Trimethoprim, Sulfamethoxazole Drug Combination
(WZRJTRPJURQBRM-UHFFFAOYSA-N)
Structure
- SMILES
- Nc1ccc(cc1)S(=O)(=O)Nc1noc(c1)C.COc1cc(Cc2cnc(nc2N)N)cc(c1OC)OC
- Molecular Formula:
- C24H29N7O6S
- Molecular Weight:
- 543.595
- Log P:
- 5.5210
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 4
- TPSA:
- 212.11
- CAS Number(s):
- 8064-90-2; 50641-67-3; 50808-41-8
Synonym(s)
1.
Trimethoprim, Sulfamethoxazole Drug Combination
2.
Trimethoprim-Sulfamethoxazole Combination
3.
Abactrim
4.
Bactifor
5.
Bactrim
6.
Biseptol
7.
Biseptol-480
8.
Centran
9.
Centrin
10.
Co-Trimoxazole
11.
Cotrimoxazole
12.
Drylin
13.
Eslectin
14.
Eusaprim
15.
Insozalin
16.
Kepinol
17.
Kepinol Forte
18.
Lescot
19.
Metomide
20.
Oriprim
21.
Septra
22.
Septrin
23.
Sulfamethoxazole-Trimethoprim Combination
24.
Sulprim
25.
Sumetrolim
26.
TMP SMX
27.
TMP-SMX
28.
Trimedin
29.
Trimethoprim-Sulfamethoxazole
30.
Trimethoprimsulfa
31.
Trimezole
32.
Trimosulfa
33.
Biseptol 480
34.
Biseptol480
35.
Co Trimoxazole
36.
Sulfamethoxazole Trimethoprim Combination
37.
Trimethoprim Sulfamethoxazole
38.
Trimethoprim Sulfamethoxazole Combination
External Link(s)
| MeSH | D015662 |
| PubChem Compound | 358641 |
| CHEMBL | CHEMBL58061 |
| KEGG | dr:D00285 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 132 Canada Vigilance: 38 | 6138645 10190377 10950090 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Urticaria | FAERS: 118 Canada Vigilance: 64 | 11792017 16422373 17162415 | CTD Canada Vigilance US FAERS |
| 3 | Pruritus | FAERS: 117 Canada Vigilance: 108 | 1587437 3094778 19142556 | CTD Canada Vigilance US FAERS |
| 4 | Stevens-Johnson Syndrome | FAERS: 112 Canada Vigilance: 15 | 7479194 16807519 25170804 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Vomiting | FAERS: 88 Canada Vigilance: 30 | 2865637 10190377 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Chills | FAERS: 74 Canada Vigilance: 20 | 3958749 | CTD Canada Vigilance US FAERS |
| 7 | Fatigue | FAERS: 67 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 8 | Headache | FAERS: 66 Canada Vigilance: 19 | 3958749 6138645 20046017 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Hypersensitivity | FAERS: 65 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 10 | Asthenia | FAERS: 63 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 11 | Pain | FAERS: 63 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Dizziness | FAERS: 58 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 13 | Thrombocytopenia | FAERS: 49 Canada Vigilance: 11 | CTD SIDER Canada Vigilance US FAERS | |
| 14 | Arthralgia | FAERS: 48 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 15 | Myalgia | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 16 | Hypotension | FAERS: 44 Canada Vigilance: 6 | 2266098 8115221 8286631 | CTD Canada Vigilance US FAERS |
| 17 | Erythema | FAERS: 42 Canada Vigilance: 39 | CTD Canada Vigilance US FAERS | |
| 18 | Toxic Epidermal Necrolysis | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 19 | Angioedema | FAERS: 40 Canada Vigilance: 2 | 17296538 | CTD SIDER Canada Vigilance US FAERS |
| 20 | Blood creatinine increased | FAERS: 40 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 21 | Malaise | FAERS: 40 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 22 | Rash erythematous | FAERS: 36 Canada Vigilance: 76 | Canada Vigilance US FAERS | |
| 23 | Abdominal Pain | FAERS: 33 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 24 | Feeling abnormal | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Tremor | FAERS: 28 Canada Vigilance: 4 | CTD Canada Vigilance US FAERS | |
| 26 | Blood urea increased | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Aspartate Aminotransferase Increased | FAERS: 24 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 28 | Pancytopenia | FAERS: 24 Canada Vigilance: 3 | CTD SIDER Canada Vigilance US FAERS | |
| 29 | Lip swelling | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Alanine Aminotransferase Increased | FAERS: 21 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 31 | Dehydration | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 32 | Drug ineffective | FAERS: 20 | US FAERS | |
| 33 | Hepatitis | FAERS: 20 Canada Vigilance: 10 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 34 | Musculoskeletal stiffness | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 35 | Back Pain | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 36 | Chest Pain | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | jaundice | FAERS: 18 Canada Vigilance: 6 | CTD Canada Vigilance US FAERS | |
| 38 | Abdominal discomfort | FAERS: 17 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 39 | Burning sensation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Leukopenia | FAERS: 16 Canada Vigilance: 113 | 7051241 | CTD SIDER Canada Vigilance US FAERS |
| 41 | Oropharyngeal pain | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 42 | Palpitations | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Swelling | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | White blood cell count decreased | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 45 | Skin lesion | FAERS: 15 | US FAERS | |
| 46 | Petechiae | FAERS: 14 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 47 | Chest discomfort | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Chromaturia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Erythema Multiforme | FAERS: 13 Canada Vigilance: 8 | 14712321 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 50 | Wheezing | FAERS: 13 | US FAERS | |
| 51 | Anxiety | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Flushing | FAERS: 12 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 53 | Metabolic acidosis | FAERS: 12 | US FAERS | |
| 54 | Neutropenia | FAERS: 12 Canada Vigilance: 5 | 3265540 7315805 | CTD SIDER Canada Vigilance US FAERS |
| 55 | Pancreatitis | FAERS: 12 Canada Vigilance: 1 | 85859 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 56 | Rhabdomyolysis | FAERS: 12 | OFFSIDES US FAERS | |
| 57 | Anorexia | FAERS: 11 | 3265285 | CTD OFFSIDES SIDER US FAERS |
| 58 | Dysuria | FAERS: 11 | 80611 | CTD US FAERS |
| 59 | Hepatomegaly | FAERS: 11 | 10950090 | CTD US FAERS |
| 60 | Lymphadenopathy | FAERS: 11 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 61 | Neck Pain | FAERS: 11 | US FAERS | |
| 62 | Sepsis | FAERS: 11 Canada Vigilance: 2 | 1090107 | CTD Canada Vigilance US FAERS |
| 63 | Acute kidney injury | FAERS: 10 Canada Vigilance: 3 | CTD Canada Vigilance US FAERS | |
| 64 | Hypophagia | FAERS: 10 | US FAERS | |
| 65 | Photophobia | FAERS: 10 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 66 | Tachycardia | FAERS: 10 Canada Vigilance: 6 | 8115221 | CTD Canada Vigilance US FAERS |
| 67 | Weight decreased | FAERS: 10 | US FAERS | |
| 68 | Abasia | FAERS: 9 | OFFSIDES US FAERS | |
| 69 | Blood potassium increased | FAERS: 9 | US FAERS | |
| 70 | Inflammation | FAERS: 9 | US FAERS | |
| 71 | Pallor | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Product quality issue | FAERS: 9 | US FAERS | |
| 73 | Syncope | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Agranulocytosis | FAERS: 8 Canada Vigilance: 2 | 871632 2785785 | CTD SIDER Canada Vigilance US FAERS |
| 75 | Blood lactate dehydrogenase increased | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 76 | Conjunctivitis | FAERS: 8 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 77 | Crystalluria | FAERS: 8 | US FAERS | |
| 78 | Dyspepsia | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 79 | Splenomegaly | FAERS: 8 | US FAERS | |
| 80 | Blood alkaline phosphatase increased | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 81 | Bradycardia | FAERS: 7 | US FAERS | |
| 82 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 83 | Eosinophilia | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 84 | Eye pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Hypoxia | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 86 | Infection | FAERS: 7 | OFFSIDES US FAERS | |
| 87 | Medication Error | FAERS: 7 | US FAERS | |
| 88 | Mental status changes | FAERS: 7 | US FAERS | |
| 89 | Musculoskeletal Pain | FAERS: 7 | US FAERS | |
| 90 | Product storage error | FAERS: 7 | US FAERS | |
| 91 | Stomatitis | FAERS: 7 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 92 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 93 | Agitation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Cellulitis | FAERS: 6 | US FAERS | |
| 95 | Discomfort | FAERS: 6 | US FAERS | |
| 96 | Drug screen false positive | FAERS: 6 | US FAERS | |
| 97 | Dysgeusia | FAERS: 6 | US FAERS | |
| 98 | Gamma-Glutamyltransferase Increased | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 99 | No adverse event | FAERS: 6 | US FAERS | |
| 100 | Oral candidiasis | FAERS: 6 | US FAERS | |
| 101 | Oral pain | FAERS: 6 | US FAERS | |
| 102 | Renal tubular necrosis | FAERS: 6 | US FAERS | |
| 103 | Restlessness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Skin reaction | FAERS: 6 | US FAERS | |
| 105 | Somnolence | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 106 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 107 | Vertigo | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 108 | Acute psychosis | FAERS: 5 | US FAERS | |
| 109 | Bedridden | FAERS: 5 | US FAERS | |
| 110 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 111 | Bronchitis | FAERS: 5 | 63882 7256343 | CTD US FAERS |
| 112 | Cholestasis | FAERS: 5 | CTD US FAERS | |
| 113 | Delirium | FAERS: 5 Canada Vigilance: 2 | 2596498 8614533 10773846 | CTD Canada Vigilance US FAERS |
| 114 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 115 | Disorientation | FAERS: 5 | US FAERS | |
| 116 | Dysphonia | FAERS: 5 | US FAERS | |
| 117 | Nervousness | FAERS: 5 | US FAERS | |
| 118 | Ocular icterus | FAERS: 5 | US FAERS | |
| 119 | Productive Cough | FAERS: 5 | OFFSIDES US FAERS | |
| 120 | Purpura | FAERS: 5 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 121 | Unevaluable event | FAERS: 5 | US FAERS | |
| 122 | Urinary Retention | FAERS: 5 | US FAERS | |
| 123 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 124 | Aphasia | FAERS: 4 | US FAERS | |
| 125 | Apparent death | FAERS: 4 | US FAERS | |
| 126 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 127 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 128 | Blood creatine phosphokinase increased | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 129 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 130 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 131 | Febrile Neutropenia | FAERS: 4 | OFFSIDES US FAERS | |
| 132 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 133 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 134 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 135 | Lethargy | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 136 | Leukocytoclastic vasculitis | FAERS: 4 | SIDER US FAERS | |
| 137 | Mental impairment | FAERS: 4 | US FAERS | |
| 138 | Myocarditis | FAERS: 4 | US FAERS | |
| 139 | Nephritis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | Pharyngolaryngeal Pain | FAERS: 4 | US FAERS | |
| 141 | Pneumonia | FAERS: 4 Canada Vigilance: 1 | 9972380 25170804 | CTD SIDER Canada Vigilance US FAERS |
| 142 | Polyuria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Renal pain | FAERS: 4 | US FAERS | |
| 144 | Respiratory Depression | FAERS: 4 | US FAERS | |
| 145 | Respiratory Failure | FAERS: 4 | OFFSIDES US FAERS | |
| 146 | Scab | FAERS: 4 | US FAERS | |
| 147 | Septic Shock | FAERS: 4 | US FAERS | |
| 148 | Serum Sickness | FAERS: 4 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 149 | Shock | FAERS: 4 Canada Vigilance: 1 | 8286631 | CTD Canada Vigilance US FAERS |
| 150 | Skin Ulcer | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Sneezing | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 152 | Sunburn | FAERS: 4 | US FAERS | |
| 153 | Throat irritation | FAERS: 4 | US FAERS | |
| 154 | Vasculitis | FAERS: 4 Canada Vigilance: 2 | 63882 528519 | CTD Canada Vigilance US FAERS |
| 155 | Visual Impairment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 157 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 158 | Ageusia | FAERS: 3 | US FAERS | |
| 159 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 160 | Arthropathy | FAERS: 3 | OFFSIDES US FAERS | |
| 161 | Ascites | FAERS: 3 | OFFSIDES US FAERS | |
| 162 | Ataxia | FAERS: 3 | SIDER US FAERS | |
| 163 | Blindness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Blood glucose decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Cheilitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Constipation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Crying | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 168 | Cystitis | FAERS: 3 | 8737160 | CTD US FAERS |
| 169 | Disease recurrence | FAERS: 3 | US FAERS | |
| 170 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 171 | Epistaxis | FAERS: 3 | US FAERS | |
| 172 | Eye irritation | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 173 | Feeling Cold | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 174 | Flank Pain | FAERS: 3 | US FAERS | |
| 175 | General physical health deterioration | FAERS: 3 | OFFSIDES US FAERS | |
| 176 | Idiosyncratic drug reaction | FAERS: 3 | US FAERS | |
| 177 | Impaired work ability | FAERS: 3 | US FAERS | |
| 178 | Influenza | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 180 | Leukocytosis | FAERS: 3 | US FAERS | |
| 181 | Lipase increased | FAERS: 3 | US FAERS | |
| 182 | Menorrhagia | FAERS: 3 | US FAERS | |
| 183 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 184 | Oropharyngeal blistering | FAERS: 3 | US FAERS | |
| 185 | Osteomyelitis | FAERS: 3 | 4615135 20171413 | CTD OFFSIDES US FAERS |
| 186 | Pain of skin | FAERS: 3 | US FAERS | |
| 187 | Papule | FAERS: 3 | US FAERS | |
| 188 | Penile blister | FAERS: 3 | US FAERS | |
| 189 | Pleuritic pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Pneumothorax | FAERS: 3 | OFFSIDES US FAERS | |
| 191 | Product use issue | FAERS: 3 | US FAERS | |
| 192 | Protein total decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 193 | Proteinuria | FAERS: 3 Canada Vigilance: 2 | 14563468 | CTD Canada Vigilance US FAERS |
| 194 | Renal tubular acidosis | FAERS: 3 | US FAERS | |
| 195 | Respiratory distress | FAERS: 3 | US FAERS | |
| 196 | Retching | FAERS: 3 | US FAERS | |
| 197 | Similar reaction on previous exposure to drug | FAERS: 3 | US FAERS | |
| 198 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 199 | Skin irritation | FAERS: 3 | US FAERS | |
| 200 | Tinnitus | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 201 | Tongue blistering | FAERS: 3 | US FAERS | |
| 202 | Toothache | FAERS: 3 | US FAERS | |
| 203 | Transaminases increased | FAERS: 3 | US FAERS | |
| 204 | Vitamin K Deficiency | FAERS: 3 | US FAERS | |
| 205 | Vitritis | FAERS: 3 | US FAERS | |
| 206 | Accidental overdose | FAERS: 2 | US FAERS | |
| 207 | Acquired diaphragmatic eventration | FAERS: 2 | US FAERS | |
| 208 | Activities of daily living impaired | FAERS: 2 | OFFSIDES US FAERS | |
| 209 | Acute prerenal failure | FAERS: 2 | US FAERS | |
| 210 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 211 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 2 | US FAERS | |
| 212 | Apathy | FAERS: 2 | US FAERS | |
| 213 | Aphagia | FAERS: 2 | US FAERS | |
| 214 | Arthropod bite | FAERS: 2 | US FAERS | |
| 215 | Asterixis | FAERS: 2 | US FAERS | |
| 216 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 217 | Blood chloride increased | FAERS: 2 | US FAERS | |
| 218 | Blood creatine increased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 219 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 220 | Blood folate decreased | FAERS: 2 | US FAERS | |
| 221 | Blood potassium decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Brain Death | FAERS: 2 | US FAERS | |
| 223 | Candidiasis | FAERS: 2 | US FAERS | |
| 224 | Carbon dioxide decreased | FAERS: 2 | US FAERS | |
| 225 | Cataract | FAERS: 2 | OFFSIDES US FAERS | |
| 226 | Choking | FAERS: 2 | US FAERS | |
| 227 | Clostridium difficile colitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 228 | Cold sweat | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 229 | Creatinine renal clearance decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 230 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 231 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 232 | Diffuse alveolar damage | FAERS: 2 | US FAERS | |
| 233 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 234 | Documented hypersensitivity to administered product | FAERS: 2 | US FAERS | |
| 235 | Drooling | FAERS: 2 | US FAERS | |
| 236 | Drug screen positive | FAERS: 2 | US FAERS | |
| 237 | Drug toxicity | FAERS: 2 | US FAERS | |
| 238 | Electrocardiogram T wave peaked | FAERS: 2 | US FAERS | |
| 239 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 240 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 241 | Epstein-Barr virus antibody positive | FAERS: 2 | US FAERS | |
| 242 | Escherichia infection | FAERS: 2 | US FAERS | |
| 243 | Excoriation | FAERS: 2 | US FAERS | |
| 244 | Exfoliative rash | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 245 | Facial Pain | FAERS: 2 | US FAERS | |
| 246 | Fixed eruption | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 247 | Flatulence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Gastritis | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 249 | Genital rash | FAERS: 2 | US FAERS | |
| 250 | Head discomfort | FAERS: 2 | US FAERS | |
| 251 | Histiocytosis haematophagic | FAERS: 2 | OFFSIDES US FAERS | |
| 252 | Hypoaldosteronism | FAERS: 2 | US FAERS | |
| 253 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 254 | Initial insomnia | FAERS: 2 | US FAERS | |
| 255 | Joint swelling | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 256 | Lung consolidation | FAERS: 2 | US FAERS | |
| 257 | Lymphocytic infiltration | FAERS: 2 | US FAERS | |
| 258 | Meningitis | FAERS: 2 | 1090107 18380704 | CTD US FAERS |
| 259 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 260 | Mood swings | FAERS: 2 | US FAERS | |
| 261 | Mouth swelling | FAERS: 2 | US FAERS | |
| 262 | Muscle strain | FAERS: 2 | US FAERS | |
| 263 | Musculoskeletal discomfort | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 264 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 265 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 266 | Necrosis | FAERS: 2 | US FAERS | |
| 267 | Nephrolithiasis | FAERS: 2 | OFFSIDES US FAERS | |
| 268 | Neutrophil count decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 269 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 270 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 271 | Otitis Media | FAERS: 2 | US FAERS | |
| 272 | Overlap syndrome | FAERS: 2 | US FAERS | |
| 273 | Pericarditis | FAERS: 2 | OFFSIDES US FAERS | |
| 274 | Peripheral swelling | FAERS: 2 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 275 | Pneumonitis | FAERS: 2 | US FAERS | |
| 276 | Procedural complication | FAERS: 2 | US FAERS | |
| 277 | Product substitution issue | FAERS: 2 | US FAERS | |
| 278 | Product use complaint | FAERS: 2 | US FAERS | |
| 279 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 280 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 281 | Pyelonephritis | FAERS: 2 | 4788840 | CTD US FAERS |
| 282 | Rhinitis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 283 | Rhonchi | FAERS: 2 | US FAERS | |
| 284 | Scleritis | FAERS: 2 | US FAERS | |
| 285 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 286 | Sinus headache | FAERS: 2 | US FAERS | |
| 287 | Skin necrosis | FAERS: 2 | US FAERS | |
| 288 | Stress | FAERS: 2 | US FAERS | |
| 289 | Thermal burn | FAERS: 2 | US FAERS | |
| 290 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 291 | Unresponsive to stimuli | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 292 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 293 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 294 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 295 | furuncle | FAERS: 2 | US FAERS | |
| 296 | prostatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 297 | pseudomembranous colitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 298 | Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 299 | Accidental exposure | FAERS: 1 | US FAERS | |
| 300 | Acidosis | FAERS: 1 | US FAERS | |
| 301 | Acne | FAERS: 1 | US FAERS | |
| 302 | Acute myocardial infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 303 | Adverse event | FAERS: 1 | US FAERS | |
| 304 | Alopecia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Alpha 2 globulin increased | FAERS: 1 | US FAERS | |
| 306 | Amputation | FAERS: 1 | US FAERS | |
| 307 | Anal spasm | FAERS: 1 | US FAERS | |
| 308 | Anencephaly | FAERS: 1 | US FAERS | |
| 309 | Anger | FAERS: 1 | US FAERS | |
| 310 | Anisocytosis | FAERS: 1 | US FAERS | |
| 311 | Anosmia | FAERS: 1 | US FAERS | |
| 312 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 313 | Antipsychotic drug level increased | FAERS: 1 | US FAERS | |
| 314 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 315 | Arthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Aspiration bone marrow abnormal | FAERS: 1 | US FAERS | |
| 317 | Atrioventricular Block | FAERS: 1 | OFFSIDES US FAERS | |
| 318 | Auricular swelling | FAERS: 1 | US FAERS | |
| 319 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 320 | Balanitis | FAERS: 1 | US FAERS | |
| 321 | Belligerence | FAERS: 1 | US FAERS | |
| 322 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 323 | Bladder pain | FAERS: 1 | US FAERS | |
| 324 | Bladder spasm | FAERS: 1 | US FAERS | |
| 325 | Blood blister | FAERS: 1 | US FAERS | |
| 326 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 327 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 328 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 329 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 330 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 331 | Blood pH increased | FAERS: 1 | US FAERS | |
| 332 | Blood pressure fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 333 | Blood smear test abnormal | FAERS: 1 | US FAERS | |
| 334 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 335 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 336 | Blood urine present | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 337 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 338 | Bone pain | FAERS: 1 | US FAERS | |
| 339 | Breast tenderness | FAERS: 1 | US FAERS | |
| 340 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 341 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 342 | Butterfly rash | FAERS: 1 | US FAERS | |
| 343 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 344 | Carpal Tunnel Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Catheter related infection | FAERS: 1 | US FAERS | |
| 346 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 347 | Chemical injury | FAERS: 1 | US FAERS | |
| 348 | Choanal Atresia | FAERS: 1 | US FAERS | |
| 349 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 350 | Cholangitis | FAERS: 1 | US FAERS | |
| 351 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 352 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 353 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 354 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 355 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 356 | Corneal erosion | FAERS: 1 | US FAERS | |
| 357 | Crystal nephropathy | FAERS: 1 | US FAERS | |
| 358 | Culture urine positive | FAERS: 1 | US FAERS | |
| 359 | Cyanosis | FAERS: 1 Canada Vigilance: 1 | 8115221 | CTD Canada Vigilance US FAERS |
| 360 | Cyst | FAERS: 1 | US FAERS | |
| 361 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 362 | Deafness | FAERS: 1 | OFFSIDES US FAERS | |
| 363 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 364 | Dementia | FAERS: 1 | US FAERS | |
| 365 | Depressed mood | FAERS: 1 | US FAERS | |
| 366 | Dermatitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 367 | Device computer issue | FAERS: 1 | US FAERS | |
| 368 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 369 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 370 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 371 | Disease complication | FAERS: 1 | US FAERS | |
| 372 | Distributive shock | FAERS: 1 | US FAERS | |
| 373 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 374 | Dose calculation error | FAERS: 1 | US FAERS | |
| 375 | Drug administration error | FAERS: 1 | US FAERS | |
| 376 | Drug dose omission | FAERS: 1 | US FAERS | |
| 377 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 378 | Drug therapy changed | FAERS: 1 | US FAERS | |
| 379 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 380 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 381 | Dysarthria | FAERS: 1 | US FAERS | |
| 382 | Dysgraphia | FAERS: 1 | US FAERS | |
| 383 | Dystonia | FAERS: 1 | US FAERS | |
| 384 | Ecchymosis | FAERS: 1 | US FAERS | |
| 385 | Economic problem | FAERS: 1 | US FAERS | |
| 386 | Ehrlichia test positive | FAERS: 1 | US FAERS | |
| 387 | Ejection Fraction Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 388 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 389 | Emotional disorder | FAERS: 1 | US FAERS | |
| 390 | Emotional distress | FAERS: 1 | US FAERS | |
| 391 | Encephalitis | FAERS: 1 | US FAERS | |
| 392 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 393 | Enteritis | FAERS: 1 | US FAERS | |
| 394 | Eosinophils urine present | FAERS: 1 | US FAERS | |
| 395 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 396 | Erythema Infectiosum | FAERS: 1 | US FAERS | |
| 397 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 398 | Eschar | FAERS: 1 | US FAERS | |
| 399 | Escherichia urinary tract infection | FAERS: 1 | OFFSIDES US FAERS | |
| 400 | Eye Burns | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Eyelid pain | FAERS: 1 | US FAERS | |
| 402 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 403 | Fibrosis | FAERS: 1 | US FAERS | |
| 404 | Food Allergy | FAERS: 1 | US FAERS | |
| 405 | Fulminant type 1 diabetes mellitus | FAERS: 1 | US FAERS | |
| 406 | Gastroenteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 407 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 408 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 409 | Genital Herpes | FAERS: 1 | US FAERS | |
| 410 | Genital erosion | FAERS: 1 | US FAERS | |
| 411 | Genital erythema | FAERS: 1 | US FAERS | |
| 412 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 413 | Genital pain | FAERS: 1 | US FAERS | |
| 414 | Gingival blister | FAERS: 1 | US FAERS | |
| 415 | Granulocytes maturation arrest | FAERS: 1 | US FAERS | |
| 416 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 417 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 418 | Haematotoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 419 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 420 | Hepatic necrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 421 | Hepatitis A | FAERS: 1 | US FAERS | |
| 422 | Hepatitis B core antibody positive | FAERS: 1 | US FAERS | |
| 423 | Hepatitis B surface antigen positive | FAERS: 1 | US FAERS | |
| 424 | Hepatitis C | FAERS: 1 | OFFSIDES US FAERS | |
| 425 | Human Ehrlichiosis | FAERS: 1 | US FAERS | |
| 426 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 427 | Hypercapnia | FAERS: 1 | US FAERS | |
| 428 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 429 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 430 | Hypersomnia | FAERS: 1 | US FAERS | |
| 431 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 432 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 433 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 434 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 435 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 436 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 437 | Hypoventilation | FAERS: 1 | US FAERS | |
| 438 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 439 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 440 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 441 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 442 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 443 | Insulin C-peptide increased | FAERS: 1 | US FAERS | |
| 444 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 445 | Joint stiffness | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 446 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 447 | Ketosis | FAERS: 1 | US FAERS | |
| 448 | Laceration | FAERS: 1 | US FAERS | |
| 449 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 450 | Loss of proprioception | FAERS: 1 | US FAERS | |
| 451 | Lung Abscess | FAERS: 1 | US FAERS | |
| 452 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 453 | Lyme Disease | FAERS: 1 | US FAERS | |
| 454 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 455 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 456 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 457 | Lymphopenia | FAERS: 1 | US FAERS | |
| 458 | Macrocytosis | FAERS: 1 | US FAERS | |
| 459 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 460 | Medical device complication | FAERS: 1 | US FAERS | |
| 461 | Memory impairment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 462 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 463 | Middle insomnia | FAERS: 1 | US FAERS | |
| 464 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 465 | Monoparesis | FAERS: 1 | US FAERS | |
| 466 | Monoplegia | FAERS: 1 | US FAERS | |
| 467 | Mucocutaneous rash | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 468 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 469 | Multifocal micronodular pneumocyte hyperplasia | FAERS: 1 | US FAERS | |
| 470 | Multiple allergies | FAERS: 1 | US FAERS | |
| 471 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 472 | Mydriasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 473 | Myeloid maturation arrest | FAERS: 1 | OFFSIDES US FAERS | |
| 474 | Myoclonus | FAERS: 1 | 14702438 15188079 | CTD US FAERS |
| 475 | Myopia | FAERS: 1 | US FAERS | |
| 476 | Myositis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 477 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 478 | Nephritis allergic | FAERS: 1 | US FAERS | |
| 479 | Neuritis | FAERS: 1 | SIDER US FAERS | |
| 480 | Neutrophil percentage decreased | FAERS: 1 | US FAERS | |
| 481 | Neutrophilic dermatosis | FAERS: 1 | US FAERS | |
| 482 | Nodule | FAERS: 1 | US FAERS | |
| 483 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 484 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 485 | Obstruction | FAERS: 1 | US FAERS | |
| 486 | Oliguria | FAERS: 1 | 65691 | CTD US FAERS |
| 487 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 488 | Oral contraception | FAERS: 1 | US FAERS | |
| 489 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 490 | Oral mucosal eruption | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 491 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 492 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 493 | Overdose | FAERS: 1 | US FAERS | |
| 494 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 495 | PO2 decreased | FAERS: 1 | US FAERS | |
| 496 | Paranoia | FAERS: 1 | US FAERS | |
| 497 | Parotid gland inflammation | FAERS: 1 | US FAERS | |
| 498 | Parvovirus B19 test positive | FAERS: 1 | US FAERS | |
| 499 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 500 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 501 | Penile swelling | FAERS: 1 | US FAERS | |
| 502 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 503 | Personality Change | FAERS: 1 | US FAERS | |
| 504 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 505 | Phlebitis | FAERS: 1 | US FAERS | |
| 506 | Piloerection | FAERS: 1 | OFFSIDES US FAERS | |
| 507 | Poikilocytosis | FAERS: 1 | US FAERS | |
| 508 | Polyarthritis | FAERS: 1 | US FAERS | |
| 509 | Polymyalgia Rheumatica | FAERS: 1 | OFFSIDES US FAERS | |
| 510 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 511 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 512 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 513 | Pregnancy | FAERS: 1 | US FAERS | |
| 514 | Presyncope | FAERS: 1 | US FAERS | |
| 515 | Priapism | FAERS: 1 | US FAERS | |
| 516 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 517 | Product coating issue | FAERS: 1 | US FAERS | |
| 518 | Product dispensing error | FAERS: 1 | US FAERS | |
| 519 | Product physical issue | FAERS: 1 | US FAERS | |
| 520 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 521 | Protein total increased | FAERS: 1 | US FAERS | |
| 522 | Protein urine present | FAERS: 1 | US FAERS | |
| 523 | Prurigo | FAERS: 1 | US FAERS | |
| 524 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 525 | Pulmonary Fibrosis | FAERS: 1 | 85859 | CTD US FAERS |
| 526 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 527 | Pulmonary congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 528 | Pulmonary pneumatocele | FAERS: 1 | US FAERS | |
| 529 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 530 | Rectal discharge | FAERS: 1 | US FAERS | |
| 531 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 532 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 533 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 534 | Reticulocytosis | FAERS: 1 | US FAERS | |
| 535 | Retinal Vasculitis | FAERS: 1 | 17162415 | CTD US FAERS |
| 536 | Retinal exudates | FAERS: 1 | US FAERS | |
| 537 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 538 | Rhinalgia | FAERS: 1 | US FAERS | |
| 539 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 540 | Schizophrenia | FAERS: 1 | US FAERS | |
| 541 | Scotoma | FAERS: 1 | US FAERS | |
| 542 | Secretion discharge | FAERS: 1 | US FAERS | |
| 543 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 544 | Skin Erosion | FAERS: 1 | US FAERS | |
| 545 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 546 | Strabismus | FAERS: 1 | US FAERS | |
| 547 | Stupor | FAERS: 1 | US FAERS | |
| 548 | Suicide attempt | FAERS: 1 | US FAERS | |
| 549 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 550 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 551 | Synovitis | FAERS: 1 | US FAERS | |
| 552 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 553 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 554 | Tarsal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 555 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 556 | Tension | FAERS: 1 | US FAERS | |
| 557 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 558 | Therapy cessation | FAERS: 1 | US FAERS | |
| 559 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 560 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 561 | Transcription medication error | FAERS: 1 | US FAERS | |
| 562 | Tri-iodothyronine free decreased | FAERS: 1 | US FAERS | |
| 563 | Troponin increased | FAERS: 1 | US FAERS | |
| 564 | Umbilical erythema | FAERS: 1 | US FAERS | |
| 565 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 566 | Urine bilirubin increased | FAERS: 1 | US FAERS | |
| 567 | Urine output increased | FAERS: 1 | US FAERS | |
| 568 | Vaginal mucosal blistering | FAERS: 1 | US FAERS | |
| 569 | Varicocele | FAERS: 1 | US FAERS | |
| 570 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 571 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 572 | Von Willebrand's factor activity abnormal | FAERS: 1 | US FAERS | |
| 573 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 574 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 575 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 576 | Wheelchair user | FAERS: 1 | US FAERS | |
| 577 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 578 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 579 | treatment failure | FAERS: 1 | US FAERS | |
| 580 | AIDS-Related Opportunistic Infections | CTD | ||
| 581 | Abdominal tenderness | OFFSIDES | ||
| 582 | Abnormal vision | OFFSIDES | ||
| 583 | Acute graft versus host disease in intestine | OFFSIDES | ||
| 584 | Acute graft versus host disease in liver | OFFSIDES | ||
| 585 | Adenoma | OFFSIDES | ||
| 586 | Amylase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 587 | Amyloidosis | OFFSIDES | ||
| 588 | Anaphylactoid Reaction | Canada Vigilance: 8 | Canada Vigilance | |
| 589 | Anemia, Hemolytic | CTD | ||
| 590 | Anemia, Macrocytic | 167444 | CTD | |
| 591 | Anemia, Megaloblastic | CTD | ||
| 592 | Anemia | 3260759 20232757 | CTD | |
| 593 | Anhedonia | OFFSIDES | ||
| 594 | Anhidrosis | OFFSIDES | ||
| 595 | Arteriosclerosis | OFFSIDES | ||
| 596 | Asthma | Canada Vigilance: 3 | 4430301 | CTD Canada Vigilance |
| 597 | Atrial tachycardia | OFFSIDES | ||
| 598 | Avascular necrosis | OFFSIDES | ||
| 599 | Azotemia | 839614 3265285 | CTD | |
| 600 | Bacterial Infections | 3264831 | CTD | |
| 601 | Bacteriuria | 85859 432171 | CTD | |
| 602 | Beta 2 microglobulin urine increased | OFFSIDES | ||
| 603 | Bile Duct Diseases | 8995964 16807519 | CTD | |
| 604 | Biopsy liver abnormal | OFFSIDES | ||
| 605 | Bipolar Disorder | 11799346 | CTD | |
| 606 | Blepharoptosis | OFFSIDES | ||
| 607 | Blood and lymphatic system disorders | SIDER | ||
| 608 | Blood cholinesterase decreased | OFFSIDES | ||
| 609 | Blood immunoglobulin G decreased | OFFSIDES | ||
| 610 | Blood immunoglobulin G increased | OFFSIDES | ||
| 611 | Blood sodium increased | OFFSIDES | ||
| 612 | Blood stem cell transplant failure | OFFSIDES | ||
| 613 | Blood uric acid | OFFSIDES | ||
| 614 | Bone marrow depression | SIDER | ||
| 615 | Bone swelling | OFFSIDES | ||
| 616 | Brain Contusion | OFFSIDES | ||
| 617 | Bronchopneumonia | 3265285 | CTD OFFSIDES | |
| 618 | Bronchospasm | Canada Vigilance: 3 | Canada Vigilance | |
| 619 | Bursitis | OFFSIDES | ||
| 620 | CD4 Lymphocytes Decreased | OFFSIDES | ||
| 621 | CYTOMEGALOVIRUS ANTIGEN | OFFSIDES | ||
| 622 | Carcinoma, Transitional Cell | 15028437 | CTD | |
| 623 | Cardiac Tamponade | OFFSIDES | ||
| 624 | Cataract operation | OFFSIDES | ||
| 625 | Cavernous Sinus Thrombosis | 18380704 | CTD | |
| 626 | Central line infection | OFFSIDES | ||
| 627 | Cerebral Hemorrhage | 85859 | CTD | |
| 628 | Cerebral atrophy | OFFSIDES | ||
| 629 | Chemical and Drug Induced Liver Injury |
1506646
1587437 2167870 6331808 7202951 7325149 7556317 8547737 8717195 10950090 11100060 15247700 16165719 17297432 | CTD | |
| 630 | Cholangiolitis | OFFSIDES | ||
| 631 | Chorea | 16220100 | CTD | |
| 632 | Chorioretinitis | OFFSIDES | ||
| 633 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 634 | Cirrhosis | OFFSIDES | ||
| 635 | Coagulation factor VIII level increased | OFFSIDES | ||
| 636 | Colonic Stenosis | OFFSIDES | ||
| 637 | Community-Acquired Infections | 25170804 | CTD | |
| 638 | Confabulation | OFFSIDES | ||
| 639 | Confusion | 3958749 6610773 11200873 | CTD | |
| 640 | Consciousness Disorders | 80611 | CTD | |
| 641 | Cranial nerve diseases | 8006651 | CTD | |
| 642 | Culture positive | OFFSIDES | ||
| 643 | Cytomegalovirus test positive | OFFSIDES | ||
| 644 | Debridement | OFFSIDES | ||
| 645 | Delusional perception | OFFSIDES | ||
| 646 | Dermatitis acneiform | Canada Vigilance: 1 | Canada Vigilance | |
| 647 | Diabetes | OFFSIDES | ||
| 648 | Diarrhea | 10950090 | CTD | |
| 649 | Discitis | 19718264 | CTD | |
| 650 | Disease Progression | OFFSIDES | ||
| 651 | Distal intestinal obstruction syndrome | OFFSIDES | ||
| 652 | Drug Eruptions | CTD | ||
| 653 | Drug withdrawal headache | OFFSIDES | ||
| 654 | Dyskinesia, Drug-Induced | 14702438 | CTD | |
| 655 | Dyspnea | 11485512 | CTD | |
| 656 | Eczema | Canada Vigilance: 1 | Canada Vigilance | |
| 657 | Enterococcal infection | OFFSIDES | ||
| 658 | Eosinophilic myocarditis | OFFSIDES SIDER | ||
| 659 | Erosive gastritis | OFFSIDES | ||
| 660 | Escherichia coli Infections | 10369619 | CTD | |
| 661 | Exanthema | CTD | ||
| 662 | Fever | CTD | ||
| 663 | Fixed drug eruption | SIDER | ||
| 664 | Gait Ataxia | 2967659 3484928 19109207 | CTD | |
| 665 | Gastrointestinal Diseases | 7051241 | CTD | |
| 666 | Gastrointestinal hypermotility | OFFSIDES | ||
| 667 | General physical condition | OFFSIDES | ||
| 668 | Gingival Hypertrophy | Canada Vigilance: 1 | Canada Vigilance | |
| 669 | Glaucoma | OFFSIDES | ||
| 670 | Glomerulonephritis | OFFSIDES | ||
| 671 | Glossitis | Canada Vigilance: 2 | Canada Vigilance SIDER | |
| 672 | Gram-Negative Bacterial Infections | 19109207 | CTD | |
| 673 | Growth Disorders | 2354467 | CTD | |
| 674 | HIV Infections | 8115221 8286631 9315796 | CTD | |
| 675 | Hallucinations | 2967659 8448723 | CTD | |
| 676 | Hemorrhage | 6388160 | CTD | |
| 677 | Hepatic Encephalopathy | 14703931 | CTD | |
| 678 | Hepatic congestion | OFFSIDES | ||
| 679 | Hepatitis B positive | OFFSIDES | ||
| 680 | Hepatitis B | OFFSIDES | ||
| 681 | Hepatitis C antibody positive | OFFSIDES | ||
| 682 | High frequency ablation | OFFSIDES | ||
| 683 | Histology | OFFSIDES | ||
| 684 | Hydrocephalus | 8115221 | CTD | |
| 685 | Hyperinsulinism | 14714756 | CTD | |
| 686 | Hyperkalemia | 8244201 8943491 9776424 | CTD | |
| 687 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 688 | Hyperpigmentation | OFFSIDES | ||
| 689 | Hypocoagulable state | OFFSIDES | ||
| 690 | Hypoglycemia | 14714756 | CTD | |
| 691 | Hypokalemia | 9238447 | CTD | |
| 692 | Hypokinesia | OFFSIDES | ||
| 693 | Hypomania | OFFSIDES | ||
| 694 | Hyporeflexia | OFFSIDES | ||
| 695 | Hypotension, Orthostatic | 20065266 | CTD | |
| 696 | Immune reconstitution syndrome | OFFSIDES | ||
| 697 | Immunosuppression | OFFSIDES | ||
| 698 | Infestation | SIDER | ||
| 699 | Infusion site pain | OFFSIDES | ||
| 700 | Infusion site swelling | OFFSIDES | ||
| 701 | Intermittent Claudication | OFFSIDES | ||
| 702 | Intestinal Fistula | OFFSIDES | ||
| 703 | Jaundice, Obstructive | 7393813 | CTD | |
| 704 | Kidney Diseases | 1221561 8244201 | CTD | |
| 705 | Kidney Failure | OFFSIDES | ||
| 706 | Klebsiella Infections | 4615135 | CTD | |
| 707 | Legionella | OFFSIDES | ||
| 708 | Leukoencephalopathy | OFFSIDES | ||
| 709 | Leukopenia neonatal | OFFSIDES | ||
| 710 | Limb discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 711 | Lip erythema | Canada Vigilance: 1 | Canada Vigilance | |
| 712 | Lipase | OFFSIDES | ||
| 713 | Livedo Reticularis | Canada Vigilance: 1 | Canada Vigilance | |
| 714 | Liver Failure, Acute | 7202951 7556317 14703931 | CTD | |
| 715 | Liver Failure | 14712321 16807519 | CTD | |
| 716 | Liver diseases | 80611 7479194 10877016 | CTD | |
| 717 | Liver transplant rejection | OFFSIDES | ||
| 718 | Long QT Syndrome | 12199987 | CTD | |
| 719 | Lung diseases | 80611 2949369 | CTD | |
| 720 | Malaria | OFFSIDES | ||
| 721 | Malnutrition | SIDER | ||
| 722 | Massive Hepatic Necrosis | 11100060 | CTD | |
| 723 | Mastication disorder | OFFSIDES | ||
| 724 | Mechanical ventilation | OFFSIDES | ||
| 725 | Meningitis, Bacterial | 18936290 | CTD | |
| 726 | Meningoencephalitis | 8614533 10066062 | CTD | |
| 727 | Metastatic Neoplasm | OFFSIDES | ||
| 728 | Mitral Valve Stenosis | OFFSIDES | ||
| 729 | Molluscum Contagiosum | OFFSIDES | ||
| 730 | Multiple Myeloma | OFFSIDES | ||
| 731 | Muscle Weakness | OFFSIDES | ||
| 732 | Mycobacterium Infections | 9665308 | CTD | |
| 733 | Nephritis, Interstitial | CTD | ||
| 734 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 735 | Nephrotic Syndrome | 17722709 | CTD | |
| 736 | Neuralgia | OFFSIDES | ||
| 737 | Neurotoxicity Syndromes | 3335815 | CTD | |
| 738 | Neutropenic colitis | OFFSIDES | ||
| 739 | Nocardia Infections | 14702438 18498026 | CTD | |
| 740 | Nystagmus | OFFSIDES | ||
| 741 | Oral mucosa atrophy | OFFSIDES | ||
| 742 | Osteopenia | OFFSIDES | ||
| 743 | Osteoporosis | OFFSIDES | ||
| 744 | Otitis Externa | Canada Vigilance: 1 | Canada Vigilance | |
| 745 | Pancreatic enzymes increased | Canada Vigilance: 1 | Canada Vigilance | |
| 746 | Pericardial effusion | OFFSIDES | ||
| 747 | Periodontitis | OFFSIDES | ||
| 748 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 749 | Peritonitis | OFFSIDES | ||
| 750 | Pharyngitis | Canada Vigilance: 5 | Canada Vigilance | |
| 751 | Physical disability | OFFSIDES | ||
| 752 | Pleurisy | 4449776 | CTD | |
| 753 | Pneumocystis Infections | 16732870 | CTD | |
| 754 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 755 | Pneumonia, Bacterial | 3080299 | CTD | |
| 756 | Polyarteritis Nodosa | SIDER | ||
| 757 | Polyomavirus-associated nephropathy | OFFSIDES | ||
| 758 | Portal Hypertension | OFFSIDES | ||
| 759 | Post procedural bile leak | OFFSIDES | ||
| 760 | Psoas Abscess | 17666656 | CTD | |
| 761 | Psychoses, Substance-Induced | CTD | ||
| 762 | Pulmonary Valve Stenosis | OFFSIDES | ||
| 763 | Pulmonary arterial pressure increased | OFFSIDES | ||
| 764 | Pulmonary sepsis | OFFSIDES | ||
| 765 | Pyomyositis | 17666656 | CTD | |
| 766 | Renal Insufficiency | 3879246 10877016 | CTD | |
| 767 | Renal cyst | OFFSIDES | ||
| 768 | Right Ventricular Hypertrophy | OFFSIDES | ||
| 769 | Sacroiliitis | OFFSIDES | ||
| 770 | Seizures | 10066062 | CTD | |
| 771 | Serum sickness-like reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 772 | Sinus pain | Canada Vigilance: 1 | Canada Vigilance | |
| 773 | Sinusitis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 774 | Skin Induration | OFFSIDES | ||
| 775 | Skin hypertrophy | OFFSIDES | ||
| 776 | Skin tightness | OFFSIDES | ||
| 777 | Sluggishness | Canada Vigilance: 1 | Canada Vigilance | |
| 778 | Spinal column stenosis | OFFSIDES | ||
| 779 | Staphylococcal Infections | CTD | ||
| 780 | Staring | OFFSIDES | ||
| 781 | Status Asthmaticus | 7427548 | CTD | |
| 782 | Stem cell transplant | OFFSIDES | ||
| 783 | Steroid withdrawal syndrome | OFFSIDES | ||
| 784 | Subcutaneous Abscess | OFFSIDES | ||
| 785 | Systemic lupus erythematosus rash | Canada Vigilance: 1 | Canada Vigilance | |
| 786 | Tachycardia, Ventricular | 9315796 12199987 | CTD | |
| 787 | Therapy change | Canada Vigilance: 1 | Canada Vigilance | |
| 788 | Thrombophlebitis | 2789377 | CTD OFFSIDES | |
| 789 | Tinea Pedis | OFFSIDES | ||
| 790 | Tongue exfoliation | Canada Vigilance: 1 | Canada Vigilance | |
| 791 | Tooth Extraction | OFFSIDES | ||
| 792 | Tooth Resorption | OFFSIDES | ||
| 793 | Torsades de Pointes | 3492908 | CTD | |
| 794 | Tracheitis | OFFSIDES | ||
| 795 | Tracheobronchitis | OFFSIDES | ||
| 796 | Transfusion microchimerism | OFFSIDES | ||
| 797 | Upper respiratory tract infection bacterial | OFFSIDES | ||
| 798 | Urinary Calculi | 6139048 | CTD | |
| 799 | Urolithiasis | 839614 1480987 | CTD | |
| 800 | Uterine Cancer | OFFSIDES | ||
| 801 | Uveitis | SIDER | ||
| 802 | Vanishing bile duct syndrome | OFFSIDES | ||
| 803 | Vascular purpura | SIDER | ||
| 804 | Vasculitis, Leukocytoclastic, Cutaneous | 724474 16422373 17162415 | CTD | |
| 805 | Vasospasm | OFFSIDES | ||
| 806 | Vitreous Detachment | OFFSIDES | ||
| 807 | Zygomycosis | 4254965 | CTD | |
| 808 | anaphylaxis | 20046017 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.