Buprenorphine
(RMRJXGBAOAMLHD-IHFGGWKQSA-N)
Structure
- SMILES
- CO[C@]12CC[C@]3(C[C@@H]1[C@@](C(C)(C)C)(O)C)[C@@]14[C@H]2Oc2c4c(C[C@H]3N(CC1)CC1CC1)ccc2O
- Type(s)
- Approved; Illicit; Investigational; Vet_approved
- ATC code(s)
- N02AE01; N07BC01; N07BC51
- Molecular Formula:
- C29H41NO4
- Molecular Weight:
- 467.640
- Log P:
- 4.3517
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 62.16
- CAS Number(s):
- 52485-79-7
Synonym(s)
1.
Buprenorphine
2.
6029-M
3.
Buprenex
4.
Buprenorphine Hydrochloride
5.
Buprex
6.
Prefin
7.
RX-6029-M
8.
Subutex
9.
Temgesic
10.
Temgésic
11.
6029 M
12.
6029M
13.
Hydrochloride, Buprenorphine
14.
RX 6029 M
15.
RX6029M
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 3399 Canada Vigilance: 96 | Canada Vigilance US FAERS | |
| 2 | Application site rash | FAERS: 2684 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 3 | Inadequate analgesia | FAERS: 2490 | US FAERS | |
| 4 | Nausea | FAERS: 2215 Canada Vigilance: 10 | CTD SIDER Canada Vigilance US FAERS | |
| 5 | Application site pruritus | FAERS: 1799 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Product adhesion issue | FAERS: 1768 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 7 | Application site irritation | FAERS: 1526 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Application site erythema | FAERS: 1328 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 9 | Dizziness | FAERS: 1055 Canada Vigilance: 4 | 8301822 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Drug withdrawal syndrome | FAERS: 892 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 11 | Application site vesicles | FAERS: 839 | US FAERS | |
| 12 | Pain | FAERS: 826 Canada Vigilance: 4 | CTD SIDER Canada Vigilance US FAERS | |
| 13 | Application site reaction | FAERS: 821 | SIDER US FAERS | |
| 14 | Headache | FAERS: 749 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 15 | Application site pain | FAERS: 686 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Vomiting | FAERS: 600 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 17 | Feeling abnormal | FAERS: 578 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Somnolence | FAERS: 512 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 19 | Application site burn | FAERS: 503 | US FAERS | |
| 20 | Skin irritation | FAERS: 480 | US FAERS | |
| 21 | Pruritus | FAERS: 414 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 22 | Extra dose administered | FAERS: 406 | US FAERS | |
| 23 | Inappropriate schedule of drug administration | FAERS: 401 | US FAERS | |
| 24 | Wrong technique in drug usage process | FAERS: 393 | US FAERS | |
| 25 | Drug administered at inappropriate site | FAERS: 368 | US FAERS | |
| 26 | Wrong technique in product usage process | FAERS: 329 | US FAERS | |
| 27 | Malaise | FAERS: 322 | SIDER US FAERS | |
| 28 | Injection site pain | FAERS: 314 | US FAERS | |
| 29 | Drug Dependence | FAERS: 275 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Fatigue | FAERS: 260 | SIDER US FAERS | |
| 31 | Skin reaction | FAERS: 233 | US FAERS | |
| 32 | Anxiety | FAERS: 232 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Constipation | FAERS: 226 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 34 | Maternal exposure during pregnancy | FAERS: 201 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Intentional product misuse | FAERS: 186 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 36 | Drug abuse | FAERS: 185 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Product quality issue | FAERS: 183 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 38 | Drug exposure during pregnancy | FAERS: 177 | OFFSIDES US FAERS | |
| 39 | Unevaluable event | FAERS: 177 | US FAERS | |
| 40 | Application site urticaria | FAERS: 170 | US FAERS | |
| 41 | Intentional product use issue | FAERS: 160 | US FAERS | |
| 42 | Application site erosion | FAERS: 137 | US FAERS | |
| 43 | Application site discharge | FAERS: 131 | US FAERS | |
| 44 | Application site exfoliation | FAERS: 129 | US FAERS | |
| 45 | Tremor | FAERS: 129 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 46 | Palpitations | FAERS: 126 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Intentional drug misuse | FAERS: 124 | OFFSIDES US FAERS | |
| 48 | Breakthrough Pain | FAERS: 116 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Application site scar | FAERS: 114 | US FAERS | |
| 50 | Device leakage | FAERS: 114 | US FAERS | |
| 51 | Application site swelling | FAERS: 113 | US FAERS | |
| 52 | Product physical issue | FAERS: 108 | US FAERS | |
| 53 | Urticaria | FAERS: 106 | SIDER US FAERS | |
| 54 | Chest Pain | FAERS: 99 | SIDER US FAERS | |
| 55 | Euphoric mood | FAERS: 99 | SIDER US FAERS | |
| 56 | Application site dryness | FAERS: 98 | US FAERS | |
| 57 | Erythema | FAERS: 98 | SIDER US FAERS | |
| 58 | Overdose | FAERS: 97 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 59 | Abdominal discomfort | FAERS: 96 | SIDER US FAERS | |
| 60 | Asthenia | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Incorrect route of drug administration | FAERS: 81 | OFFSIDES US FAERS | |
| 62 | Injection site extravasation | FAERS: 78 | US FAERS | |
| 63 | Injection site erythema | FAERS: 75 | US FAERS | |
| 64 | Product contamination | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Product use issue | FAERS: 73 | US FAERS | |
| 66 | Agitation | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 67 | Hypersensitivity | FAERS: 71 | SIDER US FAERS | |
| 68 | Back Pain | FAERS: 69 | SIDER US FAERS | |
| 69 | Application site scab | FAERS: 68 | US FAERS | |
| 70 | Chills | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 71 | Toxicity to various agents | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Application site hypersensitivity | FAERS: 59 | US FAERS | |
| 73 | Arthralgia | FAERS: 59 | SIDER US FAERS | |
| 74 | Product substitution issue | FAERS: 59 | US FAERS | |
| 75 | Weight decreased | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 76 | Respiratory Depression | FAERS: 58 | SIDER US FAERS | |
| 77 | Burning sensation | FAERS: 57 | US FAERS | |
| 78 | Hypotension | FAERS: 56 | 10075626 | CTD SIDER US FAERS |
| 79 | Peripheral swelling | FAERS: 55 | US FAERS | |
| 80 | Disorientation | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 81 | Drug effect incomplete | FAERS: 53 | US FAERS | |
| 82 | Lethargy | FAERS: 53 | SIDER US FAERS | |
| 83 | Incorrect dose administered | FAERS: 51 | US FAERS | |
| 84 | Abdominal Pain | FAERS: 50 | 12659611 | CTD SIDER US FAERS |
| 85 | Dysgeusia | FAERS: 50 | SIDER US FAERS | |
| 86 | Chest discomfort | FAERS: 48 | US FAERS | |
| 87 | Swelling | FAERS: 47 | US FAERS | |
| 88 | Oral administration complication | FAERS: 46 | US FAERS | |
| 89 | Feeling jittery | FAERS: 44 | US FAERS | |
| 90 | Endocarditis | FAERS: 43 | OFFSIDES US FAERS | |
| 91 | Myalgia | FAERS: 43 | SIDER US FAERS | |
| 92 | Urinary Retention | FAERS: 43 | 6402239 | CTD SIDER US FAERS |
| 93 | Medication residue present | FAERS: 40 | US FAERS | |
| 94 | Pneumonia | FAERS: 40 | US FAERS | |
| 95 | Vertigo | FAERS: 40 | SIDER US FAERS | |
| 96 | Application site ulcer | FAERS: 39 | US FAERS | |
| 97 | Thermal burn | FAERS: 39 | US FAERS | |
| 98 | Myocardial Infarction | FAERS: 38 | 3069539 10075626 | CTD US FAERS |
| 99 | Nervousness | FAERS: 38 | SIDER US FAERS | |
| 100 | Memory impairment | FAERS: 37 | SIDER US FAERS | |
| 101 | Cold sweat | FAERS: 36 | US FAERS | |
| 102 | Product solubility abnormal | FAERS: 35 | US FAERS | |
| 103 | Exposure during breast feeding | FAERS: 34 | US FAERS | |
| 104 | Injection site pruritus | FAERS: 34 | US FAERS | |
| 105 | Drug screen negative | FAERS: 33 | OFFSIDES US FAERS | |
| 106 | Application site papules | FAERS: 32 | US FAERS | |
| 107 | Adverse event | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Drug screen positive | FAERS: 31 | OFFSIDES US FAERS | |
| 109 | Joint swelling | FAERS: 31 | SIDER US FAERS | |
| 110 | Therapy cessation | FAERS: 31 | US FAERS | |
| 111 | Asthma | FAERS: 30 | SIDER US FAERS | |
| 112 | Dysuria | FAERS: 30 | US FAERS | |
| 113 | Injection site abscess | FAERS: 30 | US FAERS | |
| 114 | Tachycardia | FAERS: 30 | SIDER US FAERS | |
| 115 | Placental hypertrophy | FAERS: 29 | US FAERS | |
| 116 | Application site inflammation | FAERS: 28 | US FAERS | |
| 117 | Application site warmth | FAERS: 28 | US FAERS | |
| 118 | Crying | FAERS: 28 | US FAERS | |
| 119 | Injection site infection | FAERS: 28 | US FAERS | |
| 120 | Product packaging quantity issue | FAERS: 28 | US FAERS | |
| 121 | Anger | FAERS: 27 | US FAERS | |
| 122 | Drug Tolerance | FAERS: 27 | US FAERS | |
| 123 | Syncope | FAERS: 27 | SIDER US FAERS | |
| 124 | Delirium | FAERS: 26 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 125 | Drug prescribing error | FAERS: 26 | US FAERS | |
| 126 | Injection site bruising | FAERS: 26 | US FAERS | |
| 127 | Mental status changes | FAERS: 26 | SIDER US FAERS | |
| 128 | Unresponsive to stimuli | FAERS: 26 | US FAERS | |
| 129 | Application site discomfort | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Completed Suicide | FAERS: 25 | OFFSIDES US FAERS | |
| 131 | Inappropriate schedule of product administration | FAERS: 25 | US FAERS | |
| 132 | Restlessness | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Cerebrovascular accident | FAERS: 24 | US FAERS | |
| 134 | Dysarthria | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 135 | Hypersomnia | FAERS: 24 | US FAERS | |
| 136 | Mental impairment | FAERS: 24 | US FAERS | |
| 137 | Product administered at inappropriate site | FAERS: 24 | US FAERS | |
| 138 | Accidental exposure to product by child | FAERS: 23 | US FAERS | |
| 139 | Accidental overdose | FAERS: 23 | OFFSIDES US FAERS | |
| 140 | Amnesia | FAERS: 23 | US FAERS | |
| 141 | Night sweats | FAERS: 23 | US FAERS | |
| 142 | Tinnitus | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 143 | Alopecia | FAERS: 22 | US FAERS | |
| 144 | Application site pustules | FAERS: 22 | US FAERS | |
| 145 | Incorrect drug administration duration | FAERS: 22 | US FAERS | |
| 146 | Tension | FAERS: 22 | SIDER US FAERS | |
| 147 | Depressed mood | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 148 | Flushing | FAERS: 21 | SIDER US FAERS | |
| 149 | Lip swelling | FAERS: 21 | US FAERS | |
| 150 | Product taste abnormal | FAERS: 21 | US FAERS | |
| 151 | Tongue discomfort | FAERS: 21 | US FAERS | |
| 152 | Wheezing | FAERS: 21 | SIDER US FAERS | |
| 153 | Abscess | FAERS: 20 | 17112927 | CTD OFFSIDES SIDER US FAERS |
| 154 | Application site infection | FAERS: 20 | US FAERS | |
| 155 | Drug diversion | FAERS: 20 | OFFSIDES US FAERS | |
| 156 | Erectile dysfunction | FAERS: 20 | US FAERS | |
| 157 | Impaired driving ability | FAERS: 20 | US FAERS | |
| 158 | Accidental drug intake by child | FAERS: 19 | OFFSIDES US FAERS | |
| 159 | Activities of daily living impaired | FAERS: 19 | US FAERS | |
| 160 | Application site perspiration | FAERS: 19 | US FAERS | |
| 161 | Drug effect delayed | FAERS: 19 | US FAERS | |
| 162 | Feeling Cold | FAERS: 19 | US FAERS | |
| 163 | Mydriasis | FAERS: 19 | US FAERS | |
| 164 | Therapeutic response delayed | FAERS: 19 | US FAERS | |
| 165 | Therapeutic response unexpected | FAERS: 19 | US FAERS | |
| 166 | Urinary tract infection | FAERS: 19 | SIDER US FAERS | |
| 167 | Visual Impairment | FAERS: 19 | SIDER US FAERS | |
| 168 | Dyspepsia | FAERS: 18 | SIDER US FAERS | |
| 169 | Musculoskeletal stiffness | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Restless Legs Syndrome | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Dehydration | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 172 | Drug administration error | FAERS: 17 | US FAERS | |
| 173 | Drug delivery system removal | FAERS: 17 | US FAERS | |
| 174 | Injection site irritation | FAERS: 17 | US FAERS | |
| 175 | Cardiac Arrest | FAERS: 16 | US FAERS | |
| 176 | Deep Vein Thrombosis | FAERS: 16 | US FAERS | |
| 177 | Neck Pain | FAERS: 16 | SIDER US FAERS | |
| 178 | Skin Ulcer | FAERS: 16 | US FAERS | |
| 179 | Stomatitis | FAERS: 16 | US FAERS | |
| 180 | Discomfort | FAERS: 15 | SIDER US FAERS | |
| 181 | Feeling of body temperature change | FAERS: 15 | OFFSIDES US FAERS | |
| 182 | Infection | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 183 | Influenza | FAERS: 15 | SIDER US FAERS | |
| 184 | Injection Site Reaction | FAERS: 15 | SIDER US FAERS | |
| 185 | Injection site cellulitis | FAERS: 15 | US FAERS | |
| 186 | Injection site warmth | FAERS: 15 | US FAERS | |
| 187 | Low birth weight baby | FAERS: 15 | US FAERS | |
| 188 | Nasopharyngitis | FAERS: 15 | SIDER US FAERS | |
| 189 | No adverse event | FAERS: 15 | US FAERS | |
| 190 | Product dispensing issue | FAERS: 15 | US FAERS | |
| 191 | Product physical consistency issue | FAERS: 15 | US FAERS | |
| 192 | Therapeutic product effect incomplete | FAERS: 15 | US FAERS | |
| 193 | Hepatitis C | FAERS: 14 | OFFSIDES US FAERS | |
| 194 | Pulmonary Embolism | FAERS: 14 | US FAERS | |
| 195 | Respiratory distress | FAERS: 14 | SIDER US FAERS | |
| 196 | Sneezing | FAERS: 14 | US FAERS | |
| 197 | Atrial Fibrillation | FAERS: 13 | 3175177 | CTD US FAERS |
| 198 | Drug dose omission | FAERS: 13 | US FAERS | |
| 199 | Injection site ulcer | FAERS: 13 | OFFSIDES US FAERS | |
| 200 | Prescribed overdose | FAERS: 13 | US FAERS | |
| 201 | Product packaging issue | FAERS: 13 | US FAERS | |
| 202 | Yawning | FAERS: 13 | US FAERS | |
| 203 | Accidental exposure to product | FAERS: 12 | US FAERS | |
| 204 | Cellulitis | FAERS: 12 | OFFSIDES US FAERS | |
| 205 | Drug abuser | FAERS: 12 | OFFSIDES US FAERS | |
| 206 | Dysphonia | FAERS: 12 | US FAERS | |
| 207 | Epilepsy | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 208 | Paranoia | FAERS: 12 | OFFSIDES US FAERS | |
| 209 | Product dispensing error | FAERS: 12 | US FAERS | |
| 210 | Sepsis | FAERS: 12 | US FAERS | |
| 211 | Skin necrosis | FAERS: 12 | OFFSIDES US FAERS | |
| 212 | Dementia | FAERS: 11 | US FAERS | |
| 213 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 214 | Formication | FAERS: 11 | US FAERS | |
| 215 | Injection site inflammation | FAERS: 11 | US FAERS | |
| 216 | Intestinal Obstruction | FAERS: 11 | US FAERS | |
| 217 | Limb discomfort | FAERS: 11 | US FAERS | |
| 218 | Myoclonus | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Neonatal disorder | FAERS: 11 | US FAERS | |
| 220 | Pancreatitis | FAERS: 11 | US FAERS | |
| 221 | Respiratory arrest | FAERS: 11 | US FAERS | |
| 222 | Strabismus | FAERS: 11 | US FAERS | |
| 223 | Abasia | FAERS: 10 | US FAERS | |
| 224 | Bone pain | FAERS: 10 | US FAERS | |
| 225 | Dermatitis | FAERS: 10 | SIDER US FAERS | |
| 226 | Diplopia | FAERS: 10 | SIDER US FAERS | |
| 227 | Erysipelas | FAERS: 10 | OFFSIDES US FAERS | |
| 228 | Hypokinesia | FAERS: 10 | US FAERS | |
| 229 | Impaired work ability | FAERS: 10 | US FAERS | |
| 230 | Incoherent | FAERS: 10 | US FAERS | |
| 231 | Mood swings | FAERS: 10 | SIDER US FAERS | |
| 232 | Oropharyngeal pain | FAERS: 10 | US FAERS | |
| 233 | Schizophrenia | FAERS: 10 | US FAERS | |
| 234 | Stillbirth | FAERS: 10 | US FAERS | |
| 235 | Urinary Incontinence | FAERS: 10 | SIDER US FAERS | |
| 236 | Acne | FAERS: 9 | US FAERS | |
| 237 | Application site laceration | FAERS: 9 | US FAERS | |
| 238 | Chemical injury | FAERS: 9 | US FAERS | |
| 239 | Depressed Level of Consciousness | FAERS: 9 | SIDER US FAERS | |
| 240 | Drug administered to patient of inappropriate age | FAERS: 9 | US FAERS | |
| 241 | Dry skin | FAERS: 9 | SIDER US FAERS | |
| 242 | General physical health deterioration | FAERS: 9 | OFFSIDES US FAERS | |
| 243 | Injection site discomfort | FAERS: 9 | US FAERS | |
| 244 | Medication Error | FAERS: 9 | US FAERS | |
| 245 | Presyncope | FAERS: 9 | US FAERS | |
| 246 | Product size issue | FAERS: 9 | US FAERS | |
| 247 | Septic embolus | FAERS: 9 | OFFSIDES US FAERS | |
| 248 | Suicide attempt | FAERS: 9 | US FAERS | |
| 249 | Angioedema | FAERS: 8 | SIDER US FAERS | |
| 250 | Arthritis | FAERS: 8 | US FAERS | |
| 251 | Bedridden | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Bipolar Disorder | FAERS: 8 | US FAERS | |
| 253 | Deafness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Diabetes Mellitus | FAERS: 8 | US FAERS | |
| 255 | Drug exposure via breast milk | FAERS: 8 | OFFSIDES US FAERS | |
| 256 | Emotional disorder | FAERS: 8 | US FAERS | |
| 257 | Expired product administered | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 258 | Extremity necrosis | FAERS: 8 | OFFSIDES US FAERS | |
| 259 | Feeding disorder neonatal | FAERS: 8 | OFFSIDES US FAERS | |
| 260 | Gangrene | FAERS: 8 | OFFSIDES US FAERS | |
| 261 | Incorrect product administration duration | FAERS: 8 | US FAERS | |
| 262 | Injection site necrosis | FAERS: 8 | US FAERS | |
| 263 | Oral pain | FAERS: 8 | US FAERS | |
| 264 | Pregnancy | FAERS: 8 | US FAERS | |
| 265 | Respiratory Failure | FAERS: 8 | SIDER US FAERS | |
| 266 | Septic Shock | FAERS: 8 | OFFSIDES US FAERS | |
| 267 | Skin lesion | FAERS: 8 | US FAERS | |
| 268 | 17 ketosteroids urine abnormal | FAERS: 7 | US FAERS | |
| 269 | Cyanosis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 270 | Eczema | FAERS: 7 | US FAERS | |
| 271 | Eye pain | FAERS: 7 | OFFSIDES US FAERS | |
| 272 | Head discomfort | FAERS: 7 | US FAERS | |
| 273 | Hyperventilation | FAERS: 7 | SIDER US FAERS | |
| 274 | Lack of application site rotation | FAERS: 7 | US FAERS | |
| 275 | Lymphadenopathy | FAERS: 7 | US FAERS | |
| 276 | Malignant neoplasm progression | FAERS: 7 | US FAERS | |
| 277 | Muscle tightness | FAERS: 7 | US FAERS | |
| 278 | Poisoning | FAERS: 7 | US FAERS | |
| 279 | Pre-Eclampsia | FAERS: 7 | OFFSIDES US FAERS | |
| 280 | Product contamination microbial | FAERS: 7 | US FAERS | |
| 281 | Product use complaint | FAERS: 7 | US FAERS | |
| 282 | Renal tubular disorder | FAERS: 7 | US FAERS | |
| 283 | Retching | FAERS: 7 | SIDER US FAERS | |
| 284 | Serotonin Syndrome | FAERS: 7 | US FAERS | |
| 285 | Sluggishness | FAERS: 7 | US FAERS | |
| 286 | Somnambulism | FAERS: 7 | US FAERS | |
| 287 | Stress | FAERS: 7 | US FAERS | |
| 288 | Sudden death | FAERS: 7 | OFFSIDES US FAERS | |
| 289 | Venous Thrombosis | FAERS: 7 | US FAERS | |
| 290 | nervous system disorder | FAERS: 7 | SIDER US FAERS | |
| 291 | Acute respiratory failure | FAERS: 6 | US FAERS | |
| 292 | Aphasia | FAERS: 6 | US FAERS | |
| 293 | Application site induration | FAERS: 6 | US FAERS | |
| 294 | Blood glucose decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 295 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 296 | Bronchitis | FAERS: 6 | SIDER US FAERS | |
| 297 | Chromaturia | FAERS: 6 | US FAERS | |
| 298 | Disease Progression | FAERS: 6 | US FAERS | |
| 299 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 300 | Emotional distress | FAERS: 6 | US FAERS | |
| 301 | Exposure via body fluid | FAERS: 6 | US FAERS | |
| 302 | Gastrointestinal obstruction | FAERS: 6 | OFFSIDES US FAERS | |
| 303 | Large intestine perforation | FAERS: 6 | US FAERS | |
| 304 | Limb injury | FAERS: 6 | US FAERS | |
| 305 | Maternal exposure timing unspecified | FAERS: 6 | US FAERS | |
| 306 | Neuralgia | FAERS: 6 | OFFSIDES US FAERS | |
| 307 | Poor quality sleep | FAERS: 6 | SIDER US FAERS | |
| 308 | Product preparation error | FAERS: 6 | US FAERS | |
| 309 | Product storage error | FAERS: 6 | US FAERS | |
| 310 | Renal tubular necrosis | FAERS: 6 | US FAERS | |
| 311 | Subcutaneous Abscess | FAERS: 6 | OFFSIDES US FAERS | |
| 312 | Throat irritation | FAERS: 6 | US FAERS | |
| 313 | Thrombosis | FAERS: 6 | US FAERS | |
| 314 | Tongue blistering | FAERS: 6 | US FAERS | |
| 315 | Accidental exposure | FAERS: 5 | US FAERS | |
| 316 | Acute psychosis | FAERS: 5 | OFFSIDES US FAERS | |
| 317 | Altered state of consciousness | FAERS: 5 | SIDER US FAERS | |
| 318 | Apathy | FAERS: 5 | SIDER US FAERS | |
| 319 | Blindness | FAERS: 5 | US FAERS | |
| 320 | Brachial artery entrapment syndrome | FAERS: 5 | US FAERS | |
| 321 | Bradycardia | FAERS: 5 | SIDER US FAERS | |
| 322 | Drug dose titration not performed | FAERS: 5 | US FAERS | |
| 323 | Drug level increased | FAERS: 5 | US FAERS | |
| 324 | Excoriation | FAERS: 5 | US FAERS | |
| 325 | Flatulence | FAERS: 5 | SIDER US FAERS | |
| 326 | Gastrointestinal motility disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 327 | Hallucinations, mixed | FAERS: 5 | OFFSIDES US FAERS | |
| 328 | Homicide | FAERS: 5 | US FAERS | |
| 329 | Hypoxia | FAERS: 5 | 19819313 | CTD SIDER US FAERS |
| 330 | Implant site infection | FAERS: 5 | US FAERS | |
| 331 | Injection site discharge | FAERS: 5 | US FAERS | |
| 332 | Injection site injury | FAERS: 5 | OFFSIDES US FAERS | |
| 333 | Intentional self-injury | FAERS: 5 | US FAERS | |
| 334 | Livedo Reticularis | FAERS: 5 | OFFSIDES US FAERS | |
| 335 | Loss of personal independence in daily activities | FAERS: 5 | US FAERS | |
| 336 | Malabsorption from application site | FAERS: 5 | US FAERS | |
| 337 | Medical device removal | FAERS: 5 | US FAERS | |
| 338 | Musculoskeletal chest pain | FAERS: 5 | US FAERS | |
| 339 | Necrosis | FAERS: 5 | 19269730 | CTD US FAERS |
| 340 | Negative thoughts | FAERS: 5 | US FAERS | |
| 341 | Pallor | FAERS: 5 | SIDER US FAERS | |
| 342 | Pericarditis | FAERS: 5 | OFFSIDES US FAERS | |
| 343 | Personality Change | FAERS: 5 | US FAERS | |
| 344 | Pneumothorax | FAERS: 5 | OFFSIDES US FAERS | |
| 345 | Product dose omission | FAERS: 5 | US FAERS | |
| 346 | Rash erythematous | FAERS: 5 | US FAERS | |
| 347 | Secretion discharge | FAERS: 5 | US FAERS | |
| 348 | Sexual Dysfunction | FAERS: 5 | SIDER US FAERS | |
| 349 | Sudden infant death syndrome | FAERS: 5 | OFFSIDES US FAERS | |
| 350 | Theft | FAERS: 5 | US FAERS | |
| 351 | Therapeutic product effect decreased | FAERS: 5 | US FAERS | |
| 352 | Therapy naive | FAERS: 5 | US FAERS | |
| 353 | Thrombophlebitis | FAERS: 5 | OFFSIDES US FAERS | |
| 354 | Tooth Loss | FAERS: 5 | US FAERS | |
| 355 | Toothache | FAERS: 5 | US FAERS | |
| 356 | Ulcer | FAERS: 5 | US FAERS | |
| 357 | Urinary hesitation | FAERS: 5 | SIDER US FAERS | |
| 358 | jaundice | FAERS: 5 | 15371928 | CTD US FAERS |
| 359 | Accidental death | FAERS: 4 | US FAERS | |
| 360 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 361 | Aneurysm | FAERS: 4 | US FAERS | |
| 362 | Angina Pectoris | FAERS: 4 | SIDER US FAERS | |
| 363 | Aphagia | FAERS: 4 | US FAERS | |
| 364 | Application site eczema | FAERS: 4 | US FAERS | |
| 365 | Application site photosensitivity reaction | FAERS: 4 | US FAERS | |
| 366 | Arthropathy | FAERS: 4 | US FAERS | |
| 367 | Arthropod bite | FAERS: 4 | OFFSIDES US FAERS | |
| 368 | Back disorder | FAERS: 4 | US FAERS | |
| 369 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 370 | Cardio-respiratory distress | FAERS: 4 | US FAERS | |
| 371 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 372 | Cerebral cyst | FAERS: 4 | OFFSIDES US FAERS | |
| 373 | Cheilitis | FAERS: 4 | US FAERS | |
| 374 | Cleft Palate | FAERS: 4 | OFFSIDES US FAERS | |
| 375 | Coma blister | FAERS: 4 | US FAERS | |
| 376 | Dermo-hypodermitis | FAERS: 4 | US FAERS | |
| 377 | Drug effect variable | FAERS: 4 | US FAERS | |
| 378 | Drug level decreased | FAERS: 4 | US FAERS | |
| 379 | Dysmorphism | FAERS: 4 | OFFSIDES US FAERS | |
| 380 | Ectopic Pregnancy | FAERS: 4 | US FAERS | |
| 381 | Elevated mood | FAERS: 4 | OFFSIDES US FAERS | |
| 382 | Fibrosis | FAERS: 4 | US FAERS | |
| 383 | Head titubation | FAERS: 4 | US FAERS | |
| 384 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 385 | Implant site pain | FAERS: 4 | US FAERS | |
| 386 | Implant site scar | FAERS: 4 | US FAERS | |
| 387 | Incorrect route of product administration | FAERS: 4 | US FAERS | |
| 388 | Initial insomnia | FAERS: 4 | US FAERS | |
| 389 | Laceration | FAERS: 4 | US FAERS | |
| 390 | Lymphangitis | FAERS: 4 | US FAERS | |
| 391 | Meningitis | FAERS: 4 | US FAERS | |
| 392 | Mouth swelling | FAERS: 4 | US FAERS | |
| 393 | Musculoskeletal Pain | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 394 | Neonatal aspiration | FAERS: 4 | OFFSIDES US FAERS | |
| 395 | Pelvic Pain | FAERS: 4 | US FAERS | |
| 396 | Penile necrosis | FAERS: 4 | OFFSIDES US FAERS | |
| 397 | Peripheral embolism | FAERS: 4 | US FAERS | |
| 398 | Pre-existing condition improved | FAERS: 4 | OFFSIDES US FAERS | |
| 399 | Prescription form tampering | FAERS: 4 | US FAERS | |
| 400 | Product outer packaging issue | FAERS: 4 | US FAERS | |
| 401 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 402 | Psoriasis | FAERS: 4 | US FAERS | |
| 403 | Psychiatric symptom | FAERS: 4 | US FAERS | |
| 404 | Renal pain | FAERS: 4 | US FAERS | |
| 405 | Rhabdomyolysis | FAERS: 4 | 16546629 | CTD US FAERS |
| 406 | Rubber sensitivity | FAERS: 4 | US FAERS | |
| 407 | Sacroiliitis | FAERS: 4 | OFFSIDES US FAERS | |
| 408 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 409 | Victim of child abuse | FAERS: 4 | US FAERS | |
| 410 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 411 | Allergic reaction to excipient | FAERS: 3 | US FAERS | |
| 412 | Appendicitis | FAERS: 3 | US FAERS | |
| 413 | Application site cellulitis | FAERS: 3 | US FAERS | |
| 414 | Application site necrosis | FAERS: 3 | US FAERS | |
| 415 | Asphyxia | FAERS: 3 | 23376546 | CTD OFFSIDES US FAERS |
| 416 | Biliary Colic | FAERS: 3 | SIDER US FAERS | |
| 417 | Blood blister | FAERS: 3 | US FAERS | |
| 418 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 419 | Blood testosterone decreased | FAERS: 3 | US FAERS | |
| 420 | Bone infarction | FAERS: 3 | OFFSIDES US FAERS | |
| 421 | Candidiasis | FAERS: 3 | US FAERS | |
| 422 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 423 | Circumstance or information capable of leading to medication error | FAERS: 3 | OFFSIDES US FAERS | |
| 424 | Delusion of reference | FAERS: 3 | US FAERS | |
| 425 | Delusional disorder, persecutory type | FAERS: 3 | OFFSIDES US FAERS | |
| 426 | Dependence | FAERS: 3 | US FAERS | |
| 427 | Dermal absorption impaired | FAERS: 3 | US FAERS | |
| 428 | Device adhesion issue | FAERS: 3 | US FAERS | |
| 429 | Dextrocardia | FAERS: 3 | US FAERS | |
| 430 | Disability | FAERS: 3 | US FAERS | |
| 431 | Dyslalia | FAERS: 3 | US FAERS | |
| 432 | Embolism | FAERS: 3 | OFFSIDES US FAERS | |
| 433 | Enterococcal sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 434 | Eructation | FAERS: 3 | US FAERS | |
| 435 | Gastroschisis | FAERS: 3 | US FAERS | |
| 436 | Genital Herpes | FAERS: 3 | OFFSIDES US FAERS | |
| 437 | Grief reaction | FAERS: 3 | US FAERS | |
| 438 | Hepatitis | FAERS: 3 | US FAERS | |
| 439 | Hip surgery | FAERS: 3 | US FAERS | |
| 440 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 441 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 442 | Hypophagia | FAERS: 3 | US FAERS | |
| 443 | Ileus | FAERS: 3 | SIDER US FAERS | |
| 444 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 445 | Implant site erythema | FAERS: 3 | US FAERS | |
| 446 | Incontinence | FAERS: 3 | US FAERS | |
| 447 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 448 | Infantile apnoeic attack | FAERS: 3 | US FAERS | |
| 449 | Inflammation | FAERS: 3 | SIDER US FAERS | |
| 450 | Inhibitory drug interaction | FAERS: 3 | US FAERS | |
| 451 | Intentional misuse | FAERS: 3 | OFFSIDES US FAERS | |
| 452 | Joint stiffness | FAERS: 3 | US FAERS | |
| 453 | Middle insomnia | FAERS: 3 | US FAERS | |
| 454 | Motion Sickness | FAERS: 3 | US FAERS | |
| 455 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 456 | Musculoskeletal discomfort | FAERS: 3 | SIDER US FAERS | |
| 457 | Nephroangiosclerosis | FAERS: 3 | US FAERS | |
| 458 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 459 | Oral mucosal erythema | FAERS: 3 | US FAERS | |
| 460 | Oral pruritus | FAERS: 3 | US FAERS | |
| 461 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 462 | Phlebitis | FAERS: 3 | US FAERS | |
| 463 | Physical assault | FAERS: 3 | US FAERS | |
| 464 | Pierre Robin Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 465 | Post procedural pulmonary embolism | FAERS: 3 | US FAERS | |
| 466 | Product formulation issue | FAERS: 3 | US FAERS | |
| 467 | Product label issue | FAERS: 3 | US FAERS | |
| 468 | Product leakage | FAERS: 3 | US FAERS | |
| 469 | Productive Cough | FAERS: 3 | US FAERS | |
| 470 | Purpura | FAERS: 3 | US FAERS | |
| 471 | Screaming | FAERS: 3 | OFFSIDES US FAERS | |
| 472 | Soft tissue necrosis | FAERS: 3 | US FAERS | |
| 473 | Sunburn | FAERS: 3 | US FAERS | |
| 474 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 475 | Transaminases increased | FAERS: 3 | US FAERS | |
| 476 | Uterine contractions during pregnancy | FAERS: 3 | OFFSIDES US FAERS | |
| 477 | Uterine spasm | FAERS: 3 | US FAERS | |
| 478 | Vasculitis | FAERS: 3 | US FAERS | |
| 479 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 480 | Water Intoxication | FAERS: 3 | US FAERS | |
| 481 | Wrong patient received product | FAERS: 3 | US FAERS | |
| 482 | furuncle | FAERS: 3 | US FAERS | |
| 483 | skin abrasion | FAERS: 3 | US FAERS | |
| 484 | Acute kidney injury | FAERS: 2 | 18294936 | CTD US FAERS |
| 485 | Administration site reaction | FAERS: 2 | US FAERS | |
| 486 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 487 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 488 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 489 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 490 | Application site acne | FAERS: 2 | US FAERS | |
| 491 | Application site nodule | FAERS: 2 | US FAERS | |
| 492 | Ascites | FAERS: 2 | OFFSIDES US FAERS | |
| 493 | Asthenopia | FAERS: 2 | US FAERS | |
| 494 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 495 | Autosomal chromosome anomaly | FAERS: 2 | US FAERS | |
| 496 | Bladder dysfunction | FAERS: 2 | US FAERS | |
| 497 | Bladder spasm | FAERS: 2 | US FAERS | |
| 498 | Blister rupture | FAERS: 2 | US FAERS | |
| 499 | Blood glucose fluctuation | FAERS: 2 | OFFSIDES US FAERS | |
| 500 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 501 | Brain Death | FAERS: 2 | US FAERS | |
| 502 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 503 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 504 | Cardiac valve vegetation | FAERS: 2 | OFFSIDES US FAERS | |
| 505 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 506 | Cataract | FAERS: 2 | US FAERS | |
| 507 | Catatonia | FAERS: 2 | US FAERS | |
| 508 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 509 | Cerebral Palsy | FAERS: 2 | US FAERS | |
| 510 | Choking sensation | FAERS: 2 | US FAERS | |
| 511 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 512 | Claustrophobia | FAERS: 2 | US FAERS | |
| 513 | Cluster Headache | FAERS: 2 | US FAERS | |
| 514 | Complication of device removal | FAERS: 2 | US FAERS | |
| 515 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | OFFSIDES US FAERS | |
| 516 | Compulsive hoarding | FAERS: 2 | US FAERS | |
| 517 | Conversion disorder | FAERS: 2 | US FAERS | |
| 518 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 519 | Dental caries | FAERS: 2 | US FAERS | |
| 520 | Device breakage | FAERS: 2 | US FAERS | |
| 521 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 522 | Dissociation | FAERS: 2 | US FAERS | |
| 523 | Diverticulitis | FAERS: 2 | SIDER US FAERS | |
| 524 | Drooling | FAERS: 2 | US FAERS | |
| 525 | Ear tube insertion | FAERS: 2 | US FAERS | |
| 526 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 527 | Emotional poverty | FAERS: 2 | US FAERS | |
| 528 | Encephalitis | FAERS: 2 | US FAERS | |
| 529 | Expired drug administered | FAERS: 2 | US FAERS | |
| 530 | Expulsion of medication | FAERS: 2 | US FAERS | |
| 531 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 532 | Gait inability | FAERS: 2 | US FAERS | |
| 533 | Gastrointestinal hypomotility | FAERS: 2 | OFFSIDES US FAERS | |
| 534 | Gestational Diabetes | FAERS: 2 | OFFSIDES US FAERS | |
| 535 | Glossitis | FAERS: 2 | OFFSIDES US FAERS | |
| 536 | Heat Exhaustion | FAERS: 2 | US FAERS | |
| 537 | Hemiparesis | FAERS: 2 | US FAERS | |
| 538 | Hospice Care | FAERS: 2 | US FAERS | |
| 539 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 540 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 541 | Hypervigilance | FAERS: 2 | US FAERS | |
| 542 | Hypogonadism | FAERS: 2 | US FAERS | |
| 543 | Hyporesponsive to stimuli | FAERS: 2 | US FAERS | |
| 544 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 545 | Hypoventilation | FAERS: 2 | SIDER US FAERS | |
| 546 | Impaired self-care | FAERS: 2 | US FAERS | |
| 547 | Implant site inflammation | FAERS: 2 | US FAERS | |
| 548 | Implant site irritation | FAERS: 2 | US FAERS | |
| 549 | Implant site pruritus | FAERS: 2 | US FAERS | |
| 550 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 551 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 552 | Infertility | FAERS: 2 | US FAERS | |
| 553 | Injection site hypersensitivity | FAERS: 2 | US FAERS | |
| 554 | Injection site phlebitis | FAERS: 2 | US FAERS | |
| 555 | Injection site scab | FAERS: 2 | US FAERS | |
| 556 | Injection site thrombosis | FAERS: 2 | US FAERS | |
| 557 | Injection site vesicles | FAERS: 2 | US FAERS | |
| 558 | Intentional medical device removal by patient | FAERS: 2 | US FAERS | |
| 559 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 560 | Intercepted drug prescribing error | FAERS: 2 | US FAERS | |
| 561 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 562 | Lack of administration site rotation | FAERS: 2 | US FAERS | |
| 563 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 564 | Laryngitis | FAERS: 2 | US FAERS | |
| 565 | Limb operation | FAERS: 2 | US FAERS | |
| 566 | Lividity | FAERS: 2 | OFFSIDES US FAERS | |
| 567 | Lung Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 568 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 569 | Microcephaly | FAERS: 2 | US FAERS | |
| 570 | Migration of implanted drug | FAERS: 2 | US FAERS | |
| 571 | Murder | FAERS: 2 | OFFSIDES US FAERS | |
| 572 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 573 | Muscle hypertrophy | FAERS: 2 | OFFSIDES US FAERS | |
| 574 | Nodule | FAERS: 2 | US FAERS | |
| 575 | Noninfective gingivitis | FAERS: 2 | US FAERS | |
| 576 | Osteitis | FAERS: 2 | US FAERS | |
| 577 | Pain of skin | FAERS: 2 | US FAERS | |
| 578 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 579 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 580 | Pemphigus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 581 | Penile Infection | FAERS: 2 | US FAERS | |
| 582 | Peritonitis | FAERS: 2 | 14682200 | CTD US FAERS |
| 583 | Phantom pain | FAERS: 2 | US FAERS | |
| 584 | Physical product label issue | FAERS: 2 | US FAERS | |
| 585 | Pituitary enlargement | FAERS: 2 | OFFSIDES US FAERS | |
| 586 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 587 | Poor sucking reflex | FAERS: 2 | OFFSIDES US FAERS | |
| 588 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 589 | Product administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 590 | Product administration error | FAERS: 2 | US FAERS | |
| 591 | Product deposit | FAERS: 2 | US FAERS | |
| 592 | Product lot number issue | FAERS: 2 | US FAERS | |
| 593 | Psoas Abscess | FAERS: 2 | US FAERS | |
| 594 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 595 | Rales | FAERS: 2 | US FAERS | |
| 596 | Retro-orbital neoplasm | FAERS: 2 | US FAERS | |
| 597 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 598 | Ruptured cerebral aneurysm | FAERS: 2 | OFFSIDES US FAERS | |
| 599 | Scab | FAERS: 2 | OFFSIDES US FAERS | |
| 600 | Sciatica | FAERS: 2 | US FAERS | |
| 601 | Scotoma | FAERS: 2 | US FAERS | |
| 602 | Shock | FAERS: 2 | SIDER US FAERS | |
| 603 | Skin Erosion | FAERS: 2 | US FAERS | |
| 604 | Skin laceration | FAERS: 2 | OFFSIDES US FAERS | |
| 605 | Skin tightness | FAERS: 2 | US FAERS | |
| 606 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 607 | Sopor | FAERS: 2 | US FAERS | |
| 608 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 609 | Splenic Infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 610 | Spondylitis | FAERS: 2 | OFFSIDES US FAERS | |
| 611 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 612 | Synovitis | FAERS: 2 | US FAERS | |
| 613 | Talipes | FAERS: 2 | OFFSIDES US FAERS | |
| 614 | Teeth brittle | FAERS: 2 | US FAERS | |
| 615 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 616 | Therapeutic nerve ablation | FAERS: 2 | US FAERS | |
| 617 | Therapy change | FAERS: 2 | US FAERS | |
| 618 | Thirst | FAERS: 2 | US FAERS | |
| 619 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 620 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 621 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 622 | Trisomy 21 | FAERS: 2 | OFFSIDES US FAERS | |
| 623 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 624 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 625 | Vein collapse | FAERS: 2 | US FAERS | |
| 626 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 627 | Vitreous degeneration | FAERS: 2 | OFFSIDES US FAERS | |
| 628 | Weight decrease neonatal | FAERS: 2 | US FAERS | |
| 629 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 630 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 631 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 632 | Abscess fungal | FAERS: 1 | US FAERS | |
| 633 | Acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 634 | Acute endocarditis | FAERS: 1 | US FAERS | |
| 635 | Acute hepatitis C | FAERS: 1 | US FAERS | |
| 636 | Administration site dermatitis | FAERS: 1 | US FAERS | |
| 637 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 638 | Aminoaciduria | FAERS: 1 | US FAERS | |
| 639 | Amniotic fluid volume decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 640 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 641 | Anorgasmia | FAERS: 1 | US FAERS | |
| 642 | Anosmia | FAERS: 1 | US FAERS | |
| 643 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 644 | Aphonia | FAERS: 1 | US FAERS | |
| 645 | Application site abscess | FAERS: 1 | US FAERS | |
| 646 | Application site atrophy | FAERS: 1 | US FAERS | |
| 647 | Application site injury | FAERS: 1 | US FAERS | |
| 648 | Application site mass | FAERS: 1 | US FAERS | |
| 649 | Application site nerve damage | FAERS: 1 | US FAERS | |
| 650 | Arteritis | FAERS: 1 | US FAERS | |
| 651 | Arthropod sting | FAERS: 1 | US FAERS | |
| 652 | Arthroscopy | FAERS: 1 | US FAERS | |
| 653 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 654 | Ataxia | FAERS: 1 | US FAERS | |
| 655 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 656 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 657 | Azoospermia | FAERS: 1 | US FAERS | |
| 658 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 659 | Biopsy | FAERS: 1 | US FAERS | |
| 660 | Bladder pain | FAERS: 1 | US FAERS | |
| 661 | Blepharospasm | FAERS: 1 | US FAERS | |
| 662 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 663 | Blood cortisol abnormal | FAERS: 1 | US FAERS | |
| 664 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 665 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 666 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 667 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 668 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 669 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 670 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 671 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 672 | Burn infection | FAERS: 1 | US FAERS | |
| 673 | Burns fourth degree | FAERS: 1 | US FAERS | |
| 674 | Cancer Pain | FAERS: 1 | US FAERS | |
| 675 | Candida test positive | FAERS: 1 | US FAERS | |
| 676 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 677 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 678 | Cataract operation | FAERS: 1 | US FAERS | |
| 679 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 680 | Cerebral ventricle dilatation | FAERS: 1 | OFFSIDES US FAERS | |
| 681 | Choking | FAERS: 1 | US FAERS | |
| 682 | Cholecystitis | FAERS: 1 | US FAERS | |
| 683 | Cholestasis | FAERS: 1 | US FAERS | |
| 684 | Clumsiness | FAERS: 1 | US FAERS | |
| 685 | Colitis | FAERS: 1 | US FAERS | |
| 686 | Colon cancer recurrent | FAERS: 1 | US FAERS | |
| 687 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 688 | Compression fracture | FAERS: 1 | US FAERS | |
| 689 | Congenital pneumonia | FAERS: 1 | US FAERS | |
| 690 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 691 | Corrective lens user | FAERS: 1 | US FAERS | |
| 692 | Cyst | FAERS: 1 | US FAERS | |
| 693 | Delusional perception | FAERS: 1 | US FAERS | |
| 694 | Depression suicidal | FAERS: 1 | US FAERS | |
| 695 | Device Failure | FAERS: 1 | US FAERS | |
| 696 | Device difficult to use | FAERS: 1 | US FAERS | |
| 697 | Device extrusion | FAERS: 1 | US FAERS | |
| 698 | Device intolerance | FAERS: 1 | US FAERS | |
| 699 | Device physical property issue | FAERS: 1 | US FAERS | |
| 700 | Difficulty removing drug implant | FAERS: 1 | US FAERS | |
| 701 | Disuse syndrome | FAERS: 1 | US FAERS | |
| 702 | Dreamy state | FAERS: 1 | US FAERS | |
| 703 | Drowning | FAERS: 1 | US FAERS | |
| 704 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 705 | Drug level fluctuating | FAERS: 1 | US FAERS | |
| 706 | Drug therapeutic incompatibility | FAERS: 1 | US FAERS | |
| 707 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 708 | Dry gangrene | FAERS: 1 | OFFSIDES US FAERS | |
| 709 | Dwarfism | FAERS: 1 | US FAERS | |
| 710 | Dysphemia | FAERS: 1 | US FAERS | |
| 711 | Ear congestion | FAERS: 1 | US FAERS | |
| 712 | Ear discomfort | FAERS: 1 | US FAERS | |
| 713 | Ecchymosis | FAERS: 1 | US FAERS | |
| 714 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 715 | Embolic stroke | FAERS: 1 | OFFSIDES US FAERS | |
| 716 | Emergency Care | FAERS: 1 | US FAERS | |
| 717 | Endophthalmitis | FAERS: 1 | OFFSIDES US FAERS | |
| 718 | Enteritis | FAERS: 1 | US FAERS | |
| 719 | Epistaxis | FAERS: 1 | US FAERS | |
| 720 | Erection increased | FAERS: 1 | US FAERS | |
| 721 | Eschar | FAERS: 1 | US FAERS | |
| 722 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 723 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 724 | Exophthalmos | FAERS: 1 | US FAERS | |
| 725 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 726 | Exposure via father | FAERS: 1 | US FAERS | |
| 727 | Extravasation | FAERS: 1 | US FAERS | |
| 728 | Exudative retinopathy | FAERS: 1 | US FAERS | |
| 729 | Eye Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 730 | Eye irritation | FAERS: 1 | US FAERS | |
| 731 | Facial Pain | FAERS: 1 | US FAERS | |
| 732 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 1 | US FAERS | |
| 733 | Fallopian tube leiomyoma | FAERS: 1 | US FAERS | |
| 734 | Fear of falling | FAERS: 1 | US FAERS | |
| 735 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 736 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 737 | Filariasis | FAERS: 1 | US FAERS | |
| 738 | Flank Pain | FAERS: 1 | US FAERS | |
| 739 | Flat affect | FAERS: 1 | SIDER US FAERS | |
| 740 | Fluid overload | FAERS: 1 | US FAERS | |
| 741 | Folliculitis | FAERS: 1 | US FAERS | |
| 742 | Food Allergy | FAERS: 1 | US FAERS | |
| 743 | Food craving | FAERS: 1 | US FAERS | |
| 744 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 745 | Fracture | FAERS: 1 | US FAERS | |
| 746 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 747 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 748 | Gastric hypomotility | FAERS: 1 | US FAERS | |
| 749 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 750 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 751 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 752 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 753 | Glasgow coma scale | FAERS: 1 | US FAERS | |
| 754 | Glaucoma | FAERS: 1 | US FAERS | |
| 755 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 756 | Granuloma | FAERS: 1 | US FAERS | |
| 757 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 758 | Growth retardation | FAERS: 1 | US FAERS | |
| 759 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 760 | Heat Stroke | FAERS: 1 | US FAERS | |
| 761 | Hemiplegia | FAERS: 1 | US FAERS | |
| 762 | Hepatic Encephalopathy | FAERS: 1 | 10896028 | CTD US FAERS |
| 763 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 764 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 765 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 766 | Hernia | FAERS: 1 | US FAERS | |
| 767 | High frequency ablation | FAERS: 1 | US FAERS | |
| 768 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 769 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 770 | Hygroma colli | FAERS: 1 | US FAERS | |
| 771 | Hyperacusis | FAERS: 1 | US FAERS | |
| 772 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 773 | Hyperleukocytosis | FAERS: 1 | US FAERS | |
| 774 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 775 | Hyperphagia | FAERS: 1 | US FAERS | |
| 776 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 777 | Hypospadias | FAERS: 1 | US FAERS | |
| 778 | Hysterectomy | FAERS: 1 | US FAERS | |
| 779 | Implant site abscess | FAERS: 1 | US FAERS | |
| 780 | Implant site swelling | FAERS: 1 | US FAERS | |
| 781 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 782 | Inappropriate release of product for distribution | FAERS: 1 | US FAERS | |
| 783 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 784 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 785 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 786 | Incubator therapy | FAERS: 1 | US FAERS | |
| 787 | Infantile spitting up | FAERS: 1 | US FAERS | |
| 788 | Infantile vomiting | FAERS: 1 | US FAERS | |
| 789 | Infarction | FAERS: 1 | US FAERS | |
| 790 | Injection site dermatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 791 | Injection site mass | FAERS: 1 | US FAERS | |
| 792 | Injection site nodule | FAERS: 1 | US FAERS | |
| 793 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 794 | Injection | FAERS: 1 | US FAERS | |
| 795 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 796 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 797 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 798 | Intertrigo | FAERS: 1 | US FAERS | |
| 799 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 800 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 801 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 802 | Intestinal infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 803 | Intussusception | FAERS: 1 | US FAERS | |
| 804 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 805 | Joint destruction | FAERS: 1 | US FAERS | |
| 806 | Joint injury | FAERS: 1 | US FAERS | |
| 807 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 808 | Ligament rupture | FAERS: 1 | US FAERS | |
| 809 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 810 | Limb fracture | FAERS: 1 | US FAERS | |
| 811 | Liver Abscess | FAERS: 1 | US FAERS | |
| 812 | Loss of bladder sensation | FAERS: 1 | US FAERS | |
| 813 | Lyme Disease | FAERS: 1 | US FAERS | |
| 814 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 815 | Lymphoma | FAERS: 1 | US FAERS | |
| 816 | Macrocephaly | FAERS: 1 | US FAERS | |
| 817 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 818 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 819 | Mastectomy | FAERS: 1 | US FAERS | |
| 820 | Meconium Aspiration Syndrome | FAERS: 1 | US FAERS | |
| 821 | Medical device complication | FAERS: 1 | US FAERS | |
| 822 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 823 | Medical observation | FAERS: 1 | US FAERS | |
| 824 | Meningomyelocele | FAERS: 1 | US FAERS | |
| 825 | Meniscus injury | FAERS: 1 | US FAERS | |
| 826 | Menopause | FAERS: 1 | US FAERS | |
| 827 | Menorrhagia | FAERS: 1 | US FAERS | |
| 828 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 829 | Moaning | FAERS: 1 | US FAERS | |
| 830 | Mononucleosis heterophile test positive | FAERS: 1 | US FAERS | |
| 831 | Monoparesis | FAERS: 1 | US FAERS | |
| 832 | Monoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 833 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 834 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 835 | Muscle strain | FAERS: 1 | US FAERS | |
| 836 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 837 | Narcolepsy | FAERS: 1 | US FAERS | |
| 838 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 839 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 840 | Neonatal complications of substance abuse | FAERS: 1 | US FAERS | |
| 841 | Neonatal infection | FAERS: 1 | US FAERS | |
| 842 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 843 | Neonatal respiratory distress | FAERS: 1 | US FAERS | |
| 844 | Nephritis | FAERS: 1 | US FAERS | |
| 845 | Nephrotic Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 846 | Nerve injury | FAERS: 1 | US FAERS | |
| 847 | Nocturia | FAERS: 1 | US FAERS | |
| 848 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 849 | Nystagmus | FAERS: 1 | US FAERS | |
| 850 | Obesity | FAERS: 1 | US FAERS | |
| 851 | Obsessive-compulsive symptom | FAERS: 1 | US FAERS | |
| 852 | Occupational exposure to product | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 853 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 854 | Oligohydramnios | FAERS: 1 | OFFSIDES US FAERS | |
| 855 | Opiates positive | FAERS: 1 | OFFSIDES US FAERS | |
| 856 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 857 | Oral infection | FAERS: 1 | US FAERS | |
| 858 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 859 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 860 | Oropharyngeal swelling | FAERS: 1 | SIDER US FAERS | |
| 861 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 862 | Otitis Media | FAERS: 1 | US FAERS | |
| 863 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 864 | Pancytopenia | FAERS: 1 | US FAERS | |
| 865 | Panniculitis | FAERS: 1 | US FAERS | |
| 866 | Papule | FAERS: 1 | US FAERS | |
| 867 | Paranoid Personality Disorder | FAERS: 1 | US FAERS | |
| 868 | Partner stress | FAERS: 1 | US FAERS | |
| 869 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 870 | Peripheral artery dissection | FAERS: 1 | US FAERS | |
| 871 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 872 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 873 | Petechiae | FAERS: 1 | US FAERS | |
| 874 | Photophobia | FAERS: 1 | US FAERS | |
| 875 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 876 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 877 | Pleurisy | FAERS: 1 | US FAERS | |
| 878 | Pneumonitis | FAERS: 1 | US FAERS | |
| 879 | Polydactyly | FAERS: 1 | US FAERS | |
| 880 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 881 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 882 | Post procedural complication | FAERS: 1 | US FAERS | |
| 883 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 884 | Postoperative respiratory distress | FAERS: 1 | US FAERS | |
| 885 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 886 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 887 | Priapism | FAERS: 1 | US FAERS | |
| 888 | Procedural complication | FAERS: 1 | US FAERS | |
| 889 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 890 | Product availability issue | FAERS: 1 | US FAERS | |
| 891 | Product barcode issue | FAERS: 1 | US FAERS | |
| 892 | Product coating issue | FAERS: 1 | US FAERS | |
| 893 | Product commingling | FAERS: 1 | US FAERS | |
| 894 | Product communication issue | FAERS: 1 | US FAERS | |
| 895 | Product label confusion | FAERS: 1 | US FAERS | |
| 896 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 897 | Product preparation issue | FAERS: 1 | US FAERS | |
| 898 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 899 | Product residue present | FAERS: 1 | US FAERS | |
| 900 | Product tampering | FAERS: 1 | US FAERS | |
| 901 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 902 | Protein-losing gastroenteropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 903 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 904 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 905 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 906 | Purulent discharge | FAERS: 1 | US FAERS | |
| 907 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 908 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 909 | Rebound psychosis | FAERS: 1 | US FAERS | |
| 910 | Regurgitation | FAERS: 1 | US FAERS | |
| 911 | Respiratory tract congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 912 | Retinitis | FAERS: 1 | OFFSIDES US FAERS | |
| 913 | Rhinalgia | FAERS: 1 | US FAERS | |
| 914 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 915 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 916 | Selective eating disorder | FAERS: 1 | US FAERS | |
| 917 | Sexual inhibition | FAERS: 1 | US FAERS | |
| 918 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 919 | Single umbilical artery | FAERS: 1 | US FAERS | |
| 920 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 921 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 922 | Skeletal injury | FAERS: 1 | US FAERS | |
| 923 | Skin Induration | FAERS: 1 | US FAERS | |
| 924 | Skin Wrinkling | FAERS: 1 | OFFSIDES US FAERS | |
| 925 | Skin dystrophy | FAERS: 1 | US FAERS | |
| 926 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 927 | Skin nodule | FAERS: 1 | US FAERS | |
| 928 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 929 | Sleep Talking | FAERS: 1 | US FAERS | |
| 930 | Slow speech | FAERS: 1 | US FAERS | |
| 931 | Snoring | FAERS: 1 | US FAERS | |
| 932 | Sphincter of Oddi Dysfunction | FAERS: 1 | 12659611 | CTD US FAERS |
| 933 | Spinal column stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 934 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 935 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 936 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 937 | Stupor | FAERS: 1 | US FAERS | |
| 938 | Substance Dependence | FAERS: 1 | US FAERS | |
| 939 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 940 | Symptom masked | FAERS: 1 | US FAERS | |
| 941 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 942 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 943 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 944 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 945 | Tetanus | FAERS: 1 | OFFSIDES US FAERS | |
| 946 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 947 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 948 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 949 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 950 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 951 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 952 | Transcription medication error | FAERS: 1 | US FAERS | |
| 953 | Transmission of drug via semen | FAERS: 1 | OFFSIDES US FAERS | |
| 954 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 955 | Troponin increased | FAERS: 1 | US FAERS | |
| 956 | Unemployment | FAERS: 1 | US FAERS | |
| 957 | Unwanted pregnancy | FAERS: 1 | OFFSIDES US FAERS | |
| 958 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 959 | Urethral Stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 960 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 961 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 962 | Vascular access site rupture | FAERS: 1 | US FAERS | |
| 963 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 964 | Vascular pseudoaneurysm ruptured | FAERS: 1 | US FAERS | |
| 965 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 966 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 967 | Victim of chemical submission | FAERS: 1 | US FAERS | |
| 968 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 969 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 970 | Vulvovaginal injury | FAERS: 1 | US FAERS | |
| 971 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 972 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 973 | Wound infection fungal | FAERS: 1 | US FAERS | |
| 974 | Wound infection pseudomonas | FAERS: 1 | US FAERS | |
| 975 | cancer surgery | FAERS: 1 | US FAERS | |
| 976 | heart rate | FAERS: 1 | US FAERS | |
| 977 | prostatitis | FAERS: 1 | US FAERS | |
| 978 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 979 | treatment failure | FAERS: 1 | US FAERS | |
| 980 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 981 | Abdominal cavity drainage | OFFSIDES | ||
| 982 | Abdominal symptom | OFFSIDES | ||
| 983 | Abnormal palmar/plantar creases | OFFSIDES | ||
| 984 | Abuse | OFFSIDES | ||
| 985 | Acidosis, Respiratory | 19819313 | CTD | |
| 986 | Acute HIV infection | OFFSIDES | ||
| 987 | Acute fatty liver of pregnancy | OFFSIDES | ||
| 988 | Agoraphobia | OFFSIDES | ||
| 989 | Alcohol-Induced Disorders | 16493349 | CTD | |
| 990 | Alcoholic Intoxication | OFFSIDES | ||
| 991 | Alveolitis | OFFSIDES | ||
| 992 | Amblyopia | SIDER | ||
| 993 | Anaphylactic shock | SIDER | ||
| 994 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 995 | Anuria | OFFSIDES | ||
| 996 | Aortic Aneurysm | OFFSIDES | ||
| 997 | Aortic valve calcification | OFFSIDES | ||
| 998 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 999 | Aspiration Pneumonia | OFFSIDES | ||
| 1000 | Asthenic conditions | SIDER | ||
| 1001 | Asthma aggravated | SIDER | ||
| 1002 | Aura | OFFSIDES | ||
| 1003 | Automatism | OFFSIDES | ||
| 1004 | Bile Duct Diseases | 10993435 | CTD | |
| 1005 | Blepharophimosis | OFFSIDES | ||
| 1006 | Blighted ovum | OFFSIDES | ||
| 1007 | Blood HIV RNA | OFFSIDES | ||
| 1008 | Blood alcohol increased | OFFSIDES | ||
| 1009 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 1010 | Blood thyroid stimulating hormone increased | OFFSIDES | ||
| 1011 | Bone marrow depression | OFFSIDES | ||
| 1012 | Borderline Personality Disorder | OFFSIDES | ||
| 1013 | Breast cancer recurrent | OFFSIDES | ||
| 1014 | Bronchial Obstruction | OFFSIDES | ||
| 1015 | Bronchopleural Fistula | OFFSIDES | ||
| 1016 | Bronchopneumonia | OFFSIDES | ||
| 1017 | Bronchospasm | SIDER | ||
| 1018 | Catheter site erythema | OFFSIDES | ||
| 1019 | Caudal Regression Syndrome | OFFSIDES | ||
| 1020 | Cerebral artery occlusion | OFFSIDES | ||
| 1021 | Chemical and Drug Induced Liver Injury | 11395686 15371928 18294936 | CTD | |
| 1022 | Cholestatic liver injury | OFFSIDES | ||
| 1023 | Chondromalacia | OFFSIDES | ||
| 1024 | Chondroplasty | OFFSIDES | ||
| 1025 | Chorioamnionitis | OFFSIDES | ||
| 1026 | Chronic left ventricular failure | OFFSIDES | ||
| 1027 | Cirrhosis | OFFSIDES | ||
| 1028 | Cleft uvula | OFFSIDES | ||
| 1029 | Coagulation test abnormal | OFFSIDES | ||
| 1030 | Cocaine-Related Disorders |
9384844
9457145 10932843 11164693 11377924 12028741 12028854 12757969 12884887 14749690 15217203 15804873 15857725 16493349 16756418 18604522 20881947 | CTD | |
| 1031 | Congenital cystic kidney disease | OFFSIDES | ||
| 1032 | Congenital hearing disorder | OFFSIDES | ||
| 1033 | Congenital intestinal malformation | OFFSIDES | ||
| 1034 | Conjunctivitis | SIDER | ||
| 1035 | Contracted bladder | OFFSIDES | ||
| 1036 | Cutaneous Candidiasis | OFFSIDES | ||
| 1037 | Cytolytic hepatitis | OFFSIDES | ||
| 1038 | Denervation atrophy | OFFSIDES | ||
| 1039 | Dental discomfort | OFFSIDES | ||
| 1040 | Depressive disorder | 17015570 | CTD | |
| 1041 | Developmental Disabilities | 11454944 19219093 | CTD | |
| 1042 | Disturbance in sexual arousal | SIDER | ||
| 1043 | Drowsiness | OFFSIDES | ||
| 1044 | Drug addict | OFFSIDES | ||
| 1045 | Drug level below therapeutic | OFFSIDES | ||
| 1046 | Drug toxicity | OFFSIDES | ||
| 1047 | Drug withdrawal convulsions | OFFSIDES | ||
| 1048 | Ductus arteriosus premature closure | OFFSIDES | ||
| 1049 | Duodenal perforation | OFFSIDES | ||
| 1050 | Dysequilibrium | SIDER | ||
| 1051 | Dyslexia | OFFSIDES | ||
| 1052 | Dysthymic Disorder | OFFSIDES | ||
| 1053 | Ear and labyrinth disorders | SIDER | ||
| 1054 | Early satiety | OFFSIDES | ||
| 1055 | Echography abnormal | OFFSIDES | ||
| 1056 | Eclampsia | OFFSIDES | ||
| 1057 | Edema | 6123475 | CTD | |
| 1058 | Ejection Fraction Decreased | OFFSIDES | ||
| 1059 | Embryo Loss | 11454944 | CTD | |
| 1060 | Eosinophilic myocarditis | OFFSIDES | ||
| 1061 | Epidermal necrosis | OFFSIDES | ||
| 1062 | Eyelid Function Disorder | OFFSIDES | ||
| 1063 | Factor II deficiency | OFFSIDES | ||
| 1064 | Factor V deficiency | OFFSIDES | ||
| 1065 | Fetal Death | 11454944 | CTD | |
| 1066 | Fever | 19819313 | CTD | |
| 1067 | Gastrointestinal inflammation | OFFSIDES | ||
| 1068 | Graft infection | OFFSIDES | ||
| 1069 | Granulocytosis | OFFSIDES | ||
| 1070 | Hallucinations | 2497861 3123005 | CTD | |
| 1071 | Heartburn | SIDER | ||
| 1072 | Hepatic congestion | OFFSIDES | ||
| 1073 | Hepatitis B positive | OFFSIDES | ||
| 1074 | Hepatitis C antibody positive | OFFSIDES | ||
| 1075 | Hepatitis C positive | OFFSIDES | ||
| 1076 | Hepatitis C, Chronic | 19383935 | CTD | |
| 1077 | Heroin Dependence |
10529020
10630350 11164693 11377924 11481150 12392802 12756210 15349002 16493349 16814005 18294936 18621943 19224082 19269730 21866885 | CTD | |
| 1078 | Hyperalgesia | CTD | ||
| 1079 | Hypoaesthesia facial | OFFSIDES | ||
| 1080 | Hypotensive | SIDER | ||
| 1081 | Immobile | OFFSIDES | ||
| 1082 | Inappropriate affect | OFFSIDES | ||
| 1083 | Infective spondylitis | OFFSIDES | ||
| 1084 | Infestation | SIDER | ||
| 1085 | Intracranial injury | OFFSIDES | ||
| 1086 | Iodine uptake increased | OFFSIDES | ||
| 1087 | Joint prosthesis user | OFFSIDES | ||
| 1088 | Kidney Failure | OFFSIDES | ||
| 1089 | Lateral Medullary Syndrome | OFFSIDES | ||
| 1090 | Leukoencephalomyelitis | OFFSIDES | ||
| 1091 | Liver Failure, Acute | 18294936 | CTD | |
| 1092 | Lymphedema | OFFSIDES | ||
| 1093 | Lymphocele | OFFSIDES | ||
| 1094 | Macrocytosis | OFFSIDES | ||
| 1095 | Malnutrition | SIDER | ||
| 1096 | Meibomianitis | OFFSIDES | ||
| 1097 | Meniscus removal | OFFSIDES | ||
| 1098 | Mental Retardation | SIDER | ||
| 1099 | Mental disorder due to a general medical condition | OFFSIDES | ||
| 1100 | Mononeuritis | OFFSIDES | ||
| 1101 | Multiple drug overdose | OFFSIDES | ||
| 1102 | Muscle necrosis | OFFSIDES | ||
| 1103 | Myocardial Ischemia | 8974441 | CTD | |
| 1104 | Myositis | 16546629 17112927 | CTD | |
| 1105 | Neonatal Abstinence Syndrome | CTD | ||
| 1106 | Neurobehavioral Manifestations | 24321744 | CTD | |
| 1107 | Neurological decompensation | OFFSIDES | ||
| 1108 | No adverse effect | OFFSIDES | ||
| 1109 | Numbness | SIDER | ||
| 1110 | Onychoclasis | OFFSIDES | ||
| 1111 | Open reduction of fracture | OFFSIDES | ||
| 1112 | Opioid-Related Disorders |
10075626
12028741 12028854 12757969 14749690 15857725 15977920 16026125 17015570 17286641 17306725 18363014 18686025 18720267 18956527 19392907 19931991 20177760 21142534 21317595 | CTD | |
| 1113 | Optic Neuritis | OFFSIDES | ||
| 1114 | Oral polypectomy | OFFSIDES | ||
| 1115 | Ototoxicity | OFFSIDES | ||
| 1116 | Pain, Postoperative | CTD | ||
| 1117 | Pharyngitis | SIDER | ||
| 1118 | Pharyngolaryngeal Pain | SIDER | ||
| 1119 | Polyarthritis | Canada Vigilance: 1 | Canada Vigilance | |
| 1120 | Polyhydramnios | OFFSIDES | ||
| 1121 | Polyneuropathy | OFFSIDES | ||
| 1122 | Polyuria | OFFSIDES | ||
| 1123 | Poor personal hygiene | OFFSIDES | ||
| 1124 | Portal Hypertension | OFFSIDES | ||
| 1125 | Post procedural bile leak | OFFSIDES | ||
| 1126 | Postoperative Nausea and Vomiting | 6869711 8301822 | CTD | |
| 1127 | Pregnancy Complications | 24321744 | CTD | |
| 1128 | Prenatal Exposure Delayed Effects | 11454944 19219093 21142534 | CTD | |
| 1129 | Progesterone decreased | OFFSIDES | ||
| 1130 | Prothrombin level decreased | OFFSIDES | ||
| 1131 | Psychomotor Disorders | 2785813 19219093 | CTD | |
| 1132 | Pulmonary arterial hypertension | OFFSIDES | ||
| 1133 | Pulmonary artery thrombosis | OFFSIDES | ||
| 1134 | Pulmonary function test decreased | SIDER | ||
| 1135 | Pulmonary necrosis | OFFSIDES | ||
| 1136 | Pulmonary sepsis | OFFSIDES | ||
| 1137 | Pyopneumothorax | OFFSIDES | ||
| 1138 | Quadriparesis | OFFSIDES | ||
| 1139 | Renal abscess | OFFSIDES | ||
| 1140 | Renal arteritis | OFFSIDES | ||
| 1141 | Renal dysplasia | OFFSIDES | ||
| 1142 | Respiratory Insufficiency | CTD | ||
| 1143 | Reticulocyte count increased | OFFSIDES | ||
| 1144 | Retinal exudates | OFFSIDES | ||
| 1145 | Retinal scar | OFFSIDES | ||
| 1146 | Retrognathia | OFFSIDES | ||
| 1147 | Rhinitis | SIDER | ||
| 1148 | Rhinorrhea | OFFSIDES | ||
| 1149 | Sciatic Neuropathy | 16546629 | CTD | |
| 1150 | Seizures | 7860555 14745842 | CTD | |
| 1151 | Sensorimotor disorder | OFFSIDES | ||
| 1152 | Sequestrectomy | OFFSIDES | ||
| 1153 | Serology positive | OFFSIDES | ||
| 1154 | Sinus headache | OFFSIDES | ||
| 1155 | Sleep Wake Disorders | 2497861 | CTD | |
| 1156 | Slurred speech | SIDER | ||
| 1157 | Sputum culture positive | OFFSIDES | ||
| 1158 | Subileus | OFFSIDES | ||
| 1159 | Substance Withdrawal Syndrome | CTD | ||
| 1160 | Substance-Related Disorders | CTD | ||
| 1161 | Sweating | SIDER | ||
| 1162 | Syndactyly | OFFSIDES | ||
| 1163 | Synovial Cyst | OFFSIDES | ||
| 1164 | Tobacco Use Disorder | 12028854 | CTD | |
| 1165 | Toe operation | OFFSIDES | ||
| 1166 | Toxicologic test abnormal | OFFSIDES | ||
| 1167 | Unresponsive to verbal stimuli | OFFSIDES | ||
| 1168 | Upset stomach | SIDER | ||
| 1169 | Urethral discharge | OFFSIDES | ||
| 1170 | Urge Incontinence | OFFSIDES | ||
| 1171 | Vascular stenosis | OFFSIDES | ||
| 1172 | Vasodilation procedure | SIDER | ||
| 1173 | Vasodilation | SIDER | ||
| 1174 | Vasospasm, Intracranial | 18332624 | CTD | |
| 1175 | Ventricular hypoplasia | OFFSIDES | ||
| 1176 | Visual disturbance | SIDER | ||
| 1177 | Vocal Cord Paralysis | OFFSIDES | ||
| 1178 | Waist circumference increased | OFFSIDES | ||
| 1179 | Wakefulness | SIDER | ||
| 1180 | pustule | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.