Valproic Acid
(MSRILKIQRXUYCT-UHFFFAOYSA-M)
Structure
- SMILES
- CCCC(C(=O)O)CCC.CCCC(C(=O)[O-])CCC.[Na+]
- Molecular Formula:
- C16H31NaO4
- Molecular Weight:
- 310.405
- Log P:
- 3.2401
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 77.43
- CAS Number(s):
- 76584-70-8
Synonym(s)
1.
Valproic Acid
2.
Dipropyl Acetate
3.
Divalproex
4.
Sodium Valproate
5.
2-Propylpentanoic Acid
6.
Calcium Valproate
7.
Convulsofin
8.
Depakene
9.
Depakine
10.
Depakote
11.
Divalproex Sodium
12.
Ergenyl
13.
Magnesium Valproate
14.
Propylisopropylacetic Acid
15.
Semisodium Valproate
16.
Valproate
17.
Valproate Calcium
18.
Valproate Sodium
19.
Valproic Acid, Sodium Salt (2:1)
20.
Vupral
21.
2 Propylpentanoic Acid
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 696 | US FAERS | |
| 2 | Emotional distress | FAERS: 622 | US FAERS | |
| 3 | Deformity | FAERS: 595 | US FAERS | |
| 4 | Anhedonia | FAERS: 593 | US FAERS | |
| 5 | Physical disability | FAERS: 577 | US FAERS | |
| 6 | Spina Bifida | FAERS: 400 | US FAERS | |
| 7 | Tension | FAERS: 311 | US FAERS | |
| 8 | Anxiety | FAERS: 288 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Impaired work ability | FAERS: 227 | US FAERS | |
| 10 | Alopecia | FAERS: 205 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Product substitution issue | FAERS: 198 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 12 | Life expectancy shortened | FAERS: 196 | US FAERS | |
| 13 | Activities of daily living impaired | FAERS: 190 | US FAERS | |
| 14 | Unevaluable event | FAERS: 183 | US FAERS | |
| 15 | Drug exposure during pregnancy | FAERS: 178 | US FAERS | |
| 16 | Tremor | FAERS: 165 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Drug ineffective | FAERS: 157 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 18 | Economic problem | FAERS: 154 | US FAERS | |
| 19 | Medication residue | FAERS: 137 | US FAERS | |
| 20 | Ammonia increased | FAERS: 128 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 21 | Somnolence | FAERS: 110 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 22 | Quality of life decreased | FAERS: 96 | US FAERS | |
| 23 | Nausea | FAERS: 91 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 24 | Vomiting | FAERS: 89 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 25 | Maternal exposure during pregnancy | FAERS: 85 | US FAERS | |
| 26 | Feeling abnormal | FAERS: 84 | US FAERS | |
| 27 | Drug level decreased | FAERS: 81 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 28 | Pancreatitis | FAERS: 79 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 29 | Mental impairment | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Headache | FAERS: 77 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 31 | Dizziness | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Fatigue | FAERS: 74 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 33 | Thrombocytopenia | FAERS: 71 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 34 | Live Birth | FAERS: 55 | US FAERS | |
| 35 | Malaise | FAERS: 50 | US FAERS | |
| 36 | Drug level increased | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Overdose | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Product quality issue | FAERS: 47 | US FAERS | |
| 39 | Hypersensitivity | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Dysmorphism | FAERS: 42 | US FAERS | |
| 41 | nervous system disorder | FAERS: 42 | US FAERS | |
| 42 | Asthenia | FAERS: 41 | US FAERS | |
| 43 | Drug dispensing error | FAERS: 41 | US FAERS | |
| 44 | Drug level below therapeutic | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Toxicity to various agents | FAERS: 39 | US FAERS | |
| 46 | Amnesia | FAERS: 38 | US FAERS | |
| 47 | Agitation | FAERS: 36 | US FAERS | |
| 48 | Lethargy | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Memory impairment | FAERS: 35 | US FAERS | |
| 50 | Therapeutic response unexpected with drug substitution | FAERS: 35 | US FAERS | |
| 51 | Mental status changes | FAERS: 33 | US FAERS | |
| 52 | Abdominal discomfort | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 53 | Drug dose omission | FAERS: 29 | US FAERS | |
| 54 | Anger | FAERS: 28 | US FAERS | |
| 55 | Abdominal Pain | FAERS: 27 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 56 | Dysarthria | FAERS: 27 | US FAERS | |
| 57 | Pneumonia | FAERS: 27 | US FAERS | |
| 58 | Weight decreased | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Craniofacial deformity | FAERS: 25 | US FAERS | |
| 60 | Pruritus | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Suicide attempt | FAERS: 25 | US FAERS | |
| 62 | Dissociation | FAERS: 24 | US FAERS | |
| 63 | Incorrect dose administered | FAERS: 24 | US FAERS | |
| 64 | Hypospadias | FAERS: 23 | US FAERS | |
| 65 | Medication residue present | FAERS: 23 | US FAERS | |
| 66 | Mood swings | FAERS: 23 | US FAERS | |
| 67 | Supportive care | FAERS: 23 | US FAERS | |
| 68 | Cerebrovascular accident | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Epilepsy | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Bipolar Disorder | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | White blood cell count decreased | FAERS: 21 | US FAERS | |
| 72 | Dehydration | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Disorientation | FAERS: 19 | US FAERS | |
| 74 | Adverse event | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Neutropenia | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 76 | Neutrophil count decreased | FAERS: 18 | US FAERS | |
| 77 | Cleft Palate | FAERS: 17 | US FAERS | |
| 78 | Deafness | FAERS: 17 | US FAERS | |
| 79 | Dyspepsia | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 80 | Illiteracy | FAERS: 17 | US FAERS | |
| 81 | Leukopenia | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 82 | Medication Error | FAERS: 17 | US FAERS | |
| 83 | Tinnitus | FAERS: 17 | US FAERS | |
| 84 | Wrong technique in drug usage process | FAERS: 17 | US FAERS | |
| 85 | Alanine Aminotransferase Increased | FAERS: 16 | US FAERS | |
| 86 | Anticonvulsant drug level decreased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Aspartate Aminotransferase Increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Drug level fluctuating | FAERS: 16 | US FAERS | |
| 89 | Nervousness | FAERS: 16 | US FAERS | |
| 90 | Visual Impairment | FAERS: 16 | US FAERS | |
| 91 | Abasia | FAERS: 15 | US FAERS | |
| 92 | Talipes | FAERS: 15 | US FAERS | |
| 93 | Anticonvulsant drug level below therapeutic | FAERS: 14 | US FAERS | |
| 94 | Hypersomnia | FAERS: 14 | US FAERS | |
| 95 | Hypophagia | FAERS: 14 | US FAERS | |
| 96 | Hypotension | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Ataxia | FAERS: 13 | US FAERS | |
| 98 | Blood sodium decreased | FAERS: 13 | US FAERS | |
| 99 | Completed Suicide | FAERS: 13 | US FAERS | |
| 100 | Crying | FAERS: 13 | US FAERS | |
| 101 | Diabetes Mellitus | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Emotional disorder | FAERS: 13 | US FAERS | |
| 103 | Product use issue | FAERS: 13 | US FAERS | |
| 104 | Cerebral atrophy | FAERS: 12 | US FAERS | |
| 105 | Delirium | FAERS: 12 | US FAERS | |
| 106 | Impaired self-care | FAERS: 12 | US FAERS | |
| 107 | Pancytopenia | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 108 | Paranoia | FAERS: 12 | US FAERS | |
| 109 | Urinary tract infection | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Urticaria | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Anorexia | FAERS: 11 | US FAERS | |
| 112 | Aphasia | FAERS: 11 | US FAERS | |
| 113 | Back Pain | FAERS: 11 | US FAERS | |
| 114 | Blood amylase increased | FAERS: 11 | US FAERS | |
| 115 | Depressed mood | FAERS: 11 | US FAERS | |
| 116 | Epistaxis | FAERS: 11 | US FAERS | |
| 117 | Hepatotoxicity | FAERS: 11 | US FAERS | |
| 118 | Hydrocephalus | FAERS: 11 | US FAERS | |
| 119 | Myocardial Infarction | FAERS: 11 | US FAERS | |
| 120 | Patent ductus arteriosus | FAERS: 11 | US FAERS | |
| 121 | Stevens-Johnson Syndrome | FAERS: 11 | US FAERS | |
| 122 | jaundice | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Anticonvulsant drug level increased | FAERS: 10 | US FAERS | |
| 124 | Cholelithiasis | FAERS: 10 | US FAERS | |
| 125 | Constipation | FAERS: 10 | US FAERS | |
| 126 | Disability | FAERS: 10 | US FAERS | |
| 127 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 128 | Dysgeusia | FAERS: 10 | US FAERS | |
| 129 | Erythema | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Fine motor delay | FAERS: 10 | US FAERS | |
| 131 | Oppositional Defiant Disorder | FAERS: 10 | US FAERS | |
| 132 | Syncope | FAERS: 10 | US FAERS | |
| 133 | Urinary Incontinence | FAERS: 10 | US FAERS | |
| 134 | Arthralgia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 136 | Craniosynostosis | FAERS: 9 | US FAERS | |
| 137 | Depressed Level of Consciousness | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Drug level above therapeutic | FAERS: 9 | US FAERS | |
| 139 | Drug toxicity | FAERS: 9 | US FAERS | |
| 140 | Psychomotor skills impaired | FAERS: 9 | US FAERS | |
| 141 | Sepsis | FAERS: 9 | US FAERS | |
| 142 | Stress | FAERS: 9 | US FAERS | |
| 143 | Vertigo | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Angioedema | FAERS: 8 | US FAERS | |
| 145 | Blindness | FAERS: 8 | US FAERS | |
| 146 | Blood alkaline phosphatase increased | FAERS: 8 | US FAERS | |
| 147 | Chest Pain | FAERS: 8 | US FAERS | |
| 148 | Congenital neurological disorder | FAERS: 8 | US FAERS | |
| 149 | Flatulence | FAERS: 8 | US FAERS | |
| 150 | Hepatic Encephalopathy | FAERS: 8 | US FAERS | |
| 151 | Mental Retardation | FAERS: 8 | US FAERS | |
| 152 | Product taste abnormal | FAERS: 8 | US FAERS | |
| 153 | Amblyopia | FAERS: 7 | US FAERS | |
| 154 | Bedridden | FAERS: 7 | US FAERS | |
| 155 | Erectile dysfunction | FAERS: 7 | US FAERS | |
| 156 | Inappropriate schedule of drug administration | FAERS: 7 | US FAERS | |
| 157 | Intelligence test abnormal | FAERS: 7 | US FAERS | |
| 158 | Neuroleptic Malignant Syndrome | FAERS: 7 | US FAERS | |
| 159 | Osteoporosis | FAERS: 7 | US FAERS | |
| 160 | Palpitations | FAERS: 7 | US FAERS | |
| 161 | Polydactyly | FAERS: 7 | US FAERS | |
| 162 | Poor quality sleep | FAERS: 7 | US FAERS | |
| 163 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 164 | Status Epilepticus | FAERS: 7 | US FAERS | |
| 165 | Stomatitis | FAERS: 7 | US FAERS | |
| 166 | Acidosis | FAERS: 6 | US FAERS | |
| 167 | Acne | FAERS: 6 | US FAERS | |
| 168 | Anticonvulsant drug level above therapeutic | FAERS: 6 | US FAERS | |
| 169 | Asthma | FAERS: 6 | US FAERS | |
| 170 | Azoospermia | FAERS: 6 | US FAERS | |
| 171 | Dementia | FAERS: 6 | US FAERS | |
| 172 | Diplopia | FAERS: 6 | US FAERS | |
| 173 | Dysgraphia | FAERS: 6 | US FAERS | |
| 174 | Educational problem | FAERS: 6 | US FAERS | |
| 175 | Hepatitis C | FAERS: 6 | US FAERS | |
| 176 | Hepatomegaly | FAERS: 6 | US FAERS | |
| 177 | Incontinence | FAERS: 6 | US FAERS | |
| 178 | Intentional drug misuse | FAERS: 6 | US FAERS | |
| 179 | Intentional self-injury | FAERS: 6 | US FAERS | |
| 180 | Joint swelling | FAERS: 6 | US FAERS | |
| 181 | Lipase increased | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 182 | Metabolic acidosis | FAERS: 6 | US FAERS | |
| 183 | Myalgia | FAERS: 6 | US FAERS | |
| 184 | No adverse event | FAERS: 6 | US FAERS | |
| 185 | Obesity | FAERS: 6 | US FAERS | |
| 186 | Product physical issue | FAERS: 6 | US FAERS | |
| 187 | Respiratory Depression | FAERS: 6 | US FAERS | |
| 188 | Restlessness | FAERS: 6 | US FAERS | |
| 189 | Stupor | FAERS: 6 | US FAERS | |
| 190 | Swelling | FAERS: 6 | US FAERS | |
| 191 | Syndactyly | FAERS: 6 | US FAERS | |
| 192 | Therapeutic response changed | FAERS: 6 | US FAERS | |
| 193 | Tooth Loss | FAERS: 6 | US FAERS | |
| 194 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 195 | Ascites | FAERS: 5 | US FAERS | |
| 196 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 197 | Blood albumin decreased | FAERS: 5 | US FAERS | |
| 198 | Blood testosterone decreased | FAERS: 5 | US FAERS | |
| 199 | Burning sensation | FAERS: 5 | US FAERS | |
| 200 | Cataract | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Chills | FAERS: 5 | US FAERS | |
| 202 | Choking | FAERS: 5 | US FAERS | |
| 203 | Dental caries | FAERS: 5 | US FAERS | |
| 204 | Drooling | FAERS: 5 | US FAERS | |
| 205 | Drug Dependence | FAERS: 5 | US FAERS | |
| 206 | Drug administration error | FAERS: 5 | US FAERS | |
| 207 | Drug screen positive | FAERS: 5 | US FAERS | |
| 208 | Dysphonia | FAERS: 5 | US FAERS | |
| 209 | Eczema | FAERS: 5 | US FAERS | |
| 210 | Feeling jittery | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 212 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 213 | Hepatitis | FAERS: 5 | US FAERS | |
| 214 | Hypertrichosis | FAERS: 5 | US FAERS | |
| 215 | Infection | FAERS: 5 | US FAERS | |
| 216 | Intercepted drug dispensing error | FAERS: 5 | US FAERS | |
| 217 | Low set ears | FAERS: 5 | US FAERS | |
| 218 | Macrocephaly | FAERS: 5 | US FAERS | |
| 219 | Meningomyelocele | FAERS: 5 | US FAERS | |
| 220 | Myoclonic Epilepsy | FAERS: 5 | US FAERS | |
| 221 | Myoclonus | FAERS: 5 | US FAERS | |
| 222 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 223 | Pallor | FAERS: 5 | US FAERS | |
| 224 | Partner stress | FAERS: 5 | US FAERS | |
| 225 | Petechiae | FAERS: 5 | US FAERS | |
| 226 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 227 | Photophobia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Poisoning | FAERS: 5 | US FAERS | |
| 229 | Pulmonary Valve Stenosis | FAERS: 5 | US FAERS | |
| 230 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 231 | Respiratory distress | FAERS: 5 | US FAERS | |
| 232 | Retching | FAERS: 5 | US FAERS | |
| 233 | Skin lesion | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 234 | Staring | FAERS: 5 | US FAERS | |
| 235 | Tardive Dyskinesia | FAERS: 5 | US FAERS | |
| 236 | Therapy cessation | FAERS: 5 | US FAERS | |
| 237 | treatment failure | FAERS: 5 | US FAERS | |
| 238 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 239 | Arteriosclerosis | FAERS: 4 | US FAERS | |
| 240 | Bicytopenia | FAERS: 4 | US FAERS | |
| 241 | Bipolar I disorder | FAERS: 4 | US FAERS | |
| 242 | Blood thyroid stimulating hormone increased | FAERS: 4 | US FAERS | |
| 243 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 244 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 245 | Chordee | FAERS: 4 | US FAERS | |
| 246 | Congenital Hydrocephalus | FAERS: 4 | US FAERS | |
| 247 | Congenital cystic kidney disease | FAERS: 4 | US FAERS | |
| 248 | Developmental Coordination Disorder | FAERS: 4 | US FAERS | |
| 249 | Disease recurrence | FAERS: 4 | US FAERS | |
| 250 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 251 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 252 | Dry skin | FAERS: 4 | US FAERS | |
| 253 | Electroencephalogram abnormal | FAERS: 4 | US FAERS | |
| 254 | Enuresis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Eye pain | FAERS: 4 | US FAERS | |
| 256 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 257 | Gait inability | FAERS: 4 | US FAERS | |
| 258 | Hostility | FAERS: 4 | US FAERS | |
| 259 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 260 | Influenza | FAERS: 4 | US FAERS | |
| 261 | Intellectual Disability | FAERS: 4 | US FAERS | |
| 262 | Microcephaly | FAERS: 4 | US FAERS | |
| 263 | Musculoskeletal chest pain | FAERS: 4 | US FAERS | |
| 264 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 265 | Mydriasis | FAERS: 4 | US FAERS | |
| 266 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 267 | Neck Pain | FAERS: 4 | US FAERS | |
| 268 | Obsessive-Compulsive Disorder | FAERS: 4 | US FAERS | |
| 269 | Oculogyric crisis | FAERS: 4 | US FAERS | |
| 270 | Overweight | FAERS: 4 | US FAERS | |
| 271 | Pain of skin | FAERS: 4 | US FAERS | |
| 272 | Pancreatic Cyst | FAERS: 4 | US FAERS | |
| 273 | Pancreatic Pseudocyst | FAERS: 4 | US FAERS | |
| 274 | Pancreatic enzymes increased | FAERS: 4 | US FAERS | |
| 275 | Personality Change | FAERS: 4 | US FAERS | |
| 276 | Physical assault | FAERS: 4 | US FAERS | |
| 277 | Pregnancy | FAERS: 4 | US FAERS | |
| 278 | Priapism | FAERS: 4 | US FAERS | |
| 279 | Product formulation issue | FAERS: 4 | US FAERS | |
| 280 | Pseudodementia | FAERS: 4 | US FAERS | |
| 281 | Sensorimotor disorder | FAERS: 4 | US FAERS | |
| 282 | Sexual relationship change | FAERS: 4 | US FAERS | |
| 283 | Shock | FAERS: 4 | US FAERS | |
| 284 | Tachycardia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Throat irritation | FAERS: 4 | US FAERS | |
| 286 | Thrombosis | FAERS: 4 | US FAERS | |
| 287 | Transaminases increased | FAERS: 4 | US FAERS | |
| 288 | Trisomy 21 | FAERS: 4 | US FAERS | |
| 289 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 290 | Vitamin B1 increased | FAERS: 4 | US FAERS | |
| 291 | Accidental exposure | FAERS: 3 | US FAERS | |
| 292 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 293 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 294 | Anticonvulsant drug level abnormal | FAERS: 3 | US FAERS | |
| 295 | Arthritis | FAERS: 3 | US FAERS | |
| 296 | Blighted ovum | FAERS: 3 | US FAERS | |
| 297 | Bone pain | FAERS: 3 | US FAERS | |
| 298 | Bradycardia | FAERS: 3 | US FAERS | |
| 299 | Bradykinesia | FAERS: 3 | US FAERS | |
| 300 | Breast tenderness | FAERS: 3 | US FAERS | |
| 301 | Catatonia | FAERS: 3 | US FAERS | |
| 302 | Chest discomfort | FAERS: 3 | US FAERS | |
| 303 | Chromaturia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Congenital tracheomalacia | FAERS: 3 | US FAERS | |
| 305 | Cyanosis | FAERS: 3 | US FAERS | |
| 306 | Dandy-Walker Syndrome | FAERS: 3 | US FAERS | |
| 307 | Device occlusion | FAERS: 3 | US FAERS | |
| 308 | Discomfort | FAERS: 3 | US FAERS | |
| 309 | Drowning | FAERS: 3 | US FAERS | |
| 310 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 311 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 312 | Drug level changed | FAERS: 3 | US FAERS | |
| 313 | Dystonia | FAERS: 3 | US FAERS | |
| 314 | Ear discomfort | FAERS: 3 | US FAERS | |
| 315 | Ectopic Pregnancy | FAERS: 3 | US FAERS | |
| 316 | Encephalitis | FAERS: 3 | US FAERS | |
| 317 | Eosinophilia | FAERS: 3 | US FAERS | |
| 318 | Executive dysfunction | FAERS: 3 | US FAERS | |
| 319 | Exposure via ingestion | FAERS: 3 | US FAERS | |
| 320 | Facial Pain | FAERS: 3 | US FAERS | |
| 321 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 322 | Fanconi Syndrome | FAERS: 3 | US FAERS | |
| 323 | Feeling Cold | FAERS: 3 | US FAERS | |
| 324 | Finger hypoplasia | FAERS: 3 | US FAERS | |
| 325 | Flushing | FAERS: 3 | US FAERS | |
| 326 | Gastric Bypass | FAERS: 3 | US FAERS | |
| 327 | Gastritis | FAERS: 3 | US FAERS | |
| 328 | Gaze palsy | FAERS: 3 | US FAERS | |
| 329 | Gliosis | FAERS: 3 | US FAERS | |
| 330 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 331 | Growth retardation | FAERS: 3 | US FAERS | |
| 332 | Hirsutism | FAERS: 3 | US FAERS | |
| 333 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 334 | Hunger | FAERS: 3 | US FAERS | |
| 335 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 336 | Hyperchlorhydria | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 337 | Hypothalamo-pituitary disorder | FAERS: 3 | US FAERS | |
| 338 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 339 | Hypoxia | FAERS: 3 | US FAERS | |
| 340 | Ileus | FAERS: 3 | US FAERS | |
| 341 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 342 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 343 | Incoherent | FAERS: 3 | US FAERS | |
| 344 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 345 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 346 | Limb injury | FAERS: 3 | US FAERS | |
| 347 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 348 | Macrocytosis | FAERS: 3 | US FAERS | |
| 349 | Mastication disorder | FAERS: 3 | US FAERS | |
| 350 | Middle insomnia | FAERS: 3 | US FAERS | |
| 351 | Mitochondrial cytopathy | FAERS: 3 | US FAERS | |
| 352 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 353 | Myoglobinuria | FAERS: 3 | US FAERS | |
| 354 | Paradoxical drug reaction | FAERS: 3 | US FAERS | |
| 355 | Pectus excavatum | FAERS: 3 | US FAERS | |
| 356 | Pericarditis | FAERS: 3 | US FAERS | |
| 357 | Pneumothorax | FAERS: 3 | US FAERS | |
| 358 | Precocious Puberty | FAERS: 3 | US FAERS | |
| 359 | Product packaging issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 360 | Rash erythematous | FAERS: 3 | US FAERS | |
| 361 | Renal pain | FAERS: 3 | US FAERS | |
| 362 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 363 | Sexual Dysfunction | FAERS: 3 | US FAERS | |
| 364 | Sinusitis | FAERS: 3 | US FAERS | |
| 365 | Sluggishness | FAERS: 3 | US FAERS | |
| 366 | Synostosis | FAERS: 3 | US FAERS | |
| 367 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 368 | Tension Headache | FAERS: 3 | US FAERS | |
| 369 | Thirst | FAERS: 3 | US FAERS | |
| 370 | Tongue biting | FAERS: 3 | US FAERS | |
| 371 | Tooth Erosion | FAERS: 3 | US FAERS | |
| 372 | Torticollis | FAERS: 3 | US FAERS | |
| 373 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 374 | Tracheomalacia | FAERS: 3 | US FAERS | |
| 375 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 376 | Violence-related symptom | FAERS: 3 | US FAERS | |
| 377 | Vision abnormal neonatal | FAERS: 3 | US FAERS | |
| 378 | Wheelchair user | FAERS: 3 | US FAERS | |
| 379 | Abulia | FAERS: 2 | US FAERS | |
| 380 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 381 | Accidental overdose | FAERS: 2 | US FAERS | |
| 382 | Ammonia abnormal | FAERS: 2 | US FAERS | |
| 383 | Amylase increased | FAERS: 2 | US FAERS | |
| 384 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 385 | Antipsychotic drug level below therapeutic | FAERS: 2 | US FAERS | |
| 386 | Apathy | FAERS: 2 | US FAERS | |
| 387 | Aphagia | FAERS: 2 | US FAERS | |
| 388 | Arthropathy | FAERS: 2 | US FAERS | |
| 389 | Asterixis | FAERS: 2 | US FAERS | |
| 390 | Astigmatism | FAERS: 2 | US FAERS | |
| 391 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 392 | Aura | FAERS: 2 | US FAERS | |
| 393 | Blepharospasm | FAERS: 2 | US FAERS | |
| 394 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 395 | Blood folate decreased | FAERS: 2 | US FAERS | |
| 396 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 397 | Blood gonadotrophin decreased | FAERS: 2 | US FAERS | |
| 398 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 399 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 400 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 401 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 402 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 403 | Blood urea increased | FAERS: 2 | US FAERS | |
| 404 | Brachycephaly | FAERS: 2 | US FAERS | |
| 405 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 406 | Bruxism | FAERS: 2 | US FAERS | |
| 407 | Carnitine decreased | FAERS: 2 | US FAERS | |
| 408 | Carnitine deficiency | FAERS: 2 | US FAERS | |
| 409 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 410 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 411 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 412 | Complex partial seizures | FAERS: 2 | US FAERS | |
| 413 | Congenital Hypothyroidism | FAERS: 2 | US FAERS | |
| 414 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 415 | Consciousness fluctuating | FAERS: 2 | US FAERS | |
| 416 | Dacryostenosis congenital | FAERS: 2 | US FAERS | |
| 417 | Demyelination | FAERS: 2 | US FAERS | |
| 418 | Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 419 | Diverticulitis | FAERS: 2 | US FAERS | |
| 420 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 421 | Dysuria | FAERS: 2 | US FAERS | |
| 422 | Emergency Care | FAERS: 2 | US FAERS | |
| 423 | Eructation | FAERS: 2 | US FAERS | |
| 424 | Expired product administered | FAERS: 2 | US FAERS | |
| 425 | Febrile Neutropenia | FAERS: 2 | US FAERS | |
| 426 | Flight of ideas | FAERS: 2 | US FAERS | |
| 427 | Frustration | FAERS: 2 | US FAERS | |
| 428 | Gastrectomy | FAERS: 2 | US FAERS | |
| 429 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 430 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 431 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 432 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 433 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 434 | Gastroschisis | FAERS: 2 | US FAERS | |
| 435 | Gastrostomy | FAERS: 2 | US FAERS | |
| 436 | Gingival Hyperplasia | FAERS: 2 | US FAERS | |
| 437 | Gingivitis | FAERS: 2 | US FAERS | |
| 438 | Head deformity | FAERS: 2 | US FAERS | |
| 439 | Head titubation | FAERS: 2 | US FAERS | |
| 440 | Hemiparesis | FAERS: 2 | US FAERS | |
| 441 | Hooded prepuce | FAERS: 2 | US FAERS | |
| 442 | Hyperacusis | FAERS: 2 | US FAERS | |
| 443 | Hyperphagia | FAERS: 2 | US FAERS | |
| 444 | Hypomania | FAERS: 2 | US FAERS | |
| 445 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 446 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 447 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 448 | Inflammation | FAERS: 2 | US FAERS | |
| 449 | Initial insomnia | FAERS: 2 | US FAERS | |
| 450 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 451 | Joint injury | FAERS: 2 | US FAERS | |
| 452 | Laryngomalacia | FAERS: 2 | US FAERS | |
| 453 | Ligament rupture | FAERS: 2 | US FAERS | |
| 454 | Lip swelling | FAERS: 2 | US FAERS | |
| 455 | Malabsorption | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Menorrhagia | FAERS: 2 | US FAERS | |
| 457 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 458 | Microphthalmos | FAERS: 2 | US FAERS | |
| 459 | Mild Mental Retardation | FAERS: 2 | US FAERS | |
| 460 | Mineral deficiency | FAERS: 2 | US FAERS | |
| 461 | Muscle tightness | FAERS: 2 | US FAERS | |
| 462 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 463 | Myopia | FAERS: 2 | US FAERS | |
| 464 | Neutrophil count abnormal | FAERS: 2 | US FAERS | |
| 465 | Night sweats | FAERS: 2 | US FAERS | |
| 466 | Nocturia | FAERS: 2 | US FAERS | |
| 467 | Obstruction | FAERS: 2 | US FAERS | |
| 468 | Ocular icterus | FAERS: 2 | US FAERS | |
| 469 | Oligospermia | FAERS: 2 | US FAERS | |
| 470 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 471 | Osteopenia | FAERS: 2 | US FAERS | |
| 472 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 473 | Pancreatectomy | FAERS: 2 | US FAERS | |
| 474 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 475 | Penile curvature | FAERS: 2 | US FAERS | |
| 476 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 477 | Peripheral swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 478 | Polydipsia | FAERS: 2 | US FAERS | |
| 479 | Polyuria | FAERS: 2 | US FAERS | |
| 480 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 481 | Presyncope | FAERS: 2 | US FAERS | |
| 482 | Product blister packaging issue | FAERS: 2 | US FAERS | |
| 483 | Product counterfeit | FAERS: 2 | US FAERS | |
| 484 | Product storage error | FAERS: 2 | US FAERS | |
| 485 | Pseudocyst | FAERS: 2 | US FAERS | |
| 486 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 487 | Schizophrenia | FAERS: 2 | US FAERS | |
| 488 | Sensory integrative dysfunction | FAERS: 2 | US FAERS | |
| 489 | Sensory level abnormal | FAERS: 2 | US FAERS | |
| 490 | Single umbilical artery | FAERS: 2 | US FAERS | |
| 491 | Sinus headache | FAERS: 2 | US FAERS | |
| 492 | Snoring | FAERS: 2 | US FAERS | |
| 493 | Strabismus | FAERS: 2 | US FAERS | |
| 494 | Syringomyelia | FAERS: 2 | US FAERS | |
| 495 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 496 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 497 | Therapy change | FAERS: 2 | US FAERS | |
| 498 | Toothache | FAERS: 2 | US FAERS | |
| 499 | Trichotillomania | FAERS: 2 | US FAERS | |
| 500 | Tricuspid Valve Stenosis | FAERS: 2 | US FAERS | |
| 501 | Trismus | FAERS: 2 | US FAERS | |
| 502 | Ulcer | FAERS: 2 | US FAERS | |
| 503 | Vagus Nerve Disorder | FAERS: 2 | US FAERS | |
| 504 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 505 | Walking aid user | FAERS: 2 | US FAERS | |
| 506 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 507 | ACTH stimulation test abnormal | FAERS: 1 | US FAERS | |
| 508 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 509 | Abnormal palmar/plantar creases | FAERS: 1 | US FAERS | |
| 510 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 511 | Acquired von Willebrand's disease | FAERS: 1 | US FAERS | |
| 512 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 513 | Akinesia | FAERS: 1 | US FAERS | |
| 514 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 515 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 516 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 517 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 518 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 519 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 520 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 521 | Ammonia decreased | FAERS: 1 | US FAERS | |
| 522 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 523 | Anencephaly | FAERS: 1 | US FAERS | |
| 524 | Aneurysm | FAERS: 1 | US FAERS | |
| 525 | Anorgasmia | FAERS: 1 | US FAERS | |
| 526 | Antipsychotic drug level above therapeutic | FAERS: 1 | US FAERS | |
| 527 | Antipsychotic drug level increased | FAERS: 1 | US FAERS | |
| 528 | Antithrombin III Deficiency | FAERS: 1 | US FAERS | |
| 529 | Anuria | FAERS: 1 | US FAERS | |
| 530 | Aphonia | FAERS: 1 | US FAERS | |
| 531 | Appendicitis | FAERS: 1 | US FAERS | |
| 532 | Arachnodactyly | FAERS: 1 | US FAERS | |
| 533 | Arthropod bite | FAERS: 1 | US FAERS | |
| 534 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 535 | Asphyxia | FAERS: 1 | US FAERS | |
| 536 | Asthenopia | FAERS: 1 | US FAERS | |
| 537 | Atelectasis | FAERS: 1 | US FAERS | |
| 538 | Athetosis | FAERS: 1 | US FAERS | |
| 539 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 540 | Bariatric gastric balloon insertion | FAERS: 1 | US FAERS | |
| 541 | Belligerence | FAERS: 1 | US FAERS | |
| 542 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 543 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 544 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 545 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 546 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 547 | Blood creatinine increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 548 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 549 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 550 | Blood immunoglobulin A decreased | FAERS: 1 | US FAERS | |
| 551 | Blood iron increased | FAERS: 1 | US FAERS | |
| 552 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 553 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 554 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 555 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 556 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 557 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 558 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 559 | Blood urine present | FAERS: 1 | US FAERS | |
| 560 | Bone density decreased | FAERS: 1 | US FAERS | |
| 561 | Brachydactyly | FAERS: 1 | US FAERS | |
| 562 | Brain Death | FAERS: 1 | US FAERS | |
| 563 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 564 | Bronchitis | FAERS: 1 | US FAERS | |
| 565 | Bronchopulmonary Dysplasia | FAERS: 1 | US FAERS | |
| 566 | Calcinosis | FAERS: 1 | US FAERS | |
| 567 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 568 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 569 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 570 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 571 | Cell Death | FAERS: 1 | US FAERS | |
| 572 | Cellulitis | FAERS: 1 | US FAERS | |
| 573 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 574 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 575 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 576 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 577 | Cheilitis | FAERS: 1 | US FAERS | |
| 578 | Cholangitis | FAERS: 1 | US FAERS | |
| 579 | Cholestasis | FAERS: 1 | US FAERS | |
| 580 | Chorea | FAERS: 1 | US FAERS | |
| 581 | Claustrophobia | FAERS: 1 | US FAERS | |
| 582 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 583 | Colitis | FAERS: 1 | US FAERS | |
| 584 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 585 | Complement factor C4 decreased | FAERS: 1 | US FAERS | |
| 586 | Complication associated with device | FAERS: 1 | US FAERS | |
| 587 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 588 | Congenital choroid plexus cyst | FAERS: 1 | US FAERS | |
| 589 | Congenital cutis laxa | FAERS: 1 | US FAERS | |
| 590 | Congenital hearing disorder | FAERS: 1 | US FAERS | |
| 591 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 592 | Congenital renal cyst | FAERS: 1 | US FAERS | |
| 593 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 594 | Congenital scoliosis | FAERS: 1 | US FAERS | |
| 595 | Convulsion in childhood | FAERS: 1 | US FAERS | |
| 596 | Cortisol free urine increased | FAERS: 1 | US FAERS | |
| 597 | Cyst | FAERS: 1 | US FAERS | |
| 598 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 599 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 600 | Decreased eye contact | FAERS: 1 | US FAERS | |
| 601 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 602 | Dehydroepiandrosterone decreased | FAERS: 1 | US FAERS | |
| 603 | Dehydroepiandrosterone increased | FAERS: 1 | US FAERS | |
| 604 | Delayed Puberty | FAERS: 1 | US FAERS | |
| 605 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 606 | Depression suicidal | FAERS: 1 | US FAERS | |
| 607 | Dermatitis | FAERS: 1 | US FAERS | |
| 608 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 609 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 610 | Diet refusal | FAERS: 1 | US FAERS | |
| 611 | Disability assessment scale score decreased | FAERS: 1 | US FAERS | |
| 612 | Disease complication | FAERS: 1 | US FAERS | |
| 613 | Dreamy state | FAERS: 1 | US FAERS | |
| 614 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 615 | Drug abuse | FAERS: 1 | US FAERS | |
| 616 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 617 | Drug label confusion | FAERS: 1 | US FAERS | |
| 618 | Dust inhalation pneumopathy | FAERS: 1 | US FAERS | |
| 619 | Dyschezia | FAERS: 1 | US FAERS | |
| 620 | Dyslexia | FAERS: 1 | US FAERS | |
| 621 | Dysphemia | FAERS: 1 | US FAERS | |
| 622 | Ear tube insertion | FAERS: 1 | US FAERS | |
| 623 | Ectopic kidney | FAERS: 1 | US FAERS | |
| 624 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 625 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 626 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 627 | Embolic stroke | FAERS: 1 | US FAERS | |
| 628 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 629 | Eosinophilic cystitis | FAERS: 1 | US FAERS | |
| 630 | Epidermal necrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 631 | Epilepsy congenital | FAERS: 1 | US FAERS | |
| 632 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 633 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 634 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 635 | Expired drug administered | FAERS: 1 | US FAERS | |
| 636 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 637 | Extremity contracture | FAERS: 1 | US FAERS | |
| 638 | Eye irritation | FAERS: 1 | US FAERS | |
| 639 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 640 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 641 | Flat affect | FAERS: 1 | US FAERS | |
| 642 | Focal dyscognitive seizures | FAERS: 1 | US FAERS | |
| 643 | Food aversion | FAERS: 1 | US FAERS | |
| 644 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 645 | Formication | FAERS: 1 | US FAERS | |
| 646 | Fracture | FAERS: 1 | US FAERS | |
| 647 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 648 | Frostbite | FAERS: 1 | US FAERS | |
| 649 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 650 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 651 | Gallbladder anomaly congenital | FAERS: 1 | US FAERS | |
| 652 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 653 | Gastroenteritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 654 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 655 | Gastrooesophageal sphincter insufficiency | FAERS: 1 | US FAERS | |
| 656 | General physical condition | FAERS: 1 | US FAERS | |
| 657 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 658 | General symptom | FAERS: 1 | US FAERS | |
| 659 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 660 | Gingival Recession | FAERS: 1 | US FAERS | |
| 661 | Glaucoma | FAERS: 1 | US FAERS | |
| 662 | Gout | FAERS: 1 | US FAERS | |
| 663 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 664 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 665 | Head circumference abnormal | FAERS: 1 | US FAERS | |
| 666 | Head discomfort | FAERS: 1 | US FAERS | |
| 667 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 668 | Heat Stroke | FAERS: 1 | US FAERS | |
| 669 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 670 | Hepatitis A | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 671 | Hepatitis B core antigen positive | FAERS: 1 | US FAERS | |
| 672 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 673 | Hernia | FAERS: 1 | US FAERS | |
| 674 | Human papilloma virus test positive | FAERS: 1 | US FAERS | |
| 675 | Hypercapnia | FAERS: 1 | US FAERS | |
| 676 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 677 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 678 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 679 | Hyperventilation | FAERS: 1 | US FAERS | |
| 680 | Hypokinesia | FAERS: 1 | US FAERS | |
| 681 | Hypometabolism | FAERS: 1 | US FAERS | |
| 682 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 683 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 684 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 685 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 686 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 687 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 688 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 689 | Infarction | FAERS: 1 | US FAERS | |
| 690 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 691 | Intentional misuse | FAERS: 1 | US FAERS | |
| 692 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 693 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 694 | Intestinal cyst | FAERS: 1 | US FAERS | |
| 695 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 696 | Joint Instability | FAERS: 1 | US FAERS | |
| 697 | Joint laxity | FAERS: 1 | US FAERS | |
| 698 | Joint sprain | FAERS: 1 | US FAERS | |
| 699 | Laceration | FAERS: 1 | US FAERS | |
| 700 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 701 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 702 | Lipase abnormal | FAERS: 1 | US FAERS | |
| 703 | Lipoma | FAERS: 1 | US FAERS | |
| 704 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 705 | Loose associations | FAERS: 1 | US FAERS | |
| 706 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 707 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 708 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 709 | Lymphoma | FAERS: 1 | US FAERS | |
| 710 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 711 | Macular degeneration | FAERS: 1 | US FAERS | |
| 712 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 713 | Malnutrition | FAERS: 1 | US FAERS | |
| 714 | Malocclusion | FAERS: 1 | US FAERS | |
| 715 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 716 | Meningitis | FAERS: 1 | US FAERS | |
| 717 | Mental retardation severity unspecified | FAERS: 1 | US FAERS | |
| 718 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 719 | Microstomia | FAERS: 1 | US FAERS | |
| 720 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 721 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 722 | Moaning | FAERS: 1 | US FAERS | |
| 723 | Monoplegia | FAERS: 1 | US FAERS | |
| 724 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 725 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 726 | Myositis | FAERS: 1 | US FAERS | |
| 727 | Narcolepsy | FAERS: 1 | US FAERS | |
| 728 | Necrosis | FAERS: 1 | US FAERS | |
| 729 | Negative thoughts | FAERS: 1 | US FAERS | |
| 730 | Negativism | FAERS: 1 | US FAERS | |
| 731 | Neonatal cardiac failure | FAERS: 1 | US FAERS | |
| 732 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 733 | Neonatal respiratory arrest | FAERS: 1 | US FAERS | |
| 734 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 735 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 736 | Nerve injury | FAERS: 1 | US FAERS | |
| 737 | Neuralgia | FAERS: 1 | US FAERS | |
| 738 | Neuritis | FAERS: 1 | US FAERS | |
| 739 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 740 | Neurogenic Bowel | FAERS: 1 | US FAERS | |
| 741 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 742 | Neuroma | FAERS: 1 | US FAERS | |
| 743 | Neutrophil Pelger-Huet anomaly present | FAERS: 1 | US FAERS | |
| 744 | Nipple pain | FAERS: 1 | US FAERS | |
| 745 | Nodule | FAERS: 1 | US FAERS | |
| 746 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 747 | Nystagmus | FAERS: 1 | US FAERS | |
| 748 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 749 | Onychoclasis | FAERS: 1 | US FAERS | |
| 750 | Onycholysis | FAERS: 1 | US FAERS | |
| 751 | Opiates positive | FAERS: 1 | US FAERS | |
| 752 | Optic Nerve Hypoplasia | FAERS: 1 | US FAERS | |
| 753 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 754 | Oral infection | FAERS: 1 | US FAERS | |
| 755 | Oral pain | FAERS: 1 | US FAERS | |
| 756 | Orgasmic sensation decreased | FAERS: 1 | US FAERS | |
| 757 | Oromandibular dystonia | FAERS: 1 | US FAERS | |
| 758 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 759 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 760 | Osteomalacia | FAERS: 1 | US FAERS | |
| 761 | Otitis Media | FAERS: 1 | US FAERS | |
| 762 | Pancreatic Duct Stenosis | FAERS: 1 | US FAERS | |
| 763 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 764 | Paresis | FAERS: 1 | US FAERS | |
| 765 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 766 | Pelvic kidney | FAERS: 1 | US FAERS | |
| 767 | Penile size reduced | FAERS: 1 | US FAERS | |
| 768 | Performance status decreased | FAERS: 1 | US FAERS | |
| 769 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 770 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 771 | Peritonitis | FAERS: 1 | US FAERS | |
| 772 | Pharyngeal erosion | FAERS: 1 | US FAERS | |
| 773 | Phimosis | FAERS: 1 | US FAERS | |
| 774 | Physical abuse | FAERS: 1 | US FAERS | |
| 775 | Plagiocephaly | FAERS: 1 | US FAERS | |
| 776 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 777 | Pleurisy | FAERS: 1 | US FAERS | |
| 778 | Polymicrogyria | FAERS: 1 | US FAERS | |
| 779 | Poor dental condition | FAERS: 1 | US FAERS | |
| 780 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 781 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 782 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 783 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 784 | Post procedural complication | FAERS: 1 | US FAERS | |
| 785 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 786 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 787 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 788 | Prealbumin increased | FAERS: 1 | US FAERS | |
| 789 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 790 | Product availability issue | FAERS: 1 | US FAERS | |
| 791 | Product coating issue | FAERS: 1 | US FAERS | |
| 792 | Product complaint | FAERS: 1 | US FAERS | |
| 793 | Product contamination | FAERS: 1 | US FAERS | |
| 794 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 795 | Product dispensing error | FAERS: 1 | US FAERS | |
| 796 | Product dose omission | FAERS: 1 | US FAERS | |
| 797 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 798 | Product label issue | FAERS: 1 | US FAERS | |
| 799 | Product lot number issue | FAERS: 1 | US FAERS | |
| 800 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 801 | Product prescribing error | FAERS: 1 | US FAERS | |
| 802 | Product residue present | FAERS: 1 | US FAERS | |
| 803 | Product size issue | FAERS: 1 | US FAERS | |
| 804 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 805 | Product supply issue | FAERS: 1 | US FAERS | |
| 806 | Product tampering | FAERS: 1 | US FAERS | |
| 807 | Product use complaint | FAERS: 1 | US FAERS | |
| 808 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 809 | Progesterone increased | FAERS: 1 | US FAERS | |
| 810 | Protein total increased | FAERS: 1 | US FAERS | |
| 811 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 812 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 813 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 814 | Quadriplegia | FAERS: 1 | US FAERS | |
| 815 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 816 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 817 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 818 | Rebound effect | FAERS: 1 | US FAERS | |
| 819 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 820 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 821 | Regurgitation | FAERS: 1 | US FAERS | |
| 822 | Renal cyst | FAERS: 1 | US FAERS | |
| 823 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 824 | Renal fusion anomaly | FAERS: 1 | US FAERS | |
| 825 | Renal malposition | FAERS: 1 | US FAERS | |
| 826 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 827 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 828 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 829 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 830 | Retinal scar | FAERS: 1 | US FAERS | |
| 831 | Rhinitis | FAERS: 1 | US FAERS | |
| 832 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 833 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 834 | Schizotypal Personality Disorder | FAERS: 1 | US FAERS | |
| 835 | School refusal | FAERS: 1 | US FAERS | |
| 836 | Screaming | FAERS: 1 | US FAERS | |
| 837 | Selective Mutism | FAERS: 1 | US FAERS | |
| 838 | Septic Shock | FAERS: 1 | US FAERS | |
| 839 | Septo-Optic Dysplasia | FAERS: 1 | US FAERS | |
| 840 | Sick relative | FAERS: 1 | US FAERS | |
| 841 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 842 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 843 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 844 | Skin irritation | FAERS: 1 | US FAERS | |
| 845 | Skin laceration | FAERS: 1 | US FAERS | |
| 846 | Skin reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 847 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 848 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 849 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 850 | Stillbirth | FAERS: 1 | US FAERS | |
| 851 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 852 | Sudden death | FAERS: 1 | US FAERS | |
| 853 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 854 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 855 | Tablet issue | FAERS: 1 | US FAERS | |
| 856 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 857 | Terminal state | FAERS: 1 | US FAERS | |
| 858 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 859 | Thermal burn | FAERS: 1 | US FAERS | |
| 860 | Thought withdrawal | FAERS: 1 | US FAERS | |
| 861 | Throat cancer | FAERS: 1 | US FAERS | |
| 862 | Thymoma | FAERS: 1 | US FAERS | |
| 863 | Tobacco user | FAERS: 1 | US FAERS | |
| 864 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 865 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 866 | Tooth delamination | FAERS: 1 | US FAERS | |
| 867 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 868 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 869 | Tuberculin Test | FAERS: 1 | US FAERS | |
| 870 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 871 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 872 | Urinary Retention | FAERS: 1 | US FAERS | |
| 873 | Urine homocystine present | FAERS: 1 | US FAERS | |
| 874 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 875 | Urinoma | FAERS: 1 | US FAERS | |
| 876 | Vasculitis | FAERS: 1 | US FAERS | |
| 877 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 878 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 879 | Victim of homicide | FAERS: 1 | US FAERS | |
| 880 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 881 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 882 | White blood cell count normal | FAERS: 1 | US FAERS | |
| 883 | Wrist deformity | FAERS: 1 | US FAERS | |
| 884 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 885 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 886 | skin abrasion | FAERS: 1 | US FAERS | |
| 887 | Blood fibrinogen decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 888 | Erythropenia | Canada Vigilance: 1 | Canada Vigilance | |
| 889 | Muscle Spasticity | Canada Vigilance: 1 | Canada Vigilance | |
| 890 | Psychiatric symptom | Canada Vigilance: 1 | Canada Vigilance | |
| 891 | Splenomegaly | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.