Ibandronic Acid
(MPBVHIBUJCELCL-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCCN(CCC(P(=O)(O)O)(P(=O)(O)O)O)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- M05BA06; M05BB09
- Molecular Formula:
- C9H23NO7P2
- Molecular Weight:
- 319.229
- Log P:
- 0.5000
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 5
- TPSA:
- 158.15
- CAS Number(s):
- 114084-78-5; 1130899-41-0
Synonym(s)
1.
Ibandronic Acid
2.
(1-Hydroxy-3-(methylpentylamino)propylidene)bisphosphonate
3.
1-Hydroxy-3-(methylpentylamino)propylidenebisphosphonate
4.
BM 21.0955
5.
BM 210955
6.
BM-21.0955
7.
BM-210955
8.
Bondronat
9.
Boniva
10.
Bonviva
11.
Ibandronate
12.
Ibandronate Sodium
13.
Ibandronate Sodium Anhydrous
14.
Ibandronic Acid, Sodium Salt, Monohydrate
15.
RPR 102289A
16.
RPR-102289A
17.
BM21.0955
18.
BM210955
19.
RPR102289A
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Arthralgia | FAERS: 392 | SIDER US FAERS | |
| 2 | Pain | FAERS: 383 | OFFSIDES SIDER US FAERS | |
| 3 | Myalgia | FAERS: 279 | SIDER US FAERS | |
| 4 | Back Pain | FAERS: 265 | SIDER US FAERS | |
| 5 | Bone pain | FAERS: 247 | OFFSIDES SIDER US FAERS | |
| 6 | Nausea | FAERS: 220 | OFFSIDES SIDER US FAERS | |
| 7 | Dyspepsia | FAERS: 195 | OFFSIDES SIDER US FAERS | |
| 8 | Headache | FAERS: 169 | SIDER US FAERS | |
| 9 | No adverse event | FAERS: 154 | US FAERS | |
| 10 | Malaise | FAERS: 133 | SIDER US FAERS | |
| 11 | Chest Pain | FAERS: 132 | OFFSIDES SIDER US FAERS | |
| 12 | Musculoskeletal Pain | FAERS: 129 | OFFSIDES SIDER US FAERS | |
| 13 | Abdominal discomfort | FAERS: 117 | OFFSIDES SIDER US FAERS | |
| 14 | Vomiting | FAERS: 108 | SIDER US FAERS | |
| 15 | Drug ineffective | FAERS: 92 | US FAERS | |
| 16 | Osteonecrosis of Jaw | FAERS: 90 | SIDER US FAERS | |
| 17 | Wrong technique in product usage process | FAERS: 90 | US FAERS | |
| 18 | Dizziness | FAERS: 86 | SIDER US FAERS | |
| 19 | Injection site extravasation | FAERS: 78 | US FAERS | |
| 20 | Fatigue | FAERS: 68 | SIDER US FAERS | |
| 21 | Peripheral swelling | FAERS: 67 | US FAERS | |
| 22 | Drug dose omission | FAERS: 63 | US FAERS | |
| 23 | Bone density decreased | FAERS: 62 | US FAERS | |
| 24 | Asthenia | FAERS: 57 | SIDER US FAERS | |
| 25 | Abdominal Pain | FAERS: 54 | OFFSIDES SIDER US FAERS | |
| 26 | Neck Pain | FAERS: 53 | US FAERS | |
| 27 | Pneumonia | FAERS: 52 | SIDER US FAERS | |
| 28 | Myocardial Infarction | FAERS: 48 | US FAERS | |
| 29 | Chills | FAERS: 47 | SIDER US FAERS | |
| 30 | Injection site pain | FAERS: 47 | SIDER US FAERS | |
| 31 | Injection site erythema | FAERS: 43 | US FAERS | |
| 32 | Osteoporosis | FAERS: 43 | OFFSIDES US FAERS | |
| 33 | Cerebrovascular accident | FAERS: 42 | US FAERS | |
| 34 | Feeling abnormal | FAERS: 42 | SIDER US FAERS | |
| 35 | Tooth Extraction | FAERS: 42 | US FAERS | |
| 36 | Extravasation | FAERS: 40 | US FAERS | |
| 37 | Hypersensitivity | FAERS: 40 | SIDER US FAERS | |
| 38 | Swelling | FAERS: 40 | SIDER US FAERS | |
| 39 | Constipation | FAERS: 39 | SIDER US FAERS | |
| 40 | Musculoskeletal stiffness | FAERS: 38 | OFFSIDES SIDER US FAERS | |
| 41 | Pruritus | FAERS: 38 | SIDER US FAERS | |
| 42 | Alopecia | FAERS: 36 | SIDER US FAERS | |
| 43 | Flatulence | FAERS: 35 | OFFSIDES SIDER US FAERS | |
| 44 | Fracture | FAERS: 35 | SIDER US FAERS | |
| 45 | Unevaluable event | FAERS: 35 | US FAERS | |
| 46 | Medication Error | FAERS: 34 | US FAERS | |
| 47 | Oropharyngeal pain | FAERS: 34 | SIDER US FAERS | |
| 48 | Toothache | FAERS: 34 | US FAERS | |
| 49 | Erythema | FAERS: 33 | SIDER US FAERS | |
| 50 | Arthritis | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 51 | Injection Site Reaction | FAERS: 32 | SIDER US FAERS | |
| 52 | Tooth Loss | FAERS: 32 | US FAERS | |
| 53 | Chest discomfort | FAERS: 31 | US FAERS | |
| 54 | Burning sensation | FAERS: 30 | OFFSIDES US FAERS | |
| 55 | Weight decreased | FAERS: 30 | SIDER US FAERS | |
| 56 | Urticaria | FAERS: 29 | SIDER US FAERS | |
| 57 | Anxiety | FAERS: 27 | SIDER US FAERS | |
| 58 | Drug administration error | FAERS: 27 | OFFSIDES US FAERS | |
| 59 | Joint swelling | FAERS: 27 | US FAERS | |
| 60 | Musculoskeletal chest pain | FAERS: 25 | OFFSIDES US FAERS | |
| 61 | Cellulitis | FAERS: 24 | OFFSIDES US FAERS | |
| 62 | Inappropriate schedule of drug administration | FAERS: 23 | US FAERS | |
| 63 | Tremor | FAERS: 23 | US FAERS | |
| 64 | Bone density abnormal | FAERS: 22 | US FAERS | |
| 65 | Influenza | FAERS: 22 | SIDER US FAERS | |
| 66 | Injection site inflammation | FAERS: 21 | OFFSIDES US FAERS | |
| 67 | Product quality issue | FAERS: 21 | US FAERS | |
| 68 | Dental caries | FAERS: 20 | US FAERS | |
| 69 | Infection | FAERS: 20 | SIDER US FAERS | |
| 70 | Osteomyelitis | FAERS: 20 | SIDER US FAERS | |
| 71 | Urinary tract infection | FAERS: 20 | SIDER US FAERS | |
| 72 | Visual Impairment | FAERS: 20 | US FAERS | |
| 73 | Gastritis | FAERS: 19 | SIDER US FAERS | |
| 74 | Inflammation | FAERS: 19 | SIDER US FAERS | |
| 75 | Loose tooth | FAERS: 18 | US FAERS | |
| 76 | Phlebitis | FAERS: 17 | US FAERS | |
| 77 | Sinusitis | FAERS: 17 | US FAERS | |
| 78 | Arthropathy | FAERS: 16 | SIDER US FAERS | |
| 79 | Dysphonia | FAERS: 16 | US FAERS | |
| 80 | Gingivitis | FAERS: 16 | US FAERS | |
| 81 | Ulcer | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 82 | Dehydration | FAERS: 15 | US FAERS | |
| 83 | Incorrect route of drug administration | FAERS: 15 | US FAERS | |
| 84 | Thrombosis | FAERS: 15 | US FAERS | |
| 85 | Atypical femur fracture | FAERS: 14 | SIDER US FAERS | |
| 86 | Deafness | FAERS: 14 | SIDER US FAERS | |
| 87 | Discomfort | FAERS: 14 | SIDER US FAERS | |
| 88 | Dysgeusia | FAERS: 14 | SIDER US FAERS | |
| 89 | Eructation | FAERS: 14 | US FAERS | |
| 90 | Nasopharyngitis | FAERS: 14 | SIDER US FAERS | |
| 91 | Palpitations | FAERS: 14 | SIDER US FAERS | |
| 92 | Syncope | FAERS: 13 | US FAERS | |
| 93 | Throat irritation | FAERS: 13 | US FAERS | |
| 94 | Bronchitis | FAERS: 12 | SIDER US FAERS | |
| 95 | Epigastric discomfort | FAERS: 12 | US FAERS | |
| 96 | Gastric ulcer | FAERS: 12 | OFFSIDES US FAERS | |
| 97 | General physical health deterioration | FAERS: 12 | US FAERS | |
| 98 | Infusion Site Extravasation | FAERS: 12 | US FAERS | |
| 99 | Injection site mass | FAERS: 12 | US FAERS | |
| 100 | Memory impairment | FAERS: 12 | US FAERS | |
| 101 | Nephrolithiasis | FAERS: 12 | US FAERS | |
| 102 | Respiratory Failure | FAERS: 12 | US FAERS | |
| 103 | Tooth Infection | FAERS: 12 | US FAERS | |
| 104 | Vertigo | FAERS: 12 | SIDER US FAERS | |
| 105 | Aphonia | FAERS: 11 | US FAERS | |
| 106 | Atrial Fibrillation | FAERS: 11 | US FAERS | |
| 107 | Dental Restoration Failure | FAERS: 11 | US FAERS | |
| 108 | Endodontic procedure | FAERS: 11 | OFFSIDES US FAERS | |
| 109 | Osteopenia | FAERS: 11 | SIDER US FAERS | |
| 110 | Amnesia | FAERS: 10 | SIDER US FAERS | |
| 111 | Emotional distress | FAERS: 10 | US FAERS | |
| 112 | Joint stiffness | FAERS: 10 | OFFSIDES US FAERS | |
| 113 | Somnolence | FAERS: 10 | US FAERS | |
| 114 | Back disorder | FAERS: 9 | US FAERS | |
| 115 | Blood creatinine increased | FAERS: 9 | SIDER US FAERS | |
| 116 | Cardiac Arrest | FAERS: 9 | US FAERS | |
| 117 | Expired product administered | FAERS: 9 | US FAERS | |
| 118 | Feeling Cold | FAERS: 9 | US FAERS | |
| 119 | Gingival Recession | FAERS: 9 | US FAERS | |
| 120 | Glaucoma | FAERS: 9 | US FAERS | |
| 121 | Overdose | FAERS: 9 | US FAERS | |
| 122 | Pathological fracture | FAERS: 9 | US FAERS | |
| 123 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 124 | Stomatitis | FAERS: 9 | SIDER US FAERS | |
| 125 | Tinnitus | FAERS: 9 | US FAERS | |
| 126 | Dementia | FAERS: 8 | US FAERS | |
| 127 | Failure to Thrive | FAERS: 8 | OFFSIDES US FAERS | |
| 128 | Foreign body in respiratory tract | FAERS: 8 | US FAERS | |
| 129 | Hypotension | FAERS: 8 | US FAERS | |
| 130 | Joint Range of Motion Decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 131 | Limb discomfort | FAERS: 8 | US FAERS | |
| 132 | Oral pain | FAERS: 8 | US FAERS | |
| 133 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 134 | Blood urine present | FAERS: 7 | US FAERS | |
| 135 | Diabetes Mellitus | FAERS: 7 | US FAERS | |
| 136 | Eye pain | FAERS: 7 | US FAERS | |
| 137 | Facial Pain | FAERS: 7 | US FAERS | |
| 138 | Fibromyalgia | FAERS: 7 | US FAERS | |
| 139 | Gastrointestinal Pain | FAERS: 7 | SIDER US FAERS | |
| 140 | Hypophagia | FAERS: 7 | US FAERS | |
| 141 | Lethargy | FAERS: 7 | US FAERS | |
| 142 | Limb mass | FAERS: 7 | US FAERS | |
| 143 | Pancreatic carcinoma | FAERS: 7 | US FAERS | |
| 144 | Procedural complication | FAERS: 7 | US FAERS | |
| 145 | Therapy non-responder | FAERS: 7 | US FAERS | |
| 146 | Trismus | FAERS: 7 | US FAERS | |
| 147 | Abscess | FAERS: 6 | US FAERS | |
| 148 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 149 | Asthma | FAERS: 6 | SIDER US FAERS | |
| 150 | Atypical fracture | FAERS: 6 | US FAERS | |
| 151 | Blood glucose decreased | FAERS: 6 | US FAERS | |
| 152 | Bone scan abnormal | FAERS: 6 | US FAERS | |
| 153 | Bursitis | FAERS: 6 | OFFSIDES US FAERS | |
| 154 | Choking | FAERS: 6 | US FAERS | |
| 155 | Colitis | FAERS: 6 | OFFSIDES US FAERS | |
| 156 | Compression fracture | FAERS: 6 | OFFSIDES US FAERS | |
| 157 | Dysuria | FAERS: 6 | US FAERS | |
| 158 | Exposed bone in jaw | FAERS: 6 | US FAERS | |
| 159 | Gait inability | FAERS: 6 | US FAERS | |
| 160 | Injection site bruising | FAERS: 6 | US FAERS | |
| 161 | Irritable Bowel Syndrome | FAERS: 6 | US FAERS | |
| 162 | Loss of personal independence in daily activities | FAERS: 6 | US FAERS | |
| 163 | Mouth swelling | FAERS: 6 | US FAERS | |
| 164 | Muscle strain | FAERS: 6 | OFFSIDES US FAERS | |
| 165 | Osteolysis | FAERS: 6 | US FAERS | |
| 166 | Post procedural complication | FAERS: 6 | US FAERS | |
| 167 | Productive Cough | FAERS: 6 | US FAERS | |
| 168 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 169 | Sepsis | FAERS: 6 | US FAERS | |
| 170 | Tachycardia | FAERS: 6 | US FAERS | |
| 171 | Therapy cessation | FAERS: 6 | US FAERS | |
| 172 | Thrombophlebitis | FAERS: 6 | OFFSIDES US FAERS | |
| 173 | Angioedema | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 174 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 175 | Cataract | FAERS: 5 | SIDER US FAERS | |
| 176 | Cold sweat | FAERS: 5 | US FAERS | |
| 177 | Disorientation | FAERS: 5 | US FAERS | |
| 178 | Exostosis of jaw | FAERS: 5 | US FAERS | |
| 179 | Eye inflammation | FAERS: 5 | US FAERS | |
| 180 | Flushing | FAERS: 5 | US FAERS | |
| 181 | Hernia | FAERS: 5 | OFFSIDES US FAERS | |
| 182 | Lip swelling | FAERS: 5 | US FAERS | |
| 183 | Low turnover osteopathy | FAERS: 5 | US FAERS | |
| 184 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 185 | Malignant neoplasm progression | FAERS: 5 | US FAERS | |
| 186 | Muscle tightness | FAERS: 5 | OFFSIDES US FAERS | |
| 187 | Musculoskeletal discomfort | FAERS: 5 | SIDER US FAERS | |
| 188 | Nervousness | FAERS: 5 | US FAERS | |
| 189 | Onychoclasis | FAERS: 5 | US FAERS | |
| 190 | Osteitis | FAERS: 5 | US FAERS | |
| 191 | Renal pain | FAERS: 5 | US FAERS | |
| 192 | Septic Shock | FAERS: 5 | US FAERS | |
| 193 | Vascular Access Complication | FAERS: 5 | US FAERS | |
| 194 | Vascular rupture | FAERS: 5 | OFFSIDES US FAERS | |
| 195 | Abasia | FAERS: 4 | US FAERS | |
| 196 | Anaphylactic shock | FAERS: 4 | SIDER US FAERS | |
| 197 | Bedridden | FAERS: 4 | US FAERS | |
| 198 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 199 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 200 | Calcinosis | FAERS: 4 | US FAERS | |
| 201 | Cholecystitis | FAERS: 4 | US FAERS | |
| 202 | Cystitis | FAERS: 4 | SIDER US FAERS | |
| 203 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 204 | Disease Progression | FAERS: 4 | US FAERS | |
| 205 | Dry skin | FAERS: 4 | US FAERS | |
| 206 | Epistaxis | FAERS: 4 | US FAERS | |
| 207 | Eye irritation | FAERS: 4 | US FAERS | |
| 208 | Gastrointestinal sounds abnormal | FAERS: 4 | US FAERS | |
| 209 | Infusion site pain | FAERS: 4 | OFFSIDES US FAERS | |
| 210 | Injection site discomfort | FAERS: 4 | US FAERS | |
| 211 | Injection site irritation | FAERS: 4 | US FAERS | |
| 212 | Injection site vesicles | FAERS: 4 | US FAERS | |
| 213 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 214 | Laryngitis | FAERS: 4 | US FAERS | |
| 215 | Macular degeneration | FAERS: 4 | US FAERS | |
| 216 | Marasmus | FAERS: 4 | US FAERS | |
| 217 | Poor dental condition | FAERS: 4 | OFFSIDES US FAERS | |
| 218 | Retching | FAERS: 4 | US FAERS | |
| 219 | Shock | FAERS: 4 | SIDER US FAERS | |
| 220 | Sneezing | FAERS: 4 | US FAERS | |
| 221 | Stress | FAERS: 4 | US FAERS | |
| 222 | Syringe issue | FAERS: 4 | US FAERS | |
| 223 | Thirst | FAERS: 4 | SIDER US FAERS | |
| 224 | Vascular procedure complication | FAERS: 4 | US FAERS | |
| 225 | Walking aid user | FAERS: 4 | US FAERS | |
| 226 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 227 | Actinomycosis | FAERS: 3 | US FAERS | |
| 228 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 229 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 230 | Aortic Valve Stenosis | FAERS: 3 | US FAERS | |
| 231 | Bone fissure | FAERS: 3 | US FAERS | |
| 232 | Cholelithiasis | FAERS: 3 | SIDER US FAERS | |
| 233 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 234 | Crying | FAERS: 3 | US FAERS | |
| 235 | Dysarthria | FAERS: 3 | US FAERS | |
| 236 | Gout | FAERS: 3 | US FAERS | |
| 237 | Hypokinesia | FAERS: 3 | US FAERS | |
| 238 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 239 | Immobile | FAERS: 3 | OFFSIDES US FAERS | |
| 240 | Impaired work ability | FAERS: 3 | US FAERS | |
| 241 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 242 | Infusion site swelling | FAERS: 3 | OFFSIDES US FAERS | |
| 243 | Injection site necrosis | FAERS: 3 | US FAERS | |
| 244 | Limb injury | FAERS: 3 | US FAERS | |
| 245 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 246 | Muscle Fatigue | FAERS: 3 | OFFSIDES US FAERS | |
| 247 | Necrosis | FAERS: 3 | US FAERS | |
| 248 | Oropharyngeal discomfort | FAERS: 3 | SIDER US FAERS | |
| 249 | Pancreatitis | FAERS: 3 | US FAERS | |
| 250 | Pancytopenia | FAERS: 3 | US FAERS | |
| 251 | Pneumonitis | FAERS: 3 | US FAERS | |
| 252 | Polymyalgia Rheumatica | FAERS: 3 | OFFSIDES US FAERS | |
| 253 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 254 | Presyncope | FAERS: 3 | US FAERS | |
| 255 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 256 | Regurgitation | FAERS: 3 | OFFSIDES US FAERS | |
| 257 | Renal Colic | FAERS: 3 | OFFSIDES US FAERS | |
| 258 | Sciatica | FAERS: 3 | US FAERS | |
| 259 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 260 | Spondylitis | FAERS: 3 | OFFSIDES US FAERS | |
| 261 | Sudden death | FAERS: 3 | OFFSIDES US FAERS | |
| 262 | Thermal burn | FAERS: 3 | US FAERS | |
| 263 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 264 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 265 | Urinary Retention | FAERS: 3 | SIDER US FAERS | |
| 266 | Vasculitis | FAERS: 3 | US FAERS | |
| 267 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 268 | treatment failure | FAERS: 3 | US FAERS | |
| 269 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 270 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 271 | Administration site reaction | FAERS: 2 | US FAERS | |
| 272 | Administration site warmth | FAERS: 2 | US FAERS | |
| 273 | Adverse event | FAERS: 2 | US FAERS | |
| 274 | Anorexia | FAERS: 2 | US FAERS | |
| 275 | Aphasia | FAERS: 2 | US FAERS | |
| 276 | Appendicitis | FAERS: 2 | OFFSIDES US FAERS | |
| 277 | Artificial crown procedure | FAERS: 2 | US FAERS | |
| 278 | Astigmatism | FAERS: 2 | US FAERS | |
| 279 | Blood calcium abnormal | FAERS: 2 | US FAERS | |
| 280 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 281 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 282 | Bone decalcification | FAERS: 2 | US FAERS | |
| 283 | Bone fragmentation | FAERS: 2 | OFFSIDES US FAERS | |
| 284 | Bone swelling | FAERS: 2 | US FAERS | |
| 285 | Bronchial Hyperreactivity | FAERS: 2 | US FAERS | |
| 286 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 287 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 288 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 289 | Choking sensation | FAERS: 2 | US FAERS | |
| 290 | Cyst | FAERS: 2 | US FAERS | |
| 291 | Delirium | FAERS: 2 | US FAERS | |
| 292 | Dental prosthesis placement | FAERS: 2 | US FAERS | |
| 293 | Depressed mood | FAERS: 2 | OFFSIDES US FAERS | |
| 294 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 295 | Device breakage | FAERS: 2 | US FAERS | |
| 296 | Disease recurrence | FAERS: 2 | US FAERS | |
| 297 | Duodenal Ulcer | FAERS: 2 | SIDER US FAERS | |
| 298 | Ear discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 299 | Eczema | FAERS: 2 | US FAERS | |
| 300 | Enterocolitis | FAERS: 2 | US FAERS | |
| 301 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 302 | Gamma-Glutamyltransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 303 | Gastric infection | FAERS: 2 | OFFSIDES US FAERS | |
| 304 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 305 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 306 | Head discomfort | FAERS: 2 | US FAERS | |
| 307 | Hunger | FAERS: 2 | US FAERS | |
| 308 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 309 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 310 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 311 | Hysterectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 312 | Ileus | FAERS: 2 | US FAERS | |
| 313 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 314 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 315 | Incontinence | FAERS: 2 | US FAERS | |
| 316 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 317 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 318 | Induration | FAERS: 2 | US FAERS | |
| 319 | Infarction | FAERS: 2 | US FAERS | |
| 320 | Infusion site erythema | FAERS: 2 | OFFSIDES US FAERS | |
| 321 | Injection related reaction | FAERS: 2 | US FAERS | |
| 322 | Injection site cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 323 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 324 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 325 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 326 | Intestinal Fistula | FAERS: 2 | US FAERS | |
| 327 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 328 | Intestinal resection | FAERS: 2 | US FAERS | |
| 329 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 330 | Iritis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 331 | Lymphocele | FAERS: 2 | US FAERS | |
| 332 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 333 | Meniscus injury | FAERS: 2 | US FAERS | |
| 334 | Mental impairment | FAERS: 2 | US FAERS | |
| 335 | Mesothelioma | FAERS: 2 | US FAERS | |
| 336 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 337 | Metastatic Neoplasm | FAERS: 2 | OFFSIDES US FAERS | |
| 338 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 339 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 340 | Myopia | FAERS: 2 | US FAERS | |
| 341 | Needle issue | FAERS: 2 | US FAERS | |
| 342 | Neuralgia | FAERS: 2 | SIDER US FAERS | |
| 343 | Onycholysis | FAERS: 2 | US FAERS | |
| 344 | Oral Cavity Fistula | FAERS: 2 | US FAERS | |
| 345 | Oropharyngeal plaque | FAERS: 2 | US FAERS | |
| 346 | Osteochondrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 347 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 348 | Pelvic Pain | FAERS: 2 | SIDER US FAERS | |
| 349 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 350 | Periodontitis | FAERS: 2 | US FAERS | |
| 351 | Peritonitis | FAERS: 2 | US FAERS | |
| 352 | Plasmacytoma | FAERS: 2 | OFFSIDES US FAERS | |
| 353 | Product outer packaging issue | FAERS: 2 | US FAERS | |
| 354 | Product storage error | FAERS: 2 | US FAERS | |
| 355 | Pulmonary thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 356 | Purulence | FAERS: 2 | US FAERS | |
| 357 | Purulent discharge | FAERS: 2 | US FAERS | |
| 358 | Renal cyst | FAERS: 2 | SIDER US FAERS | |
| 359 | Respiratory distress | FAERS: 2 | US FAERS | |
| 360 | Seroma | FAERS: 2 | US FAERS | |
| 361 | Skin lesion | FAERS: 2 | US FAERS | |
| 362 | Spinal column injury | FAERS: 2 | US FAERS | |
| 363 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 364 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 365 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 366 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 367 | Trigeminal Neuralgia | FAERS: 2 | US FAERS | |
| 368 | Urinary Tract Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 369 | Uveitis | FAERS: 2 | SIDER US FAERS | |
| 370 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 371 | Wound Infection | FAERS: 2 | US FAERS | |
| 372 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 373 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 374 | Abdominal strangulated hernia | FAERS: 1 | US FAERS | |
| 375 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 376 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 377 | Accidental overdose | FAERS: 1 | US FAERS | |
| 378 | Acidosis | FAERS: 1 | US FAERS | |
| 379 | Acne | FAERS: 1 | US FAERS | |
| 380 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 381 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 382 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 383 | Administration site abscess | FAERS: 1 | US FAERS | |
| 384 | Administration site erythema | FAERS: 1 | US FAERS | |
| 385 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 386 | Administration site induration | FAERS: 1 | US FAERS | |
| 387 | Administration site swelling | FAERS: 1 | US FAERS | |
| 388 | Ageusia | FAERS: 1 | US FAERS | |
| 389 | Agitation | FAERS: 1 | US FAERS | |
| 390 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 391 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 392 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 393 | Anal inflammation | FAERS: 1 | US FAERS | |
| 394 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 395 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 396 | Anosmia | FAERS: 1 | US FAERS | |
| 397 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 398 | Anuria | FAERS: 1 | US FAERS | |
| 399 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 400 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 401 | Aphagia | FAERS: 1 | OFFSIDES US FAERS | |
| 402 | Application site erythema | FAERS: 1 | US FAERS | |
| 403 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 404 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 405 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 406 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 407 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 408 | Aura | FAERS: 1 | US FAERS | |
| 409 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 410 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 411 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 412 | Blindness | FAERS: 1 | US FAERS | |
| 413 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 414 | Blood cholesterol abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 415 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 416 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 417 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 418 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 419 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 420 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 421 | Blood parathyroid hormone abnormal | FAERS: 1 | US FAERS | |
| 422 | Blood parathyroid hormone increased | FAERS: 1 | SIDER US FAERS | |
| 423 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 424 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 425 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 426 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 427 | Blood urea increased | FAERS: 1 | US FAERS | |
| 428 | Bone atrophy | FAERS: 1 | US FAERS | |
| 429 | Bone erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 430 | Bone fistula | FAERS: 1 | US FAERS | |
| 431 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 432 | Bradycardia | FAERS: 1 | US FAERS | |
| 433 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 434 | Breast Cyst | FAERS: 1 | US FAERS | |
| 435 | Breast infection | FAERS: 1 | US FAERS | |
| 436 | Breast tenderness | FAERS: 1 | US FAERS | |
| 437 | Bronchopneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 438 | Bronchospasm | FAERS: 1 | SIDER US FAERS | |
| 439 | Bruxism | FAERS: 1 | US FAERS | |
| 440 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 441 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 442 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 443 | Cartilage atrophy | FAERS: 1 | US FAERS | |
| 444 | Cataract operation | FAERS: 1 | US FAERS | |
| 445 | Catheter placement | FAERS: 1 | US FAERS | |
| 446 | Cheilitis | FAERS: 1 | SIDER US FAERS | |
| 447 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 448 | Chromaturia | FAERS: 1 | OFFSIDES US FAERS | |
| 449 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 450 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 451 | Colon cancer recurrent | FAERS: 1 | OFFSIDES US FAERS | |
| 452 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 453 | Corrective lens user | FAERS: 1 | US FAERS | |
| 454 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 455 | Cytopenia | FAERS: 1 | US FAERS | |
| 456 | Dactylitis | FAERS: 1 | OFFSIDES US FAERS | |
| 457 | Deformity | FAERS: 1 | US FAERS | |
| 458 | Dengue Fever | FAERS: 1 | OFFSIDES US FAERS | |
| 459 | Dental Fistula | FAERS: 1 | US FAERS | |
| 460 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 461 | Device expulsion | FAERS: 1 | US FAERS | |
| 462 | Device related infection | FAERS: 1 | US FAERS | |
| 463 | Device toxicity | FAERS: 1 | US FAERS | |
| 464 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 465 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 466 | Diffuse vasculitis | FAERS: 1 | US FAERS | |
| 467 | Disease susceptibility | FAERS: 1 | US FAERS | |
| 468 | Diverticulitis | FAERS: 1 | US FAERS | |
| 469 | Diverticulum | FAERS: 1 | US FAERS | |
| 470 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 471 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 472 | Dyschezia | FAERS: 1 | OFFSIDES US FAERS | |
| 473 | Dysentery | FAERS: 1 | US FAERS | |
| 474 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 475 | Embolism | FAERS: 1 | US FAERS | |
| 476 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 1 | US FAERS | |
| 477 | Eosinophilic Fasciitis | FAERS: 1 | US FAERS | |
| 478 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 479 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 480 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 481 | Eye Infection | FAERS: 1 | US FAERS | |
| 482 | Facial Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Facial paralysis | FAERS: 1 | US FAERS | |
| 484 | Failure of implant | FAERS: 1 | OFFSIDES US FAERS | |
| 485 | Feeling jittery | FAERS: 1 | US FAERS | |
| 486 | Flank Pain | FAERS: 1 | US FAERS | |
| 487 | Foreign body sensation in eyes | FAERS: 1 | OFFSIDES US FAERS | |
| 488 | Fracture pain | FAERS: 1 | US FAERS | |
| 489 | Fracture treatment | FAERS: 1 | US FAERS | |
| 490 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 491 | Frustration | FAERS: 1 | US FAERS | |
| 492 | Full blood count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 493 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 494 | Gammopathy | FAERS: 1 | US FAERS | |
| 495 | Gangrene | FAERS: 1 | US FAERS | |
| 496 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 497 | Gastroenteritis | FAERS: 1 | SIDER US FAERS | |
| 498 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 499 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 500 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 501 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 502 | Gingival erythema | FAERS: 1 | US FAERS | |
| 503 | Glossitis | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Glossopharyngeal Neuralgia | FAERS: 1 | US FAERS | |
| 505 | Granuloma | FAERS: 1 | OFFSIDES US FAERS | |
| 506 | Grief reaction | FAERS: 1 | US FAERS | |
| 507 | Head titubation | FAERS: 1 | US FAERS | |
| 508 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 509 | Hepatitis | FAERS: 1 | US FAERS | |
| 510 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 511 | Homicide | FAERS: 1 | US FAERS | |
| 512 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 513 | Hypersomnia | FAERS: 1 | US FAERS | |
| 514 | Immunosuppression | FAERS: 1 | US FAERS | |
| 515 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 516 | Implant site inflammation | FAERS: 1 | US FAERS | |
| 517 | Implant site pain | FAERS: 1 | US FAERS | |
| 518 | Incoherent | FAERS: 1 | US FAERS | |
| 519 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 520 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 521 | Infusion site induration | FAERS: 1 | US FAERS | |
| 522 | Infusion site inflammation | FAERS: 1 | US FAERS | |
| 523 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 524 | Injection site cyst | FAERS: 1 | US FAERS | |
| 525 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 526 | Injection site infection | FAERS: 1 | US FAERS | |
| 527 | Injection site joint inflammation | FAERS: 1 | US FAERS | |
| 528 | Injection site movement impairment | FAERS: 1 | US FAERS | |
| 529 | Injection site nodule | FAERS: 1 | US FAERS | |
| 530 | Injection site phlebitis | FAERS: 1 | US FAERS | |
| 531 | Injection site thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 532 | Injection site warmth | FAERS: 1 | US FAERS | |
| 533 | Injury associated with device | FAERS: 1 | US FAERS | |
| 534 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 535 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 536 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 537 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 538 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 539 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 540 | Joint Instability | FAERS: 1 | US FAERS | |
| 541 | Joint injury | FAERS: 1 | US FAERS | |
| 542 | Keratitis | FAERS: 1 | US FAERS | |
| 543 | Laceration | FAERS: 1 | US FAERS | |
| 544 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 545 | Laparotomy | FAERS: 1 | US FAERS | |
| 546 | Laziness | FAERS: 1 | US FAERS | |
| 547 | Leukopenia | FAERS: 1 | US FAERS | |
| 548 | Lichen Planus | FAERS: 1 | US FAERS | |
| 549 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 550 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 551 | Lymph Node Tuberculosis | FAERS: 1 | US FAERS | |
| 552 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 553 | Macule | FAERS: 1 | US FAERS | |
| 554 | Malabsorption | FAERS: 1 | US FAERS | |
| 555 | Mastication disorder | FAERS: 1 | US FAERS | |
| 556 | Masticatory pain | FAERS: 1 | US FAERS | |
| 557 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 558 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 559 | Medial Tibial Stress Syndrome | FAERS: 1 | US FAERS | |
| 560 | Medical device implantation | FAERS: 1 | US FAERS | |
| 561 | Meningioma | FAERS: 1 | US FAERS | |
| 562 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 563 | Metastasis | FAERS: 1 | US FAERS | |
| 564 | Metastatic pain | FAERS: 1 | US FAERS | |
| 565 | Monoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 566 | Motion Sickness | FAERS: 1 | US FAERS | |
| 567 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 568 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 569 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 570 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 571 | Myelitis | FAERS: 1 | OFFSIDES US FAERS | |
| 572 | Myocarditis | FAERS: 1 | US FAERS | |
| 573 | Myositis Ossificans | FAERS: 1 | US FAERS | |
| 574 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 575 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 576 | Nerve injury | FAERS: 1 | US FAERS | |
| 577 | Night sweats | FAERS: 1 | US FAERS | |
| 578 | Nodal osteoarthritis | FAERS: 1 | US FAERS | |
| 579 | Nodule | FAERS: 1 | US FAERS | |
| 580 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 581 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 582 | Obstruction | FAERS: 1 | US FAERS | |
| 583 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 584 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 585 | Onychalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 586 | Oral candidiasis | FAERS: 1 | SIDER US FAERS | |
| 587 | Oral infection | FAERS: 1 | US FAERS | |
| 588 | Oropharyngeal spasm | FAERS: 1 | OFFSIDES US FAERS | |
| 589 | Osteogenesis Imperfecta | FAERS: 1 | OFFSIDES US FAERS | |
| 590 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 591 | Pain of skin | FAERS: 1 | US FAERS | |
| 592 | Pallor | FAERS: 1 | US FAERS | |
| 593 | Palmar erythema | FAERS: 1 | US FAERS | |
| 594 | Palpable purpura | FAERS: 1 | US FAERS | |
| 595 | Panniculitis | FAERS: 1 | US FAERS | |
| 596 | Panophthalmitis | FAERS: 1 | SIDER US FAERS | |
| 597 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 598 | Paraparesis | FAERS: 1 | US FAERS | |
| 599 | Parophthalmia | FAERS: 1 | US FAERS | |
| 600 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 601 | Periarthritis | FAERS: 1 | US FAERS | |
| 602 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 603 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 604 | Petechiae | FAERS: 1 | US FAERS | |
| 605 | Pharyngeal pouch | FAERS: 1 | US FAERS | |
| 606 | Photophobia | FAERS: 1 | US FAERS | |
| 607 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 608 | Polyneuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 609 | Polyuria | FAERS: 1 | US FAERS | |
| 610 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 611 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 612 | Post procedural inflammation | FAERS: 1 | US FAERS | |
| 613 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 614 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 615 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 616 | Pregnancy | FAERS: 1 | US FAERS | |
| 617 | Primary Biliary Cholangitis | FAERS: 1 | US FAERS | |
| 618 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 619 | Product dose omission | FAERS: 1 | US FAERS | |
| 620 | Product package associated injury | FAERS: 1 | US FAERS | |
| 621 | Product packaging issue | FAERS: 1 | US FAERS | |
| 622 | Product physical issue | FAERS: 1 | US FAERS | |
| 623 | Product substitution issue | FAERS: 1 | US FAERS | |
| 624 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 625 | Product use issue | FAERS: 1 | US FAERS | |
| 626 | Prosthesis Implantation | FAERS: 1 | US FAERS | |
| 627 | Protein urine present | FAERS: 1 | US FAERS | |
| 628 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 629 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 630 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 631 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 632 | Radial nerve compression | FAERS: 1 | US FAERS | |
| 633 | Rapidly progressive osteoarthritis | FAERS: 1 | US FAERS | |
| 634 | Rash erythematous | FAERS: 1 | SIDER US FAERS | |
| 635 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 636 | Respiratory depth decreased | FAERS: 1 | US FAERS | |
| 637 | Restlessness | FAERS: 1 | US FAERS | |
| 638 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 639 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 640 | Rhinitis | FAERS: 1 | US FAERS | |
| 641 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 642 | Scab | FAERS: 1 | OFFSIDES US FAERS | |
| 643 | Scleroderma | FAERS: 1 | OFFSIDES US FAERS | |
| 644 | Sequestrectomy | FAERS: 1 | US FAERS | |
| 645 | Sinus headache | FAERS: 1 | US FAERS | |
| 646 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 647 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 648 | Skin discomfort | FAERS: 1 | US FAERS | |
| 649 | Skin irritation | FAERS: 1 | US FAERS | |
| 650 | Skin laceration | FAERS: 1 | US FAERS | |
| 651 | Skin necrosis | FAERS: 1 | US FAERS | |
| 652 | Skin reaction | FAERS: 1 | US FAERS | |
| 653 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 654 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 655 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 656 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 657 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 658 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 659 | Surgical failure | FAERS: 1 | US FAERS | |
| 660 | Synovitis | FAERS: 1 | US FAERS | |
| 661 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 662 | Teeth brittle | FAERS: 1 | OFFSIDES US FAERS | |
| 663 | Tetany | FAERS: 1 | US FAERS | |
| 664 | Therapy responder | FAERS: 1 | US FAERS | |
| 665 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 666 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 667 | Toe operation | FAERS: 1 | US FAERS | |
| 668 | Tooth Avulsion | FAERS: 1 | US FAERS | |
| 669 | Torticollis | FAERS: 1 | US FAERS | |
| 670 | Transaminases increased | FAERS: 1 | US FAERS | |
| 671 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 672 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 673 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 674 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 675 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 676 | Vasospasm | FAERS: 1 | US FAERS | |
| 677 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 678 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 679 | Vessel puncture site bruise | FAERS: 1 | US FAERS | |
| 680 | Viral pharyngitis | FAERS: 1 | US FAERS | |
| 681 | Visual brightness | FAERS: 1 | US FAERS | |
| 682 | Visual disturbance | FAERS: 1 | US FAERS | |
| 683 | Vitreous Detachment | FAERS: 1 | OFFSIDES US FAERS | |
| 684 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 685 | Vitreous loss | FAERS: 1 | US FAERS | |
| 686 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 687 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 688 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 689 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 690 | Wheelchair user | FAERS: 1 | US FAERS | |
| 691 | Wheezing | FAERS: 1 | US FAERS | |
| 692 | Wound Complication | FAERS: 1 | US FAERS | |
| 693 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 694 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 695 | cancer surgery | FAERS: 1 | US FAERS | |
| 696 | jaundice | FAERS: 1 | US FAERS | |
| 697 | keratoacanthoma | FAERS: 1 | US FAERS | |
| 698 | skin abrasion | FAERS: 1 | US FAERS | |
| 699 | Abdominal symptom | OFFSIDES | ||
| 700 | Acholia | OFFSIDES | ||
| 701 | Acid reflux | OFFSIDES | ||
| 702 | Allergy to animal | OFFSIDES | ||
| 703 | Alopecia effluvium | OFFSIDES | ||
| 704 | Alopecia totalis | OFFSIDES | ||
| 705 | Androgenetic Alopecia | OFFSIDES | ||
| 706 | Angle Closure Glaucoma | OFFSIDES | ||
| 707 | Animal bite | OFFSIDES | ||
| 708 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 709 | Aortic valve calcification | OFFSIDES | ||
| 710 | Aortic valve sclerosis | OFFSIDES | ||
| 711 | Appendectomy | OFFSIDES | ||
| 712 | Arteritis | OFFSIDES | ||
| 713 | Atrial Flutter | OFFSIDES | ||
| 714 | Atrophic vulvovaginitis | OFFSIDES | ||
| 715 | Autoimmune hepatitis | OFFSIDES | ||
| 716 | Aversion | OFFSIDES | ||
| 717 | Avoidant Personality Disorder | OFFSIDES | ||
| 718 | Axonal neuropathy | OFFSIDES | ||
| 719 | Benign Neoplasm | OFFSIDES | ||
| 720 | Benign bone neoplasm | OFFSIDES | ||
| 721 | Benign neoplasm of skin | SIDER | ||
| 722 | Biopsy site unspecified abnormal | OFFSIDES | ||
| 723 | Bladder pain | SIDER | ||
| 724 | Blepharitis | OFFSIDES | ||
| 725 | Blepharospasm | OFFSIDES | ||
| 726 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 727 | Blood amylase decreased | OFFSIDES | ||
| 728 | Blood and lymphatic system disorders | SIDER | ||
| 729 | Blood cholinesterase decreased | OFFSIDES | ||
| 730 | Blood electrolytes decreased | OFFSIDES | ||
| 731 | Blood immunoglobulin E | OFFSIDES | ||
| 732 | Bone infarction | OFFSIDES | ||
| 733 | Bone trimming | OFFSIDES | ||
| 734 | Breast cancer recurrent | OFFSIDES | ||
| 735 | Breast fibroma | OFFSIDES | ||
| 736 | Bronchoconstriction | SIDER | ||
| 737 | Bulbar palsy | OFFSIDES | ||
| 738 | Candida sepsis | OFFSIDES | ||
| 739 | Cardiac imaging procedure normal | OFFSIDES | ||
| 740 | Cardiac valve replacement complication | OFFSIDES | ||
| 741 | Cervix carcinoma stage IV | OFFSIDES | ||
| 742 | Chronic ulcerative colitis | OFFSIDES | ||
| 743 | Circumoral paresthesia | SIDER | ||
| 744 | Clostridium difficile toxin test positive | OFFSIDES | ||
| 745 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 746 | Creatinine increased | SIDER | ||
| 747 | Cytomegalovirus test positive | OFFSIDES | ||
| 748 | Dental abscess | OFFSIDES | ||
| 749 | Dependent Personality Disorder | OFFSIDES | ||
| 750 | Diabetic Nephropathy | OFFSIDES | ||
| 751 | Diarrhea | OFFSIDES | ||
| 752 | Disease complication | OFFSIDES | ||
| 753 | Drug level fluctuating | OFFSIDES | ||
| 754 | Drug specific antibody present | OFFSIDES | ||
| 755 | Drug withdrawal headache | OFFSIDES | ||
| 756 | Duodenitis | SIDER | ||
| 757 | Dyslexia | OFFSIDES | ||
| 758 | Ear and labyrinth disorders | SIDER | ||
| 759 | Ear congestion | OFFSIDES | ||
| 760 | Ecchymosis | SIDER | ||
| 761 | Economic problem | OFFSIDES | ||
| 762 | Enamel anomaly | OFFSIDES | ||
| 763 | Endometrial hypertrophy | OFFSIDES | ||
| 764 | Endophthalmitis | SIDER | ||
| 765 | Enteritis | OFFSIDES | ||
| 766 | Enterococcal infection | OFFSIDES | ||
| 767 | Epidural Abscess | OFFSIDES | ||
| 768 | Epidural lipomatosis | OFFSIDES | ||
| 769 | Episcleritis | SIDER | ||
| 770 | Erythema Infectiosum | OFFSIDES | ||
| 771 | Escherichia infection | OFFSIDES | ||
| 772 | Esophageal Perforation | OFFSIDES | ||
| 773 | Esophageal Stenosis | OFFSIDES | ||
| 774 | Eustachian tube disorder | OFFSIDES | ||
| 775 | Exacerbation of asthma | SIDER | ||
| 776 | Extremity contracture | OFFSIDES | ||
| 777 | Eye laser surgery | OFFSIDES | ||
| 778 | Factor V deficiency | OFFSIDES | ||
| 779 | Femoral pulse decreased | OFFSIDES | ||
| 780 | Focal glomerulosclerosis | OFFSIDES | ||
| 781 | Food Allergy | OFFSIDES | ||
| 782 | Foreign body trauma | OFFSIDES | ||
| 783 | Gastroduodenitis | OFFSIDES | ||
| 784 | Gastrooesophageal cancer | OFFSIDES | ||
| 785 | General symptom | OFFSIDES | ||
| 786 | Genital Herpes | OFFSIDES | ||
| 787 | Glomerulonephritis | OFFSIDES | ||
| 788 | Granuloma Annulare | OFFSIDES | ||
| 789 | Guttate psoriasis | OFFSIDES | ||
| 790 | Hand repair operation | OFFSIDES | ||
| 791 | Hepatic vein stenosis | OFFSIDES | ||
| 792 | Hypertensive heart disease | OFFSIDES | ||
| 793 | Hypopharyngeal Cancer | OFFSIDES | ||
| 794 | Impetigo | OFFSIDES | ||
| 795 | Infestation | SIDER | ||
| 796 | Influenza-like symptoms | SIDER | ||
| 797 | Infusion site mobility decreased | OFFSIDES | ||
| 798 | Infusion site necrosis | OFFSIDES | ||
| 799 | Infusion site phlebitis | OFFSIDES | ||
| 800 | Injection site injury | OFFSIDES | ||
| 801 | Klebsiella sepsis | OFFSIDES | ||
| 802 | Latex allergy | OFFSIDES | ||
| 803 | Libido disorder | OFFSIDES | ||
| 804 | Lip exfoliation | OFFSIDES | ||
| 805 | Liver Abscess | OFFSIDES | ||
| 806 | Local reaction | SIDER | ||
| 807 | Lower respiratory tract infection fungal | OFFSIDES | ||
| 808 | Mallory-Weiss Syndrome | OFFSIDES | ||
| 809 | Malocclusion | OFFSIDES | ||
| 810 | Melanosis | OFFSIDES | ||
| 811 | Metastatic Renal Cell Carcinoma | OFFSIDES | ||
| 812 | Micturition frequency decreased | OFFSIDES | ||
| 813 | Motor retardation | OFFSIDES | ||
| 814 | Nephrectasia | OFFSIDES | ||
| 815 | Nerve Root Compression | OFFSIDES | ||
| 816 | Nerve root lesion | SIDER | ||
| 817 | Neuromyelitis Optica | OFFSIDES | ||
| 818 | No adverse effect | OFFSIDES | ||
| 819 | Non-small cell lung cancer stage I | OFFSIDES | ||
| 820 | Open reduction of fracture | OFFSIDES | ||
| 821 | Orthostatic hypertension | OFFSIDES | ||
| 822 | Osteitis Deformans | OFFSIDES | ||
| 823 | Osteoma cutis | OFFSIDES | ||
| 824 | Pain, Intractable | 15337809 | CTD | |
| 825 | Paranoid Personality Disorder | OFFSIDES | ||
| 826 | Parotid duct obstruction | OFFSIDES | ||
| 827 | Peripheral paralysis | OFFSIDES | ||
| 828 | Pharyngitis | SIDER | ||
| 829 | Pharyngolaryngeal Pain | OFFSIDES | ||
| 830 | Pharyngolaryngeal discomfort | OFFSIDES | ||
| 831 | Pigmentary retinopathy | OFFSIDES | ||
| 832 | Porokeratosis | OFFSIDES | ||
| 833 | Post procedural fistula | OFFSIDES | ||
| 834 | Post procedural infection | OFFSIDES | ||
| 835 | Post procedural swelling | OFFSIDES | ||
| 836 | Post-traumatic pain | OFFSIDES | ||
| 837 | Prolonged expiration | OFFSIDES | ||
| 838 | Prurigo | SIDER | ||
| 839 | Pruritus allergic | OFFSIDES | ||
| 840 | Pseudocyst | OFFSIDES | ||
| 841 | Punctate keratitis | OFFSIDES | ||
| 842 | Pyogenic granuloma | OFFSIDES | ||
| 843 | Radiation mucositis | OFFSIDES | ||
| 844 | Radiculopathy | SIDER | ||
| 845 | Redness | SIDER | ||
| 846 | Respiratory tract infection bacterial | OFFSIDES | ||
| 847 | Respiratory tract irritation | OFFSIDES | ||
| 848 | Retinal artery embolism | OFFSIDES | ||
| 849 | Revision of internal fixation | OFFSIDES | ||
| 850 | Rheumatoid Nodule | OFFSIDES | ||
| 851 | Sacroiliitis | OFFSIDES | ||
| 852 | Salivary Gland Fistula | OFFSIDES | ||
| 853 | Sarcoma of skin | OFFSIDES | ||
| 854 | Scan bone marrow abnormal | OFFSIDES | ||
| 855 | Scan lymph nodes | OFFSIDES | ||
| 856 | Scleritis | OFFSIDES SIDER | ||
| 857 | Serum calcium decreased | SIDER | ||
| 858 | Shoulder Pain | OFFSIDES | ||
| 859 | Skeletal injury | OFFSIDES | ||
| 860 | Sleep disorder due to general medical condition, insomnia type | OFFSIDES | ||
| 861 | Splenic granuloma | OFFSIDES | ||
| 862 | Spondylolysis | OFFSIDES | ||
| 863 | Starvation | OFFSIDES | ||
| 864 | Stridor | SIDER | ||
| 865 | Suture related complication | OFFSIDES | ||
| 866 | Sweating | SIDER | ||
| 867 | Synovectomy | OFFSIDES | ||
| 868 | Systolic hypertension | OFFSIDES | ||
| 869 | T-lymphocyte count increased | OFFSIDES | ||
| 870 | Temporal Arteritis | OFFSIDES | ||
| 871 | Tenosynovitis | OFFSIDES | ||
| 872 | Thelitis | OFFSIDES | ||
| 873 | Tinea Pedis | OFFSIDES | ||
| 874 | Tinea cruris | OFFSIDES | ||
| 875 | Tobacco withdrawal symptoms | OFFSIDES | ||
| 876 | Tooth Erosion | OFFSIDES | ||
| 877 | Trauma | SIDER | ||
| 878 | Trichiasis | OFFSIDES | ||
| 879 | Trigeminal Nerve Disorder | OFFSIDES | ||
| 880 | Uremia | SIDER | ||
| 881 | Urinary tract infection pseudomonal | OFFSIDES | ||
| 882 | Urine calcium decreased | OFFSIDES | ||
| 883 | Uterine stenosis | OFFSIDES | ||
| 884 | Vaginal burning sensation | OFFSIDES | ||
| 885 | Varicose vein operation | OFFSIDES | ||
| 886 | Venous Injury | OFFSIDES | ||
| 887 | Very low density lipoprotein increased | OFFSIDES | ||
| 888 | Vestibular Neuronitis | OFFSIDES | ||
| 889 | Violence-related symptom | OFFSIDES | ||
| 890 | White blood cells stool positive | OFFSIDES | ||
| 891 | Wound infection staphylococcal | OFFSIDES | ||
| 892 | carbuncle | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.