palbociclib
(AHJRHEGDXFFMBM-UHFFFAOYSA-N)
Structure
- SMILES
- CC(=O)c1c(C)c2cnc(nc2n(c1=O)C1CCCC1)Nc1ccc(cn1)N1CCNCC1
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE33
- Molecular Formula:
- C24H29N7O2
- Molecular Weight:
- 447.533
- Log P:
- 3.4326
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 105.04
- CAS Number(s):
- 571190-30-2
Synonym(s)
1.
palbociclib
2.
6-acetyl-8-cyclopentyl-5-methyl-2-(5-piperazin-1-ylpyridin-2-ylamino)-8H-pyrido(2,3-d)pyrimidin-7-one
3.
Ibrance
4.
PD 0332991
5.
PD-0332991
6.
PD0332991
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 3374 Canada Vigilance: 5 | 21610706 22090362 25524798 | CTD Canada Vigilance US FAERS |
| 2 | White blood cell count decreased | FAERS: 2495 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 1806 Canada Vigilance: 5 | 21610706 22090362 | CTD Canada Vigilance US FAERS |
| 4 | Alopecia | FAERS: 1359 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Neutropenia | FAERS: 1156 Canada Vigilance: 68 | CTD Canada Vigilance US FAERS | |
| 6 | Asthenia | FAERS: 635 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Stomatitis | FAERS: 634 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Vomiting | FAERS: 629 Canada Vigilance: 4 | 19164198 21610706 | CTD Canada Vigilance US FAERS |
| 9 | Malaise | FAERS: 622 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Disease Progression | FAERS: 578 | US FAERS | |
| 11 | Full blood count decreased | FAERS: 578 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Constipation | FAERS: 550 Canada Vigilance: 1 | 21610706 | CTD Canada Vigilance US FAERS |
| 13 | Headache | FAERS: 548 Canada Vigilance: 1 | 19164198 21610706 | CTD Canada Vigilance US FAERS |
| 14 | Dizziness | FAERS: 512 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Pain | FAERS: 496 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Arthralgia | FAERS: 485 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Drug dose omission | FAERS: 395 | US FAERS | |
| 18 | Epistaxis | FAERS: 377 | 21610706 | CTD US FAERS |
| 19 | Pruritus | FAERS: 342 | US FAERS | |
| 20 | Weight decreased | FAERS: 333 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Nasopharyngitis | FAERS: 330 | US FAERS | |
| 22 | Back Pain | FAERS: 320 Canada Vigilance: 1 | 25524798 | CTD Canada Vigilance US FAERS |
| 23 | Product use issue | FAERS: 319 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Neutrophil count decreased | FAERS: 299 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 25 | Bone pain | FAERS: 279 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Pneumonia | FAERS: 265 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 27 | Abdominal discomfort | FAERS: 258 | US FAERS | |
| 28 | Leukopenia | FAERS: 257 | 21610706 22090362 25524798 | CTD US FAERS |
| 29 | Dry skin | FAERS: 256 | US FAERS | |
| 30 | Peripheral swelling | FAERS: 254 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Product use in unapproved indication | FAERS: 239 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 32 | Blood count abnormal | FAERS: 229 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 33 | Memory impairment | FAERS: 216 | US FAERS | |
| 34 | Dysgeusia | FAERS: 207 | US FAERS | |
| 35 | Dehydration | FAERS: 196 | US FAERS | |
| 36 | Urinary tract infection | FAERS: 195 | US FAERS | |
| 37 | Thrombocytopenia | FAERS: 192 Canada Vigilance: 6 | 21610706 23569312 25501126 | CTD Canada Vigilance US FAERS |
| 38 | Oropharyngeal pain | FAERS: 190 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Oral pain | FAERS: 186 | US FAERS | |
| 40 | Myalgia | FAERS: 168 | US FAERS | |
| 41 | Influenza | FAERS: 163 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Dyspepsia | FAERS: 162 | US FAERS | |
| 43 | Feeling abnormal | FAERS: 159 | US FAERS | |
| 44 | Therapy cessation | FAERS: 159 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Somnolence | FAERS: 151 | US FAERS | |
| 46 | Chills | FAERS: 150 | US FAERS | |
| 47 | Abdominal Pain | FAERS: 148 | US FAERS | |
| 48 | Drug ineffective | FAERS: 144 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Product dose omission | FAERS: 140 | US FAERS | |
| 50 | Infection | FAERS: 131 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 51 | Thrombosis | FAERS: 124 | US FAERS | |
| 52 | Anxiety | FAERS: 105 | US FAERS | |
| 53 | Chest Pain | FAERS: 105 | US FAERS | |
| 54 | Pancytopenia | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Sinusitis | FAERS: 102 | US FAERS | |
| 56 | Hypersensitivity | FAERS: 90 | US FAERS | |
| 57 | Musculoskeletal Pain | FAERS: 88 | US FAERS | |
| 58 | Productive Cough | FAERS: 83 | US FAERS | |
| 59 | Joint swelling | FAERS: 81 | US FAERS | |
| 60 | Dysphonia | FAERS: 80 | US FAERS | |
| 61 | Febrile Neutropenia | FAERS: 78 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 62 | Pulmonary Embolism | FAERS: 78 Canada Vigilance: 6 | 25524798 | CTD Canada Vigilance US FAERS |
| 63 | Bronchitis | FAERS: 75 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Hypotension | FAERS: 75 | US FAERS | |
| 65 | Blood glucose increased | FAERS: 74 | US FAERS | |
| 66 | Intentional product misuse | FAERS: 74 | US FAERS | |
| 67 | Cerebrovascular accident | FAERS: 73 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Night sweats | FAERS: 72 | US FAERS | |
| 69 | Therapy change | FAERS: 70 | US FAERS | |
| 70 | Erythema | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Flatulence | FAERS: 68 | US FAERS | |
| 72 | Visual Impairment | FAERS: 67 | US FAERS | |
| 73 | Tremor | FAERS: 65 | US FAERS | |
| 74 | Cytopenia | FAERS: 63 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 75 | Burning sensation | FAERS: 62 | US FAERS | |
| 76 | Sepsis | FAERS: 62 | US FAERS | |
| 77 | Blood potassium decreased | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Musculoskeletal stiffness | FAERS: 58 | US FAERS | |
| 79 | Amnesia | FAERS: 57 | US FAERS | |
| 80 | White blood cell count abnormal | FAERS: 57 | US FAERS | |
| 81 | Decreased immune responsiveness | FAERS: 56 | US FAERS | |
| 82 | Blood creatinine increased | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Neck Pain | FAERS: 53 | US FAERS | |
| 84 | Ascites | FAERS: 52 | US FAERS | |
| 85 | Musculoskeletal chest pain | FAERS: 52 | US FAERS | |
| 86 | Onychoclasis | FAERS: 51 | US FAERS | |
| 87 | Swelling | FAERS: 51 | US FAERS | |
| 88 | Cellulitis | FAERS: 50 | US FAERS | |
| 89 | Stress | FAERS: 50 | US FAERS | |
| 90 | Hypersomnia | FAERS: 49 | US FAERS | |
| 91 | Urticaria | FAERS: 49 | US FAERS | |
| 92 | Ageusia | FAERS: 47 | US FAERS | |
| 93 | Arthritis | FAERS: 45 | US FAERS | |
| 94 | Cataract | FAERS: 44 | US FAERS | |
| 95 | Nervousness | FAERS: 42 | US FAERS | |
| 96 | Chest discomfort | FAERS: 40 | US FAERS | |
| 97 | Depressed mood | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Diabetes Mellitus | FAERS: 40 | US FAERS | |
| 99 | Vertigo | FAERS: 40 | US FAERS | |
| 100 | Deafness | FAERS: 39 | US FAERS | |
| 101 | Emotional disorder | FAERS: 39 | US FAERS | |
| 102 | Feeling Cold | FAERS: 39 | US FAERS | |
| 103 | Cystitis | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Throat irritation | FAERS: 38 | US FAERS | |
| 105 | Lethargy | FAERS: 37 | US FAERS | |
| 106 | Gait inability | FAERS: 36 | US FAERS | |
| 107 | Myocardial Infarction | FAERS: 36 | US FAERS | |
| 108 | Dysuria | FAERS: 35 | US FAERS | |
| 109 | Therapeutic response unexpected | FAERS: 35 | US FAERS | |
| 110 | Full blood count abnormal | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Skin lesion | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Syncope | FAERS: 33 | US FAERS | |
| 113 | Crying | FAERS: 32 | US FAERS | |
| 114 | Limb discomfort | FAERS: 32 | US FAERS | |
| 115 | Neuralgia | FAERS: 31 | US FAERS | |
| 116 | Toothache | FAERS: 31 | US FAERS | |
| 117 | Viral upper respiratory tract infection | FAERS: 31 | US FAERS | |
| 118 | Pulmonary thrombosis | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Acne | FAERS: 29 | US FAERS | |
| 120 | Blood glucose decreased | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Deep Vein Thrombosis | FAERS: 29 | US FAERS | |
| 122 | Palpitations | FAERS: 29 | US FAERS | |
| 123 | Rash erythematous | FAERS: 29 | US FAERS | |
| 124 | Sneezing | FAERS: 28 | US FAERS | |
| 125 | Atrial Fibrillation | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Poor quality sleep | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Retching | FAERS: 26 | US FAERS | |
| 128 | Therapy non-responder | FAERS: 26 | US FAERS | |
| 129 | Wrong technique in product usage process | FAERS: 26 | US FAERS | |
| 130 | Dementia | FAERS: 25 | US FAERS | |
| 131 | General physical health deterioration | FAERS: 25 | US FAERS | |
| 132 | Loss of personal independence in daily activities | FAERS: 25 | US FAERS | |
| 133 | Blood iron decreased | FAERS: 24 | US FAERS | |
| 134 | Mental impairment | FAERS: 24 | US FAERS | |
| 135 | Nasal discomfort | FAERS: 24 | US FAERS | |
| 136 | Sciatica | FAERS: 24 | US FAERS | |
| 137 | Urinary Incontinence | FAERS: 24 | US FAERS | |
| 138 | Blindness | FAERS: 23 | US FAERS | |
| 139 | Malignant neoplasm progression | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 140 | No adverse event | FAERS: 23 | US FAERS | |
| 141 | Pneumonitis | FAERS: 23 | US FAERS | |
| 142 | Aphonia | FAERS: 22 | US FAERS | |
| 143 | Joint stiffness | FAERS: 22 | US FAERS | |
| 144 | Pain of skin | FAERS: 22 | US FAERS | |
| 145 | Wheezing | FAERS: 22 | US FAERS | |
| 146 | Aspartate Aminotransferase Increased | FAERS: 21 | US FAERS | |
| 147 | Diverticulitis | FAERS: 21 | US FAERS | |
| 148 | Pre-existing condition improved | FAERS: 21 | US FAERS | |
| 149 | Tinnitus | FAERS: 21 | US FAERS | |
| 150 | Alanine Aminotransferase Increased | FAERS: 20 | US FAERS | |
| 151 | Eructation | FAERS: 19 | US FAERS | |
| 152 | Eye pain | FAERS: 19 | US FAERS | |
| 153 | Nephrolithiasis | FAERS: 19 | US FAERS | |
| 154 | Agitation | FAERS: 18 | US FAERS | |
| 155 | Asthma | FAERS: 18 | US FAERS | |
| 156 | Blood potassium increased | FAERS: 18 | US FAERS | |
| 157 | Blood urine present | FAERS: 18 | US FAERS | |
| 158 | Hepatotoxicity | FAERS: 18 | US FAERS | |
| 159 | Laryngitis | FAERS: 18 | US FAERS | |
| 160 | Limb injury | FAERS: 18 | US FAERS | |
| 161 | Osteoporosis | FAERS: 18 | US FAERS | |
| 162 | Colitis | FAERS: 17 | US FAERS | |
| 163 | Increased tendency to bruise | FAERS: 17 | US FAERS | |
| 164 | Inflammation | FAERS: 17 | US FAERS | |
| 165 | Lower respiratory tract infection | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Acute kidney injury | FAERS: 16 | US FAERS | |
| 167 | Eye irritation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Flushing | FAERS: 16 | US FAERS | |
| 169 | Gastritis | FAERS: 16 | US FAERS | |
| 170 | Middle insomnia | FAERS: 16 | US FAERS | |
| 171 | Paranasal sinus hypersecretion | FAERS: 16 | US FAERS | |
| 172 | Product storage error | FAERS: 16 | US FAERS | |
| 173 | Tooth Infection | FAERS: 16 | US FAERS | |
| 174 | Unevaluable event | FAERS: 16 | US FAERS | |
| 175 | Blood sodium decreased | FAERS: 15 | US FAERS | |
| 176 | Clostridium difficile infection | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Diplopia | FAERS: 15 | US FAERS | |
| 178 | Hunger | FAERS: 15 | US FAERS | |
| 179 | Lip swelling | FAERS: 15 | US FAERS | |
| 180 | Mood swings | FAERS: 15 | US FAERS | |
| 181 | Paranasal sinus discomfort | FAERS: 15 | US FAERS | |
| 182 | Psychiatric symptom | FAERS: 15 | US FAERS | |
| 183 | Thirst | FAERS: 15 | US FAERS | |
| 184 | Cheilitis | FAERS: 14 | US FAERS | |
| 185 | Disease recurrence | FAERS: 14 | US FAERS | |
| 186 | Inappropriate schedule of drug administration | FAERS: 14 | US FAERS | |
| 187 | Lymphadenopathy | FAERS: 14 | US FAERS | |
| 188 | Osteonecrosis of Jaw | FAERS: 14 | US FAERS | |
| 189 | Pericardial effusion | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Skin irritation | FAERS: 14 | US FAERS | |
| 191 | Chromaturia | FAERS: 13 | US FAERS | |
| 192 | Device related infection | FAERS: 13 | US FAERS | |
| 193 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 194 | Poor quality drug administered | FAERS: 13 | US FAERS | |
| 195 | Pulmonary congestion | FAERS: 13 | US FAERS | |
| 196 | Ulcer | FAERS: 13 | US FAERS | |
| 197 | Anger | FAERS: 12 | US FAERS | |
| 198 | Ear discomfort | FAERS: 12 | US FAERS | |
| 199 | Fracture | FAERS: 12 | US FAERS | |
| 200 | Haematotoxicity | FAERS: 12 | US FAERS | |
| 201 | Hypophagia | FAERS: 12 | US FAERS | |
| 202 | Joint injury | FAERS: 12 | US FAERS | |
| 203 | Musculoskeletal discomfort | FAERS: 12 | US FAERS | |
| 204 | Scab | FAERS: 12 | US FAERS | |
| 205 | Skin Ulcer | FAERS: 12 | US FAERS | |
| 206 | Tooth Loss | FAERS: 12 | US FAERS | |
| 207 | Upper-airway cough syndrome | FAERS: 12 | US FAERS | |
| 208 | Cardiac Arrest | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 209 | Disorientation | FAERS: 11 | US FAERS | |
| 210 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 211 | Extra dose administered | FAERS: 11 | US FAERS | |
| 212 | Gingivitis | FAERS: 11 | US FAERS | |
| 213 | Hyperchlorhydria | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Hypokinesia | FAERS: 11 | US FAERS | |
| 215 | Intestinal Obstruction | FAERS: 11 | US FAERS | |
| 216 | Respiratory tract congestion | FAERS: 11 | US FAERS | |
| 217 | Skin reaction | FAERS: 11 | US FAERS | |
| 218 | Tongue blistering | FAERS: 11 | US FAERS | |
| 219 | Accidental overdose | FAERS: 10 | US FAERS | |
| 220 | Arthropathy | FAERS: 10 | US FAERS | |
| 221 | Carpal Tunnel Syndrome | FAERS: 10 | US FAERS | |
| 222 | Dermatitis | FAERS: 10 | US FAERS | |
| 223 | Discomfort | FAERS: 10 | US FAERS | |
| 224 | Drug administration error | FAERS: 10 | US FAERS | |
| 225 | Eczema | FAERS: 10 | US FAERS | |
| 226 | Feeling of body temperature change | FAERS: 10 | US FAERS | |
| 227 | Flank Pain | FAERS: 10 | US FAERS | |
| 228 | Gastric ulcer | FAERS: 10 | US FAERS | |
| 229 | Head discomfort | FAERS: 10 | US FAERS | |
| 230 | Osteomyelitis | FAERS: 10 | US FAERS | |
| 231 | Product dispensing error | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Product size issue | FAERS: 10 | US FAERS | |
| 233 | Product use complaint | FAERS: 10 | US FAERS | |
| 234 | Psoriasis | FAERS: 10 | US FAERS | |
| 235 | Pulmonary Fibrosis | FAERS: 10 | US FAERS | |
| 236 | Restless Legs Syndrome | FAERS: 10 | US FAERS | |
| 237 | Vitreous floaters | FAERS: 10 | US FAERS | |
| 238 | Wound Infection | FAERS: 10 | US FAERS | |
| 239 | treatment failure | FAERS: 10 | US FAERS | |
| 240 | Aphasia | FAERS: 9 | US FAERS | |
| 241 | Back disorder | FAERS: 9 | US FAERS | |
| 242 | Cancer Pain | FAERS: 9 | US FAERS | |
| 243 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 244 | Cyst | FAERS: 9 | US FAERS | |
| 245 | Eye Infection | FAERS: 9 | US FAERS | |
| 246 | Full blood count increased | FAERS: 9 | US FAERS | |
| 247 | Granulocyte count decreased | FAERS: 9 | US FAERS | |
| 248 | Hypogeusia | FAERS: 9 | US FAERS | |
| 249 | Incontinence | FAERS: 9 | US FAERS | |
| 250 | Macrocytosis | FAERS: 9 | US FAERS | |
| 251 | Mouth swelling | FAERS: 9 | US FAERS | |
| 252 | Pelvic Pain | FAERS: 9 | US FAERS | |
| 253 | Sinus headache | FAERS: 9 | US FAERS | |
| 254 | Tachycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Temperature intolerance | FAERS: 9 | US FAERS | |
| 256 | Upper respiratory tract congestion | FAERS: 9 | US FAERS | |
| 257 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 258 | Blood magnesium decreased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 259 | Bowel movement irregularity | FAERS: 8 | US FAERS | |
| 260 | Choking | FAERS: 8 | US FAERS | |
| 261 | Electrolyte imbalance | FAERS: 8 | US FAERS | |
| 262 | Laceration | FAERS: 8 | US FAERS | |
| 263 | Lymphocyte count increased | FAERS: 8 | US FAERS | |
| 264 | Muscle strain | FAERS: 8 | US FAERS | |
| 265 | Nocturia | FAERS: 8 | US FAERS | |
| 266 | Product physical issue | FAERS: 8 | US FAERS | |
| 267 | Renal pain | FAERS: 8 | US FAERS | |
| 268 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 269 | Adverse event | FAERS: 7 | US FAERS | |
| 270 | Ankle Fracture | FAERS: 7 | US FAERS | |
| 271 | Asthenopia | FAERS: 7 | US FAERS | |
| 272 | Bedridden | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 273 | Cerebral disorder | FAERS: 7 | US FAERS | |
| 274 | Diverticulum | FAERS: 7 | US FAERS | |
| 275 | Expired product administered | FAERS: 7 | US FAERS | |
| 276 | Facial paralysis | FAERS: 7 | US FAERS | |
| 277 | Food craving | FAERS: 7 | US FAERS | |
| 278 | Frustration tolerance decreased | FAERS: 7 | US FAERS | |
| 279 | Glaucoma | FAERS: 7 | US FAERS | |
| 280 | Hepatitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Hernia | FAERS: 7 | US FAERS | |
| 282 | Hordeolum | FAERS: 7 | US FAERS | |
| 283 | Immunosuppression | FAERS: 7 | US FAERS | |
| 284 | Impaired driving ability | FAERS: 7 | US FAERS | |
| 285 | Intentional dose omission | FAERS: 7 | US FAERS | |
| 286 | Lymphocyte count decreased | FAERS: 7 | US FAERS | |
| 287 | Nodule | FAERS: 7 | US FAERS | |
| 288 | Oral candidiasis | FAERS: 7 | US FAERS | |
| 289 | Pancreatitis | FAERS: 7 | US FAERS | |
| 290 | Pathological fracture | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 291 | Restlessness | FAERS: 7 | US FAERS | |
| 292 | Vulvovaginal dryness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 293 | Abasia | FAERS: 6 | US FAERS | |
| 294 | Abdominal tenderness | FAERS: 6 | US FAERS | |
| 295 | Allergic sinusitis | FAERS: 6 | US FAERS | |
| 296 | Anosmia | FAERS: 6 | US FAERS | |
| 297 | Arthropod bite | FAERS: 6 | US FAERS | |
| 298 | Blood cholesterol increased | FAERS: 6 | US FAERS | |
| 299 | Blood creatinine decreased | FAERS: 6 | US FAERS | |
| 300 | Blood glucose fluctuation | FAERS: 6 | US FAERS | |
| 301 | Blood pressure fluctuation | FAERS: 6 | US FAERS | |
| 302 | Blood urea increased | FAERS: 6 | US FAERS | |
| 303 | Bone lesion | FAERS: 6 | US FAERS | |
| 304 | Cachexia | FAERS: 6 | US FAERS | |
| 305 | Carbohydrate antigen 15-3 increased | FAERS: 6 | US FAERS | |
| 306 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 307 | Early satiety | FAERS: 6 | US FAERS | |
| 308 | Facial Pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Feeling jittery | FAERS: 6 | US FAERS | |
| 310 | Gastric infection | FAERS: 6 | US FAERS | |
| 311 | Hydronephrosis | FAERS: 6 | US FAERS | |
| 312 | Inappropriate schedule of product administration | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Lip exfoliation | FAERS: 6 | US FAERS | |
| 314 | Neutrophil count abnormal | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Pleurisy | FAERS: 6 | US FAERS | |
| 316 | Radiation injury | FAERS: 6 | US FAERS | |
| 317 | Respiratory distress | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 318 | Secretion discharge | FAERS: 6 | US FAERS | |
| 319 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 320 | Transaminases increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 321 | Trichorrhexis | FAERS: 6 | US FAERS | |
| 322 | Urinary Retention | FAERS: 6 | US FAERS | |
| 323 | Vaginal Discharge | FAERS: 6 | US FAERS | |
| 324 | Vulvovaginal pruritus | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | jaundice | FAERS: 6 | US FAERS | |
| 326 | nervous system disorder | FAERS: 6 | US FAERS | |
| 327 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 328 | Bradyphrenia | FAERS: 5 | US FAERS | |
| 329 | Dental caries | FAERS: 5 | US FAERS | |
| 330 | Diaphragmalgia | FAERS: 5 | US FAERS | |
| 331 | Economic problem | FAERS: 5 | US FAERS | |
| 332 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 333 | Food Poisoning | FAERS: 5 | US FAERS | |
| 334 | Foreign body in respiratory tract | FAERS: 5 | US FAERS | |
| 335 | Gout | FAERS: 5 | US FAERS | |
| 336 | Injection site pain | FAERS: 5 | US FAERS | |
| 337 | Insurance issue | FAERS: 5 | US FAERS | |
| 338 | Macular degeneration | FAERS: 5 | US FAERS | |
| 339 | Metastatic Neoplasm | FAERS: 5 | US FAERS | |
| 340 | Muscle tightness | FAERS: 5 | US FAERS | |
| 341 | Noninfective gingivitis | FAERS: 5 | US FAERS | |
| 342 | Overdose | FAERS: 5 | US FAERS | |
| 343 | Platelet count abnormal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | Post procedural complication | FAERS: 5 | US FAERS | |
| 345 | Product quality issue | FAERS: 5 | US FAERS | |
| 346 | Senile dementia | FAERS: 5 | US FAERS | |
| 347 | Septic Shock | FAERS: 5 | US FAERS | |
| 348 | Skin laceration | FAERS: 5 | US FAERS | |
| 349 | Subcutaneous Abscess | FAERS: 5 | US FAERS | |
| 350 | Tongue discomfort | FAERS: 5 | US FAERS | |
| 351 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 352 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 353 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 354 | Blood phosphorus decreased | FAERS: 4 | US FAERS | |
| 355 | Bone marrow toxicity | FAERS: 4 | US FAERS | |
| 356 | Carbohydrate antigen 27.29 increased | FAERS: 4 | US FAERS | |
| 357 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 358 | Catheter site infection | FAERS: 4 | US FAERS | |
| 359 | Cold sweat | FAERS: 4 | US FAERS | |
| 360 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 361 | Conversion disorder | FAERS: 4 | US FAERS | |
| 362 | Dark circles under eyes | FAERS: 4 | US FAERS | |
| 363 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 364 | Depression suicidal | FAERS: 4 | US FAERS | |
| 365 | Dermatitis acneiform | FAERS: 4 | US FAERS | |
| 366 | Ear congestion | FAERS: 4 | US FAERS | |
| 367 | Echocardiogram abnormal | FAERS: 4 | US FAERS | |
| 368 | Emotional distress | FAERS: 4 | US FAERS | |
| 369 | Enteritis | FAERS: 4 | US FAERS | |
| 370 | Febrile bone marrow aplasia | FAERS: 4 | US FAERS | |
| 371 | Formication | FAERS: 4 | US FAERS | |
| 372 | Gastrointestinal motility disorder | FAERS: 4 | US FAERS | |
| 373 | Gingival blister | FAERS: 4 | US FAERS | |
| 374 | Glossitis | FAERS: 4 | US FAERS | |
| 375 | Hepatitis C | FAERS: 4 | US FAERS | |
| 376 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 377 | Hyperkeratosis | FAERS: 4 | US FAERS | |
| 378 | Hypoxia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Incoherent | FAERS: 4 | US FAERS | |
| 380 | Initial insomnia | FAERS: 4 | US FAERS | |
| 381 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 382 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 383 | Laziness | FAERS: 4 | US FAERS | |
| 384 | MYELODYSPLASTIC SYNDROME | FAERS: 4 | US FAERS | |
| 385 | Medication residue present | FAERS: 4 | US FAERS | |
| 386 | Menopause | FAERS: 4 | US FAERS | |
| 387 | Metastasis | FAERS: 4 | US FAERS | |
| 388 | Multiple Sclerosis | FAERS: 4 | US FAERS | |
| 389 | Muscle Fatigue | FAERS: 4 | US FAERS | |
| 390 | Nerve injury | FAERS: 4 | US FAERS | |
| 391 | Neutropenic sepsis | FAERS: 4 | US FAERS | |
| 392 | Onychalgia | FAERS: 4 | US FAERS | |
| 393 | Oral infection | FAERS: 4 | US FAERS | |
| 394 | Oropharyngeal discomfort | FAERS: 4 | US FAERS | |
| 395 | Pallor | FAERS: 4 | US FAERS | |
| 396 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 397 | Pelvic mass | FAERS: 4 | US FAERS | |
| 398 | Photophobia | FAERS: 4 | US FAERS | |
| 399 | Pneumothorax | FAERS: 4 | US FAERS | |
| 400 | Poor quality product administered | FAERS: 4 | US FAERS | |
| 401 | Product distribution issue | FAERS: 4 | US FAERS | |
| 402 | Product packaging quantity issue | FAERS: 4 | US FAERS | |
| 403 | Protein urine present | FAERS: 4 | US FAERS | |
| 404 | Pulmonary pain | FAERS: 4 | US FAERS | |
| 405 | Quality of life decreased | FAERS: 4 | US FAERS | |
| 406 | Radiation associated pain | FAERS: 4 | US FAERS | |
| 407 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 408 | Rhinalgia | FAERS: 4 | US FAERS | |
| 409 | Rotator cuff syndrome | FAERS: 4 | US FAERS | |
| 410 | Sensitivity to weather change | FAERS: 4 | US FAERS | |
| 411 | Spinal column injury | FAERS: 4 | US FAERS | |
| 412 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 413 | Urine output increased | FAERS: 4 | US FAERS | |
| 414 | furuncle | FAERS: 4 | US FAERS | |
| 415 | skin abrasion | FAERS: 4 | US FAERS | |
| 416 | Abdominal Infection | FAERS: 3 | US FAERS | |
| 417 | Abdominal rigidity | FAERS: 3 | US FAERS | |
| 418 | Abscess | FAERS: 3 | US FAERS | |
| 419 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 420 | Alanine aminotransferase abnormal | FAERS: 3 | US FAERS | |
| 421 | Angioedema | FAERS: 3 | US FAERS | |
| 422 | Ataxia | FAERS: 3 | US FAERS | |
| 423 | Atelectasis | FAERS: 3 | US FAERS | |
| 424 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 425 | Bladder prolapse | FAERS: 3 | US FAERS | |
| 426 | Blood blister | FAERS: 3 | US FAERS | |
| 427 | Blood creatinine abnormal | FAERS: 3 | US FAERS | |
| 428 | Blood electrolytes decreased | FAERS: 3 | US FAERS | |
| 429 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 430 | Bone scan abnormal | FAERS: 3 | US FAERS | |
| 431 | Breast tenderness | FAERS: 3 | US FAERS | |
| 432 | Carcinoembryonic antigen increased | FAERS: 3 | US FAERS | |
| 433 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 434 | Cataract operation | FAERS: 3 | US FAERS | |
| 435 | Catarrh | FAERS: 3 | US FAERS | |
| 436 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 437 | Circumstance or information capable of leading to medication error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Clostridium difficile colitis | FAERS: 3 | US FAERS | |
| 439 | Creatinine renal clearance decreased | FAERS: 3 | US FAERS | |
| 440 | Delirium | FAERS: 3 | US FAERS | |
| 441 | Embolism | FAERS: 3 | US FAERS | |
| 442 | Essential Tremor | FAERS: 3 | US FAERS | |
| 443 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 444 | Gastrointestinal perforation | FAERS: 3 | US FAERS | |
| 445 | Humidity intolerance | FAERS: 3 | US FAERS | |
| 446 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 447 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 448 | Ileus | FAERS: 3 | US FAERS | |
| 449 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 450 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 451 | Infected bite | FAERS: 3 | US FAERS | |
| 452 | Limb mass | FAERS: 3 | US FAERS | |
| 453 | Lymphoma | FAERS: 3 | US FAERS | |
| 454 | Lymphopenia | FAERS: 3 | 21610706 | CTD US FAERS |
| 455 | Macule | FAERS: 3 | US FAERS | |
| 456 | Malnutrition | FAERS: 3 | US FAERS | |
| 457 | Motion Sickness | FAERS: 3 | US FAERS | |
| 458 | Nasal inflammation | FAERS: 3 | US FAERS | |
| 459 | Obstruction | FAERS: 3 | US FAERS | |
| 460 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 461 | Ocular vascular disorder | FAERS: 3 | US FAERS | |
| 462 | Onycholysis | FAERS: 3 | US FAERS | |
| 463 | Oral contusion | FAERS: 3 | US FAERS | |
| 464 | Oral mucosal eruption | FAERS: 3 | US FAERS | |
| 465 | Oropharyngeal blistering | FAERS: 3 | US FAERS | |
| 466 | Oropharyngeal plaque | FAERS: 3 | US FAERS | |
| 467 | Osteogenesis Imperfecta | FAERS: 3 | US FAERS | |
| 468 | Osteopenia | FAERS: 3 | US FAERS | |
| 469 | Overweight | FAERS: 3 | US FAERS | |
| 470 | Paranoia | FAERS: 3 | US FAERS | |
| 471 | Pelvic fluid collection | FAERS: 3 | US FAERS | |
| 472 | Performance status decreased | FAERS: 3 | US FAERS | |
| 473 | Pharyngitis | FAERS: 3 | US FAERS | |
| 474 | Presyncope | FAERS: 3 | US FAERS | |
| 475 | Product packaging issue | FAERS: 3 | US FAERS | |
| 476 | Product prescribing error | FAERS: 3 | US FAERS | |
| 477 | Protein total decreased | FAERS: 3 | US FAERS | |
| 478 | Pseudocirrhosis | FAERS: 3 | US FAERS | |
| 479 | Pulmonary toxicity | FAERS: 3 | US FAERS | |
| 480 | Schizophrenia | FAERS: 3 | US FAERS | |
| 481 | Sinus pain | FAERS: 3 | US FAERS | |
| 482 | Skin hypertrophy | FAERS: 3 | US FAERS | |
| 483 | Sluggishness | FAERS: 3 | US FAERS | |
| 484 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 485 | Splenomegaly | FAERS: 3 | US FAERS | |
| 486 | Terminal state | FAERS: 3 | US FAERS | |
| 487 | Trismus | FAERS: 3 | US FAERS | |
| 488 | Troponin increased | FAERS: 3 | US FAERS | |
| 489 | Tumour haemorrhage | FAERS: 3 | US FAERS | |
| 490 | Venous Thrombosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 491 | Vocal Cord Paralysis | FAERS: 3 | US FAERS | |
| 492 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 493 | X-ray abnormal | FAERS: 3 | US FAERS | |
| 494 | Xerosis | FAERS: 3 | US FAERS | |
| 495 | Adnexa uteri pain | FAERS: 2 | US FAERS | |
| 496 | Ammonia increased | FAERS: 2 | US FAERS | |
| 497 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 498 | Apathy | FAERS: 2 | US FAERS | |
| 499 | Arthropod sting | FAERS: 2 | US FAERS | |
| 500 | Aspartate aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 501 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 502 | Bladder spasm | FAERS: 2 | US FAERS | |
| 503 | Blood calcium abnormal | FAERS: 2 | US FAERS | |
| 504 | Blood parathyroid hormone increased | FAERS: 2 | US FAERS | |
| 505 | Blood thyroid stimulating hormone abnormal | FAERS: 2 | US FAERS | |
| 506 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 507 | Bradycardia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 508 | Breast discomfort | FAERS: 2 | US FAERS | |
| 509 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 510 | Bursitis | FAERS: 2 | US FAERS | |
| 511 | Cell marker increased | FAERS: 2 | US FAERS | |
| 512 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 513 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 514 | Cholecystitis | FAERS: 2 | US FAERS | |
| 515 | Completed Suicide | FAERS: 2 | US FAERS | |
| 516 | Compression fracture | FAERS: 2 | US FAERS | |
| 517 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 518 | Drug level increased | FAERS: 2 | US FAERS | |
| 519 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 520 | Dysarthria | FAERS: 2 | US FAERS | |
| 521 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 522 | Enuresis | FAERS: 2 | US FAERS | |
| 523 | Enzyme level increased | FAERS: 2 | US FAERS | |
| 524 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 525 | Epilepsy | FAERS: 2 | US FAERS | |
| 526 | Escherichia infection | FAERS: 2 | US FAERS | |
| 527 | Excessive cerumen production | FAERS: 2 | US FAERS | |
| 528 | Excoriation | FAERS: 2 | US FAERS | |
| 529 | Exfoliative rash | FAERS: 2 | US FAERS | |
| 530 | Eye allergy | FAERS: 2 | US FAERS | |
| 531 | Eye inflammation | FAERS: 2 | US FAERS | |
| 532 | Eyelid margin crusting | FAERS: 2 | US FAERS | |
| 533 | Eyelid pain | FAERS: 2 | US FAERS | |
| 534 | Fibrosis | FAERS: 2 | US FAERS | |
| 535 | Fingerprint loss | FAERS: 2 | US FAERS | |
| 536 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 537 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 538 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 539 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 540 | Genital rash | FAERS: 2 | US FAERS | |
| 541 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 542 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 543 | Hemiparesis | FAERS: 2 | US FAERS | |
| 544 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 545 | Hospice Care | FAERS: 2 | US FAERS | |
| 546 | Hypercapnia | FAERS: 2 | US FAERS | |
| 547 | Hyperventilation | FAERS: 2 | US FAERS | |
| 548 | Hysterectomy | FAERS: 2 | US FAERS | |
| 549 | Impaired work ability | FAERS: 2 | US FAERS | |
| 550 | Implant site infection | FAERS: 2 | US FAERS | |
| 551 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 552 | Incision site pain | FAERS: 2 | US FAERS | |
| 553 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 554 | Increased viscosity of upper respiratory secretion | FAERS: 2 | US FAERS | |
| 555 | Injection Site Reaction | FAERS: 2 | US FAERS | |
| 556 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 557 | Intracranial mass | FAERS: 2 | US FAERS | |
| 558 | Iron deficiency | FAERS: 2 | US FAERS | |
| 559 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 560 | Leukocytosis | FAERS: 2 | US FAERS | |
| 561 | Limb operation | FAERS: 2 | US FAERS | |
| 562 | Lip erythema | FAERS: 2 | US FAERS | |
| 563 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 564 | Manufacturing product shipping issue | FAERS: 2 | US FAERS | |
| 565 | Mastitis | FAERS: 2 | US FAERS | |
| 566 | Meningioma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 567 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 568 | Monocyte count decreased | FAERS: 2 | US FAERS | |
| 569 | Monocyte count increased | FAERS: 2 | US FAERS | |
| 570 | Monoplegia | FAERS: 2 | US FAERS | |
| 571 | Multiple allergies | FAERS: 2 | US FAERS | |
| 572 | Mutism | FAERS: 2 | US FAERS | |
| 573 | Nail bed disorder | FAERS: 2 | US FAERS | |
| 574 | Nipple pain | FAERS: 2 | US FAERS | |
| 575 | Ocular icterus | FAERS: 2 | US FAERS | |
| 576 | Oliguria | FAERS: 2 | US FAERS | |
| 577 | Onychomalacia | FAERS: 2 | US FAERS | |
| 578 | Oral mucosal erythema | FAERS: 2 | US FAERS | |
| 579 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 580 | Oral pruritus | FAERS: 2 | US FAERS | |
| 581 | Panniculitis | FAERS: 2 | US FAERS | |
| 582 | Petechiae | FAERS: 2 | US FAERS | |
| 583 | Pharyngeal swelling | FAERS: 2 | US FAERS | |
| 584 | Phlebitis | FAERS: 2 | US FAERS | |
| 585 | Poisoning | FAERS: 2 | US FAERS | |
| 586 | Polyarthritis | FAERS: 2 | US FAERS | |
| 587 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 588 | Positron emission tomogram abnormal | FAERS: 2 | US FAERS | |
| 589 | Post procedural infection | FAERS: 2 | US FAERS | |
| 590 | Post procedural persistent drain fluid | FAERS: 2 | US FAERS | |
| 591 | Premenstrual syndrome | FAERS: 2 | US FAERS | |
| 592 | Procedural site reaction | FAERS: 2 | US FAERS | |
| 593 | Product administration error | FAERS: 2 | US FAERS | |
| 594 | Product container seal issue | FAERS: 2 | US FAERS | |
| 595 | Product label issue | FAERS: 2 | US FAERS | |
| 596 | Product leakage | FAERS: 2 | US FAERS | |
| 597 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 598 | Psychiatric decompensation | FAERS: 2 | US FAERS | |
| 599 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 600 | Purulent discharge | FAERS: 2 | US FAERS | |
| 601 | Pyloric Stenosis | FAERS: 2 | US FAERS | |
| 602 | Recall phenomenon | FAERS: 2 | US FAERS | |
| 603 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 604 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 605 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 606 | Rhabdomyolysis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 607 | Rhinitis | FAERS: 2 | US FAERS | |
| 608 | Saliva altered | FAERS: 2 | US FAERS | |
| 609 | Shock | FAERS: 2 | US FAERS | |
| 610 | Skeletal injury | FAERS: 2 | US FAERS | |
| 611 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 612 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 613 | Skin tightness | FAERS: 2 | US FAERS | |
| 614 | Sleep Talking | FAERS: 2 | US FAERS | |
| 615 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 616 | Stenosis | FAERS: 2 | US FAERS | |
| 617 | Sudden death | FAERS: 2 | US FAERS | |
| 618 | Thermal burn | FAERS: 2 | US FAERS | |
| 619 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 620 | Vascular pain | FAERS: 2 | US FAERS | |
| 621 | Vitamin D abnormal | FAERS: 2 | US FAERS | |
| 622 | Vitiligo | FAERS: 2 | US FAERS | |
| 623 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 624 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 625 | Wrong schedule | FAERS: 2 | US FAERS | |
| 626 | liposarcoma | FAERS: 2 | 21610706 23569312 | CTD US FAERS |
| 627 | Abdominal mass | FAERS: 1 | US FAERS | |
| 628 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 629 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 630 | Acidosis | FAERS: 1 | US FAERS | |
| 631 | Acute myocardial infarction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 632 | Adrenal gland cancer metastatic | FAERS: 1 | US FAERS | |
| 633 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 634 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 635 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 636 | Allergic cough | FAERS: 1 | US FAERS | |
| 637 | Anal Fissure | FAERS: 1 | US FAERS | |
| 638 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 639 | Aneurysm | FAERS: 1 | US FAERS | |
| 640 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 641 | Animal scratch | FAERS: 1 | US FAERS | |
| 642 | Anisocytosis | FAERS: 1 | US FAERS | |
| 643 | Anuria | FAERS: 1 | US FAERS | |
| 644 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 645 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 646 | Apparent death | FAERS: 1 | US FAERS | |
| 647 | Appendicitis | FAERS: 1 | US FAERS | |
| 648 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 649 | Asphyxia | FAERS: 1 | US FAERS | |
| 650 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 651 | Aura | FAERS: 1 | US FAERS | |
| 652 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 653 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 654 | Autoscopy | FAERS: 1 | US FAERS | |
| 655 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 656 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 657 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 658 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 659 | Bladder Neoplasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 660 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 661 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 662 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 663 | Blood homocysteine increased | FAERS: 1 | US FAERS | |
| 664 | Blood iron increased | FAERS: 1 | US FAERS | |
| 665 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 666 | Blood phosphorus abnormal | FAERS: 1 | US FAERS | |
| 667 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 668 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 669 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 670 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 671 | Body surface area decreased | FAERS: 1 | US FAERS | |
| 672 | Bone decalcification | FAERS: 1 | US FAERS | |
| 673 | Bone density decreased | FAERS: 1 | US FAERS | |
| 674 | Bone fissure | FAERS: 1 | US FAERS | |
| 675 | Bone marrow infiltration | FAERS: 1 | US FAERS | |
| 676 | Brain Abscess | FAERS: 1 | US FAERS | |
| 677 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 678 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 679 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 680 | Calcinosis | FAERS: 1 | US FAERS | |
| 681 | Capsular contracture associated with breast implant | FAERS: 1 | US FAERS | |
| 682 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 683 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 684 | Catheter site pain | FAERS: 1 | US FAERS | |
| 685 | Cell marker decreased | FAERS: 1 | US FAERS | |
| 686 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 687 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 688 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 689 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 690 | Chemotherapy | FAERS: 1 | US FAERS | |
| 691 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 692 | Chromatopsia | FAERS: 1 | US FAERS | |
| 693 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 694 | Claustrophobia | FAERS: 1 | US FAERS | |
| 695 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 696 | Clumsiness | FAERS: 1 | US FAERS | |
| 697 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 698 | Corneal Infection | FAERS: 1 | US FAERS | |
| 699 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 700 | Cyanosis | FAERS: 1 | US FAERS | |
| 701 | Cyclic neutropenia | FAERS: 1 | US FAERS | |
| 702 | Cystocele | FAERS: 1 | US FAERS | |
| 703 | Dental Restoration Failure | FAERS: 1 | US FAERS | |
| 704 | Denture wearer | FAERS: 1 | US FAERS | |
| 705 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 706 | Device malfunction | FAERS: 1 | US FAERS | |
| 707 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 708 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 709 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 710 | Diplegia | FAERS: 1 | US FAERS | |
| 711 | Disease complication | FAERS: 1 | US FAERS | |
| 712 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 713 | Dissociation | FAERS: 1 | US FAERS | |
| 714 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 715 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 716 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 717 | Drug level decreased | FAERS: 1 | US FAERS | |
| 718 | Drug resistance | FAERS: 1 | US FAERS | |
| 719 | Drug screen positive | FAERS: 1 | US FAERS | |
| 720 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 721 | Dysgraphia | FAERS: 1 | US FAERS | |
| 722 | Dyslexia | FAERS: 1 | US FAERS | |
| 723 | Dyspareunia | FAERS: 1 | US FAERS | |
| 724 | Ecchymosis | FAERS: 1 | US FAERS | |
| 725 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 726 | Emergency Care | FAERS: 1 | US FAERS | |
| 727 | Endocarditis | FAERS: 1 | US FAERS | |
| 728 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 729 | Endometrial thickening | FAERS: 1 | US FAERS | |
| 730 | Endometriosis | FAERS: 1 | US FAERS | |
| 731 | Enterocolitis | FAERS: 1 | US FAERS | |
| 732 | Ependymoma | FAERS: 1 | US FAERS | |
| 733 | Erythropenia | FAERS: 1 | US FAERS | |
| 734 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 735 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 736 | Euphoric mood | FAERS: 1 | US FAERS | |
| 737 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 738 | Eyelid infection | FAERS: 1 | US FAERS | |
| 739 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 740 | Eyelid rash | FAERS: 1 | US FAERS | |
| 741 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 742 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 743 | Familial Tremor | FAERS: 1 | US FAERS | |
| 744 | Febrile infection | FAERS: 1 | US FAERS | |
| 745 | Femoral hernia incarcerated | FAERS: 1 | US FAERS | |
| 746 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 747 | Fluid overload | FAERS: 1 | US FAERS | |
| 748 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 749 | Folliculitis | FAERS: 1 | US FAERS | |
| 750 | Food Allergy | FAERS: 1 | US FAERS | |
| 751 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 752 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 753 | Gastric pH increased | FAERS: 1 | US FAERS | |
| 754 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 755 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 756 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 757 | Gene Mutation | FAERS: 1 | US FAERS | |
| 758 | Genital Herpes | FAERS: 1 | US FAERS | |
| 759 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 760 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 761 | Gingival erythema | FAERS: 1 | US FAERS | |
| 762 | Granulocytes abnormal | FAERS: 1 | US FAERS | |
| 763 | Growth retardation | FAERS: 1 | US FAERS | |
| 764 | Head titubation | FAERS: 1 | US FAERS | |
| 765 | Hearing disability | FAERS: 1 | US FAERS | |
| 766 | Heavy exposure to ultraviolet light | FAERS: 1 | US FAERS | |
| 767 | Hemiplegia | FAERS: 1 | US FAERS | |
| 768 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 769 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 770 | Hepatic enzyme decreased | FAERS: 1 | US FAERS | |
| 771 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 772 | Hidradenitis | FAERS: 1 | US FAERS | |
| 773 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 774 | Hip surgery | FAERS: 1 | US FAERS | |
| 775 | Hirsutism | FAERS: 1 | US FAERS | |
| 776 | Hostility | FAERS: 1 | US FAERS | |
| 777 | Human epidermal growth factor receptor increased | FAERS: 1 | US FAERS | |
| 778 | Hyperoxaluria | FAERS: 1 | US FAERS | |
| 779 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 780 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 781 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 782 | Hypobarism | FAERS: 1 | US FAERS | |
| 783 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 784 | Impatience | FAERS: 1 | US FAERS | |
| 785 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 786 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 787 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 788 | Injection site bruising | FAERS: 1 | US FAERS | |
| 789 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 790 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 791 | Intercostal neuralgia | FAERS: 1 | US FAERS | |
| 792 | Interferon gamma release assay positive | FAERS: 1 | US FAERS | |
| 793 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 794 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 795 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 796 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 797 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 798 | Joint destruction | FAERS: 1 | US FAERS | |
| 799 | Joint warmth | FAERS: 1 | US FAERS | |
| 800 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 801 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 802 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 803 | Large intestine erosion | FAERS: 1 | US FAERS | |
| 804 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 805 | Laryngeal tremor | FAERS: 1 | US FAERS | |
| 806 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 807 | Libido disorder | FAERS: 1 | US FAERS | |
| 808 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 809 | Loose tooth | FAERS: 1 | US FAERS | |
| 810 | Lung Abscess | FAERS: 1 | US FAERS | |
| 811 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 812 | Lymphatic obstruction | FAERS: 1 | US FAERS | |
| 813 | Lymphocyte count abnormal | FAERS: 1 | US FAERS | |
| 814 | Malignant neoplasm of spinal cord | FAERS: 1 | US FAERS | |
| 815 | Malignant nipple neoplasm | FAERS: 1 | US FAERS | |
| 816 | Manufacturing product storage issue | FAERS: 1 | US FAERS | |
| 817 | Mastication disorder | FAERS: 1 | US FAERS | |
| 818 | Megakaryocytes decreased | FAERS: 1 | US FAERS | |
| 819 | Meningitis | FAERS: 1 | US FAERS | |
| 820 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 821 | Mental status changes | FAERS: 1 | US FAERS | |
| 822 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 823 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 824 | Microcytosis | FAERS: 1 | US FAERS | |
| 825 | Morning Sickness | FAERS: 1 | US FAERS | |
| 826 | Mucosal Infection | FAERS: 1 | US FAERS | |
| 827 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 828 | Myopia | FAERS: 1 | US FAERS | |
| 829 | Narcolepsy | FAERS: 1 | US FAERS | |
| 830 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 831 | Nephrectomy | FAERS: 1 | US FAERS | |
| 832 | Nephritis | FAERS: 1 | US FAERS | |
| 833 | Neutropenic colitis | FAERS: 1 | US FAERS | |
| 834 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 835 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 836 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 837 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 838 | Obesity | FAERS: 1 | US FAERS | |
| 839 | Obsessive-Compulsive Disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 840 | Obstructive nephropathy | FAERS: 1 | US FAERS | |
| 841 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 842 | Oncologic complication | FAERS: 1 | US FAERS | |
| 843 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 844 | Oral viral infection | FAERS: 1 | US FAERS | |
| 845 | Osteitis Deformans | FAERS: 1 | US FAERS | |
| 846 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 847 | Ovulation disorder | FAERS: 1 | US FAERS | |
| 848 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 849 | Papule | FAERS: 1 | US FAERS | |
| 850 | Paraplegia | FAERS: 1 | US FAERS | |
| 851 | Paratracheal lymphadenopathy | FAERS: 1 | US FAERS | |
| 852 | Pathologic myopia | FAERS: 1 | US FAERS | |
| 853 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 854 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 855 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 856 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 857 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 858 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 859 | Personality Change | FAERS: 1 | US FAERS | |
| 860 | Pertussis | FAERS: 1 | US FAERS | |
| 861 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 862 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 863 | Porokeratosis | FAERS: 1 | US FAERS | |
| 864 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 865 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 866 | Post procedural stroke | FAERS: 1 | US FAERS | |
| 867 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 868 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 869 | Product availability issue | FAERS: 1 | US FAERS | |
| 870 | Product closure issue | FAERS: 1 | US FAERS | |
| 871 | Product communication issue | FAERS: 1 | US FAERS | |
| 872 | Product container issue | FAERS: 1 | US FAERS | |
| 873 | Product counterfeit | FAERS: 1 | US FAERS | |
| 874 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 875 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 876 | Product label confusion | FAERS: 1 | US FAERS | |
| 877 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 878 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 879 | Product substitution issue | FAERS: 1 | US FAERS | |
| 880 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 881 | Protein total increased | FAERS: 1 | US FAERS | |
| 882 | Proteinuria | FAERS: 1 | US FAERS | |
| 883 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 884 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 885 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 886 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 887 | Pulmonary arterial pressure abnormal | FAERS: 1 | US FAERS | |
| 888 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 889 | Purpura | FAERS: 1 | US FAERS | |
| 890 | Pyomyositis | FAERS: 1 | US FAERS | |
| 891 | Radiation Fibrosis | FAERS: 1 | US FAERS | |
| 892 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 893 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 894 | Red cell distribution width abnormal | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 895 | Red cell distribution width decreased | FAERS: 1 | US FAERS | |
| 896 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 897 | Regurgitation | FAERS: 1 | US FAERS | |
| 898 | Renal Colic | FAERS: 1 | US FAERS | |
| 899 | Renal abscess | FAERS: 1 | US FAERS | |
| 900 | Renal cyst | FAERS: 1 | US FAERS | |
| 901 | Respiratory fume inhalation disorder | FAERS: 1 | US FAERS | |
| 902 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 903 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 904 | Retinitis | FAERS: 1 | US FAERS | |
| 905 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 906 | Rheumatic Fever | FAERS: 1 | US FAERS | |
| 907 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 908 | Right atrial enlargement | FAERS: 1 | US FAERS | |
| 909 | Rosacea | FAERS: 1 | US FAERS | |
| 910 | Salmonella test positive | FAERS: 1 | US FAERS | |
| 911 | Salpingo-oophorectomy | FAERS: 1 | US FAERS | |
| 912 | Sarcoma | FAERS: 1 | US FAERS | |
| 913 | Secondary cerebellar degeneration | FAERS: 1 | US FAERS | |
| 914 | Sensitive skin | FAERS: 1 | US FAERS | |
| 915 | Severe Acute Respiratory Syndrome | FAERS: 1 | US FAERS | |
| 916 | Sinus operation | FAERS: 1 | US FAERS | |
| 917 | Skin necrosis | FAERS: 1 | US FAERS | |
| 918 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 919 | Slow speech | FAERS: 1 | US FAERS | |
| 920 | Small intestine carcinoma metastatic | FAERS: 1 | US FAERS | |
| 921 | Solar lentigo | FAERS: 1 | US FAERS | |
| 922 | Somnambulism | FAERS: 1 | US FAERS | |
| 923 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 924 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 925 | Stomach scan abnormal | FAERS: 1 | US FAERS | |
| 926 | Streptococcal urinary tract infection | FAERS: 1 | US FAERS | |
| 927 | Suicide attempt | FAERS: 1 | US FAERS | |
| 928 | Sunburn | FAERS: 1 | US FAERS | |
| 929 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 930 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 931 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 932 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 933 | Suture rupture | FAERS: 1 | US FAERS | |
| 934 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 935 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 936 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 937 | Teeth brittle | FAERS: 1 | US FAERS | |
| 938 | Tethered Cord Syndrome | FAERS: 1 | US FAERS | |
| 939 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 940 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 941 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 942 | Thymoma | FAERS: 1 | US FAERS | |
| 943 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 944 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 945 | Tonsillitis | FAERS: 1 | US FAERS | |
| 946 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 947 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 948 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 949 | Trousseau's syndrome | FAERS: 1 | US FAERS | |
| 950 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 951 | Underweight | FAERS: 1 | US FAERS | |
| 952 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 953 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 954 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 955 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 956 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 957 | Urine ketone body | FAERS: 1 | US FAERS | |
| 958 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 959 | Vascular device infection | FAERS: 1 | US FAERS | |
| 960 | Vascular rupture | FAERS: 1 | US FAERS | |
| 961 | Vein collapse | FAERS: 1 | US FAERS | |
| 962 | Venous occlusion | FAERS: 1 | US FAERS | |
| 963 | Ventricular enlargement | FAERS: 1 | US FAERS | |
| 964 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 965 | Vital functions abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 966 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 967 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 968 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 969 | Walking aid user | FAERS: 1 | US FAERS | |
| 970 | Wound healing normal | FAERS: 1 | US FAERS | |
| 971 | Wound infection pseudomonas | FAERS: 1 | US FAERS | |
| 972 | Wrong dose | FAERS: 1 | US FAERS | |
| 973 | Wrong product administered | FAERS: 1 | US FAERS | |
| 974 | Yawning | FAERS: 1 | US FAERS | |
| 975 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 976 | Anemia | CTD | ||
| 977 | Brain Stem Neoplasms | 24098593 | CTD | |
| 978 | Chromosome Aberrations | 22751436 | CTD | |
| 979 | Diarrhea | 21610706 22090362 25524798 | CTD | |
| 980 | Exanthema | 21610706 | CTD | |
| 981 | Hyperglycemia | 21610706 | CTD | |
| 982 | Hyperplasia | 22508966 | CTD | |
| 983 | Hyponatremia | 21610706 | CTD | |
| 984 | Incorrect disposal of product | Canada Vigilance: 1 | Canada Vigilance | |
| 985 | Ketoacidosis | Canada Vigilance: 1 | Canada Vigilance | |
| 986 | Male Germ Cell Tumor | 19164198 | CTD | |
| 987 | Neoplasm Invasiveness | 22869556 | CTD | |
| 988 | Neoplasm Metastasis | 25501126 | CTD | |
| 989 | Neoplasms, Germ Cell and Embryonal | 25522918 | CTD | |
| 990 | Teratoma | 19164198 | CTD | |
| 991 | Testicular Neoplasms | 21610706 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.