etonogestrel
(GCKFUYQCUCGESZ-BPIQYHPVSA-N)
Structure
- SMILES
- C#C[C@]1(O)CC[C@@H]2[C@]1(CC)CC(=C)[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
- Type(s)
- Approved; Investigational
- ATC code(s)
- G03AC08
- Molecular Formula:
- C22H28O2
- Molecular Weight:
- 324.457
- Log P:
- 4.0487
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 37.3
- CAS Number(s):
- 54048-10-1
Synonym(s)
1.
etonogestrel
2.
13-ethyl-17-hydroxy-11-methylene-18,19-dinor-17alpha-pregn-4-en-20-yn-3-one
3.
3-keto-desogestrel
4.
3-ketodesogestrel
5.
3-oxo desogestrel
6.
3-oxodesogestrel
7.
Implanon
8.
ORG-3236
9.
nexplanon
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | No adverse event | FAERS: 7812 | US FAERS | |
| 2 | Device difficult to use | FAERS: 5284 | US FAERS | |
| 3 | Product quality issue | FAERS: 4529 | US FAERS | |
| 4 | Device breakage | FAERS: 3840 | OFFSIDES US FAERS | |
| 5 | Device deployment issue | FAERS: 3010 | US FAERS | |
| 6 | Complication associated with device | FAERS: 2810 | US FAERS | |
| 7 | Incorrect drug administration duration | FAERS: 2247 | OFFSIDES US FAERS | |
| 8 | Menorrhagia | FAERS: 2246 | US FAERS | |
| 9 | Medical device complication | FAERS: 2103 | OFFSIDES US FAERS | |
| 10 | Complication of device insertion | FAERS: 1970 | US FAERS | |
| 11 | Implant site pain | FAERS: 1758 | OFFSIDES SIDER US FAERS | |
| 12 | Device dislocation | FAERS: 1700 | OFFSIDES US FAERS | |
| 13 | Device kink | FAERS: 1599 | US FAERS | |
| 14 | Metrorrhagia | FAERS: 1401 | US FAERS | |
| 15 | Pregnancy with implant contraceptive | FAERS: 1384 | OFFSIDES US FAERS | |
| 16 | Complication of device removal | FAERS: 1358 | OFFSIDES US FAERS | |
| 17 | Device expulsion | FAERS: 1294 | US FAERS | |
| 18 | Headache | FAERS: 1281 | 11861056 | CTD SIDER US FAERS |
| 19 | Nausea | FAERS: 828 | SIDER US FAERS | |
| 20 | Adverse event | FAERS: 679 | US FAERS | |
| 21 | Mood swings | FAERS: 669 | SIDER US FAERS | |
| 22 | Incorrect product administration duration | FAERS: 662 | US FAERS | |
| 23 | Dizziness | FAERS: 595 | 11861056 | CTD SIDER US FAERS |
| 24 | Pain | FAERS: 568 | 17763263 | CTD SIDER US FAERS |
| 25 | Migration of implanted drug | FAERS: 509 | US FAERS | |
| 26 | Implant site pruritus | FAERS: 459 | OFFSIDES US FAERS | |
| 27 | Implant site erythema | FAERS: 446 | OFFSIDES US FAERS | |
| 28 | Weight decreased | FAERS: 414 | SIDER US FAERS | |
| 29 | Implant site infection | FAERS: 400 | OFFSIDES US FAERS | |
| 30 | Fatigue | FAERS: 393 | SIDER US FAERS | |
| 31 | Back Pain | FAERS: 387 | SIDER US FAERS | |
| 32 | Anxiety | FAERS: 378 | SIDER US FAERS | |
| 33 | Abdominal Pain | FAERS: 376 | SIDER US FAERS | |
| 34 | Acne | FAERS: 364 | OFFSIDES SIDER US FAERS | |
| 35 | Implant site swelling | FAERS: 359 | US FAERS | |
| 36 | Implant site bruising | FAERS: 335 | US FAERS | |
| 37 | Alopecia | FAERS: 315 | SIDER US FAERS | |
| 38 | Vomiting | FAERS: 308 | SIDER US FAERS | |
| 39 | Discomfort | FAERS: 278 | US FAERS | |
| 40 | Malaise | FAERS: 261 | US FAERS | |
| 41 | Product use issue | FAERS: 243 | US FAERS | |
| 42 | Medical device removal | FAERS: 237 | US FAERS | |
| 43 | Chest Pain | FAERS: 227 | US FAERS | |
| 44 | Feeling abnormal | FAERS: 225 | US FAERS | |
| 45 | Implant site scar | FAERS: 214 | US FAERS | |
| 46 | Limb discomfort | FAERS: 214 | US FAERS | |
| 47 | Expired product administered | FAERS: 213 | US FAERS | |
| 48 | Incorrect route of drug administration | FAERS: 209 | US FAERS | |
| 49 | Maternal exposure during pregnancy | FAERS: 207 | US FAERS | |
| 50 | Implant site fibrosis | FAERS: 203 | US FAERS | |
| 51 | Drug exposure during pregnancy | FAERS: 183 | OFFSIDES US FAERS | |
| 52 | Peripheral swelling | FAERS: 183 | US FAERS | |
| 53 | Implant site irritation | FAERS: 181 | US FAERS | |
| 54 | Difficulty removing drug implant | FAERS: 180 | US FAERS | |
| 55 | Asthenia | FAERS: 178 | SIDER US FAERS | |
| 56 | Overdose | FAERS: 177 | US FAERS | |
| 57 | Pruritus | FAERS: 176 | SIDER US FAERS | |
| 58 | Inappropriate schedule of drug administration | FAERS: 175 | US FAERS | |
| 59 | Drug dose omission | FAERS: 171 | US FAERS | |
| 60 | Urticaria | FAERS: 165 | SIDER US FAERS | |
| 61 | Implant site rash | FAERS: 159 | US FAERS | |
| 62 | Hypersensitivity | FAERS: 151 | SIDER US FAERS | |
| 63 | Needle issue | FAERS: 145 | US FAERS | |
| 64 | Implant site reaction | FAERS: 142 | OFFSIDES SIDER US FAERS | |
| 65 | Product use in unapproved indication | FAERS: 139 | US FAERS | |
| 66 | Breast tenderness | FAERS: 138 | SIDER US FAERS | |
| 67 | Arthralgia | FAERS: 129 | SIDER US FAERS | |
| 68 | Depressed mood | FAERS: 129 | OFFSIDES SIDER US FAERS | |
| 69 | Vaginal Discharge | FAERS: 127 | SIDER US FAERS | |
| 70 | Erythema | FAERS: 126 | SIDER US FAERS | |
| 71 | Syncope | FAERS: 118 | US FAERS | |
| 72 | Thrombosis | FAERS: 115 | US FAERS | |
| 73 | Drug ineffective | FAERS: 107 | OFFSIDES US FAERS | |
| 74 | Emotional disorder | FAERS: 105 | US FAERS | |
| 75 | Pulmonary Embolism | FAERS: 102 | US FAERS | |
| 76 | Circumstance or information capable of leading to medication error | FAERS: 98 | US FAERS | |
| 77 | Drug administration error | FAERS: 91 | US FAERS | |
| 78 | Medical device site discomfort | FAERS: 89 | US FAERS | |
| 79 | Infection | FAERS: 88 | SIDER US FAERS | |
| 80 | Cellulitis | FAERS: 87 | OFFSIDES US FAERS | |
| 81 | Limb injury | FAERS: 87 | US FAERS | |
| 82 | Implant site cellulitis | FAERS: 86 | OFFSIDES US FAERS | |
| 83 | Pelvic Pain | FAERS: 83 | US FAERS | |
| 84 | Urinary tract infection | FAERS: 83 | SIDER US FAERS | |
| 85 | Wrong technique in product usage process | FAERS: 81 | US FAERS | |
| 86 | Crying | FAERS: 78 | OFFSIDES SIDER US FAERS | |
| 87 | Ectopic Pregnancy | FAERS: 78 | SIDER US FAERS | |
| 88 | Implant site inflammation | FAERS: 77 | OFFSIDES US FAERS | |
| 89 | Medical device discomfort | FAERS: 77 | US FAERS | |
| 90 | Swelling | FAERS: 77 | SIDER US FAERS | |
| 91 | Neuralgia | FAERS: 72 | OFFSIDES US FAERS | |
| 92 | Implant site mass | FAERS: 70 | US FAERS | |
| 93 | Maternal exposure before pregnancy | FAERS: 68 | US FAERS | |
| 94 | Stress | FAERS: 68 | US FAERS | |
| 95 | Abdominal discomfort | FAERS: 67 | US FAERS | |
| 96 | Burning sensation | FAERS: 67 | US FAERS | |
| 97 | Hormone level abnormal | FAERS: 67 | OFFSIDES US FAERS | |
| 98 | Implant site discharge | FAERS: 65 | US FAERS | |
| 99 | Anger | FAERS: 64 | US FAERS | |
| 100 | Deep Vein Thrombosis | FAERS: 63 | US FAERS | |
| 101 | Palpitations | FAERS: 62 | US FAERS | |
| 102 | Breast Feeding | FAERS: 59 | US FAERS | |
| 103 | Pregnancy | FAERS: 59 | SIDER US FAERS | |
| 104 | Nervousness | FAERS: 57 | SIDER US FAERS | |
| 105 | Application site discomfort | FAERS: 56 | US FAERS | |
| 106 | Implant site hypersensitivity | FAERS: 55 | OFFSIDES US FAERS | |
| 107 | Injury associated with device | FAERS: 55 | US FAERS | |
| 108 | Implant site vesicles | FAERS: 54 | US FAERS | |
| 109 | Cerebrovascular accident | FAERS: 53 | US FAERS | |
| 110 | Musculoskeletal Pain | FAERS: 53 | SIDER US FAERS | |
| 111 | Somnolence | FAERS: 53 | SIDER US FAERS | |
| 112 | Implant site abscess | FAERS: 50 | OFFSIDES US FAERS | |
| 113 | Implant site warmth | FAERS: 48 | US FAERS | |
| 114 | Expired drug administered | FAERS: 46 | US FAERS | |
| 115 | Wrong technique in drug usage process | FAERS: 45 | US FAERS | |
| 116 | Chest discomfort | FAERS: 44 | US FAERS | |
| 117 | Implant site induration | FAERS: 44 | US FAERS | |
| 118 | Implant site urticaria | FAERS: 42 | US FAERS | |
| 119 | Inappropriate schedule of product administration | FAERS: 42 | US FAERS | |
| 120 | Neck Pain | FAERS: 42 | US FAERS | |
| 121 | Obesity | FAERS: 42 | US FAERS | |
| 122 | Accidental exposure to product | FAERS: 40 | US FAERS | |
| 123 | Pregnancy on contraceptive | FAERS: 39 | OFFSIDES US FAERS | |
| 124 | Pregnancy with contraceptive device | FAERS: 39 | US FAERS | |
| 125 | Medication Error | FAERS: 38 | US FAERS | |
| 126 | Oropharyngeal pain | FAERS: 38 | US FAERS | |
| 127 | Tremor | FAERS: 37 | US FAERS | |
| 128 | Coital bleeding | FAERS: 36 | US FAERS | |
| 129 | Myalgia | FAERS: 36 | SIDER US FAERS | |
| 130 | Nerve injury | FAERS: 36 | US FAERS | |
| 131 | Visual Impairment | FAERS: 36 | SIDER US FAERS | |
| 132 | Device malfunction | FAERS: 35 | US FAERS | |
| 133 | Dyspareunia | FAERS: 34 | US FAERS | |
| 134 | Adnexa uteri pain | FAERS: 33 | US FAERS | |
| 135 | Bipolar Disorder | FAERS: 33 | OFFSIDES US FAERS | |
| 136 | Blindness | FAERS: 33 | US FAERS | |
| 137 | Cyst | FAERS: 33 | US FAERS | |
| 138 | Infertility | FAERS: 33 | US FAERS | |
| 139 | Drug administered to patient of inappropriate age | FAERS: 31 | US FAERS | |
| 140 | Procedural complication | FAERS: 31 | US FAERS | |
| 141 | Product dose omission | FAERS: 31 | US FAERS | |
| 142 | Fibrosis | FAERS: 30 | SIDER US FAERS | |
| 143 | Injection site pain | FAERS: 29 | SIDER US FAERS | |
| 144 | Suicide attempt | FAERS: 29 | US FAERS | |
| 145 | Therapeutic response unexpected | FAERS: 29 | US FAERS | |
| 146 | Vulvovaginal dryness | FAERS: 29 | US FAERS | |
| 147 | Chills | FAERS: 28 | US FAERS | |
| 148 | Constipation | FAERS: 28 | SIDER US FAERS | |
| 149 | Overweight | FAERS: 28 | OFFSIDES US FAERS | |
| 150 | Unevaluable event | FAERS: 28 | US FAERS | |
| 151 | Arthropathy | FAERS: 27 | US FAERS | |
| 152 | Emotional distress | FAERS: 27 | US FAERS | |
| 153 | Impaired work ability | FAERS: 26 | OFFSIDES US FAERS | |
| 154 | Joint injury | FAERS: 26 | US FAERS | |
| 155 | Skin irritation | FAERS: 26 | US FAERS | |
| 156 | Application site pain | FAERS: 25 | US FAERS | |
| 157 | Device Failure | FAERS: 25 | US FAERS | |
| 158 | Epilepsy | FAERS: 25 | OFFSIDES US FAERS | |
| 159 | Incorrect route of product administration | FAERS: 25 | US FAERS | |
| 160 | Vulvovaginal pain | FAERS: 25 | OFFSIDES US FAERS | |
| 161 | Device damage | FAERS: 24 | US FAERS | |
| 162 | Eczema | FAERS: 24 | US FAERS | |
| 163 | Rash erythematous | FAERS: 24 | US FAERS | |
| 164 | Laceration | FAERS: 23 | US FAERS | |
| 165 | Lethargy | FAERS: 23 | US FAERS | |
| 166 | Tachycardia | FAERS: 23 | US FAERS | |
| 167 | Device related infection | FAERS: 22 | US FAERS | |
| 168 | Drug prescribing error | FAERS: 22 | US FAERS | |
| 169 | Poor quality sleep | FAERS: 22 | US FAERS | |
| 170 | Premenstrual syndrome | FAERS: 22 | SIDER US FAERS | |
| 171 | Amnesia | FAERS: 21 | US FAERS | |
| 172 | Dyspepsia | FAERS: 21 | SIDER US FAERS | |
| 173 | Cholelithiasis | FAERS: 20 | US FAERS | |
| 174 | Endometriosis | FAERS: 20 | US FAERS | |
| 175 | Hysterectomy | FAERS: 20 | OFFSIDES US FAERS | |
| 176 | Nasopharyngitis | FAERS: 20 | US FAERS | |
| 177 | Night sweats | FAERS: 20 | US FAERS | |
| 178 | Stillbirth | FAERS: 20 | US FAERS | |
| 179 | Agitation | FAERS: 19 | US FAERS | |
| 180 | Asthma | FAERS: 19 | SIDER US FAERS | |
| 181 | Expired device used | FAERS: 19 | US FAERS | |
| 182 | Implant site nerve injury | FAERS: 19 | US FAERS | |
| 183 | Implant site pustules | FAERS: 19 | US FAERS | |
| 184 | Incision site pain | FAERS: 19 | US FAERS | |
| 185 | Multiple Sclerosis | FAERS: 19 | OFFSIDES US FAERS | |
| 186 | Myocardial Infarction | FAERS: 19 | US FAERS | |
| 187 | Paranoia | FAERS: 19 | OFFSIDES US FAERS | |
| 188 | Vertigo | FAERS: 19 | US FAERS | |
| 189 | Vulvovaginal pruritus | FAERS: 19 | US FAERS | |
| 190 | Device use error | FAERS: 18 | US FAERS | |
| 191 | Drug ineffective for unapproved indication | FAERS: 18 | US FAERS | |
| 192 | Exposure during breast feeding | FAERS: 18 | US FAERS | |
| 193 | Hypothyroidism | FAERS: 18 | US FAERS | |
| 194 | Implant site necrosis | FAERS: 18 | OFFSIDES US FAERS | |
| 195 | Lip swelling | FAERS: 18 | US FAERS | |
| 196 | Musculoskeletal discomfort | FAERS: 18 | SIDER US FAERS | |
| 197 | Pallor | FAERS: 18 | US FAERS | |
| 198 | Post procedural complication | FAERS: 18 | OFFSIDES US FAERS | |
| 199 | Product prescribing error | FAERS: 18 | US FAERS | |
| 200 | Scab | FAERS: 18 | OFFSIDES US FAERS | |
| 201 | Wrong technique in device usage process | FAERS: 18 | US FAERS | |
| 202 | Administration site discomfort | FAERS: 17 | US FAERS | |
| 203 | Back disorder | FAERS: 17 | US FAERS | |
| 204 | Eye pain | FAERS: 17 | OFFSIDES US FAERS | |
| 205 | Implant site extravasation | FAERS: 17 | US FAERS | |
| 206 | Joint swelling | FAERS: 17 | US FAERS | |
| 207 | Nephrolithiasis | FAERS: 17 | OFFSIDES US FAERS | |
| 208 | Skin lesion | FAERS: 17 | US FAERS | |
| 209 | furuncle | FAERS: 17 | US FAERS | |
| 210 | Carpal Tunnel Syndrome | FAERS: 16 | US FAERS | |
| 211 | Chromaturia | FAERS: 16 | US FAERS | |
| 212 | Dehydration | FAERS: 16 | US FAERS | |
| 213 | Dysuria | FAERS: 16 | SIDER US FAERS | |
| 214 | Flatulence | FAERS: 16 | SIDER US FAERS | |
| 215 | Inflammation | FAERS: 16 | US FAERS | |
| 216 | Influenza | FAERS: 16 | US FAERS | |
| 217 | Intentional self-injury | FAERS: 16 | OFFSIDES US FAERS | |
| 218 | Peripheral nerve lesion | FAERS: 16 | OFFSIDES US FAERS | |
| 219 | Purulence | FAERS: 16 | US FAERS | |
| 220 | Tuberculosis | FAERS: 16 | US FAERS | |
| 221 | Application site erythema | FAERS: 15 | US FAERS | |
| 222 | Bacterial Vaginosis | FAERS: 15 | US FAERS | |
| 223 | Device extrusion | FAERS: 15 | US FAERS | |
| 224 | Diabetes Mellitus | FAERS: 15 | US FAERS | |
| 225 | Encapsulation reaction | FAERS: 15 | US FAERS | |
| 226 | Injection site erythema | FAERS: 15 | US FAERS | |
| 227 | Intentional medical device removal by patient | FAERS: 15 | US FAERS | |
| 228 | Lymphadenopathy | FAERS: 15 | US FAERS | |
| 229 | Pancreatitis | FAERS: 15 | OFFSIDES US FAERS | |
| 230 | Pelvic Inflammatory Disease | FAERS: 15 | US FAERS | |
| 231 | Personality Change | FAERS: 15 | US FAERS | |
| 232 | Pregnancy test false positive | FAERS: 15 | OFFSIDES US FAERS | |
| 233 | Presyncope | FAERS: 15 | US FAERS | |
| 234 | Suppressed lactation | FAERS: 15 | US FAERS | |
| 235 | jaundice | FAERS: 15 | US FAERS | |
| 236 | Circumstance or information capable of leading to device use error | FAERS: 14 | US FAERS | |
| 237 | Dry skin | FAERS: 14 | US FAERS | |
| 238 | Hunger | FAERS: 14 | US FAERS | |
| 239 | Implant site nodule | FAERS: 14 | US FAERS | |
| 240 | Incision site complication | FAERS: 14 | US FAERS | |
| 241 | Injection site pruritus | FAERS: 14 | US FAERS | |
| 242 | Memory impairment | FAERS: 14 | US FAERS | |
| 243 | Product quality control issue | FAERS: 14 | US FAERS | |
| 244 | Purulent discharge | FAERS: 14 | US FAERS | |
| 245 | nervous system disorder | FAERS: 14 | SIDER US FAERS | |
| 246 | Angioedema | FAERS: 13 | SIDER US FAERS | |
| 247 | Cystitis | FAERS: 13 | US FAERS | |
| 248 | Device migration | FAERS: 13 | OFFSIDES US FAERS | |
| 249 | Drug administered at inappropriate site | FAERS: 13 | US FAERS | |
| 250 | Epistaxis | FAERS: 13 | US FAERS | |
| 251 | Food craving | FAERS: 13 | US FAERS | |
| 252 | Gastric Bypass | FAERS: 13 | US FAERS | |
| 253 | Implant site erosion | FAERS: 13 | US FAERS | |
| 254 | Lactation Disorder | FAERS: 13 | US FAERS | |
| 255 | Musculoskeletal stiffness | FAERS: 13 | US FAERS | |
| 256 | Photophobia | FAERS: 13 | US FAERS | |
| 257 | Product closure removal difficult | FAERS: 13 | US FAERS | |
| 258 | Thrombophlebitis | FAERS: 13 | OFFSIDES US FAERS | |
| 259 | Vulvovaginal discomfort | FAERS: 13 | SIDER US FAERS | |
| 260 | Abscess | FAERS: 12 | SIDER US FAERS | |
| 261 | Activities of daily living impaired | FAERS: 12 | US FAERS | |
| 262 | Application site scab | FAERS: 12 | US FAERS | |
| 263 | Blood iron decreased | FAERS: 12 | US FAERS | |
| 264 | Bone pain | FAERS: 12 | SIDER US FAERS | |
| 265 | Cervical dysplasia | FAERS: 12 | US FAERS | |
| 266 | Frustration tolerance decreased | FAERS: 12 | US FAERS | |
| 267 | Hypersomnia | FAERS: 12 | US FAERS | |
| 268 | Implant site cyst | FAERS: 12 | US FAERS | |
| 269 | Pain of skin | FAERS: 12 | US FAERS | |
| 270 | Psoriasis | FAERS: 12 | US FAERS | |
| 271 | Pulmonary Infarction | FAERS: 12 | US FAERS | |
| 272 | Ruptured ectopic pregnancy | FAERS: 12 | OFFSIDES US FAERS | |
| 273 | Sepsis | FAERS: 12 | US FAERS | |
| 274 | Sinusitis | FAERS: 12 | SIDER US FAERS | |
| 275 | Application site scar | FAERS: 11 | US FAERS | |
| 276 | Ectopic pregnancy with contraceptive device | FAERS: 11 | US FAERS | |
| 277 | Fibromyalgia | FAERS: 11 | US FAERS | |
| 278 | Hypokinesia | FAERS: 11 | US FAERS | |
| 279 | Hypotension | FAERS: 11 | US FAERS | |
| 280 | Nipple pain | FAERS: 11 | US FAERS | |
| 281 | Nodule | FAERS: 11 | US FAERS | |
| 282 | Occupational exposure to product | FAERS: 11 | US FAERS | |
| 283 | Pharyngitis | FAERS: 11 | SIDER US FAERS | |
| 284 | Secretion discharge | FAERS: 11 | US FAERS | |
| 285 | Skin reaction | FAERS: 11 | US FAERS | |
| 286 | Abnormal withdrawal bleeding | FAERS: 10 | US FAERS | |
| 287 | Angina Pectoris | FAERS: 10 | US FAERS | |
| 288 | Blood urine present | FAERS: 10 | US FAERS | |
| 289 | Bronchitis | FAERS: 10 | US FAERS | |
| 290 | Cervix carcinoma | FAERS: 10 | US FAERS | |
| 291 | Cold sweat | FAERS: 10 | US FAERS | |
| 292 | Complication of drug implant insertion | FAERS: 10 | US FAERS | |
| 293 | Device defective | FAERS: 10 | US FAERS | |
| 294 | General symptom | FAERS: 10 | US FAERS | |
| 295 | Hyperthyroidism | FAERS: 10 | US FAERS | |
| 296 | Iatrogenic injury | FAERS: 10 | OFFSIDES US FAERS | |
| 297 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 298 | Musculoskeletal chest pain | FAERS: 10 | US FAERS | |
| 299 | Product physical issue | FAERS: 10 | US FAERS | |
| 300 | Abnormal weight gain | FAERS: 9 | US FAERS | |
| 301 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 302 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 303 | Ecchymosis | FAERS: 9 | US FAERS | |
| 304 | Erythema Nodosum | FAERS: 9 | OFFSIDES US FAERS | |
| 305 | Exploratory operation | FAERS: 9 | US FAERS | |
| 306 | Incision site swelling | FAERS: 9 | US FAERS | |
| 307 | Loss of personal independence in daily activities | FAERS: 9 | US FAERS | |
| 308 | Pneumonia | FAERS: 9 | US FAERS | |
| 309 | Pneumothorax | FAERS: 9 | US FAERS | |
| 310 | Tinnitus | FAERS: 9 | US FAERS | |
| 311 | Abasia | FAERS: 8 | US FAERS | |
| 312 | Appendicitis | FAERS: 8 | US FAERS | |
| 313 | Breast Cyst | FAERS: 8 | OFFSIDES US FAERS | |
| 314 | Breast discomfort | FAERS: 8 | US FAERS | |
| 315 | Completed Suicide | FAERS: 8 | US FAERS | |
| 316 | Deafness | FAERS: 8 | US FAERS | |
| 317 | Dermatitis | FAERS: 8 | SIDER US FAERS | |
| 318 | Device physical property issue | FAERS: 8 | US FAERS | |
| 319 | Dysgeusia | FAERS: 8 | US FAERS | |
| 320 | Economic problem | FAERS: 8 | OFFSIDES US FAERS | |
| 321 | Embedded device | FAERS: 8 | US FAERS | |
| 322 | Feeling Cold | FAERS: 8 | OFFSIDES US FAERS | |
| 323 | Flushing | FAERS: 8 | US FAERS | |
| 324 | Gastritis | FAERS: 8 | SIDER US FAERS | |
| 325 | Gestational Diabetes | FAERS: 8 | US FAERS | |
| 326 | Implant site dermatitis | FAERS: 8 | US FAERS | |
| 327 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 328 | Injection Site Reaction | FAERS: 8 | SIDER US FAERS | |
| 329 | Injection site infection | FAERS: 8 | US FAERS | |
| 330 | Injection site mass | FAERS: 8 | US FAERS | |
| 331 | Irritable Bowel Syndrome | FAERS: 8 | US FAERS | |
| 332 | Monoplegia | FAERS: 8 | US FAERS | |
| 333 | Muscle strain | FAERS: 8 | US FAERS | |
| 334 | Muscle tightness | FAERS: 8 | US FAERS | |
| 335 | Product administration error | FAERS: 8 | US FAERS | |
| 336 | Product contamination | FAERS: 8 | US FAERS | |
| 337 | Product prescribing issue | FAERS: 8 | US FAERS | |
| 338 | Staphylococcal abscess | FAERS: 8 | OFFSIDES US FAERS | |
| 339 | Subcutaneous Abscess | FAERS: 8 | US FAERS | |
| 340 | Suture insertion | FAERS: 8 | US FAERS | |
| 341 | Uterine Polyp | FAERS: 8 | US FAERS | |
| 342 | Uterine spasm | FAERS: 8 | US FAERS | |
| 343 | Vulvovaginal mycotic infection | FAERS: 8 | US FAERS | |
| 344 | Accidental overdose | FAERS: 7 | US FAERS | |
| 345 | Application site pruritus | FAERS: 7 | OFFSIDES US FAERS | |
| 346 | Arthropod bite | FAERS: 7 | US FAERS | |
| 347 | Bipolar I disorder | FAERS: 7 | US FAERS | |
| 348 | Feeling of body temperature change | FAERS: 7 | US FAERS | |
| 349 | Food Allergy | FAERS: 7 | US FAERS | |
| 350 | Head discomfort | FAERS: 7 | US FAERS | |
| 351 | Hemiplegia | FAERS: 7 | US FAERS | |
| 352 | Implant site coldness | FAERS: 7 | US FAERS | |
| 353 | Implant site papules | FAERS: 7 | US FAERS | |
| 354 | Injection site bruising | FAERS: 7 | US FAERS | |
| 355 | Invasive Ductal Breast Carcinoma | FAERS: 7 | US FAERS | |
| 356 | Libido disorder | FAERS: 7 | US FAERS | |
| 357 | Migraine with Aura | FAERS: 7 | US FAERS | |
| 358 | Patient-device incompatibility | FAERS: 7 | US FAERS | |
| 359 | Petechiae | FAERS: 7 | US FAERS | |
| 360 | Polymenorrhagia | FAERS: 7 | US FAERS | |
| 361 | Poor quality device used | FAERS: 7 | US FAERS | |
| 362 | Product packaging issue | FAERS: 7 | US FAERS | |
| 363 | Progesterone increased | FAERS: 7 | US FAERS | |
| 364 | Quality of life decreased | FAERS: 7 | US FAERS | |
| 365 | Rheumatoid Arthritis | FAERS: 7 | US FAERS | |
| 366 | Sexual Dysfunction | FAERS: 7 | SIDER US FAERS | |
| 367 | Ulcer | FAERS: 7 | US FAERS | |
| 368 | Violence-related symptom | FAERS: 7 | US FAERS | |
| 369 | Vulvovaginal burning sensation | FAERS: 7 | US FAERS | |
| 370 | Wound Infection | FAERS: 7 | US FAERS | |
| 371 | Anaphylactic shock | FAERS: 6 | SIDER US FAERS | |
| 372 | Application site swelling | FAERS: 6 | US FAERS | |
| 373 | Arthritis | FAERS: 6 | US FAERS | |
| 374 | Cholecystitis | FAERS: 6 | US FAERS | |
| 375 | Colitis | FAERS: 6 | US FAERS | |
| 376 | Conversion disorder | FAERS: 6 | US FAERS | |
| 377 | Device allergy | FAERS: 6 | US FAERS | |
| 378 | Device use issue | FAERS: 6 | US FAERS | |
| 379 | Disease recurrence | FAERS: 6 | US FAERS | |
| 380 | Disorientation | FAERS: 6 | US FAERS | |
| 381 | Drug exposure before pregnancy | FAERS: 6 | OFFSIDES US FAERS | |
| 382 | False negative pregnancy test | FAERS: 6 | OFFSIDES US FAERS | |
| 383 | Flank Pain | FAERS: 6 | US FAERS | |
| 384 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 385 | Grip strength decreased | FAERS: 6 | US FAERS | |
| 386 | Hemiparesis | FAERS: 6 | US FAERS | |
| 387 | Hepatitis | FAERS: 6 | US FAERS | |
| 388 | Injected limb mobility decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 389 | Injection site discomfort | FAERS: 6 | US FAERS | |
| 390 | Joint Range of Motion Decreased | FAERS: 6 | US FAERS | |
| 391 | Medical device pain | FAERS: 6 | US FAERS | |
| 392 | Meningioma | FAERS: 6 | US FAERS | |
| 393 | Muscle Fatigue | FAERS: 6 | US FAERS | |
| 394 | Obsessive-Compulsive Disorder | FAERS: 6 | US FAERS | |
| 395 | Phlebitis | FAERS: 6 | US FAERS | |
| 396 | Product container issue | FAERS: 6 | US FAERS | |
| 397 | Product expiration date issue | FAERS: 6 | US FAERS | |
| 398 | Pulmonary Fibrosis | FAERS: 6 | US FAERS | |
| 399 | Pyelonephritis | FAERS: 6 | US FAERS | |
| 400 | Renal pain | FAERS: 6 | US FAERS | |
| 401 | Salpingectomy | FAERS: 6 | US FAERS | |
| 402 | Screaming | FAERS: 6 | US FAERS | |
| 403 | Skin hypertrophy | FAERS: 6 | US FAERS | |
| 404 | Skin necrosis | FAERS: 6 | US FAERS | |
| 405 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 406 | Tonsillitis | FAERS: 6 | OFFSIDES US FAERS | |
| 407 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 408 | Application site infection | FAERS: 5 | OFFSIDES US FAERS | |
| 409 | Arterial thrombosis | FAERS: 5 | US FAERS | |
| 410 | Atelectasis | FAERS: 5 | US FAERS | |
| 411 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 412 | Blighted ovum | FAERS: 5 | US FAERS | |
| 413 | Blood potassium decreased | FAERS: 5 | US FAERS | |
| 414 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 415 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 416 | Contraindicated product administered | FAERS: 5 | US FAERS | |
| 417 | Depression suicidal | FAERS: 5 | US FAERS | |
| 418 | Dysarthria | FAERS: 5 | US FAERS | |
| 419 | Erysipelas | FAERS: 5 | US FAERS | |
| 420 | Gastrectomy | FAERS: 5 | US FAERS | |
| 421 | Gastrointestinal motility disorder | FAERS: 5 | US FAERS | |
| 422 | General physical health deterioration | FAERS: 5 | OFFSIDES US FAERS | |
| 423 | Guillain-Barre Syndrome | FAERS: 5 | US FAERS | |
| 424 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 425 | Hidradenitis | FAERS: 5 | US FAERS | |
| 426 | Implant site hypertrophy | FAERS: 5 | US FAERS | |
| 427 | Increased tendency to bruise | FAERS: 5 | US FAERS | |
| 428 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 429 | Ligament rupture | FAERS: 5 | US FAERS | |
| 430 | Limb operation | FAERS: 5 | US FAERS | |
| 431 | Low birth weight baby | FAERS: 5 | US FAERS | |
| 432 | Lymphangitis | FAERS: 5 | US FAERS | |
| 433 | Maternal exposure timing unspecified | FAERS: 5 | US FAERS | |
| 434 | Medical device site movement impairment | FAERS: 5 | US FAERS | |
| 435 | Mental status changes | FAERS: 5 | US FAERS | |
| 436 | Middle insomnia | FAERS: 5 | US FAERS | |
| 437 | Muscle Rigidity | FAERS: 5 | US FAERS | |
| 438 | Partner stress | FAERS: 5 | US FAERS | |
| 439 | Poor peripheral circulation | FAERS: 5 | US FAERS | |
| 440 | Poor quality drug administered | FAERS: 5 | US FAERS | |
| 441 | Post-Traumatic Stress Disorder | FAERS: 5 | US FAERS | |
| 442 | Pregnancy test negative | FAERS: 5 | US FAERS | |
| 443 | Product availability issue | FAERS: 5 | US FAERS | |
| 444 | Product label issue | FAERS: 5 | US FAERS | |
| 445 | Product lot number issue | FAERS: 5 | US FAERS | |
| 446 | Product sterility lacking | FAERS: 5 | US FAERS | |
| 447 | Psychiatric symptom | FAERS: 5 | US FAERS | |
| 448 | Reaction to drug excipients | FAERS: 5 | US FAERS | |
| 449 | Retching | FAERS: 5 | US FAERS | |
| 450 | Skin Erosion | FAERS: 5 | US FAERS | |
| 451 | Skin discomfort | FAERS: 5 | US FAERS | |
| 452 | Sluggishness | FAERS: 5 | US FAERS | |
| 453 | Temperature intolerance | FAERS: 5 | US FAERS | |
| 454 | Trichorrhexis | FAERS: 5 | US FAERS | |
| 455 | Unwanted pregnancy | FAERS: 5 | US FAERS | |
| 456 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 457 | Vasculitis | FAERS: 5 | US FAERS | |
| 458 | Vulvovaginal swelling | FAERS: 5 | US FAERS | |
| 459 | Wheezing | FAERS: 5 | US FAERS | |
| 460 | Wound infection staphylococcal | FAERS: 5 | US FAERS | |
| 461 | muscle injury | FAERS: 5 | US FAERS | |
| 462 | Abdominal tenderness | FAERS: 4 | US FAERS | |
| 463 | Antidepressant therapy | FAERS: 4 | US FAERS | |
| 464 | Apathy | FAERS: 4 | US FAERS | |
| 465 | Apparent death | FAERS: 4 | US FAERS | |
| 466 | Application site discharge | FAERS: 4 | US FAERS | |
| 467 | Application site mass | FAERS: 4 | US FAERS | |
| 468 | Application site rash | FAERS: 4 | US FAERS | |
| 469 | Arthropod sting | FAERS: 4 | US FAERS | |
| 470 | Ascites | FAERS: 4 | US FAERS | |
| 471 | Bladder pain | FAERS: 4 | US FAERS | |
| 472 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 473 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 474 | Blood prolactin increased | FAERS: 4 | US FAERS | |
| 475 | Breast cancer stage II | FAERS: 4 | US FAERS | |
| 476 | Cholecystitis infective | FAERS: 4 | US FAERS | |
| 477 | Complication of delivery | FAERS: 4 | US FAERS | |
| 478 | Cyanosis | FAERS: 4 | US FAERS | |
| 479 | Disability | FAERS: 4 | US FAERS | |
| 480 | Drug abuse | FAERS: 4 | US FAERS | |
| 481 | Drug exposure via breast milk | FAERS: 4 | US FAERS | |
| 482 | Endometrial disorder | FAERS: 4 | US FAERS | |
| 483 | Escherichia infection | FAERS: 4 | US FAERS | |
| 484 | Facial Pain | FAERS: 4 | US FAERS | |
| 485 | Facial paralysis | FAERS: 4 | US FAERS | |
| 486 | Fallopian tube obstruction | FAERS: 4 | US FAERS | |
| 487 | Female sexual dysfunction | FAERS: 4 | US FAERS | |
| 488 | Food Poisoning | FAERS: 4 | US FAERS | |
| 489 | Human chorionic gonadotropin increased | FAERS: 4 | US FAERS | |
| 490 | Hyperkeratosis | FAERS: 4 | US FAERS | |
| 491 | Hyperphagia | FAERS: 4 | US FAERS | |
| 492 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 493 | Hypospadias | FAERS: 4 | US FAERS | |
| 494 | Impaired quality of life | FAERS: 4 | US FAERS | |
| 495 | Implant site ulcer | FAERS: 4 | US FAERS | |
| 496 | Incision site erythema | FAERS: 4 | US FAERS | |
| 497 | Induration | FAERS: 4 | US FAERS | |
| 498 | Injection site vesicles | FAERS: 4 | US FAERS | |
| 499 | Iron deficiency | FAERS: 4 | US FAERS | |
| 500 | Leukocytoclastic vasculitis | FAERS: 4 | US FAERS | |
| 501 | Limb mass | FAERS: 4 | US FAERS | |
| 502 | Lipoma | FAERS: 4 | US FAERS | |
| 503 | Mastectomy | FAERS: 4 | US FAERS | |
| 504 | Menopause | FAERS: 4 | US FAERS | |
| 505 | Mental impairment | FAERS: 4 | US FAERS | |
| 506 | Motion Sickness | FAERS: 4 | US FAERS | |
| 507 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 508 | Neuritis | FAERS: 4 | US FAERS | |
| 509 | Non-cardiac chest pain | FAERS: 4 | US FAERS | |
| 510 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 511 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 512 | Ovarian enlargement | FAERS: 4 | US FAERS | |
| 513 | Ovulation disorder | FAERS: 4 | US FAERS | |
| 514 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 515 | Portal Vein Thrombosis | FAERS: 4 | US FAERS | |
| 516 | Pre-Eclampsia | FAERS: 4 | US FAERS | |
| 517 | Product storage error | FAERS: 4 | US FAERS | |
| 518 | Product substitution issue | FAERS: 4 | US FAERS | |
| 519 | Restlessness | FAERS: 4 | US FAERS | |
| 520 | Retinal Artery Occlusion | FAERS: 4 | US FAERS | |
| 521 | Retinal Vein Occlusion | FAERS: 4 | OFFSIDES US FAERS | |
| 522 | Rotator cuff syndrome | FAERS: 4 | US FAERS | |
| 523 | Salpingitis | FAERS: 4 | US FAERS | |
| 524 | Sciatica | FAERS: 4 | US FAERS | |
| 525 | Sneezing | FAERS: 4 | US FAERS | |
| 526 | Staphylococcus test positive | FAERS: 4 | US FAERS | |
| 527 | Supraventricular tachycardia | FAERS: 4 | US FAERS | |
| 528 | Therapeutic response changed | FAERS: 4 | US FAERS | |
| 529 | Thirst | FAERS: 4 | US FAERS | |
| 530 | Tonsillectomy | FAERS: 4 | US FAERS | |
| 531 | Ulnar Nerve Palsy | FAERS: 4 | US FAERS | |
| 532 | Ultrasound scan abnormal | FAERS: 4 | US FAERS | |
| 533 | Uterine cervical pain | FAERS: 4 | US FAERS | |
| 534 | VIIth nerve paralysis | FAERS: 4 | US FAERS | |
| 535 | Abortion of ectopic pregnancy | FAERS: 3 | US FAERS | |
| 536 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 537 | Administration site injury | FAERS: 3 | US FAERS | |
| 538 | Administration site scab | FAERS: 3 | US FAERS | |
| 539 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 540 | Anaphylactoid syndrome of pregnancy | FAERS: 3 | US FAERS | |
| 541 | Aphonia | FAERS: 3 | US FAERS | |
| 542 | Application site hypersensitivity | FAERS: 3 | US FAERS | |
| 543 | Application site vesicles | FAERS: 3 | US FAERS | |
| 544 | Arterial Injury | FAERS: 3 | US FAERS | |
| 545 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 546 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 547 | Biliary Colic | FAERS: 3 | US FAERS | |
| 548 | Blister rupture | FAERS: 3 | US FAERS | |
| 549 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 550 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 551 | Body fat disorder | FAERS: 3 | US FAERS | |
| 552 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 553 | Cervical polyp | FAERS: 3 | US FAERS | |
| 554 | Cholestasis | FAERS: 3 | US FAERS | |
| 555 | Contraceptive device complication | FAERS: 3 | US FAERS | |
| 556 | Cystic Fibrosis | FAERS: 3 | OFFSIDES US FAERS | |
| 557 | Demyelination | FAERS: 3 | US FAERS | |
| 558 | Device ineffective | FAERS: 3 | US FAERS | |
| 559 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 560 | Diplopia | FAERS: 3 | US FAERS | |
| 561 | Drug effective for unapproved indication | FAERS: 3 | US FAERS | |
| 562 | Drug level increased | FAERS: 3 | US FAERS | |
| 563 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 564 | Endometrial thickening | FAERS: 3 | US FAERS | |
| 565 | Exfoliative rash | FAERS: 3 | US FAERS | |
| 566 | Exposure via breast milk | FAERS: 3 | US FAERS | |
| 567 | Fibroadenoma of breast | FAERS: 3 | SIDER US FAERS | |
| 568 | Food aversion | FAERS: 3 | US FAERS | |
| 569 | Formication | FAERS: 3 | OFFSIDES US FAERS | |
| 570 | Gait inability | FAERS: 3 | US FAERS | |
| 571 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 572 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 573 | Gestational trophoblastic detachment | FAERS: 3 | US FAERS | |
| 574 | Granuloma | FAERS: 3 | US FAERS | |
| 575 | Hepatitis C | FAERS: 3 | US FAERS | |
| 576 | Hyperemesis Gravidarum | FAERS: 3 | US FAERS | |
| 577 | Hypertrichosis | FAERS: 3 | SIDER US FAERS | |
| 578 | Hypothalamo-pituitary disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 579 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 580 | Impatience | FAERS: 3 | US FAERS | |
| 581 | Implant site dehiscence | FAERS: 3 | US FAERS | |
| 582 | Implant site phlebitis | FAERS: 3 | US FAERS | |
| 583 | Implant site thrombosis | FAERS: 3 | US FAERS | |
| 584 | Inadequate lubrication | FAERS: 3 | US FAERS | |
| 585 | Incorrect dose administered by device | FAERS: 3 | US FAERS | |
| 586 | Infectious Mononucleosis | FAERS: 3 | US FAERS | |
| 587 | Instillation site pain | FAERS: 3 | US FAERS | |
| 588 | Insulin Resistance | FAERS: 3 | US FAERS | |
| 589 | Insurance issue | FAERS: 3 | US FAERS | |
| 590 | Limb crushing injury | FAERS: 3 | US FAERS | |
| 591 | Lymphoma | FAERS: 3 | US FAERS | |
| 592 | Medical device site scab | FAERS: 3 | US FAERS | |
| 593 | Multiple sclerosis relapse | FAERS: 3 | US FAERS | |
| 594 | Negative thoughts | FAERS: 3 | US FAERS | |
| 595 | Neuroma | FAERS: 3 | US FAERS | |
| 596 | Osteoporosis | FAERS: 3 | US FAERS | |
| 597 | Pelvic mass | FAERS: 3 | US FAERS | |
| 598 | Peripheral embolism | FAERS: 3 | OFFSIDES US FAERS | |
| 599 | Peripheral nerve palsy | FAERS: 3 | US FAERS | |
| 600 | Periphlebitis | FAERS: 3 | OFFSIDES US FAERS | |
| 601 | Physical examination normal | FAERS: 3 | US FAERS | |
| 602 | Post procedural contusion | FAERS: 3 | US FAERS | |
| 603 | Precancerous cells present | FAERS: 3 | US FAERS | |
| 604 | Pregnancy test positive | FAERS: 3 | US FAERS | |
| 605 | Premenstrual Dysphoric Disorder | FAERS: 3 | US FAERS | |
| 606 | Product adhesion issue | FAERS: 3 | US FAERS | |
| 607 | Product blister packaging issue | FAERS: 3 | US FAERS | |
| 608 | Product complaint | FAERS: 3 | US FAERS | |
| 609 | Product container seal issue | FAERS: 3 | US FAERS | |
| 610 | Product contamination with body fluid | FAERS: 3 | US FAERS | |
| 611 | Product size issue | FAERS: 3 | US FAERS | |
| 612 | Progesterone decreased | FAERS: 3 | US FAERS | |
| 613 | Pyogenic granuloma | FAERS: 3 | US FAERS | |
| 614 | Sensorimotor disorder | FAERS: 3 | US FAERS | |
| 615 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 616 | Skin implant removal | FAERS: 3 | US FAERS | |
| 617 | Splenomegaly | FAERS: 3 | US FAERS | |
| 618 | Thermal burn | FAERS: 3 | US FAERS | |
| 619 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 620 | Tobacco user | FAERS: 3 | US FAERS | |
| 621 | Toothache | FAERS: 3 | US FAERS | |
| 622 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 623 | Transaminases increased | FAERS: 3 | US FAERS | |
| 624 | Underweight | FAERS: 3 | US FAERS | |
| 625 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 626 | Vaginal lesion | FAERS: 3 | US FAERS | |
| 627 | pH body fluid abnormal | FAERS: 3 | US FAERS | |
| 628 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 629 | Abdominal mass | FAERS: 2 | US FAERS | |
| 630 | Abortion late | FAERS: 2 | OFFSIDES US FAERS | |
| 631 | Acarodermatitis | FAERS: 2 | US FAERS | |
| 632 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 633 | Adjustment disorder with mixed anxiety and depressed mood | FAERS: 2 | US FAERS | |
| 634 | Administration site hypertrichosis | FAERS: 2 | US FAERS | |
| 635 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 636 | Alcohol problem | FAERS: 2 | US FAERS | |
| 637 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 638 | Aphagia | FAERS: 2 | US FAERS | |
| 639 | Aphasia | FAERS: 2 | US FAERS | |
| 640 | Apparent life threatening event | FAERS: 2 | US FAERS | |
| 641 | Application site burn | FAERS: 2 | US FAERS | |
| 642 | Asphyxia | FAERS: 2 | US FAERS | |
| 643 | Aura | FAERS: 2 | US FAERS | |
| 644 | Bacterial abdominal infection | FAERS: 2 | US FAERS | |
| 645 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 646 | Benign neoplasm of thyroid gland | FAERS: 2 | US FAERS | |
| 647 | Blood creatinine increased | FAERS: 2 | OFFSIDES US FAERS | |
| 648 | Blood gonadotrophin decreased | FAERS: 2 | US FAERS | |
| 649 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 650 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 651 | Borderline Personality Disorder | FAERS: 2 | US FAERS | |
| 652 | Bradycardia | FAERS: 2 | US FAERS | |
| 653 | Brief psychotic disorder, with postpartum onset | FAERS: 2 | US FAERS | |
| 654 | Bunion operation | FAERS: 2 | US FAERS | |
| 655 | Cataract | FAERS: 2 | US FAERS | |
| 656 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 657 | Chlamydia test positive | FAERS: 2 | US FAERS | |
| 658 | Chloasma | FAERS: 2 | SIDER US FAERS | |
| 659 | Cholelithotomy | FAERS: 2 | US FAERS | |
| 660 | Chronic villitis of unknown etiology | FAERS: 2 | US FAERS | |
| 661 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 662 | Contraceptive implant | FAERS: 2 | US FAERS | |
| 663 | Contraindicated device used | FAERS: 2 | US FAERS | |
| 664 | Contraindicated drug administered | FAERS: 2 | US FAERS | |
| 665 | Coronary artery embolism | FAERS: 2 | OFFSIDES US FAERS | |
| 666 | Cyst removal | FAERS: 2 | US FAERS | |
| 667 | Cytolytic hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 668 | Debridement | FAERS: 2 | US FAERS | |
| 669 | Decidual cast | FAERS: 2 | US FAERS | |
| 670 | Device intolerance | FAERS: 2 | US FAERS | |
| 671 | Device leakage | FAERS: 2 | US FAERS | |
| 672 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 673 | Drug diversion | FAERS: 2 | US FAERS | |
| 674 | Drug level decreased | FAERS: 2 | US FAERS | |
| 675 | Drug physiologic incompatibility | FAERS: 2 | US FAERS | |
| 676 | Drug toxicity | FAERS: 2 | US FAERS | |
| 677 | Ear discomfort | FAERS: 2 | US FAERS | |
| 678 | Early satiety | FAERS: 2 | US FAERS | |
| 679 | Eclampsia | FAERS: 2 | US FAERS | |
| 680 | Educational problem | FAERS: 2 | US FAERS | |
| 681 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 682 | Embolism | FAERS: 2 | US FAERS | |
| 683 | Emphysematous cystitis | FAERS: 2 | OFFSIDES US FAERS | |
| 684 | Endometrial hypertrophy | FAERS: 2 | US FAERS | |
| 685 | Endometrial metaplasia | FAERS: 2 | OFFSIDES US FAERS | |
| 686 | Enuresis | FAERS: 2 | US FAERS | |
| 687 | Epidermolysis Bullosa | FAERS: 2 | US FAERS | |
| 688 | Eructation | FAERS: 2 | US FAERS | |
| 689 | Euphoric mood | FAERS: 2 | US FAERS | |
| 690 | Excessive skin | FAERS: 2 | US FAERS | |
| 691 | Exposure to body fluid | FAERS: 2 | US FAERS | |
| 692 | Exposure to radiation | FAERS: 2 | US FAERS | |
| 693 | Exposure via skin contact | FAERS: 2 | US FAERS | |
| 694 | Extraocular Muscle Paresis | FAERS: 2 | US FAERS | |
| 695 | Factor V Leiden mutation | FAERS: 2 | US FAERS | |
| 696 | Fallopian tube perforation | FAERS: 2 | US FAERS | |
| 697 | Feelings of worthlessness | FAERS: 2 | US FAERS | |
| 698 | Flat affect | FAERS: 2 | US FAERS | |
| 699 | Focal Nodular Hyperplasia | FAERS: 2 | US FAERS | |
| 700 | Fracture | FAERS: 2 | US FAERS | |
| 701 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 702 | Ganglioglioma | FAERS: 2 | US FAERS | |
| 703 | Gastric infection | FAERS: 2 | US FAERS | |
| 704 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 705 | Genital burning sensation | FAERS: 2 | US FAERS | |
| 706 | Genital pain | FAERS: 2 | US FAERS | |
| 707 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 708 | Gonadal Dysgenesis | FAERS: 2 | US FAERS | |
| 709 | Homicide | FAERS: 2 | US FAERS | |
| 710 | Human papilloma virus test positive | FAERS: 2 | US FAERS | |
| 711 | Hyperventilation | FAERS: 2 | US FAERS | |
| 712 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 713 | Hypophagia | FAERS: 2 | US FAERS | |
| 714 | Hypothermia neonatal | FAERS: 2 | US FAERS | |
| 715 | Hypotrichosis | FAERS: 2 | US FAERS | |
| 716 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 717 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 718 | Implant site atrophy | FAERS: 2 | US FAERS | |
| 719 | Implant site exfoliation | FAERS: 2 | US FAERS | |
| 720 | Incision site infection | FAERS: 2 | US FAERS | |
| 721 | Infarction | FAERS: 2 | US FAERS | |
| 722 | Injection site eczema | FAERS: 2 | US FAERS | |
| 723 | Injection site irritation | FAERS: 2 | US FAERS | |
| 724 | Injection site scab | FAERS: 2 | US FAERS | |
| 725 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 726 | Interventional procedure | FAERS: 2 | US FAERS | |
| 727 | Intracranial Aneurysm | FAERS: 2 | OFFSIDES US FAERS | |
| 728 | Intracranial meningioma malignant | FAERS: 2 | US FAERS | |
| 729 | Joint stiffness | FAERS: 2 | US FAERS | |
| 730 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 731 | Laziness | FAERS: 2 | US FAERS | |
| 732 | Lichen Planus | FAERS: 2 | US FAERS | |
| 733 | Macule | FAERS: 2 | US FAERS | |
| 734 | Malignant neoplasm progression | FAERS: 2 | OFFSIDES US FAERS | |
| 735 | Maternal exposure during delivery | FAERS: 2 | US FAERS | |
| 736 | Medical device site bruise | FAERS: 2 | US FAERS | |
| 737 | Medical device site joint movement impairment | FAERS: 2 | US FAERS | |
| 738 | Medical device site reaction | FAERS: 2 | US FAERS | |
| 739 | Medical device site scar | FAERS: 2 | US FAERS | |
| 740 | Megacolon | FAERS: 2 | US FAERS | |
| 741 | Meningioma surgery | FAERS: 2 | US FAERS | |
| 742 | Mental Retardation | FAERS: 2 | US FAERS | |
| 743 | Metastasis | FAERS: 2 | US FAERS | |
| 744 | Miliaria | FAERS: 2 | US FAERS | |
| 745 | Monoparesis | FAERS: 2 | US FAERS | |
| 746 | Mosaicism | FAERS: 2 | US FAERS | |
| 747 | Myoclonus | FAERS: 2 | US FAERS | |
| 748 | Neonatal respiratory distress | FAERS: 2 | US FAERS | |
| 749 | Neurological complication associated with device | FAERS: 2 | US FAERS | |
| 750 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 751 | Nuclear magnetic resonance imaging brain | FAERS: 2 | US FAERS | |
| 752 | Obesity surgery | FAERS: 2 | US FAERS | |
| 753 | Ocular icterus | FAERS: 2 | US FAERS | |
| 754 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 755 | Osteopenia | FAERS: 2 | US FAERS | |
| 756 | Ovarian cyst torsion | FAERS: 2 | US FAERS | |
| 757 | Partial lung resection | FAERS: 2 | US FAERS | |
| 758 | Pemphigus | FAERS: 2 | US FAERS | |
| 759 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 760 | Pericarditis | FAERS: 2 | US FAERS | |
| 761 | Peripheral artery occlusion | FAERS: 2 | US FAERS | |
| 762 | Peripheral nerve paresis | FAERS: 2 | US FAERS | |
| 763 | Peritonitis | FAERS: 2 | US FAERS | |
| 764 | Physical assault | FAERS: 2 | US FAERS | |
| 765 | Physical disability | FAERS: 2 | US FAERS | |
| 766 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 767 | Pleurisy | FAERS: 2 | US FAERS | |
| 768 | Polyarthritis | FAERS: 2 | US FAERS | |
| 769 | Polymyositis | FAERS: 2 | US FAERS | |
| 770 | Polyuria | FAERS: 2 | US FAERS | |
| 771 | Post lumbar puncture syndrome | FAERS: 2 | US FAERS | |
| 772 | Post procedural infection | FAERS: 2 | US FAERS | |
| 773 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 774 | Pregnancy with injectable contraceptive | FAERS: 2 | US FAERS | |
| 775 | Product administered at inappropriate site | FAERS: 2 | US FAERS | |
| 776 | Product communication issue | FAERS: 2 | US FAERS | |
| 777 | Product name confusion | FAERS: 2 | US FAERS | |
| 778 | Proteinuria | FAERS: 2 | US FAERS | |
| 779 | Pruritus allergic | FAERS: 2 | US FAERS | |
| 780 | Purpura | FAERS: 2 | US FAERS | |
| 781 | Recalled product administered | FAERS: 2 | US FAERS | |
| 782 | Regurgitation | FAERS: 2 | US FAERS | |
| 783 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 784 | Retained products of conception | FAERS: 2 | US FAERS | |
| 785 | Retinal vascular thrombosis | FAERS: 2 | US FAERS | |
| 786 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 787 | Sexual inhibition | FAERS: 2 | US FAERS | |
| 788 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 789 | Skin indentation | FAERS: 2 | US FAERS | |
| 790 | Skin laceration | FAERS: 2 | US FAERS | |
| 791 | Skin texture abnormal | FAERS: 2 | US FAERS | |
| 792 | Skin tightness | FAERS: 2 | US FAERS | |
| 793 | Soft tissue foreign body | FAERS: 2 | US FAERS | |
| 794 | Somatic symptom disorder | FAERS: 2 | US FAERS | |
| 795 | Stress ulcer | FAERS: 2 | US FAERS | |
| 796 | Subacute endocarditis | FAERS: 2 | OFFSIDES US FAERS | |
| 797 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 798 | Superficial vein prominence | FAERS: 2 | US FAERS | |
| 799 | Superinfection | FAERS: 2 | US FAERS | |
| 800 | Surgical failure | FAERS: 2 | US FAERS | |
| 801 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 802 | Tension Headache | FAERS: 2 | US FAERS | |
| 803 | Therapy cessation | FAERS: 2 | US FAERS | |
| 804 | Throat irritation | FAERS: 2 | US FAERS | |
| 805 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 806 | Tissue injury | FAERS: 2 | US FAERS | |
| 807 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 808 | Ulnar Neuritis | FAERS: 2 | OFFSIDES US FAERS | |
| 809 | Ulnar tunnel syndrome | FAERS: 2 | US FAERS | |
| 810 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 811 | Unintentional use for unapproved indication | FAERS: 2 | US FAERS | |
| 812 | Vascular pain | FAERS: 2 | US FAERS | |
| 813 | Venous Injury | FAERS: 2 | US FAERS | |
| 814 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 815 | Venous thrombosis limb | FAERS: 2 | US FAERS | |
| 816 | Vestibulitis | FAERS: 2 | US FAERS | |
| 817 | Victim of sexual abuse | FAERS: 2 | US FAERS | |
| 818 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 819 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 820 | Vulvovaginal inflammation | FAERS: 2 | US FAERS | |
| 821 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 822 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 823 | Wound infection bacterial | FAERS: 2 | US FAERS | |
| 824 | treatment failure | FAERS: 2 | OFFSIDES US FAERS | |
| 825 | 17-hydroxyprogesterone increased | FAERS: 1 | US FAERS | |
| 826 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 827 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 828 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 829 | Abortion complete | FAERS: 1 | US FAERS | |
| 830 | Abortion early | FAERS: 1 | US FAERS | |
| 831 | Abortion induced complete | FAERS: 1 | US FAERS | |
| 832 | Accidental exposure | FAERS: 1 | US FAERS | |
| 833 | Acidosis | FAERS: 1 | US FAERS | |
| 834 | Acne fulminans | FAERS: 1 | US FAERS | |
| 835 | Acquired diaphragmatic eventration | FAERS: 1 | US FAERS | |
| 836 | Acute polyneuropathy | FAERS: 1 | US FAERS | |
| 837 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 838 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 839 | Adenocarcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 840 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 841 | Administration site granuloma | FAERS: 1 | US FAERS | |
| 842 | Administration site infection | FAERS: 1 | US FAERS | |
| 843 | Administration site irritation | FAERS: 1 | US FAERS | |
| 844 | Administration site laceration | FAERS: 1 | US FAERS | |
| 845 | Administration site movement impairment | FAERS: 1 | US FAERS | |
| 846 | Administration site streaking | FAERS: 1 | US FAERS | |
| 847 | Administration site swelling | FAERS: 1 | US FAERS | |
| 848 | Agitated depression | FAERS: 1 | US FAERS | |
| 849 | Agoraphobia | FAERS: 1 | US FAERS | |
| 850 | Air Embolism | FAERS: 1 | US FAERS | |
| 851 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 852 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 853 | Allergy test negative | FAERS: 1 | US FAERS | |
| 854 | Allergy to animal | FAERS: 1 | US FAERS | |
| 855 | Alopecia totalis | FAERS: 1 | OFFSIDES US FAERS | |
| 856 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 857 | Amblyopia | FAERS: 1 | US FAERS | |
| 858 | Amniotic cavity disorder | FAERS: 1 | US FAERS | |
| 859 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 860 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 861 | Anal Fissure | FAERS: 1 | US FAERS | |
| 862 | Androgens increased | FAERS: 1 | US FAERS | |
| 863 | Anembryonic gestation | FAERS: 1 | US FAERS | |
| 864 | Aneurysm | FAERS: 1 | US FAERS | |
| 865 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 866 | Animal bite | FAERS: 1 | US FAERS | |
| 867 | Animal scratch | FAERS: 1 | US FAERS | |
| 868 | Anisomastia | FAERS: 1 | US FAERS | |
| 869 | Anterior displaced anus | FAERS: 1 | US FAERS | |
| 870 | Antibiotic resistant Staphylococcus test | FAERS: 1 | US FAERS | |
| 871 | Antisynthetase syndrome | FAERS: 1 | US FAERS | |
| 872 | Anuria | FAERS: 1 | US FAERS | |
| 873 | Application site abscess | FAERS: 1 | US FAERS | |
| 874 | Application site acne | FAERS: 1 | US FAERS | |
| 875 | Application site cellulitis | FAERS: 1 | US FAERS | |
| 876 | Application site dryness | FAERS: 1 | US FAERS | |
| 877 | Application site erosion | FAERS: 1 | US FAERS | |
| 878 | Application site hypertrichosis | FAERS: 1 | US FAERS | |
| 879 | Application site induration | FAERS: 1 | US FAERS | |
| 880 | Application site inflammation | FAERS: 1 | US FAERS | |
| 881 | Application site necrosis | FAERS: 1 | US FAERS | |
| 882 | Application site nodule | FAERS: 1 | US FAERS | |
| 883 | Application site pallor | FAERS: 1 | US FAERS | |
| 884 | Application site reaction | FAERS: 1 | US FAERS | |
| 885 | Application site urticaria | FAERS: 1 | US FAERS | |
| 886 | Application site warmth | FAERS: 1 | US FAERS | |
| 887 | Application site wound | FAERS: 1 | US FAERS | |
| 888 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 889 | Asthma-Chronic Obstructive Pulmonary Disease Overlap Syndrome | FAERS: 1 | US FAERS | |
| 890 | Astrocytoma, low grade | FAERS: 1 | US FAERS | |
| 891 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 892 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 893 | Autophobia | FAERS: 1 | US FAERS | |
| 894 | Avoidant Personality Disorder | FAERS: 1 | US FAERS | |
| 895 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 896 | Benign breast lump removal | FAERS: 1 | US FAERS | |
| 897 | Benign neoplasm of spinal cord | FAERS: 1 | US FAERS | |
| 898 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 899 | Biopsy chorionic villous abnormal | FAERS: 1 | US FAERS | |
| 900 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 901 | Blepharitis | FAERS: 1 | US FAERS | |
| 902 | Blepharospasm | FAERS: 1 | US FAERS | |
| 903 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 904 | Blood blister | FAERS: 1 | US FAERS | |
| 905 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 906 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 907 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 908 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 909 | Blood human chorionic gonadotropin decreased | FAERS: 1 | US FAERS | |
| 910 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 911 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 912 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 913 | Blood lactic acid | FAERS: 1 | US FAERS | |
| 914 | Blood pH increased | FAERS: 1 | US FAERS | |
| 915 | Blood prolactin normal | FAERS: 1 | US FAERS | |
| 916 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 917 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 918 | Bone Tuberculosis | FAERS: 1 | US FAERS | |
| 919 | Bone density decreased | FAERS: 1 | US FAERS | |
| 920 | Bradykinesia | FAERS: 1 | US FAERS | |
| 921 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 922 | Brain Death | FAERS: 1 | US FAERS | |
| 923 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 924 | Breast engorgement | FAERS: 1 | US FAERS | |
| 925 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 926 | Breech Presentation | FAERS: 1 | US FAERS | |
| 927 | Brief psychotic disorder with marked stressors | FAERS: 1 | US FAERS | |
| 928 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 929 | Bronchopneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 930 | Candidiasis | FAERS: 1 | US FAERS | |
| 931 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 932 | Carbohydrate deficient transferrin increased | FAERS: 1 | US FAERS | |
| 933 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 934 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 935 | Cardioactive drug level decreased | FAERS: 1 | US FAERS | |
| 936 | Cardiomyopathy neonatal | FAERS: 1 | US FAERS | |
| 937 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 938 | Cartilage injury | FAERS: 1 | US FAERS | |
| 939 | Cataplexy | FAERS: 1 | US FAERS | |
| 940 | Catheter placement | FAERS: 1 | US FAERS | |
| 941 | Catheter site infection | FAERS: 1 | US FAERS | |
| 942 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 943 | Cerebellar artery thrombosis | FAERS: 1 | US FAERS | |
| 944 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 945 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 946 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 947 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 948 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 949 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 950 | Cervix carcinoma recurrent | FAERS: 1 | US FAERS | |
| 951 | Change in seizure presentation | FAERS: 1 | US FAERS | |
| 952 | Choking | FAERS: 1 | US FAERS | |
| 953 | Cholecystostomy | FAERS: 1 | US FAERS | |
| 954 | Chorea | FAERS: 1 | US FAERS | |
| 955 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 956 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 957 | Claustrophobia | FAERS: 1 | US FAERS | |
| 958 | Clonus | FAERS: 1 | US FAERS | |
| 959 | Cluster Headache | FAERS: 1 | US FAERS | |
| 960 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 961 | Colitis psychogenic | FAERS: 1 | US FAERS | |
| 962 | Colposcopy | FAERS: 1 | US FAERS | |
| 963 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 964 | Congenital neuropathy | FAERS: 1 | US FAERS | |
| 965 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 966 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 967 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 968 | Cryotherapy | FAERS: 1 | US FAERS | |
| 969 | Culture positive | FAERS: 1 | US FAERS | |
| 970 | Death of relative | FAERS: 1 | US FAERS | |
| 971 | Dehydroepiandrosterone decreased | FAERS: 1 | US FAERS | |
| 972 | Denervation atrophy | FAERS: 1 | US FAERS | |
| 973 | Dependence | FAERS: 1 | US FAERS | |
| 974 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 975 | Dermatophytosis | FAERS: 1 | US FAERS | |
| 976 | Device adhesion issue | FAERS: 1 | US FAERS | |
| 977 | Device component issue | FAERS: 1 | US FAERS | |
| 978 | Device dispensing error | FAERS: 1 | US FAERS | |
| 979 | Device interaction | FAERS: 1 | US FAERS | |
| 980 | Device material issue | FAERS: 1 | US FAERS | |
| 981 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 982 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 983 | Difficulty inserting drug implant | FAERS: 1 | US FAERS | |
| 984 | Disease complication | FAERS: 1 | US FAERS | |
| 985 | Dissociation | FAERS: 1 | US FAERS | |
| 986 | Disturbance in sexual arousal | FAERS: 1 | SIDER US FAERS | |
| 987 | Diverticulitis | FAERS: 1 | US FAERS | |
| 988 | Drowning | FAERS: 1 | US FAERS | |
| 989 | Drug Dependence | FAERS: 1 | US FAERS | |
| 990 | Drug abuser | FAERS: 1 | US FAERS | |
| 991 | Drug dispensing issue | FAERS: 1 | US FAERS | |
| 992 | Drug level fluctuating | FAERS: 1 | US FAERS | |
| 993 | Drug screen positive | FAERS: 1 | US FAERS | |
| 994 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 995 | Duodenal switch | FAERS: 1 | US FAERS | |
| 996 | Dysphemia | FAERS: 1 | US FAERS | |
| 997 | Dysphonia | FAERS: 1 | US FAERS | |
| 998 | Dysplasia | FAERS: 1 | US FAERS | |
| 999 | Dysthymic Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 1000 | Ectopic pregnancy under hormonal contraception | FAERS: 1 | US FAERS | |
| 1001 | Elbow operation | FAERS: 1 | US FAERS | |
| 1002 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 1003 | Embolic stroke | FAERS: 1 | US FAERS | |
| 1004 | Emergency Care | FAERS: 1 | US FAERS | |
| 1005 | Empyema | FAERS: 1 | US FAERS | |
| 1006 | Endocervical curettage | FAERS: 1 | US FAERS | |
| 1007 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 1008 | Endometrial dysplasia | FAERS: 1 | US FAERS | |
| 1009 | Endometriosis ablation | FAERS: 1 | US FAERS | |
| 1010 | Endometritis | FAERS: 1 | US FAERS | |
| 1011 | Eosinophil percentage decreased | FAERS: 1 | US FAERS | |
| 1012 | Epicondylitis | FAERS: 1 | US FAERS | |
| 1013 | Eschar | FAERS: 1 | US FAERS | |
| 1014 | Escherichia urinary tract infection | FAERS: 1 | OFFSIDES US FAERS | |
| 1015 | Essential Tremor | FAERS: 1 | US FAERS | |
| 1016 | Ex-tobacco user | FAERS: 1 | US FAERS | |
| 1017 | Expulsion of medication | FAERS: 1 | US FAERS | |
| 1018 | Extensive swelling of vaccinated limb | FAERS: 1 | US FAERS | |
| 1019 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 1020 | Eye allergy | FAERS: 1 | US FAERS | |
| 1021 | Eye complication associated with device | FAERS: 1 | US FAERS | |
| 1022 | Eye irritation | FAERS: 1 | US FAERS | |
| 1023 | Eye ulcer | FAERS: 1 | US FAERS | |
| 1024 | False positive investigation result | FAERS: 1 | US FAERS | |
| 1025 | Fat necrosis | FAERS: 1 | US FAERS | |
| 1026 | Female sex hormone level abnormal | FAERS: 1 | US FAERS | |
| 1027 | Femoral arterial stenosis | FAERS: 1 | US FAERS | |
| 1028 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 1029 | Fine motor delay | FAERS: 1 | US FAERS | |
| 1030 | Finger hypoplasia | FAERS: 1 | US FAERS | |
| 1031 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 1032 | Folliculitis | FAERS: 1 | US FAERS | |
| 1033 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 1034 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 1035 | Gastric banding reversal | FAERS: 1 | US FAERS | |
| 1036 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 1037 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 1038 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 1039 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 1040 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 1041 | Genital contusion | FAERS: 1 | US FAERS | |
| 1042 | Genital discharge | FAERS: 1 | SIDER US FAERS | |
| 1043 | Genito-pelvic pain/penetration disorder | FAERS: 1 | US FAERS | |
| 1044 | Genitourinary tract gonococcal infection | FAERS: 1 | US FAERS | |
| 1045 | Gingival Recession | FAERS: 1 | US FAERS | |
| 1046 | Gingivitis | FAERS: 1 | US FAERS | |
| 1047 | HER-2 positive breast cancer | FAERS: 1 | US FAERS | |
| 1048 | HIV carrier | FAERS: 1 | US FAERS | |
| 1049 | Hair injury | FAERS: 1 | US FAERS | |
| 1050 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 1051 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1052 | Hirsutism | FAERS: 1 | US FAERS | |
| 1053 | Hostility | FAERS: 1 | US FAERS | |
| 1054 | Human Bite | FAERS: 1 | US FAERS | |
| 1055 | Human chorionic gonadotropin decreased | FAERS: 1 | US FAERS | |
| 1056 | Human chorionic gonadotropin negative | FAERS: 1 | US FAERS | |
| 1057 | Human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 1058 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 1059 | Hyperacusis | FAERS: 1 | US FAERS | |
| 1060 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 1061 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 1062 | Hysterical psychosis | FAERS: 1 | US FAERS | |
| 1063 | Hysteroscopy | FAERS: 1 | US FAERS | |
| 1064 | Immunosuppressant drug level increased | FAERS: 1 | US FAERS | |
| 1065 | Immunosuppression | FAERS: 1 | US FAERS | |
| 1066 | Implant site effusion | FAERS: 1 | US FAERS | |
| 1067 | Implant tissue necrosis | FAERS: 1 | US FAERS | |
| 1068 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 1069 | Inadequate aseptic technique in use of product | FAERS: 1 | US FAERS | |
| 1070 | Incision site discharge | FAERS: 1 | US FAERS | |
| 1071 | Incision site vesicles | FAERS: 1 | US FAERS | |
| 1072 | Incisional hernia | FAERS: 1 | US FAERS | |
| 1073 | Incontinence | FAERS: 1 | US FAERS | |
| 1074 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 1075 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 1076 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 1077 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 1078 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 1079 | Infusion site mass | FAERS: 1 | US FAERS | |
| 1080 | Infusion site pain | FAERS: 1 | US FAERS | |
| 1081 | Infusion site scab | FAERS: 1 | US FAERS | |
| 1082 | Infusion site scar | FAERS: 1 | US FAERS | |
| 1083 | Initial insomnia | FAERS: 1 | US FAERS | |
| 1084 | Injection site abscess | FAERS: 1 | US FAERS | |
| 1085 | Injection site cellulitis | FAERS: 1 | US FAERS | |
| 1086 | Injection site cyst | FAERS: 1 | US FAERS | |
| 1087 | Injection site discharge | FAERS: 1 | US FAERS | |
| 1088 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 1089 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 1090 | Injection site injury | FAERS: 1 | US FAERS | |
| 1091 | Injection site nodule | FAERS: 1 | US FAERS | |
| 1092 | Injection site pustule | FAERS: 1 | US FAERS | |
| 1093 | Injection site scar | FAERS: 1 | US FAERS | |
| 1094 | Instillation site discomfort | FAERS: 1 | US FAERS | |
| 1095 | Instillation site erythema | FAERS: 1 | US FAERS | |
| 1096 | Instillation site irritation | FAERS: 1 | US FAERS | |
| 1097 | Instillation site pruritus | FAERS: 1 | US FAERS | |
| 1098 | Intentional device use issue | FAERS: 1 | US FAERS | |
| 1099 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 1100 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 1101 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 1102 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 1103 | Intestinal resection | FAERS: 1 | US FAERS | |
| 1104 | Intracranial mass | FAERS: 1 | US FAERS | |
| 1105 | Intramedullary rod insertion | FAERS: 1 | US FAERS | |
| 1106 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 1107 | Ischiatic hernia | FAERS: 1 | US FAERS | |
| 1108 | Itching scar | FAERS: 1 | US FAERS | |
| 1109 | Joint warmth | FAERS: 1 | US FAERS | |
| 1110 | Keratitis | FAERS: 1 | US FAERS | |
| 1111 | Ketonuria | FAERS: 1 | US FAERS | |
| 1112 | Kidney ablation | FAERS: 1 | US FAERS | |
| 1113 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 1114 | Laparoscopy | FAERS: 1 | US FAERS | |
| 1115 | Laparotomy | FAERS: 1 | US FAERS | |
| 1116 | Laryngitis | FAERS: 1 | US FAERS | |
| 1117 | Latent Tuberculosis | FAERS: 1 | US FAERS | |
| 1118 | Latex allergy | FAERS: 1 | US FAERS | |
| 1119 | Lentigo | FAERS: 1 | US FAERS | |
| 1120 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 1121 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 1122 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 1123 | Lipolysis procedure | FAERS: 1 | US FAERS | |
| 1124 | Liver Abscess | FAERS: 1 | US FAERS | |
| 1125 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 1126 | Local reaction | FAERS: 1 | US FAERS | |
| 1127 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 1128 | Loop electrosurgical excision procedure | FAERS: 1 | US FAERS | |
| 1129 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1130 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 1131 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 1132 | Lyme Disease | FAERS: 1 | US FAERS | |
| 1133 | Lymph nodes scan abnormal | FAERS: 1 | US FAERS | |
| 1134 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 1135 | Lymphatic obstruction | FAERS: 1 | US FAERS | |
| 1136 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 1137 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 1138 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 1139 | Mastitis | FAERS: 1 | US FAERS | |
| 1140 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 1141 | Measles | FAERS: 1 | US FAERS | |
| 1142 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 1143 | Medical device monitoring error | FAERS: 1 | US FAERS | |
| 1144 | Medical device site cellulitis | FAERS: 1 | US FAERS | |
| 1145 | Medical device site hyperkeratosis | FAERS: 1 | US FAERS | |
| 1146 | Medical device site induration | FAERS: 1 | US FAERS | |
| 1147 | Medical device site injury | FAERS: 1 | US FAERS | |
| 1148 | Medical device site nerve damage | FAERS: 1 | US FAERS | |
| 1149 | Medical device site pain | FAERS: 1 | US FAERS | |
| 1150 | Medical device site streaking | FAERS: 1 | US FAERS | |
| 1151 | Medical procedure | FAERS: 1 | US FAERS | |
| 1152 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 1153 | Meningitis | FAERS: 1 | US FAERS | |
| 1154 | Menstrual cycle management | FAERS: 1 | US FAERS | |
| 1155 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 1156 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 1157 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 1158 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 1159 | Microembolism | FAERS: 1 | US FAERS | |
| 1160 | Mite allergy | FAERS: 1 | US FAERS | |
| 1161 | Morning Sickness | FAERS: 1 | US FAERS | |
| 1162 | Mouth swelling | FAERS: 1 | US FAERS | |
| 1163 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 1164 | Multiple Pregnancy | FAERS: 1 | US FAERS | |
| 1165 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 1166 | Multiple use of single-use product | FAERS: 1 | US FAERS | |
| 1167 | Muscle hypertrophy | FAERS: 1 | US FAERS | |
| 1168 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 1169 | Mycobacterium abscessus Infection | FAERS: 1 | US FAERS | |
| 1170 | Myomectomy | FAERS: 1 | US FAERS | |
| 1171 | Narcolepsy | FAERS: 1 | US FAERS | |
| 1172 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 1173 | Nephritis | FAERS: 1 | US FAERS | |
| 1174 | Neurectomy | FAERS: 1 | US FAERS | |
| 1175 | Neurological procedural complication | FAERS: 1 | US FAERS | |
| 1176 | Neurostimulator implantation | FAERS: 1 | US FAERS | |
| 1177 | Neurotransmitter level altered | FAERS: 1 | US FAERS | |
| 1178 | Neutropenia | FAERS: 1 | US FAERS | |
| 1179 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 1180 | New daily persistent headache | FAERS: 1 | US FAERS | |
| 1181 | Nocturia | FAERS: 1 | US FAERS | |
| 1182 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 1183 | Nuclear magnetic resonance imaging spinal | FAERS: 1 | US FAERS | |
| 1184 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 1185 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 1186 | Open wound | FAERS: 1 | US FAERS | |
| 1187 | Oral pain | FAERS: 1 | US FAERS | |
| 1188 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 1189 | Otitis Media | FAERS: 1 | SIDER US FAERS | |
| 1190 | Ovarian Infection | FAERS: 1 | US FAERS | |
| 1191 | Ovarian vein thrombosis | FAERS: 1 | US FAERS | |
| 1192 | Ovulation Induction | FAERS: 1 | US FAERS | |
| 1193 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 1194 | PO2 decreased | FAERS: 1 | US FAERS | |
| 1195 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 1196 | Panic Disorder | FAERS: 1 | US FAERS | |
| 1197 | Paraplegia | FAERS: 1 | US FAERS | |
| 1198 | Parasitic gastroenteritis | FAERS: 1 | US FAERS | |
| 1199 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 1200 | Patient restraint | FAERS: 1 | US FAERS | |
| 1201 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 1202 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 1203 | Pelvic fluid collection | FAERS: 1 | US FAERS | |
| 1204 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 1205 | Periarthritis | FAERS: 1 | US FAERS | |
| 1206 | Pericardial effusion | FAERS: 1 | OFFSIDES US FAERS | |
| 1207 | Perineal cyst | FAERS: 1 | US FAERS | |
| 1208 | Peripheral arterial occlusive disease | FAERS: 1 | OFFSIDES US FAERS | |
| 1209 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 1210 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 1211 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 1212 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 1213 | Persistent depressive disorder | FAERS: 1 | US FAERS | |
| 1214 | Personal relationship issue | FAERS: 1 | US FAERS | |
| 1215 | Pertussis | FAERS: 1 | US FAERS | |
| 1216 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 1217 | Phonophobia | FAERS: 1 | US FAERS | |
| 1218 | Physical abuse | FAERS: 1 | US FAERS | |
| 1219 | Placenta Accreta | FAERS: 1 | US FAERS | |
| 1220 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 1221 | Poisoning | FAERS: 1 | US FAERS | |
| 1222 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 1223 | Post abortion complication | FAERS: 1 | US FAERS | |
| 1224 | Post procedural cellulitis | FAERS: 1 | US FAERS | |
| 1225 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 1226 | Post procedural inflammation | FAERS: 1 | US FAERS | |
| 1227 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 1228 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 1229 | Postoperative adhesion | FAERS: 1 | US FAERS | |
| 1230 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 1231 | Postpartum venous thrombosis | FAERS: 1 | US FAERS | |
| 1232 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 1233 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 1234 | Pregnancy on oral contraceptive | FAERS: 1 | US FAERS | |
| 1235 | Premature Menopause | FAERS: 1 | US FAERS | |
| 1236 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 1237 | Procedural nausea | FAERS: 1 | US FAERS | |
| 1238 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 1239 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 1240 | Product contamination physical | FAERS: 1 | US FAERS | |
| 1241 | Product dispensing error | FAERS: 1 | US FAERS | |
| 1242 | Product package associated injury | FAERS: 1 | US FAERS | |
| 1243 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 1244 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 1245 | Product preparation issue | FAERS: 1 | US FAERS | |
| 1246 | Product shape issue | FAERS: 1 | US FAERS | |
| 1247 | Product supply issue | FAERS: 1 | US FAERS | |
| 1248 | Product tampering | FAERS: 1 | US FAERS | |
| 1249 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 1250 | Progesterone receptor assay negative | FAERS: 1 | OFFSIDES US FAERS | |
| 1251 | Prostatic specific antigen decreased | FAERS: 1 | US FAERS | |
| 1252 | Pseudocyst | FAERS: 1 | US FAERS | |
| 1253 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 1254 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 1255 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 1256 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 1257 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 1258 | Puncture site pain | FAERS: 1 | US FAERS | |
| 1259 | Pyelitis | FAERS: 1 | US FAERS | |
| 1260 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 1261 | Pyoderma | FAERS: 1 | US FAERS | |
| 1262 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 1263 | Radiculitis | FAERS: 1 | US FAERS | |
| 1264 | Radiculopathy | FAERS: 1 | US FAERS | |
| 1265 | Radiotherapy to breast | FAERS: 1 | US FAERS | |
| 1266 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 1267 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 1268 | Rectal discharge | FAERS: 1 | US FAERS | |
| 1269 | Rectal fissure | FAERS: 1 | US FAERS | |
| 1270 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 1271 | Renal disorder in pregnancy | FAERS: 1 | US FAERS | |
| 1272 | Renal fusion anomaly | FAERS: 1 | US FAERS | |
| 1273 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 1274 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 1275 | Rhinitis | FAERS: 1 | SIDER US FAERS | |
| 1276 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 1277 | Schizophrenia | FAERS: 1 | US FAERS | |
| 1278 | Scleroderma | FAERS: 1 | US FAERS | |
| 1279 | Sense of oppression | FAERS: 1 | US FAERS | |
| 1280 | Sensitive skin | FAERS: 1 | US FAERS | |
| 1281 | Septal panniculitis | FAERS: 1 | US FAERS | |
| 1282 | Septic Shock | FAERS: 1 | US FAERS | |
| 1283 | Sinus operation | FAERS: 1 | US FAERS | |
| 1284 | Skin Induration | FAERS: 1 | US FAERS | |
| 1285 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 1286 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 1287 | Skin implant | FAERS: 1 | US FAERS | |
| 1288 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 1289 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 1290 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 1291 | Slow speech | FAERS: 1 | US FAERS | |
| 1292 | Smear site unspecified abnormal | FAERS: 1 | US FAERS | |
| 1293 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 1294 | Soft tissue atrophy | FAERS: 1 | US FAERS | |
| 1295 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 1296 | Somatic symptom disorder of pregnancy | FAERS: 1 | US FAERS | |
| 1297 | Somatoform disorder pregnancy | FAERS: 1 | US FAERS | |
| 1298 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 1299 | Spina Bifida | FAERS: 1 | US FAERS | |
| 1300 | Spinal artery thrombosis | FAERS: 1 | US FAERS | |
| 1301 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1302 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 1303 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 1304 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 1305 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 1306 | Stomatitis | FAERS: 1 | US FAERS | |
| 1307 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 1308 | Stress at work | FAERS: 1 | US FAERS | |
| 1309 | Subclavian artery thrombosis | FAERS: 1 | US FAERS | |
| 1310 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 1311 | Sudden death | FAERS: 1 | US FAERS | |
| 1312 | Sunburn | FAERS: 1 | US FAERS | |
| 1313 | Superovulation | FAERS: 1 | US FAERS | |
| 1314 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 1315 | Surgical skin tear | FAERS: 1 | US FAERS | |
| 1316 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 1317 | Suture rupture | FAERS: 1 | US FAERS | |
| 1318 | Symphysiolysis | FAERS: 1 | US FAERS | |
| 1319 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 1320 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 1321 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 1322 | Tattoo | FAERS: 1 | US FAERS | |
| 1323 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 1324 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 1325 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 1326 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 1327 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 1328 | Thoracotomy | FAERS: 1 | US FAERS | |
| 1329 | Thought withdrawal | FAERS: 1 | US FAERS | |
| 1330 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 1331 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 1332 | Toe operation | FAERS: 1 | US FAERS | |
| 1333 | Tongue blistering | FAERS: 1 | US FAERS | |
| 1334 | Tooth Infection | FAERS: 1 | US FAERS | |
| 1335 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1336 | Trismus | FAERS: 1 | US FAERS | |
| 1337 | Tubal rupture | FAERS: 1 | US FAERS | |
| 1338 | Ultrasound ovary abnormal | FAERS: 1 | US FAERS | |
| 1339 | Ultrasound uterus abnormal | FAERS: 1 | US FAERS | |
| 1340 | Unemployment | FAERS: 1 | US FAERS | |
| 1341 | Unintentional medical device removal | FAERS: 1 | US FAERS | |
| 1342 | Urethral discharge | FAERS: 1 | US FAERS | |
| 1343 | Urinary Retention | FAERS: 1 | US FAERS | |
| 1344 | Urine human chorionic gonadotropin positive | FAERS: 1 | OFFSIDES US FAERS | |
| 1345 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 1346 | Uterine Inversion | FAERS: 1 | US FAERS | |
| 1347 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 1348 | Uterine cervix stenosis | FAERS: 1 | US FAERS | |
| 1349 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 1350 | Vascular access placement | FAERS: 1 | US FAERS | |
| 1351 | Vascular compression | FAERS: 1 | US FAERS | |
| 1352 | Vasectomy | FAERS: 1 | US FAERS | |
| 1353 | Vasospasm | FAERS: 1 | US FAERS | |
| 1354 | Vein collapse | FAERS: 1 | US FAERS | |
| 1355 | Venous aneurysm | FAERS: 1 | US FAERS | |
| 1356 | Venous occlusion | FAERS: 1 | US FAERS | |
| 1357 | Ventricular hypokinesia | FAERS: 1 | OFFSIDES US FAERS | |
| 1358 | Vertebral Artery Dissection | FAERS: 1 | US FAERS | |
| 1359 | Vessel perforation | FAERS: 1 | US FAERS | |
| 1360 | Victim of homicide | FAERS: 1 | US FAERS | |
| 1361 | Viral pharyngitis | FAERS: 1 | US FAERS | |
| 1362 | Visual disturbance | FAERS: 1 | US FAERS | |
| 1363 | Vitiligo | FAERS: 1 | US FAERS | |
| 1364 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 1365 | Von Willebrand's factor activity abnormal | FAERS: 1 | US FAERS | |
| 1366 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 1367 | Weight decrease neonatal | FAERS: 1 | US FAERS | |
| 1368 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 1369 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 1370 | Wound Complication | FAERS: 1 | US FAERS | |
| 1371 | Wound abscess | FAERS: 1 | US FAERS | |
| 1372 | Wrong product administered | FAERS: 1 | US FAERS | |
| 1373 | Xanthopsia | FAERS: 1 | US FAERS | |
| 1374 | Yawning | FAERS: 1 | US FAERS | |
| 1375 | effusion | FAERS: 1 | US FAERS | |
| 1376 | fibroma | FAERS: 1 | US FAERS | |
| 1377 | liposarcoma | FAERS: 1 | US FAERS | |
| 1378 | neurofibroma | FAERS: 1 | US FAERS | |
| 1379 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 1380 | venipuncture | FAERS: 1 | US FAERS | |
| 1381 | Abnormal vision | SIDER | ||
| 1382 | Acne Vulgaris | 11861056 17763263 | CTD | |
| 1383 | Alveolitis | OFFSIDES | ||
| 1384 | Amenorrhea | 20970261 | CTD OFFSIDES | |
| 1385 | Anorexia | SIDER | ||
| 1386 | Appendectomy | OFFSIDES | ||
| 1387 | BREAST PAIN FEMALE | SIDER | ||
| 1388 | Breast Diseases | 17763263 | CTD | |
| 1389 | Bruxism | OFFSIDES | ||
| 1390 | Carotid Artery Thrombosis | OFFSIDES | ||
| 1391 | Cheilitis | OFFSIDES | ||
| 1392 | Cholangiolitis | OFFSIDES | ||
| 1393 | Cytomegalovirus hepatitis | OFFSIDES | ||
| 1394 | Depressive disorder | 17763263 | CTD | |
| 1395 | Drug withdrawal headache | OFFSIDES | ||
| 1396 | Dysmenorrhea | 20931801 | CTD | |
| 1397 | Escherichia sepsis | OFFSIDES | ||
| 1398 | Fibroadenosis of breast | SIDER | ||
| 1399 | Hypertrophy of Breast | SIDER | ||
| 1400 | Hypomenorrhea | OFFSIDES | ||
| 1401 | Infestation | SIDER | ||
| 1402 | Influenza-like symptoms | SIDER | ||
| 1403 | Leukorrhea | SIDER | ||
| 1404 | Malnutrition | SIDER | ||
| 1405 | Menstruation Disturbances | 17763263 | CTD | |
| 1406 | Mood Disorders | 11861056 17763263 20970261 | CTD | |
| 1407 | Muscle Weakness | OFFSIDES | ||
| 1408 | Neonatal aspiration | OFFSIDES | ||
| 1409 | Nervous tension | OFFSIDES | ||
| 1410 | Optic Disc Edema | OFFSIDES | ||
| 1411 | Oropharyngeal blistering | OFFSIDES | ||
| 1412 | Ovarian dysgerminoma stage unspecified | OFFSIDES | ||
| 1413 | Polymenorrhea | OFFSIDES | ||
| 1414 | Premenstrual Tension | SIDER | ||
| 1415 | Progesterone receptor assay | OFFSIDES | ||
| 1416 | Redness | SIDER | ||
| 1417 | Sinus Thrombosis, Intracranial | 20500972 | CTD | |
| 1418 | Tension | SIDER | ||
| 1419 | Vaginal discomfort | SIDER | ||
| 1420 | Weight Gain | 11861056 17763263 20970261 | CTD OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.