Goserelin
(BLCLNMBMMGCOAS-URPVMXJPSA-N)
Structure
- SMILES
- OC[C@@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)NNC(=O)N)CCCN=C(N)N)CC(C)C)COC(C)(C)C)Cc1ccc(cc1)O)NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@@H](NC(=O)[C@@H]1CCC(=O)N1)Cc1[nH]cnc1
- Type(s)
- Approved
- ATC code(s)
- L02AE03
- Molecular Formula:
- C59H84N18O14
- Molecular Weight:
- 1269.410
- Log P:
- 2.7800
- Hydrogen Bond Acceptor:
- 30
- Hydrogen Bond Donor:
- 17
- TPSA:
- 495.89
- CAS Number(s):
- 65807-02-5; 145781-92-6
Synonym(s)
1.
Goserelin
2.
Goserelin Acetate
3.
ICI-118630
4.
Zoladex
5.
Acetate, Goserelin
6.
ICI 118630
7.
ICI118630
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 112 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Headache | FAERS: 57 | SIDER US FAERS | |
| 3 | Product quality issue | FAERS: 45 | US FAERS | |
| 4 | Fatigue | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Nausea | FAERS: 38 | SIDER US FAERS | |
| 6 | Dizziness | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Pain | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Vomiting | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Arthralgia | FAERS: 27 | SIDER US FAERS | |
| 10 | Malaise | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Abdominal Pain | FAERS: 25 | SIDER US FAERS | |
| 12 | Drug dose omission | FAERS: 24 | US FAERS | |
| 13 | Asthenia | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Drug ineffective | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Injection site pain | FAERS: 22 | US FAERS | |
| 16 | Back Pain | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 17 | Weight decreased | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Drug exposure during pregnancy | FAERS: 17 | US FAERS | |
| 19 | Cerebrovascular accident | FAERS: 16 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 20 | Myocardial Infarction | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 21 | Pneumonia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Syncope | FAERS: 16 | US FAERS | |
| 23 | Device expulsion | FAERS: 15 | US FAERS | |
| 24 | Disease Progression | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 25 | Osteoporosis | FAERS: 12 | SIDER US FAERS | |
| 26 | Anxiety | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 27 | Drug administration error | FAERS: 11 | OFFSIDES US FAERS | |
| 28 | Feeling abnormal | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Blood glucose increased | FAERS: 10 | US FAERS | |
| 30 | Bone pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 31 | Endometriosis | FAERS: 10 | 9230649 | CTD OFFSIDES US FAERS |
| 32 | Medication Error | FAERS: 10 | US FAERS | |
| 33 | Alopecia | FAERS: 9 | SIDER US FAERS | |
| 34 | Amnesia | FAERS: 9 | SIDER US FAERS | |
| 35 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 36 | Circumstance or information capable of leading to medication error | FAERS: 9 | US FAERS | |
| 37 | Myalgia | FAERS: 9 | SIDER US FAERS | |
| 38 | Palpitations | FAERS: 9 | SIDER US FAERS | |
| 39 | Pulmonary Embolism | FAERS: 9 | SIDER US FAERS | |
| 40 | Acute myocardial infarction | FAERS: 8 | OFFSIDES US FAERS | |
| 41 | Device dislocation | FAERS: 8 | US FAERS | |
| 42 | Hypersensitivity | FAERS: 8 | SIDER US FAERS | |
| 43 | Hypotension | FAERS: 8 | SIDER US FAERS | |
| 44 | Joint swelling | FAERS: 8 | US FAERS | |
| 45 | Musculoskeletal stiffness | FAERS: 8 | US FAERS | |
| 46 | Pruritus | FAERS: 8 | SIDER US FAERS | |
| 47 | Somnolence | FAERS: 8 | SIDER US FAERS | |
| 48 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 49 | Application site pain | FAERS: 7 | OFFSIDES US FAERS | |
| 50 | Ascites | FAERS: 7 | US FAERS | |
| 51 | Blood cholesterol increased | FAERS: 7 | SIDER US FAERS | |
| 52 | Constipation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Device malfunction | FAERS: 7 | OFFSIDES US FAERS | |
| 54 | General physical health deterioration | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 55 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 56 | Terminal state | FAERS: 7 | US FAERS | |
| 57 | Urinary Retention | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Anger | FAERS: 6 | US FAERS | |
| 59 | Blood pressure fluctuation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Blood urine present | FAERS: 6 | OFFSIDES US FAERS | |
| 61 | Chest Pain | FAERS: 6 | SIDER US FAERS | |
| 62 | Chills | FAERS: 6 | SIDER US FAERS | |
| 63 | Coronary Artery Disease | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Cystitis | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 65 | Deep Vein Thrombosis | FAERS: 6 | SIDER US FAERS | |
| 66 | Hunger | FAERS: 6 | US FAERS | |
| 67 | Mood swings | FAERS: 6 | SIDER US FAERS | |
| 68 | Night sweats | FAERS: 6 | US FAERS | |
| 69 | Pancreatic carcinoma | FAERS: 6 | US FAERS | |
| 70 | Polymyalgia Rheumatica | FAERS: 6 | US FAERS | |
| 71 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 72 | Therapy cessation | FAERS: 6 | US FAERS | |
| 73 | Thrombosis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Urinary tract infection | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 75 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 76 | Adverse event | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Agitation | FAERS: 5 | US FAERS | |
| 78 | Anaphylactic shock | FAERS: 5 | SIDER US FAERS | |
| 79 | Aspartate Aminotransferase Increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Blindness | FAERS: 5 | US FAERS | |
| 81 | Blood potassium decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 82 | Blood testosterone decreased | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 83 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 84 | Dysuria | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 85 | Erythema | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 86 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 87 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 88 | Leukopenia | FAERS: 5 | SIDER US FAERS | |
| 89 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 90 | Medical device complication | FAERS: 5 | OFFSIDES US FAERS | |
| 91 | Metastatic Neoplasm | FAERS: 5 | OFFSIDES US FAERS | |
| 92 | Nervousness | FAERS: 5 | SIDER US FAERS | |
| 93 | Peripheral swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 95 | Stress | FAERS: 5 | US FAERS | |
| 96 | Tachycardia | FAERS: 5 | SIDER US FAERS | |
| 97 | Tremor | FAERS: 5 | US FAERS | |
| 98 | Visual Impairment | FAERS: 5 | US FAERS | |
| 99 | Visual disturbance | FAERS: 5 | US FAERS | |
| 100 | jaundice | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 101 | Alanine Aminotransferase Increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 102 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 103 | Bradycardia | FAERS: 4 | US FAERS | |
| 104 | Breast tenderness | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 105 | Burning sensation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Diabetes Mellitus | FAERS: 4 | SIDER US FAERS | |
| 107 | Dry skin | FAERS: 4 | SIDER US FAERS | |
| 108 | Erectile dysfunction | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 109 | Hormone level abnormal | FAERS: 4 | OFFSIDES US FAERS | |
| 110 | Implant site reaction | FAERS: 4 | OFFSIDES US FAERS | |
| 111 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 112 | Injection site abscess | FAERS: 4 | US FAERS | |
| 113 | Injection site bruising | FAERS: 4 | US FAERS | |
| 114 | Joint stiffness | FAERS: 4 | US FAERS | |
| 115 | Metastasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Metrorrhagia | FAERS: 4 | SIDER US FAERS | |
| 117 | Neck Pain | FAERS: 4 | US FAERS | |
| 118 | Pancreatitis | FAERS: 4 | US FAERS | |
| 119 | Swelling | FAERS: 4 | SIDER US FAERS | |
| 120 | Abdominal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 121 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 122 | Arthritis | FAERS: 3 | OFFSIDES US FAERS | |
| 123 | Ataxia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Bedridden | FAERS: 3 | US FAERS | |
| 125 | Blood follicle stimulating hormone decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 126 | Bone density decreased | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 127 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 128 | Chromaturia | FAERS: 3 | OFFSIDES US FAERS | |
| 129 | Cold sweat | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Depressed mood | FAERS: 3 | US FAERS | |
| 131 | Device Failure | FAERS: 3 | OFFSIDES US FAERS | |
| 132 | Ejection Fraction Decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 133 | Erythema Nodosum | FAERS: 3 | US FAERS | |
| 134 | Feeling Cold | FAERS: 3 | OFFSIDES US FAERS | |
| 135 | Gamma-Glutamyltransferase Increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 136 | Hemiparesis | FAERS: 3 | OFFSIDES US FAERS | |
| 137 | Hostility | FAERS: 3 | OFFSIDES US FAERS | |
| 138 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 139 | Hyperventilation | FAERS: 3 | US FAERS | |
| 140 | Implant site extravasation | FAERS: 3 | US FAERS | |
| 141 | Implant site pain | FAERS: 3 | US FAERS | |
| 142 | Infection | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 143 | Influenza | FAERS: 3 | SIDER US FAERS | |
| 144 | Injection site irritation | FAERS: 3 | SIDER US FAERS | |
| 145 | Injection site mass | FAERS: 3 | US FAERS | |
| 146 | Intestinal Obstruction | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 147 | Lethargy | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 148 | MYELODYSPLASTIC SYNDROME | FAERS: 3 | US FAERS | |
| 149 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 150 | Memory impairment | FAERS: 3 | US FAERS | |
| 151 | Nephrolithiasis | FAERS: 3 | OFFSIDES US FAERS | |
| 152 | Neuralgia | FAERS: 3 | US FAERS | |
| 153 | Nodule | FAERS: 3 | SIDER US FAERS | |
| 154 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 155 | Ovarian Hyperstimulation Syndrome | FAERS: 3 | SIDER US FAERS | |
| 156 | Overdose | FAERS: 3 | US FAERS | |
| 157 | Pancytopenia | FAERS: 3 | US FAERS | |
| 158 | Paranoia | FAERS: 3 | OFFSIDES US FAERS | |
| 159 | Pelvic mass | FAERS: 3 | OFFSIDES US FAERS | |
| 160 | Pituitary enlargement | FAERS: 3 | US FAERS | |
| 161 | Pregnancy test false positive | FAERS: 3 | OFFSIDES US FAERS | |
| 162 | Presyncope | FAERS: 3 | US FAERS | |
| 163 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 164 | Sepsis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 165 | Skeletal injury | FAERS: 3 | OFFSIDES US FAERS | |
| 166 | Spinal column stenosis | FAERS: 3 | OFFSIDES US FAERS | |
| 167 | Thrombocytopenia | FAERS: 3 | SIDER US FAERS | |
| 168 | Urinary Incontinence | FAERS: 3 | SIDER US FAERS | |
| 169 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 170 | Urticaria | FAERS: 3 | SIDER US FAERS | |
| 171 | Uterine Cancer | FAERS: 3 | OFFSIDES US FAERS | |
| 172 | Vulvovaginal dryness | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 173 | Wheezing | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 175 | Abulia | FAERS: 2 | US FAERS | |
| 176 | Administration site discomfort | FAERS: 2 | US FAERS | |
| 177 | Adnexa uteri pain | FAERS: 2 | US FAERS | |
| 178 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 179 | Angioedema | FAERS: 2 | OFFSIDES US FAERS | |
| 180 | Ankle Fracture | FAERS: 2 | OFFSIDES US FAERS | |
| 181 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 182 | Anosmia | FAERS: 2 | US FAERS | |
| 183 | Arterial Injury | FAERS: 2 | US FAERS | |
| 184 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 185 | Asthma | FAERS: 2 | OFFSIDES US FAERS | |
| 186 | Axonal neuropathy | FAERS: 2 | US FAERS | |
| 187 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 188 | Bile Duct Stenosis | FAERS: 2 | US FAERS | |
| 189 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 190 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 191 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 192 | Blood testosterone abnormal | FAERS: 2 | US FAERS | |
| 193 | Blood testosterone increased | FAERS: 2 | OFFSIDES US FAERS | |
| 194 | Brain Hypoxia | FAERS: 2 | OFFSIDES US FAERS | |
| 195 | Brain stem syndrome | FAERS: 2 | US FAERS | |
| 196 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 197 | Cataract | FAERS: 2 | OFFSIDES US FAERS | |
| 198 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 199 | Cyst | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 200 | Degeneration of uterine fibroid | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 201 | Dementia | FAERS: 2 | US FAERS | |
| 202 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 203 | Discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 204 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 205 | Dysgeusia | FAERS: 2 | OFFSIDES US FAERS | |
| 206 | Dysgraphia | FAERS: 2 | US FAERS | |
| 207 | Ear discomfort | FAERS: 2 | US FAERS | |
| 208 | Eczema | FAERS: 2 | OFFSIDES US FAERS | |
| 209 | Emotional disorder | FAERS: 2 | US FAERS | |
| 210 | Epilepsy | FAERS: 2 | US FAERS | |
| 211 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 212 | Folliculitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 213 | Fracture | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 214 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 215 | Hepatitis | FAERS: 2 Canada Vigilance: 1 | 9267134 | CTD SIDER Canada Vigilance US FAERS |
| 216 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 217 | Hernia | FAERS: 2 | US FAERS | |
| 218 | Homicide | FAERS: 2 | OFFSIDES US FAERS | |
| 219 | Hyperacusis | FAERS: 2 | US FAERS | |
| 220 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 221 | Hysterectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Immunosuppression | FAERS: 2 | US FAERS | |
| 223 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 224 | Implant expulsion | FAERS: 2 | OFFSIDES US FAERS | |
| 225 | Implant site mass | FAERS: 2 | US FAERS | |
| 226 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 227 | Incontinence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 228 | Inflammation | FAERS: 2 | US FAERS | |
| 229 | Injection Site Reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 230 | Injection site discharge | FAERS: 2 | OFFSIDES US FAERS | |
| 231 | Injection site discomfort | FAERS: 2 | US FAERS | |
| 232 | Injection site erythema | FAERS: 2 | US FAERS | |
| 233 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 234 | Injection site infection | FAERS: 2 | US FAERS | |
| 235 | Injection site inflammation | FAERS: 2 | US FAERS | |
| 236 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 237 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 238 | Limb discomfort | FAERS: 2 | US FAERS | |
| 239 | Lymphocyte stimulation test positive | FAERS: 2 | OFFSIDES US FAERS | |
| 240 | Macular degeneration | FAERS: 2 | US FAERS | |
| 241 | Male sexual dysfunction | FAERS: 2 | US FAERS | |
| 242 | Migration of implanted drug | FAERS: 2 | US FAERS | |
| 243 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 244 | Neutropenia | FAERS: 2 | US FAERS | |
| 245 | Oncologic complication | FAERS: 2 | US FAERS | |
| 246 | Osteonecrosis of Jaw | FAERS: 2 | US FAERS | |
| 247 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 248 | Photophobia | FAERS: 2 | US FAERS | |
| 249 | Post procedural complication | FAERS: 2 | US FAERS | |
| 250 | Pregnancy | FAERS: 2 | US FAERS | |
| 251 | Product use issue | FAERS: 2 | US FAERS | |
| 252 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 253 | Pulmonary Infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 254 | Renal pain | FAERS: 2 | US FAERS | |
| 255 | Respiratory distress | FAERS: 2 | US FAERS | |
| 256 | Restlessness | FAERS: 2 | US FAERS | |
| 257 | Retroperitoneal fibrosis | FAERS: 2 | US FAERS | |
| 258 | Sarcoma | FAERS: 2 | US FAERS | |
| 259 | Sinus Tachycardia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Sperm concentration zero | FAERS: 2 | US FAERS | |
| 261 | Subcutaneous Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 262 | Suicide attempt | FAERS: 2 | US FAERS | |
| 263 | Syringe issue | FAERS: 2 | US FAERS | |
| 264 | Temporal Arteritis | FAERS: 2 | US FAERS | |
| 265 | Tenosynovitis | FAERS: 2 | US FAERS | |
| 266 | Transaminases increased | FAERS: 2 | US FAERS | |
| 267 | Unevaluable event | FAERS: 2 | OFFSIDES US FAERS | |
| 268 | Urostomy complication | FAERS: 2 | OFFSIDES US FAERS | |
| 269 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 270 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 271 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 272 | Abdominal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 273 | Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 274 | Acidosis | FAERS: 1 | US FAERS | |
| 275 | Acne | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 276 | Acute kidney injury | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 277 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 278 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 279 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 280 | Aphagia | FAERS: 1 | US FAERS | |
| 281 | Aphasia | FAERS: 1 | US FAERS | |
| 282 | Application site erythema | FAERS: 1 | US FAERS | |
| 283 | Aqueductal Stenosis | FAERS: 1 | US FAERS | |
| 284 | Arthropathy | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 285 | Asbestosis | FAERS: 1 | US FAERS | |
| 286 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 287 | Bladder neoplasm surgery | FAERS: 1 | US FAERS | |
| 288 | Bladder pain | FAERS: 1 | SIDER US FAERS | |
| 289 | Blood alkaline phosphatase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 290 | Blood antidiuretic hormone decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 291 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 292 | Blood follicle stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 293 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 294 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 295 | Blood sodium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 296 | Bradykinesia | FAERS: 1 | US FAERS | |
| 297 | Bronchospasm | FAERS: 1 | US FAERS | |
| 298 | Camptocormia | FAERS: 1 | US FAERS | |
| 299 | Cancer Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Carbohydrate antigen 15-3 increased | FAERS: 1 | US FAERS | |
| 301 | Carcinoembryonic antigen increased | FAERS: 1 | OFFSIDES US FAERS | |
| 302 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 303 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 304 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 305 | Catatonia | FAERS: 1 | US FAERS | |
| 306 | Cellulitis | FAERS: 1 | US FAERS | |
| 307 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 308 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 309 | Cervical polyp | FAERS: 1 | OFFSIDES US FAERS | |
| 310 | Chest discomfort | FAERS: 1 | US FAERS | |
| 311 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 312 | Chondroma | FAERS: 1 | US FAERS | |
| 313 | Chorea | FAERS: 1 | US FAERS | |
| 314 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 315 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 316 | Colitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 317 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 318 | Complication of device removal | FAERS: 1 | US FAERS | |
| 319 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 320 | Cystoscopy | FAERS: 1 | US FAERS | |
| 321 | Deafness | FAERS: 1 | US FAERS | |
| 322 | Degeneration of uterine leiomyoma | FAERS: 1 | US FAERS | |
| 323 | Delirium | FAERS: 1 | US FAERS | |
| 324 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 325 | Dengue Fever | FAERS: 1 | US FAERS | |
| 326 | Depression suicidal | FAERS: 1 | US FAERS | |
| 327 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 328 | Dermatomyositis | FAERS: 1 | OFFSIDES US FAERS | |
| 329 | Device difficult to use | FAERS: 1 | US FAERS | |
| 330 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 331 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 332 | Diplegia | FAERS: 1 | US FAERS | |
| 333 | Disorientation | FAERS: 1 | US FAERS | |
| 334 | Drooling | FAERS: 1 | US FAERS | |
| 335 | Drug Dependence | FAERS: 1 | US FAERS | |
| 336 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 337 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 338 | Drug resistance | FAERS: 1 | US FAERS | |
| 339 | Drug toxicity | FAERS: 1 | US FAERS | |
| 340 | Dyspareunia | FAERS: 1 | SIDER US FAERS | |
| 341 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 342 | Dysphonia | FAERS: 1 | US FAERS | |
| 343 | Dystonia | FAERS: 1 | US FAERS | |
| 344 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 345 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 346 | Endometrial disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 347 | Eosinophilia | FAERS: 1 | US FAERS | |
| 348 | Eosinophilic Pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 349 | Epistaxis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 350 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 351 | Expired product administered | FAERS: 1 | US FAERS | |
| 352 | Expulsion of medication | FAERS: 1 | US FAERS | |
| 353 | Eye irritation | FAERS: 1 | US FAERS | |
| 354 | Facial Pain | FAERS: 1 | US FAERS | |
| 355 | Fallopian tube obstruction | FAERS: 1 | US FAERS | |
| 356 | Feeling jittery | FAERS: 1 | US FAERS | |
| 357 | Flatulence | FAERS: 1 | SIDER US FAERS | |
| 358 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 360 | Gastrointestinal carcinoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 361 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 362 | Glaucoma | FAERS: 1 | US FAERS | |
| 363 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 364 | Hepatic cyst ruptured | FAERS: 1 | OFFSIDES US FAERS | |
| 365 | Hepatitis C | FAERS: 1 | US FAERS | |
| 366 | Hirsutism | FAERS: 1 | SIDER US FAERS | |
| 367 | Hydrocephalus | FAERS: 1 | OFFSIDES US FAERS | |
| 368 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 369 | Hypogonadism | FAERS: 1 | OFFSIDES US FAERS | |
| 370 | Hypophagia | FAERS: 1 | OFFSIDES US FAERS | |
| 371 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 372 | Hypoxia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 373 | Immobile | FAERS: 1 | US FAERS | |
| 374 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 375 | Impaired work ability | FAERS: 1 | US FAERS | |
| 376 | Impatience | FAERS: 1 | US FAERS | |
| 377 | Impetigo | FAERS: 1 | US FAERS | |
| 378 | Implant site effusion | FAERS: 1 | US FAERS | |
| 379 | Implant site swelling | FAERS: 1 | US FAERS | |
| 380 | Incision site infection | FAERS: 1 | US FAERS | |
| 381 | Incorrect route of product administration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 382 | Injection related reaction | FAERS: 1 | US FAERS | |
| 383 | Injection site cellulitis | FAERS: 1 | US FAERS | |
| 384 | Injection site fibrosis | FAERS: 1 | US FAERS | |
| 385 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 386 | Injury associated with device | FAERS: 1 | US FAERS | |
| 387 | Insurance issue | FAERS: 1 | US FAERS | |
| 388 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 389 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 390 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 391 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 392 | Laceration | FAERS: 1 | US FAERS | |
| 393 | Laryngitis | FAERS: 1 | US FAERS | |
| 394 | Laryngospasm | FAERS: 1 | US FAERS | |
| 395 | Leprosy | FAERS: 1 | US FAERS | |
| 396 | Light chain disease | FAERS: 1 | US FAERS | |
| 397 | Limb injury | FAERS: 1 | US FAERS | |
| 398 | Lip swelling | FAERS: 1 | US FAERS | |
| 399 | Lipids abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 400 | Living in residential institution | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 402 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 403 | Lymphopenia | FAERS: 1 | US FAERS | |
| 404 | Medical device discomfort | FAERS: 1 | US FAERS | |
| 405 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 406 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 407 | Muscle strain | FAERS: 1 | US FAERS | |
| 408 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 409 | Mutism | FAERS: 1 | US FAERS | |
| 410 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 411 | Myocarditis | FAERS: 1 | US FAERS | |
| 412 | Myoclonus | FAERS: 1 | US FAERS | |
| 413 | Myopia | FAERS: 1 | US FAERS | |
| 414 | Myositis | FAERS: 1 | US FAERS | |
| 415 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 416 | Nasal mucosal disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 417 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 418 | Nephrogenic Diabetes Insipidus | FAERS: 1 | OFFSIDES US FAERS | |
| 419 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 420 | Nipple pain | FAERS: 1 | US FAERS | |
| 421 | No adverse event | FAERS: 1 | US FAERS | |
| 422 | Obesity | FAERS: 1 | US FAERS | |
| 423 | Onychoclasis | FAERS: 1 | US FAERS | |
| 424 | Onycholysis | FAERS: 1 | US FAERS | |
| 425 | Oral pain | FAERS: 1 | US FAERS | |
| 426 | Osteitis Deformans | FAERS: 1 | US FAERS | |
| 427 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 428 | Osteogenesis Imperfecta | FAERS: 1 | US FAERS | |
| 429 | Pain of skin | FAERS: 1 | US FAERS | |
| 430 | Palliative Care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 431 | Pallor | FAERS: 1 | US FAERS | |
| 432 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 433 | Panic Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 434 | Paraplegia | FAERS: 1 | US FAERS | |
| 435 | Pathological fracture | FAERS: 1 | US FAERS | |
| 436 | Pemphigus | FAERS: 1 | US FAERS | |
| 437 | Personality Change | FAERS: 1 | US FAERS | |
| 438 | Petechiae | FAERS: 1 | US FAERS | |
| 439 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 440 | Pneumothorax | FAERS: 1 | US FAERS | |
| 441 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 442 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 443 | Premature Menopause | FAERS: 1 | US FAERS | |
| 444 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 445 | Priapism | FAERS: 1 | US FAERS | |
| 446 | Procedural complication | FAERS: 1 | US FAERS | |
| 447 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 448 | Product administration error | FAERS: 1 | US FAERS | |
| 449 | Product dose omission | FAERS: 1 | US FAERS | |
| 450 | Product preparation issue | FAERS: 1 | US FAERS | |
| 451 | Product storage error | FAERS: 1 | US FAERS | |
| 452 | Productive Cough | FAERS: 1 | US FAERS | |
| 453 | Prostate cancer recurrent | FAERS: 1 | OFFSIDES US FAERS | |
| 454 | Prostate examination abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 455 | Prostatectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 456 | Psoriasis | FAERS: 1 | OFFSIDES US FAERS | |
| 457 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 458 | Pubic pain | FAERS: 1 | US FAERS | |
| 459 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 460 | Quadriplegia | FAERS: 1 | US FAERS | |
| 461 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 462 | Rash erythematous | FAERS: 1 | US FAERS | |
| 463 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 464 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 465 | Retropharyngeal Abscess | FAERS: 1 | US FAERS | |
| 466 | Rhabdomyolysis | FAERS: 1 | OFFSIDES US FAERS | |
| 467 | Rhabdomyoma | FAERS: 1 | OFFSIDES US FAERS | |
| 468 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 469 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 470 | Sarcomatosis | FAERS: 1 | OFFSIDES US FAERS | |
| 471 | Sciatica | FAERS: 1 | US FAERS | |
| 472 | Sense of oppression | FAERS: 1 | US FAERS | |
| 473 | Shock | FAERS: 1 | SIDER US FAERS | |
| 474 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 475 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 476 | Skin irritation | FAERS: 1 | US FAERS | |
| 477 | Skin laceration | FAERS: 1 | US FAERS | |
| 478 | Skin lesion | FAERS: 1 | US FAERS | |
| 479 | Skin reaction | FAERS: 1 | US FAERS | |
| 480 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 481 | Snoring | FAERS: 1 | US FAERS | |
| 482 | Spinal column injury | FAERS: 1 | US FAERS | |
| 483 | Splenic granuloma | FAERS: 1 | US FAERS | |
| 484 | Splenomegaly | FAERS: 1 | US FAERS | |
| 485 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 486 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 487 | Suture insertion | FAERS: 1 | US FAERS | |
| 488 | Therapy non-responder | FAERS: 1 | OFFSIDES US FAERS | |
| 489 | Thirst | FAERS: 1 | SIDER US FAERS | |
| 490 | Throat cancer | FAERS: 1 | US FAERS | |
| 491 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 492 | Tinnitus | FAERS: 1 | US FAERS | |
| 493 | Tooth Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 494 | Toothache | FAERS: 1 | US FAERS | |
| 495 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 496 | Ulcer | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 497 | Unwanted pregnancy | FAERS: 1 | OFFSIDES US FAERS | |
| 498 | Urethral stricture | FAERS: 1 | US FAERS | |
| 499 | Urine output increased | FAERS: 1 | OFFSIDES US FAERS | |
| 500 | Uterine Polyp | FAERS: 1 | OFFSIDES US FAERS | |
| 501 | Uterine Prolapse | FAERS: 1 | OFFSIDES US FAERS | |
| 502 | Uveitis | FAERS: 1 | US FAERS | |
| 503 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 504 | Vasculitis | FAERS: 1 | US FAERS | |
| 505 | Vertigo | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 506 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 507 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 508 | Walking aid user | FAERS: 1 | US FAERS | |
| 509 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 510 | furuncle | FAERS: 1 | US FAERS | |
| 511 | kyphosis | FAERS: 1 | US FAERS | |
| 512 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 513 | skin abrasion | FAERS: 1 | US FAERS | |
| 514 | Actinomycosis | OFFSIDES | ||
| 515 | Acute Coronary Syndrome | SIDER | ||
| 516 | Acute bronchitis | OFFSIDES | ||
| 517 | Acute respiratory failure | OFFSIDES | ||
| 518 | Acute sinusitis | OFFSIDES | ||
| 519 | Administration site reaction | OFFSIDES | ||
| 520 | Adnexa uteri cyst | OFFSIDES | ||
| 521 | Ageusia | OFFSIDES | ||
| 522 | Alcohol abuse | OFFSIDES | ||
| 523 | Altered visual depth perception | OFFSIDES | ||
| 524 | Alveoloplasty | OFFSIDES | ||
| 525 | Amblyopia | SIDER | ||
| 526 | Amenorrhea | OFFSIDES | ||
| 527 | Anhedonia | OFFSIDES | ||
| 528 | Anhidrosis | OFFSIDES | ||
| 529 | Anisocytosis | OFFSIDES | ||
| 530 | Ankle brachial index decreased | OFFSIDES | ||
| 531 | Anti-neutrophil cytoplasmic antibody positive vasculitis | OFFSIDES | ||
| 532 | Aortic valve sclerosis | OFFSIDES | ||
| 533 | Aphthous Stomatitis | OFFSIDES | ||
| 534 | Application site reaction | SIDER | ||
| 535 | Arteriosclerosis | OFFSIDES | ||
| 536 | Artificial crown procedure | OFFSIDES | ||
| 537 | Aspergilloma | OFFSIDES | ||
| 538 | Atelectasis | OFFSIDES | ||
| 539 | Atrial hypertrophy | OFFSIDES | ||
| 540 | Atrial tachycardia | OFFSIDES | ||
| 541 | Bacteria tissue specimen identified | OFFSIDES | ||
| 542 | Bacterial test positive | OFFSIDES | ||
| 543 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 544 | Biopsy site unspecified abnormal | OFFSIDES | ||
| 545 | Biopsy | OFFSIDES | ||
| 546 | Bladder Neoplasm | SIDER | ||
| 547 | Bladder neck obstruction | OFFSIDES | ||
| 548 | Blood magnesium increased | OFFSIDES | ||
| 549 | Blood phosphorus decreased | OFFSIDES | ||
| 550 | Blood uric acid | OFFSIDES | ||
| 551 | Bone infarction | OFFSIDES | ||
| 552 | Bone lesion | OFFSIDES | ||
| 553 | Bone scan abnormal | OFFSIDES | ||
| 554 | Bone swelling | OFFSIDES | ||
| 555 | Bone trimming | OFFSIDES | ||
| 556 | Breast Cyst | OFFSIDES | ||
| 557 | Bronchial Hyperreactivity | SIDER | ||
| 558 | Bronchitis | SIDER | ||
| 559 | Bulbar palsy | OFFSIDES | ||
| 560 | Cardiac Tamponade | OFFSIDES | ||
| 561 | Cardiac stress test abnormal | OFFSIDES | ||
| 562 | Cataract operation | OFFSIDES | ||
| 563 | Catheter placement | OFFSIDES | ||
| 564 | Central venous catheter removal | OFFSIDES | ||
| 565 | Cerebral atrophy | OFFSIDES | ||
| 566 | Cerebral calcification | OFFSIDES | ||
| 567 | Cerebral hypoperfusion | OFFSIDES | ||
| 568 | Cervical dysplasia | OFFSIDES | ||
| 569 | Cervicobrachial syndrome | OFFSIDES | ||
| 570 | Cholangiolitis | OFFSIDES | ||
| 571 | Cholestatic liver injury | OFFSIDES | ||
| 572 | Choroiditis | OFFSIDES | ||
| 573 | Claustrophobia | OFFSIDES | ||
| 574 | Cognition Disorders | 12175403 15142146 | CTD | |
| 575 | Completed Suicide | OFFSIDES | ||
| 576 | Compression fracture | OFFSIDES | ||
| 577 | Concomitant disease progression | OFFSIDES | ||
| 578 | Contracted bladder | OFFSIDES | ||
| 579 | Coronary artery reocclusion | Canada Vigilance: 1 | Canada Vigilance | |
| 580 | Cramps of lower extremities | SIDER | ||
| 581 | Debridement | OFFSIDES | ||
| 582 | Decreased Libido | OFFSIDES | ||
| 583 | Dental Fistula | OFFSIDES | ||
| 584 | Dental abscess | OFFSIDES | ||
| 585 | Dental caries | OFFSIDES | ||
| 586 | Dental examination | OFFSIDES | ||
| 587 | Dental prosthesis placement | OFFSIDES | ||
| 588 | Denture wearer | OFFSIDES | ||
| 589 | Device related infection | OFFSIDES | ||
| 590 | Diabetes | OFFSIDES | ||
| 591 | Diastolic dysfunction | OFFSIDES | ||
| 592 | Diplopia | OFFSIDES | ||
| 593 | Disturbance in sexual arousal | SIDER | ||
| 594 | Diverticulosis | OFFSIDES | ||
| 595 | Diverticulum | OFFSIDES | ||
| 596 | Drowsiness | SIDER | ||
| 597 | Drug withdrawal headache | OFFSIDES | ||
| 598 | Duodenal Obstruction | OFFSIDES | ||
| 599 | Duodenitis | OFFSIDES | ||
| 600 | Ecchymosis | SIDER | ||
| 601 | Endodontic procedure | OFFSIDES | ||
| 602 | Endometrial Hyperplasia | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 603 | Endometrial cancer stage III | OFFSIDES | ||
| 604 | Eosinophilic cystitis | OFFSIDES | ||
| 605 | Epididymitis | OFFSIDES | ||
| 606 | Erysipelas | OFFSIDES | ||
| 607 | Erythrodermic psoriasis | OFFSIDES | ||
| 608 | Excoriation | OFFSIDES | ||
| 609 | Extravasation | SIDER | ||
| 610 | Eyelid infection | OFFSIDES | ||
| 611 | Fasciitis | OFFSIDES | ||
| 612 | Fatty Liver | OFFSIDES | ||
| 613 | Febrile Neutropenia | SIDER | ||
| 614 | Feeding tube complication | OFFSIDES | ||
| 615 | Feeling of body temperature change | OFFSIDES | ||
| 616 | Femoral arterial stenosis | OFFSIDES | ||
| 617 | Formication | OFFSIDES | ||
| 618 | Fracture treatment | OFFSIDES | ||
| 619 | Gammopathy | OFFSIDES | ||
| 620 | Gastric Dilatation | OFFSIDES | ||
| 621 | Gastrointestinal Pain | SIDER | ||
| 622 | Gastrointestinal sounds abnormal | OFFSIDES | ||
| 623 | Gastrointestinal toxicity | OFFSIDES | ||
| 624 | Gastrostomy | OFFSIDES | ||
| 625 | Giardiasis | OFFSIDES | ||
| 626 | Gingival erythema | OFFSIDES | ||
| 627 | Globulinuria | OFFSIDES | ||
| 628 | Goiter | OFFSIDES | ||
| 629 | Gout | SIDER | ||
| 630 | Graft infection | OFFSIDES | ||
| 631 | Granuloma | OFFSIDES | ||
| 632 | Hepatic Encephalopathy | 15017238 | CTD | |
| 633 | Hip surgery | OFFSIDES | ||
| 634 | Hormone Therapy | OFFSIDES | ||
| 635 | Hydronephrosis | OFFSIDES | ||
| 636 | Hyperpigmentation | OFFSIDES | ||
| 637 | Hypoaesthesia facial | OFFSIDES | ||
| 638 | Hypomania | OFFSIDES | ||
| 639 | Hypothalamo-pituitary disorder | OFFSIDES | ||
| 640 | Iliac artery stenosis | OFFSIDES | ||
| 641 | Implant site discharge | OFFSIDES | ||
| 642 | Infarction | SIDER | ||
| 643 | Inspiratory capacity decreased | OFFSIDES | ||
| 644 | Intentional self-injury | OFFSIDES | ||
| 645 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 646 | Jaw lesion excision | OFFSIDES | ||
| 647 | Jealous delusion | OFFSIDES | ||
| 648 | Joint injury | OFFSIDES | ||
| 649 | Joint sprain | OFFSIDES | ||
| 650 | Kidney Failure | OFFSIDES | ||
| 651 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 652 | Lesion excision | OFFSIDES | ||
| 653 | Leukoencephalomyelitis | OFFSIDES | ||
| 654 | Life expectancy shortened | OFFSIDES | ||
| 655 | Loose tooth | OFFSIDES | ||
| 656 | Low density lipoprotein increased | SIDER | ||
| 657 | Lower Urinary Tract Symptoms | SIDER | ||
| 658 | Lupus-like syndrome | SIDER | ||
| 659 | Lymph nodes scan abnormal | OFFSIDES | ||
| 660 | Lymphedema | OFFSIDES | ||
| 661 | Lymphocyte count decreased | OFFSIDES | ||
| 662 | Malnutrition | SIDER | ||
| 663 | Mastectomy | OFFSIDES | ||
| 664 | Mastication disorder | OFFSIDES | ||
| 665 | Medical device implantation | OFFSIDES | ||
| 666 | Medical device removal | OFFSIDES | ||
| 667 | Memory Disorders | 12175403 | CTD | |
| 668 | Memory Loss | SIDER | ||
| 669 | Menorrhagia | SIDER | ||
| 670 | Mental status changes | OFFSIDES | ||
| 671 | Metaplasia | OFFSIDES | ||
| 672 | Microcytosis | OFFSIDES | ||
| 673 | Monoparesis | OFFSIDES | ||
| 674 | Muscle Weakness | OFFSIDES | ||
| 675 | Muscle necrosis | OFFSIDES | ||
| 676 | Musculoskeletal Pain | OFFSIDES | ||
| 677 | Musculoskeletal discomfort | SIDER | ||
| 678 | Myelodysplasia | OFFSIDES | ||
| 679 | Narcotic intoxication | OFFSIDES | ||
| 680 | Nephrotic Syndrome | OFFSIDES | ||
| 681 | Neurodermatitis | OFFSIDES | ||
| 682 | Neutrophil count abnormal | OFFSIDES | ||
| 683 | Nocturia | OFFSIDES SIDER | ||
| 684 | Nutritional condition abnormal | OFFSIDES | ||
| 685 | Obstruction | OFFSIDES | ||
| 686 | Occult blood positive | OFFSIDES | ||
| 687 | Oligohydramnios | OFFSIDES | ||
| 688 | Oliguria | OFFSIDES | ||
| 689 | Open reduction of fracture | OFFSIDES | ||
| 690 | Open wound | OFFSIDES | ||
| 691 | Ophthalmoplegia | SIDER | ||
| 692 | Oral Cavity Fistula | OFFSIDES | ||
| 693 | Oral infection | OFFSIDES | ||
| 694 | Oral torus | OFFSIDES | ||
| 695 | Orchitis | OFFSIDES | ||
| 696 | Oropharyngeal plaque | OFFSIDES | ||
| 697 | Osteolysis | OFFSIDES | ||
| 698 | Osteomyelitis | OFFSIDES | ||
| 699 | Osteopenia | OFFSIDES | ||
| 700 | Osteosclerosis | OFFSIDES | ||
| 701 | Ovarian enlargement | OFFSIDES | ||
| 702 | Pelvic Floor Muscle Weakness | OFFSIDES | ||
| 703 | Pelvic Pain | SIDER | ||
| 704 | Penile size reduced | OFFSIDES | ||
| 705 | Peptostreptococcus infection | OFFSIDES | ||
| 706 | Percutaneous Coronary Intervention | OFFSIDES | ||
| 707 | Performance status decreased | OFFSIDES | ||
| 708 | Periarthritis | OFFSIDES | ||
| 709 | Periodontitis | OFFSIDES | ||
| 710 | Periostitis | OFFSIDES | ||
| 711 | Pharyngitis | SIDER | ||
| 712 | Phlebitis | OFFSIDES | ||
| 713 | Physical disability | OFFSIDES | ||
| 714 | Pilonidal Cyst | OFFSIDES | ||
| 715 | Pituitary Adenoma | SIDER | ||
| 716 | Pituitary Apoplexy | SIDER | ||
| 717 | Pituitary infarction | SIDER | ||
| 718 | Platelet function test abnormal | OFFSIDES | ||
| 719 | Polyneuropathy | OFFSIDES | ||
| 720 | Polyuria | OFFSIDES | ||
| 721 | Poor dental condition | OFFSIDES | ||
| 722 | Poor personal hygiene | OFFSIDES | ||
| 723 | Post procedural fistula | OFFSIDES | ||
| 724 | Primary sequestrum | OFFSIDES | ||
| 725 | Proctitis | SIDER | ||
| 726 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 727 | Prostatic Neoplasms | CTD | ||
| 728 | Prosthesis Implantation | OFFSIDES | ||
| 729 | Pulmonary arterial pressure increased | OFFSIDES | ||
| 730 | Purulence | OFFSIDES | ||
| 731 | Purulent discharge | OFFSIDES | ||
| 732 | Rales | OFFSIDES | ||
| 733 | Reaction aggravation | SIDER | ||
| 734 | Red blood cell schistocytes present | OFFSIDES | ||
| 735 | Relapsing Fever | OFFSIDES | ||
| 736 | Renal abscess | OFFSIDES | ||
| 737 | Renal mass | OFFSIDES | ||
| 738 | Respiratory tract congestion | OFFSIDES | ||
| 739 | Restrictive pulmonary disease | OFFSIDES | ||
| 740 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 741 | Rhinitis | SIDER | ||
| 742 | Rouleaux formation | OFFSIDES | ||
| 743 | Salpingitis | OFFSIDES | ||
| 744 | Secretion discharge | OFFSIDES | ||
| 745 | Sequestrectomy | OFFSIDES | ||
| 746 | Sexual Dysfunction | SIDER | ||
| 747 | Sinus headache | OFFSIDES | ||
| 748 | Sinusitis | SIDER | ||
| 749 | Skin neoplasm excision | OFFSIDES | ||
| 750 | Skin toxicity | OFFSIDES | ||
| 751 | Soft Tissue Infection | OFFSIDES | ||
| 752 | Somatoform Disorder | OFFSIDES | ||
| 753 | Spinal claudication | OFFSIDES | ||
| 754 | Splenic cyst | OFFSIDES | ||
| 755 | Spondylolisthesis | OFFSIDES | ||
| 756 | Subcutaneous Emphysema | OFFSIDES | ||
| 757 | Sudden Cardiac Death | SIDER | ||
| 758 | Sudden death | OFFSIDES | ||
| 759 | Sweating | SIDER | ||
| 760 | Tension Headache | OFFSIDES | ||
| 761 | Tension | SIDER | ||
| 762 | Testicular mass | OFFSIDES | ||
| 763 | Therapeutic response delayed | Canada Vigilance: 1 | Canada Vigilance | |
| 764 | Thoracotomy | OFFSIDES | ||
| 765 | Thrombophlebitis | SIDER | ||
| 766 | Thyroiditis | OFFSIDES | ||
| 767 | Tonsillitis | OFFSIDES | ||
| 768 | Tooth Erosion | OFFSIDES | ||
| 769 | Tooth Extraction | OFFSIDES | ||
| 770 | Tooth Loss | OFFSIDES | ||
| 771 | Tooth repair | OFFSIDES | ||
| 772 | Tricuspid valve sclerosis | OFFSIDES | ||
| 773 | Troponin I | OFFSIDES | ||
| 774 | Tumor Lysis Syndrome | 15017238 | CTD | |
| 775 | Ubiquinone decreased | OFFSIDES | ||
| 776 | Ultrasound thyroid abnormal | OFFSIDES | ||
| 777 | Upper respiratory tract inflammation | OFFSIDES | ||
| 778 | Urethral Stenosis | OFFSIDES | ||
| 779 | Urinary Tract Pain | OFFSIDES | ||
| 780 | Urine flow decreased | OFFSIDES | ||
| 781 | Vaginal dryness | SIDER | ||
| 782 | Vascular calcification | OFFSIDES | ||
| 783 | Vascular insufficiency | OFFSIDES | ||
| 784 | Vasectomy | OFFSIDES | ||
| 785 | Vasodilation procedure | SIDER | ||
| 786 | Vasodilation | SIDER | ||
| 787 | Venous angioma of brain | OFFSIDES | ||
| 788 | Venous stenosis | OFFSIDES | ||
| 789 | Vertebroplasty | OFFSIDES | ||
| 790 | Vocal cord cyst | OFFSIDES | ||
| 791 | Vulvovaginitis | SIDER | ||
| 792 | Weight Gain | OFFSIDES | ||
| 793 | Wound Complication | OFFSIDES | ||
| 794 | Wound Debridement | OFFSIDES | ||
| 795 | Wound dehiscence | OFFSIDES | ||
| 796 | Wound infection staphylococcal | OFFSIDES | ||
| 797 | X-linked chromosomal disorder | OFFSIDES | ||
| 798 | prostatitis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.