Fenofibrate
(YMTINGFKWWXKFG-UHFFFAOYSA-N)
Structure
- SMILES
- CC(OC(=O)C(Oc1ccc(cc1)C(=O)c1ccc(cc1)Cl)(C)C)C
- Type(s)
- Approved
- ATC code(s)
- C10AB05; C10BA03; C10BA04
- Molecular Formula:
- C20H21ClO4
- Molecular Weight:
- 360.831
- Log P:
- 4.6800
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 52.6
- CAS Number(s):
- 49562-28-9
Synonym(s)
1.
Fenofibrate
2.
Procetofen
3.
Antara Micronized Procetofen
4.
Apo-Feno-Micro
5.
Apo-Fenofibrate
6.
CiL
7.
Controlip
8.
Fenobeta
9.
Fenofanton
10.
Fenofibrat AL
11.
Fenofibrat AZU
12.
Fenofibrat AbZ
13.
Fenofibrat FPh
14.
Fenofibrat Heumann
15.
Fenofibrat Hexal
16.
Fenofibrat Stada
17.
Fenofibrat-ratiopharm
18.
Fénofibrate Debat
19.
Fénofibrate MSD
20.
Gen-Fenofibrate
21.
LF-178
22.
Lipanthyl
23.
Lipantil
24.
Liparison
25.
Lipidil
26.
Lipidil-Ter
27.
Livesan
28.
Lofibra
29.
MTW-Fenofibrat
30.
Normalip
31.
Novo-Fenofibrate
32.
Nu-Fenofibrate
33.
PMS-Fenofibrate Micro
34.
Phenofibrate
35.
Procetofene
36.
Secalip
37.
Supralip
38.
Tricor
39.
durafenat
40.
fenofibrat von ct
41.
AZU, Fenofibrat
42.
Apo Feno Micro
43.
Apo Fenofibrate
44.
Debat, Fénofibrate
45.
Fenofibrat ratiopharm
46.
Gen Fenofibrate
47.
Heumann, Fenofibrat
48.
Hexal, Fenofibrat
49.
LF 178
50.
LF178
51.
Lipidil Ter
52.
MTW Fenofibrat
53.
Micronized Procetofen, Antara
54.
Novo Fenofibrate
55.
Nu Fenofibrate
56.
PMS Fenofibrate Micro
57.
Procetofen, Antara Micronized
58.
Stada, Fenofibrat
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myalgia | FAERS: 127 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 2 | Arthralgia | FAERS: 70 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 3 | Fatigue | FAERS: 69 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Rhabdomyolysis | FAERS: 65 | 17994463 18520113 20811485 | CTD OFFSIDES SIDER US FAERS |
| 5 | Blood creatinine increased | FAERS: 64 | OFFSIDES SIDER US FAERS | |
| 6 | Headache | FAERS: 57 | SIDER US FAERS | |
| 7 | Nausea | FAERS: 56 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 8 | Blood triglycerides increased | FAERS: 50 | OFFSIDES US FAERS | |
| 9 | Asthenia | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Pruritus | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Back Pain | FAERS: 45 | SIDER US FAERS | |
| 12 | Pain | FAERS: 43 Canada Vigilance: 1 | 9033862 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 13 | Abdominal Pain | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Dizziness | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Drug ineffective | FAERS: 37 | US FAERS | |
| 16 | Accidental exposure | FAERS: 34 | US FAERS | |
| 17 | Pancreatitis | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 18 | Blood creatine phosphokinase increased | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Malaise | FAERS: 30 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 20 | Aspartate Aminotransferase Increased | FAERS: 28 | SIDER US FAERS | |
| 21 | Alanine Aminotransferase Increased | FAERS: 27 | SIDER US FAERS | |
| 22 | Chest Pain | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 23 | Hypersensitivity | FAERS: 25 | SIDER US FAERS | |
| 24 | Urticaria | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Pulmonary Embolism | FAERS: 24 | SIDER US FAERS | |
| 26 | Vomiting | FAERS: 24 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 27 | jaundice | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Cholelithiasis | FAERS: 22 | 11318529 | CTD SIDER US FAERS |
| 29 | Constipation | FAERS: 22 | SIDER US FAERS | |
| 30 | Angioedema | FAERS: 20 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 19 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 32 | Gamma-Glutamyltransferase Increased | FAERS: 17 | SIDER US FAERS | |
| 33 | Abasia | FAERS: 15 | US FAERS | |
| 34 | Flatulence | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 35 | Dyspepsia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 36 | Feeling abnormal | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Low density lipoprotein increased | FAERS: 13 | US FAERS | |
| 38 | Blood cholesterol increased | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Hepatitis | FAERS: 12 | CTD SIDER US FAERS | |
| 40 | Musculoskeletal Pain | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 41 | Vertigo | FAERS: 12 | SIDER US FAERS | |
| 42 | Anxiety | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 43 | Palpitations | FAERS: 11 | SIDER US FAERS | |
| 44 | Alopecia | FAERS: 10 | SIDER US FAERS | |
| 45 | Blood glucose increased | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Blood urea increased | FAERS: 10 | SIDER US FAERS | |
| 47 | Chest discomfort | FAERS: 10 | US FAERS | |
| 48 | Myocardial Infarction | FAERS: 10 Canada Vigilance: 1 | 24593216 | CTD SIDER Canada Vigilance US FAERS |
| 49 | Chromaturia | FAERS: 9 | US FAERS | |
| 50 | Erythema | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 51 | Tremor | FAERS: 9 | US FAERS | |
| 52 | Accidental overdose | FAERS: 8 | US FAERS | |
| 53 | Anger | FAERS: 8 | OFFSIDES US FAERS | |
| 54 | Diabetes Mellitus | FAERS: 8 | US FAERS | |
| 55 | Dysgeusia | FAERS: 8 | US FAERS | |
| 56 | Eczema | FAERS: 8 | SIDER US FAERS | |
| 57 | Myopathy | FAERS: 8 | SIDER US FAERS | |
| 58 | Overdose | FAERS: 8 | US FAERS | |
| 59 | Pulmonary Fibrosis | FAERS: 8 | US FAERS | |
| 60 | Rash erythematous | FAERS: 8 | US FAERS | |
| 61 | Somnolence | FAERS: 8 | SIDER US FAERS | |
| 62 | Transaminases increased | FAERS: 8 | US FAERS | |
| 63 | Activities of daily living impaired | FAERS: 7 | OFFSIDES US FAERS | |
| 64 | Autoimmune hepatitis | FAERS: 7 | US FAERS | |
| 65 | Blood alkaline phosphatase increased | FAERS: 7 | SIDER US FAERS | |
| 66 | Bone pain | FAERS: 7 | US FAERS | |
| 67 | Deep Vein Thrombosis | FAERS: 7 | SIDER US FAERS | |
| 68 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES US FAERS | |
| 69 | Amnesia | FAERS: 6 | OFFSIDES US FAERS | |
| 70 | Anorexia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 71 | Blood lactate dehydrogenase increased | FAERS: 6 | SIDER US FAERS | |
| 72 | Blood triglycerides abnormal | FAERS: 6 | US FAERS | |
| 73 | Burning sensation | FAERS: 6 | US FAERS | |
| 74 | Choking | FAERS: 6 | US FAERS | |
| 75 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 76 | Erythema Multiforme | FAERS: 6 | US FAERS | |
| 77 | Flushing | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Joint swelling | FAERS: 6 | US FAERS | |
| 79 | Leukocytoclastic vasculitis | FAERS: 6 | US FAERS | |
| 80 | Medication residue | FAERS: 6 | US FAERS | |
| 81 | Myositis | FAERS: 6 | SIDER US FAERS | |
| 82 | Neck Pain | FAERS: 6 | US FAERS | |
| 83 | Night sweats | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Product substitution issue | FAERS: 6 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 85 | Reaction to drug excipients | FAERS: 6 | US FAERS | |
| 86 | Visual Impairment | FAERS: 6 | SIDER US FAERS | |
| 87 | Weight decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Abdominal rigidity | FAERS: 5 | US FAERS | |
| 89 | Angina Pectoris | FAERS: 5 | SIDER US FAERS | |
| 90 | Asthma | FAERS: 5 | SIDER US FAERS | |
| 91 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 92 | Chills | FAERS: 5 | US FAERS | |
| 93 | Dehydration | FAERS: 5 | OFFSIDES US FAERS | |
| 94 | Dermatomyositis | FAERS: 5 | US FAERS | |
| 95 | Drug administration error | FAERS: 5 | US FAERS | |
| 96 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 97 | Lip swelling | FAERS: 5 | US FAERS | |
| 98 | Memory impairment | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 100 | Thrombocytopenia | FAERS: 5 | SIDER US FAERS | |
| 101 | Arteriosclerosis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 102 | Benign Prostatic Hyperplasia | FAERS: 4 | OFFSIDES US FAERS | |
| 103 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 104 | Blood homocysteine increased | FAERS: 4 | US FAERS | |
| 105 | Epistaxis | FAERS: 4 | OFFSIDES US FAERS | |
| 106 | Erectile dysfunction | FAERS: 4 | SIDER US FAERS | |
| 107 | Gastritis | FAERS: 4 | SIDER US FAERS | |
| 108 | Joint Range of Motion Decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 109 | Lipase increased | FAERS: 4 | US FAERS | |
| 110 | Lymphoma | FAERS: 4 | US FAERS | |
| 111 | Medication Error | FAERS: 4 | US FAERS | |
| 112 | Muscle tightness | FAERS: 4 | OFFSIDES US FAERS | |
| 113 | Ocular icterus | FAERS: 4 | OFFSIDES US FAERS | |
| 114 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 115 | Pancytopenia | FAERS: 4 | US FAERS | |
| 116 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 117 | Renal cyst | FAERS: 4 | OFFSIDES US FAERS | |
| 118 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 119 | Restlessness | FAERS: 4 | US FAERS | |
| 120 | Retroperitoneal lymphadenopathy | FAERS: 4 | US FAERS | |
| 121 | Sexual Dysfunction | FAERS: 4 | US FAERS | |
| 122 | Splenomegaly | FAERS: 4 | US FAERS | |
| 123 | Stomatitis | FAERS: 4 | US FAERS | |
| 124 | Syncope | FAERS: 4 | US FAERS | |
| 125 | Unevaluable event | FAERS: 4 | US FAERS | |
| 126 | Vasculitis | FAERS: 4 | US FAERS | |
| 127 | Venous Thrombosis | FAERS: 4 | US FAERS | |
| 128 | Adverse event | FAERS: 3 | US FAERS | |
| 129 | Alveolitis | FAERS: 3 | SIDER US FAERS | |
| 130 | Bronchitis | FAERS: 3 | SIDER US FAERS | |
| 131 | Cataract | FAERS: 3 | SIDER US FAERS | |
| 132 | Cholestasis | FAERS: 3 | US FAERS | |
| 133 | Creatinine renal clearance increased | FAERS: 3 | US FAERS | |
| 134 | Discomfort | FAERS: 3 | SIDER US FAERS | |
| 135 | Dysuria | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 136 | Full blood count abnormal | FAERS: 3 | US FAERS | |
| 137 | Hypotension | FAERS: 3 | SIDER US FAERS | |
| 138 | Impaired work ability | FAERS: 3 | US FAERS | |
| 139 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 140 | Infection | FAERS: 3 | SIDER US FAERS | |
| 141 | Inflammation | FAERS: 3 | US FAERS | |
| 142 | Influenza | FAERS: 3 | SIDER US FAERS | |
| 143 | Lethargy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 144 | Ligament rupture | FAERS: 3 | US FAERS | |
| 145 | Lymphadenopathy | FAERS: 3 | SIDER US FAERS | |
| 146 | Medication residue present | FAERS: 3 | US FAERS | |
| 147 | Metabolic acidosis | FAERS: 3 | OFFSIDES US FAERS | |
| 148 | Metabolic alkalosis | FAERS: 3 | US FAERS | |
| 149 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 150 | Polymyositis | FAERS: 3 | 2041914 15050796 | CTD US FAERS |
| 151 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 152 | Rotator cuff syndrome | FAERS: 3 | US FAERS | |
| 153 | Throat irritation | FAERS: 3 | US FAERS | |
| 154 | Thrombosis | FAERS: 3 | 16689755 | CTD US FAERS |
| 155 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 156 | muscle injury | FAERS: 3 | OFFSIDES US FAERS | |
| 157 | Abscess | FAERS: 2 | US FAERS | |
| 158 | Agitation | FAERS: 2 | US FAERS | |
| 159 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 160 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 161 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 162 | Aphasia | FAERS: 2 | US FAERS | |
| 163 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 164 | Arthropathy | FAERS: 2 | SIDER US FAERS | |
| 165 | Asthenopia | FAERS: 2 | US FAERS | |
| 166 | Atrial Fibrillation | FAERS: 2 | SIDER US FAERS | |
| 167 | Biliary Dyskinesia | FAERS: 2 | US FAERS | |
| 168 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 169 | Blood glucose decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 170 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 171 | Blood potassium increased | FAERS: 2 | OFFSIDES US FAERS | |
| 172 | Bradycardia | FAERS: 2 | US FAERS | |
| 173 | Bronchopulmonary Dysplasia | FAERS: 2 | US FAERS | |
| 174 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 175 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 177 | Cholecystitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 178 | Cholestatic liver injury | FAERS: 2 | US FAERS | |
| 179 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 180 | Cyanosis | FAERS: 2 | US FAERS | |
| 181 | Drug abuse | FAERS: 2 | US FAERS | |
| 182 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 183 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 184 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 185 | Drug withdrawal convulsions | FAERS: 2 | US FAERS | |
| 186 | Dry skin | FAERS: 2 | OFFSIDES US FAERS | |
| 187 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 188 | Electromyogram abnormal | FAERS: 2 | US FAERS | |
| 189 | Embolism | FAERS: 2 | SIDER US FAERS | |
| 190 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 191 | Flank Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 192 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 193 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 194 | General physical health deterioration | FAERS: 2 | OFFSIDES US FAERS | |
| 195 | Hepatomegaly | FAERS: 2 | 17264098 19819289 28108177 | CTD US FAERS |
| 196 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 197 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 198 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 199 | Leukopenia | FAERS: 2 | SIDER US FAERS | |
| 200 | Low density lipoprotein abnormal | FAERS: 2 | US FAERS | |
| 201 | Mental impairment | FAERS: 2 | OFFSIDES US FAERS | |
| 202 | Monoparesis | FAERS: 2 | US FAERS | |
| 203 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 204 | Muscle strain | FAERS: 2 | OFFSIDES US FAERS | |
| 205 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 206 | Neutropenia | FAERS: 2 | US FAERS | |
| 207 | No adverse event | FAERS: 2 | US FAERS | |
| 208 | Nodule | FAERS: 2 | OFFSIDES US FAERS | |
| 209 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 210 | Papule | FAERS: 2 | US FAERS | |
| 211 | Photophobia | FAERS: 2 | US FAERS | |
| 212 | Pneumonia | FAERS: 2 | SIDER US FAERS | |
| 213 | Polyarthritis | FAERS: 2 | US FAERS | |
| 214 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 215 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 216 | Product commingling | FAERS: 2 | US FAERS | |
| 217 | Product contamination | FAERS: 2 | US FAERS | |
| 218 | Product quality issue | FAERS: 2 | US FAERS | |
| 219 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 220 | Protein total increased | FAERS: 2 | US FAERS | |
| 221 | Proteinuria | FAERS: 2 | US FAERS | |
| 222 | Prurigo | FAERS: 2 | US FAERS | |
| 223 | Respiratory distress | FAERS: 2 | US FAERS | |
| 224 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 225 | Scleroderma | FAERS: 2 | US FAERS | |
| 226 | Skin laceration | FAERS: 2 | US FAERS | |
| 227 | Stent occlusion | FAERS: 2 | US FAERS | |
| 228 | Sunburn | FAERS: 2 | US FAERS | |
| 229 | Swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Tachycardia | FAERS: 2 | SIDER US FAERS | |
| 231 | Teeth brittle | FAERS: 2 | OFFSIDES US FAERS | |
| 232 | Therapeutic response unexpected | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 234 | Thirst | FAERS: 2 | US FAERS | |
| 235 | Thrombosed varicose vein | FAERS: 2 | US FAERS | |
| 236 | Urinary tract infection | FAERS: 2 | SIDER US FAERS | |
| 237 | Urinary tract inflammation | FAERS: 2 | US FAERS | |
| 238 | Visual disturbance | FAERS: 2 | US FAERS | |
| 239 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 240 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 241 | Ageusia | FAERS: 1 | US FAERS | |
| 242 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 243 | Amylase increased | FAERS: 1 | US FAERS | |
| 244 | Amyloidosis | FAERS: 1 | US FAERS | |
| 245 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 246 | Angioplasty | FAERS: 1 | US FAERS | |
| 247 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 248 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 249 | Apathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 250 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 251 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 252 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 253 | Back disorder | FAERS: 1 | US FAERS | |
| 254 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 255 | Biliary Colic | FAERS: 1 | US FAERS | |
| 256 | Bladder spasm | FAERS: 1 | OFFSIDES US FAERS | |
| 257 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 258 | Blood cholesterol abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 259 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 260 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 261 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 262 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 263 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 264 | Blood iron increased | FAERS: 1 | US FAERS | |
| 265 | Blood iron normal | FAERS: 1 | US FAERS | |
| 266 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 267 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 268 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 269 | Bone Sarcoma | FAERS: 1 | US FAERS | |
| 270 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 271 | Breast tenderness | FAERS: 1 | US FAERS | |
| 272 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 273 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 274 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 275 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 276 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 277 | Cholangitis | FAERS: 1 | US FAERS | |
| 278 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 279 | Colitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 280 | Complex partial seizures | FAERS: 1 | OFFSIDES US FAERS | |
| 281 | Coronary Artery Disease | FAERS: 1 | 16511610 | CTD SIDER US FAERS |
| 282 | Crying | FAERS: 1 | US FAERS | |
| 283 | Cyst | FAERS: 1 | US FAERS | |
| 284 | Cytomegalovirus antibody positive | FAERS: 1 | US FAERS | |
| 285 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 286 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 287 | Dementia | FAERS: 1 | US FAERS | |
| 288 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 289 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 290 | Diplopia | FAERS: 1 | OFFSIDES US FAERS | |
| 291 | Disability | FAERS: 1 | US FAERS | |
| 292 | Disorientation | FAERS: 1 | US FAERS | |
| 293 | Diverticulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 294 | Diverticulum | FAERS: 1 | US FAERS | |
| 295 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 296 | Drug dose omission | FAERS: 1 | US FAERS | |
| 297 | Drug toxicity | FAERS: 1 | US FAERS | |
| 298 | Dysphonia | FAERS: 1 | US FAERS | |
| 299 | Echography abnormal | FAERS: 1 | US FAERS | |
| 300 | Economic problem | FAERS: 1 | US FAERS | |
| 301 | Electrocardiogram abnormal | FAERS: 1 | SIDER US FAERS | |
| 302 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 303 | Eosinophilia | FAERS: 1 | SIDER US FAERS | |
| 304 | Eructation | FAERS: 1 | SIDER US FAERS | |
| 305 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 306 | Excoriation | FAERS: 1 | US FAERS | |
| 307 | Exophthalmos | FAERS: 1 | US FAERS | |
| 308 | Expired drug administered | FAERS: 1 | US FAERS | |
| 309 | Eye pain | FAERS: 1 | US FAERS | |
| 310 | Feeling jittery | FAERS: 1 | US FAERS | |
| 311 | Food Allergy | FAERS: 1 | US FAERS | |
| 312 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 313 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 314 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 315 | Gastroenteritis | FAERS: 1 | SIDER US FAERS | |
| 316 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 317 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 318 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 319 | General symptom | FAERS: 1 | US FAERS | |
| 320 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 321 | Glaucoma | FAERS: 1 | US FAERS | |
| 322 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 323 | Gout | FAERS: 1 | 12759298 16913436 | CTD SIDER US FAERS |
| 324 | Grief reaction | FAERS: 1 | US FAERS | |
| 325 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 326 | Hemiplegia | FAERS: 1 | US FAERS | |
| 327 | Hepatitis A antibody positive | FAERS: 1 | US FAERS | |
| 328 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 329 | Hernia | FAERS: 1 | SIDER US FAERS | |
| 330 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 331 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 332 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 333 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 334 | Hypervigilance | FAERS: 1 | US FAERS | |
| 335 | Hypocoagulable state | FAERS: 1 | US FAERS | |
| 336 | Hypophagia | FAERS: 1 | US FAERS | |
| 337 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 338 | Hypospadias | FAERS: 1 | US FAERS | |
| 339 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 340 | Impaired driving ability | FAERS: 1 | OFFSIDES US FAERS | |
| 341 | Incoherent | FAERS: 1 | US FAERS | |
| 342 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 343 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 344 | Initial insomnia | FAERS: 1 | US FAERS | |
| 345 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 346 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 347 | Joint injury | FAERS: 1 | US FAERS | |
| 348 | Joint stiffness | FAERS: 1 | US FAERS | |
| 349 | Large intestine perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Libido disorder | FAERS: 1 | US FAERS | |
| 351 | Light chain analysis increased | FAERS: 1 | US FAERS | |
| 352 | Liver Abscess | FAERS: 1 | US FAERS | |
| 353 | Low set ears | FAERS: 1 | US FAERS | |
| 354 | Lymphangitis | FAERS: 1 | US FAERS | |
| 355 | Macular degeneration | FAERS: 1 | US FAERS | |
| 356 | Mechanical urticaria | FAERS: 1 | US FAERS | |
| 357 | Medical device removal | FAERS: 1 | US FAERS | |
| 358 | Mental status changes | FAERS: 1 | US FAERS | |
| 359 | Microcephaly | FAERS: 1 | US FAERS | |
| 360 | Microlithiasis | FAERS: 1 | US FAERS | |
| 361 | Mood swings | FAERS: 1 | US FAERS | |
| 362 | Mouth swelling | FAERS: 1 | US FAERS | |
| 363 | Mucosal pigmentation | FAERS: 1 | US FAERS | |
| 364 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 365 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 366 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 367 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 368 | Necrosis | FAERS: 1 | 22301950 | CTD US FAERS |
| 369 | Nephritis | FAERS: 1 | US FAERS | |
| 370 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 371 | Nerve injury | FAERS: 1 | US FAERS | |
| 372 | Neuralgia | FAERS: 1 | SIDER US FAERS | |
| 373 | Neuropathy | FAERS: 1 | US FAERS | |
| 374 | Nocturia | FAERS: 1 | US FAERS | |
| 375 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 376 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 377 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 378 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 379 | Otitis Media | FAERS: 1 | SIDER US FAERS | |
| 380 | PO2 decreased | FAERS: 1 | US FAERS | |
| 381 | Pallor | FAERS: 1 | OFFSIDES US FAERS | |
| 382 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 383 | Paraparesis | FAERS: 1 | US FAERS | |
| 384 | Paresis | FAERS: 1 | US FAERS | |
| 385 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 386 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 387 | Pharyngolaryngeal Pain | FAERS: 1 | SIDER US FAERS | |
| 388 | Pneumonitis | FAERS: 1 | US FAERS | |
| 389 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 390 | Polyuria | FAERS: 1 | OFFSIDES US FAERS | |
| 391 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 392 | Post procedural complication | FAERS: 1 | US FAERS | |
| 393 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 394 | Product formulation issue | FAERS: 1 | US FAERS | |
| 395 | Product lot number issue | FAERS: 1 | US FAERS | |
| 396 | Product packaging issue | FAERS: 1 | US FAERS | |
| 397 | Product physical issue | FAERS: 1 | US FAERS | |
| 398 | Product residue present | FAERS: 1 | US FAERS | |
| 399 | Product shape issue | FAERS: 1 | US FAERS | |
| 400 | Product size issue | FAERS: 1 | US FAERS | |
| 401 | Productive Cough | FAERS: 1 | US FAERS | |
| 402 | Psoriasis | FAERS: 1 | US FAERS | |
| 403 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 404 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 405 | Purpura | FAERS: 1 | US FAERS | |
| 406 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 407 | Renal pain | FAERS: 1 | US FAERS | |
| 408 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 409 | Retching | FAERS: 1 | US FAERS | |
| 410 | Reticulocyte count decreased | FAERS: 1 | US FAERS | |
| 411 | Retinal scar | FAERS: 1 | US FAERS | |
| 412 | Retinal transplant | FAERS: 1 | US FAERS | |
| 413 | Sciatica | FAERS: 1 | US FAERS | |
| 414 | Severe Acute Respiratory Syndrome | FAERS: 1 | US FAERS | |
| 415 | Shock | FAERS: 1 | US FAERS | |
| 416 | Sinusitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 417 | Skin Induration | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Skin lesion | FAERS: 1 | US FAERS | |
| 419 | Skin reaction | FAERS: 1 | US FAERS | |
| 420 | Skin tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 421 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 422 | Stevens-Johnson Syndrome | FAERS: 1 | 25811541 | CTD US FAERS |
| 423 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 424 | Syringomyelia | FAERS: 1 | US FAERS | |
| 425 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 426 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 427 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 428 | Thermal burn | FAERS: 1 | US FAERS | |
| 429 | Tinnitus | FAERS: 1 | US FAERS | |
| 430 | Tongue biting | FAERS: 1 | US FAERS | |
| 431 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 432 | Toothache | FAERS: 1 | US FAERS | |
| 433 | Trismus | FAERS: 1 | US FAERS | |
| 434 | Ulcer | FAERS: 1 | US FAERS | |
| 435 | Urinary Retention | FAERS: 1 | US FAERS | |
| 436 | VIIth nerve paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 437 | Vascular purpura | FAERS: 1 | US FAERS | |
| 438 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 439 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 440 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 441 | Yawning | FAERS: 1 | US FAERS | |
| 442 | beta Globulin | FAERS: 1 | US FAERS | |
| 443 | Abnormal vision | SIDER | ||
| 444 | Abuse | OFFSIDES | ||
| 445 | Acid reflux | OFFSIDES | ||
| 446 | Acne | SIDER | ||
| 447 | Actinomycosis | OFFSIDES | ||
| 448 | Acute Coronary Syndrome | SIDER | ||
| 449 | Acute kidney injury | 17994463 18520113 20811485 | CTD | |
| 450 | Acute myocardial infarction | OFFSIDES | ||
| 451 | Adenocarcinoma | OFFSIDES | ||
| 452 | Agraphia | OFFSIDES | ||
| 453 | Allergy test positive | OFFSIDES | ||
| 454 | Amblyopia | SIDER | ||
| 455 | Anhedonia | OFFSIDES | ||
| 456 | Aortic Diseases | 20694523 | CTD | |
| 457 | Appendicitis | OFFSIDES | ||
| 458 | Application site irritation | OFFSIDES | ||
| 459 | Application site urticaria | OFFSIDES | ||
| 460 | Arteriovenous fistula aneurysm | OFFSIDES | ||
| 461 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 462 | Asbestosis | OFFSIDES | ||
| 463 | Atherosclerosis | SIDER | ||
| 464 | Atrioventricular Block | OFFSIDES | ||
| 465 | Aura | OFFSIDES | ||
| 466 | Bacterial test positive | OFFSIDES | ||
| 467 | Biopsy chest wall abnormal | OFFSIDES | ||
| 468 | Bipolar I disorder | OFFSIDES | ||
| 469 | Bladder pain | SIDER | ||
| 470 | Blood Coagulation Disorders | 9681093 | CTD | |
| 471 | Blood Glucose | OFFSIDES | ||
| 472 | Blood and lymphatic system disorders | SIDER | ||
| 473 | Blood cholesterol | OFFSIDES | ||
| 474 | Blood human chorionic gonadotropin increased | OFFSIDES | ||
| 475 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 476 | Blood immunoglobulin G decreased | OFFSIDES | ||
| 477 | Blood magnesium decreased | OFFSIDES | ||
| 478 | Blood pressure fluctuation | OFFSIDES | ||
| 479 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 480 | Blood thyroid stimulating hormone abnormal | OFFSIDES | ||
| 481 | Blood triglycerides | OFFSIDES | ||
| 482 | Blurred vision | OFFSIDES | ||
| 483 | Body Temperature | OFFSIDES | ||
| 484 | Bone lesion | OFFSIDES | ||
| 485 | Breast Feeding | SIDER | ||
| 486 | Bronchiectasis | OFFSIDES | ||
| 487 | Bruxism | OFFSIDES | ||
| 488 | Bulbar palsy | OFFSIDES | ||
| 489 | Bulimia | OFFSIDES | ||
| 490 | Bursitis | OFFSIDES SIDER | ||
| 491 | Candida sepsis | OFFSIDES | ||
| 492 | Cardiomyopathies | 22301950 | CTD | |
| 493 | Cardiovascular Diseases | 20580385 | CTD | |
| 494 | Cataract specified | SIDER | ||
| 495 | Catheter site infection | OFFSIDES | ||
| 496 | Cervical dysplasia | OFFSIDES | ||
| 497 | Cervical gland tuberculosis | OFFSIDES | ||
| 498 | Chemical and Drug Induced Liver Injury | CTD | ||
| 499 | Choking sensation | OFFSIDES | ||
| 500 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 501 | Chronic left ventricular failure | OFFSIDES | ||
| 502 | Clumsiness | OFFSIDES | ||
| 503 | Confabulation | OFFSIDES | ||
| 504 | Conjunctivitis | SIDER | ||
| 505 | Continuous Positive Airway Pressure | OFFSIDES | ||
| 506 | Cramps of lower extremities | SIDER | ||
| 507 | Creatine Phosphokinase Increased | SIDER | ||
| 508 | Creatinine increased | SIDER | ||
| 509 | Cutaneous hypersensitivity | SIDER | ||
| 510 | Cutis Laxa | OFFSIDES | ||
| 511 | Cystitis | SIDER | ||
| 512 | Cytolytic hepatitis | OFFSIDES | ||
| 513 | Dacryostenosis acquired | OFFSIDES | ||
| 514 | Debridement | OFFSIDES | ||
| 515 | Dental abscess | OFFSIDES | ||
| 516 | Dental caries | OFFSIDES | ||
| 517 | Dental discomfort | OFFSIDES | ||
| 518 | Dental prosthesis placement | OFFSIDES | ||
| 519 | Dependence | OFFSIDES | ||
| 520 | Dermatitis | SIDER | ||
| 521 | Device malfunction | OFFSIDES | ||
| 522 | Diabetes | OFFSIDES | ||
| 523 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 524 | Diabetic Foot | OFFSIDES | ||
| 525 | Diabetic Retinopathy | 20580385 | CTD | |
| 526 | Diarrhea | OFFSIDES | ||
| 527 | Distal intestinal obstruction syndrome | OFFSIDES | ||
| 528 | Disturbance in sexual arousal | SIDER | ||
| 529 | Drowsiness | OFFSIDES | ||
| 530 | Drug level below therapeutic | OFFSIDES | ||
| 531 | Drug specific antibody present | OFFSIDES | ||
| 532 | Drug withdrawal headache | OFFSIDES | ||
| 533 | Duodenal Ulcer | SIDER | ||
| 534 | Dysgraphia | OFFSIDES | ||
| 535 | Dyslipidemias | CTD | ||
| 536 | Dysthymic Disorder | OFFSIDES | ||
| 537 | Early satiety | OFFSIDES | ||
| 538 | Eating disorder symptom | OFFSIDES | ||
| 539 | Ecchymosis | SIDER | ||
| 540 | Electromechanical dissociation | OFFSIDES | ||
| 541 | Emotional distress | OFFSIDES | ||
| 542 | Endodontic procedure | OFFSIDES | ||
| 543 | Endometrial Hyperplasia | OFFSIDES | ||
| 544 | Endometrial Neoplasms | 16569247 | CTD | |
| 545 | Enteritis | OFFSIDES | ||
| 546 | Enterococcal infection | OFFSIDES | ||
| 547 | Epigastric distress | SIDER | ||
| 548 | Erosive gastritis | OFFSIDES | ||
| 549 | Erythema Nodosum | OFFSIDES | ||
| 550 | Escherichia urinary tract infection | OFFSIDES | ||
| 551 | Eyelid Diseases | OFFSIDES | ||
| 552 | Facial Neuralgia | OFFSIDES | ||
| 553 | Fatty Liver | 17201732 | CTD OFFSIDES | |
| 554 | Feeling Cold | OFFSIDES | ||
| 555 | Fibromyalgia | OFFSIDES | ||
| 556 | Fibrosis | 28871336 | CTD | |
| 557 | Foreign body aspiration | OFFSIDES | ||
| 558 | Gastrointestinal hypermotility | OFFSIDES | ||
| 559 | Gastrointestinal inflammation | OFFSIDES | ||
| 560 | General physical condition | OFFSIDES | ||
| 561 | Genital Herpes | OFFSIDES | ||
| 562 | Globulinuria | OFFSIDES | ||
| 563 | Goiter | OFFSIDES | ||
| 564 | Graft infection | OFFSIDES | ||
| 565 | Hepatitis, Chronic | 8253329 | CTD | |
| 566 | Herpes NOS | SIDER | ||
| 567 | Histoplasmosis | OFFSIDES | ||
| 568 | Hordeolum | OFFSIDES | ||
| 569 | House dust allergy | OFFSIDES | ||
| 570 | Human papilloma virus test positive | OFFSIDES | ||
| 571 | Hyperaldosteronism | OFFSIDES | ||
| 572 | Hypercholesterolemia | CTD | ||
| 573 | Hypercreatininaemia | OFFSIDES | ||
| 574 | Hyperlipidemia, Familial Combined | 3760707 | CTD | |
| 575 | Hyperlipoproteinemia Type IV | 4004987 | CTD | |
| 576 | Hyperlipoproteinemias | 20855072 | CTD | |
| 577 | Hyperparathyroidism | OFFSIDES | ||
| 578 | Hypertriglyceridemia | CTD | ||
| 579 | Hyperuricemia | 16913436 | CTD | |
| 580 | Hypogeusia | OFFSIDES | ||
| 581 | Hypothyroidism | 9506029 | CTD | |
| 582 | Hypoxia | OFFSIDES | ||
| 583 | Implant site infection | OFFSIDES | ||
| 584 | Incontinence | OFFSIDES | ||
| 585 | Induration | OFFSIDES | ||
| 586 | Infestation | SIDER | ||
| 587 | Insulin Resistance | 26973390 | CTD OFFSIDES | |
| 588 | Insulin-requiring type 2 diabetes mellitus | OFFSIDES | ||
| 589 | Intentional drug misuse | OFFSIDES | ||
| 590 | Intussusception | OFFSIDES | ||
| 591 | Joint Instability | OFFSIDES | ||
| 592 | Joint sprain | OFFSIDES | ||
| 593 | Kidney Diseases | 11096145 21338618 | CTD | |
| 594 | Kidney Failure | OFFSIDES | ||
| 595 | Kidney Neoplasm | OFFSIDES | ||
| 596 | Labile blood pressure | OFFSIDES | ||
| 597 | Lactic dehydrogenase activity increased | SIDER | ||
| 598 | Laryngitis | SIDER | ||
| 599 | Life expectancy shortened | OFFSIDES | ||
| 600 | Limb discomfort | OFFSIDES | ||
| 601 | Liver Cirrhosis, Experimental | 15474484 | CTD | |
| 602 | Liver Cirrhosis | 15745090 | CTD | |
| 603 | Liver Neoplasms, Experimental | 18253720 18775883 | CTD | |
| 604 | Liver diseases | 9033862 18157972 | CTD | |
| 605 | Liver fatty deposition | SIDER | ||
| 606 | Liver neoplasms | CTD | ||
| 607 | Loose tooth | OFFSIDES | ||
| 608 | Lung consolidation | OFFSIDES | ||
| 609 | Lung infiltration malignant | OFFSIDES | ||
| 610 | Lupus-like syndrome | OFFSIDES | ||
| 611 | Lymphedema | OFFSIDES | ||
| 612 | Lymphocyte count abnormal | OFFSIDES | ||
| 613 | Malignant Hypertension | OFFSIDES | ||
| 614 | Malnutrition | SIDER | ||
| 615 | Mastectomy | OFFSIDES | ||
| 616 | Mediastinitis | OFFSIDES | ||
| 617 | Meibomianitis | OFFSIDES | ||
| 618 | Mesenteric vascular insufficiency | OFFSIDES | ||
| 619 | Metastatic uterine cancer | OFFSIDES | ||
| 620 | Microalbuminuria | OFFSIDES | ||
| 621 | Mixed liver injury | OFFSIDES | ||
| 622 | Mood disorder due to a general medical condition | OFFSIDES | ||
| 623 | Muscle Weakness | 24593216 | CTD OFFSIDES | |
| 624 | Muscle flap operation | OFFSIDES | ||
| 625 | Myopia | OFFSIDES | ||
| 626 | Neoplasm Invasiveness | 25545733 | CTD | |
| 627 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 628 | Nephrolithiasis | OFFSIDES | ||
| 629 | Nervous tension | OFFSIDES | ||
| 630 | Neurodermatitis | OFFSIDES | ||
| 631 | Nodular regenerative hyperplasia | OFFSIDES | ||
| 632 | Non-alcoholic Fatty Liver Disease | 26973390 | CTD | |
| 633 | Oliguria | OFFSIDES | ||
| 634 | Optic Neuropathy | OFFSIDES | ||
| 635 | Oral infection | OFFSIDES | ||
| 636 | Orchitis | OFFSIDES | ||
| 637 | Osteomyelitis | OFFSIDES | ||
| 638 | Osteoradionecrosis | OFFSIDES | ||
| 639 | Pancreatic enlargement | OFFSIDES | ||
| 640 | Panic Disorder | OFFSIDES | ||
| 641 | Paranoia | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 642 | Peptic Ulcer | SIDER | ||
| 643 | Periodontitis | OFFSIDES | ||
| 644 | Personality change due to a general medical condition | OFFSIDES | ||
| 645 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 646 | Phlebitis | OFFSIDES SIDER | ||
| 647 | Physical disability | OFFSIDES | ||
| 648 | Pinguecula | OFFSIDES | ||
| 649 | Plasma creatinine increased | SIDER | ||
| 650 | Polyneuropathy | OFFSIDES | ||
| 651 | Poor personal hygiene | OFFSIDES | ||
| 652 | Postmenopausal bleeding | OFFSIDES | ||
| 653 | Presbyopia | OFFSIDES | ||
| 654 | Primary sequestrum | OFFSIDES | ||
| 655 | Pseudolymphoma | Canada Vigilance: 1 | Canada Vigilance | |
| 656 | Pulmonary alveolitis | SIDER | ||
| 657 | Quadriplegia | 15269493 | CTD | |
| 658 | Radiation associated pain | OFFSIDES | ||
| 659 | Rales | OFFSIDES | ||
| 660 | Renal Artery Stenosis | OFFSIDES | ||
| 661 | Renal tubular acidosis | OFFSIDES | ||
| 662 | Renal tubular disorder | OFFSIDES | ||
| 663 | Reperfusion Injury | 20863214 | CTD | |
| 664 | Respiratory tract infection fungal | OFFSIDES | ||
| 665 | Retinal Vasculitis | OFFSIDES | ||
| 666 | Rhinitis | SIDER | ||
| 667 | Risus sardonicus | OFFSIDES | ||
| 668 | Schizoaffective Disorder | OFFSIDES | ||
| 669 | Screaming | OFFSIDES | ||
| 670 | Seizures | 19054409 | CTD | |
| 671 | Sequestrectomy | OFFSIDES | ||
| 672 | Sinus operation | OFFSIDES | ||
| 673 | Skeletal injury | OFFSIDES | ||
| 674 | Skin Ulcer | SIDER | ||
| 675 | Skin hypertrophy | OFFSIDES | ||
| 676 | Sleep Talking | OFFSIDES | ||
| 677 | Spinal cord herniation | OFFSIDES | ||
| 678 | Status Epilepticus | 19054409 | CTD | |
| 679 | Stress | OFFSIDES | ||
| 680 | Suicide attempt | Canada Vigilance: 1 | Canada Vigilance | |
| 681 | Sweating | SIDER | ||
| 682 | Tachyphrenia | OFFSIDES | ||
| 683 | Tardive Dyskinesia | OFFSIDES | ||
| 684 | Tendinitis | OFFSIDES | ||
| 685 | Tenosynovitis | SIDER | ||
| 686 | Tension Headache | OFFSIDES | ||
| 687 | Tension | SIDER | ||
| 688 | Thromboembolism | SIDER | ||
| 689 | Thrombophlebitis | OFFSIDES | ||
| 690 | Tooth Extraction | OFFSIDES | ||
| 691 | Tooth Loss | OFFSIDES | ||
| 692 | Tracheal fistula | OFFSIDES | ||
| 693 | Unwell | SIDER | ||
| 694 | Urinary tract infection pseudomonal | OFFSIDES | ||
| 695 | Urine output increased | OFFSIDES | ||
| 696 | Urolithiasis | SIDER | ||
| 697 | Vasodilation procedure | SIDER | ||
| 698 | Vasodilation | SIDER | ||
| 699 | Venous Thromboembolism | SIDER | ||
| 700 | Vulvovaginal dryness | OFFSIDES | ||
| 701 | Vulvovaginal mycotic infection | SIDER | ||
| 702 | Vulvovaginal pruritus | OFFSIDES | ||
| 703 | Walking aid user | OFFSIDES | ||
| 704 | Weight Gain | 18166149 26973390 | CTD OFFSIDES | |
| 705 | effusion | OFFSIDES | ||
| 706 | kyphosis | OFFSIDES | ||
| 707 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.