Cabergoline
(KORNTPPJEAJQIU-KJXAQDMKSA-N)
Structure
- SMILES
- C=CCN1C[C@@H](C[C@H]2[C@H]1Cc1c[nH]c3c1c2ccc3)C(=O)N(C(=O)NCC)CCCN(C)C
- Type(s)
- Approved
- ATC code(s)
- G02CB03; N04BC06
- Molecular Formula:
- C26H37N5O2
- Molecular Weight:
- 451.604
- Log P:
- 3.5227
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 71.68
- CAS Number(s):
- 81409-90-7
Synonym(s)
1.
Cabergoline
2.
1-((6-allylergolin-8beta-yl)carbonyl)-1-(3-(dimethylamino)propyl)-3-ethylurea
3.
1-Ethyl-2-(3'-dimethylaminopropyl)-3-(6'-allylergoline-8'-beta-carbonyl)urea diphosphate
4.
Cabaser
5.
Cabaseril
6.
Cabergoline Diphosphate
7.
Dostinex
8.
FCE 21336
9.
FCE-21336
10.
Galastop
External Link(s)
| MeSH | D000077465 |
| PubChem Compound | 54746 |
| BindingDB | 50426497 |
| ChEBI | 3286 |
| CHEMBL | CHEMBL1201087 |
| DrugBank | DB00248 |
| DrugCentral | 460 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 37 |
| KEGG | cpd:C08187 dr:D00987 |
| Therapeutic Target Database | D04EGX |
| ZINC | 3800008 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 86 Canada Vigilance: 3 | 12058109 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Drug ineffective | FAERS: 73 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 3 | Drug exposure during pregnancy | FAERS: 69 | OFFSIDES US FAERS | |
| 4 | Nausea | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 5 | Blood prolactin increased | FAERS: 65 | OFFSIDES US FAERS | |
| 6 | Dizziness | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Fatigue | FAERS: 33 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 8 | Pneumocephalus | FAERS: 28 | OFFSIDES US FAERS | |
| 9 | Malaise | FAERS: 27 | SIDER US FAERS | |
| 10 | Asthenia | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Chest Pain | FAERS: 24 | OFFSIDES US FAERS | |
| 12 | Pregnancy | FAERS: 24 | US FAERS | |
| 13 | Syncope | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Vomiting | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 15 | Visual Impairment | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 16 | Maternal exposure during pregnancy | FAERS: 21 | US FAERS | |
| 17 | Anxiety | FAERS: 20 | SIDER US FAERS | |
| 18 | Aortic valve sclerosis | FAERS: 19 | OFFSIDES US FAERS | |
| 19 | Intracranial Hypotension | FAERS: 19 | OFFSIDES US FAERS | |
| 20 | Tachycardia | FAERS: 19 | US FAERS | |
| 21 | Abdominal Pain | FAERS: 17 | SIDER US FAERS | |
| 22 | Pulmonary Fibrosis | FAERS: 17 | 19170199 | CTD SIDER US FAERS |
| 23 | Feeling abnormal | FAERS: 16 | SIDER US FAERS | |
| 24 | Prolactinoma | FAERS: 16 | 15377706 16686914 18172015 | CTD OFFSIDES US FAERS |
| 25 | Somnolence | FAERS: 16 | SIDER US FAERS | |
| 26 | Tremor | FAERS: 16 | US FAERS | |
| 27 | Blindness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Mastitis | FAERS: 15 | US FAERS | |
| 29 | Pain | FAERS: 15 | SIDER US FAERS | |
| 30 | Palpitations | FAERS: 15 | SIDER US FAERS | |
| 31 | Drug resistance | FAERS: 14 | OFFSIDES US FAERS | |
| 32 | Alopecia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Empty Sella Syndrome | FAERS: 13 | US FAERS | |
| 34 | Delirium | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 36 | Hypotension | FAERS: 12 | SIDER US FAERS | |
| 37 | Product quality issue | FAERS: 12 | US FAERS | |
| 38 | Product use in unapproved indication | FAERS: 12 | US FAERS | |
| 39 | Back Pain | FAERS: 11 | SIDER US FAERS | |
| 40 | Constipation | FAERS: 11 | SIDER US FAERS | |
| 41 | Hypersensitivity | FAERS: 11 | SIDER US FAERS | |
| 42 | Pericardial effusion | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 43 | Product use issue | FAERS: 11 | US FAERS | |
| 44 | Pulmonary Hypertension | FAERS: 11 | OFFSIDES US FAERS | |
| 45 | Angina Pectoris | FAERS: 10 | US FAERS | |
| 46 | Overdose | FAERS: 10 | US FAERS | |
| 47 | Pleurisy | FAERS: 10 | 19170199 | CTD OFFSIDES SIDER US FAERS |
| 48 | Stress | FAERS: 10 | US FAERS | |
| 49 | Vertigo | FAERS: 10 | SIDER US FAERS | |
| 50 | Depressed mood | FAERS: 9 | US FAERS | |
| 51 | Maternal exposure timing unspecified | FAERS: 9 | US FAERS | |
| 52 | Menorrhagia | FAERS: 9 | US FAERS | |
| 53 | Poor quality drug administered | FAERS: 9 | US FAERS | |
| 54 | Weight decreased | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Amnesia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Blood prolactin decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 57 | Complications of maternal exposure to therapeutic drugs | FAERS: 8 | OFFSIDES US FAERS | |
| 58 | Deafness | FAERS: 8 | OFFSIDES US FAERS | |
| 59 | Drug ineffective for unapproved indication | FAERS: 8 | US FAERS | |
| 60 | Epilepsy | FAERS: 8 | US FAERS | |
| 61 | Lactation Disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 62 | Obsessive-Compulsive Disorder | FAERS: 8 | US FAERS | |
| 63 | Tumour haemorrhage | FAERS: 8 | US FAERS | |
| 64 | Agitation | FAERS: 7 | US FAERS | |
| 65 | Carotid aneurysm rupture | FAERS: 7 | US FAERS | |
| 66 | Compulsive shopping | FAERS: 7 | US FAERS | |
| 67 | Disease recurrence | FAERS: 7 | US FAERS | |
| 68 | Erythema | FAERS: 7 | US FAERS | |
| 69 | Medication Error | FAERS: 7 | US FAERS | |
| 70 | Memory impairment | FAERS: 7 | US FAERS | |
| 71 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 72 | Posterior reversible encephalopathy syndrome | FAERS: 7 | US FAERS | |
| 73 | Priapism | FAERS: 7 | OFFSIDES US FAERS | |
| 74 | Therapeutic response unexpected | FAERS: 7 | US FAERS | |
| 75 | Accidental overdose | FAERS: 6 | US FAERS | |
| 76 | Arteriovenous fistula | FAERS: 6 | US FAERS | |
| 77 | Blood creatine phosphokinase increased | FAERS: 6 | OFFSIDES US FAERS | |
| 78 | Chest discomfort | FAERS: 6 | US FAERS | |
| 79 | Craniopharyngioma | FAERS: 6 | US FAERS | |
| 80 | Depressed Level of Consciousness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Disease Progression | FAERS: 6 | US FAERS | |
| 82 | Fibrosis | FAERS: 6 | SIDER US FAERS | |
| 83 | Leukopenia | FAERS: 6 | US FAERS | |
| 84 | Myalgia | FAERS: 6 | US FAERS | |
| 85 | Neck Pain | FAERS: 6 | US FAERS | |
| 86 | Neonatal disorder | FAERS: 6 | US FAERS | |
| 87 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 88 | Personality Change | FAERS: 6 | US FAERS | |
| 89 | Retroperitoneal fibrosis | FAERS: 6 | 19170199 | CTD SIDER US FAERS |
| 90 | Reversible cerebral vasoconstriction syndrome | FAERS: 6 | US FAERS | |
| 91 | Testotoxicosis | FAERS: 6 | US FAERS | |
| 92 | Tinnitus | FAERS: 6 | US FAERS | |
| 93 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 94 | Abdominal discomfort | FAERS: 5 | SIDER US FAERS | |
| 95 | Acromegaly | FAERS: 5 | US FAERS | |
| 96 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 97 | Breast engorgement | FAERS: 5 | OFFSIDES US FAERS | |
| 98 | Cardiac valve sclerosis | FAERS: 5 | OFFSIDES US FAERS | |
| 99 | Cardiomegaly | FAERS: 5 | US FAERS | |
| 100 | Drug exposure via breast milk | FAERS: 5 | OFFSIDES US FAERS | |
| 101 | Ectopic Pregnancy | FAERS: 5 | US FAERS | |
| 102 | Gastritis | FAERS: 5 | SIDER US FAERS | |
| 103 | Hypothalamo-pituitary disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 104 | Insulin-like growth factor increased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 105 | Mitral valve sclerosis | FAERS: 5 | OFFSIDES US FAERS | |
| 106 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 107 | No adverse event | FAERS: 5 | US FAERS | |
| 108 | Pneumonia | FAERS: 5 | SIDER US FAERS | |
| 109 | Pre-Eclampsia | FAERS: 5 | OFFSIDES US FAERS | |
| 110 | Pre-existing condition improved | FAERS: 5 | US FAERS | |
| 111 | Right ventricular failure | FAERS: 5 | US FAERS | |
| 112 | Suspected counterfeit product | FAERS: 5 | US FAERS | |
| 113 | Tachyphylaxis | FAERS: 5 | US FAERS | |
| 114 | Urticaria | FAERS: 5 | US FAERS | |
| 115 | Abscess | FAERS: 4 | US FAERS | |
| 116 | Acute psychosis | FAERS: 4 | US FAERS | |
| 117 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 118 | Angle Closure Glaucoma | FAERS: 4 | US FAERS | |
| 119 | Apathy | FAERS: 4 | US FAERS | |
| 120 | Arterial fibrosis | FAERS: 4 | OFFSIDES US FAERS | |
| 121 | Asthma | FAERS: 4 | US FAERS | |
| 122 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 123 | Bipolar Disorder | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 125 | Cavernous Sinus Thrombosis | FAERS: 4 | US FAERS | |
| 126 | Central nervous system lesion | FAERS: 4 | US FAERS | |
| 127 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 128 | Crying | FAERS: 4 | US FAERS | |
| 129 | Drug Dependence | FAERS: 4 | US FAERS | |
| 130 | Drug administration error | FAERS: 4 | US FAERS | |
| 131 | Emotional disorder | FAERS: 4 | US FAERS | |
| 132 | Focal Nodular Hyperplasia | FAERS: 4 | OFFSIDES US FAERS | |
| 133 | Gamma-Glutamyltransferase Increased | FAERS: 4 | OFFSIDES US FAERS | |
| 134 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 135 | Hydrocephalus | FAERS: 4 | US FAERS | |
| 136 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 137 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 138 | Neuroleptic Malignant Syndrome | FAERS: 4 | OFFSIDES US FAERS | |
| 139 | Ophthalmic vein thrombosis | FAERS: 4 | US FAERS | |
| 140 | Ovarian Hyperstimulation Syndrome | FAERS: 4 | OFFSIDES US FAERS | |
| 141 | Pancreatitis | FAERS: 4 | US FAERS | |
| 142 | Pelvic Pain | FAERS: 4 | US FAERS | |
| 143 | Pericarditis | FAERS: 4 | 19170199 | CTD SIDER US FAERS |
| 144 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 145 | Pituitary cyst | FAERS: 4 | US FAERS | |
| 146 | Pneumonitis | FAERS: 4 | US FAERS | |
| 147 | Polyuria | FAERS: 4 | US FAERS | |
| 148 | Product substitution issue | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 149 | Pruritus | FAERS: 4 | SIDER US FAERS | |
| 150 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 151 | Pulmonary artery stenosis | FAERS: 4 | US FAERS | |
| 152 | Pulmonary congestion | FAERS: 4 | OFFSIDES US FAERS | |
| 153 | Restless Legs Syndrome | FAERS: 4 | 17230484 | CTD US FAERS |
| 154 | Retching | FAERS: 4 | US FAERS | |
| 155 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 156 | Transaminases increased | FAERS: 4 | OFFSIDES US FAERS | |
| 157 | Tricuspid valve sclerosis | FAERS: 4 | OFFSIDES US FAERS | |
| 158 | Trisomy 21 | FAERS: 4 | OFFSIDES US FAERS | |
| 159 | Urinary tract infection | FAERS: 4 | SIDER US FAERS | |
| 160 | Accidental drug intake by child | FAERS: 3 | OFFSIDES US FAERS | |
| 161 | Activities of daily living impaired | FAERS: 3 | OFFSIDES US FAERS | |
| 162 | Alanine Aminotransferase Increased | FAERS: 3 | OFFSIDES US FAERS | |
| 163 | Ammonia increased | FAERS: 3 | US FAERS | |
| 164 | Anger | FAERS: 3 | US FAERS | |
| 165 | Angioedema | FAERS: 3 | US FAERS | |
| 166 | Anorexia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 167 | Antinuclear antibody increased | FAERS: 3 | OFFSIDES US FAERS | |
| 168 | Appendicitis | FAERS: 3 | US FAERS | |
| 169 | Arthralgia | FAERS: 3 | SIDER US FAERS | |
| 170 | Arthropod sting | FAERS: 3 | US FAERS | |
| 171 | Blood Corticotrophin Decreased | FAERS: 3 | US FAERS | |
| 172 | Blood cortisol increased | FAERS: 3 | OFFSIDES US FAERS | |
| 173 | Blood testosterone decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 174 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 175 | Bradycardia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 176 | Cardiac Hypertrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 177 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 178 | Cleft Palate | FAERS: 3 | US FAERS | |
| 179 | Cyanosis | FAERS: 3 | OFFSIDES US FAERS | |
| 180 | Dexamethasone suppression test negative | FAERS: 3 | US FAERS | |
| 181 | Diabetes Insipidus | FAERS: 3 | US FAERS | |
| 182 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 183 | Disorientation | FAERS: 3 | US FAERS | |
| 184 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 185 | Drug toxicity | FAERS: 3 | US FAERS | |
| 186 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 187 | Dysphonia | FAERS: 3 | US FAERS | |
| 188 | Dystonia | FAERS: 3 | US FAERS | |
| 189 | Echocardiogram abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 190 | Ejection Fraction Decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Expired drug administered | FAERS: 3 | US FAERS | |
| 192 | Galactostasis | FAERS: 3 | US FAERS | |
| 193 | Gambling | FAERS: 3 | 17230484 | CTD US FAERS |
| 194 | Heart valve stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 195 | Hip Dysplasia | FAERS: 3 | OFFSIDES US FAERS | |
| 196 | Holoprosencephaly | FAERS: 3 | OFFSIDES US FAERS | |
| 197 | Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 198 | Mental impairment | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Metrorrhagia | FAERS: 3 | US FAERS | |
| 200 | Middle insomnia | FAERS: 3 | US FAERS | |
| 201 | Mitral Valve Stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 202 | Myocarditis | FAERS: 3 | US FAERS | |
| 203 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 204 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 205 | Nipple pain | FAERS: 3 | US FAERS | |
| 206 | Osteoporosis | FAERS: 3 | US FAERS | |
| 207 | Paranoia | FAERS: 3 | US FAERS | |
| 208 | Pituitary enlargement | FAERS: 3 | US FAERS | |
| 209 | Pneumothorax | FAERS: 3 | US FAERS | |
| 210 | Poor quality product administered | FAERS: 3 | US FAERS | |
| 211 | Presyncope | FAERS: 3 | US FAERS | |
| 212 | Pulmonary arterial hypertension | FAERS: 3 | US FAERS | |
| 213 | Pulmonary toxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 214 | Respiratory Failure | FAERS: 3 | SIDER US FAERS | |
| 215 | Spina Bifida | FAERS: 3 | US FAERS | |
| 216 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 217 | Swelling | FAERS: 3 | US FAERS | |
| 218 | Talipes | FAERS: 3 | OFFSIDES US FAERS | |
| 219 | Thirst | FAERS: 3 | US FAERS | |
| 220 | Viral myocarditis | FAERS: 3 | OFFSIDES US FAERS | |
| 221 | nervous system disorder | FAERS: 3 | US FAERS | |
| 222 | Akinesia | FAERS: 2 | OFFSIDES US FAERS | |
| 223 | Alcohol poisoning | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 225 | Alveolitis | FAERS: 2 | US FAERS | |
| 226 | Aneurysm | FAERS: 2 | US FAERS | |
| 227 | Angiosclerosis | FAERS: 2 | US FAERS | |
| 228 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 229 | Aortic valve calcification | FAERS: 2 | OFFSIDES US FAERS | |
| 230 | Aplasia Cutis Congenita | FAERS: 2 | OFFSIDES US FAERS | |
| 231 | Ascites | FAERS: 2 | OFFSIDES US FAERS | |
| 232 | Asphyxia | FAERS: 2 | US FAERS | |
| 233 | Blepharospasm | FAERS: 2 | US FAERS | |
| 234 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 235 | Blood count abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 236 | Blood follicle stimulating hormone increased | FAERS: 2 | OFFSIDES US FAERS | |
| 237 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 238 | Blood growth hormone abnormal | FAERS: 2 | US FAERS | |
| 239 | Blood urine present | FAERS: 2 | US FAERS | |
| 240 | Breast Cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 241 | Breast hyperplasia | FAERS: 2 | US FAERS | |
| 242 | Bronchitis | FAERS: 2 | SIDER US FAERS | |
| 243 | Burning sensation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 244 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 245 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 246 | Cold sweat | FAERS: 2 | US FAERS | |
| 247 | Complication of delivery | FAERS: 2 | OFFSIDES US FAERS | |
| 248 | Dehydration | FAERS: 2 | US FAERS | |
| 249 | Dependence | FAERS: 2 | US FAERS | |
| 250 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 251 | Diplopia | FAERS: 2 | US FAERS | |
| 252 | Drowning | FAERS: 2 | OFFSIDES US FAERS | |
| 253 | Drug dose omission | FAERS: 2 | US FAERS | |
| 254 | Drug exposure before pregnancy | FAERS: 2 | OFFSIDES US FAERS | |
| 255 | Dysarthria | FAERS: 2 | US FAERS | |
| 256 | Dyspepsia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 257 | Economic problem | FAERS: 2 | US FAERS | |
| 258 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 259 | Emotional distress | FAERS: 2 | US FAERS | |
| 260 | Endometrial Hyperplasia | FAERS: 2 | US FAERS | |
| 261 | Expired product administered | FAERS: 2 | US FAERS | |
| 262 | Fibrosarcoma | FAERS: 2 | US FAERS | |
| 263 | Fracture | FAERS: 2 | US FAERS | |
| 264 | Glaucoma | FAERS: 2 | US FAERS | |
| 265 | Growth retardation | FAERS: 2 | US FAERS | |
| 266 | Hemiparesis | FAERS: 2 | US FAERS | |
| 267 | Hemiplegia | FAERS: 2 | US FAERS | |
| 268 | Hepatitis | FAERS: 2 | US FAERS | |
| 269 | Hernia | FAERS: 2 | OFFSIDES US FAERS | |
| 270 | Hyperventilation | FAERS: 2 | US FAERS | |
| 271 | Hypokinesia | FAERS: 2 | SIDER US FAERS | |
| 272 | Hypospadias | FAERS: 2 | OFFSIDES US FAERS | |
| 273 | Hypoxia | FAERS: 2 | US FAERS | |
| 274 | Ileus | FAERS: 2 | US FAERS | |
| 275 | Impaired work ability | FAERS: 2 | US FAERS | |
| 276 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 277 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 278 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 279 | Laceration | FAERS: 2 | US FAERS | |
| 280 | Lip swelling | FAERS: 2 | US FAERS | |
| 281 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 282 | Lymphocyte stimulation test positive | FAERS: 2 | OFFSIDES US FAERS | |
| 283 | Mental status changes | FAERS: 2 | US FAERS | |
| 284 | Microcephaly | FAERS: 2 | US FAERS | |
| 285 | Mood swings | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 286 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 287 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 288 | Myopia | FAERS: 2 | US FAERS | |
| 289 | Neonatal respiratory failure | FAERS: 2 | OFFSIDES US FAERS | |
| 290 | Nervousness | FAERS: 2 | SIDER US FAERS | |
| 291 | Neutropenia | FAERS: 2 | US FAERS | |
| 292 | Pancreatic Insufficiency | FAERS: 2 | OFFSIDES US FAERS | |
| 293 | Paramnesia | FAERS: 2 | US FAERS | |
| 294 | Paranoid Personality Disorder | FAERS: 2 | US FAERS | |
| 295 | Pemphigus | FAERS: 2 | US FAERS | |
| 296 | Poisoning | FAERS: 2 | US FAERS | |
| 297 | Pregnancy test false positive | FAERS: 2 | OFFSIDES US FAERS | |
| 298 | Product coating issue | FAERS: 2 | US FAERS | |
| 299 | Product storage error | FAERS: 2 | US FAERS | |
| 300 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 301 | Pulmonary arterial pressure increased | FAERS: 2 | OFFSIDES US FAERS | |
| 302 | Purpura | FAERS: 2 | US FAERS | |
| 303 | Rebound effect | FAERS: 2 | US FAERS | |
| 304 | Sexual activity increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Shunt occlusion | FAERS: 2 | OFFSIDES US FAERS | |
| 306 | Sopor | FAERS: 2 | OFFSIDES US FAERS | |
| 307 | Stillbirth | FAERS: 2 | US FAERS | |
| 308 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 309 | Sudden onset of sleep | FAERS: 2 | SIDER US FAERS | |
| 310 | Syndactyly | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Thrombosis | FAERS: 2 | US FAERS | |
| 312 | Torticollis | FAERS: 2 | US FAERS | |
| 313 | Umbilical hernia | FAERS: 2 | OFFSIDES US FAERS | |
| 314 | Unevaluable event | FAERS: 2 | US FAERS | |
| 315 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 316 | Urinary Retention | FAERS: 2 | US FAERS | |
| 317 | Vasculitis | FAERS: 2 | US FAERS | |
| 318 | Vasospasm | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 319 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 320 | Visual disturbance | FAERS: 2 | US FAERS | |
| 321 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 322 | Abasia | FAERS: 1 | US FAERS | |
| 323 | Abdominal mass | FAERS: 1 | US FAERS | |
| 324 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 325 | Accidental exposure | FAERS: 1 | US FAERS | |
| 326 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 327 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 328 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 329 | Adverse event | FAERS: 1 | US FAERS | |
| 330 | Ageusia | FAERS: 1 | US FAERS | |
| 331 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 332 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 333 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 334 | Anencephaly | FAERS: 1 | US FAERS | |
| 335 | Anisocytosis | FAERS: 1 | US FAERS | |
| 336 | Anorgasmia | FAERS: 1 | US FAERS | |
| 337 | Anosmia | FAERS: 1 | US FAERS | |
| 338 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 339 | Aortic Valve Prolapse | FAERS: 1 | US FAERS | |
| 340 | Aphasia | FAERS: 1 | US FAERS | |
| 341 | Apparent death | FAERS: 1 | US FAERS | |
| 342 | Arthritis | FAERS: 1 | 18172015 | CTD OFFSIDES US FAERS |
| 343 | Arthropathy | FAERS: 1 | SIDER US FAERS | |
| 344 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 345 | Aspiration pleural cavity abnormal | FAERS: 1 | US FAERS | |
| 346 | Ataxia | FAERS: 1 | US FAERS | |
| 347 | Atelectasis | FAERS: 1 | US FAERS | |
| 348 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 349 | Automatism | FAERS: 1 | US FAERS | |
| 350 | Bankruptcy | FAERS: 1 | US FAERS | |
| 351 | Blighted ovum | FAERS: 1 | US FAERS | |
| 352 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 353 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 354 | Blood creatine phosphokinase abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 355 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 356 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 357 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 358 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 359 | Bone erosion | FAERS: 1 | US FAERS | |
| 360 | Bone pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 361 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 362 | Bronchospasm | FAERS: 1 | US FAERS | |
| 363 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 364 | Bursitis | FAERS: 1 | US FAERS | |
| 365 | Candidiasis | FAERS: 1 | US FAERS | |
| 366 | Carotid bruit | FAERS: 1 | US FAERS | |
| 367 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 368 | Choking | FAERS: 1 | US FAERS | |
| 369 | Cholangitis | FAERS: 1 | US FAERS | |
| 370 | Chorea | FAERS: 1 | US FAERS | |
| 371 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 372 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 373 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 374 | Congenital absence of vertebra | FAERS: 1 | US FAERS | |
| 375 | Congenital cerebellar agenesis | FAERS: 1 | US FAERS | |
| 376 | Cyst | FAERS: 1 | US FAERS | |
| 377 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 378 | Demyelination | FAERS: 1 | US FAERS | |
| 379 | Dopamine dysregulation syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 380 | Drooling | FAERS: 1 | US FAERS | |
| 381 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 382 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 383 | Dysgeusia | FAERS: 1 | US FAERS | |
| 384 | Dyslalia | FAERS: 1 | US FAERS | |
| 385 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 386 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 387 | Encephalocele | FAERS: 1 | US FAERS | |
| 388 | Enchondroma | FAERS: 1 | US FAERS | |
| 389 | Endocardial disease | FAERS: 1 | OFFSIDES US FAERS | |
| 390 | Endocarditis | FAERS: 1 | OFFSIDES US FAERS | |
| 391 | Endometriosis | FAERS: 1 | OFFSIDES US FAERS | |
| 392 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 393 | Ependymoma | FAERS: 1 | US FAERS | |
| 394 | Epistaxis | FAERS: 1 | SIDER US FAERS | |
| 395 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 396 | Exhibitionism | FAERS: 1 | US FAERS | |
| 397 | Eye pain | FAERS: 1 | US FAERS | |
| 398 | Facial Pain | FAERS: 1 | US FAERS | |
| 399 | False positive investigation result | FAERS: 1 | US FAERS | |
| 400 | Feeling Cold | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Finger hypoplasia | FAERS: 1 | US FAERS | |
| 402 | Flatulence | FAERS: 1 | SIDER US FAERS | |
| 403 | Flight of ideas | FAERS: 1 | US FAERS | |
| 404 | Flushing | FAERS: 1 | US FAERS | |
| 405 | Forceps delivery | FAERS: 1 | US FAERS | |
| 406 | Formication | FAERS: 1 | US FAERS | |
| 407 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 408 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 409 | Gaze palsy | FAERS: 1 | US FAERS | |
| 410 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 411 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 412 | Genital pain | FAERS: 1 | US FAERS | |
| 413 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 414 | Head deformity | FAERS: 1 | US FAERS | |
| 415 | Head discomfort | FAERS: 1 | US FAERS | |
| 416 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 417 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 418 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 419 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 420 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 421 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 422 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 423 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 424 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 425 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 426 | Inflammation | FAERS: 1 | US FAERS | |
| 427 | Influenza | FAERS: 1 | SIDER US FAERS | |
| 428 | Insulin-like growth factor decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 429 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 430 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 431 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 432 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 433 | Jealous delusion | FAERS: 1 | US FAERS | |
| 434 | Joint injury | FAERS: 1 | US FAERS | |
| 435 | Joint swelling | FAERS: 1 | US FAERS | |
| 436 | Keratitis | FAERS: 1 | US FAERS | |
| 437 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 438 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 439 | Lethargy | FAERS: 1 | OFFSIDES US FAERS | |
| 440 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 441 | Libido disorder | FAERS: 1 | US FAERS | |
| 442 | Ligament rupture | FAERS: 1 | US FAERS | |
| 443 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 444 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 445 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 446 | Menopause | FAERS: 1 | US FAERS | |
| 447 | Mental Retardation | FAERS: 1 | US FAERS | |
| 448 | Mitral valve disease mixed | FAERS: 1 | US FAERS | |
| 449 | Mixed Connective Tissue Disease | FAERS: 1 | US FAERS | |
| 450 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 451 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 452 | Narcolepsy | FAERS: 1 | US FAERS | |
| 453 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 454 | Necrosis | FAERS: 1 | US FAERS | |
| 455 | Negative thoughts | FAERS: 1 | US FAERS | |
| 456 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 457 | Nerve injury | FAERS: 1 | US FAERS | |
| 458 | Obstruction | FAERS: 1 | US FAERS | |
| 459 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 460 | Oligohydramnios | FAERS: 1 | OFFSIDES US FAERS | |
| 461 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 462 | Orchitis noninfective | FAERS: 1 | US FAERS | |
| 463 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 464 | Osteopenia | FAERS: 1 | US FAERS | |
| 465 | Ovarian adenoma | FAERS: 1 | US FAERS | |
| 466 | Pachygyria | FAERS: 1 | US FAERS | |
| 467 | Pallor | FAERS: 1 | US FAERS | |
| 468 | Panic Disorder | FAERS: 1 | US FAERS | |
| 469 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 470 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 471 | Paraparesis | FAERS: 1 | US FAERS | |
| 472 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 473 | Pharyngitis | FAERS: 1 | US FAERS | |
| 474 | Pituitary Apoplexy | FAERS: 1 | US FAERS | |
| 475 | Pleural Mesothelioma | FAERS: 1 | US FAERS | |
| 476 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 477 | Polydipsia | FAERS: 1 | US FAERS | |
| 478 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 479 | Poriomania | FAERS: 1 | OFFSIDES US FAERS | |
| 480 | Post procedural complication | FAERS: 1 | US FAERS | |
| 481 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 482 | Premature Menopause | FAERS: 1 | US FAERS | |
| 483 | Product administration error | FAERS: 1 | US FAERS | |
| 484 | Product counterfeit | FAERS: 1 | US FAERS | |
| 485 | Product dispensing error | FAERS: 1 | US FAERS | |
| 486 | Product label issue | FAERS: 1 | US FAERS | |
| 487 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 488 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 489 | Productive Cough | FAERS: 1 | OFFSIDES US FAERS | |
| 490 | Prostatectomy | FAERS: 1 | US FAERS | |
| 491 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 492 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 493 | Psychotic symptom | FAERS: 1 | US FAERS | |
| 494 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 495 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 496 | Radiation injury | FAERS: 1 | US FAERS | |
| 497 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 498 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 499 | Renal pain | FAERS: 1 | US FAERS | |
| 500 | Respiratory distress | FAERS: 1 | US FAERS | |
| 501 | Restlessness | FAERS: 1 | US FAERS | |
| 502 | SUNCT Syndrome | FAERS: 1 | US FAERS | |
| 503 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 504 | Schizophrenia | FAERS: 1 | US FAERS | |
| 505 | Scleritis | FAERS: 1 | US FAERS | |
| 506 | Scleroderma | FAERS: 1 | US FAERS | |
| 507 | Scotoma | FAERS: 1 | OFFSIDES US FAERS | |
| 508 | Secondary hypothyroidism | FAERS: 1 | US FAERS | |
| 509 | Secretory adenoma of pituitary | FAERS: 1 | US FAERS | |
| 510 | Sepsis | FAERS: 1 | US FAERS | |
| 511 | Serositis | FAERS: 1 | OFFSIDES US FAERS | |
| 512 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 513 | Sexual abuse | FAERS: 1 | US FAERS | |
| 514 | Shoplifting | FAERS: 1 | US FAERS | |
| 515 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 516 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 517 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 518 | Skin necrosis | FAERS: 1 | US FAERS | |
| 519 | Staring | FAERS: 1 | US FAERS | |
| 520 | Substance Dependence | FAERS: 1 | US FAERS | |
| 521 | Sudden death | FAERS: 1 | US FAERS | |
| 522 | Suicide attempt | FAERS: 1 | US FAERS | |
| 523 | Suppressed lactation | FAERS: 1 | OFFSIDES US FAERS | |
| 524 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 525 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 526 | Therapy non-responder | FAERS: 1 | OFFSIDES US FAERS | |
| 527 | Thirst decreased | FAERS: 1 | US FAERS | |
| 528 | Thought insertion | FAERS: 1 | US FAERS | |
| 529 | Thrombophlebitis | FAERS: 1 | OFFSIDES US FAERS | |
| 530 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 531 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 532 | Transferrin | FAERS: 1 | US FAERS | |
| 533 | Transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 534 | Tuberculosis | FAERS: 1 | US FAERS | |
| 535 | Ulcer | FAERS: 1 | US FAERS | |
| 536 | Ultrasound Doppler abnormal | FAERS: 1 | US FAERS | |
| 537 | Ultrasound antenatal screen | FAERS: 1 | US FAERS | |
| 538 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 539 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 540 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 541 | Venous stasis | FAERS: 1 | US FAERS | |
| 542 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 543 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 544 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 545 | White matter lesion | FAERS: 1 | US FAERS | |
| 546 | colonoscopy | FAERS: 1 | US FAERS | |
| 547 | Abnormal vision | SIDER | ||
| 548 | Abuse | OFFSIDES | ||
| 549 | Acne | SIDER | ||
| 550 | Acquired Protein S Deficiency | OFFSIDES | ||
| 551 | Adenoma | OFFSIDES | ||
| 552 | Adjustment disorder with depressed mood | OFFSIDES | ||
| 553 | Amenorrhea | OFFSIDES | ||
| 554 | Anti-HBc antibody | OFFSIDES | ||
| 555 | Aortic Valve Insufficiency | 17202454 17307289 18398916 | CTD | |
| 556 | Aphagia | OFFSIDES | ||
| 557 | Arthropod bite | OFFSIDES | ||
| 558 | Aspiration Pneumonia | OFFSIDES | ||
| 559 | Atrial Flutter | OFFSIDES | ||
| 560 | Avascular necrosis | OFFSIDES | ||
| 561 | BREAST PAIN FEMALE | SIDER | ||
| 562 | Basal cell carcinoma | OFFSIDES | ||
| 563 | Bilirubinuria | OFFSIDES | ||
| 564 | Bladder prolapse | OFFSIDES | ||
| 565 | Blepharoptosis | OFFSIDES | ||
| 566 | Blood chloride decreased | OFFSIDES | ||
| 567 | Blood corticotrophin | OFFSIDES | ||
| 568 | Blood creatinine increased | SIDER | ||
| 569 | Blood follicle stimulating hormone decreased | OFFSIDES | ||
| 570 | Blood glucose decreased | OFFSIDES | ||
| 571 | Blood lactate dehydrogenase decreased | OFFSIDES | ||
| 572 | Blood lactate dehydrogenase increased | OFFSIDES | ||
| 573 | Blood urea increased | OFFSIDES | ||
| 574 | Bone density decreased | OFFSIDES | ||
| 575 | Bone lesion | OFFSIDES | ||
| 576 | Cardiac procedure complication | OFFSIDES | ||
| 577 | Cataplexy | OFFSIDES | ||
| 578 | Chills | Canada Vigilance: 1 | Canada Vigilance | |
| 579 | Choking sensation | OFFSIDES | ||
| 580 | Cholestasis of pregnancy | OFFSIDES | ||
| 581 | Chronic left ventricular failure | OFFSIDES | ||
| 582 | Chronic ulcerative colitis | OFFSIDES | ||
| 583 | Cirrhosis | OFFSIDES | ||
| 584 | Coagulation factor VII level increased | OFFSIDES | ||
| 585 | Coagulation factor VIII level increased | OFFSIDES | ||
| 586 | Cocaine-Related Disorders | 15730352 15730354 15773068 | CTD | |
| 587 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 588 | Cramps of lower extremities | SIDER | ||
| 589 | Cryptorchidism | OFFSIDES | ||
| 590 | Dental prosthesis user | OFFSIDES | ||
| 591 | Depression suicidal | OFFSIDES | ||
| 592 | Dermatitis | SIDER | ||
| 593 | Discomfort | SIDER | ||
| 594 | Disorders of Excessive Somnolence | 11261748 | CTD | |
| 595 | Disturbance in sexual arousal | SIDER | ||
| 596 | Drug Tolerance | OFFSIDES | ||
| 597 | Drug level below therapeutic | OFFSIDES | ||
| 598 | Drug withdrawal headache | OFFSIDES | ||
| 599 | Dry skin | OFFSIDES | ||
| 600 | Duodenal Ulcer | SIDER | ||
| 601 | Dyscalculia | OFFSIDES | ||
| 602 | Dyskinesia, Drug-Induced | CTD | ||
| 603 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 604 | Endodontic procedure | OFFSIDES | ||
| 605 | Endometrial hypertrophy | OFFSIDES | ||
| 606 | Enteritis necroticans | OFFSIDES | ||
| 607 | Eosinophil percentage increased | OFFSIDES | ||
| 608 | Eosinophilic myocarditis | OFFSIDES | ||
| 609 | Epicondylitis | OFFSIDES | ||
| 610 | Epigastric pain | SIDER | ||
| 611 | Erosive gastritis | OFFSIDES | ||
| 612 | Erythema Nodosum | 18172015 | CTD | |
| 613 | Euphoric mood | SIDER | ||
| 614 | Excessive daytime sleepiness | SIDER | ||
| 615 | Exophthalmos | OFFSIDES | ||
| 616 | Fasting | Canada Vigilance: 1 | Canada Vigilance | |
| 617 | Galactorrhea | OFFSIDES | ||
| 618 | Gastric ulcer helicobacter | OFFSIDES | ||
| 619 | Gastrointestinal Pain | SIDER | ||
| 620 | Glioblastoma Multiforme | OFFSIDES | ||
| 621 | Heart failure | 17926907 | CTD | |
| 622 | Heart valve calcification | OFFSIDES | ||
| 623 | Hemothorax | OFFSIDES | ||
| 624 | Hepaplastin abnormal | OFFSIDES | ||
| 625 | Hepatic congestion | OFFSIDES | ||
| 626 | Hepatitis B antibody positive | OFFSIDES | ||
| 627 | Hepatosplenomegaly | OFFSIDES | ||
| 628 | Hirsutism | Canada Vigilance: 1 | Canada Vigilance | |
| 629 | Histology | OFFSIDES | ||
| 630 | Hyperkinetic Heart Syndrome | OFFSIDES | ||
| 631 | Hyperprolactinemia | CTD | ||
| 632 | Hypertransaminasaemia | OFFSIDES | ||
| 633 | Hypogonadism | 11194712 | CTD OFFSIDES | |
| 634 | Hypomenorrhea | OFFSIDES | ||
| 635 | Hypopituitarism | OFFSIDES | ||
| 636 | Hyporeflexia | OFFSIDES | ||
| 637 | Hypotension symptomatic | SIDER | ||
| 638 | Hypotensive | SIDER | ||
| 639 | Induration | OFFSIDES | ||
| 640 | Infantile apnoeic attack | OFFSIDES | ||
| 641 | Influenza-like symptoms | SIDER | ||
| 642 | Injection site dermatitis | OFFSIDES | ||
| 643 | Insulin Resistance | OFFSIDES | ||
| 644 | Intubation | OFFSIDES | ||
| 645 | Leg edema | SIDER | ||
| 646 | Lightheadedness | SIDER | ||
| 647 | Lipodystrophy acquired | OFFSIDES | ||
| 648 | Loose tooth | OFFSIDES | ||
| 649 | Lymphocyte count decreased | OFFSIDES | ||
| 650 | Lysosomal Storage Diseases | 28551711 | CTD | |
| 651 | Megacolon | OFFSIDES | ||
| 652 | Meningioma surgery | OFFSIDES | ||
| 653 | Metastases to reproductive organ | OFFSIDES | ||
| 654 | Mitral Valve Insufficiency | CTD | ||
| 655 | Musculoskeletal Pain | SIDER | ||
| 656 | Musculoskeletal discomfort | OFFSIDES SIDER | ||
| 657 | Myoglobin blood increased | OFFSIDES | ||
| 658 | Neurotransmitter level altered | OFFSIDES | ||
| 659 | Nuchal Rigidity | OFFSIDES | ||
| 660 | Oliguria | OFFSIDES | ||
| 661 | Oral administration complication | OFFSIDES | ||
| 662 | Orthostatic intolerance | OFFSIDES | ||
| 663 | Osteomyelitis | OFFSIDES | ||
| 664 | Osteosclerosis | OFFSIDES | ||
| 665 | PCO2 decreased | OFFSIDES | ||
| 666 | PO2 decreased | OFFSIDES | ||
| 667 | Panniculitis | 18172015 | CTD | |
| 668 | Parkinson Disease | CTD | ||
| 669 | Parkinsonian Disorders | 9930741 | CTD | |
| 670 | Parkinsonian rest tremor | OFFSIDES | ||
| 671 | Paroxysmal Hemicrania | 16686914 | CTD | |
| 672 | Periarthritis | OFFSIDES | ||
| 673 | Peritoneal Dialysis | OFFSIDES | ||
| 674 | Pituitary Neoplasms | 2570719 | CTD | |
| 675 | Pleuropericarditis | OFFSIDES | ||
| 676 | Polyhydramnios | OFFSIDES | ||
| 677 | Polyneuropathy | OFFSIDES | ||
| 678 | Polysubstance dependence | OFFSIDES | ||
| 679 | Portal Vein Thrombosis | OFFSIDES | ||
| 680 | Psychotic Disorders | 18585544 | CTD | |
| 681 | Pulmonary artery thrombosis | OFFSIDES | ||
| 682 | Pupillary light reflex tests abnormal | OFFSIDES | ||
| 683 | Purulence | OFFSIDES | ||
| 684 | Pyelectasia | OFFSIDES | ||
| 685 | Rales | OFFSIDES | ||
| 686 | Regurgitation | SIDER | ||
| 687 | Renal Colic | OFFSIDES | ||
| 688 | Renal cyst | OFFSIDES | ||
| 689 | Restrictive pulmonary disease | OFFSIDES | ||
| 690 | Retrocollis | OFFSIDES | ||
| 691 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 692 | Rhinalgia | OFFSIDES | ||
| 693 | Rhinitis | SIDER | ||
| 694 | Rhinorrhea | OFFSIDES | ||
| 695 | Screaming | OFFSIDES | ||
| 696 | Shock | SIDER | ||
| 697 | Sick Sinus Syndrome | OFFSIDES | ||
| 698 | Sinus bradycardia | OFFSIDES | ||
| 699 | Skin neoplasm excision | OFFSIDES | ||
| 700 | Spontaneous penile erection | OFFSIDES | ||
| 701 | Substance Withdrawal Syndrome | 19336508 | CTD | |
| 702 | Sympathicotonia | OFFSIDES | ||
| 703 | Tension | SIDER | ||
| 704 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 705 | Therapeutic response changed | Canada Vigilance: 1 | Canada Vigilance | |
| 706 | Throat irritation | SIDER | ||
| 707 | Tooth Extraction | OFFSIDES | ||
| 708 | Tooth Infection | OFFSIDES | ||
| 709 | Toothache | SIDER | ||
| 710 | Tricuspid Valve Insufficiency | 17307289 | CTD | |
| 711 | Troponin T | OFFSIDES | ||
| 712 | Upset stomach | SIDER | ||
| 713 | Urine output increased | OFFSIDES | ||
| 714 | Uterine Cancer | OFFSIDES | ||
| 715 | Von Willebrand's factor multimers abnormal | OFFSIDES | ||
| 716 | Vulvovaginal mycotic infection | Canada Vigilance: 1 | Canada Vigilance | |
| 717 | Wound Complication | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.