FAERS: 1 | US FAERS | |
| 423 | Application site injury | FAERS: 1 | US FAERS | |
| 424 | Application site reaction | FAERS: 1 | US FAERS | |
| 425 | Arteriovenous fistula thrombosis | FAERS: 1 | US FAERS | |
| 426 | Arteritis | FAERS: 1 | US FAERS | |
| 427 | Asphyxia | FAERS: 1 | US FAERS | |
| 428 | Bacillus infection | FAERS: 1 | US FAERS | |
| 429 | Back disorder | FAERS: 1 | US FAERS | |
| 430 | Bedridden | FAERS: 1 | US FAERS | |
| 431 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 432 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 433 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 434 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 435 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 436 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 437 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 438 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 439 | Blood stem cell transplant failure | FAERS: 1 | US FAERS | |
| 440 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 441 | Blood urine present | FAERS: 1 | US FAERS | |
| 442 | Brain Abscess | FAERS: 1 | US FAERS | |
| 443 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 444 | Bronchial Obstruction | FAERS: 1 | OFFSIDES US FAERS | |
| 445 | Candida sepsis | FAERS: 1 | US FAERS | |
| 446 | Candida test positive | FAERS: 1 | US FAERS | |
| 447 | Cardiac Death | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 448 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 449 | Cardiac valve abscess | FAERS: 1 | US FAERS | |
| 450 | Cardiomyopathy acute | FAERS: 1 | US FAERS | |
| 451 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 452 | Cataract | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 453 | Catheter site erythema | FAERS: 1 | SIDER US FAERS | |
| 454 | Catheter site infection | FAERS: 1 | US FAERS | |
| 455 | Catheter site necrosis | FAERS: 1 | US FAERS | |
| 456 | Catheter site pain | FAERS: 1 | US FAERS | |
| 457 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 458 | Catheter site warmth | FAERS: 1 | US FAERS | |
| 459 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 460 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 461 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 462 | Chest discomfort | FAERS: 1 | US FAERS | |
| 463 | Chimerism | FAERS: 1 | US FAERS | |
| 464 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 465 | Citrobacter infection | FAERS: 1 | US FAERS | |
| 466 | Clonus | FAERS: 1 | US FAERS | |
| 467 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 468 | Compression fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 469 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 470 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 471 | Device dislocation | FAERS: 1 | US FAERS | |
| 472 | Device related sepsis | FAERS: 1 | US FAERS | |
| 473 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 474 | Diabetic foot infection | FAERS: 1 | US FAERS | |
| 475 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 476 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 477 | Dysarthria | FAERS: 1 | US FAERS | |
| 478 | Dysphonia | FAERS: 1 | US FAERS | |
| 479 | Early satiety | FAERS: 1 | US FAERS | |
| 480 | Emotional distress | FAERS: 1 | US FAERS | |
| 481 | Empyema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 482 | Enterocolitis | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 484 | Eosinophilia | FAERS: 1 | US FAERS | |
| 485 | Erythroblastosis | FAERS: 1 | US FAERS | |
| 486 | Escherichia sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 487 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 488 | Eye pain | FAERS: 1 | OFFSIDES US FAERS | |
| 489 | Eyelid pain | FAERS: 1 | US FAERS | |
| 490 | Facial Paresis | FAERS: 1 | US FAERS | |
| 491 | Facial paralysis | FAERS: 1 | US FAERS | |
| 492 | Factor V inhibition | FAERS: 1 | US FAERS | |
| 493 | Fat necrosis | FAERS: 1 | US FAERS | |
| 494 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 495 | Fracture | FAERS: 1 | US FAERS | |
| 496 | Ganglioneuroma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 497 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 498 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 499 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 500 | General symptom | FAERS: 1 | US FAERS | |
| 501 | Genital Herpes | FAERS: 1 | US FAERS | |
| 502 | Genital abscess | FAERS: 1 | US FAERS | |
| 503 | Genitourinary tract infection | FAERS: 1 | US FAERS | |
| 504 | Gingivitis | FAERS: 1 | US FAERS | |
| 505 | Glaucoma | FAERS: 1 | OFFSIDES US FAERS | |
| 506 | Glioblastoma | FAERS: 1 | US FAERS | |
| 507 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 508 | Glossitis | FAERS: 1 | US FAERS | |
| 509 | Guillain-Barre Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 510 | Hemiplegia | FAERS: 1 | US FAERS | |
| 511 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 512 | Hepatitis E | FAERS: 1 | US FAERS | |
| 513 | Hidradenitis | FAERS: 1 | US FAERS | |
| 514 | Hospice Care | FAERS: 1 | US FAERS | |
| 515 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 516 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 517 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 518 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 519 | Hypomania | FAERS: 1 | US FAERS | |
| 520 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 521 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 522 | Ileal Stenosis | FAERS: 1 | US FAERS | |
| 523 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 524 | Impaired self-care | FAERS: 1 | US FAERS | |
| 525 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 526 | Incontinence | FAERS: 1 | US FAERS | |
| 527 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 528 | Infectious colitis | FAERS: 1 | US FAERS | |
| 529 | Infusion site pruritus | FAERS: 1 | US FAERS | |
| 530 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 531 | Injection site dermatitis | FAERS: 1 | SIDER US FAERS | |
| 532 | Injection site discomfort | FAERS: 1 | US FAERS | |
| 533 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 534 | Injection site streaking | FAERS: 1 | US FAERS | |
| 535 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 536 | Janus kinase 2 mutation | FAERS: 1 | US FAERS | |
| 537 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 538 | Jugular vein occlusion | FAERS: 1 | US FAERS | |
| 539 | Leptotrichia infection | FAERS: 1 | US FAERS | |
| 540 | Limb injury | FAERS: 1 | US FAERS | |
| 541 | Limbic Encephalitis | FAERS: 1 | US FAERS | |
| 542 | Lip and/or oral cavity cancer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 543 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 544 | Listeriosis | FAERS: 1 | US FAERS | |
| 545 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 546 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 547 | Lung squamous cell carcinoma stage IV | FAERS: 1 | US FAERS | |
| 548 | Lymphadenopathy | FAERS: 1 | SIDER US FAERS | |
| 549 | Macule | FAERS: 1 | US FAERS | |
| 550 | Malabsorption | FAERS: 1 | US FAERS | |
| 551 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 552 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 553 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 554 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 555 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 556 | Mucormycosis | FAERS: 1 | US FAERS | |
| 557 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 558 | Myopericarditis | FAERS: 1 | US FAERS | |
| 559 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 560 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 561 | Neuralgia | FAERS: 1 | US FAERS | |
| 562 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 563 | Neutrophilic panniculitis | FAERS: 1 | US FAERS | |
| 564 | No adverse event | FAERS: 1 | US FAERS | |
| 565 | Nodular vasculitis | FAERS: 1 | US FAERS | |
| 566 | Obesity | FAERS: 1 | US FAERS | |
| 567 | Optic Neuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 568 | Oral pain | FAERS: 1 | US FAERS | |
| 569 | Oral pustule | FAERS: 1 | US FAERS | |
| 570 | Osteolysis | FAERS: 1 | US FAERS | |
| 571 | PO2 decreased | FAERS: 1 | US FAERS | |
| 572 | Palpitations | FAERS: 1 | US FAERS | |
| 573 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 574 | Paraparesis | FAERS: 1 | US FAERS | |
| 575 | Pemphigus | FAERS: 1 | US FAERS | |
| 576 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 577 | Periorbital abscess | FAERS: 1 | US FAERS | |
| 578 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 579 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 580 | Perirectal abscess | FAERS: 1 | SIDER US FAERS | |
| 581 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 582 | Philadelphia chromosome positive | FAERS: 1 | US FAERS | |
| 583 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 584 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 585 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 586 | Polyarthritis | FAERS: 1 | US FAERS | |
| 587 | Post procedural infection | FAERS: 1 | US FAERS | |
| 588 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 589 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 590 | Product administration error | FAERS: 1 | US FAERS | |
| 591 | Product formulation issue | FAERS: 1 | US FAERS | |
| 592 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 593 | Product packaging issue | FAERS: 1 | US FAERS | |
| 594 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 595 | Productive Cough | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 596 | Protein total decreased | FAERS: 1 | US FAERS | |
| 597 | Psoriasis | FAERS: 1 | US FAERS | |
| 598 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 599 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 600 | Pure white cell aplasia | FAERS: 1 | US FAERS | |
| 601 | Rales | FAERS: 1 | SIDER US FAERS | |
| 602 | Rash erythematous | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 603 | Renal Colic | FAERS: 1 | US FAERS | |
| 604 | Renal cyst | FAERS: 1 | US FAERS | |
| 605 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 606 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 607 | Respiratory distress | FAERS: 1 | SIDER US FAERS | |
| 608 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 609 | Restlessness | FAERS: 1 | US FAERS | |
| 610 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 611 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 612 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 613 | Rhinalgia | FAERS: 1 | US FAERS | |
| 614 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 615 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 616 | Scab | FAERS: 1 | US FAERS | |
| 617 | Scedosporium infection | FAERS: 1 | US FAERS | |
| 618 | Secretion discharge | FAERS: 1 | US FAERS | |
| 619 | Seminal vesiculitis | FAERS: 1 | US FAERS | |
| 620 | Severe Acute Respiratory Syndrome | FAERS: 1 | US FAERS | |
| 621 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 622 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 623 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 624 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 625 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 626 | Superinfection | FAERS: 1 | US FAERS | |
| 627 | Systemic Inflammatory Response Syndrome | FAERS: 1 | SIDER US FAERS | |
| 628 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 629 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 630 | Terminal state | FAERS: 1 | US FAERS | |
| 631 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 632 | Thermal burn | FAERS: 1 | US FAERS | |
| 633 | Throat irritation | FAERS: 1 | US FAERS | |
| 634 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 635 | Tooth Infection | FAERS: 1 | US FAERS | |
| 636 | Transfusion Reaction | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 637 | Transfusion-Related Acute Lung Injury | FAERS: 1 | US FAERS | |
| 638 | Transplant | FAERS: 1 | US FAERS | |
| 639 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 640 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 641 | Urinary tract infection pseudomonal | FAERS: 1 | US FAERS | |
| 642 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 643 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 644 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 645 | Venoocclusive disease | FAERS: 1 | US FAERS | |
| 646 | Ventricular Flutter | FAERS: 1 | US FAERS | |
| 647 | Vulvar erosion | FAERS: 1 | US FAERS | |
| 648 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 649 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 650 | Zygomycosis | FAERS: 1 | US FAERS | |
| 651 | prostatitis | FAERS: 1 | US FAERS | |
| 652 | Abdominal Infection | Canada Vigilance: 1 | Canada Vigilance | |
| 653 | Abdominal sepsis | OFFSIDES | ||
| 654 | Abdominal tenderness | SIDER | ||
| 655 | Abnormalities, Drug-Induced | 2467392 | CTD | |
| 656 | Abscess soft tissue | Canada Vigilance: 1 | Canada Vigilance | |
| 657 | Acute prerenal failure | OFFSIDES | ||
| 658 | Agraphia | OFFSIDES | ||
| 659 | Anaemia NOS aggravated | SIDER | ||
| 660 | Anaphylactic shock | SIDER | ||
| 661 | Anencephaly | 11875660 | CTD | |
| 662 | Anorectal cellulitis | OFFSIDES | ||
| 663 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 664 | Apnea | OFFSIDES | ||
| 665 | Asbestosis | OFFSIDES | ||
| 666 | Atrial tachycardia | OFFSIDES | ||
| 667 | Bacterial culture positive | OFFSIDES | ||
| 668 | Birth Weight | 70373 | CTD | |
| 669 | Blast cell count decreased | OFFSIDES | ||
| 670 | Blastomycosis | SIDER | ||
| 671 | Blepharospasm | OFFSIDES | ||
| 672 | Blood Coagulation Disorders | 26712470 | CTD | |
| 673 | Blood Glucose | OFFSIDES | ||
| 674 | Blood and lymphatic system disorders | SIDER | ||
| 675 | Blood erythropoietin increased | OFFSIDES | ||
| 676 | Blood immunoglobulin A increased | OFFSIDES | ||
| 677 | Bone Marrow Diseases | 2410119 6178065 | CTD | |
| 678 | Bone fistula | OFFSIDES | ||
| 679 | Bone marrow depression | SIDER | ||
| 680 | Bone pain aggravated | SIDER | ||
| 681 | Brain Diseases | 70373 | CTD | |
| 682 | Bronchial Neoplasms | 6209028 | CTD | |
| 683 | Cardiomyopathies | 2410119 | CTD | |
| 684 | Cardiovascular Abnormalities | 26712470 | CTD | |
| 685 | Chemical and Drug Induced Liver Injury | 6178065 | CTD | |
| 686 | Chest wall pain | SIDER | ||
| 687 | Chronic left ventricular failure | OFFSIDES | ||
| 688 | Colonic Neoplasms | 19723570 | CTD | |
| 689 | Colorectal Neoplasms | 19934284 | CTD | |
| 690 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 691 | Decreased Libido | OFFSIDES | ||
| 692 | Dermatitis | SIDER | ||
| 693 | Device leakage | OFFSIDES | ||
| 694 | Diarrhea | 2410119 | CTD | |
| 695 | Drug addict | OFFSIDES | ||
| 696 | Dyspnoea exacerbated | SIDER | ||
| 697 | Edema | 26712470 | CTD | |
| 698 | Embryo Loss | 26712470 | CTD | |
| 699 | Endarterectomy | OFFSIDES | ||
| 700 | Eye muscle operation | OFFSIDES | ||
| 701 | Failure to Thrive | OFFSIDES | ||
| 702 | Fasciotomy | OFFSIDES | ||
| 703 | Fatigue aggravated | SIDER | ||
| 704 | Fetal Death | 2408741 | CTD | |
| 705 | Fetal Growth Retardation | 1690922 | CTD | |
| 706 | Fetal Resorption | 1690922 | CTD | |
| 707 | Flank Pain | OFFSIDES | ||
| 708 | Fungal test positive | OFFSIDES | ||
| 709 | Gastrointestinal Pain | SIDER | ||
| 710 | General physical condition | OFFSIDES | ||
| 711 | Giardiasis | OFFSIDES | ||
| 712 | Granulocytosis | OFFSIDES | ||
| 713 | Hyperbilirubinemia | 2410119 | CTD | |
| 714 | Hypercapnia | OFFSIDES | ||
| 715 | Hypophosphatemia | 6160887 | CTD | |
| 716 | Hypotension, Orthostatic | 6160887 | CTD | |
| 717 | Incision site pain | Canada Vigilance: 1 | Canada Vigilance | |
| 718 | Infestation | SIDER | ||
| 719 | Injection site fibrosis | OFFSIDES | ||
| 720 | Injection site granuloma | SIDER | ||
| 721 | Injection site pruritus | SIDER | ||
| 722 | Injection site warmth | Canada Vigilance: 1 | Canada Vigilance | |
| 723 | Intestinal infarction | OFFSIDES | ||
| 724 | Joint abscess | OFFSIDES | ||
| 725 | Kidney Diseases | 19723570 | CTD | |
| 726 | Klebsiella sepsis | SIDER | ||
| 727 | Leukopenia neonatal | OFFSIDES | ||
| 728 | Leukostasis | OFFSIDES | ||
| 729 | Lipase abnormal | OFFSIDES | ||
| 730 | Liver Neoplasms, Experimental | 17113696 | CTD | |
| 731 | Loin pain | SIDER | ||
| 732 | Lung Neoplasms | 2408741 21224363 | CTD | |
| 733 | Mammary Neoplasms, Experimental | 19723570 | CTD | |
| 734 | Metamyelocyte count increased | OFFSIDES | ||
| 735 | Monosomy | 19299654 | CTD | |
| 736 | Multiple Myeloma | 18443271 19549372 | CTD OFFSIDES | |
| 737 | Musculoskeletal chest pain | SIDER | ||
| 738 | Musculoskeletal discomfort | SIDER | ||
| 739 | Myelodysplasia | OFFSIDES | ||
| 740 | Neoplasms, Experimental | 2408741 | CTD | |
| 741 | Neoplasms, Multiple Primary | 6209028 | CTD | |
| 742 | Neural Tube Defects | 1690922 | CTD | |
| 743 | Neuromuscular Diseases | 6178065 | CTD | |
| 744 | Nutritional condition abnormal | OFFSIDES | ||
| 745 | Optic Disc Edema | OFFSIDES | ||
| 746 | Oral mucosal petechiae | SIDER | ||
| 747 | Pallor | SIDER | ||
| 748 | Pharyngolaryngeal Pain | SIDER | ||
| 749 | Pitting edema | SIDER | ||
| 750 | Polyuria | 6160887 11219485 | CTD | |
| 751 | Post procedural pain | SIDER | ||
| 752 | Precancerous Conditions | 2578334 6208592 6209028 | CTD | |
| 753 | Prenatal Exposure Delayed Effects | 70373 | CTD | |
| 754 | Prenatal Injuries | 1690922 | CTD | |
| 755 | Prostatic Neoplasms | 18324645 | CTD | |
| 756 | Prurigo | SIDER | ||
| 757 | Psychomotor skills impaired | OFFSIDES | ||
| 758 | Pterygium | OFFSIDES | ||
| 759 | Red blood cell spherocytes present | OFFSIDES | ||
| 760 | Rhonchi | SIDER | ||
| 761 | Sarcoma, Experimental | 2408741 | CTD | |
| 762 | Scotoma | OFFSIDES | ||
| 763 | Sigmoiditis | OFFSIDES | ||
| 764 | Skin Induration | SIDER | ||
| 765 | Skin Neoplasms | 6209028 | CTD | |
| 766 | Skin neoplasm excision | OFFSIDES | ||
| 767 | Skin nodule | SIDER | ||
| 768 | Snoring | OFFSIDES | ||
| 769 | Soft Tissue Neoplasms | 2408741 | CTD | |
| 770 | Spondylitic myelopathy | OFFSIDES | ||
| 771 | Sporotrichosis | OFFSIDES | ||
| 772 | Sputum culture positive | OFFSIDES | ||
| 773 | Supraventricular tachyarrhythmia | OFFSIDES | ||
| 774 | Temporal Arteritis | OFFSIDES | ||
| 775 | Testicular Neoplasms | 6209028 | CTD | |
| 776 | Upper-airway cough syndrome | SIDER | ||
| 777 | Vascular purpura | SIDER | ||
| 778 | Viral upper respiratory tract infection | OFFSIDES | ||
| 779 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 780 | Wheezing | SIDER | ||
| 781 | Wound closure | OFFSIDES | ||
| 782 | bone marrow fibrosis | OFFSIDES | ||
| 783 | leukemia | 2408741 19148494 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.