Voriconazole
(BCEHBSKCWLPMDN-MGPLVRAMSA-N)
Structure
- SMILES
- Fc1ccc(c(c1)F)[C@]([C@H](c1ncncc1F)C)(Cn1cncn1)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- J02AC03
- Molecular Formula:
- C16H14F3N5O
- Molecular Weight:
- 349.310
- Log P:
- 2.1769
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 76.72
- CAS Number(s):
- 137234-62-9; 188416-29-7
Synonym(s)
1.
Voriconazole
2.
UK 109,496
3.
UK 109496
4.
UK-109,496
5.
UK-109496
6.
Vfend
7.
UK109,496
8.
UK109496
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 172 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Pneumonia | FAERS: 108 | 19148589 | CTD SIDER US FAERS |
| 3 | Disease Progression | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Visual Impairment | FAERS: 98 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 5 | Malaise | FAERS: 96 | SIDER US FAERS | |
| 6 | Periostitis | FAERS: 73 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 7 | Drug level increased | FAERS: 61 | US FAERS | |
| 8 | Dizziness | FAERS: 52 | SIDER US FAERS | |
| 9 | Respiratory Failure | FAERS: 52 | OFFSIDES US FAERS | |
| 10 | Nausea | FAERS: 50 | SIDER US FAERS | |
| 11 | Photophobia | FAERS: 45 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 44 | SIDER US FAERS | |
| 13 | Product use issue | FAERS: 41 | US FAERS | |
| 14 | Infection | FAERS: 37 | OFFSIDES SIDER US FAERS | |
| 15 | Altered state of consciousness | FAERS: 36 | US FAERS | |
| 16 | Headache | FAERS: 35 | SIDER US FAERS | |
| 17 | Sepsis | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 18 | Squamous cell carcinoma | FAERS: 35 | SIDER US FAERS | |
| 19 | Blindness | FAERS: 33 | US FAERS | |
| 20 | Drug resistance | FAERS: 32 | OFFSIDES US FAERS | |
| 21 | treatment failure | FAERS: 32 | US FAERS | |
| 22 | Arthralgia | FAERS: 31 | SIDER US FAERS | |
| 23 | Bone pain | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Aspergillosis | FAERS: 29 | CTD OFFSIDES US FAERS | |
| 25 | Mental status changes | FAERS: 29 | US FAERS | |
| 26 | Weight decreased | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Myalgia | FAERS: 28 | SIDER US FAERS | |
| 28 | Product use in unapproved indication | FAERS: 28 | US FAERS | |
| 29 | Drug level below therapeutic | FAERS: 26 | US FAERS | |
| 30 | Drug level decreased | FAERS: 26 | US FAERS | |
| 31 | Bronchopulmonary Aspergillosis | FAERS: 25 | US FAERS | |
| 32 | Erythema | FAERS: 25 | SIDER US FAERS | |
| 33 | Hepatotoxicity | FAERS: 25 | OFFSIDES US FAERS | |
| 34 | Vomiting | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Delirium | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Pain | FAERS: 23 | 15642862 19457596 | CTD SIDER US FAERS |
| 37 | Pathogen resistance | FAERS: 23 | OFFSIDES US FAERS | |
| 38 | nervous system disorder | FAERS: 23 | SIDER US FAERS | |
| 39 | Fatigue | FAERS: 22 | US FAERS | |
| 40 | No adverse event | FAERS: 22 | US FAERS | |
| 41 | Rhabdomyolysis | FAERS: 21 | 16410267 | CTD OFFSIDES US FAERS |
| 42 | Aspartate Aminotransferase Increased | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 43 | Cheilitis | FAERS: 20 | SIDER US FAERS | |
| 44 | Disease recurrence | FAERS: 20 | US FAERS | |
| 45 | Feeling abnormal | FAERS: 20 | SIDER US FAERS | |
| 46 | General physical health deterioration | FAERS: 20 | US FAERS | |
| 47 | Mucormycosis | FAERS: 20 | US FAERS | |
| 48 | Pruritus | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Somnolence | FAERS: 20 | SIDER US FAERS | |
| 50 | Visual disturbance | FAERS: 20 | SIDER US FAERS | |
| 51 | Actinic keratosis | FAERS: 19 | US FAERS | |
| 52 | Alopecia | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Drug level above therapeutic | FAERS: 19 | US FAERS | |
| 54 | Tremor | FAERS: 19 | SIDER US FAERS | |
| 55 | Gamma-Glutamyltransferase Increased | FAERS: 18 | OFFSIDES US FAERS | |
| 56 | Septic Shock | FAERS: 18 | OFFSIDES US FAERS | |
| 57 | Zygomycosis | FAERS: 18 | US FAERS | |
| 58 | Dyschromatopsia | FAERS: 17 | US FAERS | |
| 59 | Memory impairment | FAERS: 17 | US FAERS | |
| 60 | Neutropenia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Squamous cell carcinoma of skin | FAERS: 17 | US FAERS | |
| 62 | Agitation | FAERS: 16 | SIDER US FAERS | |
| 63 | Alanine Aminotransferase Increased | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 64 | Cerebrovascular accident | FAERS: 16 | SIDER US FAERS | |
| 65 | Hypersensitivity | FAERS: 16 | SIDER US FAERS | |
| 66 | Cholestasis | FAERS: 15 | SIDER US FAERS | |
| 67 | Chromatopsia | FAERS: 15 | SIDER US FAERS | |
| 68 | Influenza | FAERS: 15 | SIDER US FAERS | |
| 69 | Transaminases increased | FAERS: 15 | OFFSIDES US FAERS | |
| 70 | Xanthopsia | FAERS: 15 | US FAERS | |
| 71 | Abdominal discomfort | FAERS: 14 | US FAERS | |
| 72 | Agranulocytosis | FAERS: 14 | SIDER US FAERS | |
| 73 | Anxiety | FAERS: 14 | SIDER US FAERS | |
| 74 | Back Pain | FAERS: 14 | SIDER US FAERS | |
| 75 | Blood alkaline phosphatase increased | FAERS: 14 | SIDER US FAERS | |
| 76 | Fluoride increased | FAERS: 14 | US FAERS | |
| 77 | Impaired driving ability | FAERS: 14 | US FAERS | |
| 78 | Polyneuropathy | FAERS: 14 | OFFSIDES US FAERS | |
| 79 | Cardiac Arrest | FAERS: 13 | SIDER US FAERS | |
| 80 | Drug effect incomplete | FAERS: 13 | US FAERS | |
| 81 | Retinal toxicity | FAERS: 13 | SIDER US FAERS | |
| 82 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 83 | Chest Pain | FAERS: 11 | SIDER US FAERS | |
| 84 | Diplopia | FAERS: 11 | SIDER US FAERS | |
| 85 | Lymphoma | FAERS: 11 | OFFSIDES US FAERS | |
| 86 | Myocardial Infarction | FAERS: 11 | SIDER US FAERS | |
| 87 | Thrombocytopenia | FAERS: 11 | SIDER US FAERS | |
| 88 | Disorientation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Febrile Neutropenia | FAERS: 10 | OFFSIDES US FAERS | |
| 90 | Ileus | FAERS: 10 | US FAERS | |
| 91 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 92 | Pancreatitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 93 | White blood cell count decreased | FAERS: 10 | US FAERS | |
| 94 | Acute kidney injury | FAERS: 9 Canada Vigilance: 1 | 16410267 | CTD Canada Vigilance US FAERS |
| 95 | Basal cell carcinoma | FAERS: 9 | US FAERS | |
| 96 | Cellulitis | FAERS: 9 | SIDER US FAERS | |
| 97 | Constipation | FAERS: 9 | SIDER US FAERS | |
| 98 | Dehydration | FAERS: 9 | US FAERS | |
| 99 | Depressed Level of Consciousness | FAERS: 9 | OFFSIDES US FAERS | |
| 100 | Drug dose omission | FAERS: 9 | US FAERS | |
| 101 | Epilepsy | FAERS: 9 | US FAERS | |
| 102 | Hypotension | FAERS: 9 | SIDER US FAERS | |
| 103 | Intentional product use issue | FAERS: 9 | US FAERS | |
| 104 | MYELODYSPLASTIC SYNDROME | FAERS: 9 | US FAERS | |
| 105 | Peripheral swelling | FAERS: 9 | US FAERS | |
| 106 | Productive Cough | FAERS: 9 | US FAERS | |
| 107 | Pseudoporphyria | FAERS: 9 | SIDER US FAERS | |
| 108 | Scedosporium infection | FAERS: 9 | US FAERS | |
| 109 | Solar dermatitis | FAERS: 9 | US FAERS | |
| 110 | Therapeutic response unexpected | FAERS: 9 | US FAERS | |
| 111 | Thrombosis | FAERS: 9 | US FAERS | |
| 112 | Abdominal Pain | FAERS: 8 | SIDER US FAERS | |
| 113 | Aspergillus test positive | FAERS: 8 | US FAERS | |
| 114 | Blood creatinine increased | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 115 | Burning sensation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Candidiasis | FAERS: 8 | 17653912 18627469 | CTD US FAERS |
| 117 | Deafness | FAERS: 8 | SIDER US FAERS | |
| 118 | Dyspepsia | FAERS: 8 | SIDER US FAERS | |
| 119 | Hypoxia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 120 | Lentigo | FAERS: 8 | US FAERS | |
| 121 | Macular opacity | FAERS: 8 | US FAERS | |
| 122 | Stem cell transplant | FAERS: 8 | OFFSIDES US FAERS | |
| 123 | Atrial Fibrillation | FAERS: 7 | SIDER US FAERS | |
| 124 | Blood creatine phosphokinase increased | FAERS: 7 | SIDER US FAERS | |
| 125 | Bradycardia | FAERS: 7 | 15472801 | CTD SIDER US FAERS |
| 126 | Dental caries | FAERS: 7 | US FAERS | |
| 127 | Drug administration error | FAERS: 7 | US FAERS | |
| 128 | Joint swelling | FAERS: 7 | US FAERS | |
| 129 | Overdose | FAERS: 7 | US FAERS | |
| 130 | Pericardial effusion | FAERS: 7 | OFFSIDES US FAERS | |
| 131 | Porphyria non-acute | FAERS: 7 | US FAERS | |
| 132 | Restlessness | FAERS: 7 | US FAERS | |
| 133 | Skin lesion | FAERS: 7 | SIDER US FAERS | |
| 134 | Adverse event | FAERS: 6 | US FAERS | |
| 135 | Aspergilloma | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Bacterial sepsis | FAERS: 6 | US FAERS | |
| 137 | Blood albumin decreased | FAERS: 6 | US FAERS | |
| 138 | Complications of transplant surgery | FAERS: 6 | OFFSIDES US FAERS | |
| 139 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 140 | Dry skin | FAERS: 6 | SIDER US FAERS | |
| 141 | Dysgeusia | FAERS: 6 | SIDER US FAERS | |
| 142 | Medication Error | FAERS: 6 | US FAERS | |
| 143 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 144 | Palpitations | FAERS: 6 | SIDER US FAERS | |
| 145 | Pneumothorax | FAERS: 6 | OFFSIDES US FAERS | |
| 146 | Pulmonary Embolism | FAERS: 6 | SIDER US FAERS | |
| 147 | Pulmonary function test decreased | FAERS: 6 | US FAERS | |
| 148 | Tachycardia | FAERS: 6 | SIDER US FAERS | |
| 149 | Tuberculosis | FAERS: 6 | US FAERS | |
| 150 | Unevaluable event | FAERS: 6 | US FAERS | |
| 151 | Blood count abnormal | FAERS: 5 | US FAERS | |
| 152 | Bowen's Disease | FAERS: 5 | OFFSIDES US FAERS | |
| 153 | Bronchitis | FAERS: 5 | US FAERS | |
| 154 | Cachexia | FAERS: 5 | US FAERS | |
| 155 | Chloropsia | FAERS: 5 | US FAERS | |
| 156 | Choking | FAERS: 5 | US FAERS | |
| 157 | Hallucinations, mixed | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Hyperkeratosis | FAERS: 5 | US FAERS | |
| 159 | Incoherent | FAERS: 5 | US FAERS | |
| 160 | Lung transplant rejection | FAERS: 5 | US FAERS | |
| 161 | Malignant neoplasm progression | FAERS: 5 | OFFSIDES US FAERS | |
| 162 | Metamorphopsia | FAERS: 5 | US FAERS | |
| 163 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 164 | Neck Pain | FAERS: 5 | US FAERS | |
| 165 | Nephrotic Syndrome | FAERS: 5 | SIDER US FAERS | |
| 166 | Osteomyelitis | FAERS: 5 | US FAERS | |
| 167 | Prescribed overdose | FAERS: 5 | US FAERS | |
| 168 | Respiratory distress | FAERS: 5 | SIDER US FAERS | |
| 169 | Stevens-Johnson Syndrome | FAERS: 5 Canada Vigilance: 2 | 25811541 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 170 | Stomatitis | FAERS: 5 | SIDER US FAERS | |
| 171 | Sunburn | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Swelling | FAERS: 5 | US FAERS | |
| 173 | Syncope | FAERS: 5 | SIDER US FAERS | |
| 174 | Transplant | FAERS: 5 | US FAERS | |
| 175 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 176 | Arthropathy | FAERS: 4 | US FAERS | |
| 177 | Bedridden | FAERS: 4 | OFFSIDES US FAERS | |
| 178 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 179 | Blood potassium abnormal | FAERS: 4 | US FAERS | |
| 180 | Blood potassium decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 181 | Cataract | FAERS: 4 | US FAERS | |
| 182 | Cholecystitis | FAERS: 4 | SIDER US FAERS | |
| 183 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 184 | Dysarthria | FAERS: 4 | US FAERS | |
| 185 | Erythropsia | FAERS: 4 | US FAERS | |
| 186 | Eye Infection | FAERS: 4 | US FAERS | |
| 187 | Glomerulonephritis | FAERS: 4 | OFFSIDES US FAERS | |
| 188 | Hydrothorax | FAERS: 4 | US FAERS | |
| 189 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 190 | Lemierre Syndrome | FAERS: 4 | US FAERS | |
| 191 | Leukopenia | FAERS: 4 | SIDER US FAERS | |
| 192 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 193 | Malabsorption | FAERS: 4 | US FAERS | |
| 194 | Muscle tightness | FAERS: 4 | US FAERS | |
| 195 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 196 | Necrosis | FAERS: 4 | US FAERS | |
| 197 | Nervousness | FAERS: 4 | US FAERS | |
| 198 | Neuralgia | FAERS: 4 | SIDER US FAERS | |
| 199 | Oropharyngeal pain | FAERS: 4 | SIDER US FAERS | |
| 200 | Pancytopenia | FAERS: 4 | SIDER US FAERS | |
| 201 | Periarthritis | FAERS: 4 | US FAERS | |
| 202 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 203 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 204 | Pulmonary Hypertension | FAERS: 4 | US FAERS | |
| 205 | Rash erythematous | FAERS: 4 | US FAERS | |
| 206 | Sudden death | FAERS: 4 | US FAERS | |
| 207 | Tinnitus | FAERS: 4 | SIDER US FAERS | |
| 208 | jaundice | FAERS: 4 | SIDER US FAERS | |
| 209 | Ammonia increased | FAERS: 3 | US FAERS | |
| 210 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 211 | Angioedema | FAERS: 3 | SIDER US FAERS | |
| 212 | Anorexia | FAERS: 3 | SIDER US FAERS | |
| 213 | Aphasia | FAERS: 3 | US FAERS | |
| 214 | Capillary Leak Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 215 | Cerebral aspergillosis | FAERS: 3 | US FAERS | |
| 216 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 217 | Chest discomfort | FAERS: 3 | SIDER US FAERS | |
| 218 | Chromaturia | FAERS: 3 | US FAERS | |
| 219 | Creatinine renal clearance decreased | FAERS: 3 | SIDER US FAERS | |
| 220 | Device related infection | FAERS: 3 | US FAERS | |
| 221 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 222 | Drug effect delayed | FAERS: 3 | US FAERS | |
| 223 | Dysphonia | FAERS: 3 | US FAERS | |
| 224 | Encephalitis | FAERS: 3 | SIDER US FAERS | |
| 225 | Eosinophilia | FAERS: 3 | SIDER US FAERS | |
| 226 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 227 | Exophthalmos | FAERS: 3 | US FAERS | |
| 228 | Eye pain | FAERS: 3 | SIDER US FAERS | |
| 229 | Facial Pain | FAERS: 3 | US FAERS | |
| 230 | Feeling jittery | FAERS: 3 | US FAERS | |
| 231 | Flushing | FAERS: 3 | SIDER US FAERS | |
| 232 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 233 | Gait inability | FAERS: 3 | US FAERS | |
| 234 | Glaucoma | FAERS: 3 | US FAERS | |
| 235 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 236 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 237 | Leukocytosis | FAERS: 3 | US FAERS | |
| 238 | Lip swelling | FAERS: 3 | US FAERS | |
| 239 | Lower respiratory tract infection viral | FAERS: 3 | US FAERS | |
| 240 | Lymphadenopathy | FAERS: 3 | SIDER US FAERS | |
| 241 | MELAS Syndrome | FAERS: 3 | US FAERS | |
| 242 | Meningitis | FAERS: 3 | US FAERS | |
| 243 | Mental impairment | FAERS: 3 | US FAERS | |
| 244 | Myasthenia Gravis | FAERS: 3 | US FAERS | |
| 245 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 246 | Pneumonitis | FAERS: 3 | US FAERS | |
| 247 | Post procedural complication | FAERS: 3 | US FAERS | |
| 248 | Product quality issue | FAERS: 3 | US FAERS | |
| 249 | Prurigo | FAERS: 3 | US FAERS | |
| 250 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 251 | Retinal Vein Occlusion | FAERS: 3 | US FAERS | |
| 252 | Retinal exudates | FAERS: 3 | US FAERS | |
| 253 | Shock | FAERS: 3 | SIDER US FAERS | |
| 254 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 255 | Skin discomfort | FAERS: 3 | US FAERS | |
| 256 | Skin reaction | FAERS: 3 | US FAERS | |
| 257 | Skin tightness | FAERS: 3 | US FAERS | |
| 258 | Skin toxicity | FAERS: 3 | US FAERS | |
| 259 | Solar lentigo | FAERS: 3 | US FAERS | |
| 260 | Toxic Epidermal Necrolysis | FAERS: 3 | SIDER US FAERS | |
| 261 | Tracheobronchitis | FAERS: 3 | US FAERS | |
| 262 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 263 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 264 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 265 | Acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 266 | Acquired Immunodeficiency Syndrome | FAERS: 2 | US FAERS | |
| 267 | Ageusia | FAERS: 2 | SIDER US FAERS | |
| 268 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 269 | Amaurosis | FAERS: 2 | US FAERS | |
| 270 | Amnesia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 271 | Anoxia | FAERS: 2 | US FAERS | |
| 272 | Apathy | FAERS: 2 | US FAERS | |
| 273 | Aphonia | FAERS: 2 | US FAERS | |
| 274 | Apparent death | FAERS: 2 | US FAERS | |
| 275 | Asthenopia | FAERS: 2 | US FAERS | |
| 276 | Asthma | FAERS: 2 | US FAERS | |
| 277 | Ataxia | FAERS: 2 | SIDER US FAERS | |
| 278 | Atrial Flutter | FAERS: 2 | OFFSIDES US FAERS | |
| 279 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 280 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 281 | Bronchospasm | FAERS: 2 | US FAERS | |
| 282 | Carcinoma | FAERS: 2 | US FAERS | |
| 283 | Cell Death | FAERS: 2 | US FAERS | |
| 284 | Chills | FAERS: 2 | SIDER US FAERS | |
| 285 | Cholelithiasis | FAERS: 2 | SIDER US FAERS | |
| 286 | Conversion disorder | FAERS: 2 | US FAERS | |
| 287 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 288 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 289 | Dementia | FAERS: 2 | SIDER US FAERS | |
| 290 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 291 | Dermatomyositis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Diabetes Insipidus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 293 | Disseminated Intravascular Coagulation | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 294 | Drug level changed | FAERS: 2 | US FAERS | |
| 295 | Drug level fluctuating | FAERS: 2 | US FAERS | |
| 296 | Drug toxicity | FAERS: 2 | US FAERS | |
| 297 | Eczema | FAERS: 2 | SIDER US FAERS | |
| 298 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 299 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 300 | Embolic stroke | FAERS: 2 | US FAERS | |
| 301 | Emotional disorder | FAERS: 2 | US FAERS | |
| 302 | Enterococcal infection | FAERS: 2 | US FAERS | |
| 303 | Epstein-Barr virus test positive | FAERS: 2 | US FAERS | |
| 304 | Expired product administered | FAERS: 2 | US FAERS | |
| 305 | Extremity necrosis | FAERS: 2 | US FAERS | |
| 306 | Eye Burns | FAERS: 2 | US FAERS | |
| 307 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 308 | Hemiparesis | FAERS: 2 | US FAERS | |
| 309 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 310 | Hypercapnia | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Hypokinesia | FAERS: 2 | US FAERS | |
| 312 | Impaired work ability | FAERS: 2 | US FAERS | |
| 313 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 314 | Inflammation | FAERS: 2 | SIDER US FAERS | |
| 315 | Infusion site erythema | FAERS: 2 | US FAERS | |
| 316 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 317 | Iritis | FAERS: 2 | US FAERS | |
| 318 | Joint injury | FAERS: 2 | US FAERS | |
| 319 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 320 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 321 | Leukoencephalopathy | FAERS: 2 | OFFSIDES US FAERS | |
| 322 | Limb discomfort | FAERS: 2 | US FAERS | |
| 323 | Liver Abscess | FAERS: 2 | US FAERS | |
| 324 | Lower respiratory tract infection bacterial | FAERS: 2 | US FAERS | |
| 325 | Macular degeneration | FAERS: 2 | US FAERS | |
| 326 | Mental disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 327 | Metabolic acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 328 | Monoplegia | FAERS: 2 | US FAERS | |
| 329 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 330 | Mycobacterium abscessus Infection | FAERS: 2 | US FAERS | |
| 331 | Mydriasis | FAERS: 2 | SIDER US FAERS | |
| 332 | Myocardial necrosis marker increased | FAERS: 2 | US FAERS | |
| 333 | Myositis | FAERS: 2 | US FAERS | |
| 334 | Nerve injury | FAERS: 2 | US FAERS | |
| 335 | Night sweats | FAERS: 2 | US FAERS | |
| 336 | Oliguria | FAERS: 2 | SIDER US FAERS | |
| 337 | Onycholysis | FAERS: 2 | US FAERS | |
| 338 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 339 | Optic Neuritis | FAERS: 2 | SIDER US FAERS | |
| 340 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 341 | Osteitis Deformans | FAERS: 2 | US FAERS | |
| 342 | Osteosclerosis | FAERS: 2 | US FAERS | |
| 343 | Pharyngitis | FAERS: 2 | SIDER US FAERS | |
| 344 | Pleurisy | FAERS: 2 | US FAERS | |
| 345 | Polyomavirus-associated nephropathy | FAERS: 2 | US FAERS | |
| 346 | Pre-existing condition improved | FAERS: 2 | US FAERS | |
| 347 | Precancerous skin lesion | FAERS: 2 | US FAERS | |
| 348 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 349 | Product contamination | FAERS: 2 | US FAERS | |
| 350 | Protein total decreased | FAERS: 2 | US FAERS | |
| 351 | Prothrombin level decreased | FAERS: 2 | US FAERS | |
| 352 | Pseudomonal sepsis | FAERS: 2 | US FAERS | |
| 353 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 354 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 355 | Pupillary light reflex tests abnormal | FAERS: 2 | US FAERS | |
| 356 | Red man syndrome | FAERS: 2 | US FAERS | |
| 357 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 358 | Scleritis | FAERS: 2 | SIDER US FAERS | |
| 359 | Scopulariopsis infection | FAERS: 2 | US FAERS | |
| 360 | Skin irritation | FAERS: 2 | US FAERS | |
| 361 | Sleep Talking | FAERS: 2 | US FAERS | |
| 362 | Supraventricular tachycardia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 363 | Therapy partial responder | FAERS: 2 | US FAERS | |
| 364 | Thermal burn | FAERS: 2 | US FAERS | |
| 365 | Urinary Retention | FAERS: 2 | SIDER US FAERS | |
| 366 | Urticaria | FAERS: 2 | SIDER US FAERS | |
| 367 | Ventricular Fibrillation | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 368 | Wheezing | FAERS: 2 | US FAERS | |
| 369 | White blood cell count abnormal | FAERS: 2 | US FAERS | |
| 370 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 371 | Abasia | FAERS: 1 | OFFSIDES US FAERS | |
| 372 | Abscess | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 373 | Acanthamoeba Infection | FAERS: 1 | US FAERS | |
| 374 | Accidental overdose | FAERS: 1 | US FAERS | |
| 375 | Acquired night blindness | FAERS: 1 | US FAERS | |
| 376 | Acquired porphyria | FAERS: 1 | US FAERS | |
| 377 | Adenosquamous cell lung cancer | FAERS: 1 | US FAERS | |
| 378 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 379 | Alternaria infection | FAERS: 1 | US FAERS | |
| 380 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 381 | Amputation | FAERS: 1 | US FAERS | |
| 382 | Amyloidosis | FAERS: 1 | US FAERS | |
| 383 | Anal Fissure | FAERS: 1 | US FAERS | |
| 384 | Anal Fistula | FAERS: 1 | US FAERS | |
| 385 | Anger | FAERS: 1 | US FAERS | |
| 386 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 387 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 388 | Antibiotic level below therapeutic | FAERS: 1 | US FAERS | |
| 389 | Anuria | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 390 | Aortitis | FAERS: 1 | US FAERS | |
| 391 | Arthritis | FAERS: 1 | SIDER US FAERS | |
| 392 | Ascites | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 393 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 394 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 395 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 396 | Back disorder | FAERS: 1 | US FAERS | |
| 397 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 398 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 399 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 400 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 401 | Bladder pain | FAERS: 1 | US FAERS | |
| 402 | Blepharitis | FAERS: 1 | SIDER US FAERS | |
| 403 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 404 | Blood beta-D-glucan abnormal | FAERS: 1 | US FAERS | |
| 405 | Blood beta-D-glucan increased | FAERS: 1 | OFFSIDES US FAERS | |
| 406 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 407 | Blood blister | FAERS: 1 | US FAERS | |
| 408 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 409 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 410 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 411 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 412 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 413 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 414 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 415 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 416 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 417 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 418 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 419 | Bone abscess | FAERS: 1 | US FAERS | |
| 420 | Bone formation decreased | FAERS: 1 | US FAERS | |
| 421 | Bone lesion | FAERS: 1 | US FAERS | |
| 422 | Bone marrow transplant rejection | FAERS: 1 | US FAERS | |
| 423 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 424 | Brain Abscess | FAERS: 1 | US FAERS | |
| 425 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 426 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 427 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 428 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 429 | Bronchoscopy abnormal | FAERS: 1 | US FAERS | |
| 430 | Candida sepsis | FAERS: 1 | US FAERS | |
| 431 | Carcinogenicity | FAERS: 1 | US FAERS | |
| 432 | Cardiac Death | FAERS: 1 | US FAERS | |
| 433 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 434 | Cardiomyopathy acute | FAERS: 1 | US FAERS | |
| 435 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 436 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 437 | Chemotherapy | FAERS: 1 | US FAERS | |
| 438 | Cholangitis | FAERS: 1 | US FAERS | |
| 439 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 440 | Choroidal dystrophy | FAERS: 1 | US FAERS | |
| 441 | Chronic granulomatous disease | FAERS: 1 | OFFSIDES US FAERS | |
| 442 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 443 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 444 | Coccidioidomycosis | FAERS: 1 | OFFSIDES US FAERS | |
| 445 | Cold sweat | FAERS: 1 | US FAERS | |
| 446 | Colitis | FAERS: 1 | US FAERS | |
| 447 | Completed Suicide | FAERS: 1 | US FAERS | |
| 448 | Complications of bone marrow transplant | FAERS: 1 | US FAERS | |
| 449 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 450 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 451 | Critical Illness | FAERS: 1 | US FAERS | |
| 452 | Crying | FAERS: 1 | US FAERS | |
| 453 | Cyanopsia | FAERS: 1 | US FAERS | |
| 454 | Cyanosis | FAERS: 1 | SIDER US FAERS | |
| 455 | Cytokine storm | FAERS: 1 | US FAERS | |
| 456 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 457 | Delirium febrile | FAERS: 1 | US FAERS | |
| 458 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 459 | Dependence | FAERS: 1 | US FAERS | |
| 460 | Depressed mood | FAERS: 1 | US FAERS | |
| 461 | Diplegia | FAERS: 1 | US FAERS | |
| 462 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 463 | Diverticulitis | FAERS: 1 | US FAERS | |
| 464 | Drug abuse | FAERS: 1 | US FAERS | |
| 465 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 466 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 467 | Dysuria | FAERS: 1 | SIDER US FAERS | |
| 468 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 469 | Ectopic Pregnancy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 470 | Embolism | FAERS: 1 | US FAERS | |
| 471 | Emotional distress | FAERS: 1 | US FAERS | |
| 472 | Empyema | FAERS: 1 | OFFSIDES US FAERS | |
| 473 | Endophthalmitis | FAERS: 1 | OFFSIDES US FAERS | |
| 474 | Enteritis | FAERS: 1 | US FAERS | |
| 475 | Enterobacter pneumonia | FAERS: 1 | US FAERS | |
| 476 | Erectile dysfunction | FAERS: 1 | SIDER US FAERS | |
| 477 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 478 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 479 | Euphoric mood | FAERS: 1 | SIDER US FAERS | |
| 480 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 481 | Extra dose administered | FAERS: 1 | US FAERS | |
| 482 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 483 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 484 | Folliculitis | FAERS: 1 | US FAERS | |
| 485 | Formication | FAERS: 1 | US FAERS | |
| 486 | Fracture | FAERS: 1 | US FAERS | |
| 487 | Fungal peritonitis | FAERS: 1 | US FAERS | |
| 488 | Fungal retinitis | FAERS: 1 | US FAERS | |
| 489 | Fungal test positive | FAERS: 1 | OFFSIDES US FAERS | |
| 490 | Fungus sputum test positive | FAERS: 1 | US FAERS | |
| 491 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 492 | Gastric ulcer | FAERS: 1 | SIDER US FAERS | |
| 493 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 494 | Gastroenteritis | FAERS: 1 | SIDER US FAERS | |
| 495 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 496 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 497 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 498 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 499 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 500 | Glossitis | FAERS: 1 | SIDER US FAERS | |
| 501 | Glycosuria | FAERS: 1 | SIDER US FAERS | |
| 502 | Guillain-Barre Syndrome | FAERS: 1 | SIDER US FAERS | |
| 503 | Hemiplegia | FAERS: 1 | US FAERS | |
| 504 | Hepatic candidiasis | FAERS: 1 | US FAERS | |
| 505 | Hepatitis | FAERS: 1 | SIDER US FAERS | |
| 506 | Hepatomegaly | FAERS: 1 | SIDER US FAERS | |
| 507 | Histiocytosis haematophagic | FAERS: 1 | OFFSIDES US FAERS | |
| 508 | Hostility | FAERS: 1 | US FAERS | |
| 509 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 510 | Hypertrophic osteoarthropathy | FAERS: 1 | US FAERS | |
| 511 | Hyperventilation | FAERS: 1 | US FAERS | |
| 512 | Hypothyroidism | FAERS: 1 | SIDER US FAERS | |
| 513 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 514 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 515 | Immune reconstitution syndrome | FAERS: 1 | US FAERS | |
| 516 | Immunosuppression | FAERS: 1 | US FAERS | |
| 517 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 518 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 519 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 520 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 521 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 522 | Infarction | FAERS: 1 | US FAERS | |
| 523 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 524 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 525 | Infusion site infection | FAERS: 1 | US FAERS | |
| 526 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 527 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 528 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 529 | Intussusception | FAERS: 1 | US FAERS | |
| 530 | Joint abscess | FAERS: 1 | US FAERS | |
| 531 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 532 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 533 | Laryngitis | FAERS: 1 | US FAERS | |
| 534 | Lethargy | FAERS: 1 | US FAERS | |
| 535 | Limb mass | FAERS: 1 | US FAERS | |
| 536 | Lip neoplasm malignant stage unspecified | FAERS: 1 | US FAERS | |
| 537 | Lipase increased | FAERS: 1 | US FAERS | |
| 538 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 539 | Lung adenocarcinoma recurrent | FAERS: 1 | US FAERS | |
| 540 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 541 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 542 | Macular pigmentation | FAERS: 1 | US FAERS | |
| 543 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 544 | Mastoiditis | FAERS: 1 | US FAERS | |
| 545 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 546 | Mucosal necrosis | FAERS: 1 | US FAERS | |
| 547 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 548 | Muscle strain | FAERS: 1 | US FAERS | |
| 549 | Mycobacterium kansasii pneumonia | FAERS: 1 | US FAERS | |
| 550 | Myelitis | FAERS: 1 | US FAERS | |
| 551 | Myocarditis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 552 | Myoclonus | FAERS: 1 | US FAERS | |
| 553 | Myopia | FAERS: 1 | US FAERS | |
| 554 | Nail Infection | FAERS: 1 | US FAERS | |
| 555 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 556 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 557 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 558 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 559 | Neuropathy | FAERS: 1 | SIDER US FAERS | |
| 560 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 561 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 562 | Nipple pain | FAERS: 1 | US FAERS | |
| 563 | No adverse effect | FAERS: 1 | US FAERS | |
| 564 | Nystagmus | FAERS: 1 | SIDER US FAERS | |
| 565 | Obesity | FAERS: 1 | US FAERS | |
| 566 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 567 | Opisthotonus | FAERS: 1 | US FAERS | |
| 568 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 569 | Oral pain | FAERS: 1 | US FAERS | |
| 570 | Osteolysis | FAERS: 1 | US FAERS | |
| 571 | Osteopenia | FAERS: 1 | US FAERS | |
| 572 | PO2 decreased | FAERS: 1 | US FAERS | |
| 573 | Pain of skin | FAERS: 1 | US FAERS | |
| 574 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 575 | Papule | FAERS: 1 | US FAERS | |
| 576 | Paranoia | FAERS: 1 | US FAERS | |
| 577 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 578 | Parophthalmia | FAERS: 1 | US FAERS | |
| 579 | Parotid gland inflammation | FAERS: 1 | US FAERS | |
| 580 | Peritonitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 581 | Personality Change | FAERS: 1 | US FAERS | |
| 582 | Petechiae | FAERS: 1 | SIDER US FAERS | |
| 583 | Photodermatosis | FAERS: 1 | US FAERS | |
| 584 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 585 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 586 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 587 | Polyuria | FAERS: 1 | US FAERS | |
| 588 | Pregnancy | FAERS: 1 | US FAERS | |
| 589 | Primary Adrenal Insufficiency | FAERS: 1 | US FAERS | |
| 590 | Procedural complication | FAERS: 1 | US FAERS | |
| 591 | Procedural hypertension | FAERS: 1 | US FAERS | |
| 592 | Product container issue | FAERS: 1 | US FAERS | |
| 593 | Product counterfeit | FAERS: 1 | US FAERS | |
| 594 | Product lot number issue | FAERS: 1 | US FAERS | |
| 595 | Product packaging issue | FAERS: 1 | US FAERS | |
| 596 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 597 | Pulmonary congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 598 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 599 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 600 | Quadriparesis | FAERS: 1 | US FAERS | |
| 601 | Rales | FAERS: 1 | US FAERS | |
| 602 | Rash scaly | FAERS: 1 | US FAERS | |
| 603 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 604 | Renal cell carcinoma recurrent | FAERS: 1 | US FAERS | |
| 605 | Renal pain | FAERS: 1 | SIDER US FAERS | |
| 606 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 607 | Respiratory fatigue | FAERS: 1 | US FAERS | |
| 608 | Respiratory syncytial virus bronchitis | FAERS: 1 | US FAERS | |
| 609 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 610 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 611 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 612 | Retinal phototoxicity | FAERS: 1 | US FAERS | |
| 613 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 614 | Salpingitis | FAERS: 1 | US FAERS | |
| 615 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 616 | Scab | FAERS: 1 | US FAERS | |
| 617 | Schizophrenia | FAERS: 1 | US FAERS | |
| 618 | Sciatica | FAERS: 1 | US FAERS | |
| 619 | Shock symptom | FAERS: 1 | US FAERS | |
| 620 | Sinus operation | FAERS: 1 | US FAERS | |
| 621 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 622 | Sitting disability | FAERS: 1 | US FAERS | |
| 623 | Skin Induration | FAERS: 1 | US FAERS | |
| 624 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 625 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 626 | Skin necrosis | FAERS: 1 | US FAERS | |
| 627 | Sluggishness | FAERS: 1 | US FAERS | |
| 628 | Splenomegaly | FAERS: 1 | SIDER US FAERS | |
| 629 | Sputum retention | FAERS: 1 | US FAERS | |
| 630 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 631 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 632 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 633 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 634 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 635 | Teeth brittle | FAERS: 1 | US FAERS | |
| 636 | Tension | FAERS: 1 | US FAERS | |
| 637 | Therapy cessation | FAERS: 1 | US FAERS | |
| 638 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 639 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 640 | Thirst | FAERS: 1 | US FAERS | |
| 641 | Tonsillitis | FAERS: 1 | US FAERS | |
| 642 | Tracheal mass | FAERS: 1 | US FAERS | |
| 643 | Traumatic lumbar puncture | FAERS: 1 | US FAERS | |
| 644 | Trichosporon infection | FAERS: 1 | US FAERS | |
| 645 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 646 | Ulcer | FAERS: 1 | US FAERS | |
| 647 | Umbilical discharge | FAERS: 1 | US FAERS | |
| 648 | Urinary Incontinence | FAERS: 1 | SIDER US FAERS | |
| 649 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 650 | Urinary tract infection | FAERS: 1 | SIDER US FAERS | |
| 651 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 652 | Urine output increased | FAERS: 1 | US FAERS | |
| 653 | Urticarial vasculitis | FAERS: 1 | US FAERS | |
| 654 | Uveitis | FAERS: 1 | SIDER US FAERS | |
| 655 | VIth nerve paresis | FAERS: 1 | US FAERS | |
| 656 | Venoocclusive disease | FAERS: 1 | US FAERS | |
| 657 | Ventricular arrhythmia | FAERS: 1 | SIDER US FAERS | |
| 658 | Visual acuity tests abnormal | FAERS: 1 | US FAERS | |
| 659 | Visual brightness | FAERS: 1 | US FAERS | |
| 660 | Vitritis | FAERS: 1 | US FAERS | |
| 661 | Walking aid user | FAERS: 1 | US FAERS | |
| 662 | Wheelchair user | FAERS: 1 | US FAERS | |
| 663 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 664 | Abnormal vision | SIDER | ||
| 665 | Acute Coronary Syndrome | SIDER | ||
| 666 | Acute graft versus host disease in liver | OFFSIDES | ||
| 667 | Acute psychosis | OFFSIDES | ||
| 668 | Adrenal cortical hypofunction | SIDER | ||
| 669 | Akathisia | SIDER | ||
| 670 | Albuminuria | SIDER | ||
| 671 | Anaphylactoid Reaction | SIDER | ||
| 672 | Anhedonia | OFFSIDES | ||
| 673 | Anorectal cellulitis | OFFSIDES | ||
| 674 | Antithrombin III decreased | OFFSIDES | ||
| 675 | Antiviral drug level above therapeutic | OFFSIDES | ||
| 676 | Arteriovenous fistula site complication | OFFSIDES | ||
| 677 | Atrial arrhythmia | SIDER | ||
| 678 | Autoimmune hepatitis | OFFSIDES | ||
| 679 | BK virus infection | OFFSIDES | ||
| 680 | Bacterial Endocarditis | OFFSIDES | ||
| 681 | Bicytopenia | OFFSIDES | ||
| 682 | Blighted ovum | SIDER | ||
| 683 | Blood and lymphatic system disorders | SIDER | ||
| 684 | Blood cholesterol increased | SIDER | ||
| 685 | Blood urea increased | OFFSIDES SIDER | ||
| 686 | Blurred vision | OFFSIDES | ||
| 687 | Bone marrow depression | SIDER | ||
| 688 | Bone marrow toxicity | OFFSIDES | ||
| 689 | Bronchiolitis | Canada Vigilance: 1 | Canada Vigilance | |
| 690 | Bronchoalveolar Lavage | OFFSIDES | ||
| 691 | Bronchopulmonary disease | OFFSIDES | ||
| 692 | Carbon dioxide abnormal | OFFSIDES | ||
| 693 | Cardiomegaly | SIDER | ||
| 694 | Catheter site erythema | OFFSIDES | ||
| 695 | Central Nervous System Infection | OFFSIDES | ||
| 696 | Cerebral artery stenosis | OFFSIDES | ||
| 697 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 698 | Chest tightness | SIDER | ||
| 699 | Clostridium difficile colitis | OFFSIDES | ||
| 700 | Color vision change | SIDER | ||
| 701 | Compression fracture | OFFSIDES | ||
| 702 | Confabulation | OFFSIDES | ||
| 703 | Conjunctivitis | SIDER | ||
| 704 | Corneal Opacity | SIDER | ||
| 705 | Cramps of lower extremities | SIDER | ||
| 706 | Creatine Phosphokinase Increased | SIDER | ||
| 707 | Creatinine increased | SIDER | ||
| 708 | Cystitis viral | OFFSIDES | ||
| 709 | Cytomegalovirus test positive | OFFSIDES | ||
| 710 | Dermatitis | SIDER | ||
| 711 | Disturbance in sexual arousal | SIDER | ||
| 712 | Diverticulum | OFFSIDES | ||
| 713 | Drowsiness | OFFSIDES | ||
| 714 | Duodenal ulcer perforation | SIDER | ||
| 715 | Duodenitis | SIDER | ||
| 716 | Ear and labyrinth disorders | SIDER | ||
| 717 | Electrocardiogram QT corrected interval | SIDER | ||
| 718 | Endocarditis | OFFSIDES SIDER | ||
| 719 | Engraft failure | OFFSIDES | ||
| 720 | Enlargement abdomen | SIDER | ||
| 721 | Epidermolysis | OFFSIDES | ||
| 722 | Epididymitis | SIDER | ||
| 723 | Epstein-Barr virus associated lymphoproliferative disorder | OFFSIDES | ||
| 724 | Febrile bone marrow aplasia | OFFSIDES | ||
| 725 | Febrile infection | Canada Vigilance: 1 | Canada Vigilance | |
| 726 | Fibromyalgia | OFFSIDES | ||
| 727 | Fixed drug eruption | SIDER | ||
| 728 | Flank Pain | SIDER | ||
| 729 | Flatulence | SIDER | ||
| 730 | Fluid overload | SIDER | ||
| 731 | Fungemia | 24366741 | CTD | |
| 732 | Furunculosis | SIDER | ||
| 733 | Fusariosis | 22225407 | CTD | |
| 734 | Gingival Hyperplasia | OFFSIDES SIDER | ||
| 735 | Gingivitis | SIDER | ||
| 736 | Granulocyte count decreased | OFFSIDES | ||
| 737 | Granulocytosis | OFFSIDES | ||
| 738 | Granuloma | SIDER | ||
| 739 | Hallucinations | 18574651 19540418 | CTD | |
| 740 | Hepatic Infection | OFFSIDES | ||
| 741 | Herpes NOS | SIDER | ||
| 742 | Hiccough | OFFSIDES | ||
| 743 | Hydrocephalus | OFFSIDES | ||
| 744 | Hydronephrosis | SIDER | ||
| 745 | Hydropneumothorax | OFFSIDES | ||
| 746 | Hypercalcemia | 16263588 | CTD | |
| 747 | Hyperthyroidism | SIDER | ||
| 748 | Hyponatremia | 20567873 | CTD | |
| 749 | Hypopyon | OFFSIDES | ||
| 750 | Hysterectomy | OFFSIDES | ||
| 751 | Infestation | SIDER | ||
| 752 | Influenza-like symptoms | SIDER | ||
| 753 | Injection Site Reaction | SIDER | ||
| 754 | Injection site infection | SIDER | ||
| 755 | Injection site pain | SIDER | ||
| 756 | Intestinal Perforation | SIDER | ||
| 757 | Invasive Pulmonary Aspergillosis | 19011270 | CTD | |
| 758 | Keratitis | SIDER | ||
| 759 | Keratoconjunctivitis | SIDER | ||
| 760 | Kidney Diseases | 20567873 | CTD | |
| 761 | Kidney Failure | OFFSIDES | ||
| 762 | Leukopenia neonatal | OFFSIDES | ||
| 763 | Lip erosion | OFFSIDES | ||
| 764 | Lipase | OFFSIDES | ||
| 765 | Lung infection pseudomonal | OFFSIDES | ||
| 766 | Lymphangitis | SIDER | ||
| 767 | Mechanical ventilation | Canada Vigilance: 1 | Canada Vigilance | |
| 768 | Melanosis | SIDER | ||
| 769 | Metrorrhagia | SIDER | ||
| 770 | Microcytosis | SIDER | ||
| 771 | Muscle Weakness | 16410267 | CTD OFFSIDES | |
| 772 | Musculoskeletal discomfort | SIDER | ||
| 773 | Mycetoma | 22205798 22760037 | CTD | |
| 774 | Mycoses | 12149384 17015631 23964828 | CTD | |
| 775 | Myelodysplasia | OFFSIDES | ||
| 776 | Myopathy | SIDER | ||
| 777 | Nephritis | SIDER | ||
| 778 | Nephrogenic Diabetes Insipidus | OFFSIDES | ||
| 779 | Nephrosis | SIDER | ||
| 780 | Nerve Block | OFFSIDES | ||
| 781 | Neuroaspergillosis | 19827595 | CTD | |
| 782 | Neutropenic infection | OFFSIDES | ||
| 783 | Ocular Toxicity | Canada Vigilance: 1 | Canada Vigilance | |
| 784 | Oculogyration | SIDER | ||
| 785 | Oculogyric crisis | SIDER | ||
| 786 | Open reduction of fracture | OFFSIDES | ||
| 787 | Optic Atrophy | SIDER | ||
| 788 | Oropharyngeal discomfort | SIDER | ||
| 789 | Osteomalacia | SIDER | ||
| 790 | Osteoporosis | OFFSIDES SIDER | ||
| 791 | Otitis Externa | SIDER | ||
| 792 | Pelvic Pain | SIDER | ||
| 793 | Periodontitis | SIDER | ||
| 794 | Peripheral Nervous System Diseases | CTD | ||
| 795 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 796 | Phlebitis | SIDER | ||
| 797 | Pneumonia herpes viral | OFFSIDES | ||
| 798 | Proctitis | SIDER | ||
| 799 | Product substitution issue | Canada Vigilance: 1 | Canada Vigilance | |
| 800 | Product use complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 801 | Protein urine present | SIDER | ||
| 802 | Proteinuria | SIDER | ||
| 803 | Pseudotumor Cerebri | 21071321 | CTD | |
| 804 | Psoriasis | SIDER | ||
| 805 | Pulmonary Aspergillosis | 19457596 | CTD | |
| 806 | Purulence | OFFSIDES | ||
| 807 | Renal tubular necrosis | SIDER | ||
| 808 | Respiratory Distress Syndrome | SIDER | ||
| 809 | Retching | Canada Vigilance: 1 | Canada Vigilance | |
| 810 | Retinitis | SIDER | ||
| 811 | Retrosternal pain | SIDER | ||
| 812 | Rhinitis | SIDER | ||
| 813 | Scleroderma | OFFSIDES | ||
| 814 | Scotoma | SIDER | ||
| 815 | Stenotrophomonas infection | OFFSIDES | ||
| 816 | Sweating | SIDER | ||
| 817 | Synovial Cyst | OFFSIDES | ||
| 818 | Systemic candidiasis | 19141735 | CTD | |
| 819 | Tachycardia, Ventricular | 15472801 | CTD | |
| 820 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 821 | Thrombophlebitis | SIDER | ||
| 822 | Tooth Extraction | OFFSIDES | ||
| 823 | Transaminases abnormal | OFFSIDES | ||
| 824 | Traumatic liver injury | SIDER | ||
| 825 | Uremia | SIDER | ||
| 826 | Vascular purpura | SIDER | ||
| 827 | Ventricular bigeminy | SIDER | ||
| 828 | Vertigo | SIDER | ||
| 829 | Vision Disorders | 18466103 18574651 | CTD | |
| 830 | furuncle | SIDER | ||
| 831 | microcytic | SIDER | ||
| 832 | prostatitis | OFFSIDES | ||
| 833 | pseudomembranous colitis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.