MDV 3100
(WXCXUHSOUPDCQV-UHFFFAOYSA-N)
Structure
- SMILES
- CNC(=O)c1ccc(cc1F)N1C(=S)N(C(=O)C1(C)C)c1ccc(c(c1)C(F)(F)F)C#N
- Type(s)
- Approved
- ATC code(s)
- L02BB04
- Molecular Formula:
- C21H16F4N4O2S
- Molecular Weight:
- 464.436
- Log P:
- 4.5134
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 108.53
- CAS Number(s):
- 915087-33-1
Synonym(s)
1.
MDV 3100
2.
MDV-3100
3.
MDV3100
4.
enzalutamide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 4868 Canada Vigilance: 27 | Canada Vigilance SIDER US FAERS | |
| 2 | Malignant neoplasm progression | FAERS: 2574 Canada Vigilance: 86 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 2259 Canada Vigilance: 45 | Canada Vigilance US FAERS | |
| 4 | Asthenia | FAERS: 1805 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 5 | Nausea | FAERS: 1498 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 1410 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 7 | Back Pain | FAERS: 1140 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 8 | Arthralgia | FAERS: 928 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Weight decreased | FAERS: 822 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 10 | Headache | FAERS: 783 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 11 | Constipation | FAERS: 766 | US FAERS | |
| 12 | Peripheral swelling | FAERS: 725 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Malaise | FAERS: 700 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 14 | Drug dose omission | FAERS: 675 | US FAERS | |
| 15 | Pain | FAERS: 597 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 16 | Vomiting | FAERS: 510 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 17 | Abdominal discomfort | FAERS: 470 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Myalgia | FAERS: 458 | US FAERS | |
| 19 | Somnolence | FAERS: 443 | US FAERS | |
| 20 | Product size issue | FAERS: 363 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 21 | Memory impairment | FAERS: 355 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 22 | Dysgeusia | FAERS: 350 | US FAERS | |
| 23 | Bone pain | FAERS: 348 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 314 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Inappropriate schedule of drug administration | FAERS: 306 | US FAERS | |
| 26 | Urinary tract infection | FAERS: 270 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Cerebrovascular accident | FAERS: 268 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 28 | Pneumonia | FAERS: 262 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 29 | Anxiety | FAERS: 247 | SIDER US FAERS | |
| 30 | Amnesia | FAERS: 244 | SIDER US FAERS | |
| 31 | Pruritus | FAERS: 224 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Joint swelling | FAERS: 215 | US FAERS | |
| 33 | Musculoskeletal Pain | FAERS: 212 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Dehydration | FAERS: 201 | US FAERS | |
| 35 | Nasopharyngitis | FAERS: 179 | SIDER US FAERS | |
| 36 | Tremor | FAERS: 173 | US FAERS | |
| 37 | General physical health deterioration | FAERS: 169 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 38 | Adverse event | FAERS: 168 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Chest Pain | FAERS: 166 | US FAERS | |
| 40 | Product storage error | FAERS: 159 | US FAERS | |
| 41 | Vertigo | FAERS: 150 | SIDER US FAERS | |
| 42 | Flatulence | FAERS: 145 | US FAERS | |
| 43 | Blood urine present | FAERS: 144 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Visual Impairment | FAERS: 144 | US FAERS | |
| 45 | Myocardial Infarction | FAERS: 141 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 46 | Hypersomnia | FAERS: 139 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Lethargy | FAERS: 139 | US FAERS | |
| 48 | Alopecia | FAERS: 132 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Incorrect product storage | FAERS: 124 | US FAERS | |
| 50 | Ageusia | FAERS: 123 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Dementia | FAERS: 123 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Epistaxis | FAERS: 120 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 53 | Dyspepsia | FAERS: 118 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 54 | Musculoskeletal stiffness | FAERS: 115 | SIDER US FAERS | |
| 55 | Hypotension | FAERS: 104 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Abdominal Pain | FAERS: 103 | US FAERS | |
| 57 | Infection | FAERS: 97 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 58 | Restless Legs Syndrome | FAERS: 93 | US FAERS | |
| 59 | Product physical issue | FAERS: 92 | US FAERS | |
| 60 | Dry skin | FAERS: 91 | SIDER US FAERS | |
| 61 | Disease Progression | FAERS: 89 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 62 | Wrong technique in product usage process | FAERS: 88 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 63 | Neck Pain | FAERS: 87 | US FAERS | |
| 64 | Chills | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Oropharyngeal pain | FAERS: 83 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Burning sensation | FAERS: 82 | US FAERS | |
| 67 | Circumstance or information capable of leading to medication error | FAERS: 81 | US FAERS | |
| 68 | Disorientation | FAERS: 80 | US FAERS | |
| 69 | Throat irritation | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | treatment failure | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Arthritis | FAERS: 78 | US FAERS | |
| 72 | Influenza | FAERS: 78 | US FAERS | |
| 73 | Swelling | FAERS: 78 | US FAERS | |
| 74 | Dysuria | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Flushing | FAERS: 76 | US FAERS | |
| 76 | Erythema | FAERS: 73 | US FAERS | |
| 77 | Hypersensitivity | FAERS: 73 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Thrombosis | FAERS: 73 | US FAERS | |
| 79 | Night sweats | FAERS: 71 | US FAERS | |
| 80 | Blood glucose increased | FAERS: 69 | US FAERS | |
| 81 | Prescribed underdose | FAERS: 69 | US FAERS | |
| 82 | Intentional dose omission | FAERS: 67 | US FAERS | |
| 83 | Sepsis | FAERS: 67 | SIDER US FAERS | |
| 84 | Overdose | FAERS: 66 | US FAERS | |
| 85 | Cystitis | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Atrial Fibrillation | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Urinary Incontinence | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Tinnitus | FAERS: 60 | US FAERS | |
| 89 | Dysphonia | FAERS: 59 | US FAERS | |
| 90 | Unevaluable event | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 91 | Limb discomfort | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Urticaria | FAERS: 58 | US FAERS | |
| 93 | Productive Cough | FAERS: 57 | US FAERS | |
| 94 | Hospice Care | FAERS: 56 | US FAERS | |
| 95 | Musculoskeletal chest pain | FAERS: 56 | US FAERS | |
| 96 | Urinary Retention | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Retching | FAERS: 55 | US FAERS | |
| 98 | Sinusitis | FAERS: 55 | SIDER US FAERS | |
| 99 | Chest discomfort | FAERS: 54 | US FAERS | |
| 100 | Abasia | FAERS: 53 | US FAERS | |
| 101 | Product dose omission | FAERS: 53 | US FAERS | |
| 102 | Nocturia | FAERS: 52 | US FAERS | |
| 103 | Syncope | FAERS: 51 | US FAERS | |
| 104 | Choking | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 105 | Nervousness | FAERS: 49 | US FAERS | |
| 106 | Incorrect dose administered | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Gait inability | FAERS: 47 | US FAERS | |
| 108 | Feeling Cold | FAERS: 46 | US FAERS | |
| 109 | Full blood count decreased | FAERS: 45 | US FAERS | |
| 110 | White blood cell count decreased | FAERS: 43 | US FAERS | |
| 111 | Bedridden | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Joint stiffness | FAERS: 42 | US FAERS | |
| 113 | Foreign body in respiratory tract | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Gout | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Intentional product misuse | FAERS: 40 | US FAERS | |
| 116 | Nephrolithiasis | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 117 | Restlessness | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 118 | Thrombocytopenia | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 119 | Loss of personal independence in daily activities | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Blindness | FAERS: 36 | US FAERS | |
| 121 | Blood glucose decreased | FAERS: 35 | US FAERS | |
| 122 | Depressed mood | FAERS: 35 | US FAERS | |
| 123 | Diplopia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Drug prescribing error | FAERS: 35 | US FAERS | |
| 125 | Intestinal Obstruction | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Palpitations | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Product supply issue | FAERS: 34 | US FAERS | |
| 128 | Respiratory Failure | FAERS: 34 | US FAERS | |
| 129 | Wrong technique in drug usage process | FAERS: 34 | US FAERS | |
| 130 | Head discomfort | FAERS: 33 | US FAERS | |
| 131 | Mental status changes | FAERS: 33 | US FAERS | |
| 132 | Chromaturia | FAERS: 32 | US FAERS | |
| 133 | Sneezing | FAERS: 32 | US FAERS | |
| 134 | Hypophagia | FAERS: 31 | US FAERS | |
| 135 | Limb injury | FAERS: 31 | US FAERS | |
| 136 | Terminal state | FAERS: 31 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 137 | Accidental overdose | FAERS: 30 | US FAERS | |
| 138 | Arthropathy | FAERS: 30 | US FAERS | |
| 139 | Cardiac Arrest | FAERS: 30 | US FAERS | |
| 140 | Dysarthria | FAERS: 30 | US FAERS | |
| 141 | Eructation | FAERS: 30 | US FAERS | |
| 142 | Incontinence | FAERS: 30 | US FAERS | |
| 143 | Cataract | FAERS: 29 | US FAERS | |
| 144 | Deafness | FAERS: 29 | US FAERS | |
| 145 | Feeling jittery | FAERS: 29 | US FAERS | |
| 146 | Mental impairment | FAERS: 28 | US FAERS | |
| 147 | Musculoskeletal discomfort | FAERS: 28 | SIDER US FAERS | |
| 148 | Pelvic Pain | FAERS: 28 | US FAERS | |
| 149 | Cellulitis | FAERS: 27 | US FAERS | |
| 150 | Intentional product use issue | FAERS: 27 | US FAERS | |
| 151 | No adverse event | FAERS: 27 | US FAERS | |
| 152 | Pulmonary Embolism | FAERS: 27 | US FAERS | |
| 153 | Sluggishness | FAERS: 27 | US FAERS | |
| 154 | Blood sodium decreased | FAERS: 26 | US FAERS | |
| 155 | Diabetes Mellitus | FAERS: 26 | US FAERS | |
| 156 | Initial insomnia | FAERS: 26 | US FAERS | |
| 157 | Neuralgia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Acute kidney injury | FAERS: 25 | US FAERS | |
| 159 | Bronchitis | FAERS: 25 | SIDER US FAERS | |
| 160 | Product quality issue | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Toothache | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Activities of daily living impaired | FAERS: 24 | US FAERS | |
| 163 | Cancer Pain | FAERS: 24 | US FAERS | |
| 164 | Poor quality drug administered | FAERS: 24 | US FAERS | |
| 165 | Product packaging quantity issue | FAERS: 24 | US FAERS | |
| 166 | Aphasia | FAERS: 23 | US FAERS | |
| 167 | Blood potassium decreased | FAERS: 23 | US FAERS | |
| 168 | Discomfort | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Apathy | FAERS: 22 | US FAERS | |
| 170 | Breast tenderness | FAERS: 22 | US FAERS | |
| 171 | Hypokinesia | FAERS: 22 | US FAERS | |
| 172 | Incorrect storage of drug | FAERS: 22 | US FAERS | |
| 173 | Joint injury | FAERS: 22 | US FAERS | |
| 174 | Muscle strain | FAERS: 22 | US FAERS | |
| 175 | Bowel movement irregularity | FAERS: 21 | US FAERS | |
| 176 | Clostridium difficile infection | FAERS: 21 | US FAERS | |
| 177 | Device related infection | FAERS: 21 | US FAERS | |
| 178 | Eye pain | FAERS: 21 | US FAERS | |
| 179 | Product use in unapproved indication | FAERS: 21 | US FAERS | |
| 180 | Toxicity to various agents | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Lip swelling | FAERS: 20 | US FAERS | |
| 182 | Agitation | FAERS: 19 | US FAERS | |
| 183 | Cerebral Infarction | FAERS: 19 | US FAERS | |
| 184 | Drug dispensing error | FAERS: 19 | US FAERS | |
| 185 | Ear discomfort | FAERS: 19 | US FAERS | |
| 186 | Lymphadenopathy | FAERS: 19 | US FAERS | |
| 187 | Medication residue present | FAERS: 19 | US FAERS | |
| 188 | Nipple pain | FAERS: 19 | US FAERS | |
| 189 | Posterior reversible encephalopathy syndrome | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Quality of life decreased | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Blood potassium increased | FAERS: 18 | US FAERS | |
| 192 | Depressed Level of Consciousness | FAERS: 18 | US FAERS | |
| 193 | Erectile dysfunction | FAERS: 18 | US FAERS | |
| 194 | Mood swings | FAERS: 18 | US FAERS | |
| 195 | Product use complaint | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 196 | Rash erythematous | FAERS: 18 | US FAERS | |
| 197 | Delirium | FAERS: 17 | US FAERS | |
| 198 | Drug effect incomplete | FAERS: 17 | US FAERS | |
| 199 | Epilepsy | FAERS: 17 | US FAERS | |
| 200 | Gastritis | FAERS: 17 | US FAERS | |
| 201 | Pericardial effusion | FAERS: 17 | US FAERS | |
| 202 | Pulmonary congestion | FAERS: 17 | US FAERS | |
| 203 | Secretion discharge | FAERS: 17 | US FAERS | |
| 204 | Therapy cessation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Therapy non-responder | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Blood cholesterol increased | FAERS: 16 | US FAERS | |
| 207 | Blood count abnormal | FAERS: 16 | US FAERS | |
| 208 | Blood creatinine increased | FAERS: 16 | US FAERS | |
| 209 | Cold sweat | FAERS: 16 | US FAERS | |
| 210 | Inflammation | FAERS: 16 | US FAERS | |
| 211 | Pancytopenia | FAERS: 16 | US FAERS | |
| 212 | Poor peripheral circulation | FAERS: 16 | US FAERS | |
| 213 | Product taste abnormal | FAERS: 16 | US FAERS | |
| 214 | Renal pain | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | nervous system disorder | FAERS: 16 | SIDER US FAERS | |
| 216 | Back disorder | FAERS: 15 | US FAERS | |
| 217 | Blood pressure fluctuation | FAERS: 15 | US FAERS | |
| 218 | Cerebral disorder | FAERS: 15 | US FAERS | |
| 219 | Eye irritation | FAERS: 15 | US FAERS | |
| 220 | Inappropriate schedule of product administration | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 221 | Muscle tightness | FAERS: 15 | US FAERS | |
| 222 | Oncologic complication | FAERS: 15 | US FAERS | |
| 223 | Product use issue | FAERS: 15 | US FAERS | |
| 224 | Sciatica | FAERS: 15 | US FAERS | |
| 225 | Therapeutic response unexpected | FAERS: 15 | US FAERS | |
| 226 | jaundice | FAERS: 15 | US FAERS | |
| 227 | Blood testosterone decreased | FAERS: 14 | US FAERS | |
| 228 | Expired product administered | FAERS: 14 | US FAERS | |
| 229 | General physical condition abnormal | FAERS: 14 | US FAERS | |
| 230 | Glaucoma | FAERS: 14 | US FAERS | |
| 231 | Hyperchlorhydria | FAERS: 14 | US FAERS | |
| 232 | Pallor | FAERS: 14 | US FAERS | |
| 233 | Poor quality sleep | FAERS: 14 | US FAERS | |
| 234 | Stomatitis | FAERS: 14 | US FAERS | |
| 235 | Stress | FAERS: 14 | US FAERS | |
| 236 | Temperature intolerance | FAERS: 14 | US FAERS | |
| 237 | Tooth Infection | FAERS: 14 | US FAERS | |
| 238 | Emotional disorder | FAERS: 13 | US FAERS | |
| 239 | Failure to Thrive | FAERS: 13 | US FAERS | |
| 240 | Fracture | FAERS: 13 | SIDER US FAERS | |
| 241 | Tachycardia | FAERS: 13 | US FAERS | |
| 242 | Unresponsive to stimuli | FAERS: 13 | US FAERS | |
| 243 | Wheezing | FAERS: 13 | US FAERS | |
| 244 | Aphonia | FAERS: 12 | US FAERS | |
| 245 | Bradycardia | FAERS: 12 | US FAERS | |
| 246 | Cholelithiasis | FAERS: 12 | US FAERS | |
| 247 | Colitis | FAERS: 12 | US FAERS | |
| 248 | Muscle Fatigue | FAERS: 12 | US FAERS | |
| 249 | Oral pain | FAERS: 12 | US FAERS | |
| 250 | Septic Shock | FAERS: 12 | US FAERS | |
| 251 | Thirst | FAERS: 12 | US FAERS | |
| 252 | Upper-airway cough syndrome | FAERS: 12 | US FAERS | |
| 253 | Ankle Fracture | FAERS: 11 | US FAERS | |
| 254 | Blood alkaline phosphatase increased | FAERS: 11 | US FAERS | |
| 255 | Blood testosterone increased | FAERS: 11 | US FAERS | |
| 256 | Dental caries | FAERS: 11 | US FAERS | |
| 257 | Disease complication | FAERS: 11 | US FAERS | |
| 258 | Diverticulitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 259 | Laziness | FAERS: 11 | US FAERS | |
| 260 | Malnutrition | FAERS: 11 | US FAERS | |
| 261 | Metastasis | FAERS: 11 | US FAERS | |
| 262 | Pancreatic carcinoma | FAERS: 11 | US FAERS | |
| 263 | Personality Change | FAERS: 11 | US FAERS | |
| 264 | Slow speech | FAERS: 11 | US FAERS | |
| 265 | Asthma | FAERS: 10 | US FAERS | |
| 266 | Deep Vein Thrombosis | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 267 | Flank Pain | FAERS: 10 | US FAERS | |
| 268 | Hypogeusia | FAERS: 10 | US FAERS | |
| 269 | Pulmonary thrombosis | FAERS: 10 | US FAERS | |
| 270 | Skin Ulcer | FAERS: 10 | US FAERS | |
| 271 | Ulcer | FAERS: 10 | US FAERS | |
| 272 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 273 | Anger | FAERS: 9 | US FAERS | |
| 274 | Anorectal discomfort | FAERS: 9 | US FAERS | |
| 275 | Blood glucose abnormal | FAERS: 9 | US FAERS | |
| 276 | Blood glucose fluctuation | FAERS: 9 | US FAERS | |
| 277 | Blood iron decreased | FAERS: 9 | US FAERS | |
| 278 | Blood magnesium decreased | FAERS: 9 | US FAERS | |
| 279 | Blood triglycerides increased | FAERS: 9 | US FAERS | |
| 280 | Cardiac Flutter | FAERS: 9 | US FAERS | |
| 281 | Formication | FAERS: 9 | US FAERS | |
| 282 | Gastric ulcer | FAERS: 9 | US FAERS | |
| 283 | Presyncope | FAERS: 9 | US FAERS | |
| 284 | Product packaging issue | FAERS: 9 | US FAERS | |
| 285 | Skin irritation | FAERS: 9 | US FAERS | |
| 286 | Tooth Loss | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | furuncle | FAERS: 9 | US FAERS | |
| 288 | Abscess | FAERS: 8 | US FAERS | |
| 289 | Acne | FAERS: 8 | US FAERS | |
| 290 | Acute myocardial infarction | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 291 | Alanine Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 292 | Anosmia | FAERS: 8 | US FAERS | |
| 293 | Apparent death | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Asthenopia | FAERS: 8 | US FAERS | |
| 295 | Bone lesion | FAERS: 8 | US FAERS | |
| 296 | Coronary Artery Disease | FAERS: 8 | US FAERS | |
| 297 | Facial paralysis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 298 | Gingivitis | FAERS: 8 | US FAERS | |
| 299 | Hydronephrosis | FAERS: 8 | US FAERS | |
| 300 | Metastatic Neoplasm | FAERS: 8 | US FAERS | |
| 301 | Motion Sickness | FAERS: 8 | US FAERS | |
| 302 | Neutropenia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 303 | Osteonecrosis of Jaw | FAERS: 8 | US FAERS | |
| 304 | Regurgitation | FAERS: 8 | US FAERS | |
| 305 | Tooth Extraction | FAERS: 8 | US FAERS | |
| 306 | Ureteral stent insertion | FAERS: 8 | US FAERS | |
| 307 | Urine flow decreased | FAERS: 8 | US FAERS | |
| 308 | Walking aid user | FAERS: 8 | US FAERS | |
| 309 | Altered state of consciousness | FAERS: 7 | US FAERS | |
| 310 | Aphagia | FAERS: 7 | US FAERS | |
| 311 | Bradyphrenia | FAERS: 7 | US FAERS | |
| 312 | Clostridium difficile colitis | FAERS: 7 | US FAERS | |
| 313 | Disseminated Intravascular Coagulation | FAERS: 7 | US FAERS | |
| 314 | Drooling | FAERS: 7 | US FAERS | |
| 315 | Drug resistance | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Gastrointestinal motility disorder | FAERS: 7 | US FAERS | |
| 317 | Hip surgery | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 318 | Hypertensive crisis | FAERS: 7 | US FAERS | |
| 319 | Immobile | FAERS: 7 | US FAERS | |
| 320 | Incoherent | FAERS: 7 | US FAERS | |
| 321 | Incorrect route of drug administration | FAERS: 7 | US FAERS | |
| 322 | Leukopenia | FAERS: 7 | SIDER US FAERS | |
| 323 | Lymphoma | FAERS: 7 | US FAERS | |
| 324 | MYELODYSPLASTIC SYNDROME | FAERS: 7 | US FAERS | |
| 325 | Medication Error | FAERS: 7 | US FAERS | |
| 326 | Osteomyelitis | FAERS: 7 | US FAERS | |
| 327 | Pancreatitis | FAERS: 7 | US FAERS | |
| 328 | Product label issue | FAERS: 7 | US FAERS | |
| 329 | Respiratory distress | FAERS: 7 | US FAERS | |
| 330 | Stevens-Johnson Syndrome | FAERS: 7 | US FAERS | |
| 331 | Throat cancer | FAERS: 7 | US FAERS | |
| 332 | Urinary tract obstruction | FAERS: 7 | US FAERS | |
| 333 | Vitreous floaters | FAERS: 7 | US FAERS | |
| 334 | Aortic Aneurysm | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 335 | Arthropod bite | FAERS: 6 | US FAERS | |
| 336 | Ascites | FAERS: 6 | US FAERS | |
| 337 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 338 | Ataxia | FAERS: 6 | US FAERS | |
| 339 | Atrial Flutter | FAERS: 6 | US FAERS | |
| 340 | Basal cell carcinoma | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 341 | Complication associated with device | FAERS: 6 | US FAERS | |
| 342 | Cyst | FAERS: 6 | US FAERS | |
| 343 | Device occlusion | FAERS: 6 | US FAERS | |
| 344 | Dysgraphia | FAERS: 6 | US FAERS | |
| 345 | Eczema | FAERS: 6 | US FAERS | |
| 346 | Extra dose administered | FAERS: 6 | US FAERS | |
| 347 | Facial Pain | FAERS: 6 | US FAERS | |
| 348 | Hypothyroidism | FAERS: 6 | US FAERS | |
| 349 | Laryngitis | FAERS: 6 | SIDER US FAERS | |
| 350 | Lower respiratory tract infection | FAERS: 6 | SIDER US FAERS | |
| 351 | Nerve injury | FAERS: 6 | US FAERS | |
| 352 | Pain of skin | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 353 | Paranasal sinus hypersecretion | FAERS: 6 | US FAERS | |
| 354 | Photophobia | FAERS: 6 | US FAERS | |
| 355 | Prostatic specific antigen decreased | FAERS: 6 | US FAERS | |
| 356 | Retinal Detachment | FAERS: 6 | US FAERS | |
| 357 | Rhinitis | FAERS: 6 | SIDER US FAERS | |
| 358 | Skin lesion | FAERS: 6 | US FAERS | |
| 359 | Stenosis | FAERS: 6 | US FAERS | |
| 360 | Transaminases increased | FAERS: 6 | US FAERS | |
| 361 | Wound Infection | FAERS: 6 | US FAERS | |
| 362 | Angina Pectoris | FAERS: 5 | US FAERS | |
| 363 | Angioedema | FAERS: 5 | US FAERS | |
| 364 | Blood thyroid stimulating hormone increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Blood urea increased | FAERS: 5 | US FAERS | |
| 366 | Bone density decreased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Bone scan abnormal | FAERS: 5 | US FAERS | |
| 368 | Cachexia | FAERS: 5 | US FAERS | |
| 369 | Cataract operation | FAERS: 5 | US FAERS | |
| 370 | Completed Suicide | FAERS: 5 | US FAERS | |
| 371 | Compression fracture | FAERS: 5 | US FAERS | |
| 372 | Crying | FAERS: 5 | US FAERS | |
| 373 | Dermatitis | FAERS: 5 | US FAERS | |
| 374 | Drug ineffective for unapproved indication | FAERS: 5 | US FAERS | |
| 375 | Ear congestion | FAERS: 5 | US FAERS | |
| 376 | Ejection Fraction Decreased | FAERS: 5 | US FAERS | |
| 377 | Eye Infection | FAERS: 5 | US FAERS | |
| 378 | Fluid overload | FAERS: 5 | US FAERS | |
| 379 | Foreign body aspiration | FAERS: 5 | US FAERS | |
| 380 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 381 | Gastroenteritis | FAERS: 5 | US FAERS | |
| 382 | Gastrointestinal toxicity | FAERS: 5 | US FAERS | |
| 383 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 384 | Hernia | FAERS: 5 | US FAERS | |
| 385 | Hunger | FAERS: 5 | US FAERS | |
| 386 | Hypotrichosis | FAERS: 5 | US FAERS | |
| 387 | Infrequent bowel movements | FAERS: 5 | US FAERS | |
| 388 | Intervertebral Disc Degeneration | FAERS: 5 | US FAERS | |
| 389 | Monoplegia | FAERS: 5 | US FAERS | |
| 390 | Nasal discomfort | FAERS: 5 | US FAERS | |
| 391 | Onychoclasis | FAERS: 5 | US FAERS | |
| 392 | Paranasal sinus discomfort | FAERS: 5 | US FAERS | |
| 393 | Performance status decreased | FAERS: 5 | US FAERS | |
| 394 | Pneumonitis | FAERS: 5 | US FAERS | |
| 395 | Psoriasis | FAERS: 5 | US FAERS | |
| 396 | Pulmonary Fibrosis | FAERS: 5 | US FAERS | |
| 397 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 398 | Rehabilitation therapy | FAERS: 5 | US FAERS | |
| 399 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 400 | Rhabdomyolysis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Rotator cuff syndrome | FAERS: 5 | US FAERS | |
| 402 | Seizure like phenomena | FAERS: 5 | US FAERS | |
| 403 | Skin Wrinkling | FAERS: 5 | US FAERS | |
| 404 | Splenectomy | FAERS: 5 | US FAERS | |
| 405 | Sudden death | FAERS: 5 | US FAERS | |
| 406 | Tinea Pedis | FAERS: 5 | US FAERS | |
| 407 | Urethral Obstruction | FAERS: 5 | US FAERS | |
| 408 | Urethral intrinsic sphincter deficiency | FAERS: 5 | US FAERS | |
| 409 | skin abrasion | FAERS: 5 | US FAERS | |
| 410 | Accidental underdose | FAERS: 4 | US FAERS | |
| 411 | Acute Coronary Syndrome | FAERS: 4 | US FAERS | |
| 412 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 413 | Aneurysm | FAERS: 4 | US FAERS | |
| 414 | Anuria | FAERS: 4 | US FAERS | |
| 415 | Atrioventricular Block | FAERS: 4 | US FAERS | |
| 416 | Atypical pneumonia | FAERS: 4 | US FAERS | |
| 417 | Bladder pain | FAERS: 4 | US FAERS | |
| 418 | Bladder spasm | FAERS: 4 | US FAERS | |
| 419 | Blepharospasm | FAERS: 4 | US FAERS | |
| 420 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 421 | Catheter placement | FAERS: 4 | US FAERS | |
| 422 | Catheter site infection | FAERS: 4 | US FAERS | |
| 423 | Central nervous system lesion | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 424 | Colectomy | FAERS: 4 | US FAERS | |
| 425 | Depression suicidal | FAERS: 4 | US FAERS | |
| 426 | Drug administration error | FAERS: 4 | US FAERS | |
| 427 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 428 | Eschar | FAERS: 4 | US FAERS | |
| 429 | Gastrointestinal infection | FAERS: 4 | US FAERS | |
| 430 | Genital swelling | FAERS: 4 | US FAERS | |
| 431 | Hyperacusis | FAERS: 4 | US FAERS | |
| 432 | Laceration | FAERS: 4 | US FAERS | |
| 433 | Liver Abscess | FAERS: 4 | US FAERS | |
| 434 | Middle insomnia | FAERS: 4 | US FAERS | |
| 435 | Oral candidiasis | FAERS: 4 | US FAERS | |
| 436 | Osteoporosis | FAERS: 4 | US FAERS | |
| 437 | Pneumothorax | FAERS: 4 | US FAERS | |
| 438 | Product physical consistency issue | FAERS: 4 | US FAERS | |
| 439 | Prostatic pain | FAERS: 4 | US FAERS | |
| 440 | Psychiatric symptom | FAERS: 4 | US FAERS | |
| 441 | Radiation injury | FAERS: 4 | US FAERS | |
| 442 | Rectal discharge | FAERS: 4 | US FAERS | |
| 443 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 444 | Saliva altered | FAERS: 4 | US FAERS | |
| 445 | Scan abnormal | FAERS: 4 | US FAERS | |
| 446 | Sinus operation | FAERS: 4 | US FAERS | |
| 447 | Skin laceration | FAERS: 4 | US FAERS | |
| 448 | Slow response to stimuli | FAERS: 4 | US FAERS | |
| 449 | Somnambulism | FAERS: 4 | US FAERS | |
| 450 | Synovial Cyst | FAERS: 4 | US FAERS | |
| 451 | Throat clearing | FAERS: 4 | US FAERS | |
| 452 | Thyroid hormones decreased | FAERS: 4 | US FAERS | |
| 453 | VIIth nerve paralysis | FAERS: 4 | US FAERS | |
| 454 | Abdominal mass | FAERS: 3 | US FAERS | |
| 455 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 456 | Abdominal tenderness | FAERS: 3 | US FAERS | |
| 457 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 458 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 459 | Blood creatinine abnormal | FAERS: 3 | US FAERS | |
| 460 | Bronchospasm | FAERS: 3 | US FAERS | |
| 461 | Bursitis | FAERS: 3 | US FAERS | |
| 462 | Cholecystitis | FAERS: 3 | US FAERS | |
| 463 | Claustrophobia | FAERS: 3 | US FAERS | |
| 464 | Corneal Perforation | FAERS: 3 | US FAERS | |
| 465 | Cystoscopy | FAERS: 3 | US FAERS | |
| 466 | Dengue Fever | FAERS: 3 | US FAERS | |
| 467 | Device fastener issue | FAERS: 3 | US FAERS | |
| 468 | Diplegia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 469 | Early satiety | FAERS: 3 | US FAERS | |
| 470 | Embolism | FAERS: 3 | US FAERS | |
| 471 | Exophthalmos | FAERS: 3 | US FAERS | |
| 472 | Eye allergy | FAERS: 3 | US FAERS | |
| 473 | Eyelid margin crusting | FAERS: 3 | US FAERS | |
| 474 | Fear of falling | FAERS: 3 | US FAERS | |
| 475 | Feeding tube user | FAERS: 3 | US FAERS | |
| 476 | Feeling of body temperature change | FAERS: 3 | US FAERS | |
| 477 | Food aversion | FAERS: 3 | US FAERS | |
| 478 | Full blood count abnormal | FAERS: 3 | US FAERS | |
| 479 | Full blood count increased | FAERS: 3 | US FAERS | |
| 480 | Gangrene | FAERS: 3 | US FAERS | |
| 481 | Gastric Fistula | FAERS: 3 | US FAERS | |
| 482 | Gastrostomy | FAERS: 3 | US FAERS | |
| 483 | Glaucoma surgery | FAERS: 3 | US FAERS | |
| 484 | Hepatitis C | FAERS: 3 | US FAERS | |
| 485 | Hyperkeratosis | FAERS: 3 | US FAERS | |
| 486 | Hyperphagia | FAERS: 3 | US FAERS | |
| 487 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 488 | Impaired quality of life | FAERS: 3 | US FAERS | |
| 489 | Infarction | FAERS: 3 | US FAERS | |
| 490 | Intraocular pressure test abnormal | FAERS: 3 | US FAERS | |
| 491 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 492 | Lower respiratory tract congestion | FAERS: 3 | US FAERS | |
| 493 | Lyme Disease | FAERS: 3 | US FAERS | |
| 494 | Medical device implantation | FAERS: 3 | US FAERS | |
| 495 | Meningitis | FAERS: 3 | US FAERS | |
| 496 | Meniscus injury | FAERS: 3 | US FAERS | |
| 497 | Mouth swelling | FAERS: 3 | US FAERS | |
| 498 | Muscle contusion | FAERS: 3 | US FAERS | |
| 499 | Neutrophil count decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 500 | Nodule | FAERS: 3 | US FAERS | |
| 501 | Oropharyngeal discomfort | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 502 | Pancreatic Neoplasm | FAERS: 3 | US FAERS | |
| 503 | Papule | FAERS: 3 | US FAERS | |
| 504 | Pathological fracture | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Penile size reduced | FAERS: 3 | US FAERS | |
| 506 | Pleurisy | FAERS: 3 | US FAERS | |
| 507 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 508 | Product expiration date issue | FAERS: 3 | US FAERS | |
| 509 | Prostate ablation | FAERS: 3 | US FAERS | |
| 510 | Skin tightness | FAERS: 3 | US FAERS | |
| 511 | Sleep Talking | FAERS: 3 | US FAERS | |
| 512 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 513 | Spondylitis | FAERS: 3 | US FAERS | |
| 514 | Suicide attempt | FAERS: 3 | US FAERS | |
| 515 | Sunburn | FAERS: 3 | US FAERS | |
| 516 | Tonsillitis | FAERS: 3 | US FAERS | |
| 517 | Urinary tract stoma complication | FAERS: 3 | US FAERS | |
| 518 | Urine output increased | FAERS: 3 | US FAERS | |
| 519 | Urine viscosity increased | FAERS: 3 | US FAERS | |
| 520 | Vascular occlusion | FAERS: 3 | US FAERS | |
| 521 | Vasculitis | FAERS: 3 | US FAERS | |
| 522 | Vertebral lesion | FAERS: 3 | US FAERS | |
| 523 | Vertebrobasilar Insufficiency | FAERS: 3 | US FAERS | |
| 524 | Wheelchair user | FAERS: 3 | US FAERS | |
| 525 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 526 | Acidosis | FAERS: 2 | US FAERS | |
| 527 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 528 | Akathisia | FAERS: 2 | US FAERS | |
| 529 | Ammonia increased | FAERS: 2 | US FAERS | |
| 530 | Angioplasty | FAERS: 2 | US FAERS | |
| 531 | Animal bite | FAERS: 2 | US FAERS | |
| 532 | Appendicitis | FAERS: 2 | US FAERS | |
| 533 | Arthropod sting | FAERS: 2 | US FAERS | |
| 534 | Asphyxia | FAERS: 2 | US FAERS | |
| 535 | Atrial pressure increased | FAERS: 2 | US FAERS | |
| 536 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 537 | Aversion | FAERS: 2 | US FAERS | |
| 538 | Bacterial test positive | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 539 | Biliary tract infection | FAERS: 2 | US FAERS | |
| 540 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 541 | Bladder cyst | FAERS: 2 | US FAERS | |
| 542 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 543 | Blood viscosity decreased | FAERS: 2 | US FAERS | |
| 544 | Brain scan abnormal | FAERS: 2 | US FAERS | |
| 545 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 546 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 547 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 548 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 549 | Charles Bonnet Syndrome | FAERS: 2 | US FAERS | |
| 550 | Choking sensation | FAERS: 2 | US FAERS | |
| 551 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 552 | Cholelithotomy | FAERS: 2 | US FAERS | |
| 553 | Clumsiness | FAERS: 2 | US FAERS | |
| 554 | Cognitive linguistic deficit | FAERS: 2 | US FAERS | |
| 555 | Consciousness fluctuating | FAERS: 2 | US FAERS | |
| 556 | Cortisol decreased | FAERS: 2 | US FAERS | |
| 557 | Cytopenia | FAERS: 2 | US FAERS | |
| 558 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 559 | Dental Restoration Failure | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 560 | Device malfunction | FAERS: 2 | US FAERS | |
| 561 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 562 | Diffuse Large B-Cell Lymphoma | FAERS: 2 | US FAERS | |
| 563 | Disability | FAERS: 2 | US FAERS | |
| 564 | Diverticulum | FAERS: 2 | US FAERS | |
| 565 | Eating disorder symptom | FAERS: 2 | US FAERS | |
| 566 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 567 | Emergency Care | FAERS: 2 | US FAERS | |
| 568 | Emotional distress | FAERS: 2 | US FAERS | |
| 569 | Emotional poverty | FAERS: 2 | US FAERS | |
| 570 | Endodontic procedure | FAERS: 2 | US FAERS | |
| 571 | Enterococcal infection | FAERS: 2 | US FAERS | |
| 572 | Enuresis | FAERS: 2 | US FAERS | |
| 573 | Enzyme level increased | FAERS: 2 | US FAERS | |
| 574 | Escherichia infection | FAERS: 2 | US FAERS | |
| 575 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 576 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 577 | Essential Tremor | FAERS: 2 | US FAERS | |
| 578 | Excessive cerumen production | FAERS: 2 | US FAERS | |
| 579 | Eyelid infection | FAERS: 2 | US FAERS | |
| 580 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 581 | Food Poisoning | FAERS: 2 | US FAERS | |
| 582 | Food craving | FAERS: 2 | US FAERS | |
| 583 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 584 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 585 | Gastrointestinal bacterial infection | FAERS: 2 | US FAERS | |
| 586 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 587 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 588 | General symptom | FAERS: 2 | US FAERS | |
| 589 | Genital rash | FAERS: 2 | US FAERS | |
| 590 | Glossitis | FAERS: 2 | US FAERS | |
| 591 | Hemiparesis | FAERS: 2 | US FAERS | |
| 592 | Hepatitis | FAERS: 2 | US FAERS | |
| 593 | Hepatomegaly | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 594 | Hernia pain | FAERS: 2 | US FAERS | |
| 595 | Homicide | FAERS: 2 | US FAERS | |
| 596 | Hordeolum | FAERS: 2 | US FAERS | |
| 597 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 598 | Ileus | FAERS: 2 | US FAERS | |
| 599 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 600 | Impaired work ability | FAERS: 2 | US FAERS | |
| 601 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 602 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 603 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 604 | Infected bite | FAERS: 2 | US FAERS | |
| 605 | Inhibitory drug interaction | FAERS: 2 | US FAERS | |
| 606 | Injection site infection | FAERS: 2 | US FAERS | |
| 607 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 608 | Intermittent Claudication | FAERS: 2 | US FAERS | |
| 609 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 610 | Intestinal fibrosis | FAERS: 2 | US FAERS | |
| 611 | Intracranial mass | FAERS: 2 | US FAERS | |
| 612 | Investigation abnormal | FAERS: 2 | US FAERS | |
| 613 | Irregular breathing | FAERS: 2 | US FAERS | |
| 614 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 615 | Lichen Planus | FAERS: 2 | US FAERS | |
| 616 | Limb mass | FAERS: 2 | US FAERS | |
| 617 | Limb operation | FAERS: 2 | US FAERS | |
| 618 | Lip erythema | FAERS: 2 | US FAERS | |
| 619 | Lipase increased | FAERS: 2 | US FAERS | |
| 620 | Loose tooth | FAERS: 2 | US FAERS | |
| 621 | Low density lipoprotein increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 622 | Lung neoplasm surgery | FAERS: 2 | US FAERS | |
| 623 | Lymph node abscess | FAERS: 2 | US FAERS | |
| 624 | Meningeal disorder | FAERS: 2 | US FAERS | |
| 625 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 626 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 627 | Metastases to adrenals | FAERS: 2 | US FAERS | |
| 628 | Metastatic pain | FAERS: 2 | US FAERS | |
| 629 | Mineral supplementation | FAERS: 2 | US FAERS | |
| 630 | Monoparesis | FAERS: 2 | US FAERS | |
| 631 | Muscle hypertrophy | FAERS: 2 | US FAERS | |
| 632 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 633 | Necrosis | FAERS: 2 | US FAERS | |
| 634 | Negative thoughts | FAERS: 2 | US FAERS | |
| 635 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 636 | Oral infection | FAERS: 2 | US FAERS | |
| 637 | Orchitis noninfective | FAERS: 2 | US FAERS | |
| 638 | Osteopenia | FAERS: 2 | US FAERS | |
| 639 | Pain management | FAERS: 2 | US FAERS | |
| 640 | Paracentesis | FAERS: 2 | US FAERS | |
| 641 | Paraplegia | FAERS: 2 | US FAERS | |
| 642 | Pelvic discomfort | FAERS: 2 | US FAERS | |
| 643 | Penile swelling | FAERS: 2 | US FAERS | |
| 644 | Pericarditis | FAERS: 2 | US FAERS | |
| 645 | Perineal pain | FAERS: 2 | US FAERS | |
| 646 | Periorbital contusion | FAERS: 2 | US FAERS | |
| 647 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 648 | Peripheral artery bypass | FAERS: 2 | US FAERS | |
| 649 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 650 | Petechiae | FAERS: 2 | US FAERS | |
| 651 | Phantom pain | FAERS: 2 | US FAERS | |
| 652 | Pharyngitis | FAERS: 2 | SIDER US FAERS | |
| 653 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 654 | Post procedural infection | FAERS: 2 | US FAERS | |
| 655 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 656 | Product adhesion issue | FAERS: 2 | US FAERS | |
| 657 | Product availability issue | FAERS: 2 | US FAERS | |
| 658 | Product container issue | FAERS: 2 | US FAERS | |
| 659 | Product container seal issue | FAERS: 2 | US FAERS | |
| 660 | Product contamination | FAERS: 2 | US FAERS | |
| 661 | Product counterfeit | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 662 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 663 | Product lot number issue | FAERS: 2 | US FAERS | |
| 664 | Proteinuria | FAERS: 2 | US FAERS | |
| 665 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 666 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 667 | Radiation proctitis | FAERS: 2 | US FAERS | |
| 668 | Renal mass | FAERS: 2 | US FAERS | |
| 669 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 670 | Selective eating disorder | FAERS: 2 | US FAERS | |
| 671 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 672 | Silent myocardial infarction | FAERS: 2 | US FAERS | |
| 673 | Sinus headache | FAERS: 2 | US FAERS | |
| 674 | Skin Erosion | FAERS: 2 | US FAERS | |
| 675 | Skin discomfort | FAERS: 2 | US FAERS | |
| 676 | Skin reaction | FAERS: 2 | US FAERS | |
| 677 | Small cell lung cancer metastatic | FAERS: 2 | US FAERS | |
| 678 | Spinal column injury | FAERS: 2 | US FAERS | |
| 679 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 680 | Staring | FAERS: 2 | US FAERS | |
| 681 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 682 | Stem cell transplant | FAERS: 2 | US FAERS | |
| 683 | Strabismus | FAERS: 2 | US FAERS | |
| 684 | Tension Headache | FAERS: 2 | US FAERS | |
| 685 | Therapeutic procedure | FAERS: 2 | US FAERS | |
| 686 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 687 | Therapy change | FAERS: 2 | US FAERS | |
| 688 | Thermal burn | FAERS: 2 | US FAERS | |
| 689 | Thrombotic stroke | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 690 | Tongue erythema | FAERS: 2 | US FAERS | |
| 691 | Trismus | FAERS: 2 | US FAERS | |
| 692 | Urethral Stenosis | FAERS: 2 | US FAERS | |
| 693 | Urethritis | FAERS: 2 | US FAERS | |
| 694 | Urinary hesitation | FAERS: 2 | US FAERS | |
| 695 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 696 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 697 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 698 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 699 | cancer surgery | FAERS: 2 | US FAERS | |
| 700 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 701 | Activated partial thromboplastin time abnormal | FAERS: 1 | US FAERS | |
| 702 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 703 | Adrenal mass | FAERS: 1 | US FAERS | |
| 704 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 705 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 706 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 707 | Amyloidosis | FAERS: 1 | US FAERS | |
| 708 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 709 | Anal abscess | FAERS: 1 | US FAERS | |
| 710 | Anal inflammation | FAERS: 1 | US FAERS | |
| 711 | Androgens decreased | FAERS: 1 | US FAERS | |
| 712 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 713 | Anti-androgen withdrawal syndrome | FAERS: 1 | US FAERS | |
| 714 | Anticoagulant therapy | FAERS: 1 | US FAERS | |
| 715 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 716 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 717 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 718 | Arterial insufficiency | FAERS: 1 | US FAERS | |
| 719 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 720 | Atelectasis | FAERS: 1 | US FAERS | |
| 721 | Atypical fracture | FAERS: 1 | US FAERS | |
| 722 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 723 | Benign neoplasm of bladder | FAERS: 1 | US FAERS | |
| 724 | Bile output decreased | FAERS: 1 | US FAERS | |
| 725 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 726 | Bladder calculus removal | FAERS: 1 | US FAERS | |
| 727 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 728 | Bladder sphincter atony | FAERS: 1 | US FAERS | |
| 729 | Bladder tamponade | FAERS: 1 | US FAERS | |
| 730 | Blister rupture | FAERS: 1 | US FAERS | |
| 731 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 732 | Blood chromogranin A increased | FAERS: 1 | US FAERS | |
| 733 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 734 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 735 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 736 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 737 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 738 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 739 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 740 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 741 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 742 | Blood viscosity abnormal | FAERS: 1 | US FAERS | |
| 743 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 744 | Bone erosion | FAERS: 1 | US FAERS | |
| 745 | Bone fissure | FAERS: 1 | US FAERS | |
| 746 | Bradykinesia | FAERS: 1 | US FAERS | |
| 747 | Brain Abscess | FAERS: 1 | US FAERS | |
| 748 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 749 | Bruxism | FAERS: 1 | US FAERS | |
| 750 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 751 | Butterfly rash | FAERS: 1 | US FAERS | |
| 752 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 753 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 754 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 755 | Cardiac Death | FAERS: 1 | US FAERS | |
| 756 | Cardiac infection | FAERS: 1 | US FAERS | |
| 757 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 758 | Cardioactive drug level increased | FAERS: 1 | US FAERS | |
| 759 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 760 | Catheter management | FAERS: 1 | US FAERS | |
| 761 | Catheter site erythema | FAERS: 1 | US FAERS | |
| 762 | Cauda Equina Syndrome | FAERS: 1 | SIDER US FAERS | |
| 763 | Central nervous system mass | FAERS: 1 | US FAERS | |
| 764 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 765 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 766 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 767 | Cerebrospinal fluid circulation disorder | FAERS: 1 | US FAERS | |
| 768 | Cheilitis | FAERS: 1 | US FAERS | |
| 769 | Cheyne-Stokes Respiration | FAERS: 1 | US FAERS | |
| 770 | Chloasma | FAERS: 1 | US FAERS | |
| 771 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 772 | Chromatopsia | FAERS: 1 | US FAERS | |
| 773 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 774 | Clostridial sepsis | FAERS: 1 | US FAERS | |
| 775 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 776 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 777 | Contracted bladder | FAERS: 1 | US FAERS | |
| 778 | Corneal lesion | FAERS: 1 | US FAERS | |
| 779 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 780 | Coronary artery stent removal | FAERS: 1 | US FAERS | |
| 781 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 782 | Croup infectious | FAERS: 1 | US FAERS | |
| 783 | Device leakage | FAERS: 1 | US FAERS | |
| 784 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 785 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 786 | Drowning | FAERS: 1 | US FAERS | |
| 787 | Drug level decreased | FAERS: 1 | US FAERS | |
| 788 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 789 | Duodenitis | FAERS: 1 | US FAERS | |
| 790 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 791 | Dyscalculia | FAERS: 1 | US FAERS | |
| 792 | Dysentery | FAERS: 1 | US FAERS | |
| 793 | Dyslexia | FAERS: 1 | US FAERS | |
| 794 | Dysphemia | FAERS: 1 | US FAERS | |
| 795 | Dysplasia | FAERS: 1 | US FAERS | |
| 796 | Ecchymosis | FAERS: 1 | US FAERS | |
| 797 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 798 | Elbow operation | FAERS: 1 | US FAERS | |
| 799 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 800 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 801 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 802 | Embolic stroke | FAERS: 1 | US FAERS | |
| 803 | Empyema | FAERS: 1 | US FAERS | |
| 804 | Encephalitis | FAERS: 1 | US FAERS | |
| 805 | Endocarditis | FAERS: 1 | US FAERS | |
| 806 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 807 | Erysipelas | FAERS: 1 | US FAERS | |
| 808 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 809 | Euphoric mood | FAERS: 1 | US FAERS | |
| 810 | Euthanasia | FAERS: 1 | US FAERS | |
| 811 | Excoriation | FAERS: 1 | US FAERS | |
| 812 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 813 | Exostosis of jaw | FAERS: 1 | US FAERS | |
| 814 | Exposed bone in jaw | FAERS: 1 | US FAERS | |
| 815 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 816 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 817 | Exposure via partner | FAERS: 1 | US FAERS | |
| 818 | Expulsion of medication | FAERS: 1 | US FAERS | |
| 819 | Extremity contracture | FAERS: 1 | US FAERS | |
| 820 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 821 | Eye inflammation | FAERS: 1 | US FAERS | |
| 822 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 823 | Flat affect | FAERS: 1 | US FAERS | |
| 824 | Focal dyscognitive seizures | FAERS: 1 | US FAERS | |
| 825 | Food Allergy | FAERS: 1 | US FAERS | |
| 826 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 827 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 828 | Gastric Lavage | FAERS: 1 | US FAERS | |
| 829 | Gastric infection | FAERS: 1 | US FAERS | |
| 830 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 831 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 832 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 833 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 834 | Gastrointestinal stromal cancer | FAERS: 1 | US FAERS | |
| 835 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 836 | Genital discomfort | FAERS: 1 | US FAERS | |
| 837 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 838 | Glioblastoma | FAERS: 1 | US FAERS | |
| 839 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 840 | Groin infection | FAERS: 1 | US FAERS | |
| 841 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 842 | Haematinuria | FAERS: 1 | US FAERS | |
| 843 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 844 | Heat Stroke | FAERS: 1 | US FAERS | |
| 845 | Hemiplegia | FAERS: 1 | US FAERS | |
| 846 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 847 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 848 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 849 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 850 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 851 | Hyperventilation | FAERS: 1 | US FAERS | |
| 852 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 853 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 854 | Hypotonic urinary bladder | FAERS: 1 | US FAERS | |
| 855 | Immunosuppression | FAERS: 1 | US FAERS | |
| 856 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 857 | Impaired self-care | FAERS: 1 | US FAERS | |
| 858 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 859 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 860 | Infected cyst | FAERS: 1 | US FAERS | |
| 861 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 862 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 863 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 864 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 865 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 866 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 867 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 868 | Iritis | FAERS: 1 | US FAERS | |
| 869 | Iron deficiency | FAERS: 1 | US FAERS | |
| 870 | Joint Instability | FAERS: 1 | US FAERS | |
| 871 | Joint laxity | FAERS: 1 | US FAERS | |
| 872 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 873 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 874 | Late onset hypogonadism syndrome | FAERS: 1 | US FAERS | |
| 875 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 876 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 877 | Ligament injury | FAERS: 1 | US FAERS | |
| 878 | Ligament rupture | FAERS: 1 | US FAERS | |
| 879 | Limbic Encephalitis | FAERS: 1 | US FAERS | |
| 880 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 881 | Lip neoplasm malignant stage unspecified | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 882 | Living in residential institution | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 883 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 884 | Macular degeneration | FAERS: 1 | US FAERS | |
| 885 | Macule | FAERS: 1 | US FAERS | |
| 886 | Male genital atrophy | FAERS: 1 | US FAERS | |
| 887 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 888 | Malignant neoplasm of spinal cord | FAERS: 1 | US FAERS | |
| 889 | Malignant neoplasm of thorax | FAERS: 1 | US FAERS | |
| 890 | Malignant urinary tract obstruction | FAERS: 1 | US FAERS | |
| 891 | Marasmus | FAERS: 1 | US FAERS | |
| 892 | Mastication disorder | FAERS: 1 | US FAERS | |
| 893 | Medical device complication | FAERS: 1 | US FAERS | |
| 894 | Megacolon | FAERS: 1 | US FAERS | |
| 895 | Meningioma | FAERS: 1 | US FAERS | |
| 896 | Meniscus operation | FAERS: 1 | US FAERS | |
| 897 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 898 | Mental disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 899 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 900 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 901 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 902 | Metastatic bronchial carcinoma | FAERS: 1 | US FAERS | |
| 903 | Miliaria | FAERS: 1 | US FAERS | |
| 904 | Moaning | FAERS: 1 | US FAERS | |
| 905 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 906 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 907 | Multifocal motor neuropathy | FAERS: 1 | US FAERS | |
| 908 | Multimorbidity | FAERS: 1 | US FAERS | |
| 909 | Mutism | FAERS: 1 | US FAERS | |
| 910 | Myopathy | FAERS: 1 | US FAERS | |
| 911 | Nail Infection | FAERS: 1 | US FAERS | |
| 912 | Nail bed disorder | FAERS: 1 | US FAERS | |
| 913 | Nail discomfort | FAERS: 1 | US FAERS | |
| 914 | Near Drowning | FAERS: 1 | US FAERS | |
| 915 | Nephrectomy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 916 | Neuritis | FAERS: 1 | US FAERS | |
| 917 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 918 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 919 | Neurosyphilis | FAERS: 1 | US FAERS | |
| 920 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 921 | Obesity | FAERS: 1 | US FAERS | |
| 922 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 923 | Obstructive nephropathy | FAERS: 1 | US FAERS | |
| 924 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 925 | Oliguria | FAERS: 1 | US FAERS | |
| 926 | Onycholysis | FAERS: 1 | US FAERS | |
| 927 | Onychomycosis | FAERS: 1 | US FAERS | |
| 928 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 929 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 930 | Oral pruritus | FAERS: 1 | US FAERS | |
| 931 | Organic brain syndrome | FAERS: 1 | US FAERS | |
| 932 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 933 | Osteitis Deformans | FAERS: 1 | US FAERS | |
| 934 | Osteotomy | FAERS: 1 | US FAERS | |
| 935 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 936 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 937 | Pacemaker generated arrhythmia | FAERS: 1 | US FAERS | |
| 938 | Palliative Care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 939 | Pancreatic carcinoma recurrent | FAERS: 1 | US FAERS | |
| 940 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 941 | Paranoia | FAERS: 1 | US FAERS | |
| 942 | Paresis anal sphincter | FAERS: 1 | US FAERS | |
| 943 | Parotitis | FAERS: 1 | US FAERS | |
| 944 | Penile burning sensation | FAERS: 1 | US FAERS | |
| 945 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 946 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 947 | Peritonitis | FAERS: 1 | US FAERS | |
| 948 | Phlebitis | FAERS: 1 | US FAERS | |
| 949 | Physical product label issue | FAERS: 1 | US FAERS | |
| 950 | Piloerection | FAERS: 1 | US FAERS | |
| 951 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 952 | Poisoning | FAERS: 1 | US FAERS | |
| 953 | Polyarthritis | FAERS: 1 | US FAERS | |
| 954 | Polydipsia | FAERS: 1 | US FAERS | |
| 955 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 956 | Polyuria | FAERS: 1 | US FAERS | |
| 957 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 958 | Post procedural complication | FAERS: 1 | US FAERS | |
| 959 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 960 | Procedural complication | FAERS: 1 | US FAERS | |
| 961 | Proctitis | FAERS: 1 | US FAERS | |
| 962 | Product dispensing error | FAERS: 1 | US FAERS | |
| 963 | Product distribution issue | FAERS: 1 | US FAERS | |
| 964 | Product label confusion | FAERS: 1 | US FAERS | |
| 965 | Product prescribing error | FAERS: 1 | US FAERS | |
| 966 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 967 | Product tampering | FAERS: 1 | US FAERS | |
| 968 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 969 | Protein total decreased | FAERS: 1 | US FAERS | |
| 970 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 971 | Purging | FAERS: 1 | US FAERS | |
| 972 | Purpura | FAERS: 1 | US FAERS | |
| 973 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 974 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 975 | Quadriplegia | FAERS: 1 | US FAERS | |
| 976 | Rales | FAERS: 1 | US FAERS | |
| 977 | Rectal spasm | FAERS: 1 | US FAERS | |
| 978 | Renal artery stent placement | FAERS: 1 | US FAERS | |
| 979 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 980 | Rhinalgia | FAERS: 1 | US FAERS | |
| 981 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 982 | Salt craving | FAERS: 1 | US FAERS | |
| 983 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 984 | Scab | FAERS: 1 | US FAERS | |
| 985 | Schizophrenia | FAERS: 1 | US FAERS | |
| 986 | Scleroderma | FAERS: 1 | US FAERS | |
| 987 | Screaming | FAERS: 1 | US FAERS | |
| 988 | Scrotal erythema | FAERS: 1 | US FAERS | |
| 989 | Sexual inhibition | FAERS: 1 | US FAERS | |
| 990 | Shock | FAERS: 1 | US FAERS | |
| 991 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 992 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 993 | Skin toxicity | FAERS: 1 | US FAERS | |
| 994 | Spinal cord herniation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 995 | Splenomegaly | FAERS: 1 | US FAERS | |
| 996 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 997 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 998 | Stoma complication | FAERS: 1 | US FAERS | |
| 999 | Stoma site extravasation | FAERS: 1 | US FAERS | |
| 1000 | Subileus | FAERS: 1 | US FAERS | |
| 1001 | Tension | FAERS: 1 | US FAERS | |
| 1002 | Testicular hypertrophy | FAERS: 1 | US FAERS | |
| 1003 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 1004 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1005 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 1006 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 1007 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1008 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 1009 | Time perception altered | FAERS: 1 | US FAERS | |
| 1010 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 1011 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 1012 | Tooth Avulsion | FAERS: 1 | US FAERS | |
| 1013 | Tooth repair | FAERS: 1 | US FAERS | |
| 1014 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 1015 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1016 | Troponin T increased | FAERS: 1 | US FAERS | |
| 1017 | Tuberculosis | FAERS: 1 | US FAERS | |
| 1018 | Underweight | FAERS: 1 | US FAERS | |
| 1019 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 1020 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 1021 | Urethrotomy | FAERS: 1 | US FAERS | |
| 1022 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 1023 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 1024 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 1025 | Vascular rupture | FAERS: 1 | US FAERS | |
| 1026 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 1027 | Verbigeration | FAERS: 1 | US FAERS | |
| 1028 | Very low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 1029 | Vessel perforation | FAERS: 1 | US FAERS | |
| 1030 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 1031 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 1032 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 1033 | Vocal Cord Dysfunction | FAERS: 1 | US FAERS | |
| 1034 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 1035 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 1036 | Wound decomposition | FAERS: 1 | US FAERS | |
| 1037 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 1038 | Wrong schedule | FAERS: 1 | US FAERS | |
| 1039 | Xeroderma | FAERS: 1 | US FAERS | |
| 1040 | Yawning | FAERS: 1 | US FAERS | |
| 1041 | colonoscopy | FAERS: 1 | US FAERS | |
| 1042 | intensive care | FAERS: 1 | US FAERS | |
| 1043 | prostatitis | FAERS: 1 | US FAERS | |
| 1044 | Asthenic conditions | SIDER | ||
| 1045 | Blood and lymphatic system disorders | SIDER | ||
| 1046 | Infestation | SIDER | ||
| 1047 | Mental impairment disorders | SIDER | ||
| 1048 | Product preparation issue | Canada Vigilance: 1 | Canada Vigilance | |
| 1049 | Prostatic Neoplasms, Castration-Resistant | CTD | ||
| 1050 | Prostatic Neoplasms | CTD | ||
| 1051 | Triple Negative Breast Neoplasms | 27255535 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.