Esomeprazole
(SUBDBMMJDZJVOS-DEOSSOPVSA-N)
Structure
- SMILES
- COc1ccc2c(c1)[nH]c(n2)[S@@](=O)Cc1ncc(c(c1C)OC)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- A02BC05; A02BD06; M01AE52
- Molecular Formula:
- C17H19N3O3S
- Molecular Weight:
- 345.416
- Log P:
- 3.7654
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 96.31
- CAS Number(s):
- 119141-88-7; 326602-80-6
Synonym(s)
1.
Esomeprazole
2.
Esomeprazole Magnesium
3.
Esomeprazole Potassium
4.
Esomeprazole Sodium
5.
Esomeprazole Strontium
6.
Esomeprazole Strontium Anhydrous
7.
Nexium
8.
Strontium, Esomeprazole
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 793 | US FAERS | |
| 2 | Acute kidney injury | FAERS: 759 | US FAERS | |
| 3 | Drug ineffective | FAERS: 516 Canada Vigilance: 249 | Canada Vigilance US FAERS | |
| 4 | Dyspepsia | FAERS: 428 Canada Vigilance: 40 | Canada Vigilance SIDER US FAERS | |
| 5 | Malaise | FAERS: 416 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 6 | Intentional product misuse | FAERS: 370 | US FAERS | |
| 7 | Osteoporosis | FAERS: 362 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Rebound acid hypersecretion | FAERS: 300 | US FAERS | |
| 9 | Pain | FAERS: 235 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 10 | Bone density decreased | FAERS: 231 | US FAERS | |
| 11 | Intentional drug misuse | FAERS: 222 | US FAERS | |
| 12 | Vomiting | FAERS: 202 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 13 | Abdominal discomfort | FAERS: 195 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 14 | Product use issue | FAERS: 162 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Feeling abnormal | FAERS: 147 | SIDER US FAERS | |
| 16 | Nausea | FAERS: 140 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 17 | Adverse event | FAERS: 131 | US FAERS | |
| 18 | Chest Pain | FAERS: 119 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 19 | Headache | FAERS: 84 Canada Vigilance: 18 | Canada Vigilance SIDER US FAERS | |
| 20 | Throat irritation | FAERS: 80 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 21 | Weight decreased | FAERS: 80 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 22 | Ulcer | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Product substitution issue | FAERS: 76 Canada Vigilance: 41 | Canada Vigilance US FAERS | |
| 24 | Aphagia | FAERS: 75 | US FAERS | |
| 25 | Oropharyngeal pain | FAERS: 59 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 26 | Product quality issue | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Intentional product use issue | FAERS: 57 | US FAERS | |
| 28 | Nasopharyngitis | FAERS: 56 | US FAERS | |
| 29 | Regurgitation | FAERS: 56 | US FAERS | |
| 30 | Abdominal Pain | FAERS: 53 Canada Vigilance: 16 | Canada Vigilance SIDER US FAERS | |
| 31 | Diabetes Mellitus | FAERS: 53 | US FAERS | |
| 32 | Chest discomfort | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 33 | Dizziness | FAERS: 46 Canada Vigilance: 20 | Canada Vigilance SIDER US FAERS | |
| 34 | Discomfort | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 35 | Anxiety | FAERS: 44 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 36 | Arthritis | FAERS: 44 | SIDER US FAERS | |
| 37 | Burning sensation | FAERS: 44 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 38 | Hyperchlorhydria | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Hypersensitivity | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 40 | Myocardial Infarction | FAERS: 42 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 41 | Arthralgia | FAERS: 41 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 42 | Flatulence | FAERS: 41 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 43 | Memory impairment | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 44 | Back Pain | FAERS: 40 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 45 | Cerebrovascular accident | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Eructation | FAERS: 39 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 47 | Influenza | FAERS: 36 | US FAERS | |
| 48 | Constipation | FAERS: 34 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 49 | Dysphonia | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Sleep disorder due to general medical condition, insomnia type | FAERS: 34 | US FAERS | |
| 51 | Blood magnesium decreased | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Fatigue | FAERS: 32 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 53 | Pneumonia | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 54 | Asthenia | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 55 | Irritable Bowel Syndrome | FAERS: 30 | US FAERS | |
| 56 | Bronchitis | FAERS: 29 | US FAERS | |
| 57 | Dysgeusia | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 58 | Product use in unapproved indication | FAERS: 29 | US FAERS | |
| 59 | Stress | FAERS: 29 | US FAERS | |
| 60 | Circumstance or information capable of leading to medication error | FAERS: 28 | US FAERS | |
| 61 | Choking | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Gastric ulcer | FAERS: 27 | SIDER US FAERS | |
| 63 | Urticaria | FAERS: 27 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 64 | Activities of daily living impaired | FAERS: 25 | US FAERS | |
| 65 | Hernia | FAERS: 25 | SIDER US FAERS | |
| 66 | Gastritis | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 67 | Nephrolithiasis | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Palpitations | FAERS: 22 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 69 | Pruritus | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 70 | Hypophagia | FAERS: 21 | US FAERS | |
| 71 | Sleep disorder due to a general medical condition | FAERS: 21 | US FAERS | |
| 72 | Therapy cessation | FAERS: 21 | US FAERS | |
| 73 | Visual Impairment | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Amnesia | FAERS: 20 | US FAERS | |
| 75 | Dehydration | FAERS: 20 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 76 | Diverticulitis | FAERS: 20 | US FAERS | |
| 77 | Malabsorption | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Myalgia | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 79 | Therapeutic response unexpected | FAERS: 20 | US FAERS | |
| 80 | Alopecia | FAERS: 19 | SIDER US FAERS | |
| 81 | Disease recurrence | FAERS: 19 | US FAERS | |
| 82 | Joint injury | FAERS: 19 | US FAERS | |
| 83 | Osteopenia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 84 | Tremor | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 85 | Crying | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 86 | Drug Dependence | FAERS: 17 | US FAERS | |
| 87 | Rebound effect | FAERS: 17 | US FAERS | |
| 88 | Fibromyalgia | FAERS: 16 | SIDER US FAERS | |
| 89 | Fracture | FAERS: 16 | US FAERS | |
| 90 | Blood cholesterol increased | FAERS: 15 | US FAERS | |
| 91 | Laryngitis | FAERS: 15 | US FAERS | |
| 92 | Retching | FAERS: 15 | US FAERS | |
| 93 | Rhabdomyolysis | FAERS: 15 | US FAERS | |
| 94 | Ankle Fracture | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Dementia | FAERS: 14 | US FAERS | |
| 96 | General physical health deterioration | FAERS: 14 | US FAERS | |
| 97 | Multiple allergies | FAERS: 14 | US FAERS | |
| 98 | Product dose omission | FAERS: 14 | US FAERS | |
| 99 | Back disorder | FAERS: 13 | US FAERS | |
| 100 | Blood potassium decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Musculoskeletal Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Vertigo | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 103 | Aphonia | FAERS: 12 | US FAERS | |
| 104 | Arthropathy | FAERS: 12 | SIDER US FAERS | |
| 105 | Impaired gastric emptying | FAERS: 12 | US FAERS | |
| 106 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 107 | Sinusitis | FAERS: 12 | SIDER US FAERS | |
| 108 | Urinary tract infection | FAERS: 12 | US FAERS | |
| 109 | Asthma | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 110 | Drug ineffective for unapproved indication | FAERS: 11 | US FAERS | |
| 111 | Impaired work ability | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 112 | Limb injury | FAERS: 11 | US FAERS | |
| 113 | Peripheral swelling | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 114 | Clostridium difficile infection | FAERS: 10 | US FAERS | |
| 115 | Drug prescribing error | FAERS: 10 | US FAERS | |
| 116 | Emotional distress | FAERS: 10 | US FAERS | |
| 117 | Incorrect drug administration duration | FAERS: 10 | US FAERS | |
| 118 | Nervousness | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 119 | Pancreatitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 120 | Rheumatoid Arthritis | FAERS: 10 | US FAERS | |
| 121 | Swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Therapeutic response changed | FAERS: 10 | US FAERS | |
| 123 | Bone pain | FAERS: 9 | US FAERS | |
| 124 | Chills | FAERS: 9 | SIDER US FAERS | |
| 125 | Deafness | FAERS: 9 | US FAERS | |
| 126 | Diabetic Ketoacidosis | FAERS: 9 | US FAERS | |
| 127 | Food Allergy | FAERS: 9 | US FAERS | |
| 128 | Intestinal Obstruction | FAERS: 9 | US FAERS | |
| 129 | Oral pain | FAERS: 9 | US FAERS | |
| 130 | Overdose | FAERS: 9 | US FAERS | |
| 131 | Sepsis | FAERS: 9 | US FAERS | |
| 132 | Somnolence | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 133 | Vitamin D Deficiency | FAERS: 9 | US FAERS | |
| 134 | nervous system disorder | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Blood glucose increased | FAERS: 8 | US FAERS | |
| 136 | Cataract | FAERS: 8 | US FAERS | |
| 137 | Erythema | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 138 | Gluten sensitivity | FAERS: 8 | US FAERS | |
| 139 | Musculoskeletal discomfort | FAERS: 8 | SIDER US FAERS | |
| 140 | Nerve injury | FAERS: 8 | US FAERS | |
| 141 | Oropharyngeal discomfort | FAERS: 8 | US FAERS | |
| 142 | Reaction to drug excipients | FAERS: 8 | US FAERS | |
| 143 | Thrombosis | FAERS: 8 | US FAERS | |
| 144 | Atrial Fibrillation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Bowel movement irregularity | FAERS: 7 | US FAERS | |
| 146 | Choking sensation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Colitis | FAERS: 7 | US FAERS | |
| 148 | Disability | FAERS: 7 | US FAERS | |
| 149 | Drug administered to patient of inappropriate age | FAERS: 7 | US FAERS | |
| 150 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 151 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 152 | Epilepsy | FAERS: 7 | US FAERS | |
| 153 | Feeling jittery | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Gastric pH decreased | FAERS: 7 | US FAERS | |
| 155 | Inappropriate schedule of drug administration | FAERS: 7 | US FAERS | |
| 156 | Infantile spitting up | FAERS: 7 | US FAERS | |
| 157 | Insurance issue | FAERS: 7 | US FAERS | |
| 158 | Joint swelling | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Limb discomfort | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 160 | Neck Pain | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 161 | Product physical issue | FAERS: 7 | US FAERS | |
| 162 | Productive Cough | FAERS: 7 | US FAERS | |
| 163 | Tetany | FAERS: 7 | US FAERS | |
| 164 | Tinnitus | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 165 | Toxic Epidermal Necrolysis | FAERS: 7 | SIDER US FAERS | |
| 166 | Agitation | FAERS: 6 | SIDER US FAERS | |
| 167 | Cholelithiasis | FAERS: 6 | US FAERS | |
| 168 | Depressed mood | FAERS: 6 | US FAERS | |
| 169 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 170 | Erythema Multiforme | FAERS: 6 | SIDER US FAERS | |
| 171 | Escherichia infection | FAERS: 6 | US FAERS | |
| 172 | Gastrointestinal Pain | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 173 | Gastrointestinal inflammation | FAERS: 6 | US FAERS | |
| 174 | Gastrointestinal ulcer | FAERS: 6 | US FAERS | |
| 175 | Impaired driving ability | FAERS: 6 | US FAERS | |
| 176 | Lip swelling | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 177 | Magnesium Deficiency | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Musculoskeletal stiffness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Osteogenesis Imperfecta | FAERS: 6 | US FAERS | |
| 180 | Pancreatic carcinoma | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 182 | Syncope | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Abasia | FAERS: 5 | US FAERS | |
| 184 | Atypical pneumonia | FAERS: 5 | US FAERS | |
| 185 | Blindness | FAERS: 5 | US FAERS | |
| 186 | Calcium deficiency | FAERS: 5 | US FAERS | |
| 187 | Drug effect delayed | FAERS: 5 | US FAERS | |
| 188 | Dysarthria | FAERS: 5 | US FAERS | |
| 189 | Emotional disorder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Extra dose administered | FAERS: 5 | US FAERS | |
| 191 | Hunger | FAERS: 5 | US FAERS | |
| 192 | Intervertebral Disc Degeneration | FAERS: 5 | US FAERS | |
| 193 | MYELODYSPLASTIC SYNDROME | FAERS: 5 | US FAERS | |
| 194 | Mental impairment | FAERS: 5 | US FAERS | |
| 195 | No adverse event | FAERS: 5 | US FAERS | |
| 196 | Pancytopenia | FAERS: 5 | SIDER US FAERS | |
| 197 | Peptic Ulcer | FAERS: 5 | US FAERS | |
| 198 | Poor quality sleep | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Psoriasis | FAERS: 5 | US FAERS | |
| 200 | Renal pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Screaming | FAERS: 5 | US FAERS | |
| 202 | Status Epilepticus | FAERS: 5 | US FAERS | |
| 203 | Suspected counterfeit product | FAERS: 5 | US FAERS | |
| 204 | Tachycardia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 205 | Urinary Retention | FAERS: 5 | US FAERS | |
| 206 | jaundice | FAERS: 5 | SIDER US FAERS | |
| 207 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 208 | Anger | FAERS: 4 | US FAERS | |
| 209 | Apparent death | FAERS: 4 | US FAERS | |
| 210 | Blood calcium abnormal | FAERS: 4 | US FAERS | |
| 211 | Blood chromogranin A increased | FAERS: 4 | US FAERS | |
| 212 | Blood magnesium abnormal | FAERS: 4 | US FAERS | |
| 213 | Blood urine present | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Bone density abnormal | FAERS: 4 | US FAERS | |
| 215 | Chromaturia | FAERS: 4 | US FAERS | |
| 216 | Dental caries | FAERS: 4 | US FAERS | |
| 217 | Epistaxis | FAERS: 4 | SIDER US FAERS | |
| 218 | Glaucoma | FAERS: 4 | US FAERS | |
| 219 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 220 | Increased upper airway secretion | FAERS: 4 | US FAERS | |
| 221 | Inflammation | FAERS: 4 | US FAERS | |
| 222 | Lactose Intolerance | FAERS: 4 | US FAERS | |
| 223 | Leukopenia | FAERS: 4 | SIDER US FAERS | |
| 224 | Lupus-like syndrome | FAERS: 4 | US FAERS | |
| 225 | Medication residue present | FAERS: 4 | US FAERS | |
| 226 | Middle insomnia | FAERS: 4 | US FAERS | |
| 227 | Neutropenia | FAERS: 4 | US FAERS | |
| 228 | Non-cardiac chest pain | FAERS: 4 | US FAERS | |
| 229 | Reflux gastritis | FAERS: 4 | US FAERS | |
| 230 | Respiratory tract congestion | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Respiratory tract irritation | FAERS: 4 | US FAERS | |
| 232 | Sneezing | FAERS: 4 | US FAERS | |
| 233 | Throat cancer | FAERS: 4 | US FAERS | |
| 234 | Tooth Loss | FAERS: 4 | US FAERS | |
| 235 | Unevaluable event | FAERS: 4 | US FAERS | |
| 236 | Wheezing | FAERS: 4 | US FAERS | |
| 237 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 238 | Acidosis | FAERS: 3 | US FAERS | |
| 239 | Amyotrophic Lateral Sclerosis | FAERS: 3 | US FAERS | |
| 240 | Angioedema | FAERS: 3 | SIDER US FAERS | |
| 241 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 242 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 243 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 244 | Blood creatinine increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 245 | Blood gastrin increased | FAERS: 3 | SIDER US FAERS | |
| 246 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 247 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 248 | Bursitis | FAERS: 3 | US FAERS | |
| 249 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 250 | Chronic gastritis | FAERS: 3 | US FAERS | |
| 251 | Cyanosis | FAERS: 3 | US FAERS | |
| 252 | Device occlusion | FAERS: 3 | US FAERS | |
| 253 | Diplopia | FAERS: 3 | US FAERS | |
| 254 | Duodenal Ulcer | FAERS: 3 | US FAERS | |
| 255 | Dysuria | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 256 | Ear discomfort | FAERS: 3 | US FAERS | |
| 257 | Flank Pain | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 258 | Food craving | FAERS: 3 | US FAERS | |
| 259 | Formication | FAERS: 3 | US FAERS | |
| 260 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 261 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 262 | Gastrooesophageal sphincter insufficiency | FAERS: 3 | US FAERS | |
| 263 | General symptom | FAERS: 3 | US FAERS | |
| 264 | Gout | FAERS: 3 | US FAERS | |
| 265 | Hypersomnia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 266 | Infarction | FAERS: 3 | US FAERS | |
| 267 | Infection | FAERS: 3 | SIDER US FAERS | |
| 268 | Iron deficiency | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 269 | Joint stiffness | FAERS: 3 | US FAERS | |
| 270 | Laryngospasm | FAERS: 3 | US FAERS | |
| 271 | Lethargy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 272 | Long QT Syndrome | FAERS: 3 | US FAERS | |
| 273 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 274 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 275 | Muscle tightness | FAERS: 3 | US FAERS | |
| 276 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 277 | Night sweats | FAERS: 3 | US FAERS | |
| 278 | Precancerous cells present | FAERS: 3 | US FAERS | |
| 279 | Precancerous mucosal lesion | FAERS: 3 | US FAERS | |
| 280 | Product difficult to swallow | FAERS: 3 | US FAERS | |
| 281 | Product packaging issue | FAERS: 3 | US FAERS | |
| 282 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 283 | Renal cyst | FAERS: 3 | US FAERS | |
| 284 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 285 | Restlessness | FAERS: 3 | US FAERS | |
| 286 | Sciatica | FAERS: 3 | US FAERS | |
| 287 | Septic Shock | FAERS: 3 | US FAERS | |
| 288 | Stomatitis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 289 | Thirst | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 290 | Tongue blistering | FAERS: 3 | US FAERS | |
| 291 | Tooth Erosion | FAERS: 3 | US FAERS | |
| 292 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 293 | Wrong patient received medication | FAERS: 3 | US FAERS | |
| 294 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 295 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 296 | Ageusia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 297 | Agoraphobia | FAERS: 2 | US FAERS | |
| 298 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 299 | Anaphylactic shock | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 300 | Anorectal discomfort | FAERS: 2 | SIDER US FAERS | |
| 301 | Aphasia | FAERS: 2 | US FAERS | |
| 302 | Appendicitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Ataxia | FAERS: 2 | US FAERS | |
| 304 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 305 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 306 | Blepharospasm | FAERS: 2 | US FAERS | |
| 307 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 308 | Blood iron abnormal | FAERS: 2 | US FAERS | |
| 309 | Blood iron decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Blood iron increased | FAERS: 2 | US FAERS | |
| 311 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 312 | Bronchospasm | FAERS: 2 | SIDER US FAERS | |
| 313 | Bruxism | FAERS: 2 | US FAERS | |
| 314 | Cardiac Arrest | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 315 | Cartilage injury | FAERS: 2 | US FAERS | |
| 316 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 317 | Claustrophobia | FAERS: 2 | US FAERS | |
| 318 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 319 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 320 | Cystitis | FAERS: 2 | SIDER US FAERS | |
| 321 | Delirium | FAERS: 2 | US FAERS | |
| 322 | Dermatitis | FAERS: 2 | SIDER US FAERS | |
| 323 | Disease Progression | FAERS: 2 | US FAERS | |
| 324 | Disorientation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | Diverticulum | FAERS: 2 | US FAERS | |
| 326 | Drug screen positive | FAERS: 2 | US FAERS | |
| 327 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 328 | Economic problem | FAERS: 2 | US FAERS | |
| 329 | Encephalitis | FAERS: 2 | US FAERS | |
| 330 | Endometriosis | FAERS: 2 | US FAERS | |
| 331 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 332 | Expired product administered | FAERS: 2 | US FAERS | |
| 333 | Eye irritation | FAERS: 2 | US FAERS | |
| 334 | False positive investigation result | FAERS: 2 | US FAERS | |
| 335 | Flushing | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 336 | Gastric infection | FAERS: 2 | US FAERS | |
| 337 | Gastric pH increased | FAERS: 2 | US FAERS | |
| 338 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 339 | Gastrointestinal mucosal disorder | FAERS: 2 | US FAERS | |
| 340 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 341 | Glossitis | FAERS: 2 | US FAERS | |
| 342 | Heat Stroke | FAERS: 2 | US FAERS | |
| 343 | Hemiplegia | FAERS: 2 | US FAERS | |
| 344 | Hernia pain | FAERS: 2 | US FAERS | |
| 345 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 346 | Hyperphagia | FAERS: 2 | US FAERS | |
| 347 | Hypokinesia | FAERS: 2 | US FAERS | |
| 348 | Hypoparathyroidism | FAERS: 2 | US FAERS | |
| 349 | Hypotension | FAERS: 2 | US FAERS | |
| 350 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 351 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 352 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 353 | Infrequent bowel movements | FAERS: 2 | US FAERS | |
| 354 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 355 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 356 | Kounis Syndrome | FAERS: 2 | US FAERS | |
| 357 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 358 | Ligament injury | FAERS: 2 | US FAERS | |
| 359 | Lymphoma | FAERS: 2 | US FAERS | |
| 360 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 361 | Malnutrition | FAERS: 2 | US FAERS | |
| 362 | Monoplegia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 363 | Negative thoughts | FAERS: 2 | US FAERS | |
| 364 | Neuralgia | FAERS: 2 | US FAERS | |
| 365 | Nodule | FAERS: 2 | SIDER US FAERS | |
| 366 | Obsessive thoughts | FAERS: 2 | US FAERS | |
| 367 | Ocular icterus | FAERS: 2 | US FAERS | |
| 368 | Panic Disorder | FAERS: 2 | US FAERS | |
| 369 | Paranoia | FAERS: 2 | US FAERS | |
| 370 | Periarthritis | FAERS: 2 | US FAERS | |
| 371 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 372 | Pharyngitis | FAERS: 2 | SIDER US FAERS | |
| 373 | Pleurothotonus | FAERS: 2 | US FAERS | |
| 374 | Post procedural complication | FAERS: 2 | US FAERS | |
| 375 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 376 | Product contamination | FAERS: 2 | US FAERS | |
| 377 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 378 | Renal Colic | FAERS: 2 | US FAERS | |
| 379 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 380 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 381 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 382 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 383 | Sinus headache | FAERS: 2 | US FAERS | |
| 384 | Sluggishness | FAERS: 2 | US FAERS | |
| 385 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 386 | Spondylolisthesis | FAERS: 2 | US FAERS | |
| 387 | Suicide attempt | FAERS: 2 | US FAERS | |
| 388 | Thermal burn | FAERS: 2 | US FAERS | |
| 389 | Thoracic vertebral fracture | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Throat clearing | FAERS: 2 | US FAERS | |
| 391 | Thrombocytopenia | FAERS: 2 | SIDER US FAERS | |
| 392 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 393 | Toothache | FAERS: 2 | US FAERS | |
| 394 | Transaminases increased | FAERS: 2 | US FAERS | |
| 395 | Uterine Cancer | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 396 | Vasculitis | FAERS: 2 | US FAERS | |
| 397 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 398 | kyphosis | FAERS: 2 | US FAERS | |
| 399 | Abdominal mass | FAERS: 1 | US FAERS | |
| 400 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 401 | Abscess | FAERS: 1 | US FAERS | |
| 402 | Abstains from alcohol | FAERS: 1 | US FAERS | |
| 403 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 404 | Accidental overdose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 405 | Achlorhydria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 406 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 407 | Acute psychosis | FAERS: 1 | US FAERS | |
| 408 | Agranulocytosis | FAERS: 1 | SIDER US FAERS | |
| 409 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 410 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 411 | Amblyopia | FAERS: 1 | US FAERS | |
| 412 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 413 | Anal Fissure | FAERS: 1 | US FAERS | |
| 414 | Anal abscess | FAERS: 1 | US FAERS | |
| 415 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 416 | Aneurysm | FAERS: 1 | US FAERS | |
| 417 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 418 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 419 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 420 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 421 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 422 | Apathy | FAERS: 1 | SIDER US FAERS | |
| 423 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 424 | Ascites | FAERS: 1 | US FAERS | |
| 425 | Aspartate Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 426 | Atelectasis | FAERS: 1 | US FAERS | |
| 427 | Auricular swelling | FAERS: 1 | US FAERS | |
| 428 | Autoimmune neutropenia | FAERS: 1 | US FAERS | |
| 429 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 430 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 431 | BK virus infection | FAERS: 1 | US FAERS | |
| 432 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 433 | Bedridden | FAERS: 1 | US FAERS | |
| 434 | Benzodiazepine drug level | FAERS: 1 | US FAERS | |
| 435 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 436 | Biopsy stomach abnormal | FAERS: 1 | US FAERS | |
| 437 | Biotin deficiency | FAERS: 1 | US FAERS | |
| 438 | Blepharitis | FAERS: 1 | US FAERS | |
| 439 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 440 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 441 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 442 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 443 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 444 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 445 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 446 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 447 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 448 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 449 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 450 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 451 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 452 | Blood urea increased | FAERS: 1 | US FAERS | |
| 453 | Bone decalcification | FAERS: 1 | US FAERS | |
| 454 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 455 | Bradycardia | FAERS: 1 | US FAERS | |
| 456 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 457 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 458 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 459 | Cardiac Flutter | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 460 | Catheter site pain | FAERS: 1 | US FAERS | |
| 461 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 462 | Cell Death | FAERS: 1 | US FAERS | |
| 463 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 464 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 465 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 466 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 467 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 468 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 469 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 470 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 471 | Cholangitis | FAERS: 1 | US FAERS | |
| 472 | Cholecystitis | FAERS: 1 | US FAERS | |
| 473 | Cholestasis | FAERS: 1 | US FAERS | |
| 474 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 475 | Clostridium difficile colitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 476 | Clumsiness | FAERS: 1 | US FAERS | |
| 477 | Congenital hearing disorder | FAERS: 1 | US FAERS | |
| 478 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 479 | Conversion disorder | FAERS: 1 | US FAERS | |
| 480 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 481 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 482 | Dependence | FAERS: 1 | US FAERS | |
| 483 | Depression suicidal | FAERS: 1 | US FAERS | |
| 484 | Device dislocation | FAERS: 1 | US FAERS | |
| 485 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 486 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 487 | Diet refusal | FAERS: 1 | US FAERS | |
| 488 | Dilatation intrahepatic duct acquired | FAERS: 1 | US FAERS | |
| 489 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 490 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 491 | Drug administration error | FAERS: 1 | US FAERS | |
| 492 | Drug effect variable | FAERS: 1 | US FAERS | |
| 493 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 494 | Drug level changed | FAERS: 1 | US FAERS | |
| 495 | Drug metabolising enzyme decreased | FAERS: 1 | US FAERS | |
| 496 | Drug resistance | FAERS: 1 | US FAERS | |
| 497 | Duodenitis | FAERS: 1 | SIDER US FAERS | |
| 498 | Dysgraphia | FAERS: 1 | US FAERS | |
| 499 | Dysplasia | FAERS: 1 | SIDER US FAERS | |
| 500 | Early satiety | FAERS: 1 | US FAERS | |
| 501 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 502 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 503 | Elbow deformity | FAERS: 1 | US FAERS | |
| 504 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 505 | Enterocolitis | FAERS: 1 | US FAERS | |
| 506 | Enzyme level abnormal | FAERS: 1 | US FAERS | |
| 507 | Epicondylitis | FAERS: 1 | US FAERS | |
| 508 | Erectile dysfunction | FAERS: 1 | SIDER US FAERS | |
| 509 | Erythropenia | FAERS: 1 | US FAERS | |
| 510 | Euphoric mood | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 511 | Expired drug administered | FAERS: 1 | US FAERS | |
| 512 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 513 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 514 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 515 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 516 | Food Poisoning | FAERS: 1 | US FAERS | |
| 517 | Frustration | FAERS: 1 | US FAERS | |
| 518 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 519 | Gastric Antral Vascular Ectasia | FAERS: 1 | US FAERS | |
| 520 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 521 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 522 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 523 | Gastroenteritis | FAERS: 1 | SIDER US FAERS | |
| 524 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 525 | Gastrointestinal candidiasis | FAERS: 1 | SIDER US FAERS | |
| 526 | Gastrointestinal stenosis | FAERS: 1 | US FAERS | |
| 527 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 528 | General physical condition | FAERS: 1 | US FAERS | |
| 529 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 530 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 531 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 532 | Granuloma | FAERS: 1 | US FAERS | |
| 533 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 534 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 535 | Hepatitis C | FAERS: 1 | US FAERS | |
| 536 | Hepatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 537 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 538 | Hirsutism | FAERS: 1 | US FAERS | |
| 539 | Histamine level increased | FAERS: 1 | US FAERS | |
| 540 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 541 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 542 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 543 | Hyperventilation | FAERS: 1 | US FAERS | |
| 544 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 545 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 546 | Hypoxia | FAERS: 1 | US FAERS | |
| 547 | Ileal Stenosis | FAERS: 1 | US FAERS | |
| 548 | Illness anxiety disorder | FAERS: 1 | US FAERS | |
| 549 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 550 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 551 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 552 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 553 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 554 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 555 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 556 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 557 | Initial insomnia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 558 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 559 | Injury associated with device | FAERS: 1 | US FAERS | |
| 560 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 561 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 562 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 563 | Intestinal cyst | FAERS: 1 | US FAERS | |
| 564 | Intrinsic Factor Deficiency | FAERS: 1 | US FAERS | |
| 565 | Joint laxity | FAERS: 1 | US FAERS | |
| 566 | Ketosis | FAERS: 1 | US FAERS | |
| 567 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 568 | Leptospirosis | FAERS: 1 | US FAERS | |
| 569 | Lichenification | FAERS: 1 | US FAERS | |
| 570 | Ligament rupture | FAERS: 1 | US FAERS | |
| 571 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 572 | Lip neoplasm malignant stage unspecified | FAERS: 1 | US FAERS | |
| 573 | Lipoma | FAERS: 1 | US FAERS | |
| 574 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 575 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 576 | Lyme Disease | FAERS: 1 | US FAERS | |
| 577 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 578 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 579 | Lymphopenia | FAERS: 1 | US FAERS | |
| 580 | Macular degeneration | FAERS: 1 | US FAERS | |
| 581 | Marasmus | FAERS: 1 | US FAERS | |
| 582 | Mastication disorder | FAERS: 1 | US FAERS | |
| 583 | Mastocytosis | FAERS: 1 | US FAERS | |
| 584 | Medication Error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 585 | Menopause | FAERS: 1 | US FAERS | |
| 586 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 587 | Metastasis | FAERS: 1 | US FAERS | |
| 588 | Milk soy protein intolerance | FAERS: 1 | US FAERS | |
| 589 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 590 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 591 | Mood swings | FAERS: 1 | US FAERS | |
| 592 | Motion Sickness | FAERS: 1 | US FAERS | |
| 593 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 594 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 595 | Muscle strain | FAERS: 1 | US FAERS | |
| 596 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 597 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 598 | Myocarditis | FAERS: 1 | US FAERS | |
| 599 | Myopathy | FAERS: 1 | US FAERS | |
| 600 | Myositis | FAERS: 1 | US FAERS | |
| 601 | Nasopharyngeal reflux | FAERS: 1 | US FAERS | |
| 602 | Nephritis | FAERS: 1 | US FAERS | |
| 603 | Obesity | FAERS: 1 | US FAERS | |
| 604 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 605 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 606 | Oliguria | FAERS: 1 | US FAERS | |
| 607 | Opisthotonus | FAERS: 1 | US FAERS | |
| 608 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 609 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 610 | Osteitis | FAERS: 1 | US FAERS | |
| 611 | Overgrowth fungal | FAERS: 1 | US FAERS | |
| 612 | Pain of skin | FAERS: 1 | US FAERS | |
| 613 | Pallor | FAERS: 1 | US FAERS | |
| 614 | Patellofemoral Pain Syndrome | FAERS: 1 | US FAERS | |
| 615 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 616 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 617 | Performance status decreased | FAERS: 1 | US FAERS | |
| 618 | Pericarditis | FAERS: 1 | US FAERS | |
| 619 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 620 | Personality Change | FAERS: 1 | US FAERS | |
| 621 | Pharyngeal erosion | FAERS: 1 | US FAERS | |
| 622 | Photophobia | FAERS: 1 | US FAERS | |
| 623 | Physical disability | FAERS: 1 | US FAERS | |
| 624 | Physical product label issue | FAERS: 1 | US FAERS | |
| 625 | Piloerection | FAERS: 1 | US FAERS | |
| 626 | Pleurisy | FAERS: 1 | US FAERS | |
| 627 | Poisoning | FAERS: 1 | US FAERS | |
| 628 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 629 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 630 | Post procedural infection | FAERS: 1 | US FAERS | |
| 631 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 632 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 633 | Pregnancy | FAERS: 1 | US FAERS | |
| 634 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 635 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 636 | Presyncope | FAERS: 1 | US FAERS | |
| 637 | Primary Biliary Cholangitis | FAERS: 1 | US FAERS | |
| 638 | Proctitis | FAERS: 1 | US FAERS | |
| 639 | Product complaint | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 640 | Product contamination physical | FAERS: 1 | US FAERS | |
| 641 | Product dispensing error | FAERS: 1 | US FAERS | |
| 642 | Product formulation issue | FAERS: 1 | US FAERS | |
| 643 | Product impurity | FAERS: 1 | US FAERS | |
| 644 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 645 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 646 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 647 | Product preparation error | FAERS: 1 | US FAERS | |
| 648 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 649 | Product storage error | FAERS: 1 | US FAERS | |
| 650 | Product use complaint | FAERS: 1 | US FAERS | |
| 651 | Protein total decreased | FAERS: 1 | US FAERS | |
| 652 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 653 | Purulence | FAERS: 1 | US FAERS | |
| 654 | Rash erythematous | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 655 | Reaction to excipient | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 656 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 657 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 658 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 659 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 660 | Renal tubular injury | FAERS: 1 | US FAERS | |
| 661 | Respiratory distress | FAERS: 1 | US FAERS | |
| 662 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 663 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 664 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 665 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 666 | Rosacea | FAERS: 1 | US FAERS | |
| 667 | Saliva altered | FAERS: 1 | US FAERS | |
| 668 | Scab | FAERS: 1 | US FAERS | |
| 669 | Schizophrenia | FAERS: 1 | US FAERS | |
| 670 | Secretion discharge | FAERS: 1 | US FAERS | |
| 671 | Sinus perforation | FAERS: 1 | US FAERS | |
| 672 | Skeletal injury | FAERS: 1 | US FAERS | |
| 673 | Skin lesion | FAERS: 1 | US FAERS | |
| 674 | Skin reaction | FAERS: 1 | US FAERS | |
| 675 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 676 | Small intestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 677 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 678 | Spinal fusion acquired | FAERS: 1 | US FAERS | |
| 679 | Spondylolysis | FAERS: 1 | US FAERS | |
| 680 | Stevens-Johnson Syndrome | FAERS: 1 Canada Vigilance: 1 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 681 | Supraventricular tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 682 | Suture insertion | FAERS: 1 | US FAERS | |
| 683 | Suture related complication | FAERS: 1 | US FAERS | |
| 684 | Synovitis | FAERS: 1 | US FAERS | |
| 685 | Systemic Scleroderma | FAERS: 1 | US FAERS | |
| 686 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 687 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 688 | Tension Headache | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 689 | Tension | FAERS: 1 | SIDER US FAERS | |
| 690 | Terminal state | FAERS: 1 | US FAERS | |
| 691 | Therapeutic product ineffective | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 692 | Therapy change | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 693 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 694 | Tongue eruption | FAERS: 1 | US FAERS | |
| 695 | Tooth Infection | FAERS: 1 | US FAERS | |
| 696 | Torticollis | FAERS: 1 | US FAERS | |
| 697 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 698 | Tracheostomy malfunction | FAERS: 1 | US FAERS | |
| 699 | Transcription medication error | FAERS: 1 | US FAERS | |
| 700 | Trismus | FAERS: 1 | US FAERS | |
| 701 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 702 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 703 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 704 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 705 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 706 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 707 | Vagus Nerve Disorder | FAERS: 1 | US FAERS | |
| 708 | Vascular calcification | FAERS: 1 | US FAERS | |
| 709 | Vascular rupture | FAERS: 1 | US FAERS | |
| 710 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 711 | Venous occlusion | FAERS: 1 | US FAERS | |
| 712 | Vitamin B6 decreased | FAERS: 1 | US FAERS | |
| 713 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 714 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 715 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 716 | Vocal cord cyst | FAERS: 1 | US FAERS | |
| 717 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 718 | Water Intoxication | FAERS: 1 | US FAERS | |
| 719 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 720 | Yawning | FAERS: 1 | US FAERS | |
| 721 | muscle injury | FAERS: 1 | US FAERS | |
| 722 | prostatitis | FAERS: 1 | US FAERS | |
| 723 | treatment failure | FAERS: 1 | US FAERS | |
| 724 | Abnormal vision | SIDER | ||
| 725 | Alanine Aminotransferase Increased | SIDER | ||
| 726 | Albuminuria | SIDER | ||
| 727 | Anorexia | SIDER | ||
| 728 | Arthritis aggravated | SIDER | ||
| 729 | Asthma aggravated | SIDER | ||
| 730 | Bladder pain | SIDER | ||
| 731 | Blood alkaline phosphatase increased | SIDER | ||
| 732 | Cleft Palate | Canada Vigilance: 1 | Canada Vigilance | |
| 733 | Conjunctivitis | SIDER | ||
| 734 | Constipation aggravated | SIDER | ||
| 735 | Creatinine increased | SIDER | ||
| 736 | Depression aggravated | SIDER | ||
| 737 | Enlargement abdomen | SIDER | ||
| 738 | Eosinophilia | Canada Vigilance: 1 | Canada Vigilance | |
| 739 | Eosinophilic Fasciitis | Canada Vigilance: 1 | Canada Vigilance | |
| 740 | Epigastric pain | SIDER | ||
| 741 | Flat affect | SIDER | ||
| 742 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 743 | Glycosuria | SIDER | ||
| 744 | Head discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 745 | Hepatic Encephalopathy | SIDER | ||
| 746 | Ileus | Canada Vigilance: 1 | Canada Vigilance | |
| 747 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 748 | Infertility | Canada Vigilance: 1 | Canada Vigilance | |
| 749 | Infestation | SIDER | ||
| 750 | Leg edema | SIDER | ||
| 751 | Leukocytosis | SIDER | ||
| 752 | Lymphadenopathy | SIDER | ||
| 753 | Migraine aggravated | SIDER | ||
| 754 | Oral administration complication | Canada Vigilance: 1 | Canada Vigilance | |
| 755 | Oral mucosal eruption | Canada Vigilance: 1 | Canada Vigilance | |
| 756 | Otitis Media | SIDER | ||
| 757 | Polymyalgia Rheumatica | SIDER | ||
| 758 | Polyuria | SIDER | ||
| 759 | Product compounding quality issue | Canada Vigilance: 1 | Canada Vigilance | |
| 760 | Product size issue | Canada Vigilance: 1 | Canada Vigilance | |
| 761 | Product substitution | Canada Vigilance: 1 | Canada Vigilance | |
| 762 | Product used for unknown indication | Canada Vigilance: 1 | Canada Vigilance | |
| 763 | Retrosternal pain | SIDER | ||
| 764 | Rhinitis | SIDER | ||
| 765 | Scotoma | SIDER | ||
| 766 | Serum gastrin increased | SIDER | ||
| 767 | Shock | SIDER | ||
| 768 | Therapeutic product effect decreased | Canada Vigilance: 3 | Canada Vigilance | |
| 769 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 770 | Therapy non-responder | Canada Vigilance: 1 | Canada Vigilance | |
| 771 | Tongue discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 772 | Ulcerative stomatitis | SIDER | ||
| 773 | Urine output increased | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.