Methotrexate
(DASQOOZCTWOQPA-GXKRWWSZSA-L)
Structure
- SMILES
- [O-]C(=O)CC[C@@H](C(=O)[O-])NC(=O)c1ccc(cc1)N(Cc1cnc2c(n1)c(N)nc(n2)N)C.[Na+].[Na+]
- Molecular Formula:
- C20H20N8Na2O5
- Molecular Weight:
- 498.403
- Log P:
- -0.8477
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 3
- TPSA:
- 216.2
- CAS Number(s):
- 7413-34-5
Synonym(s)
1.
Methotrexate
2.
Amethopterin
3.
Methotrexate Hydrate
4.
Methotrexate Sodium
5.
Methotrexate, (D)-Isomer
6.
Methotrexate, (DL)-Isomer
7.
Methotrexate, Dicesium Salt
8.
Methotrexate, Disodium Salt
9.
Methotrexate, Sodium Salt
10.
Mexate
11.
Dicesium Salt Methotrexate
12.
Hydrate, Methotrexate
13.
Sodium, Methotrexate
External Link(s)
| MeSH | D008727 |
| PubChem Compound | 11329481 |
| ChEBI | 50679 |
| CHEMBL | CHEMBL3244648 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 4560 Canada Vigilance: 213 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 995 Canada Vigilance: 34 | Canada Vigilance US FAERS | |
| 3 | Alopecia | FAERS: 756 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 4 | Drug effect incomplete | FAERS: 594 | US FAERS | |
| 5 | Fatigue | FAERS: 447 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 6 | Abdominal discomfort | FAERS: 423 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 7 | treatment failure | FAERS: 325 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 8 | Malaise | FAERS: 314 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 9 | Vomiting | FAERS: 283 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 10 | Arthralgia | FAERS: 259 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 11 | Pain | FAERS: 185 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 12 | Headache | FAERS: 159 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 13 | Stomatitis | FAERS: 151 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 14 | Joint swelling | FAERS: 130 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 15 | Musculoskeletal stiffness | FAERS: 125 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Infection | FAERS: 123 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 17 | Dizziness | FAERS: 109 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 18 | Toxicity to various agents | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Leukopenia | FAERS: 81 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Product use issue | FAERS: 78 | US FAERS | |
| 21 | Transaminases increased | FAERS: 78 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Pneumonia | FAERS: 77 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 23 | Peripheral swelling | FAERS: 74 | US FAERS | |
| 24 | Synovitis | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Feeling abnormal | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Swelling | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Nodule | FAERS: 63 | US FAERS | |
| 28 | Pancytopenia | FAERS: 63 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 29 | Therapeutic product effect incomplete | FAERS: 58 Canada Vigilance: 33 | Canada Vigilance US FAERS | |
| 30 | Urticaria | FAERS: 58 | US FAERS | |
| 31 | Abdominal Pain | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Product use in unapproved indication | FAERS: 56 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 33 | Pulmonary Fibrosis | FAERS: 56 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 34 | Rheumatoid Arthritis | FAERS: 56 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 35 | Contraindicated product administered | FAERS: 52 | US FAERS | |
| 36 | Drug ineffective for unapproved indication | FAERS: 50 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 37 | Diffuse Large B-Cell Lymphoma | FAERS: 48 | US FAERS | |
| 38 | Asthenia | FAERS: 47 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 39 | White blood cell count decreased | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Hypersensitivity | FAERS: 46 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 41 | Pneumonitis | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Pruritus | FAERS: 45 | US FAERS | |
| 43 | Weight decreased | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 44 | Musculoskeletal Pain | FAERS: 41 | US FAERS | |
| 45 | Pulmonary toxicity | FAERS: 40 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 46 | Thrombocytopenia | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Hepatotoxicity | FAERS: 39 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 48 | Joint Range of Motion Decreased | FAERS: 39 | US FAERS | |
| 49 | Myalgia | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Neutropenia | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Back Pain | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Urinary tract infection | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Arthropathy | FAERS: 30 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 54 | Dyspepsia | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 55 | Accidental overdose | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Inflammation | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Intentional product misuse | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Sepsis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Chest Pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Psoriasis | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Sinusitis | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Arthritis | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 63 | Memory impairment | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Acute kidney injury | FAERS: 23 | US FAERS | |
| 65 | Alanine Aminotransferase Increased | FAERS: 23 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 66 | Hepatitis | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 67 | Joint stiffness | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Overdose | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Skin lesion | FAERS: 22 | US FAERS | |
| 70 | Somnolence | FAERS: 22 | US FAERS | |
| 71 | Rheumatoid Nodule | FAERS: 21 | US FAERS | |
| 72 | Visual Impairment | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Influenza | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Loss of personal independence in daily activities | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Nasopharyngitis | FAERS: 20 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 76 | Bronchitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Injection Site Reaction | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Palpitations | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Anxiety | FAERS: 18 | US FAERS | |
| 80 | Epistaxis | FAERS: 18 | US FAERS | |
| 81 | Medication Error | FAERS: 18 | US FAERS | |
| 82 | No adverse event | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Oral pain | FAERS: 17 | US FAERS | |
| 84 | Oropharyngeal pain | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 85 | Aspartate Aminotransferase Increased | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Blood creatinine increased | FAERS: 16 | US FAERS | |
| 87 | Cellulitis | FAERS: 16 | US FAERS | |
| 88 | Erythema | FAERS: 16 | US FAERS | |
| 89 | Neck Pain | FAERS: 16 | US FAERS | |
| 90 | Bone marrow toxicity | FAERS: 15 | US FAERS | |
| 91 | Epstein Barr virus positive mucocutaneous ulcer | FAERS: 15 | US FAERS | |
| 92 | Incorrect route of drug administration | FAERS: 15 | US FAERS | |
| 93 | Musculoskeletal discomfort | FAERS: 15 | US FAERS | |
| 94 | Syncope | FAERS: 15 | US FAERS | |
| 95 | Tremor | FAERS: 15 | US FAERS | |
| 96 | Chills | FAERS: 14 | US FAERS | |
| 97 | Hepatitis C | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Inappropriate schedule of drug administration | FAERS: 14 | US FAERS | |
| 99 | Injection site pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Lethargy | FAERS: 14 | US FAERS | |
| 101 | Angioedema | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Drug level increased | FAERS: 13 | US FAERS | |
| 103 | Immunosuppression | FAERS: 13 | US FAERS | |
| 104 | Lymphoma | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Ulcer | FAERS: 13 | US FAERS | |
| 106 | Cytopenia | FAERS: 12 | US FAERS | |
| 107 | Disease Progression | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Dry skin | FAERS: 12 | US FAERS | |
| 109 | Respiratory Failure | FAERS: 12 | US FAERS | |
| 110 | Septic Shock | FAERS: 12 | US FAERS | |
| 111 | Therapy non-responder | FAERS: 12 | US FAERS | |
| 112 | Amnesia | FAERS: 11 | US FAERS | |
| 113 | Asthma | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Bronchiectasis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Colitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Dysgeusia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Gastritis | FAERS: 11 | US FAERS | |
| 118 | Incorrect route of product administration | FAERS: 11 | US FAERS | |
| 119 | Lower respiratory tract infection | FAERS: 11 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 120 | Myocardial Infarction | FAERS: 11 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 121 | Tachycardia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | nervous system disorder | FAERS: 11 | US FAERS | |
| 123 | Cerebrovascular accident | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Drug clearance decreased | FAERS: 10 | US FAERS | |
| 125 | Gastrointestinal perforation | FAERS: 10 | US FAERS | |
| 126 | Leukoencephalopathy | FAERS: 10 | US FAERS | |
| 127 | Limb discomfort | FAERS: 10 | US FAERS | |
| 128 | Product quality issue | FAERS: 10 | US FAERS | |
| 129 | Sjogren's Syndrome | FAERS: 10 | US FAERS | |
| 130 | Skin Ulcer | FAERS: 10 | US FAERS | |
| 131 | Bone pain | FAERS: 9 | US FAERS | |
| 132 | Diverticulitis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 133 | Drug administration error | FAERS: 9 | US FAERS | |
| 134 | Hemiparesis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Maternal exposure during pregnancy | FAERS: 9 | US FAERS | |
| 136 | Mycobacterium tuberculosis complex test positive | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Tinnitus | FAERS: 9 | US FAERS | |
| 138 | Varicella Zoster Virus Infection | FAERS: 9 | US FAERS | |
| 139 | Burning sensation | FAERS: 8 | US FAERS | |
| 140 | Disease recurrence | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Drug dispensing error | FAERS: 8 | US FAERS | |
| 142 | Epstein-Barr virus associated lymphoproliferative disorder | FAERS: 8 | US FAERS | |
| 143 | Lymphadenopathy | FAERS: 8 | US FAERS | |
| 144 | Macrocytosis | FAERS: 8 | US FAERS | |
| 145 | Tuberculosis | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 146 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 147 | Adverse event | FAERS: 7 | US FAERS | |
| 148 | Aphasia | FAERS: 7 | US FAERS | |
| 149 | Blood alkaline phosphatase increased | FAERS: 7 | US FAERS | |
| 150 | Bone erosion | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Cataract | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 152 | Chest discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Deformity | FAERS: 7 | US FAERS | |
| 154 | Diabetes Mellitus | FAERS: 7 | US FAERS | |
| 155 | Discomfort | FAERS: 7 | US FAERS | |
| 156 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 157 | Gastrointestinal toxicity | FAERS: 7 | US FAERS | |
| 158 | Grip strength decreased | FAERS: 7 | US FAERS | |
| 159 | Hepatitis B virus test positive | FAERS: 7 | US FAERS | |
| 160 | Impaired work ability | FAERS: 7 | US FAERS | |
| 161 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 162 | Onychoclasis | FAERS: 7 | US FAERS | |
| 163 | Osteomyelitis | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 164 | Oxidative Stress | FAERS: 7 | US FAERS | |
| 165 | Spermatozoa abnormal | FAERS: 7 | US FAERS | |
| 166 | Acute respiratory failure | FAERS: 6 | US FAERS | |
| 167 | Anti-cyclic citrullinated peptide antibody positive | FAERS: 6 | US FAERS | |
| 168 | Blood count abnormal | FAERS: 6 | US FAERS | |
| 169 | Blood creatine increased | FAERS: 6 | US FAERS | |
| 170 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 171 | Cholestasis | FAERS: 6 | US FAERS | |
| 172 | Circumstance or information capable of leading to medication error | FAERS: 6 | US FAERS | |
| 173 | Dysarthria | FAERS: 6 | US FAERS | |
| 174 | Febrile Neutropenia | FAERS: 6 | US FAERS | |
| 175 | Fibromyalgia | FAERS: 6 | US FAERS | |
| 176 | Gastrointestinal Pain | FAERS: 6 | US FAERS | |
| 177 | Hypotension | FAERS: 6 | US FAERS | |
| 178 | Mental impairment | FAERS: 6 | US FAERS | |
| 179 | Nephrolithiasis | FAERS: 6 | US FAERS | |
| 180 | Pancreatitis | FAERS: 6 | US FAERS | |
| 181 | Polyneuropathy | FAERS: 6 | US FAERS | |
| 182 | Vertigo | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Wheezing | FAERS: 6 | US FAERS | |
| 184 | furuncle | FAERS: 6 | US FAERS | |
| 185 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 186 | Clostridium difficile infection | FAERS: 5 | US FAERS | |
| 187 | Dehydration | FAERS: 5 | US FAERS | |
| 188 | Drug Tolerance | FAERS: 5 | US FAERS | |
| 189 | Drug dose omission | FAERS: 5 | US FAERS | |
| 190 | Dysuria | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Endometritis | FAERS: 5 | US FAERS | |
| 192 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 5 | US FAERS | |
| 193 | Hepatomegaly | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Hernia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Inflammatory marker increased | FAERS: 5 | US FAERS | |
| 196 | Intestinal Obstruction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Joint destruction | FAERS: 5 | US FAERS | |
| 198 | Pericarditis | FAERS: 5 | US FAERS | |
| 199 | Pleurisy | FAERS: 5 | US FAERS | |
| 200 | Presyncope | FAERS: 5 | US FAERS | |
| 201 | Rash erythematous | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | Skin reaction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Suicide attempt | FAERS: 5 | US FAERS | |
| 204 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 205 | Acne | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Alveolitis | FAERS: 4 | US FAERS | |
| 207 | Ataxia | FAERS: 4 | US FAERS | |
| 208 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 209 | Basal cell carcinoma | FAERS: 4 | US FAERS | |
| 210 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 211 | Bursitis | FAERS: 4 | US FAERS | |
| 212 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 213 | Constipation | FAERS: 4 | US FAERS | |
| 214 | Contraindicated product prescribed | FAERS: 4 | US FAERS | |
| 215 | Cyst | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 216 | Deafness | FAERS: 4 | US FAERS | |
| 217 | Drug effective for unapproved indication | FAERS: 4 | US FAERS | |
| 218 | Dysphonia | FAERS: 4 | US FAERS | |
| 219 | Epstein-Barr virus associated lymphoma | FAERS: 4 | US FAERS | |
| 220 | Facial paralysis | FAERS: 4 | US FAERS | |
| 221 | Gastric ulcer | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 222 | Glaucoma | FAERS: 4 | US FAERS | |
| 223 | Incontinence | FAERS: 4 | US FAERS | |
| 224 | Incorrect drug administration rate | FAERS: 4 | US FAERS | |
| 225 | Injection site bruising | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 226 | Insulin Resistance | FAERS: 4 | US FAERS | |
| 227 | Intentional dose omission | FAERS: 4 | US FAERS | |
| 228 | Intervertebral Disc Degeneration | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Iron deficiency | FAERS: 4 | US FAERS | |
| 230 | Limb injury | FAERS: 4 | US FAERS | |
| 231 | Mental status changes | FAERS: 4 | US FAERS | |
| 232 | Osteonecrosis of Jaw | FAERS: 4 | US FAERS | |
| 233 | Osteopenia | FAERS: 4 | US FAERS | |
| 234 | Osteoporosis | FAERS: 4 | US FAERS | |
| 235 | Pelvic Pain | FAERS: 4 | US FAERS | |
| 236 | Pemphigus | FAERS: 4 | US FAERS | |
| 237 | Photophobia | FAERS: 4 | US FAERS | |
| 238 | Pneumothorax | FAERS: 4 | US FAERS | |
| 239 | Product dose omission | FAERS: 4 | US FAERS | |
| 240 | Product prescribing error | FAERS: 4 | US FAERS | |
| 241 | Pustular psoriasis | FAERS: 4 | US FAERS | |
| 242 | Skin Papilloma | FAERS: 4 | US FAERS | |
| 243 | Thrombosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Toothache | FAERS: 4 | US FAERS | |
| 245 | Vasculitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | White blood cell count abnormal | FAERS: 4 | US FAERS | |
| 247 | jaundice | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Abasia | FAERS: 3 | US FAERS | |
| 249 | Abscess | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 250 | Ageusia | FAERS: 3 | US FAERS | |
| 251 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 252 | Arachnoiditis | FAERS: 3 | US FAERS | |
| 253 | Ascites | FAERS: 3 | US FAERS | |
| 254 | Aspartate aminotransferase abnormal | FAERS: 3 | US FAERS | |
| 255 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 256 | Back disorder | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Blood cholesterol increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 259 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 260 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 261 | Crying | FAERS: 3 | US FAERS | |
| 262 | Demyelination | FAERS: 3 | US FAERS | |
| 263 | Depressed mood | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Dermatitis | FAERS: 3 | US FAERS | |
| 265 | Device related infection | FAERS: 3 | US FAERS | |
| 266 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 267 | Drug effect delayed | FAERS: 3 | US FAERS | |
| 268 | Drug level below therapeutic | FAERS: 3 | US FAERS | |
| 269 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 270 | Emotional disorder | FAERS: 3 | US FAERS | |
| 271 | Erythropenia | FAERS: 3 | US FAERS | |
| 272 | Feeling Cold | FAERS: 3 | US FAERS | |
| 273 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 274 | Gait inability | FAERS: 3 | US FAERS | |
| 275 | Gastrointestinal ulcer | FAERS: 3 | US FAERS | |
| 276 | General physical health deterioration | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 277 | Gout | FAERS: 3 | US FAERS | |
| 278 | Hemiplegia | FAERS: 3 | US FAERS | |
| 279 | Hepatitis B | FAERS: 3 | US FAERS | |
| 280 | Histiocytosis haematophagic | FAERS: 3 | US FAERS | |
| 281 | Histoplasmosis | FAERS: 3 | US FAERS | |
| 282 | Hypoxia | FAERS: 3 | US FAERS | |
| 283 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 284 | Inflammatory pain | FAERS: 3 | US FAERS | |
| 285 | Injection site discomfort | FAERS: 3 | US FAERS | |
| 286 | Injection site erythema | FAERS: 3 | US FAERS | |
| 287 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 288 | Joint injury | FAERS: 3 | US FAERS | |
| 289 | Joint warmth | FAERS: 3 | US FAERS | |
| 290 | Nervousness | FAERS: 3 | US FAERS | |
| 291 | Night sweats | FAERS: 3 | US FAERS | |
| 292 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 293 | Peritonitis | FAERS: 3 | US FAERS | |
| 294 | Petechiae | FAERS: 3 | US FAERS | |
| 295 | Pharyngitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Pneumatosis intestinalis | FAERS: 3 | US FAERS | |
| 297 | Pneumoconiosis | FAERS: 3 | US FAERS | |
| 298 | Poisoning | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 299 | Polyarthritis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Posterior reversible encephalopathy syndrome | FAERS: 3 | US FAERS | |
| 301 | Pre-existing condition improved | FAERS: 3 | US FAERS | |
| 302 | Product administration error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Product container issue | FAERS: 3 | US FAERS | |
| 304 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 305 | Productive Cough | FAERS: 3 | US FAERS | |
| 306 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 307 | Purulence | FAERS: 3 | US FAERS | |
| 308 | Rebound effect | FAERS: 3 | US FAERS | |
| 309 | Renal Cell Carcinoma | FAERS: 3 | US FAERS | |
| 310 | Renal tubular necrosis | FAERS: 3 | US FAERS | |
| 311 | Rheumatic disorder | FAERS: 3 | US FAERS | |
| 312 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 313 | Scleritis | FAERS: 3 | US FAERS | |
| 314 | Shock | FAERS: 3 | US FAERS | |
| 315 | Skin Erosion | FAERS: 3 | US FAERS | |
| 316 | Skin toxicity | FAERS: 3 | US FAERS | |
| 317 | Splenomegaly | FAERS: 3 | US FAERS | |
| 318 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 319 | Tenosynovitis | FAERS: 3 | US FAERS | |
| 320 | Throat irritation | FAERS: 3 | US FAERS | |
| 321 | Thrombocytosis | FAERS: 3 | US FAERS | |
| 322 | Transaminases abnormal | FAERS: 3 | US FAERS | |
| 323 | Urinary Retention | FAERS: 3 | US FAERS | |
| 324 | Uveitis | FAERS: 3 | US FAERS | |
| 325 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 326 | Vitamin D Deficiency | FAERS: 3 | US FAERS | |
| 327 | kyphosis | FAERS: 3 | US FAERS | |
| 328 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 329 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 330 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 331 | Anal Fistula | FAERS: 2 | US FAERS | |
| 332 | Anal abscess | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 333 | Ankylosing spondylitis | FAERS: 2 | US FAERS | |
| 334 | Arthropod bite | FAERS: 2 | US FAERS | |
| 335 | Asphyxia | FAERS: 2 | US FAERS | |
| 336 | Aversion | FAERS: 2 | US FAERS | |
| 337 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 338 | Blindness | FAERS: 2 | US FAERS | |
| 339 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 340 | Blood urea increased | FAERS: 2 | US FAERS | |
| 341 | Bronchospasm | FAERS: 2 | US FAERS | |
| 342 | Cachexia | FAERS: 2 | US FAERS | |
| 343 | Cell Death | FAERS: 2 | US FAERS | |
| 344 | Cephalin flocculation abnormal | FAERS: 2 | US FAERS | |
| 345 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 346 | Chemotherapeutic drug level increased | FAERS: 2 | US FAERS | |
| 347 | Choking | FAERS: 2 | US FAERS | |
| 348 | Cold sweat | FAERS: 2 | US FAERS | |
| 349 | Cystitis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 350 | Cytomegalovirus chorioretinitis | FAERS: 2 | US FAERS | |
| 351 | Cytomegalovirus gastroenteritis | FAERS: 2 | US FAERS | |
| 352 | Device malfunction | FAERS: 2 | US FAERS | |
| 353 | Drug abuse | FAERS: 2 | US FAERS | |
| 354 | Drug monitoring procedure not performed | FAERS: 2 | US FAERS | |
| 355 | Drug resistance | FAERS: 2 | US FAERS | |
| 356 | Ecchymosis | FAERS: 2 | US FAERS | |
| 357 | Endometrial adenocarcinoma | FAERS: 2 | US FAERS | |
| 358 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 359 | Enzyme level increased | FAERS: 2 | US FAERS | |
| 360 | Epidermal necrosis | FAERS: 2 | US FAERS | |
| 361 | Epilepsy | FAERS: 2 | US FAERS | |
| 362 | Epstein-Barr virus test positive | FAERS: 2 | US FAERS | |
| 363 | Extremity contracture | FAERS: 2 | US FAERS | |
| 364 | Eye irritation | FAERS: 2 | US FAERS | |
| 365 | Febrile bone marrow aplasia | FAERS: 2 | US FAERS | |
| 366 | Feeling jittery | FAERS: 2 | US FAERS | |
| 367 | Flatulence | FAERS: 2 | US FAERS | |
| 368 | Folliculitis | FAERS: 2 | US FAERS | |
| 369 | Fracture | FAERS: 2 | US FAERS | |
| 370 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 371 | Gastrointestinal wall thickening | FAERS: 2 | US FAERS | |
| 372 | Glossitis | FAERS: 2 | US FAERS | |
| 373 | Heavy Chain Disease | FAERS: 2 | US FAERS | |
| 374 | Hepatitis C virus test positive | FAERS: 2 | US FAERS | |
| 375 | Immune-mediated adverse reaction | FAERS: 2 | US FAERS | |
| 376 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 377 | Injection related reaction | FAERS: 2 | US FAERS | |
| 378 | Injection site nodule | FAERS: 2 | US FAERS | |
| 379 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 380 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 381 | Intertrigo | FAERS: 2 | US FAERS | |
| 382 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 383 | Keratitis | FAERS: 2 | US FAERS | |
| 384 | Laryngitis | FAERS: 2 | US FAERS | |
| 385 | Lennox-Gastaut syndrome | FAERS: 2 | US FAERS | |
| 386 | Leptotrichia infection | FAERS: 2 | US FAERS | |
| 387 | Leukocytosis | FAERS: 2 | US FAERS | |
| 388 | Limb mass | FAERS: 2 | US FAERS | |
| 389 | Lipoma | FAERS: 2 | US FAERS | |
| 390 | Listeriosis | FAERS: 2 | US FAERS | |
| 391 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 392 | Lower Urinary Tract Symptoms | FAERS: 2 | US FAERS | |
| 393 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 394 | Lymphopenia | FAERS: 2 | US FAERS | |
| 395 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 396 | Mastoiditis | FAERS: 2 | US FAERS | |
| 397 | Mechanic's hand | FAERS: 2 | US FAERS | |
| 398 | Meningitis | FAERS: 2 | US FAERS | |
| 399 | Middle insomnia | FAERS: 2 | US FAERS | |
| 400 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 401 | Muscle enzyme increased | FAERS: 2 | US FAERS | |
| 402 | Myelitis | FAERS: 2 | US FAERS | |
| 403 | Myopathy | FAERS: 2 | US FAERS | |
| 404 | Myositis | FAERS: 2 | US FAERS | |
| 405 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 406 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 407 | Nodal osteoarthritis | FAERS: 2 | US FAERS | |
| 408 | Nodular regenerative hyperplasia | FAERS: 2 | US FAERS | |
| 409 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 410 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 411 | Otitis Media | FAERS: 2 | US FAERS | |
| 412 | Pain of skin | FAERS: 2 | US FAERS | |
| 413 | Pancreatic calcification | FAERS: 2 | US FAERS | |
| 414 | Panniculitis | FAERS: 2 | US FAERS | |
| 415 | Papule | FAERS: 2 | US FAERS | |
| 416 | Paraplegia | FAERS: 2 | US FAERS | |
| 417 | Paresis | FAERS: 2 | US FAERS | |
| 418 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 419 | Personality Change | FAERS: 2 | US FAERS | |
| 420 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 421 | Polymyalgia Rheumatica | FAERS: 2 | US FAERS | |
| 422 | Polymyositis | FAERS: 2 | US FAERS | |
| 423 | Porencephaly | FAERS: 2 | US FAERS | |
| 424 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 425 | Primary Biliary Cholangitis | FAERS: 2 | US FAERS | |
| 426 | Product preparation error | FAERS: 2 | US FAERS | |
| 427 | Psychogenic seizure | FAERS: 2 | US FAERS | |
| 428 | Pulmonary Embolism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 429 | Pulmonary function test decreased | FAERS: 2 | US FAERS | |
| 430 | Pulmonary granuloma | FAERS: 2 | US FAERS | |
| 431 | Purpura | FAERS: 2 | US FAERS | |
| 432 | Quadriparesis | FAERS: 2 | US FAERS | |
| 433 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 434 | Renal pain | FAERS: 2 | US FAERS | |
| 435 | Respiratory distress | FAERS: 2 | US FAERS | |
| 436 | Respiratory tract congestion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 437 | Restless Legs Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Restrictive pulmonary disease | FAERS: 2 | US FAERS | |
| 439 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 440 | Rosacea | FAERS: 2 | US FAERS | |
| 441 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 442 | Sluggishness | FAERS: 2 | US FAERS | |
| 443 | Soft tissue swelling | FAERS: 2 | US FAERS | |
| 444 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 445 | Steatohepatitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 446 | Stress | FAERS: 2 | US FAERS | |
| 447 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 448 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 449 | Therapeutic product effect decreased | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 450 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 451 | Uterine Rupture | FAERS: 2 | US FAERS | |
| 452 | Wrist deformity | FAERS: 2 | US FAERS | |
| 453 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 454 | effusion | FAERS: 2 | US FAERS | |
| 455 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 456 | Accidental underdose | FAERS: 1 | US FAERS | |
| 457 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 458 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 459 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 460 | Acute pulmonary histoplasmosis | FAERS: 1 | US FAERS | |
| 461 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 462 | Agitation | FAERS: 1 | US FAERS | |
| 463 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 464 | Alopecia totalis | FAERS: 1 | US FAERS | |
| 465 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 466 | Amyloidosis | FAERS: 1 | US FAERS | |
| 467 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 468 | Aneurysm | FAERS: 1 | US FAERS | |
| 469 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 470 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 471 | Anorexia | FAERS: 1 | US FAERS | |
| 472 | Anosmia | FAERS: 1 | US FAERS | |
| 473 | Anterior displaced anus | FAERS: 1 | US FAERS | |
| 474 | Anti-insulin antibody increased | FAERS: 1 | US FAERS | |
| 475 | Aphagia | FAERS: 1 | US FAERS | |
| 476 | Apoptotic colonopathy | FAERS: 1 | US FAERS | |
| 477 | Apparent death | FAERS: 1 | US FAERS | |
| 478 | Asthenopia | FAERS: 1 | US FAERS | |
| 479 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 480 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 481 | Atypical fracture | FAERS: 1 | US FAERS | |
| 482 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 483 | B-cell unclassifiable lymphoma high grade | FAERS: 1 | US FAERS | |
| 484 | Bedridden | FAERS: 1 | US FAERS | |
| 485 | Bicytopenia | FAERS: 1 | US FAERS | |
| 486 | Bile output increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 487 | Biliary sepsis | FAERS: 1 | US FAERS | |
| 488 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 489 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 490 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 491 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 492 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 493 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 494 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 495 | Blood urine present | FAERS: 1 | US FAERS | |
| 496 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 497 | Body fat disorder | FAERS: 1 | US FAERS | |
| 498 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 499 | Bone swelling | FAERS: 1 | US FAERS | |
| 500 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 501 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 502 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 503 | Butterfly rash | FAERS: 1 | US FAERS | |
| 504 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 505 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 506 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 507 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 508 | Cartilage injury | FAERS: 1 | US FAERS | |
| 509 | Catheter site infection | FAERS: 1 | US FAERS | |
| 510 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 511 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 512 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 513 | Cheilitis | FAERS: 1 | US FAERS | |
| 514 | Chemical burn of skin | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 515 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 516 | Chondromatosis | FAERS: 1 | US FAERS | |
| 517 | Chromaturia | FAERS: 1 | US FAERS | |
| 518 | Chronic Spontaneous Urticaria | FAERS: 1 | US FAERS | |
| 519 | Cleft Palate | FAERS: 1 | US FAERS | |
| 520 | Cluster Headache | FAERS: 1 | US FAERS | |
| 521 | Combined immunodeficiency | FAERS: 1 | US FAERS | |
| 522 | Completed Suicide | FAERS: 1 | US FAERS | |
| 523 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 524 | Craniosynostosis | FAERS: 1 | US FAERS | |
| 525 | Crystal urine present | FAERS: 1 | US FAERS | |
| 526 | Cytology abnormal | FAERS: 1 | US FAERS | |
| 527 | Cytomegalovirus enterocolitis | FAERS: 1 | US FAERS | |
| 528 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 529 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 530 | Delirium | FAERS: 1 | US FAERS | |
| 531 | Dementia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 532 | Dengue Fever | FAERS: 1 | US FAERS | |
| 533 | Dental caries | FAERS: 1 | US FAERS | |
| 534 | Dental discomfort | FAERS: 1 | US FAERS | |
| 535 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 536 | Device related sepsis | FAERS: 1 | US FAERS | |
| 537 | Device related thrombosis | FAERS: 1 | US FAERS | |
| 538 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 539 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 540 | Diplegia | FAERS: 1 | US FAERS | |
| 541 | Drug Dependence | FAERS: 1 | US FAERS | |
| 542 | Drug level changed | FAERS: 1 | US FAERS | |
| 543 | Drug level decreased | FAERS: 1 | US FAERS | |
| 544 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 545 | Dysmorphism | FAERS: 1 | US FAERS | |
| 546 | Eczema | FAERS: 1 | US FAERS | |
| 547 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 548 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 549 | Encephalitis | FAERS: 1 | US FAERS | |
| 550 | Enchondromatosis | FAERS: 1 | US FAERS | |
| 551 | Endocarditis | FAERS: 1 | US FAERS | |
| 552 | Enteritis necroticans | FAERS: 1 | US FAERS | |
| 553 | Enteritis | FAERS: 1 | US FAERS | |
| 554 | Enuresis | FAERS: 1 | US FAERS | |
| 555 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 556 | Eosinophilia | FAERS: 1 | US FAERS | |
| 557 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 558 | Epiglottitis | FAERS: 1 | US FAERS | |
| 559 | Episcleritis | FAERS: 1 | US FAERS | |
| 560 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 561 | Escherichia infection | FAERS: 1 | US FAERS | |
| 562 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 563 | Exophthalmos | FAERS: 1 | US FAERS | |
| 564 | Expired product administered | FAERS: 1 | US FAERS | |
| 565 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 566 | Eye Infection | FAERS: 1 | US FAERS | |
| 567 | Eye pain | FAERS: 1 | US FAERS | |
| 568 | Facial Pain | FAERS: 1 | US FAERS | |
| 569 | Fibrosis | FAERS: 1 | US FAERS | |
| 570 | Fistula of small intestine | FAERS: 1 | US FAERS | |
| 571 | Flank Pain | FAERS: 1 | US FAERS | |
| 572 | Flight of ideas | FAERS: 1 | US FAERS | |
| 573 | Flushing | FAERS: 1 | US FAERS | |
| 574 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 575 | Formication | FAERS: 1 | US FAERS | |
| 576 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 577 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 578 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 579 | Gastrointestinal infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 580 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 581 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 582 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 583 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 584 | Gingivitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 585 | Glioma | FAERS: 1 | US FAERS | |
| 586 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 587 | Granulocyte count increased | FAERS: 1 | US FAERS | |
| 588 | Granulocytosis | FAERS: 1 | US FAERS | |
| 589 | Granuloma | FAERS: 1 | US FAERS | |
| 590 | Grip strength | FAERS: 1 | US FAERS | |
| 591 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 592 | Head discomfort | FAERS: 1 | US FAERS | |
| 593 | Hearing disability | FAERS: 1 | US FAERS | |
| 594 | Hepatitis B antigen positive | FAERS: 1 | US FAERS | |
| 595 | Hepatitis E | FAERS: 1 | US FAERS | |
| 596 | Hepatosplenic T-cell lymphoma | FAERS: 1 | US FAERS | |
| 597 | Hidradenitis | FAERS: 1 | US FAERS | |
| 598 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 599 | Histamine intolerance | FAERS: 1 | US FAERS | |
| 600 | Human anti-mouse antibody increased | FAERS: 1 | US FAERS | |
| 601 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 602 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 603 | Hypermobility syndrome | FAERS: 1 | US FAERS | |
| 604 | Hyperphagia | FAERS: 1 | US FAERS | |
| 605 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 606 | Hypokinesia | FAERS: 1 | US FAERS | |
| 607 | Hypophagia | FAERS: 1 | US FAERS | |
| 608 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 609 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 610 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 611 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 612 | Ileus | FAERS: 1 | US FAERS | |
| 613 | Immobile | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 614 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 615 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 616 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 617 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 618 | Induration | FAERS: 1 | US FAERS | |
| 619 | Infected cyst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 620 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 621 | Infertility | FAERS: 1 | US FAERS | |
| 622 | Initial insomnia | FAERS: 1 | US FAERS | |
| 623 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 624 | Injection site irritation | FAERS: 1 | US FAERS | |
| 625 | Injection site scar | FAERS: 1 | US FAERS | |
| 626 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 627 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 628 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 629 | Interleukin level increased | FAERS: 1 | US FAERS | |
| 630 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 631 | Invasive Lobular Breast Carcinoma | FAERS: 1 | US FAERS | |
| 632 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 633 | Keratopathy | FAERS: 1 | US FAERS | |
| 634 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 635 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 636 | Latent Tuberculosis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 637 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 638 | Lipase decreased | FAERS: 1 | US FAERS | |
| 639 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 640 | Lividity | FAERS: 1 | US FAERS | |
| 641 | Loose tooth | FAERS: 1 | US FAERS | |
| 642 | Lumbosacral radiculopathy | FAERS: 1 | US FAERS | |
| 643 | Lung perforation | FAERS: 1 | US FAERS | |
| 644 | Lyme Disease | FAERS: 1 | US FAERS | |
| 645 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 646 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 647 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 648 | Malabsorption | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 649 | Malnutrition | FAERS: 1 | US FAERS | |
| 650 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 651 | Mass excision | FAERS: 1 | US FAERS | |
| 652 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 653 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 654 | Mediastinal Cyst | FAERS: 1 | US FAERS | |
| 655 | Megacolon | FAERS: 1 | US FAERS | |
| 656 | Meningioma | FAERS: 1 | US FAERS | |
| 657 | Meningomyelocele | FAERS: 1 | US FAERS | |
| 658 | Meningoradiculitis | FAERS: 1 | US FAERS | |
| 659 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 660 | Meniscus injury | FAERS: 1 | US FAERS | |
| 661 | Menopause | FAERS: 1 | US FAERS | |
| 662 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 663 | Metastasis | FAERS: 1 | US FAERS | |
| 664 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 665 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 666 | Molluscum Contagiosum | FAERS: 1 | US FAERS | |
| 667 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 668 | Monoplegia | FAERS: 1 | US FAERS | |
| 669 | Mood swings | FAERS: 1 | US FAERS | |
| 670 | Mouth swelling | FAERS: 1 | US FAERS | |
| 671 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 672 | Mucosal toxicity | FAERS: 1 | US FAERS | |
| 673 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 674 | Multiple System Atrophy | FAERS: 1 | US FAERS | |
| 675 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 676 | Muscle tightness | FAERS: 1 | US FAERS | |
| 677 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 678 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 679 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 680 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 681 | Nerve injury | FAERS: 1 | US FAERS | |
| 682 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 683 | Neutrophil count decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 684 | Nocturia | FAERS: 1 | US FAERS | |
| 685 | Nodular vasculitis | FAERS: 1 | US FAERS | |
| 686 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 687 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 688 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 689 | Ocular icterus | FAERS: 1 | US FAERS | |
| 690 | Ocular sarcoidosis | FAERS: 1 | US FAERS | |
| 691 | Oliguria | FAERS: 1 | US FAERS | |
| 692 | Onycholysis | FAERS: 1 | US FAERS | |
| 693 | Onychomycosis | FAERS: 1 | US FAERS | |
| 694 | Oral infection | FAERS: 1 | US FAERS | |
| 695 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 696 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 697 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 698 | Oral pruritus | FAERS: 1 | US FAERS | |
| 699 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 700 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 701 | Osteitis | FAERS: 1 | US FAERS | |
| 702 | Osteosarcoma | FAERS: 1 | US FAERS | |
| 703 | Otitis media fungal | FAERS: 1 | US FAERS | |
| 704 | Overgrowth fungal | FAERS: 1 | US FAERS | |
| 705 | Overweight | FAERS: 1 | US FAERS | |
| 706 | Palindromic rheumatism | FAERS: 1 | US FAERS | |
| 707 | Pallor | FAERS: 1 | US FAERS | |
| 708 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 709 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 710 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 711 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 712 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 713 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 714 | Paraparesis | FAERS: 1 | US FAERS | |
| 715 | Parotid abscess | FAERS: 1 | US FAERS | |
| 716 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 717 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 718 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 719 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 720 | Pertussis | FAERS: 1 | US FAERS | |
| 721 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 722 | Phlebitis | FAERS: 1 | US FAERS | |
| 723 | Physical disability | FAERS: 1 | US FAERS | |
| 724 | Plague | FAERS: 1 | US FAERS | |
| 725 | Plasmablastic lymphoma | FAERS: 1 | US FAERS | |
| 726 | Polyuria | FAERS: 1 | US FAERS | |
| 727 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 728 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 729 | Poor quality sleep | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 730 | Portosplenomesenteric venous thrombosis | FAERS: 1 | US FAERS | |
| 731 | Post procedural complication | FAERS: 1 | US FAERS | |
| 732 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 733 | Postrenal failure | FAERS: 1 | US FAERS | |
| 734 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 735 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 736 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 737 | Proctitis | FAERS: 1 | US FAERS | |
| 738 | Product deposit | FAERS: 1 | US FAERS | |
| 739 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 740 | Product label issue | FAERS: 1 | US FAERS | |
| 741 | Product leakage | FAERS: 1 | US FAERS | |
| 742 | Product packaging issue | FAERS: 1 | US FAERS | |
| 743 | Product size issue | FAERS: 1 | US FAERS | |
| 744 | Product substitution issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 745 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 746 | Proteinuria | FAERS: 1 | US FAERS | |
| 747 | Pseudoporphyria | FAERS: 1 | US FAERS | |
| 748 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 749 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 750 | Purulent discharge | FAERS: 1 | US FAERS | |
| 751 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 752 | Radiculopathy | FAERS: 1 | US FAERS | |
| 753 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 754 | Regurgitation | FAERS: 1 | US FAERS | |
| 755 | Renal abscess | FAERS: 1 | US FAERS | |
| 756 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 757 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 758 | Respiratory tract ulceration | FAERS: 1 | US FAERS | |
| 759 | Retching | FAERS: 1 | US FAERS | |
| 760 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 761 | Rheumatoid Vasculitis | FAERS: 1 | US FAERS | |
| 762 | Sciatica | FAERS: 1 | US FAERS | |
| 763 | Scleroderma | FAERS: 1 | US FAERS | |
| 764 | Secondary hypertension | FAERS: 1 | US FAERS | |
| 765 | Single functional kidney | FAERS: 1 | US FAERS | |
| 766 | Sinus headache | FAERS: 1 | US FAERS | |
| 767 | Sinus pain | FAERS: 1 | US FAERS | |
| 768 | Skin graft detachment | FAERS: 1 | US FAERS | |
| 769 | Skin laceration | FAERS: 1 | US FAERS | |
| 770 | Snoring | FAERS: 1 | US FAERS | |
| 771 | Staring | FAERS: 1 | US FAERS | |
| 772 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 773 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 774 | Strongyloidiasis | FAERS: 1 | US FAERS | |
| 775 | Sunburn | FAERS: 1 | US FAERS | |
| 776 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 777 | Syndactyly | FAERS: 1 | US FAERS | |
| 778 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 779 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 780 | Talipes | FAERS: 1 | US FAERS | |
| 781 | Tension | FAERS: 1 | US FAERS | |
| 782 | Tetany | FAERS: 1 | US FAERS | |
| 783 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 784 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 785 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 786 | Therapy cessation | FAERS: 1 | US FAERS | |
| 787 | Thermal burn | FAERS: 1 | US FAERS | |
| 788 | Thirst | FAERS: 1 | US FAERS | |
| 789 | Tinea cruris | FAERS: 1 | US FAERS | |
| 790 | Tongue blistering | FAERS: 1 | US FAERS | |
| 791 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 792 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 793 | Tonsillitis | FAERS: 1 | US FAERS | |
| 794 | Tooth Infection | FAERS: 1 | US FAERS | |
| 795 | Tooth Loss | FAERS: 1 | US FAERS | |
| 796 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 797 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 798 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 799 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 800 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 801 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 802 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 803 | Urethral melanoma metastatic | FAERS: 1 | US FAERS | |
| 804 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 805 | Uterine Fistula | FAERS: 1 | US FAERS | |
| 806 | Uterine necrosis | FAERS: 1 | US FAERS | |
| 807 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 808 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 809 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 810 | Viral uveitis | FAERS: 1 | US FAERS | |
| 811 | Viral vasculitis | FAERS: 1 | US FAERS | |
| 812 | Vitritis | FAERS: 1 | US FAERS | |
| 813 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 814 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 815 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 816 | Wrong dose | FAERS: 1 | US FAERS | |
| 817 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 818 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 819 | prostatitis | FAERS: 1 | US FAERS | |
| 820 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 821 | Extra dose administered | Canada Vigilance: 1 | Canada Vigilance | |
| 822 | Macular degeneration | Canada Vigilance: 1 | Canada Vigilance | |
| 823 | Mixed Connective Tissue Disease | Canada Vigilance: 1 | Canada Vigilance | |
| 824 | Paranoia | Canada Vigilance: 1 | Canada Vigilance | |
| 825 | Product complaint | Canada Vigilance: 3 | Canada Vigilance | |
| 826 | Product dispensing error | Canada Vigilance: 2 | Canada Vigilance | |
| 827 | Product storage error | Canada Vigilance: 1 | Canada Vigilance | |
| 828 | Suspected product quality issue | Canada Vigilance: 1 | Canada Vigilance | |
| 829 | Vessel puncture site bruise | Canada Vigilance: 1 | Canada Vigilance | |
| 830 | Wound Infection | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.