Terbinafine
(DOMXUEMWDBAQBQ-WEVVVXLNSA-N)
Structure
- SMILES
- CN(Cc1cccc2c1cccc2)C/C=C/C#CC(C)(C)C
- Type(s)
- Approved; Investigational; Vet_approved
- ATC code(s)
- D01AE15; D01BA02
- Molecular Formula:
- C21H25N
- Molecular Weight:
- 291.430
- Log P:
- 4.8773
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 0
- TPSA:
- 3.24
- CAS Number(s):
- 91161-71-6
Synonym(s)
1.
Terbinafine
2.
(E)-N-(6,6-Dimethyl-2-heptenynyl)-N-methyl-1-naphthalenementhamin hydrochloride
3.
DA 5505
4.
Lamisil
5.
SF 86-327
6.
SF-86-327
7.
TDT-067
8.
Terbinafine Hydrochloride
9.
Terbinafine, (Z)-
10.
Terbinafine, (Z)-isomer
11.
SF 86 327
12.
SF 86327
13.
SF86327
14.
TDT 067
15.
TDT067
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Ageusia | FAERS: 238 Canada Vigilance: 19 | 7475473 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Drug ineffective | FAERS: 222 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 3 | Pruritus | FAERS: 185 Canada Vigilance: 13 | Canada Vigilance SIDER US FAERS | |
| 4 | Aspartate Aminotransferase Increased | FAERS: 177 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 5 | Alanine Aminotransferase Increased | FAERS: 173 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Dysgeusia | FAERS: 163 Canada Vigilance: 12 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Nausea | FAERS: 153 Canada Vigilance: 10 | 10384922 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Fatigue | FAERS: 126 Canada Vigilance: 10 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Blood creatine phosphokinase increased | FAERS: 125 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Malaise | FAERS: 124 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Urticaria | FAERS: 124 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 12 | Weight decreased | FAERS: 124 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 13 | Myalgia | FAERS: 110 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 14 | Gamma-Glutamyltransferase Increased | FAERS: 106 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Erythema | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Arthralgia | FAERS: 96 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 17 | Asthenia | FAERS: 96 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Blood alkaline phosphatase increased | FAERS: 96 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Pain | FAERS: 95 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 20 | Headache | FAERS: 91 Canada Vigilance: 4 | 10384922 18378354 | CTD SIDER Canada Vigilance US FAERS |
| 21 | Dizziness | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 22 | Hypersensitivity | FAERS: 82 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 23 | jaundice | FAERS: 77 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 24 | Rhabdomyolysis | FAERS: 72 | OFFSIDES SIDER US FAERS | |
| 25 | Abdominal Pain | FAERS: 71 Canada Vigilance: 4 | 10384922 | CTD SIDER Canada Vigilance US FAERS |
| 26 | Chromaturia | FAERS: 71 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Vomiting | FAERS: 65 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 28 | Blood lactate dehydrogenase increased | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 29 | Product use in unapproved indication | FAERS: 61 | US FAERS | |
| 30 | Anosmia | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 31 | Anorexia | FAERS: 50 | OFFSIDES SIDER US FAERS | |
| 32 | Anxiety | FAERS: 49 | SIDER US FAERS | |
| 33 | White blood cell count decreased | FAERS: 48 | US FAERS | |
| 34 | Rash erythematous | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Hepatitis | FAERS: 45 Canada Vigilance: 8 | 11508672 15614306 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 36 | Drug exposure during pregnancy | FAERS: 43 | OFFSIDES US FAERS | |
| 37 | Incorrect drug administration duration | FAERS: 38 | US FAERS | |
| 38 | Chills | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Cholestasis | FAERS: 34 Canada Vigilance: 1 | 15122001 15614306 | CTD SIDER Canada Vigilance US FAERS |
| 40 | Swelling | FAERS: 33 | US FAERS | |
| 41 | Infection | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 42 | Lethargy | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Back Pain | FAERS: 30 | US FAERS | |
| 44 | Peripheral swelling | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Inflammation | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Pancytopenia | FAERS: 28 | 11508672 | CTD SIDER US FAERS |
| 47 | Burning sensation | FAERS: 27 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 48 | Drug effect incomplete | FAERS: 27 | US FAERS | |
| 49 | Joint swelling | FAERS: 27 | US FAERS | |
| 50 | Palpitations | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 51 | General physical health deterioration | FAERS: 26 | US FAERS | |
| 52 | Neutropenia | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 53 | Therapeutic response unexpected | FAERS: 26 | OFFSIDES US FAERS | |
| 54 | Alopecia | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Blood creatinine increased | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Erythema Multiforme | FAERS: 25 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 57 | Leukopenia | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 58 | Product quality issue | FAERS: 25 | US FAERS | |
| 59 | Psoriasis | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 60 | Stevens-Johnson Syndrome | FAERS: 25 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 61 | Transaminases increased | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 62 | Arthritis | FAERS: 24 | SIDER US FAERS | |
| 63 | Feeling abnormal | FAERS: 24 | SIDER US FAERS | |
| 64 | Inappropriate schedule of drug administration | FAERS: 23 | US FAERS | |
| 65 | Pneumonia | FAERS: 23 | US FAERS | |
| 66 | Syncope | FAERS: 23 | US FAERS | |
| 67 | Blood cholesterol increased | FAERS: 22 | US FAERS | |
| 68 | Lymphadenopathy | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Skin reaction | FAERS: 22 | US FAERS | |
| 70 | Chest Pain | FAERS: 21 | SIDER US FAERS | |
| 71 | Deafness | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 72 | Drug administered at inappropriate site | FAERS: 21 | US FAERS | |
| 73 | Dyspepsia | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 74 | Thrombocytopenia | FAERS: 21 Canada Vigilance: 1 | 17426078 | CTD SIDER Canada Vigilance US FAERS |
| 75 | Blood glucose increased | FAERS: 20 | US FAERS | |
| 76 | Constipation | FAERS: 20 | US FAERS | |
| 77 | Pancreatitis | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 78 | Pharyngolaryngeal Pain | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 79 | Urinary Retention | FAERS: 20 | US FAERS | |
| 80 | Erythema Nodosum | FAERS: 19 | OFFSIDES US FAERS | |
| 81 | Lip swelling | FAERS: 19 | US FAERS | |
| 82 | Pustular psoriasis | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 83 | Epistaxis | FAERS: 18 | US FAERS | |
| 84 | Neutrophil count decreased | FAERS: 18 | OFFSIDES US FAERS | |
| 85 | Product use issue | FAERS: 18 | US FAERS | |
| 86 | Purpura | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Abdominal discomfort | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Depressed mood | FAERS: 17 | OFFSIDES US FAERS | |
| 89 | Lupus-like syndrome | FAERS: 17 | OFFSIDES US FAERS | |
| 90 | Ocular icterus | FAERS: 17 | OFFSIDES US FAERS | |
| 91 | Thirst | FAERS: 17 | US FAERS | |
| 92 | Tinnitus | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 93 | Application site erythema | FAERS: 16 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 94 | Cellulitis | FAERS: 16 | US FAERS | |
| 95 | Chest discomfort | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Incorrect dose administered | FAERS: 16 | US FAERS | |
| 97 | Skin lesion | FAERS: 16 | OFFSIDES US FAERS | |
| 98 | Tremor | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 99 | Application site pain | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 100 | Blood triglycerides increased | FAERS: 15 | OFFSIDES US FAERS | |
| 101 | Hepatomegaly | FAERS: 15 | 28108177 | CTD US FAERS |
| 102 | Eye pain | FAERS: 14 | OFFSIDES US FAERS | |
| 103 | Oropharyngeal pain | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 104 | Visual disturbance | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 105 | Drug ineffective for unapproved indication | FAERS: 13 | US FAERS | |
| 106 | Skin irritation | FAERS: 13 | US FAERS | |
| 107 | Vasculitis | FAERS: 13 | SIDER US FAERS | |
| 108 | Cytolytic hepatitis | FAERS: 12 | OFFSIDES US FAERS | |
| 109 | Disease recurrence | FAERS: 12 | OFFSIDES US FAERS | |
| 110 | Drug administration error | FAERS: 12 | OFFSIDES US FAERS | |
| 111 | Eosinophilia | FAERS: 12 | SIDER US FAERS | |
| 112 | Incorrect route of drug administration | FAERS: 12 | US FAERS | |
| 113 | Musculoskeletal stiffness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Overdose | FAERS: 12 | US FAERS | |
| 115 | Petechiae | FAERS: 12 | US FAERS | |
| 116 | Wrong technique in drug usage process | FAERS: 12 | US FAERS | |
| 117 | Discomfort | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 118 | Disorientation | FAERS: 11 | US FAERS | |
| 119 | Dry skin | FAERS: 11 | US FAERS | |
| 120 | Dysuria | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Gastroenteritis | FAERS: 11 | US FAERS | |
| 122 | Limb discomfort | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 123 | Lymphocyte count decreased | FAERS: 11 | OFFSIDES US FAERS | |
| 124 | Onychomycosis | FAERS: 11 Canada Vigilance: 4 | CTD Canada Vigilance US FAERS | |
| 125 | Restlessness | FAERS: 11 | US FAERS | |
| 126 | Sneezing | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Systemic lupus erythematosus rash | FAERS: 11 | US FAERS | |
| 128 | Vertigo | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 129 | Activities of daily living impaired | FAERS: 10 | OFFSIDES US FAERS | |
| 130 | Asthma | FAERS: 10 | OFFSIDES US FAERS | |
| 131 | Autoimmune hepatitis | FAERS: 10 | OFFSIDES US FAERS | |
| 132 | Bilirubin conjugated increased | FAERS: 10 | OFFSIDES US FAERS | |
| 133 | Cerebrovascular accident | FAERS: 10 | US FAERS | |
| 134 | Cholestatic liver injury | FAERS: 10 | US FAERS | |
| 135 | Eczema | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 136 | Lipase increased | FAERS: 10 | US FAERS | |
| 137 | Myocardial Infarction | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Neck Pain | FAERS: 10 | US FAERS | |
| 139 | Tinea Pedis | FAERS: 10 | OFFSIDES US FAERS | |
| 140 | Toxic Epidermal Necrolysis | FAERS: 10 | SIDER US FAERS | |
| 141 | Accidental exposure to product | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Angioedema | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 143 | Application site irritation | FAERS: 9 | OFFSIDES US FAERS | |
| 144 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 145 | Blood amylase increased | FAERS: 9 | OFFSIDES US FAERS | |
| 146 | Blood urea increased | FAERS: 9 | SIDER US FAERS | |
| 147 | Bone pain | FAERS: 9 | US FAERS | |
| 148 | Colitis | FAERS: 9 | US FAERS | |
| 149 | Diabetes Mellitus | FAERS: 9 | US FAERS | |
| 150 | Drug toxicity | FAERS: 9 | US FAERS | |
| 151 | Flatulence | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 152 | Hepatotoxicity | FAERS: 9 | US FAERS | |
| 153 | Lymphoma | FAERS: 9 | OFFSIDES US FAERS | |
| 154 | MYELODYSPLASTIC SYNDROME | FAERS: 9 | US FAERS | |
| 155 | Myoglobin blood increased | FAERS: 9 | OFFSIDES US FAERS | |
| 156 | Nasopharyngitis | FAERS: 9 Canada Vigilance: 1 | 18378354 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 157 | Protein urine present | FAERS: 9 | US FAERS | |
| 158 | Urinary tract infection | FAERS: 9 | US FAERS | |
| 159 | Wrong technique in product usage process | FAERS: 9 | US FAERS | |
| 160 | Agranulocytosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 161 | Ascites | FAERS: 8 | US FAERS | |
| 162 | Blood albumin decreased | FAERS: 8 | US FAERS | |
| 163 | Concomitant disease aggravated | FAERS: 8 | OFFSIDES US FAERS | |
| 164 | Diplopia | FAERS: 8 | OFFSIDES US FAERS | |
| 165 | Exfoliative rash | FAERS: 8 | OFFSIDES US FAERS | |
| 166 | Hypophagia | FAERS: 8 | US FAERS | |
| 167 | Influenza | FAERS: 8 | SIDER US FAERS | |
| 168 | Night sweats | FAERS: 8 | US FAERS | |
| 169 | Oliguria | FAERS: 8 | US FAERS | |
| 170 | Product substitution issue | FAERS: 8 | US FAERS | |
| 171 | Proteinuria | FAERS: 8 | US FAERS | |
| 172 | Quality of life decreased | FAERS: 8 | US FAERS | |
| 173 | Skin necrosis | FAERS: 8 | US FAERS | |
| 174 | Somnolence | FAERS: 8 | US FAERS | |
| 175 | Deafness Neurosensory | FAERS: 7 | OFFSIDES US FAERS | |
| 176 | Dehydration | FAERS: 7 | US FAERS | |
| 177 | Dermatitis | FAERS: 7 | SIDER US FAERS | |
| 178 | Drug effect delayed | FAERS: 7 | US FAERS | |
| 179 | Electrocardiogram QT interval abnormal | FAERS: 7 | US FAERS | |
| 180 | Erysipelas | FAERS: 7 | OFFSIDES US FAERS | |
| 181 | Expired product administered | FAERS: 7 | US FAERS | |
| 182 | Gastritis | FAERS: 7 | SIDER US FAERS | |
| 183 | Hepatitis B | FAERS: 7 | OFFSIDES US FAERS | |
| 184 | Hepatitis C | FAERS: 7 | OFFSIDES US FAERS | |
| 185 | Intentional drug misuse | FAERS: 7 | US FAERS | |
| 186 | Leukocytosis | FAERS: 7 | US FAERS | |
| 187 | Lymphocyte stimulation test positive | FAERS: 7 | OFFSIDES US FAERS | |
| 188 | Medication Error | FAERS: 7 | US FAERS | |
| 189 | Musculoskeletal discomfort | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 190 | Myositis | FAERS: 7 | US FAERS | |
| 191 | Neuralgia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 192 | Photodermatosis | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 193 | Polyarthritis | FAERS: 7 | US FAERS | |
| 194 | Purulent discharge | FAERS: 7 | OFFSIDES US FAERS | |
| 195 | Saliva altered | FAERS: 7 | US FAERS | |
| 196 | Shock | FAERS: 7 | US FAERS | |
| 197 | Stress | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 198 | Visual Impairment | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 199 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 200 | Application site swelling | FAERS: 6 | OFFSIDES US FAERS | |
| 201 | Arthropathy | FAERS: 6 | OFFSIDES US FAERS | |
| 202 | Breast tenderness | FAERS: 6 | US FAERS | |
| 203 | Cataract | FAERS: 6 | OFFSIDES US FAERS | |
| 204 | Cholecystitis | FAERS: 6 | US FAERS | |
| 205 | Drug administered to patient of inappropriate age | FAERS: 6 | US FAERS | |
| 206 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 207 | Emotional disorder | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 208 | Emotional distress | FAERS: 6 | US FAERS | |
| 209 | Epidermal necrosis | FAERS: 6 | US FAERS | |
| 210 | Glaucoma | FAERS: 6 | OFFSIDES US FAERS | |
| 211 | Hypogeusia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 212 | Low density lipoprotein increased | FAERS: 6 | US FAERS | |
| 213 | Mental impairment | FAERS: 6 | OFFSIDES US FAERS | |
| 214 | Monocyte count increased | FAERS: 6 | US FAERS | |
| 215 | Neutrophil percentage decreased | FAERS: 6 | US FAERS | |
| 216 | Oral pain | FAERS: 6 | US FAERS | |
| 217 | Pain of skin | FAERS: 6 | US FAERS | |
| 218 | Pallor | FAERS: 6 | US FAERS | |
| 219 | Platelet count abnormal | FAERS: 6 | OFFSIDES US FAERS | |
| 220 | Pregnancy | FAERS: 6 | US FAERS | |
| 221 | Presyncope | FAERS: 6 | US FAERS | |
| 222 | Renal Colic | FAERS: 6 | OFFSIDES US FAERS | |
| 223 | Sepsis | FAERS: 6 | US FAERS | |
| 224 | Sudden death | FAERS: 6 | US FAERS | |
| 225 | Throat irritation | FAERS: 6 | US FAERS | |
| 226 | Vitreous opacities | FAERS: 6 | US FAERS | |
| 227 | Abasia | FAERS: 5 | US FAERS | |
| 228 | Application site burn | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 229 | Blood bilirubin abnormal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 230 | Blood glucose decreased | FAERS: 5 | US FAERS | |
| 231 | Blood immunoglobulin G increased | FAERS: 5 | OFFSIDES US FAERS | |
| 232 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 233 | Cheilitis | FAERS: 5 | US FAERS | |
| 234 | Disseminated Intravascular Coagulation | FAERS: 5 | US FAERS | |
| 235 | Erectile dysfunction | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 236 | Expired drug administered | FAERS: 5 | US FAERS | |
| 237 | Eye irritation | FAERS: 5 | US FAERS | |
| 238 | Feeling jittery | FAERS: 5 | US FAERS | |
| 239 | Genital discharge | FAERS: 5 | OFFSIDES US FAERS | |
| 240 | Hepatic necrosis | FAERS: 5 | US FAERS | |
| 241 | Impaired work ability | FAERS: 5 | OFFSIDES US FAERS | |
| 242 | Joint stiffness | FAERS: 5 | US FAERS | |
| 243 | Lichen Planus | FAERS: 5 | US FAERS | |
| 244 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 245 | Lymphocyte percentage increased | FAERS: 5 | US FAERS | |
| 246 | Lymphocytosis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 247 | Memory impairment | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Menorrhagia | FAERS: 5 | US FAERS | |
| 249 | Mucosal erosion | FAERS: 5 | US FAERS | |
| 250 | No adverse event | FAERS: 5 | US FAERS | |
| 251 | Occupational exposure to product | FAERS: 5 | US FAERS | |
| 252 | Oropharyngeal swelling | FAERS: 5 | OFFSIDES US FAERS | |
| 253 | Poisoning | FAERS: 5 | US FAERS | |
| 254 | Polyuria | FAERS: 5 | US FAERS | |
| 255 | Product lot number issue | FAERS: 5 | US FAERS | |
| 256 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 257 | Retching | FAERS: 5 | US FAERS | |
| 258 | Rhinitis | FAERS: 5 | US FAERS | |
| 259 | Sinusitis | FAERS: 5 | US FAERS | |
| 260 | Skin Ulcer | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Skin hypertrophy | FAERS: 5 | US FAERS | |
| 262 | Stomatitis | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 263 | Streptokinase antibody increased | FAERS: 5 | OFFSIDES US FAERS | |
| 264 | Superinfection | FAERS: 5 | US FAERS | |
| 265 | Tachycardia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 266 | Thrombocytopenic purpura | FAERS: 5 | US FAERS | |
| 267 | Tongue blistering | FAERS: 5 | US FAERS | |
| 268 | Transmission of drug via semen | FAERS: 5 | OFFSIDES US FAERS | |
| 269 | Acne | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 270 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 271 | Adverse event | FAERS: 4 | US FAERS | |
| 272 | Alanine aminotransferase abnormal | FAERS: 4 | US FAERS | |
| 273 | Aldolase increased | FAERS: 4 | OFFSIDES US FAERS | |
| 274 | Alpha 2 globulin increased | FAERS: 4 | OFFSIDES US FAERS | |
| 275 | Application site pruritus | FAERS: 4 | US FAERS | |
| 276 | Biliary Colic | FAERS: 4 | US FAERS | |
| 277 | Biopsy liver abnormal | FAERS: 4 | OFFSIDES US FAERS | |
| 278 | Biopsy | FAERS: 4 | US FAERS | |
| 279 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 280 | Blood creatine phosphokinase MB increased | FAERS: 4 | OFFSIDES US FAERS | |
| 281 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 282 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 283 | Blood urine present | FAERS: 4 | US FAERS | |
| 284 | Cholangitis | FAERS: 4 | US FAERS | |
| 285 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 286 | Colectomy | FAERS: 4 | US FAERS | |
| 287 | Creatinine renal clearance decreased | FAERS: 4 | US FAERS | |
| 288 | Crying | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Delirium | FAERS: 4 | US FAERS | |
| 290 | Dementia | FAERS: 4 | US FAERS | |
| 291 | Device related infection | FAERS: 4 | US FAERS | |
| 292 | Dysarthria | FAERS: 4 | US FAERS | |
| 293 | Enzyme Inhibition | FAERS: 4 | US FAERS | |
| 294 | Epilepsy | FAERS: 4 | OFFSIDES US FAERS | |
| 295 | Flank Pain | FAERS: 4 | OFFSIDES US FAERS | |
| 296 | Glossitis | FAERS: 4 | OFFSIDES US FAERS | |
| 297 | Hepatosplenomegaly | FAERS: 4 | US FAERS | |
| 298 | Hypotension | FAERS: 4 | US FAERS | |
| 299 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 300 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 301 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 302 | Iridocyclitis | FAERS: 4 | OFFSIDES US FAERS | |
| 303 | Lactation Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 304 | Lymphopenia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Metrorrhagia | FAERS: 4 | US FAERS | |
| 306 | Multiple sclerosis relapse | FAERS: 4 | US FAERS | |
| 307 | Myoglobinaemia | FAERS: 4 | OFFSIDES US FAERS | |
| 308 | Onychalgia | FAERS: 4 | US FAERS | |
| 309 | Papule | FAERS: 4 | US FAERS | |
| 310 | Pathogen resistance | FAERS: 4 | US FAERS | |
| 311 | Pityriasis Rosea | FAERS: 4 | US FAERS | |
| 312 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 313 | Product administered at inappropriate site | FAERS: 4 | US FAERS | |
| 314 | Product complaint | FAERS: 4 | US FAERS | |
| 315 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 316 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 317 | Rheumatoid factor increased | FAERS: 4 | OFFSIDES US FAERS | |
| 318 | Skin tightness | FAERS: 4 | US FAERS | |
| 319 | Solar urticaria | FAERS: 4 | OFFSIDES US FAERS | |
| 320 | Splenectomy | FAERS: 4 | OFFSIDES US FAERS | |
| 321 | Stroke in evolution | FAERS: 4 | OFFSIDES US FAERS | |
| 322 | Subcutaneous Abscess | FAERS: 4 | US FAERS | |
| 323 | Temporal Arteritis | FAERS: 4 | OFFSIDES US FAERS | |
| 324 | Thermal burn | FAERS: 4 | US FAERS | |
| 325 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 326 | Trichophytosis | FAERS: 4 | US FAERS | |
| 327 | Unevaluable event | FAERS: 4 | US FAERS | |
| 328 | VIIth nerve paralysis | FAERS: 4 | US FAERS | |
| 329 | Vitiligo | FAERS: 4 | US FAERS | |
| 330 | White blood cell agglutination present | FAERS: 4 | OFFSIDES US FAERS | |
| 331 | Abnormal weight gain | FAERS: 3 | US FAERS | |
| 332 | Accidental exposure | FAERS: 3 | US FAERS | |
| 333 | Activated partial thromboplastin time shortened | FAERS: 3 | OFFSIDES US FAERS | |
| 334 | Alopecia totalis | FAERS: 3 | OFFSIDES US FAERS | |
| 335 | Ammonia increased | FAERS: 3 | US FAERS | |
| 336 | Amnesia | FAERS: 3 | US FAERS | |
| 337 | Anal abscess | FAERS: 3 | US FAERS | |
| 338 | Anger | FAERS: 3 | US FAERS | |
| 339 | Antiphospholipid antibodies positive | FAERS: 3 | US FAERS | |
| 340 | Application site exfoliation | FAERS: 3 | US FAERS | |
| 341 | Asthenopia | FAERS: 3 | US FAERS | |
| 342 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 343 | Blindness | FAERS: 3 | US FAERS | |
| 344 | Blood blister | FAERS: 3 | OFFSIDES US FAERS | |
| 345 | Blood cholinesterase decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 346 | Blood cholinesterase increased | FAERS: 3 | US FAERS | |
| 347 | Blood creatinine decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 348 | Blood immunoglobulin A increased | FAERS: 3 | US FAERS | |
| 349 | Blood iron increased | FAERS: 3 | OFFSIDES US FAERS | |
| 350 | Bone marrow depression | FAERS: 3 | OFFSIDES US FAERS | |
| 351 | Bronchitis | FAERS: 3 | OFFSIDES US FAERS | |
| 352 | Cachexia | FAERS: 3 | US FAERS | |
| 353 | Cardiac Tamponade | FAERS: 3 | US FAERS | |
| 354 | Chemical burn of skin | FAERS: 3 | OFFSIDES US FAERS | |
| 355 | Choking | FAERS: 3 | US FAERS | |
| 356 | Circumstance or information capable of leading to medication error | FAERS: 3 | OFFSIDES US FAERS | |
| 357 | Cold sweat | FAERS: 3 | US FAERS | |
| 358 | Complications of maternal exposure to therapeutic drugs | FAERS: 3 | OFFSIDES US FAERS | |
| 359 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 360 | Dermatomyositis | FAERS: 3 | US FAERS | |
| 361 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 362 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 363 | Drug effective for unapproved indication | FAERS: 3 | US FAERS | |
| 364 | Drug resistance | FAERS: 3 | US FAERS | |
| 365 | Ecchymosis | FAERS: 3 | US FAERS | |
| 366 | Endocarditis | FAERS: 3 | OFFSIDES US FAERS | |
| 367 | Endothelial dysfunction | FAERS: 3 | OFFSIDES US FAERS | |
| 368 | Enteritis | FAERS: 3 | US FAERS | |
| 369 | Erythrodermic psoriasis | FAERS: 3 | OFFSIDES US FAERS | |
| 370 | Eye Redness | FAERS: 3 | US FAERS | |
| 371 | Fracture | FAERS: 3 | US FAERS | |
| 372 | Gingival erythema | FAERS: 3 | US FAERS | |
| 373 | Gingivitis | FAERS: 3 | US FAERS | |
| 374 | Granuloma | FAERS: 3 | OFFSIDES US FAERS | |
| 375 | Hypokinesia | FAERS: 3 | US FAERS | |
| 376 | Immobile | FAERS: 3 | US FAERS | |
| 377 | Inability to afford medication | FAERS: 3 | US FAERS | |
| 378 | Infarction | FAERS: 3 | US FAERS | |
| 379 | Intentional product misuse | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 380 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 381 | Lymphocyte count increased | FAERS: 3 | US FAERS | |
| 382 | Markedly reduced dietary intake | FAERS: 3 | US FAERS | |
| 383 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 384 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 385 | Musculoskeletal chest pain | FAERS: 3 | OFFSIDES US FAERS | |
| 386 | Nephrectomy | FAERS: 3 | OFFSIDES US FAERS | |
| 387 | Nephrolithiasis | FAERS: 3 | OFFSIDES US FAERS | |
| 388 | Nervousness | FAERS: 3 | US FAERS | |
| 389 | Neutrophil percentage increased | FAERS: 3 | US FAERS | |
| 390 | Onychoclasis | FAERS: 3 | US FAERS | |
| 391 | Oropharyngeal blistering | FAERS: 3 | OFFSIDES US FAERS | |
| 392 | Paradoxical drug reaction | FAERS: 3 | US FAERS | |
| 393 | Polydipsia | FAERS: 3 | US FAERS | |
| 394 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 395 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 396 | Productive Cough | FAERS: 3 | OFFSIDES US FAERS | |
| 397 | Prurigo | FAERS: 3 | US FAERS | |
| 398 | Rales | FAERS: 3 | US FAERS | |
| 399 | Renal pain | FAERS: 3 | US FAERS | |
| 400 | Reticulocyte count increased | FAERS: 3 | OFFSIDES US FAERS | |
| 401 | Retinal Degeneration | FAERS: 3 | OFFSIDES US FAERS | |
| 402 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 403 | Retinal Vein Occlusion | FAERS: 3 | OFFSIDES US FAERS | |
| 404 | Sciatica | FAERS: 3 | US FAERS | |
| 405 | Serum Sickness | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 406 | Shoulder Pain | FAERS: 3 | OFFSIDES US FAERS | |
| 407 | Skin dystrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 408 | Skin test positive | FAERS: 3 | US FAERS | |
| 409 | Soft Tissue Infection | FAERS: 3 | US FAERS | |
| 410 | Stridor | FAERS: 3 | OFFSIDES US FAERS | |
| 411 | Sunburn | FAERS: 3 | US FAERS | |
| 412 | Therapeutic product contamination | FAERS: 3 | US FAERS | |
| 413 | Tongue discomfort | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 414 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 415 | Venous Injury | FAERS: 3 | OFFSIDES US FAERS | |
| 416 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 417 | Wheezing | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 418 | Wound Debridement | FAERS: 3 | OFFSIDES US FAERS | |
| 419 | prostatitis | FAERS: 3 | US FAERS | |
| 420 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 421 | Abscess | FAERS: 2 | US FAERS | |
| 422 | Acute myocardial infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 423 | Agitation | FAERS: 2 | US FAERS | |
| 424 | Alpha hydroxybutyrate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 425 | Angioplasty | FAERS: 2 | US FAERS | |
| 426 | Anti-SS-A antibody positive | FAERS: 2 | OFFSIDES US FAERS | |
| 427 | Application site discomfort | FAERS: 2 | US FAERS | |
| 428 | Application site inflammation | FAERS: 2 | US FAERS | |
| 429 | Application site reaction | FAERS: 2 | US FAERS | |
| 430 | Application site ulcer | FAERS: 2 | US FAERS | |
| 431 | Application site vesicles | FAERS: 2 | US FAERS | |
| 432 | Application site warmth | FAERS: 2 | US FAERS | |
| 433 | Bedridden | FAERS: 2 | US FAERS | |
| 434 | Biliary dilatation | FAERS: 2 | OFFSIDES US FAERS | |
| 435 | Biopsy bone marrow abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 436 | Blast cells present | FAERS: 2 | OFFSIDES US FAERS | |
| 437 | Blepharitis | FAERS: 2 | US FAERS | |
| 438 | Blood bilirubin unconjugated increased | FAERS: 2 | OFFSIDES US FAERS | |
| 439 | Blood creatine phosphokinase MM | FAERS: 2 | US FAERS | |
| 440 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 441 | Blood immunoglobulin E decreased | FAERS: 2 | US FAERS | |
| 442 | Blood immunoglobulin E increased | FAERS: 2 | US FAERS | |
| 443 | Blood iron decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 444 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 445 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 446 | Blood uric acid decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 447 | Bone density decreased | FAERS: 2 | US FAERS | |
| 448 | Bronchospasm | FAERS: 2 | US FAERS | |
| 449 | Butterfly rash | FAERS: 2 | US FAERS | |
| 450 | Callus formation delayed | FAERS: 2 | OFFSIDES US FAERS | |
| 451 | Carbohydrate antigen 19-9 increased | FAERS: 2 | US FAERS | |
| 452 | Cataract operation | FAERS: 2 | OFFSIDES US FAERS | |
| 453 | Cell Death | FAERS: 2 | US FAERS | |
| 454 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 455 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 456 | Corneal lesion | FAERS: 2 | US FAERS | |
| 457 | Cytomegalovirus antibody positive | FAERS: 2 | OFFSIDES US FAERS | |
| 458 | Deep Vein Thrombosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 459 | Dermatophytosis | FAERS: 2 | OFFSIDES US FAERS | |
| 460 | Drug Dependence | FAERS: 2 | US FAERS | |
| 461 | Drug exposure before pregnancy | FAERS: 2 | OFFSIDES US FAERS | |
| 462 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 463 | Economic problem | FAERS: 2 | OFFSIDES US FAERS | |
| 464 | Embolism | FAERS: 2 | OFFSIDES US FAERS | |
| 465 | Excoriation | FAERS: 2 | US FAERS | |
| 466 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 467 | Eye Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 468 | Facial Pain | FAERS: 2 | US FAERS | |
| 469 | Facial Paresis | FAERS: 2 | US FAERS | |
| 470 | Familial Mediterranean Fever | FAERS: 2 | OFFSIDES US FAERS | |
| 471 | Feeding disorder neonatal | FAERS: 2 | OFFSIDES US FAERS | |
| 472 | Flushing | FAERS: 2 | US FAERS | |
| 473 | Formication | FAERS: 2 | OFFSIDES US FAERS | |
| 474 | Gamma-glutamyltransferase decreased | FAERS: 2 | US FAERS | |
| 475 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 476 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 477 | Gout | FAERS: 2 | OFFSIDES US FAERS | |
| 478 | Growing pains | FAERS: 2 | US FAERS | |
| 479 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 480 | Head discomfort | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 481 | Hemiparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 482 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 483 | Hepatitis A antibody positive | FAERS: 2 | US FAERS | |
| 484 | Hernia | FAERS: 2 | OFFSIDES US FAERS | |
| 485 | Hunger | FAERS: 2 | US FAERS | |
| 486 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 487 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 488 | Infertility | FAERS: 2 | OFFSIDES US FAERS | |
| 489 | Light chain analysis increased | FAERS: 2 | US FAERS | |
| 490 | Lyme Disease | FAERS: 2 | OFFSIDES US FAERS | |
| 491 | Lymphocyte percentage decreased | FAERS: 2 | US FAERS | |
| 492 | Lymphocyte stimulation test negative | FAERS: 2 | OFFSIDES US FAERS | |
| 493 | Malabsorption | FAERS: 2 | US FAERS | |
| 494 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 495 | Medial Tibial Stress Syndrome | FAERS: 2 | US FAERS | |
| 496 | Megakaryocytes decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 497 | Megaloblasts increased | FAERS: 2 | OFFSIDES US FAERS | |
| 498 | Mental status changes | FAERS: 2 | US FAERS | |
| 499 | Middle insomnia | FAERS: 2 | US FAERS | |
| 500 | Monocyte morphology abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 501 | Mycosis Fungoides | FAERS: 2 | OFFSIDES US FAERS | |
| 502 | Myoglobin urine present | FAERS: 2 | OFFSIDES US FAERS | |
| 503 | Nail Infection | FAERS: 2 | US FAERS | |
| 504 | Nasal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 505 | Open wound | FAERS: 2 | OFFSIDES US FAERS | |
| 506 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 507 | Osteoporosis | FAERS: 2 | US FAERS | |
| 508 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 509 | Pemphigus | FAERS: 2 | US FAERS | |
| 510 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 511 | Peripheral nerve lesion | FAERS: 2 | OFFSIDES US FAERS | |
| 512 | Perivascular dermatitis | FAERS: 2 | US FAERS | |
| 513 | Pharmaceutical product counterfeit | FAERS: 2 | OFFSIDES US FAERS | |
| 514 | Phlebitis | FAERS: 2 | US FAERS | |
| 515 | Photophobia | FAERS: 2 | US FAERS | |
| 516 | Plasmapheresis | FAERS: 2 | OFFSIDES US FAERS | |
| 517 | Pleurisy | FAERS: 2 | US FAERS | |
| 518 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 519 | Prothrombin time ratio | FAERS: 2 | US FAERS | |
| 520 | Pseudohyperkalaemia | FAERS: 2 | OFFSIDES US FAERS | |
| 521 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 522 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 523 | Rash scaly | FAERS: 2 | US FAERS | |
| 524 | Reaction to preservatives | FAERS: 2 | OFFSIDES US FAERS | |
| 525 | Respiratory distress | FAERS: 2 | US FAERS | |
| 526 | Secretion discharge | FAERS: 2 | OFFSIDES US FAERS | |
| 527 | Semen abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 528 | Sjogren's Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 529 | Skin laceration | FAERS: 2 | US FAERS | |
| 530 | Splenomegaly | FAERS: 2 | US FAERS | |
| 531 | Subcorneal pustular dermatosis | FAERS: 2 | OFFSIDES US FAERS | |
| 532 | Suicide attempt | FAERS: 2 | US FAERS | |
| 533 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 534 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 2 | US FAERS | |
| 535 | Temperature regulation disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 536 | Tension | FAERS: 2 | US FAERS | |
| 537 | Thirst decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 538 | Thrombosis | FAERS: 2 | US FAERS | |
| 539 | Thyroiditis | FAERS: 2 | US FAERS | |
| 540 | Tinea cruris | FAERS: 2 | OFFSIDES US FAERS | |
| 541 | Tongue eruption | FAERS: 2 | OFFSIDES US FAERS | |
| 542 | Tonsillitis | FAERS: 2 | OFFSIDES US FAERS | |
| 543 | Transferrin increased | FAERS: 2 | OFFSIDES US FAERS | |
| 544 | Unintentional use for unapproved indication | FAERS: 2 | US FAERS | |
| 545 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 546 | Urinary sediment abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 547 | Urine output increased | FAERS: 2 | US FAERS | |
| 548 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 549 | Viral load decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 550 | Vulvovaginal dryness | FAERS: 2 | US FAERS | |
| 551 | Wound necrosis | FAERS: 2 | US FAERS | |
| 552 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 553 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 554 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 555 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 556 | Activated Protein C Resistance | FAERS: 1 | US FAERS | |
| 557 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 558 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 559 | Allodynia | FAERS: 1 | US FAERS | |
| 560 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 561 | Anal erosion | FAERS: 1 | US FAERS | |
| 562 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 563 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 564 | Anencephaly | FAERS: 1 | US FAERS | |
| 565 | Anhedonia | FAERS: 1 | US FAERS | |
| 566 | Anti-SS-B antibody positive | FAERS: 1 | US FAERS | |
| 567 | Aphagia | FAERS: 1 | US FAERS | |
| 568 | Aphonia | FAERS: 1 | US FAERS | |
| 569 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 570 | Apparent death | FAERS: 1 | US FAERS | |
| 571 | Application site acne | FAERS: 1 | US FAERS | |
| 572 | Application site alopecia | FAERS: 1 | US FAERS | |
| 573 | Application site dryness | FAERS: 1 | US FAERS | |
| 574 | Application site erosion | FAERS: 1 | US FAERS | |
| 575 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 576 | Application site rash | FAERS: 1 | US FAERS | |
| 577 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 578 | Arthropod bite | FAERS: 1 | OFFSIDES US FAERS | |
| 579 | Asbestosis | FAERS: 1 | OFFSIDES US FAERS | |
| 580 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 581 | Asphyxia | FAERS: 1 | US FAERS | |
| 582 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 583 | Autoantibody positive | FAERS: 1 | OFFSIDES US FAERS | |
| 584 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 585 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 586 | Azoospermia | FAERS: 1 | US FAERS | |
| 587 | Bacterial culture positive | FAERS: 1 | US FAERS | |
| 588 | Band neutrophil percentage decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 589 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 590 | Biopsy bladder normal | FAERS: 1 | US FAERS | |
| 591 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 592 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 593 | Blepharospasm | FAERS: 1 | US FAERS | |
| 594 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 595 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 596 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 597 | Bone marrow necrosis | FAERS: 1 | US FAERS | |
| 598 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 599 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 600 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 601 | Buccal mucosal roughening | FAERS: 1 | OFFSIDES US FAERS | |
| 602 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 603 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 604 | Candidiasis | FAERS: 1 | US FAERS | |
| 605 | Cardiac Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 606 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 607 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 608 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 609 | Catatonia | FAERS: 1 | US FAERS | |
| 610 | Catheter placement | FAERS: 1 | OFFSIDES US FAERS | |
| 611 | Caustic injury | FAERS: 1 | US FAERS | |
| 612 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 613 | Chemical injury | FAERS: 1 | US FAERS | |
| 614 | Choledochoenterostomy | FAERS: 1 | OFFSIDES US FAERS | |
| 615 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 616 | Coagulation factor X level decreased | FAERS: 1 | US FAERS | |
| 617 | Coital bleeding | FAERS: 1 | OFFSIDES US FAERS | |
| 618 | Collagen-vascular disease | FAERS: 1 | US FAERS | |
| 619 | Complement factor increased | FAERS: 1 | US FAERS | |
| 620 | Completed Suicide | FAERS: 1 | US FAERS | |
| 621 | Congenital heart valve disorder | FAERS: 1 | US FAERS | |
| 622 | Conjunctival ulcer | FAERS: 1 | US FAERS | |
| 623 | Contact lens complication | FAERS: 1 | US FAERS | |
| 624 | Corneal erosion | FAERS: 1 | US FAERS | |
| 625 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 626 | Cyanosis | FAERS: 1 | US FAERS | |
| 627 | Cystitis | FAERS: 1 | US FAERS | |
| 628 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 629 | Deformity | FAERS: 1 | US FAERS | |
| 630 | Demyelination | FAERS: 1 | US FAERS | |
| 631 | Device material issue | FAERS: 1 | US FAERS | |
| 632 | Differential white blood cell count abnormal | FAERS: 1 | US FAERS | |
| 633 | Disability | FAERS: 1 | US FAERS | |
| 634 | Dissociation | FAERS: 1 | US FAERS | |
| 635 | Drug abuser | FAERS: 1 | US FAERS | |
| 636 | Drug screen positive | FAERS: 1 | US FAERS | |
| 637 | Dysphonia | FAERS: 1 | US FAERS | |
| 638 | Early satiety | FAERS: 1 | US FAERS | |
| 639 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 640 | Eczema weeping | FAERS: 1 | OFFSIDES US FAERS | |
| 641 | Educational problem | FAERS: 1 | US FAERS | |
| 642 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 643 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 644 | Elevated mood | FAERS: 1 | US FAERS | |
| 645 | Eosinophilic Pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 646 | Eosinophilic colitis | FAERS: 1 | US FAERS | |
| 647 | Epicondylitis | FAERS: 1 | US FAERS | |
| 648 | Epstein-Barr virus antibody positive | FAERS: 1 | OFFSIDES US FAERS | |
| 649 | Eructation | FAERS: 1 | SIDER US FAERS | |
| 650 | Exercise capacity decreased | FAERS: 1 | US FAERS | |
| 651 | Extensive swelling of vaccinated limb | FAERS: 1 | US FAERS | |
| 652 | Eye allergy | FAERS: 1 | US FAERS | |
| 653 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 654 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 655 | Feeling Cold | FAERS: 1 | US FAERS | |
| 656 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 657 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 658 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 659 | Fibrosis | FAERS: 1 | US FAERS | |
| 660 | Food Allergy | FAERS: 1 | US FAERS | |
| 661 | Frustration | FAERS: 1 | US FAERS | |
| 662 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 663 | Gastrointestinal erosion | FAERS: 1 | US FAERS | |
| 664 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 665 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 666 | Genital discomfort | FAERS: 1 | US FAERS | |
| 667 | Gingival Recession | FAERS: 1 | US FAERS | |
| 668 | HIV antibody positive | FAERS: 1 | US FAERS | |
| 669 | Hepatic siderosis | FAERS: 1 | US FAERS | |
| 670 | Hepatic vein stenosis | FAERS: 1 | US FAERS | |
| 671 | Hepatitis A | FAERS: 1 | OFFSIDES US FAERS | |
| 672 | Hepatitis B core antigen positive | FAERS: 1 | US FAERS | |
| 673 | Hepatitis C antibody positive | FAERS: 1 | OFFSIDES US FAERS | |
| 674 | Hepatitis C positive | FAERS: 1 | US FAERS | |
| 675 | Hepatitis C virus test positive | FAERS: 1 | US FAERS | |
| 676 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 677 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 678 | Hypersomnia | FAERS: 1 | US FAERS | |
| 679 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 680 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 681 | Impaired self-care | FAERS: 1 | US FAERS | |
| 682 | Impetigo | FAERS: 1 | US FAERS | |
| 683 | Inappropriate schedule of product administration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 684 | Incontinence | FAERS: 1 | US FAERS | |
| 685 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 686 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 687 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 688 | Infection reactivation | FAERS: 1 | US FAERS | |
| 689 | Injection site warmth | FAERS: 1 | US FAERS | |
| 690 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 691 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 692 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 693 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 694 | Irregular sleep wake rhythm disorder | FAERS: 1 | US FAERS | |
| 695 | Juvenile arthritis | FAERS: 1 | US FAERS | |
| 696 | Keratitis | FAERS: 1 | US FAERS | |
| 697 | Laceration | FAERS: 1 | US FAERS | |
| 698 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 699 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 700 | Liver Abscess | FAERS: 1 | US FAERS | |
| 701 | Loose tooth | FAERS: 1 | US FAERS | |
| 702 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 703 | Lymphangitis | FAERS: 1 | OFFSIDES US FAERS | |
| 704 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 705 | Macular degeneration | FAERS: 1 | US FAERS | |
| 706 | Macule | FAERS: 1 | US FAERS | |
| 707 | Mechanical ventilation | FAERS: 1 | OFFSIDES US FAERS | |
| 708 | Meningism | FAERS: 1 | US FAERS | |
| 709 | Menopause | FAERS: 1 | US FAERS | |
| 710 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 711 | Miliaria | FAERS: 1 | US FAERS | |
| 712 | Mixed Connective Tissue Disease | FAERS: 1 | US FAERS | |
| 713 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 714 | Monocyte percentage increased | FAERS: 1 | OFFSIDES US FAERS | |
| 715 | Monocytosis | FAERS: 1 | US FAERS | |
| 716 | Mood swings | FAERS: 1 | US FAERS | |
| 717 | Mouth swelling | FAERS: 1 | US FAERS | |
| 718 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 719 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 720 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 721 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 722 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 723 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 724 | Myokymia | FAERS: 1 | US FAERS | |
| 725 | Nail necrosis | FAERS: 1 | US FAERS | |
| 726 | Nephritis | FAERS: 1 | US FAERS | |
| 727 | Nephrotic Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 728 | Nerve injury | FAERS: 1 | US FAERS | |
| 729 | Neuropathy | FAERS: 1 | US FAERS | |
| 730 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 731 | Nodule | FAERS: 1 | US FAERS | |
| 732 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 733 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 734 | Obesity | FAERS: 1 | US FAERS | |
| 735 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 736 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 737 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 738 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 739 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 740 | Optic Neuritis | FAERS: 1 | OFFSIDES US FAERS | |
| 741 | Osteitis | FAERS: 1 | US FAERS | |
| 742 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 743 | Otitis Media | FAERS: 1 | US FAERS | |
| 744 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 745 | Pancreas lipomatosis | FAERS: 1 | US FAERS | |
| 746 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 747 | Pancreatic Insufficiency | FAERS: 1 | OFFSIDES US FAERS | |
| 748 | Pancreatic enzymes abnormal | FAERS: 1 | US FAERS | |
| 749 | Panic Disorder | FAERS: 1 | US FAERS | |
| 750 | Parvovirus B19 serology positive | FAERS: 1 | US FAERS | |
| 751 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 752 | Penile blister | FAERS: 1 | US FAERS | |
| 753 | Penile erythema | FAERS: 1 | US FAERS | |
| 754 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 755 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 756 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 757 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 758 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 759 | Polymyositis | FAERS: 1 | US FAERS | |
| 760 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 761 | Post procedural complication | FAERS: 1 | US FAERS | |
| 762 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 763 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 764 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 765 | Product counterfeit | FAERS: 1 | US FAERS | |
| 766 | Product label issue | FAERS: 1 | US FAERS | |
| 767 | Product primary packaging issue | FAERS: 1 | US FAERS | |
| 768 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 769 | Protein total decreased | FAERS: 1 | US FAERS | |
| 770 | Protein total increased | FAERS: 1 | OFFSIDES US FAERS | |
| 771 | Pseudocyst | FAERS: 1 | US FAERS | |
| 772 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 773 | Purulence | FAERS: 1 | US FAERS | |
| 774 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 775 | Q Fever | FAERS: 1 | US FAERS | |
| 776 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 777 | Rebound effect | FAERS: 1 | US FAERS | |
| 778 | Renal vasculitis | FAERS: 1 | US FAERS | |
| 779 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 780 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 781 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 782 | Retinal exudates | FAERS: 1 | US FAERS | |
| 783 | Retinal infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 784 | Rhinalgia | FAERS: 1 | US FAERS | |
| 785 | Rhonchi | FAERS: 1 | OFFSIDES US FAERS | |
| 786 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 787 | Scab | FAERS: 1 | US FAERS | |
| 788 | Scedosporium infection | FAERS: 1 | OFFSIDES US FAERS | |
| 789 | Screaming | FAERS: 1 | US FAERS | |
| 790 | Sense of oppression | FAERS: 1 | US FAERS | |
| 791 | Septal panniculitis | FAERS: 1 | US FAERS | |
| 792 | Septic Shock | FAERS: 1 | US FAERS | |
| 793 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 794 | Sick Building Syndrome | FAERS: 1 | US FAERS | |
| 795 | Sinus bradycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 796 | Sinus headache | FAERS: 1 | US FAERS | |
| 797 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 798 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 799 | Somnambulism | FAERS: 1 | US FAERS | |
| 800 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 801 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 802 | Subileus | FAERS: 1 | OFFSIDES US FAERS | |
| 803 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 804 | Synovitis | FAERS: 1 | OFFSIDES US FAERS | |
| 805 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 806 | Tension Headache | FAERS: 1 | US FAERS | |
| 807 | Therapy cessation | FAERS: 1 | US FAERS | |
| 808 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 809 | Thromboembolectomy | FAERS: 1 | US FAERS | |
| 810 | Tinea Capitis | FAERS: 1 | 18378354 | CTD US FAERS |
| 811 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 812 | Tongue spasm | FAERS: 1 | US FAERS | |
| 813 | Tooth Loss | FAERS: 1 | US FAERS | |
| 814 | Total cholesterol/HDL ratio increased | FAERS: 1 | US FAERS | |
| 815 | Toxic Optic Neuropathy | FAERS: 1 | US FAERS | |
| 816 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 817 | Tryptase increased | FAERS: 1 | US FAERS | |
| 818 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 819 | Tympanic Membrane Perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 820 | Ultrasound liver abnormal | FAERS: 1 | US FAERS | |
| 821 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 822 | Urinary occult blood positive | FAERS: 1 | US FAERS | |
| 823 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 824 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 825 | Uveitis | FAERS: 1 | US FAERS | |
| 826 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 827 | Venous angioma of brain | FAERS: 1 | US FAERS | |
| 828 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 829 | Vitreous Detachment | FAERS: 1 | OFFSIDES US FAERS | |
| 830 | Vitritis | FAERS: 1 | US FAERS | |
| 831 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 832 | Vulvovaginal mycotic infection | FAERS: 1 | OFFSIDES US FAERS | |
| 833 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 834 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 835 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 836 | Wrong product administered | FAERS: 1 | US FAERS | |
| 837 | X-ray limb abnormal | FAERS: 1 | US FAERS | |
| 838 | diagnostic procedure | FAERS: 1 | US FAERS | |
| 839 | effusion | FAERS: 1 | US FAERS | |
| 840 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 841 | treatment failure | FAERS: 1 | US FAERS | |
| 842 | Abdominal Cramps | SIDER | ||
| 843 | Abdominal symptom | OFFSIDES | ||
| 844 | Acid reflux | OFFSIDES | ||
| 845 | Acute glomerulonephritis | OFFSIDES | ||
| 846 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 847 | Anaphylactoid Reaction | SIDER | ||
| 848 | Anhidrosis | OFFSIDES | ||
| 849 | Antasthmatic drug level above therapeutic | OFFSIDES | ||
| 850 | Apathy | OFFSIDES | ||
| 851 | Atelectasis | OFFSIDES | ||
| 852 | Automatism | OFFSIDES | ||
| 853 | Back disorder | OFFSIDES | ||
| 854 | Balanoposthitis | Canada Vigilance: 1 | Canada Vigilance | |
| 855 | Band neutrophil percentage increased | OFFSIDES | ||
| 856 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 857 | Bicytopenia | OFFSIDES | ||
| 858 | Biopsy bone abnormal | OFFSIDES | ||
| 859 | Bladder discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 860 | Blood Glucose | OFFSIDES | ||
| 861 | Blood albumin abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 862 | Blood albumin increased | OFFSIDES | ||
| 863 | Blood and lymphatic system disorders | SIDER | ||
| 864 | Blood cannabinoids | OFFSIDES | ||
| 865 | Blood cholesterol | OFFSIDES | ||
| 866 | Blood immunoglobulin E | OFFSIDES | ||
| 867 | Blood iron abnormal | OFFSIDES | ||
| 868 | Blood pressure ambulatory decreased | OFFSIDES | ||
| 869 | Bradycardia | 24894748 | CTD | |
| 870 | Breast discomfort | OFFSIDES | ||
| 871 | Bullous eruption | SIDER | ||
| 872 | Bunion | OFFSIDES | ||
| 873 | Candida serology positive | OFFSIDES | ||
| 874 | Candidiasis of vagina | OFFSIDES | ||
| 875 | Cardiac Hypertrophy | OFFSIDES | ||
| 876 | Cardiac function test abnormal | OFFSIDES | ||
| 877 | Ceruloplasmin decreased | OFFSIDES | ||
| 878 | Chemical and Drug Induced Liver Injury | CTD | ||
| 879 | Chest wall pain | OFFSIDES | ||
| 880 | Cholangiolitis | OFFSIDES | ||
| 881 | Chondromalacia | OFFSIDES | ||
| 882 | Cirrhosis | OFFSIDES | ||
| 883 | Coagulation factor X level increased | OFFSIDES | ||
| 884 | Contact Dermatitis | OFFSIDES | ||
| 885 | Coronary angioplasty | OFFSIDES | ||
| 886 | Cytomegalovirus test positive | OFFSIDES | ||
| 887 | Denervation atrophy | OFFSIDES | ||
| 888 | Dermatomycoses | 19659541 | CTD | |
| 889 | Diabetic Retinopathy | OFFSIDES | ||
| 890 | Diaphragmatic Hernia | OFFSIDES | ||
| 891 | Diverticulitis | OFFSIDES | ||
| 892 | Drug withdrawal headache | OFFSIDES | ||
| 893 | Duodenal ulcer perforation | Canada Vigilance: 1 | Canada Vigilance | |
| 894 | Dysmenorrhea | OFFSIDES | ||
| 895 | Dysthymic Disorder | OFFSIDES | ||
| 896 | Ear and labyrinth disorders | SIDER | ||
| 897 | Eczema impetiginous | OFFSIDES | ||
| 898 | Endocardial disease | OFFSIDES | ||
| 899 | Enterococcal sepsis | OFFSIDES | ||
| 900 | Enterocolitis bacterial | OFFSIDES | ||
| 901 | Essential Hypertension | OFFSIDES | ||
| 902 | Exanthema | 18833041 | CTD | |
| 903 | Facial Neuralgia | OFFSIDES | ||
| 904 | Fat intolerance | OFFSIDES | ||
| 905 | Fat redistribution | OFFSIDES | ||
| 906 | Fatty Liver | OFFSIDES | ||
| 907 | Femoral artery occlusion | OFFSIDES | ||
| 908 | Fever | 18378354 | CTD | |
| 909 | Focal glomerulosclerosis | OFFSIDES | ||
| 910 | Free prostate-specific antigen increased | OFFSIDES | ||
| 911 | Fungus serology test positive | OFFSIDES | ||
| 912 | Gastric mucosal lesion | OFFSIDES | ||
| 913 | Gastrointestinal Pain | SIDER | ||
| 914 | Gastrointestinal hypomotility | OFFSIDES | ||
| 915 | Gastrointestinal mucosal disorder | OFFSIDES | ||
| 916 | General physical condition | OFFSIDES | ||
| 917 | Glaucoma surgery | OFFSIDES | ||
| 918 | Globulinuria | OFFSIDES | ||
| 919 | Glutamate dehydrogenase increased | OFFSIDES | ||
| 920 | Grip strength | OFFSIDES | ||
| 921 | Groin infection | OFFSIDES | ||
| 922 | Haptoglobin Decreased | OFFSIDES | ||
| 923 | Hay fever | OFFSIDES | ||
| 924 | Hepatitis A positive | OFFSIDES | ||
| 925 | Hepatitis B DNA assay positive | Canada Vigilance: 1 | Canada Vigilance | |
| 926 | Hepatitis B antigen positive | Canada Vigilance: 1 | Canada Vigilance | |
| 927 | Hepatitis B positive | OFFSIDES | ||
| 928 | Hepatitis B surface antigen positive | OFFSIDES | ||
| 929 | Herpes simplex serology positive | OFFSIDES | ||
| 930 | Hiccough | OFFSIDES | ||
| 931 | Histone antibody positive | OFFSIDES | ||
| 932 | Horseshoe Kidney | OFFSIDES | ||
| 933 | Hyalohyphomycosis | 18415842 | CTD | |
| 934 | Incorrect route of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 935 | Infestation | SIDER | ||
| 936 | Infusion site mobility decreased | OFFSIDES | ||
| 937 | Injection site discomfort | OFFSIDES | ||
| 938 | Intertrigo | OFFSIDES | ||
| 939 | Intra-aortic balloon placement | OFFSIDES | ||
| 940 | Iridectomy | OFFSIDES | ||
| 941 | Iritis | OFFSIDES | ||
| 942 | Klebsiella sepsis | OFFSIDES | ||
| 943 | Laryngospasm | OFFSIDES | ||
| 944 | Leukocyte alkaline phosphatase increased | OFFSIDES | ||
| 945 | Leukopenia neonatal | OFFSIDES | ||
| 946 | Leukoplakia | OFFSIDES | ||
| 947 | Lightheadedness | SIDER | ||
| 948 | Lipase | OFFSIDES | ||
| 949 | Liver Cirrhosis | 20816994 | CTD | |
| 950 | Liver Failure, Acute | 17192859 | CTD | |
| 951 | Liver neoplasms | 25058030 | CTD | |
| 952 | Loss of personal independence in daily activities | Canada Vigilance: 1 | Canada Vigilance | |
| 953 | Lumbar radiculopathy | OFFSIDES | ||
| 954 | Lung Injury | OFFSIDES | ||
| 955 | Lupus Erythematosus | SIDER | ||
| 956 | Lymphedema | OFFSIDES | ||
| 957 | Malignant anorectal neoplasm | OFFSIDES | ||
| 958 | Mastoiditis | OFFSIDES | ||
| 959 | Megakaryocytes increased | OFFSIDES | ||
| 960 | Migraine with Aura | OFFSIDES | ||
| 961 | Mononeuritis | OFFSIDES | ||
| 962 | Morganella infection | OFFSIDES | ||
| 963 | Muscle Spasticity | Canada Vigilance: 1 | Canada Vigilance | |
| 964 | Muscle abscess | OFFSIDES | ||
| 965 | Muscle strain | OFFSIDES | ||
| 966 | Mycoses | 12149384 17015631 23964828 | CTD | |
| 967 | Myelodysplasia | OFFSIDES | ||
| 968 | Nail discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 969 | Nail pigmentation | OFFSIDES | ||
| 970 | Neurodermatitis | OFFSIDES | ||
| 971 | Optic Disc Edema | OFFSIDES | ||
| 972 | Oropharyngeal plaque | OFFSIDES | ||
| 973 | Oropharyngeal spasm | OFFSIDES | ||
| 974 | Otomycosis | 21895787 22359155 | CTD | |
| 975 | PROTHROMBIN TIME | OFFSIDES | ||
| 976 | Parakeratosis | OFFSIDES | ||
| 977 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 978 | Pelvic Floor Muscle Weakness | OFFSIDES | ||
| 979 | Percutaneous Coronary Intervention | OFFSIDES | ||
| 980 | Periarthritis | OFFSIDES | ||
| 981 | Pericarditis | OFFSIDES | ||
| 982 | Pharyngitis | Canada Vigilance: 1 | Canada Vigilance | |
| 983 | Photosensitivity allergic reaction | SIDER | ||
| 984 | Physical disability | OFFSIDES | ||
| 985 | Postural Orthostatic Tachycardia Syndrome | OFFSIDES | ||
| 986 | Pregnancy on oral contraceptive | OFFSIDES | ||
| 987 | Product contamination | OFFSIDES | ||
| 988 | Prothrombin level abnormal | OFFSIDES | ||
| 989 | Prothrombin level decreased | OFFSIDES | ||
| 990 | Psoriasis flare-up | SIDER | ||
| 991 | Red blood cell schistocytes present | OFFSIDES | ||
| 992 | Redness | SIDER | ||
| 993 | Reticulocyte count decreased | OFFSIDES | ||
| 994 | Retinitis | OFFSIDES | ||
| 995 | Schizoaffective Disorder | OFFSIDES | ||
| 996 | Schizotypal Personality Disorder | OFFSIDES | ||
| 997 | Scleritis | OFFSIDES | ||
| 998 | Scotoma | OFFSIDES SIDER | ||
| 999 | Serum sickness-like reaction | SIDER | ||
| 1000 | Serum urea increased | SIDER | ||
| 1001 | Silent myocardial infarction | OFFSIDES | ||
| 1002 | Skin Erosion | OFFSIDES | ||
| 1003 | Skin texture abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 1004 | Soft Tissue Injuries | OFFSIDES | ||
| 1005 | Somatoform Disorder | OFFSIDES | ||
| 1006 | Spinal column stenosis | OFFSIDES | ||
| 1007 | Spinal shock | OFFSIDES | ||
| 1008 | Stubbornness | OFFSIDES | ||
| 1009 | Suprapubic pain | OFFSIDES | ||
| 1010 | Suture insertion | OFFSIDES | ||
| 1011 | Systemic mycosis | OFFSIDES | ||
| 1012 | Taste Disorders | 10384922 | CTD | |
| 1013 | Thoracic vertebral fracture | OFFSIDES | ||
| 1014 | Tinea Versicolor | OFFSIDES | ||
| 1015 | Tinea | 17442600 | CTD OFFSIDES | |
| 1016 | Toothache | SIDER | ||
| 1017 | Traumatic liver injury | SIDER | ||
| 1018 | Vascular stenosis | OFFSIDES | ||
| 1019 | Vasculitic rash | OFFSIDES | ||
| 1020 | Vasculitis gastrointestinal | SIDER | ||
| 1021 | Venous stenosis | OFFSIDES | ||
| 1022 | Venous thrombosis limb | OFFSIDES | ||
| 1023 | Viral upper respiratory tract infection | Canada Vigilance: 1 | Canada Vigilance | |
| 1024 | Vitamin A Deficiency | OFFSIDES | ||
| 1025 | Walking aid user | OFFSIDES | ||
| 1026 | carbuncle | OFFSIDES | ||
| 1027 | furuncle | Canada Vigilance: 1 | Canada Vigilance | |
| 1028 | muscle injury | OFFSIDES | ||
| 1029 | streptococcal serology | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.