Tiotropium Bromide
(DQHNAVOVODVIMG-RGECMCKFSA-M)
Structure
- SMILES
- O=C(C(c1cccs1)(c1cccs1)O)OC1C[C@@H]2[C@@H]3[C@H]([C@H](C1)[N+]2(C)C)O3.[Br-]
- Molecular Formula:
- C19H22BrNO4S2
- Molecular Weight:
- 472.416
- Log P:
- -0.6915
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 115.54
- CAS Number(s):
- 136310-93-5; 139404-48-1
Synonym(s)
1.
Tiotropium Bromide
2.
7-((hydroxybis(2-thienyl)acetyl)oxy)-9,9-dimethyl-3-oxa-9-azoniatricyclo(3.3.1.0(2,4))nonane bromide
3.
BA 679 BR
4.
BA-679 BR
5.
Spiriva
6.
Tiotropium
7.
679 BR, BA
8.
BA679 BR
9.
BR, BA 679
10.
Bromide, Tiotropium
External Link(s)
| MeSH | D000069447 |
| PubChem Compound | 5487426 |
| ChEBI | 90959 |
| CHEMBL | CHEMBL3189058 |
| Therapeutic Target Database | D0Z7AB |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Incorrect route of drug administration | FAERS: 22154 | US FAERS | |
| 2 | Drug ineffective | FAERS: 2707 Canada Vigilance: 234 | Canada Vigilance US FAERS | |
| 3 | Product quality issue | FAERS: 2462 Canada Vigilance: 38 | Canada Vigilance US FAERS | |
| 4 | Pneumonia | FAERS: 725 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Malaise | FAERS: 419 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 6 | Product physical issue | FAERS: 351 Canada Vigilance: 35 | Canada Vigilance US FAERS | |
| 7 | Dysphonia | FAERS: 348 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Overdose | FAERS: 310 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Dizziness | FAERS: 298 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 10 | Incorrect route of product administration | FAERS: 294 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 11 | Incorrect dose administered | FAERS: 267 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Urinary Retention | FAERS: 266 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 13 | Headache | FAERS: 262 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Chest discomfort | FAERS: 245 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 15 | Fatigue | FAERS: 233 | US FAERS | |
| 16 | Asthenia | FAERS: 224 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Bronchitis | FAERS: 222 | US FAERS | |
| 18 | Oropharyngeal pain | FAERS: 221 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Myocardial Infarction | FAERS: 219 Canada Vigilance: 2 | 18035867 | CTD Canada Vigilance US FAERS |
| 20 | Medication Error | FAERS: 217 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Constipation | FAERS: 205 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 22 | Wheezing | FAERS: 205 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 23 | Chest Pain | FAERS: 203 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Nasopharyngitis | FAERS: 202 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Cataract | FAERS: 201 | US FAERS | |
| 26 | Cerebrovascular accident | FAERS: 190 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Extra dose administered | FAERS: 189 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Visual Impairment | FAERS: 188 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Throat irritation | FAERS: 180 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 30 | Nausea | FAERS: 168 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 31 | Dysuria | FAERS: 164 | US FAERS | |
| 32 | Unevaluable event | FAERS: 160 | US FAERS | |
| 33 | Asthma | FAERS: 146 | US FAERS | |
| 34 | Eye pain | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Dysgeusia | FAERS: 137 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Tremor | FAERS: 137 | US FAERS | |
| 37 | Feeling abnormal | FAERS: 136 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Productive Cough | FAERS: 133 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 39 | Anxiety | FAERS: 128 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 40 | Urinary tract infection | FAERS: 120 | US FAERS | |
| 41 | Influenza | FAERS: 119 | US FAERS | |
| 42 | Memory impairment | FAERS: 118 | US FAERS | |
| 43 | Vomiting | FAERS: 117 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Ageusia | FAERS: 116 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Macular degeneration | FAERS: 112 | US FAERS | |
| 46 | Choking | FAERS: 111 | US FAERS | |
| 47 | Pruritus | FAERS: 111 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Sinusitis | FAERS: 110 | US FAERS | |
| 49 | Inappropriate schedule of drug administration | FAERS: 106 | US FAERS | |
| 50 | Aphonia | FAERS: 103 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Back Pain | FAERS: 100 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Arthritis | FAERS: 99 | US FAERS | |
| 53 | Pain | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Hypersensitivity | FAERS: 96 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Glaucoma | FAERS: 95 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 56 | Atrial Fibrillation | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Urticaria | FAERS: 92 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 58 | Nervousness | FAERS: 91 | US FAERS | |
| 59 | Accidental exposure to product | FAERS: 89 | US FAERS | |
| 60 | Respiratory Failure | FAERS: 89 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 61 | Increased upper airway secretion | FAERS: 86 | US FAERS | |
| 62 | Accidental overdose | FAERS: 81 | US FAERS | |
| 63 | Arthralgia | FAERS: 78 | US FAERS | |
| 64 | Palpitations | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Tachycardia | FAERS: 76 | 19281075 | CTD US FAERS |
| 66 | Pulmonary congestion | FAERS: 70 | US FAERS | |
| 67 | Epistaxis | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Pharyngolaryngeal Pain | FAERS: 66 | US FAERS | |
| 69 | Oral pain | FAERS: 65 | US FAERS | |
| 70 | Stomatitis | FAERS: 65 | US FAERS | |
| 71 | Abdominal discomfort | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Amnesia | FAERS: 63 | US FAERS | |
| 73 | Dementia | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Blindness | FAERS: 60 | US FAERS | |
| 75 | Weight decreased | FAERS: 59 | US FAERS | |
| 76 | Laryngitis | FAERS: 57 | US FAERS | |
| 77 | Pharmaceutical product complaint | FAERS: 57 | US FAERS | |
| 78 | Peripheral swelling | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Dehydration | FAERS: 49 | US FAERS | |
| 80 | Drug effect incomplete | FAERS: 47 | US FAERS | |
| 81 | Alopecia | FAERS: 46 | US FAERS | |
| 82 | Cardiac Arrest | FAERS: 46 | US FAERS | |
| 83 | Intentional product use issue | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Wrong technique in drug usage process | FAERS: 46 | US FAERS | |
| 85 | Dyspepsia | FAERS: 45 | US FAERS | |
| 86 | Feeling jittery | FAERS: 45 | US FAERS | |
| 87 | Deafness | FAERS: 44 | US FAERS | |
| 88 | Drug administration error | FAERS: 44 | US FAERS | |
| 89 | Eye irritation | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Pneumothorax | FAERS: 43 | US FAERS | |
| 91 | Benign Prostatic Hyperplasia | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Myalgia | FAERS: 41 | US FAERS | |
| 93 | Sepsis | FAERS: 41 | US FAERS | |
| 94 | Intestinal Obstruction | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Retching | FAERS: 40 | US FAERS | |
| 96 | Disability | FAERS: 39 | US FAERS | |
| 97 | General physical health deterioration | FAERS: 39 | US FAERS | |
| 98 | Cystitis | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 99 | Erythema | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Joint swelling | FAERS: 36 | US FAERS | |
| 101 | Secretion discharge | FAERS: 36 | US FAERS | |
| 102 | Abdominal Pain | FAERS: 35 | US FAERS | |
| 103 | Adverse event | FAERS: 35 | US FAERS | |
| 104 | Device malfunction | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 105 | Dyspnoea exacerbated | FAERS: 35 | US FAERS | |
| 106 | Hypotension | FAERS: 35 | 26026369 | CTD US FAERS |
| 107 | Infection | FAERS: 35 | US FAERS | |
| 108 | Lip swelling | FAERS: 34 | US FAERS | |
| 109 | Thrombosis | FAERS: 34 | US FAERS | |
| 110 | Bronchospasm | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 111 | No adverse event | FAERS: 33 | US FAERS | |
| 112 | Skin laceration | FAERS: 33 | US FAERS | |
| 113 | Blood glucose increased | FAERS: 32 | US FAERS | |
| 114 | Pulmonary Embolism | FAERS: 32 | US FAERS | |
| 115 | Somnolence | FAERS: 32 | US FAERS | |
| 116 | Candidiasis | FAERS: 31 | US FAERS | |
| 117 | Accidental exposure | FAERS: 30 | US FAERS | |
| 118 | Aortic Aneurysm | FAERS: 30 | US FAERS | |
| 119 | Burning sensation | FAERS: 30 | US FAERS | |
| 120 | Lower respiratory tract infection | FAERS: 30 | US FAERS | |
| 121 | Oral candidiasis | FAERS: 30 | US FAERS | |
| 122 | Syncope | FAERS: 29 | US FAERS | |
| 123 | Diabetes Mellitus | FAERS: 28 | US FAERS | |
| 124 | Swelling | FAERS: 27 | US FAERS | |
| 125 | Musculoskeletal Pain | FAERS: 26 | US FAERS | |
| 126 | Respiratory arrest | FAERS: 26 | US FAERS | |
| 127 | Urinary Incontinence | FAERS: 26 | US FAERS | |
| 128 | Laceration | FAERS: 25 | US FAERS | |
| 129 | Ankle Fracture | FAERS: 24 | US FAERS | |
| 130 | Chills | FAERS: 24 | US FAERS | |
| 131 | Diplopia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Hernia | FAERS: 24 | US FAERS | |
| 133 | Stress | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Drug prescribing error | FAERS: 23 | US FAERS | |
| 135 | Limb injury | FAERS: 23 | US FAERS | |
| 136 | Respiratory distress | FAERS: 23 | US FAERS | |
| 137 | Visual disturbance | FAERS: 23 | US FAERS | |
| 138 | Agitation | FAERS: 22 | US FAERS | |
| 139 | Capsule physical issue | FAERS: 22 | US FAERS | |
| 140 | Dental caries | FAERS: 22 | US FAERS | |
| 141 | Hypoxia | FAERS: 22 | US FAERS | |
| 142 | Lymphoma | FAERS: 22 | US FAERS | |
| 143 | Sudden death | FAERS: 22 | US FAERS | |
| 144 | Therapeutic response unexpected | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 145 | Tinnitus | FAERS: 22 | US FAERS | |
| 146 | Dry skin | FAERS: 21 | US FAERS | |
| 147 | Sneezing | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Angioedema | FAERS: 20 | US FAERS | |
| 149 | Discomfort | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Frustration tolerance decreased | FAERS: 20 | US FAERS | |
| 151 | Product use issue | FAERS: 20 | US FAERS | |
| 152 | Acute respiratory failure | FAERS: 19 | US FAERS | |
| 153 | Flatulence | FAERS: 19 | US FAERS | |
| 154 | Foreign body aspiration | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 155 | Neck Pain | FAERS: 19 | US FAERS | |
| 156 | Osteoporosis | FAERS: 19 | US FAERS | |
| 157 | Pharyngitis | FAERS: 19 | US FAERS | |
| 158 | Product taste abnormal | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Urine flow decreased | FAERS: 19 | US FAERS | |
| 160 | Arthropathy | FAERS: 18 | US FAERS | |
| 161 | Coronary Artery Disease | FAERS: 18 | US FAERS | |
| 162 | Nephrolithiasis | FAERS: 18 | US FAERS | |
| 163 | Prescribed overdose | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Product packaging issue | FAERS: 18 | US FAERS | |
| 165 | Blood cholesterol increased | FAERS: 17 | US FAERS | |
| 166 | Product use in unapproved indication | FAERS: 17 | US FAERS | |
| 167 | Pulmonary thrombosis | FAERS: 17 | US FAERS | |
| 168 | Blood urine present | FAERS: 16 | US FAERS | |
| 169 | Cellulitis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Depressed mood | FAERS: 16 | US FAERS | |
| 171 | Disorientation | FAERS: 16 | US FAERS | |
| 172 | Glossitis | FAERS: 16 | US FAERS | |
| 173 | Oxygen saturation abnormal | FAERS: 16 | US FAERS | |
| 174 | Pulmonary function test decreased | FAERS: 16 | US FAERS | |
| 175 | Respiratory tract congestion | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Throat cancer | FAERS: 16 | US FAERS | |
| 177 | Viral upper respiratory tract infection | FAERS: 16 | US FAERS | |
| 178 | Carpal Tunnel Syndrome | FAERS: 15 | US FAERS | |
| 179 | Drug dispensing error | FAERS: 15 | US FAERS | |
| 180 | Eructation | FAERS: 15 | US FAERS | |
| 181 | Feeling Cold | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 182 | Musculoskeletal discomfort | FAERS: 15 | US FAERS | |
| 183 | Musculoskeletal stiffness | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Pancreatitis | FAERS: 15 | US FAERS | |
| 185 | Urinary tract obstruction | FAERS: 15 | US FAERS | |
| 186 | Angle Closure Glaucoma | FAERS: 14 | US FAERS | |
| 187 | Apparent death | FAERS: 14 | US FAERS | |
| 188 | Atrioventricular Block | FAERS: 14 | US FAERS | |
| 189 | Back disorder | FAERS: 14 | US FAERS | |
| 190 | Cheilitis | FAERS: 14 | US FAERS | |
| 191 | Choking sensation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Pulmonary Hypertension | FAERS: 14 | US FAERS | |
| 193 | Retinal Detachment | FAERS: 14 | US FAERS | |
| 194 | Tooth Loss | FAERS: 14 | US FAERS | |
| 195 | Vertigo | FAERS: 14 | US FAERS | |
| 196 | Abasia | FAERS: 13 | US FAERS | |
| 197 | Carotid artery occlusion | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Ear discomfort | FAERS: 13 | US FAERS | |
| 199 | Fracture | FAERS: 13 | US FAERS | |
| 200 | Joint injury | FAERS: 13 | US FAERS | |
| 201 | Product packaging quantity issue | FAERS: 13 | US FAERS | |
| 202 | Rheumatoid Arthritis | FAERS: 13 | US FAERS | |
| 203 | Wrong technique in product usage process | FAERS: 13 | US FAERS | |
| 204 | Activities of daily living impaired | FAERS: 12 | US FAERS | |
| 205 | Bone pain | FAERS: 12 | US FAERS | |
| 206 | Flushing | FAERS: 12 | US FAERS | |
| 207 | Lymphadenopathy | FAERS: 12 | US FAERS | |
| 208 | Nasal discomfort | FAERS: 12 | US FAERS | |
| 209 | Nocturia | FAERS: 12 | US FAERS | |
| 210 | Pancreatic carcinoma | FAERS: 12 | US FAERS | |
| 211 | Blood potassium decreased | FAERS: 11 | US FAERS | |
| 212 | Blood potassium increased | FAERS: 11 | US FAERS | |
| 213 | Cholelithiasis | FAERS: 11 | US FAERS | |
| 214 | Fibromyalgia | FAERS: 11 | US FAERS | |
| 215 | Foreign body in respiratory tract | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 216 | Laryngospasm | FAERS: 11 | US FAERS | |
| 217 | Lethargy | FAERS: 11 | US FAERS | |
| 218 | Pericardial effusion | FAERS: 11 | US FAERS | |
| 219 | Pulmonary Fibrosis | FAERS: 11 | US FAERS | |
| 220 | Sinus headache | FAERS: 11 | US FAERS | |
| 221 | Therapeutic reaction time decreased | FAERS: 11 | US FAERS | |
| 222 | Thirst | FAERS: 11 | US FAERS | |
| 223 | Tongue blistering | FAERS: 11 | US FAERS | |
| 224 | Vitreous floaters | FAERS: 11 | US FAERS | |
| 225 | Asphyxia | FAERS: 10 | US FAERS | |
| 226 | Blood sodium decreased | FAERS: 10 | US FAERS | |
| 227 | Bronchial Obstruction | FAERS: 10 | US FAERS | |
| 228 | Capsule issue | FAERS: 10 | US FAERS | |
| 229 | Hyperventilation | FAERS: 10 | US FAERS | |
| 230 | Limb discomfort | FAERS: 10 | US FAERS | |
| 231 | Musculoskeletal chest pain | FAERS: 10 | US FAERS | |
| 232 | Oral fungal infection | FAERS: 10 | US FAERS | |
| 233 | Rash erythematous | FAERS: 10 | US FAERS | |
| 234 | Respiratory tract irritation | FAERS: 10 | US FAERS | |
| 235 | Spinal column stenosis | FAERS: 10 | US FAERS | |
| 236 | Aphasia | FAERS: 9 | US FAERS | |
| 237 | Bronchiectasis | FAERS: 9 | US FAERS | |
| 238 | Colitis | FAERS: 9 | US FAERS | |
| 239 | Cyanosis | FAERS: 9 | US FAERS | |
| 240 | Dysarthria | FAERS: 9 | US FAERS | |
| 241 | Eye Infection | FAERS: 9 | US FAERS | |
| 242 | Flank Pain | FAERS: 9 | US FAERS | |
| 243 | Gastritis | FAERS: 9 | US FAERS | |
| 244 | Gout | FAERS: 9 | US FAERS | |
| 245 | Inappropriate schedule of product administration | FAERS: 9 | US FAERS | |
| 246 | Intentional product misuse | FAERS: 9 | US FAERS | |
| 247 | Oropharyngeal blistering | FAERS: 9 | US FAERS | |
| 248 | Photophobia | FAERS: 9 | US FAERS | |
| 249 | Poor quality sleep | FAERS: 9 | US FAERS | |
| 250 | Product quality control issue | FAERS: 9 | US FAERS | |
| 251 | Renal pain | FAERS: 9 | US FAERS | |
| 252 | Sciatica | FAERS: 9 | US FAERS | |
| 253 | Anuria | FAERS: 8 | US FAERS | |
| 254 | Aphthous Stomatitis | FAERS: 8 | US FAERS | |
| 255 | Bronchopneumonia | FAERS: 8 | US FAERS | |
| 256 | Delirium | FAERS: 8 | US FAERS | |
| 257 | Dermatitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Diverticulitis | FAERS: 8 | US FAERS | |
| 259 | Hypoventilation | FAERS: 8 | US FAERS | |
| 260 | Ileus | FAERS: 8 | US FAERS | |
| 261 | Impaired driving ability | FAERS: 8 | US FAERS | |
| 262 | Intraocular pressure test | FAERS: 8 | US FAERS | |
| 263 | Mental impairment | FAERS: 8 | US FAERS | |
| 264 | Middle insomnia | FAERS: 8 | US FAERS | |
| 265 | Multiple allergies | FAERS: 8 | US FAERS | |
| 266 | Poor quality drug administered | FAERS: 8 | US FAERS | |
| 267 | Skin Ulcer | FAERS: 8 | US FAERS | |
| 268 | Sluggishness | FAERS: 8 | US FAERS | |
| 269 | Upper-airway cough syndrome | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 270 | Urinary hesitation | FAERS: 8 | US FAERS | |
| 271 | prostatitis | FAERS: 8 | US FAERS | |
| 272 | Accidental exposure to product by child | FAERS: 7 | US FAERS | |
| 273 | Acute myocardial infarction | FAERS: 7 | US FAERS | |
| 274 | Anaphylactic shock | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Aneurysm | FAERS: 7 | US FAERS | |
| 276 | Anger | FAERS: 7 | US FAERS | |
| 277 | Basal cell carcinoma | FAERS: 7 | US FAERS | |
| 278 | Blepharitis | FAERS: 7 | US FAERS | |
| 279 | Carbon dioxide increased | FAERS: 7 | US FAERS | |
| 280 | Chromaturia | FAERS: 7 | US FAERS | |
| 281 | Device defective | FAERS: 7 | US FAERS | |
| 282 | Drug effect delayed | FAERS: 7 | US FAERS | |
| 283 | Emotional disorder | FAERS: 7 | US FAERS | |
| 284 | Head discomfort | FAERS: 7 | US FAERS | |
| 285 | Hoarseness | FAERS: 7 | US FAERS | |
| 286 | Hypothyroidism | FAERS: 7 | US FAERS | |
| 287 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 288 | Malignant neoplasm progression | FAERS: 7 | US FAERS | |
| 289 | Mouth swelling | FAERS: 7 | US FAERS | |
| 290 | Muscle Cramp | FAERS: 7 | US FAERS | |
| 291 | Oxygen consumption decreased | FAERS: 7 | US FAERS | |
| 292 | Poor peripheral circulation | FAERS: 7 | US FAERS | |
| 293 | Product blister packaging issue | FAERS: 7 | US FAERS | |
| 294 | Rotator cuff syndrome | FAERS: 7 | US FAERS | |
| 295 | Supraventricular tachycardia | FAERS: 7 | US FAERS | |
| 296 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 297 | Bedridden | FAERS: 6 | US FAERS | |
| 298 | Brain Hypoxia | FAERS: 6 | US FAERS | |
| 299 | Breast cancer recurrent | FAERS: 6 | US FAERS | |
| 300 | Bronchial secretion retention | FAERS: 6 | US FAERS | |
| 301 | Cardiac Flutter | FAERS: 6 | US FAERS | |
| 302 | Cerebral Infarction | FAERS: 6 | US FAERS | |
| 303 | Chronic respiratory failure | FAERS: 6 | US FAERS | |
| 304 | Clostridium difficile infection | FAERS: 6 | US FAERS | |
| 305 | Completed Suicide | FAERS: 6 | US FAERS | |
| 306 | Conjunctivitis | FAERS: 6 | US FAERS | |
| 307 | Dose calculation error | FAERS: 6 | US FAERS | |
| 308 | Drug effect variable | FAERS: 6 | US FAERS | |
| 309 | Drug screen positive | FAERS: 6 | US FAERS | |
| 310 | Erectile dysfunction | FAERS: 6 | US FAERS | |
| 311 | Hypercapnia | FAERS: 6 | US FAERS | |
| 312 | Hypertensive crisis | FAERS: 6 | US FAERS | |
| 313 | Impaired gastric emptying | FAERS: 6 | US FAERS | |
| 314 | Incorrect drug administration duration | FAERS: 6 | US FAERS | |
| 315 | Increased bronchial secretion | FAERS: 6 | US FAERS | |
| 316 | Intentional drug misuse | FAERS: 6 | US FAERS | |
| 317 | Intracranial Aneurysm | FAERS: 6 | US FAERS | |
| 318 | Irregular breathing | FAERS: 6 | US FAERS | |
| 319 | Neuralgia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Night sweats | FAERS: 6 | US FAERS | |
| 321 | Oral mucosal erythema | FAERS: 6 | US FAERS | |
| 322 | Postoperative ileus | FAERS: 6 | US FAERS | |
| 323 | Restlessness | FAERS: 6 | US FAERS | |
| 324 | Sinus operation | FAERS: 6 | US FAERS | |
| 325 | Sputum retention | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 326 | Tooth Extraction | FAERS: 6 | US FAERS | |
| 327 | Toothache | FAERS: 6 | US FAERS | |
| 328 | Total lung capacity abnormal | FAERS: 6 | US FAERS | |
| 329 | nervous system disorder | FAERS: 6 | US FAERS | |
| 330 | Abnormal weight gain | FAERS: 5 | US FAERS | |
| 331 | Accidental drug intake by child | FAERS: 5 | US FAERS | |
| 332 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 333 | Anorexia | FAERS: 5 | US FAERS | |
| 334 | Asthenopia | FAERS: 5 | US FAERS | |
| 335 | Atrial Flutter | FAERS: 5 | US FAERS | |
| 336 | Bladder discomfort | FAERS: 5 | US FAERS | |
| 337 | Bladder neck obstruction | FAERS: 5 | US FAERS | |
| 338 | Blood creatinine increased | FAERS: 5 | US FAERS | |
| 339 | Blood glucose decreased | FAERS: 5 | US FAERS | |
| 340 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 341 | Bradycardia | FAERS: 5 | 26026369 | CTD US FAERS |
| 342 | Compression fracture | FAERS: 5 | US FAERS | |
| 343 | Cyst | FAERS: 5 | US FAERS | |
| 344 | Device difficult to use | FAERS: 5 | US FAERS | |
| 345 | Drug Dependence | FAERS: 5 | US FAERS | |
| 346 | Emotional distress | FAERS: 5 | US FAERS | |
| 347 | Expired product administered | FAERS: 5 | US FAERS | |
| 348 | Foreign body trauma | FAERS: 5 | US FAERS | |
| 349 | Gait inability | FAERS: 5 | US FAERS | |
| 350 | Gastric ulcer | FAERS: 5 | US FAERS | |
| 351 | Impaired work ability | FAERS: 5 | US FAERS | |
| 352 | Incorrect drug administration rate | FAERS: 5 | US FAERS | |
| 353 | Increased viscosity of bronchial secretion | FAERS: 5 | US FAERS | |
| 354 | Inflammation | FAERS: 5 | US FAERS | |
| 355 | Intestinal Perforation | FAERS: 5 | US FAERS | |
| 356 | Iritis | FAERS: 5 | US FAERS | |
| 357 | Mental status changes | FAERS: 5 | US FAERS | |
| 358 | Muscle strain | FAERS: 5 | US FAERS | |
| 359 | Muscle tightness | FAERS: 5 | US FAERS | |
| 360 | Mydriasis | FAERS: 5 | US FAERS | |
| 361 | Oropharyngeal swelling | FAERS: 5 | US FAERS | |
| 362 | Pallor | FAERS: 5 | US FAERS | |
| 363 | Pancreatic Cyst | FAERS: 5 | US FAERS | |
| 364 | Panic Disorder | FAERS: 5 | US FAERS | |
| 365 | Peripheral arterial occlusive disease | FAERS: 5 | US FAERS | |
| 366 | Pleurisy | FAERS: 5 | US FAERS | |
| 367 | Pneumonitis | FAERS: 5 | US FAERS | |
| 368 | Post procedural complication | FAERS: 5 | US FAERS | |
| 369 | Regurgitation | FAERS: 5 | US FAERS | |
| 370 | Rehabilitation therapy | FAERS: 5 | US FAERS | |
| 371 | Rhinitis | FAERS: 5 | US FAERS | |
| 372 | Self-induced vomiting | FAERS: 5 | US FAERS | |
| 373 | Septic Shock | FAERS: 5 | US FAERS | |
| 374 | Skin irritation | FAERS: 5 | US FAERS | |
| 375 | Therapy change | FAERS: 5 | US FAERS | |
| 376 | Ventricular Fibrillation | FAERS: 5 | US FAERS | |
| 377 | Acne | FAERS: 4 | US FAERS | |
| 378 | Airway burns | FAERS: 4 | US FAERS | |
| 379 | Anosmia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 380 | Atypical pneumonia | FAERS: 4 | US FAERS | |
| 381 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 382 | Blood glucose abnormal | FAERS: 4 | US FAERS | |
| 383 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 384 | Cold sweat | FAERS: 4 | US FAERS | |
| 385 | Crying | FAERS: 4 | US FAERS | |
| 386 | Drug dose omission | FAERS: 4 | US FAERS | |
| 387 | Fluid overload | FAERS: 4 | US FAERS | |
| 388 | Gallbladder pain | FAERS: 4 | US FAERS | |
| 389 | Gangrene | FAERS: 4 | US FAERS | |
| 390 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 391 | Gastrointestinal infection | FAERS: 4 | US FAERS | |
| 392 | Gingivitis | FAERS: 4 | US FAERS | |
| 393 | Hemiplegia | FAERS: 4 | US FAERS | |
| 394 | Immobile | FAERS: 4 | US FAERS | |
| 395 | Intervertebral Disc Degeneration | FAERS: 4 | US FAERS | |
| 396 | Lactose Intolerance | FAERS: 4 | US FAERS | |
| 397 | Large intestine perforation | FAERS: 4 | US FAERS | |
| 398 | Ligament rupture | FAERS: 4 | US FAERS | |
| 399 | Loose tooth | FAERS: 4 | US FAERS | |
| 400 | Malnutrition | FAERS: 4 | US FAERS | |
| 401 | Monoplegia | FAERS: 4 | US FAERS | |
| 402 | Non-cardiac chest pain | FAERS: 4 | US FAERS | |
| 403 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 404 | Obstruction | FAERS: 4 | US FAERS | |
| 405 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 406 | Oxygen consumption increased | FAERS: 4 | US FAERS | |
| 407 | Paranoia | FAERS: 4 | US FAERS | |
| 408 | Peptic Ulcer | FAERS: 4 | US FAERS | |
| 409 | Physical disability | FAERS: 4 | US FAERS | |
| 410 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 411 | Pre-existing condition improved | FAERS: 4 | US FAERS | |
| 412 | Product counterfeit | FAERS: 4 | US FAERS | |
| 413 | Product label issue | FAERS: 4 | US FAERS | |
| 414 | Product use complaint | FAERS: 4 | US FAERS | |
| 415 | Prostatic Adenoma | FAERS: 4 | US FAERS | |
| 416 | Protein total increased | FAERS: 4 | US FAERS | |
| 417 | Pulmonary pain | FAERS: 4 | US FAERS | |
| 418 | Renal cyst | FAERS: 4 | US FAERS | |
| 419 | Rosacea | FAERS: 4 | US FAERS | |
| 420 | Small cell lung cancer recurrent | FAERS: 4 | US FAERS | |
| 421 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 422 | Synovial Cyst | FAERS: 4 | US FAERS | |
| 423 | Tension | FAERS: 4 | US FAERS | |
| 424 | Terminal state | FAERS: 4 | US FAERS | |
| 425 | Thyroid Neoplasm | FAERS: 4 | US FAERS | |
| 426 | Vaginal Discharge | FAERS: 4 | US FAERS | |
| 427 | Vocal Cord Paralysis | FAERS: 4 | US FAERS | |
| 428 | Walking aid user | FAERS: 4 | US FAERS | |
| 429 | Abscess | FAERS: 3 | US FAERS | |
| 430 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 431 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 432 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 433 | Amphetamines positive | FAERS: 3 | US FAERS | |
| 434 | Amyotrophic Lateral Sclerosis | FAERS: 3 | US FAERS | |
| 435 | Aortic Valve Stenosis | FAERS: 3 | US FAERS | |
| 436 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 437 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 438 | Atelectasis | FAERS: 3 | US FAERS | |
| 439 | Bladder pain | FAERS: 3 | US FAERS | |
| 440 | Blepharospasm | FAERS: 3 | US FAERS | |
| 441 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 442 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 443 | Blood magnesium decreased | FAERS: 3 | US FAERS | |
| 444 | Bone contusion | FAERS: 3 | US FAERS | |
| 445 | Bronchial irritation | FAERS: 3 | US FAERS | |
| 446 | Bursitis | FAERS: 3 | US FAERS | |
| 447 | Cardiac discomfort | FAERS: 3 | US FAERS | |
| 448 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 449 | Cataract operation | FAERS: 3 | US FAERS | |
| 450 | Cholecystitis | FAERS: 3 | US FAERS | |
| 451 | Complication associated with device | FAERS: 3 | US FAERS | |
| 452 | Cystic Fibrosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 453 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 454 | Device Failure | FAERS: 3 | US FAERS | |
| 455 | Device breakage | FAERS: 3 | US FAERS | |
| 456 | Device dislocation | FAERS: 3 | US FAERS | |
| 457 | Device ineffective | FAERS: 3 | US FAERS | |
| 458 | Device use error | FAERS: 3 | US FAERS | |
| 459 | Disease Progression | FAERS: 3 | US FAERS | |
| 460 | Diverticulum | FAERS: 3 | US FAERS | |
| 461 | Ear congestion | FAERS: 3 | US FAERS | |
| 462 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 463 | Embolism | FAERS: 3 | US FAERS | |
| 464 | Eosinophilia | FAERS: 3 | US FAERS | |
| 465 | Escherichia infection | FAERS: 3 | US FAERS | |
| 466 | Eye Burns | FAERS: 3 | US FAERS | |
| 467 | Facial Pain | FAERS: 3 | US FAERS | |
| 468 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 469 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 470 | Gastrointestinal perforation | FAERS: 3 | US FAERS | |
| 471 | Hearing disability | FAERS: 3 | US FAERS | |
| 472 | Hemiparesis | FAERS: 3 | US FAERS | |
| 473 | Hordeolum | FAERS: 3 | US FAERS | |
| 474 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 475 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 476 | Hypersomnia | FAERS: 3 | US FAERS | |
| 477 | Hypokinesia | FAERS: 3 | US FAERS | |
| 478 | Hypophagia | FAERS: 3 | US FAERS | |
| 479 | Increased viscosity of upper respiratory secretion | FAERS: 3 | US FAERS | |
| 480 | Intervertebral disc disorder | FAERS: 3 | US FAERS | |
| 481 | Intestinal infarction | FAERS: 3 | US FAERS | |
| 482 | Keratoconjunctivitis Sicca | FAERS: 3 | US FAERS | |
| 483 | Laryngeal Obstruction | FAERS: 3 | US FAERS | |
| 484 | Lip exfoliation | FAERS: 3 | US FAERS | |
| 485 | Lower respiratory tract infection bacterial | FAERS: 3 | US FAERS | |
| 486 | Lung hyperinflation | FAERS: 3 | US FAERS | |
| 487 | MYELODYSPLASTIC SYNDROME | FAERS: 3 | US FAERS | |
| 488 | Mastication disorder | FAERS: 3 | US FAERS | |
| 489 | Medical device complication | FAERS: 3 | US FAERS | |
| 490 | Medication residue | FAERS: 3 | US FAERS | |
| 491 | Medication residue present | FAERS: 3 | US FAERS | |
| 492 | Meniscus injury | FAERS: 3 | US FAERS | |
| 493 | Mental Fatigue | FAERS: 3 | US FAERS | |
| 494 | Mononeuritis | FAERS: 3 | US FAERS | |
| 495 | Mood swings | FAERS: 3 | US FAERS | |
| 496 | Ocular Hypertension | FAERS: 3 | US FAERS | |
| 497 | Oral infection | FAERS: 3 | US FAERS | |
| 498 | Oxygen Consumption | FAERS: 3 | US FAERS | |
| 499 | Oxygen supplementation | FAERS: 3 | US FAERS | |
| 500 | Paranasal sinus discomfort | FAERS: 3 | US FAERS | |
| 501 | Periarthritis | FAERS: 3 | US FAERS | |
| 502 | Peripheral arthritis | FAERS: 3 | US FAERS | |
| 503 | Peripheral paralysis | FAERS: 3 | US FAERS | |
| 504 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 505 | Procedural complication | FAERS: 3 | US FAERS | |
| 506 | Product dispensing error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 507 | Product package associated injury | FAERS: 3 | US FAERS | |
| 508 | Rales | FAERS: 3 | US FAERS | |
| 509 | Residual urine | FAERS: 3 | US FAERS | |
| 510 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 511 | Scab | FAERS: 3 | US FAERS | |
| 512 | Schizophrenia | FAERS: 3 | US FAERS | |
| 513 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 514 | Skin reaction | FAERS: 3 | US FAERS | |
| 515 | Spinal column injury | FAERS: 3 | US FAERS | |
| 516 | Splenic Rupture | FAERS: 3 | US FAERS | |
| 517 | Squamous cell carcinoma of lung | FAERS: 3 | US FAERS | |
| 518 | Stridor | FAERS: 3 | US FAERS | |
| 519 | Therapeutic product ineffective | FAERS: 3 | US FAERS | |
| 520 | Therapy cessation | FAERS: 3 | US FAERS | |
| 521 | Thermal burn | FAERS: 3 | US FAERS | |
| 522 | Tooth Infection | FAERS: 3 | US FAERS | |
| 523 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 524 | Venous occlusion | FAERS: 3 | US FAERS | |
| 525 | Vulvovaginal dryness | FAERS: 3 | US FAERS | |
| 526 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 527 | Wrong patient received medication | FAERS: 3 | US FAERS | |
| 528 | jaundice | FAERS: 3 | US FAERS | |
| 529 | treatment failure | FAERS: 3 | US FAERS | |
| 530 | Acidosis | FAERS: 2 | US FAERS | |
| 531 | Acquired Immunodeficiency Syndrome | FAERS: 2 | US FAERS | |
| 532 | Akathisia | FAERS: 2 | US FAERS | |
| 533 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 534 | Aphagia | FAERS: 2 | US FAERS | |
| 535 | Appendicitis | FAERS: 2 | US FAERS | |
| 536 | Arthropod bite | FAERS: 2 | US FAERS | |
| 537 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 538 | Blood urea increased | FAERS: 2 | US FAERS | |
| 539 | Bloody airway discharge | FAERS: 2 | US FAERS | |
| 540 | Blue Toe Syndrome | FAERS: 2 | US FAERS | |
| 541 | Body Temperature | FAERS: 2 | US FAERS | |
| 542 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 543 | Breast discomfort | FAERS: 2 | US FAERS | |
| 544 | Breath alcohol test positive | FAERS: 2 | US FAERS | |
| 545 | Bruxism | FAERS: 2 | US FAERS | |
| 546 | Carbon Dioxide | FAERS: 2 | US FAERS | |
| 547 | Carbon Monoxide Poisoning | FAERS: 2 | US FAERS | |
| 548 | Cardiac infection | FAERS: 2 | US FAERS | |
| 549 | Cardiac procedure complication | FAERS: 2 | US FAERS | |
| 550 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 551 | Cartilage injury | FAERS: 2 | US FAERS | |
| 552 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 553 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 554 | Chemotherapy | FAERS: 2 | US FAERS | |
| 555 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 556 | Conversion disorder | FAERS: 2 | US FAERS | |
| 557 | Corneal degeneration | FAERS: 2 | US FAERS | |
| 558 | Corneal dystrophy | FAERS: 2 | US FAERS | |
| 559 | Cyst drainage | FAERS: 2 | US FAERS | |
| 560 | Device interaction | FAERS: 2 | US FAERS | |
| 561 | Device material issue | FAERS: 2 | US FAERS | |
| 562 | Device occlusion | FAERS: 2 | US FAERS | |
| 563 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 564 | Diabetic Foot | FAERS: 2 | US FAERS | |
| 565 | Disuse syndrome | FAERS: 2 | US FAERS | |
| 566 | Drug abuser | FAERS: 2 | US FAERS | |
| 567 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 568 | Dysphemia | FAERS: 2 | US FAERS | |
| 569 | Dystonia | FAERS: 2 | US FAERS | |
| 570 | Economic problem | FAERS: 2 | US FAERS | |
| 571 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 572 | Enamel anomaly | FAERS: 2 | US FAERS | |
| 573 | Endodontic procedure | FAERS: 2 | US FAERS | |
| 574 | Epiglottic carcinoma | FAERS: 2 | US FAERS | |
| 575 | Epilepsy | FAERS: 2 | US FAERS | |
| 576 | Erythema Multiforme | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 577 | Euphoric mood | FAERS: 2 | US FAERS | |
| 578 | Excoriation | FAERS: 2 | US FAERS | |
| 579 | Exophthalmos | FAERS: 2 | US FAERS | |
| 580 | Exposure via inhalation | FAERS: 2 | US FAERS | |
| 581 | Eyelid margin crusting | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 582 | Food Poisoning | FAERS: 2 | US FAERS | |
| 583 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 584 | Formication | FAERS: 2 | US FAERS | |
| 585 | Frustration | FAERS: 2 | US FAERS | |
| 586 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 587 | Gastric infection | FAERS: 2 | US FAERS | |
| 588 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 589 | Gastrointestinal viral infection | FAERS: 2 | US FAERS | |
| 590 | Gingival blister | FAERS: 2 | US FAERS | |
| 591 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 592 | Hepatitis | FAERS: 2 | US FAERS | |
| 593 | Hernia pain | FAERS: 2 | US FAERS | |
| 594 | Hospice Care | FAERS: 2 | US FAERS | |
| 595 | Hypogeusia | FAERS: 2 | US FAERS | |
| 596 | Impatience | FAERS: 2 | US FAERS | |
| 597 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 598 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 599 | Incoherent | FAERS: 2 | US FAERS | |
| 600 | Incontinence | FAERS: 2 | US FAERS | |
| 601 | Incorrect dose administered by device | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 602 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 603 | Infarction | FAERS: 2 | US FAERS | |
| 604 | Infective exacerbation of chronic obstructive airways disease | FAERS: 2 | US FAERS | |
| 605 | Intestinal gangrene | FAERS: 2 | US FAERS | |
| 606 | Intraocular pressure test abnormal | FAERS: 2 | US FAERS | |
| 607 | Joint stiffness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 608 | Laryngectomy | FAERS: 2 | US FAERS | |
| 609 | Limb operation | FAERS: 2 | US FAERS | |
| 610 | Lung carcinoma cell type unspecified stage I | FAERS: 2 | US FAERS | |
| 611 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 612 | Malignant ascites | FAERS: 2 | US FAERS | |
| 613 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 614 | Maximal Voluntary Ventilation | FAERS: 2 | US FAERS | |
| 615 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 616 | Menorrhagia | FAERS: 2 | US FAERS | |
| 617 | Mesothelioma | FAERS: 2 | US FAERS | |
| 618 | Metastasis | FAERS: 2 | US FAERS | |
| 619 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 620 | Multimorbidity | FAERS: 2 | US FAERS | |
| 621 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 622 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 623 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 624 | Mycobacterium abscessus Infection | FAERS: 2 | US FAERS | |
| 625 | Nerve injury | FAERS: 2 | US FAERS | |
| 626 | Neuroma | FAERS: 2 | US FAERS | |
| 627 | Nodule on extremity | FAERS: 2 | US FAERS | |
| 628 | Obesity | FAERS: 2 | US FAERS | |
| 629 | Off label use of device | FAERS: 2 | US FAERS | |
| 630 | Onychoclasis | FAERS: 2 | US FAERS | |
| 631 | Oral contusion | FAERS: 2 | US FAERS | |
| 632 | Oral pruritus | FAERS: 2 | US FAERS | |
| 633 | Oxygen saturation increased | FAERS: 2 | US FAERS | |
| 634 | Pain of skin | FAERS: 2 | US FAERS | |
| 635 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 636 | Physical product label issue | FAERS: 2 | US FAERS | |
| 637 | Polydipsia | FAERS: 2 | US FAERS | |
| 638 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 639 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 640 | Presyncope | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 641 | Product complaint | FAERS: 2 Canada Vigilance: 42 | Canada Vigilance US FAERS | |
| 642 | Product distribution issue | FAERS: 2 | US FAERS | |
| 643 | Product friable | FAERS: 2 | US FAERS | |
| 644 | Product label on wrong product | FAERS: 2 | US FAERS | |
| 645 | Product prescribing error | FAERS: 2 | US FAERS | |
| 646 | Product storage error | FAERS: 2 | US FAERS | |
| 647 | Product substitution issue | FAERS: 2 | US FAERS | |
| 648 | Prostate cancer recurrent | FAERS: 2 | US FAERS | |
| 649 | Prostate examination abnormal | FAERS: 2 | US FAERS | |
| 650 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 651 | Pulmonary function test increased | FAERS: 2 | US FAERS | |
| 652 | Pulmonary vascular disorder | FAERS: 2 | US FAERS | |
| 653 | Purpura | FAERS: 2 | US FAERS | |
| 654 | Pyloric Stenosis | FAERS: 2 | US FAERS | |
| 655 | Quality of life decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 656 | Renal mass | FAERS: 2 | US FAERS | |
| 657 | Respiratory Therapy | FAERS: 2 | US FAERS | |
| 658 | Respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 659 | Rhinalgia | FAERS: 2 | US FAERS | |
| 660 | Rhinovirus infection | FAERS: 2 | US FAERS | |
| 661 | Right ventricular failure | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 662 | Scleroderma | FAERS: 2 | US FAERS | |
| 663 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 664 | Skeletal injury | FAERS: 2 | US FAERS | |
| 665 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 666 | Skin tightness | FAERS: 2 | US FAERS | |
| 667 | Spinal Stenosis | FAERS: 2 | US FAERS | |
| 668 | Spinal cord infection | FAERS: 2 | US FAERS | |
| 669 | Sputum decreased | FAERS: 2 | US FAERS | |
| 670 | Subcutaneous nodule | FAERS: 2 | US FAERS | |
| 671 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 672 | Therapeutic product effect incomplete | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 673 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 674 | Tobacco user | FAERS: 2 | US FAERS | |
| 675 | Tongue eruption | FAERS: 2 | US FAERS | |
| 676 | Tonsillitis | FAERS: 2 | US FAERS | |
| 677 | Tooth Erosion | FAERS: 2 | US FAERS | |
| 678 | Trismus | FAERS: 2 | US FAERS | |
| 679 | Ulcer | FAERS: 2 | US FAERS | |
| 680 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 681 | Urine amphetamine positive | FAERS: 2 | US FAERS | |
| 682 | Vascular rupture | FAERS: 2 | US FAERS | |
| 683 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 684 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 685 | Vitreous loss | FAERS: 2 | US FAERS | |
| 686 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 687 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 688 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 689 | Weaning failure | FAERS: 2 | US FAERS | |
| 690 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 691 | Wrong device used | FAERS: 2 | US FAERS | |
| 692 | Wrong dose | FAERS: 2 | US FAERS | |
| 693 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 694 | furuncle | FAERS: 2 | US FAERS | |
| 695 | muscle injury | FAERS: 2 | US FAERS | |
| 696 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 697 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 698 | Abdominal mass | FAERS: 1 | US FAERS | |
| 699 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 700 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 701 | Abdominal wound dehiscence | FAERS: 1 | US FAERS | |
| 702 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 703 | Accidental death | FAERS: 1 | US FAERS | |
| 704 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 705 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 706 | Agoraphobia | FAERS: 1 | US FAERS | |
| 707 | Air Embolism | FAERS: 1 | US FAERS | |
| 708 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 709 | Amaurosis | FAERS: 1 | US FAERS | |
| 710 | Ammonia increased | FAERS: 1 | US FAERS | |
| 711 | Amputation | FAERS: 1 | US FAERS | |
| 712 | Anal Fistula | FAERS: 1 | US FAERS | |
| 713 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 714 | Animal bite | FAERS: 1 | US FAERS | |
| 715 | Animal scratch | FAERS: 1 | US FAERS | |
| 716 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 717 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 718 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 719 | Aortic stent insertion | FAERS: 1 | US FAERS | |
| 720 | Aortic valve calcification | FAERS: 1 | US FAERS | |
| 721 | Application site injury | FAERS: 1 | US FAERS | |
| 722 | Application site pain | FAERS: 1 | US FAERS | |
| 723 | Application site reaction | FAERS: 1 | US FAERS | |
| 724 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 725 | Arthropod sting | FAERS: 1 | US FAERS | |
| 726 | Asbestosis | FAERS: 1 | US FAERS | |
| 727 | Astigmatism | FAERS: 1 | US FAERS | |
| 728 | Ataxia | FAERS: 1 | US FAERS | |
| 729 | Aversion | FAERS: 1 | US FAERS | |
| 730 | Avulsion fracture | FAERS: 1 | US FAERS | |
| 731 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 732 | Benign neoplasm of adrenal gland | FAERS: 1 | US FAERS | |
| 733 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 734 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 735 | Bladder cancer stage IV | FAERS: 1 | US FAERS | |
| 736 | Bladder dysplasia | FAERS: 1 | US FAERS | |
| 737 | Bladder spasm | FAERS: 1 | US FAERS | |
| 738 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 739 | Blood caffeine increased | FAERS: 1 | US FAERS | |
| 740 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 741 | Blood carbon monoxide increased | FAERS: 1 | US FAERS | |
| 742 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 743 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 744 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 745 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 746 | Blood insulin abnormal | FAERS: 1 | US FAERS | |
| 747 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 748 | Blood iron increased | FAERS: 1 | US FAERS | |
| 749 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 750 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 751 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 752 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 753 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 754 | Body fat disorder | FAERS: 1 | US FAERS | |
| 755 | Bone atrophy | FAERS: 1 | US FAERS | |
| 756 | Boredom | FAERS: 1 | US FAERS | |
| 757 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 758 | Breast Cyst | FAERS: 1 | US FAERS | |
| 759 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 760 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 761 | Bronchial polyp | FAERS: 1 | US FAERS | |
| 762 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 763 | Bronchomalacia | FAERS: 1 | US FAERS | |
| 764 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 765 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 766 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 767 | Bunion | FAERS: 1 | US FAERS | |
| 768 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 769 | Calcinosis | FAERS: 1 | US FAERS | |
| 770 | Carbon dioxide abnormal | FAERS: 1 | US FAERS | |
| 771 | Carcinoma | FAERS: 1 | US FAERS | |
| 772 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 773 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 774 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 775 | Carditis | FAERS: 1 | US FAERS | |
| 776 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 777 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 778 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 779 | Catheter management | FAERS: 1 | US FAERS | |
| 780 | Catheter placement | FAERS: 1 | US FAERS | |
| 781 | Catheter site pain | FAERS: 1 | US FAERS | |
| 782 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 783 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 784 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 785 | Cervix carcinoma stage IV | FAERS: 1 | US FAERS | |
| 786 | Cholangitis | FAERS: 1 | US FAERS | |
| 787 | Cholesteatoma | FAERS: 1 | US FAERS | |
| 788 | Chromatopsia | FAERS: 1 | US FAERS | |
| 789 | Chronic disease | FAERS: 1 | US FAERS | |
| 790 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 791 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 792 | Cluster Headache | FAERS: 1 | US FAERS | |
| 793 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 794 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 795 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 796 | Contracted bladder | FAERS: 1 | US FAERS | |
| 797 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 798 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 799 | Corneal Scar | FAERS: 1 | US FAERS | |
| 800 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 801 | Coronary artery perforation | FAERS: 1 | US FAERS | |
| 802 | Corrective lens user | FAERS: 1 | US FAERS | |
| 803 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 804 | Critical Illness | FAERS: 1 | US FAERS | |
| 805 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 806 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 807 | Decreased bronchial secretion | FAERS: 1 | US FAERS | |
| 808 | Deformity | FAERS: 1 | US FAERS | |
| 809 | Dental discomfort | FAERS: 1 | US FAERS | |
| 810 | Depression suicidal | FAERS: 1 | US FAERS | |
| 811 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 812 | Device related infection | FAERS: 1 | US FAERS | |
| 813 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 814 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 815 | Disabled relative | FAERS: 1 | US FAERS | |
| 816 | Disease complication | FAERS: 1 | US FAERS | |
| 817 | Disease recurrence | FAERS: 1 | US FAERS | |
| 818 | Dissociation | FAERS: 1 | US FAERS | |
| 819 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 820 | Drooling | FAERS: 1 | US FAERS | |
| 821 | Drowning | FAERS: 1 | US FAERS | |
| 822 | Drug abuse | FAERS: 1 | US FAERS | |
| 823 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 824 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 825 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 826 | Drug level increased | FAERS: 1 | US FAERS | |
| 827 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 828 | Drug toxicity | FAERS: 1 | US FAERS | |
| 829 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 830 | Dry gangrene | FAERS: 1 | US FAERS | |
| 831 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 832 | Dyscalculia | FAERS: 1 | US FAERS | |
| 833 | Dyschezia | FAERS: 1 | US FAERS | |
| 834 | Dysphasia | FAERS: 1 | US FAERS | |
| 835 | Ecchymosis | FAERS: 1 | US FAERS | |
| 836 | Eczema | FAERS: 1 | US FAERS | |
| 837 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 838 | Empyema | FAERS: 1 | US FAERS | |
| 839 | Enteritis | FAERS: 1 | US FAERS | |
| 840 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 841 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 842 | Epididymitis | FAERS: 1 | US FAERS | |
| 843 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 844 | Epiglottitis | FAERS: 1 | US FAERS | |
| 845 | Erection increased | FAERS: 1 | US FAERS | |
| 846 | Ex-tobacco user | FAERS: 1 | US FAERS | |
| 847 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 848 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 849 | Expulsion of medication | FAERS: 1 | US FAERS | |
| 850 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 851 | Eye Redness | FAERS: 1 | US FAERS | |
| 852 | Eye inflammation | FAERS: 1 | US FAERS | |
| 853 | Eyelid infection | FAERS: 1 | US FAERS | |
| 854 | Eyelid pain | FAERS: 1 | US FAERS | |
| 855 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 856 | Facial Paresis | FAERS: 1 | US FAERS | |
| 857 | Facial paralysis | FAERS: 1 | US FAERS | |
| 858 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 859 | Feeding tube user | FAERS: 1 | US FAERS | |
| 860 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 861 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 862 | Food Allergy | FAERS: 1 | US FAERS | |
| 863 | Forced expiratory volume abnormal | FAERS: 1 | US FAERS | |
| 864 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 865 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 866 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 867 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 868 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 869 | General symptom | FAERS: 1 | US FAERS | |
| 870 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 871 | Genital pain | FAERS: 1 | US FAERS | |
| 872 | Genital swelling | FAERS: 1 | US FAERS | |
| 873 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 874 | Grief reaction | FAERS: 1 | US FAERS | |
| 875 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 876 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 877 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 878 | Heat Stroke | FAERS: 1 | US FAERS | |
| 879 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 880 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 881 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 882 | Hepatitis A | FAERS: 1 | US FAERS | |
| 883 | Hepatitis C | FAERS: 1 | US FAERS | |
| 884 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 885 | Herpes Zoster Oticus | FAERS: 1 | US FAERS | |
| 886 | Hip surgery | FAERS: 1 | US FAERS | |
| 887 | Hostility | FAERS: 1 | US FAERS | |
| 888 | House dust allergy | FAERS: 1 | US FAERS | |
| 889 | Hunger | FAERS: 1 | US FAERS | |
| 890 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 891 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 892 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 893 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 894 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 895 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 896 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 897 | Impaired self-care | FAERS: 1 | US FAERS | |
| 898 | Implant site reaction | FAERS: 1 | US FAERS | |
| 899 | Inappropriate device therapy | FAERS: 1 | US FAERS | |
| 900 | Incision site abscess | FAERS: 1 | US FAERS | |
| 901 | Incision site infection | FAERS: 1 | US FAERS | |
| 902 | Incisional hernia | FAERS: 1 | US FAERS | |
| 903 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 904 | Increased viscosity of nasal secretion | FAERS: 1 | US FAERS | |
| 905 | Infective glossitis | FAERS: 1 | US FAERS | |
| 906 | Infusion site infection | FAERS: 1 | US FAERS | |
| 907 | Injury associated with device | FAERS: 1 | US FAERS | |
| 908 | Inspiratory capacity decreased | FAERS: 1 | US FAERS | |
| 909 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 910 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 911 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 912 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 913 | Intestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 914 | Iron deficiency | FAERS: 1 | US FAERS | |
| 915 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 916 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 917 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 918 | Laryngeal neoplasm | FAERS: 1 | US FAERS | |
| 919 | Laryngotracheal operation | FAERS: 1 | US FAERS | |
| 920 | Laziness | FAERS: 1 | US FAERS | |
| 921 | Leukopenia | FAERS: 1 | US FAERS | |
| 922 | Lichen Planus | FAERS: 1 | US FAERS | |
| 923 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 924 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 925 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 926 | Living in residential institution | FAERS: 1 | US FAERS | |
| 927 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 928 | Local reaction | FAERS: 1 | US FAERS | |
| 929 | Loss of personal independence in daily activities | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 930 | Lung Abscess | FAERS: 1 | US FAERS | |
| 931 | Lung squamous cell carcinoma stage II | FAERS: 1 | US FAERS | |
| 932 | Lung squamous cell carcinoma stage I | FAERS: 1 | US FAERS | |
| 933 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 934 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 935 | Malignant neoplasm of spinal cord | FAERS: 1 | US FAERS | |
| 936 | Malignant polyp | FAERS: 1 | US FAERS | |
| 937 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 938 | Mechanical ileus | FAERS: 1 | US FAERS | |
| 939 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 940 | Megacolon | FAERS: 1 | US FAERS | |
| 941 | Meningitis | FAERS: 1 | US FAERS | |
| 942 | Mesenteric arteriosclerosis | FAERS: 1 | US FAERS | |
| 943 | Mesenteric artery stenosis | FAERS: 1 | US FAERS | |
| 944 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 945 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 946 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 947 | Micturition frequency decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 948 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 949 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 950 | Mucosal hypertrophy | FAERS: 1 | US FAERS | |
| 951 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 952 | Multiple drug therapy | FAERS: 1 | US FAERS | |
| 953 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 954 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 955 | Myocarditis | FAERS: 1 | US FAERS | |
| 956 | Myopia | FAERS: 1 | US FAERS | |
| 957 | Myositis | FAERS: 1 | US FAERS | |
| 958 | Nail bed injury | FAERS: 1 | US FAERS | |
| 959 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 960 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 961 | Negative thoughts | FAERS: 1 | US FAERS | |
| 962 | Nephrectomy | FAERS: 1 | US FAERS | |
| 963 | Nephritis | FAERS: 1 | US FAERS | |
| 964 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 965 | Neuropathy | FAERS: 1 | US FAERS | |
| 966 | Neurotransmitter level altered | FAERS: 1 | US FAERS | |
| 967 | Nicotine Dependence | FAERS: 1 | US FAERS | |
| 968 | No adverse effect | FAERS: 1 | US FAERS | |
| 969 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 970 | Nodule | FAERS: 1 | US FAERS | |
| 971 | Non-small cell lung cancer stage III | FAERS: 1 | US FAERS | |
| 972 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 973 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 974 | Obstructive nephropathy | FAERS: 1 | US FAERS | |
| 975 | Ocular Rosacea | FAERS: 1 | US FAERS | |
| 976 | Ocular icterus | FAERS: 1 | US FAERS | |
| 977 | Oliguria | FAERS: 1 | US FAERS | |
| 978 | Onychomycosis | FAERS: 1 | US FAERS | |
| 979 | Open wound | FAERS: 1 | US FAERS | |
| 980 | Opiates positive | FAERS: 1 | US FAERS | |
| 981 | Optic nerve cupping | FAERS: 1 | US FAERS | |
| 982 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 983 | Orchitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 984 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 985 | Oropharyngitis fungal | FAERS: 1 | US FAERS | |
| 986 | Osteitis | FAERS: 1 | US FAERS | |
| 987 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 988 | Osteopenia | FAERS: 1 | US FAERS | |
| 989 | Ovarian cancer stage IV | FAERS: 1 | US FAERS | |
| 990 | Ovarian enlargement | FAERS: 1 | US FAERS | |
| 991 | Palliative Care | FAERS: 1 | US FAERS | |
| 992 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 993 | Pancreatic operation | FAERS: 1 | US FAERS | |
| 994 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 995 | Paresis | FAERS: 1 | US FAERS | |
| 996 | Patellofemoral Pain Syndrome | FAERS: 1 | US FAERS | |
| 997 | Pathological fracture | FAERS: 1 | US FAERS | |
| 998 | Peak expiratory flow rate | FAERS: 1 | US FAERS | |
| 999 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 1000 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 1001 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 1002 | Peritonitis | FAERS: 1 | US FAERS | |
| 1003 | Petechiae | FAERS: 1 | US FAERS | |
| 1004 | Pharyngeal polyp | FAERS: 1 | US FAERS | |
| 1005 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 1006 | Physical assault | FAERS: 1 | US FAERS | |
| 1007 | Pigmentation lip | FAERS: 1 | US FAERS | |
| 1008 | Pleural fluid analysis | FAERS: 1 | US FAERS | |
| 1009 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 1010 | Poisoning | FAERS: 1 | US FAERS | |
| 1011 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 1012 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 1013 | Polyuria | FAERS: 1 | US FAERS | |
| 1014 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 1015 | Post procedural infection | FAERS: 1 | US FAERS | |
| 1016 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 1017 | Postoperative stitch sinus | FAERS: 1 | US FAERS | |
| 1018 | Presbyopia | FAERS: 1 | US FAERS | |
| 1019 | Product availability issue | FAERS: 1 | US FAERS | |
| 1020 | Product container issue | FAERS: 1 | US FAERS | |
| 1021 | Product contamination physical | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1022 | Product deposit | FAERS: 1 | US FAERS | |
| 1023 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 1024 | Product formulation issue | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 1025 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 1026 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 1027 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1028 | Product process control issue | FAERS: 1 | US FAERS | |
| 1029 | Product selection error | FAERS: 1 | US FAERS | |
| 1030 | Product size issue | FAERS: 1 | US FAERS | |
| 1031 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 1032 | Product tampering | FAERS: 1 | US FAERS | |
| 1033 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 1034 | Psoriasis | FAERS: 1 | US FAERS | |
| 1035 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 1036 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 1037 | Purulent discharge | FAERS: 1 | US FAERS | |
| 1038 | Radial nerve compression | FAERS: 1 | US FAERS | |
| 1039 | Radiation injury | FAERS: 1 | US FAERS | |
| 1040 | Reaction to medical agent preservatives | FAERS: 1 | US FAERS | |
| 1041 | Rectal discharge | FAERS: 1 | US FAERS | |
| 1042 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1043 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 1044 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 1045 | Respiratory muscle weakness | FAERS: 1 | US FAERS | |
| 1046 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 1047 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 1048 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 1049 | Retinoschisis | FAERS: 1 | US FAERS | |
| 1050 | Saliva altered | FAERS: 1 | US FAERS | |
| 1051 | Screaming | FAERS: 1 | US FAERS | |
| 1052 | Semen volume decreased | FAERS: 1 | US FAERS | |
| 1053 | Serum Sickness | FAERS: 1 | US FAERS | |
| 1054 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 1055 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 1056 | Sight disability | FAERS: 1 | US FAERS | |
| 1057 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 1058 | Somnambulism | FAERS: 1 | US FAERS | |
| 1059 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 1060 | Splenectomy | FAERS: 1 | US FAERS | |
| 1061 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 1062 | Spondylitis | FAERS: 1 | US FAERS | |
| 1063 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 1064 | Starvation | FAERS: 1 | US FAERS | |
| 1065 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 1066 | Steroid diabetes | FAERS: 1 | US FAERS | |
| 1067 | Stoma complication | FAERS: 1 | US FAERS | |
| 1068 | Stoma site pain | FAERS: 1 | US FAERS | |
| 1069 | Strabismus | FAERS: 1 | US FAERS | |
| 1070 | Stress at work | FAERS: 1 | US FAERS | |
| 1071 | Subclavian artery occlusion | FAERS: 1 | US FAERS | |
| 1072 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 1073 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 1074 | Suicide attempt | FAERS: 1 | US FAERS | |
| 1075 | Supportive care | FAERS: 1 | US FAERS | |
| 1076 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 1077 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 1078 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1079 | Therapeutic product effect variable | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1080 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 1081 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 1082 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1083 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 1084 | Therapy responder | FAERS: 1 | US FAERS | |
| 1085 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1086 | Throat clearing | FAERS: 1 | US FAERS | |
| 1087 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 1088 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1089 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 1090 | Total Lung Capacity | FAERS: 1 | US FAERS | |
| 1091 | Total lung capacity increased | FAERS: 1 | US FAERS | |
| 1092 | Tracheal pain | FAERS: 1 | US FAERS | |
| 1093 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 1094 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 1095 | Transcription medication error | FAERS: 1 | US FAERS | |
| 1096 | Transplant | FAERS: 1 | US FAERS | |
| 1097 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1098 | Tuberculosis | FAERS: 1 | US FAERS | |
| 1099 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 1100 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 1101 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 1102 | Urethritis | FAERS: 1 | US FAERS | |
| 1103 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 1104 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 1105 | Urine amphetamine negative | FAERS: 1 | US FAERS | |
| 1106 | Urine glucose false positive | FAERS: 1 | US FAERS | |
| 1107 | Urine output increased | FAERS: 1 | US FAERS | |
| 1108 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1109 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 1110 | Vaginal exfoliation | FAERS: 1 | US FAERS | |
| 1111 | Vascular calcification | FAERS: 1 | US FAERS | |
| 1112 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 1113 | Vasculitis | FAERS: 1 | US FAERS | |
| 1114 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 1115 | Vessel perforation | FAERS: 1 | US FAERS | |
| 1116 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 1117 | Viral load increased | FAERS: 1 | US FAERS | |
| 1118 | Water Intoxication | FAERS: 1 | US FAERS | |
| 1119 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 1120 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 1121 | cancer surgery | FAERS: 1 | US FAERS | |
| 1122 | carbuncle | FAERS: 1 | US FAERS | |
| 1123 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1124 | skin abrasion | FAERS: 1 | US FAERS | |
| 1125 | Incorrect product administration duration | Canada Vigilance: 1 | Canada Vigilance | |
| 1126 | Inspiratory capacity abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1127 | Myocardial Ischemia | 20659403 | CTD | |
| 1128 | Product lot number issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1129 | Product preparation issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1130 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance | |
| 1131 | Therapeutic product effect decreased | Canada Vigilance: 4 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.