Exenatide
(HTQBXNHDCUEHJF-XWLPCZSASA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)NCC(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N)CO)C)CO)CO)CC(=O)N)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)CNC(=O)[C@@H](NC(=O)CNC(=O)[C@H](Cc1nc[nH]c1)N)CCC(=O)O)Cc1ccccc1)CO)CC(=O)O)CC(C)C)CO)CCCCN)CCC(=O)N)CCSC)CCC(=O)O)CCC(=O)O)CCC(=O)O)C)CCCNC(=N)N)CC(C)C)Cc1ccccc1)CCC(=O)O)CC(C)C
- Molecular Formula:
- C184H282N50O60S
- Molecular Weight:
- 4186.570
- Log P:
- -2.1694
- Hydrogen Bond Acceptor:
- 109
- Hydrogen Bond Donor:
- 58
- TPSA:
- 1775.05
- CAS Number(s):
- 141758-74-9
Synonym(s)
1.
Exenatide
2.
AC 2993
3.
AC 2993 LAR
4.
Bydureon
5.
Byetta
6.
Ex4 Peptide
7.
Exendin 4
8.
Exendin-4
9.
ITCA 650
10.
Peptide, Ex4
External Link(s)
| MeSH | D000077270 |
| PubChem Compound | 56947125 91935542 45588096 16157882 |
| BindingDB | 50241203 |
| CHEMBL | CHEMBL414357 |
| DrugCentral | 1123 |
| Therapeutic Target Database | D00YVF |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood glucose increased | FAERS: 3617 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Weight decreased | FAERS: 3229 | SIDER US FAERS | |
| 3 | Nausea | FAERS: 2519 Canada Vigilance: 2 | 19171732 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Pancreatitis | FAERS: 1434 | US FAERS | |
| 5 | Injection site pain | FAERS: 1233 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 6 | Vomiting | FAERS: 983 Canada Vigilance: 1 | 19171732 | CTD SIDER Canada Vigilance US FAERS |
| 7 | Injection site nodule | FAERS: 832 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 8 | Product quality issue | FAERS: 805 | US FAERS | |
| 9 | Injection site mass | FAERS: 663 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 10 | Blood glucose decreased | FAERS: 661 | SIDER US FAERS | |
| 11 | Malaise | FAERS: 604 | US FAERS | |
| 12 | Injection site bruising | FAERS: 602 | US FAERS | |
| 13 | Incorrect dose administered | FAERS: 555 | US FAERS | |
| 14 | Drug dose omission | FAERS: 554 | US FAERS | |
| 15 | Injection site extravasation | FAERS: 514 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Injection site pruritus | FAERS: 473 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Drug ineffective | FAERS: 446 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Pancreatic carcinoma | FAERS: 420 | US FAERS | |
| 19 | Device malfunction | FAERS: 403 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Dizziness | FAERS: 402 | SIDER US FAERS | |
| 21 | Feeling abnormal | FAERS: 392 | US FAERS | |
| 22 | Headache | FAERS: 362 | SIDER US FAERS | |
| 23 | Injection site erythema | FAERS: 362 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Blood glucose abnormal | FAERS: 307 | US FAERS | |
| 25 | Intentional product misuse | FAERS: 298 | US FAERS | |
| 26 | Fatigue | FAERS: 287 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Medication Error | FAERS: 283 | US FAERS | |
| 28 | Abdominal Pain | FAERS: 247 | SIDER US FAERS | |
| 29 | Constipation | FAERS: 230 | SIDER US FAERS | |
| 30 | Asthenia | FAERS: 216 | SIDER US FAERS | |
| 31 | Circumstance or information capable of leading to medication error | FAERS: 211 | US FAERS | |
| 32 | Urticaria | FAERS: 192 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Wrong technique in product usage process | FAERS: 183 | US FAERS | |
| 34 | Dyspepsia | FAERS: 182 | SIDER US FAERS | |
| 35 | Blood glucose fluctuation | FAERS: 171 | US FAERS | |
| 36 | Needle issue | FAERS: 171 | US FAERS | |
| 37 | Pruritus | FAERS: 170 | SIDER US FAERS | |
| 38 | Injection site irritation | FAERS: 167 | US FAERS | |
| 39 | Tremor | FAERS: 165 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Pain | FAERS: 164 | US FAERS | |
| 41 | Injection site urticaria | FAERS: 161 | US FAERS | |
| 42 | Wrong technique in device usage process | FAERS: 146 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Device leakage | FAERS: 142 | US FAERS | |
| 44 | Injection Site Reaction | FAERS: 142 | SIDER US FAERS | |
| 45 | Abdominal discomfort | FAERS: 141 | SIDER US FAERS | |
| 46 | Intentional device misuse | FAERS: 138 | US FAERS | |
| 47 | Anorexia | FAERS: 136 | SIDER US FAERS | |
| 48 | Nodule | FAERS: 133 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Nasopharyngitis | FAERS: 129 | SIDER US FAERS | |
| 50 | Drug administration error | FAERS: 119 | US FAERS | |
| 51 | Eructation | FAERS: 114 | SIDER US FAERS | |
| 52 | Accidental needle stick | FAERS: 105 | US FAERS | |
| 53 | Diabetes mellitus inadequate control | FAERS: 104 | US FAERS | |
| 54 | Early satiety | FAERS: 99 | US FAERS | |
| 55 | Feeling jittery | FAERS: 99 | SIDER US FAERS | |
| 56 | Product use issue | FAERS: 99 | US FAERS | |
| 57 | Accidental overdose | FAERS: 97 | US FAERS | |
| 58 | Hypersensitivity | FAERS: 97 | SIDER US FAERS | |
| 59 | Dehydration | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Nervousness | FAERS: 94 | SIDER US FAERS | |
| 61 | Back Pain | FAERS: 92 | SIDER US FAERS | |
| 62 | Dysgeusia | FAERS: 91 | SIDER US FAERS | |
| 63 | Flatulence | FAERS: 90 | SIDER US FAERS | |
| 64 | Chills | FAERS: 88 | SIDER US FAERS | |
| 65 | Somnolence | FAERS: 87 | SIDER US FAERS | |
| 66 | Drug ineffective for unapproved indication | FAERS: 86 | US FAERS | |
| 67 | Therapeutic response unexpected | FAERS: 86 | US FAERS | |
| 68 | Chest Pain | FAERS: 84 | SIDER US FAERS | |
| 69 | Hunger | FAERS: 82 | US FAERS | |
| 70 | Adverse event | FAERS: 80 | US FAERS | |
| 71 | Cholelithiasis | FAERS: 80 | US FAERS | |
| 72 | Influenza | FAERS: 80 | SIDER US FAERS | |
| 73 | Alopecia | FAERS: 76 | SIDER US FAERS | |
| 74 | Myocardial Infarction | FAERS: 74 | US FAERS | |
| 75 | Lipase increased | FAERS: 70 | US FAERS | |
| 76 | Anxiety | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Visual Impairment | FAERS: 67 | US FAERS | |
| 78 | Pneumonia | FAERS: 63 | US FAERS | |
| 79 | Cerebrovascular accident | FAERS: 61 | US FAERS | |
| 80 | Drug prescribing error | FAERS: 60 | US FAERS | |
| 81 | Unevaluable event | FAERS: 59 | US FAERS | |
| 82 | Erythema | FAERS: 58 | SIDER US FAERS | |
| 83 | Palpitations | FAERS: 58 | US FAERS | |
| 84 | Feeling Cold | FAERS: 57 | US FAERS | |
| 85 | Product dose omission | FAERS: 57 | US FAERS | |
| 86 | Injection site injury | FAERS: 56 | US FAERS | |
| 87 | Memory impairment | FAERS: 55 | US FAERS | |
| 88 | Arthralgia | FAERS: 54 | SIDER US FAERS | |
| 89 | Drug dispensing error | FAERS: 54 | US FAERS | |
| 90 | Impaired gastric emptying | FAERS: 54 | US FAERS | |
| 91 | Incorrect dose administered by device | FAERS: 52 | US FAERS | |
| 92 | Overdose | FAERS: 49 | US FAERS | |
| 93 | Syncope | FAERS: 49 | US FAERS | |
| 94 | Arthritis | FAERS: 48 | US FAERS | |
| 95 | Incorrect product storage | FAERS: 48 | US FAERS | |
| 96 | Injury associated with device | FAERS: 48 | US FAERS | |
| 97 | Pharmaceutical product complaint | FAERS: 48 | US FAERS | |
| 98 | Wrong technique in drug usage process | FAERS: 48 | US FAERS | |
| 99 | Injection site discomfort | FAERS: 47 | US FAERS | |
| 100 | Device Failure | FAERS: 46 | US FAERS | |
| 101 | Urinary tract infection | FAERS: 46 | SIDER US FAERS | |
| 102 | Product use in unapproved indication | FAERS: 45 | US FAERS | |
| 103 | Injection site warmth | FAERS: 44 | US FAERS | |
| 104 | Cataract | FAERS: 42 | US FAERS | |
| 105 | Stress | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Swelling | FAERS: 41 | US FAERS | |
| 107 | Myalgia | FAERS: 39 | US FAERS | |
| 108 | Burning sensation | FAERS: 38 | US FAERS | |
| 109 | Blood triglycerides increased | FAERS: 37 | US FAERS | |
| 110 | Nephrolithiasis | FAERS: 37 | US FAERS | |
| 111 | Sinusitis | FAERS: 35 | SIDER US FAERS | |
| 112 | Chest discomfort | FAERS: 34 | US FAERS | |
| 113 | Blood creatinine increased | FAERS: 33 | SIDER US FAERS | |
| 114 | Product packaging quantity issue | FAERS: 33 | US FAERS | |
| 115 | Cellulitis | FAERS: 32 | US FAERS | |
| 116 | Device defective | FAERS: 32 | US FAERS | |
| 117 | Dysphonia | FAERS: 32 | US FAERS | |
| 118 | Lethargy | FAERS: 32 | US FAERS | |
| 119 | Retching | FAERS: 32 | US FAERS | |
| 120 | Oropharyngeal pain | FAERS: 29 | SIDER US FAERS | |
| 121 | Visual disturbance | FAERS: 29 | US FAERS | |
| 122 | Angioedema | FAERS: 28 | SIDER US FAERS | |
| 123 | Blood amylase increased | FAERS: 28 | US FAERS | |
| 124 | Flushing | FAERS: 28 | US FAERS | |
| 125 | Injection site inflammation | FAERS: 28 | US FAERS | |
| 126 | Depressed mood | FAERS: 27 | US FAERS | |
| 127 | Hypotension | FAERS: 27 | US FAERS | |
| 128 | Vertigo | FAERS: 27 | US FAERS | |
| 129 | Lip swelling | FAERS: 26 | US FAERS | |
| 130 | Atrial Fibrillation | FAERS: 25 | US FAERS | |
| 131 | Bronchitis | FAERS: 25 | US FAERS | |
| 132 | Cold sweat | FAERS: 24 | US FAERS | |
| 133 | Inappropriate schedule of drug administration | FAERS: 24 | US FAERS | |
| 134 | Injection site abscess | FAERS: 24 | US FAERS | |
| 135 | Device difficult to use | FAERS: 23 | US FAERS | |
| 136 | Discomfort | FAERS: 23 | US FAERS | |
| 137 | Hypophagia | FAERS: 23 | US FAERS | |
| 138 | Product solubility abnormal | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Expired product administered | FAERS: 22 | US FAERS | |
| 140 | Hyperchlorhydria | FAERS: 22 | US FAERS | |
| 141 | Pulmonary Embolism | FAERS: 22 | US FAERS | |
| 142 | Diabetic Ketoacidosis | FAERS: 21 | US FAERS | |
| 143 | Disorientation | FAERS: 21 | US FAERS | |
| 144 | Drug exposure during pregnancy | FAERS: 21 | US FAERS | |
| 145 | Peripheral swelling | FAERS: 21 | US FAERS | |
| 146 | jaundice | FAERS: 21 | US FAERS | |
| 147 | Cystitis | FAERS: 20 | US FAERS | |
| 148 | Diverticulitis | FAERS: 20 | US FAERS | |
| 149 | Food craving | FAERS: 20 | US FAERS | |
| 150 | General physical health deterioration | FAERS: 20 | US FAERS | |
| 151 | Sepsis | FAERS: 20 | US FAERS | |
| 152 | Amnesia | FAERS: 19 | US FAERS | |
| 153 | Blindness | FAERS: 19 | US FAERS | |
| 154 | No adverse event | FAERS: 19 | US FAERS | |
| 155 | Tachycardia | FAERS: 19 | 18420740 | CTD SIDER US FAERS |
| 156 | Arthropathy | FAERS: 18 | US FAERS | |
| 157 | Frustration tolerance decreased | FAERS: 18 | US FAERS | |
| 158 | Hypersomnia | FAERS: 18 | US FAERS | |
| 159 | Injection site scar | FAERS: 18 | US FAERS | |
| 160 | Intentional product use issue | FAERS: 18 | US FAERS | |
| 161 | Cholecystitis | FAERS: 17 | US FAERS | |
| 162 | Infection | FAERS: 17 | SIDER US FAERS | |
| 163 | Intentional drug misuse | FAERS: 17 | US FAERS | |
| 164 | Joint swelling | FAERS: 17 | US FAERS | |
| 165 | Limb injury | FAERS: 17 | US FAERS | |
| 166 | Musculoskeletal Pain | FAERS: 17 | SIDER US FAERS | |
| 167 | Thrombosis | FAERS: 17 | US FAERS | |
| 168 | Acute kidney injury | FAERS: 16 | US FAERS | |
| 169 | Anaphylactic shock | FAERS: 16 | SIDER US FAERS | |
| 170 | Cardiac Arrest | FAERS: 16 | US FAERS | |
| 171 | Diabetes Mellitus | FAERS: 16 | SIDER US FAERS | |
| 172 | Epistaxis | FAERS: 16 | US FAERS | |
| 173 | Gout | FAERS: 16 | US FAERS | |
| 174 | Injection site vesicles | FAERS: 16 | US FAERS | |
| 175 | Intestinal Obstruction | FAERS: 16 | US FAERS | |
| 176 | Presyncope | FAERS: 16 | US FAERS | |
| 177 | Device use issue | FAERS: 15 | US FAERS | |
| 178 | Hepatitis | FAERS: 15 | US FAERS | |
| 179 | Pancreatic Cyst | FAERS: 15 | US FAERS | |
| 180 | Pancreatic enzymes increased | FAERS: 15 | US FAERS | |
| 181 | Pharyngolaryngeal Pain | FAERS: 15 | US FAERS | |
| 182 | Therapy cessation | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Chromaturia | FAERS: 14 | US FAERS | |
| 184 | Dry skin | FAERS: 14 | US FAERS | |
| 185 | Infrequent bowel movements | FAERS: 14 | US FAERS | |
| 186 | Injection site hypersensitivity | FAERS: 14 | US FAERS | |
| 187 | Injection site infection | FAERS: 14 | US FAERS | |
| 188 | Sluggishness | FAERS: 14 | US FAERS | |
| 189 | Thirst | FAERS: 14 | US FAERS | |
| 190 | Angina Pectoris | FAERS: 13 | US FAERS | |
| 191 | Asthma | FAERS: 13 | US FAERS | |
| 192 | Colitis | FAERS: 13 | US FAERS | |
| 193 | Food aversion | FAERS: 13 | US FAERS | |
| 194 | Gastritis | FAERS: 13 | US FAERS | |
| 195 | Injection site coldness | FAERS: 13 | US FAERS | |
| 196 | Musculoskeletal chest pain | FAERS: 13 | US FAERS | |
| 197 | Neck Pain | FAERS: 13 | US FAERS | |
| 198 | Shock | FAERS: 13 | US FAERS | |
| 199 | Bowel movement irregularity | FAERS: 12 | US FAERS | |
| 200 | Incorrect route of drug administration | FAERS: 12 | US FAERS | |
| 201 | Toothache | FAERS: 12 | SIDER US FAERS | |
| 202 | Ageusia | FAERS: 11 | US FAERS | |
| 203 | Agitation | FAERS: 11 | US FAERS | |
| 204 | Anger | FAERS: 11 | US FAERS | |
| 205 | Blood cholesterol increased | FAERS: 11 | US FAERS | |
| 206 | Deep Vein Thrombosis | FAERS: 11 | US FAERS | |
| 207 | Device use error | FAERS: 11 | US FAERS | |
| 208 | Dysuria | FAERS: 11 | US FAERS | |
| 209 | Hernia | FAERS: 11 | US FAERS | |
| 210 | Respiratory Failure | FAERS: 11 | US FAERS | |
| 211 | Skin reaction | FAERS: 11 | US FAERS | |
| 212 | Throat irritation | FAERS: 11 | US FAERS | |
| 213 | Acute myocardial infarction | FAERS: 10 | US FAERS | |
| 214 | Ankle Fracture | FAERS: 10 | US FAERS | |
| 215 | Circumstance or information capable of leading to device use error | FAERS: 10 | US FAERS | |
| 216 | Deafness | FAERS: 10 | US FAERS | |
| 217 | Flank Pain | FAERS: 10 | US FAERS | |
| 218 | Injection site cellulitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Lymphoma | FAERS: 10 | US FAERS | |
| 220 | Musculoskeletal stiffness | FAERS: 10 | US FAERS | |
| 221 | Product storage error | FAERS: 10 | US FAERS | |
| 222 | Rash erythematous | FAERS: 10 | US FAERS | |
| 223 | Renal pain | FAERS: 10 | US FAERS | |
| 224 | Sneezing | FAERS: 10 | US FAERS | |
| 225 | Tinnitus | FAERS: 10 | US FAERS | |
| 226 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 227 | Appendicitis | FAERS: 9 | US FAERS | |
| 228 | Back disorder | FAERS: 9 | US FAERS | |
| 229 | Cyst | FAERS: 9 | US FAERS | |
| 230 | Depressed Level of Consciousness | FAERS: 9 | US FAERS | |
| 231 | Drug effect incomplete | FAERS: 9 | US FAERS | |
| 232 | Extra dose administered | FAERS: 9 | US FAERS | |
| 233 | Eye irritation | FAERS: 9 | US FAERS | |
| 234 | Gastric Bypass | FAERS: 9 | US FAERS | |
| 235 | Gastroenteritis | FAERS: 9 | SIDER US FAERS | |
| 236 | Gastrointestinal Pain | FAERS: 9 | SIDER US FAERS | |
| 237 | Injection site cyst | FAERS: 9 | US FAERS | |
| 238 | Liquid product physical issue | FAERS: 9 | US FAERS | |
| 239 | Lymphadenopathy | FAERS: 9 | US FAERS | |
| 240 | Musculoskeletal discomfort | FAERS: 9 | SIDER US FAERS | |
| 241 | Obesity | FAERS: 9 | US FAERS | |
| 242 | Overweight | FAERS: 9 | US FAERS | |
| 243 | Pancreatic Neoplasm | FAERS: 9 | US FAERS | |
| 244 | Product compounding quality issue | FAERS: 9 | US FAERS | |
| 245 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 246 | Urinary Incontinence | FAERS: 9 | US FAERS | |
| 247 | Aphonia | FAERS: 8 | US FAERS | |
| 248 | Blood urine present | FAERS: 8 | US FAERS | |
| 249 | Crying | FAERS: 8 | US FAERS | |
| 250 | Erectile dysfunction | FAERS: 8 | SIDER US FAERS | |
| 251 | Expired drug administered | FAERS: 8 | US FAERS | |
| 252 | Food Poisoning | FAERS: 8 | US FAERS | |
| 253 | Gamma-Glutamyltransferase Increased | FAERS: 8 | US FAERS | |
| 254 | Ileus | FAERS: 8 | SIDER US FAERS | |
| 255 | Incorrect disposal of product | FAERS: 8 | US FAERS | |
| 256 | Inflammation | FAERS: 8 | 24534256 | CTD US FAERS |
| 257 | Injection site scab | FAERS: 8 | US FAERS | |
| 258 | Irritable Bowel Syndrome | FAERS: 8 | US FAERS | |
| 259 | Laryngitis | FAERS: 8 | US FAERS | |
| 260 | Ligament rupture | FAERS: 8 | US FAERS | |
| 261 | Macular degeneration | FAERS: 8 | US FAERS | |
| 262 | Menorrhagia | FAERS: 8 | US FAERS | |
| 263 | Product leakage | FAERS: 8 | US FAERS | |
| 264 | Product preparation error | FAERS: 8 | US FAERS | |
| 265 | Skin irritation | FAERS: 8 | US FAERS | |
| 266 | Thyroid Neoplasm | FAERS: 8 | US FAERS | |
| 267 | Trichorrhexis | FAERS: 8 | US FAERS | |
| 268 | Ulcer | FAERS: 8 | US FAERS | |
| 269 | Wheezing | FAERS: 8 | US FAERS | |
| 270 | Alanine Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 271 | Foreign body trauma | FAERS: 7 | US FAERS | |
| 272 | Head discomfort | FAERS: 7 | US FAERS | |
| 273 | Insurance issue | FAERS: 7 | US FAERS | |
| 274 | Joint injury | FAERS: 7 | US FAERS | |
| 275 | Mental impairment | FAERS: 7 | US FAERS | |
| 276 | Mood swings | FAERS: 7 | US FAERS | |
| 277 | Photophobia | FAERS: 7 | US FAERS | |
| 278 | Rotator cuff syndrome | FAERS: 7 | US FAERS | |
| 279 | Sinus headache | FAERS: 7 | US FAERS | |
| 280 | Skin Ulcer | FAERS: 7 | US FAERS | |
| 281 | Skin lesion | FAERS: 7 | US FAERS | |
| 282 | Sudden death | FAERS: 7 | US FAERS | |
| 283 | Umbilical hernia | FAERS: 7 | US FAERS | |
| 284 | Abasia | FAERS: 6 | US FAERS | |
| 285 | Acne | FAERS: 6 | US FAERS | |
| 286 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 287 | Blood magnesium decreased | FAERS: 6 | US FAERS | |
| 288 | Blood potassium increased | FAERS: 6 | US FAERS | |
| 289 | Blood urea increased | FAERS: 6 | US FAERS | |
| 290 | Diplopia | FAERS: 6 | US FAERS | |
| 291 | Eczema | FAERS: 6 | US FAERS | |
| 292 | Eye pain | FAERS: 6 | US FAERS | |
| 293 | Hip surgery | FAERS: 6 | US FAERS | |
| 294 | Infarction | FAERS: 6 | US FAERS | |
| 295 | Leukocytosis | FAERS: 6 | US FAERS | |
| 296 | Limb discomfort | FAERS: 6 | US FAERS | |
| 297 | Night sweats | FAERS: 6 | US FAERS | |
| 298 | No adverse effect | FAERS: 6 | US FAERS | |
| 299 | Non-cardiac chest pain | FAERS: 6 | US FAERS | |
| 300 | Pallor | FAERS: 6 | US FAERS | |
| 301 | Pancreatic Pseudocyst | FAERS: 6 | US FAERS | |
| 302 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 303 | Pregnancy | FAERS: 6 | US FAERS | |
| 304 | Stomatitis | FAERS: 6 | US FAERS | |
| 305 | Vasculitis | FAERS: 6 | US FAERS | |
| 306 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 307 | Amylase increased | FAERS: 5 | US FAERS | |
| 308 | Arteriosclerosis | FAERS: 5 | US FAERS | |
| 309 | Arthropod bite | FAERS: 5 | US FAERS | |
| 310 | Benign neoplasm of thyroid gland | FAERS: 5 | US FAERS | |
| 311 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 312 | Cataract operation | FAERS: 5 | US FAERS | |
| 313 | Fibromyalgia | FAERS: 5 | US FAERS | |
| 314 | Formication | FAERS: 5 | US FAERS | |
| 315 | Gastric ulcer | FAERS: 5 | US FAERS | |
| 316 | Gastrointestinal infection | FAERS: 5 | US FAERS | |
| 317 | Glaucoma | FAERS: 5 | US FAERS | |
| 318 | Hyperphagia | FAERS: 5 | US FAERS | |
| 319 | Hyperthyroidism | FAERS: 5 | US FAERS | |
| 320 | Hypothyroidism | FAERS: 5 | US FAERS | |
| 321 | Hypotrichosis | FAERS: 5 | US FAERS | |
| 322 | Injection site pustule | FAERS: 5 | US FAERS | |
| 323 | Ketoacidosis | FAERS: 5 | US FAERS | |
| 324 | Limb mass | FAERS: 5 | US FAERS | |
| 325 | Lipodystrophy acquired | FAERS: 5 | US FAERS | |
| 326 | Lipoma | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 327 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 328 | Medical device complication | FAERS: 5 | US FAERS | |
| 329 | Multi-organ disorder | FAERS: 5 | US FAERS | |
| 330 | Neuropathy | FAERS: 5 | US FAERS | |
| 331 | Paranasal sinus hypersecretion | FAERS: 5 | US FAERS | |
| 332 | Polyuria | FAERS: 5 | US FAERS | |
| 333 | Post procedural complication | FAERS: 5 | US FAERS | |
| 334 | Product label issue | FAERS: 5 | US FAERS | |
| 335 | Product physical issue | FAERS: 5 | US FAERS | |
| 336 | Product preparation issue | FAERS: 5 | US FAERS | |
| 337 | Product quality control issue | FAERS: 5 | US FAERS | |
| 338 | Product substitution issue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Protein urine present | FAERS: 5 | US FAERS | |
| 340 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 341 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 342 | Skin laceration | FAERS: 5 | US FAERS | |
| 343 | Spinal fusion surgery | FAERS: 5 | US FAERS | |
| 344 | Sudden Cardiac Death | FAERS: 5 | US FAERS | |
| 345 | Suicide attempt | FAERS: 5 | US FAERS | |
| 346 | Syringe issue | FAERS: 5 | US FAERS | |
| 347 | Transaminases increased | FAERS: 5 | US FAERS | |
| 348 | VIIth nerve paralysis | FAERS: 5 | US FAERS | |
| 349 | Abdominal mass | FAERS: 4 | US FAERS | |
| 350 | Abdominal rigidity | FAERS: 4 | US FAERS | |
| 351 | Accidental exposure | FAERS: 4 | US FAERS | |
| 352 | Aortic Aneurysm | FAERS: 4 | US FAERS | |
| 353 | Aphagia | FAERS: 4 | US FAERS | |
| 354 | Ascites | FAERS: 4 | US FAERS | |
| 355 | Auricular swelling | FAERS: 4 | US FAERS | |
| 356 | Blood Glucose | FAERS: 4 | US FAERS | |
| 357 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 358 | Carpal Tunnel Syndrome | FAERS: 4 | US FAERS | |
| 359 | Choking | FAERS: 4 | US FAERS | |
| 360 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 361 | Dementia | FAERS: 4 | US FAERS | |
| 362 | Dermatitis | FAERS: 4 | US FAERS | |
| 363 | Device occlusion | FAERS: 4 | US FAERS | |
| 364 | Drug dose omission by device | FAERS: 4 | US FAERS | |
| 365 | Drug effect delayed | FAERS: 4 | US FAERS | |
| 366 | Emotional distress | FAERS: 4 | US FAERS | |
| 367 | Eosinophilia | FAERS: 4 | US FAERS | |
| 368 | Eye Infection | FAERS: 4 | US FAERS | |
| 369 | Gastrointestinal sounds abnormal | FAERS: 4 | US FAERS | |
| 370 | Glossitis | FAERS: 4 | US FAERS | |
| 371 | Guillain-Barre Syndrome | FAERS: 4 | US FAERS | |
| 372 | Impaired work ability | FAERS: 4 | US FAERS | |
| 373 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 374 | Increased upper airway secretion | FAERS: 4 | US FAERS | |
| 375 | Injection site discharge | FAERS: 4 | US FAERS | |
| 376 | Injection site laceration | FAERS: 4 | US FAERS | |
| 377 | Injection site ulcer | FAERS: 4 | US FAERS | |
| 378 | Intentional device use issue | FAERS: 4 | US FAERS | |
| 379 | Laceration | FAERS: 4 | US FAERS | |
| 380 | Metastatic Neoplasm | FAERS: 4 | US FAERS | |
| 381 | Metrorrhagia | FAERS: 4 | US FAERS | |
| 382 | Motion Sickness | FAERS: 4 | US FAERS | |
| 383 | Multiple allergies | FAERS: 4 | US FAERS | |
| 384 | Oropharyngeal discomfort | FAERS: 4 | US FAERS | |
| 385 | Pancreatic Duct Stenosis | FAERS: 4 | US FAERS | |
| 386 | Pancreatic Insufficiency | FAERS: 4 | US FAERS | |
| 387 | Panic Disorder | FAERS: 4 | US FAERS | |
| 388 | Peritonitis | FAERS: 4 | US FAERS | |
| 389 | Post procedural infection | FAERS: 4 | US FAERS | |
| 390 | Productive Cough | FAERS: 4 | US FAERS | |
| 391 | Psoriasis | FAERS: 4 | US FAERS | |
| 392 | Regurgitation | FAERS: 4 | US FAERS | |
| 393 | Renal Cell Carcinoma | FAERS: 4 | US FAERS | |
| 394 | Renal cyst | FAERS: 4 | US FAERS | |
| 395 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 396 | Skin Wrinkling | FAERS: 4 | US FAERS | |
| 397 | Uterine Cancer | FAERS: 4 | US FAERS | |
| 398 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 399 | Waist circumference increased | FAERS: 4 | US FAERS | |
| 400 | furuncle | FAERS: 4 | US FAERS | |
| 401 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 402 | Abdominal Abscess | FAERS: 3 | US FAERS | |
| 403 | Abdominal tenderness | FAERS: 3 | US FAERS | |
| 404 | Abscess | FAERS: 3 | US FAERS | |
| 405 | Acanthosis Nigricans | FAERS: 3 | US FAERS | |
| 406 | Acidosis | FAERS: 3 | US FAERS | |
| 407 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 408 | Aneurysm | FAERS: 3 | US FAERS | |
| 409 | Antiviral drug level below therapeutic | FAERS: 3 | US FAERS | |
| 410 | Aortic Valve Stenosis | FAERS: 3 | US FAERS | |
| 411 | Aphasia | FAERS: 3 | US FAERS | |
| 412 | Aphthous Stomatitis | FAERS: 3 | US FAERS | |
| 413 | Arthropod sting | FAERS: 3 | US FAERS | |
| 414 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 415 | Benign Prostatic Hyperplasia | FAERS: 3 | US FAERS | |
| 416 | Biliary Dyskinesia | FAERS: 3 | US FAERS | |
| 417 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 418 | Blood calcitonin increased | FAERS: 3 | US FAERS | |
| 419 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 420 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 421 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 422 | Blood triglycerides abnormal | FAERS: 3 | US FAERS | |
| 423 | Bradycardia | FAERS: 3 | US FAERS | |
| 424 | Cardiac discomfort | FAERS: 3 | US FAERS | |
| 425 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 426 | Cholangitis | FAERS: 3 | US FAERS | |
| 427 | Complication associated with device | FAERS: 3 | US FAERS | |
| 428 | Creatinine renal clearance increased | FAERS: 3 | US FAERS | |
| 429 | Dandy-Walker Syndrome | FAERS: 3 | US FAERS | |
| 430 | Device related infection | FAERS: 3 | US FAERS | |
| 431 | Diabetic Foot | FAERS: 3 | US FAERS | |
| 432 | Disease complication | FAERS: 3 | US FAERS | |
| 433 | Disease recurrence | FAERS: 3 | US FAERS | |
| 434 | Dysarthria | FAERS: 3 | US FAERS | |
| 435 | Ear discomfort | FAERS: 3 | US FAERS | |
| 436 | Emotional disorder | FAERS: 3 | US FAERS | |
| 437 | Erysipelas | FAERS: 3 | US FAERS | |
| 438 | Excoriation | FAERS: 3 | US FAERS | |
| 439 | Gallbladder pain | FAERS: 3 | US FAERS | |
| 440 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 441 | Hemiplegia | FAERS: 3 | US FAERS | |
| 442 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 443 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 444 | Hypogeusia | FAERS: 3 | US FAERS | |
| 445 | Immobile | FAERS: 3 | US FAERS | |
| 446 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 447 | Incision site infection | FAERS: 3 | US FAERS | |
| 448 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 449 | Induration | FAERS: 3 | SIDER US FAERS | |
| 450 | Initial insomnia | FAERS: 3 | US FAERS | |
| 451 | Injection site indentation | FAERS: 3 | US FAERS | |
| 452 | Injection | FAERS: 3 | US FAERS | |
| 453 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 454 | Intervertebral Disc Degeneration | FAERS: 3 | US FAERS | |
| 455 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 456 | Malabsorption | FAERS: 3 | US FAERS | |
| 457 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 458 | Multiple use of single-use product | FAERS: 3 | US FAERS | |
| 459 | Muscle Fatigue | FAERS: 3 | US FAERS | |
| 460 | Muscle tightness | FAERS: 3 | US FAERS | |
| 461 | Nerve injury | FAERS: 3 | US FAERS | |
| 462 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 463 | Obesity surgery | FAERS: 3 | US FAERS | |
| 464 | Ocular discomfort | FAERS: 3 | US FAERS | |
| 465 | Off label use of device | FAERS: 3 | US FAERS | |
| 466 | Oropharyngeal swelling | FAERS: 3 | US FAERS | |
| 467 | Palmar erythema | FAERS: 3 | US FAERS | |
| 468 | Pancreatic enzymes abnormal | FAERS: 3 | US FAERS | |
| 469 | Paranasal sinus discomfort | FAERS: 3 | US FAERS | |
| 470 | Peripheral arterial occlusive disease | FAERS: 3 | US FAERS | |
| 471 | Pharyngitis | FAERS: 3 | US FAERS | |
| 472 | Polydipsia | FAERS: 3 | US FAERS | |
| 473 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 474 | Pre-existing condition improved | FAERS: 3 | US FAERS | |
| 475 | Product packaging issue | FAERS: 3 | US FAERS | |
| 476 | Product prescribing issue | FAERS: 3 | US FAERS | |
| 477 | Product use complaint | FAERS: 3 | US FAERS | |
| 478 | Pseudocyst | FAERS: 3 | US FAERS | |
| 479 | Renal mass | FAERS: 3 | US FAERS | |
| 480 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 481 | Restlessness | FAERS: 3 | US FAERS | |
| 482 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 483 | Scab | FAERS: 3 | US FAERS | |
| 484 | Schizophrenia | FAERS: 3 | US FAERS | |
| 485 | Screaming | FAERS: 3 | US FAERS | |
| 486 | Skin nodule | FAERS: 3 | US FAERS | |
| 487 | Splenectomy | FAERS: 3 | US FAERS | |
| 488 | Starvation | FAERS: 3 | US FAERS | |
| 489 | Subcutaneous nodule | FAERS: 3 | US FAERS | |
| 490 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 491 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 492 | Tension | FAERS: 3 | US FAERS | |
| 493 | Thirst decreased | FAERS: 3 | US FAERS | |
| 494 | Throat cancer | FAERS: 3 | US FAERS | |
| 495 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 496 | Trisomy 21 | FAERS: 3 | US FAERS | |
| 497 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 498 | Urinary Retention | FAERS: 3 | US FAERS | |
| 499 | Vascular occlusion | FAERS: 3 | US FAERS | |
| 500 | Viral load increased | FAERS: 3 | US FAERS | |
| 501 | Walking aid user | FAERS: 3 | US FAERS | |
| 502 | Weight | FAERS: 3 | US FAERS | |
| 503 | muscle injury | FAERS: 3 | US FAERS | |
| 504 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 505 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 506 | Administration site nodule | FAERS: 2 | US FAERS | |
| 507 | Adnexa uteri pain | FAERS: 2 | US FAERS | |
| 508 | Amputation | FAERS: 2 | US FAERS | |
| 509 | Anorectal infection | FAERS: 2 | US FAERS | |
| 510 | Apparent death | FAERS: 2 | US FAERS | |
| 511 | Arteriovenous fistula aneurysm | FAERS: 2 | US FAERS | |
| 512 | Asphyxia | FAERS: 2 | US FAERS | |
| 513 | Asthenopia | FAERS: 2 | US FAERS | |
| 514 | Bedridden | FAERS: 2 | US FAERS | |
| 515 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 516 | Blood blister | FAERS: 2 | US FAERS | |
| 517 | Blood chloride decreased | FAERS: 2 | US FAERS | |
| 518 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 519 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 520 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 521 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 522 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 523 | Body temperature fluctuation | FAERS: 2 | US FAERS | |
| 524 | Breast cancer recurrent | FAERS: 2 | US FAERS | |
| 525 | Calciphylaxis | FAERS: 2 | US FAERS | |
| 526 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 527 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 528 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 529 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 530 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 531 | Completed Suicide | FAERS: 2 | US FAERS | |
| 532 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 533 | Delirium | FAERS: 2 | US FAERS | |
| 534 | Device breakage | FAERS: 2 | US FAERS | |
| 535 | Diabetic foot infection | FAERS: 2 | US FAERS | |
| 536 | Diplegia | FAERS: 2 | US FAERS | |
| 537 | Disability | FAERS: 2 | US FAERS | |
| 538 | Diverticulum | FAERS: 2 | US FAERS | |
| 539 | Drug Tolerance | FAERS: 2 | US FAERS | |
| 540 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 541 | Drug exposure before pregnancy | FAERS: 2 | US FAERS | |
| 542 | Dysphasia | FAERS: 2 | US FAERS | |
| 543 | Ecchymosis | FAERS: 2 | US FAERS | |
| 544 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 545 | Epicondylitis | FAERS: 2 | US FAERS | |
| 546 | Epilepsy | FAERS: 2 | US FAERS | |
| 547 | Exaggerated startle response | FAERS: 2 | US FAERS | |
| 548 | Excessive skin | FAERS: 2 | US FAERS | |
| 549 | Extremity necrosis | FAERS: 2 | US FAERS | |
| 550 | Eye inflammation | FAERS: 2 | US FAERS | |
| 551 | Fat necrosis | FAERS: 2 | US FAERS | |
| 552 | Fibrosis | FAERS: 2 | US FAERS | |
| 553 | Food Allergy | FAERS: 2 | US FAERS | |
| 554 | Frustration | FAERS: 2 | US FAERS | |
| 555 | Gastric ileus | FAERS: 2 | US FAERS | |
| 556 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 557 | Hemiparesis | FAERS: 2 | US FAERS | |
| 558 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 559 | Hernia obstructive | FAERS: 2 | US FAERS | |
| 560 | Hidradenitis | FAERS: 2 | US FAERS | |
| 561 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 562 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 563 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 564 | Hyperventilation | FAERS: 2 | US FAERS | |
| 565 | Hysterectomy | FAERS: 2 | US FAERS | |
| 566 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 567 | Injection site joint erythema | FAERS: 2 | US FAERS | |
| 568 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 569 | Injection site papule | FAERS: 2 | US FAERS | |
| 570 | Injection site streaking | FAERS: 2 | US FAERS | |
| 571 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 572 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 573 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 574 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 575 | Ketosis | FAERS: 2 | US FAERS | |
| 576 | Lack of satiety | FAERS: 2 | US FAERS | |
| 577 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 578 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 579 | Ligament injury | FAERS: 2 | US FAERS | |
| 580 | Lipase abnormal | FAERS: 2 | US FAERS | |
| 581 | Lithotripsy | FAERS: 2 | US FAERS | |
| 582 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 583 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 584 | Megacolon | FAERS: 2 | US FAERS | |
| 585 | Mental status changes | FAERS: 2 | US FAERS | |
| 586 | Microalbuminuria | FAERS: 2 | US FAERS | |
| 587 | Middle insomnia | FAERS: 2 | US FAERS | |
| 588 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 589 | Mixed liver injury | FAERS: 2 | US FAERS | |
| 590 | Monoparesis | FAERS: 2 | US FAERS | |
| 591 | Muscle strain | FAERS: 2 | US FAERS | |
| 592 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 593 | Nephritis | FAERS: 2 | US FAERS | |
| 594 | Neuralgia | FAERS: 2 | US FAERS | |
| 595 | Neutropenia | FAERS: 2 | US FAERS | |
| 596 | Nipple pain | FAERS: 2 | US FAERS | |
| 597 | Nocturia | FAERS: 2 | US FAERS | |
| 598 | Ocular icterus | FAERS: 2 | US FAERS | |
| 599 | Onychoclasis | FAERS: 2 | US FAERS | |
| 600 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 601 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 602 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 603 | Pancreatic carcinoma non-resectable | FAERS: 2 | US FAERS | |
| 604 | Panniculitis | FAERS: 2 | US FAERS | |
| 605 | Paranoia | FAERS: 2 | US FAERS | |
| 606 | Pemphigus | FAERS: 2 | US FAERS | |
| 607 | Pericarditis | FAERS: 2 | US FAERS | |
| 608 | Personality Change | FAERS: 2 | US FAERS | |
| 609 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 610 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 611 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 612 | Product administration error | FAERS: 2 | US FAERS | |
| 613 | Product contamination | FAERS: 2 | US FAERS | |
| 614 | Product label confusion | FAERS: 2 | US FAERS | |
| 615 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 616 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 617 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 618 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 619 | Rosacea | FAERS: 2 | US FAERS | |
| 620 | Sciatica | FAERS: 2 | US FAERS | |
| 621 | Secretion discharge | FAERS: 2 | US FAERS | |
| 622 | Sensitive skin | FAERS: 2 | US FAERS | |
| 623 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 624 | Skeletal injury | FAERS: 2 | US FAERS | |
| 625 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 626 | Skin hypertrophy | FAERS: 2 | US FAERS | |
| 627 | Skin necrosis | FAERS: 2 | US FAERS | |
| 628 | Sleep disorder due to general medical condition, hypersomnia type | FAERS: 2 | US FAERS | |
| 629 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 630 | Splenomegaly | FAERS: 2 | US FAERS | |
| 631 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 632 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 633 | Therapeutic product contamination | FAERS: 2 | US FAERS | |
| 634 | Thermal burn | FAERS: 2 | US FAERS | |
| 635 | Tooth Loss | FAERS: 2 | US FAERS | |
| 636 | Tracheal Stenosis | FAERS: 2 | US FAERS | |
| 637 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 638 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 639 | Urine output increased | FAERS: 2 | US FAERS | |
| 640 | Urticaria localised | FAERS: 2 | US FAERS | |
| 641 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 642 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 643 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 644 | Vulvovaginal dryness | FAERS: 2 | US FAERS | |
| 645 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 646 | Wound abscess | FAERS: 2 | US FAERS | |
| 647 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 648 | Accidental underdose | FAERS: 1 | US FAERS | |
| 649 | Acquired hydrocele | FAERS: 1 | US FAERS | |
| 650 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 651 | Administration site bruise | FAERS: 1 | US FAERS | |
| 652 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 653 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 654 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 655 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 656 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 657 | Animal bite | FAERS: 1 | US FAERS | |
| 658 | Anorgasmia | FAERS: 1 | US FAERS | |
| 659 | Anosmia | FAERS: 1 | US FAERS | |
| 660 | Anti-GAD antibody positive | FAERS: 1 | US FAERS | |
| 661 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 662 | Anuria | FAERS: 1 | US FAERS | |
| 663 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 664 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 665 | Apathy | FAERS: 1 | US FAERS | |
| 666 | Application site warmth | FAERS: 1 | US FAERS | |
| 667 | Atelectasis | FAERS: 1 | US FAERS | |
| 668 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 669 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 670 | Bacteria urine identified | FAERS: 1 | US FAERS | |
| 671 | Benign neoplasm of skin | FAERS: 1 | US FAERS | |
| 672 | Biliary Colic | FAERS: 1 | US FAERS | |
| 673 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 674 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 675 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 676 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 677 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 678 | Bladder pain | FAERS: 1 | US FAERS | |
| 679 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 680 | Blood amylase decreased | FAERS: 1 | US FAERS | |
| 681 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 682 | Blood catecholamines increased | FAERS: 1 | US FAERS | |
| 683 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 684 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 685 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 686 | Blood ketone body | FAERS: 1 | US FAERS | |
| 687 | Blood lactic acid abnormal | FAERS: 1 | US FAERS | |
| 688 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 689 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 690 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 691 | Blood testosterone free decreased | FAERS: 1 | US FAERS | |
| 692 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 693 | Bone density decreased | FAERS: 1 | US FAERS | |
| 694 | Boredom | FAERS: 1 | US FAERS | |
| 695 | Breast Cyst | FAERS: 1 | US FAERS | |
| 696 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 697 | Burn infection | FAERS: 1 | US FAERS | |
| 698 | Calcific deposits removal | FAERS: 1 | US FAERS | |
| 699 | Calcinosis | FAERS: 1 | US FAERS | |
| 700 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 701 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 702 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 703 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 704 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 705 | Cartilage injury | FAERS: 1 | US FAERS | |
| 706 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 707 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 708 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 709 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 710 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 711 | Cheilitis | FAERS: 1 | US FAERS | |
| 712 | Chemotherapy | FAERS: 1 | US FAERS | |
| 713 | Cholecystostomy | FAERS: 1 | US FAERS | |
| 714 | Cholera | FAERS: 1 | US FAERS | |
| 715 | Cholestasis | FAERS: 1 | US FAERS | |
| 716 | Chromatopsia | FAERS: 1 | US FAERS | |
| 717 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 718 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 719 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 720 | Coccidioidomycosis | FAERS: 1 | US FAERS | |
| 721 | Colectomy | FAERS: 1 | US FAERS | |
| 722 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 723 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 724 | Conversion disorder | FAERS: 1 | US FAERS | |
| 725 | Coronary artery reocclusion | FAERS: 1 | US FAERS | |
| 726 | Cortisol increased | FAERS: 1 | US FAERS | |
| 727 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 728 | Cyanosis | FAERS: 1 | US FAERS | |
| 729 | Cystocele | FAERS: 1 | US FAERS | |
| 730 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 731 | Dental caries | FAERS: 1 | US FAERS | |
| 732 | Depression suicidal | FAERS: 1 | US FAERS | |
| 733 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 734 | Device physical property issue | FAERS: 1 | US FAERS | |
| 735 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 736 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 737 | Disease Progression | FAERS: 1 | US FAERS | |
| 738 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 739 | Drooling | FAERS: 1 | US FAERS | |
| 740 | Drug abuse | FAERS: 1 | US FAERS | |
| 741 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 742 | Drug delivery system malfunction | FAERS: 1 | US FAERS | |
| 743 | Drug effect variable | FAERS: 1 | US FAERS | |
| 744 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 745 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 746 | Drug physiologic incompatibility | FAERS: 1 | US FAERS | |
| 747 | Drug screen positive | FAERS: 1 | US FAERS | |
| 748 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 749 | Drug toxicity | FAERS: 1 | US FAERS | |
| 750 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 751 | Duodenitis | FAERS: 1 | US FAERS | |
| 752 | Dyschezia | FAERS: 1 | US FAERS | |
| 753 | Dysplasia | FAERS: 1 | US FAERS | |
| 754 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 755 | Dystonia | FAERS: 1 | US FAERS | |
| 756 | Ear, nose and throat examination abnormal | FAERS: 1 | US FAERS | |
| 757 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 758 | Educational problem | FAERS: 1 | US FAERS | |
| 759 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 760 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 761 | Endometriosis | FAERS: 1 | US FAERS | |
| 762 | Enteritis | FAERS: 1 | US FAERS | |
| 763 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 764 | Enterocolitis | FAERS: 1 | US FAERS | |
| 765 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 766 | Eosinophilic granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 767 | Eosinophilic panniculitis | FAERS: 1 | US FAERS | |
| 768 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 769 | Erythema Induratum | FAERS: 1 | US FAERS | |
| 770 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 771 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 772 | Euphoric mood | FAERS: 1 | US FAERS | |
| 773 | Expired device used | FAERS: 1 | US FAERS | |
| 774 | Eye allergy | FAERS: 1 | US FAERS | |
| 775 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 776 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 777 | Facial Pain | FAERS: 1 | US FAERS | |
| 778 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 779 | Fear of falling | FAERS: 1 | US FAERS | |
| 780 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 781 | Flight of ideas | FAERS: 1 | US FAERS | |
| 782 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 783 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 784 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 785 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 786 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 787 | Gastric hypermotility | FAERS: 1 | US FAERS | |
| 788 | Gastric hypomotility | FAERS: 1 | US FAERS | |
| 789 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 790 | Gastrointestinal cancer metastatic | FAERS: 1 | US FAERS | |
| 791 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 792 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 793 | Gastrolithiasis | FAERS: 1 | US FAERS | |
| 794 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 795 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 796 | General symptom | FAERS: 1 | US FAERS | |
| 797 | Genital rash | FAERS: 1 | US FAERS | |
| 798 | Gingivitis | FAERS: 1 | US FAERS | |
| 799 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 800 | Helicobacter test positive | FAERS: 1 | US FAERS | |
| 801 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 802 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 803 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 804 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 805 | Hepatobiliary scan | FAERS: 1 | US FAERS | |
| 806 | Heteroplasia | FAERS: 1 | US FAERS | |
| 807 | Hirsutism | FAERS: 1 | US FAERS | |
| 808 | Histrionic Personality Disorder | FAERS: 1 | US FAERS | |
| 809 | Humidity intolerance | FAERS: 1 | US FAERS | |
| 810 | Hyperinsulinism | FAERS: 1 | US FAERS | |
| 811 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 812 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 813 | Hyperplastic cholecystopathy | FAERS: 1 | US FAERS | |
| 814 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 815 | Hypokinesia | FAERS: 1 | US FAERS | |
| 816 | Idiopathic neutropenia | FAERS: 1 | US FAERS | |
| 817 | Illogical thinking | FAERS: 1 | US FAERS | |
| 818 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 819 | Immune-mediated adverse reaction | FAERS: 1 | US FAERS | |
| 820 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 821 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 822 | Incoherent | FAERS: 1 | US FAERS | |
| 823 | Incontinence | FAERS: 1 | US FAERS | |
| 824 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 825 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 826 | Infected bite | FAERS: 1 | US FAERS | |
| 827 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 828 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 829 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 830 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 831 | Infusion site scar | FAERS: 1 | US FAERS | |
| 832 | Injection site atrophy | FAERS: 1 | US FAERS | |
| 833 | Injection site calcification | FAERS: 1 | US FAERS | |
| 834 | Injection site dermatitis | FAERS: 1 | SIDER US FAERS | |
| 835 | Injection site dryness | FAERS: 1 | US FAERS | |
| 836 | Injection site exfoliation | FAERS: 1 | US FAERS | |
| 837 | Injection site fibrosis | FAERS: 1 | US FAERS | |
| 838 | Injection site granuloma | FAERS: 1 | US FAERS | |
| 839 | Injection site nerve damage | FAERS: 1 | US FAERS | |
| 840 | Injection site pallor | FAERS: 1 | US FAERS | |
| 841 | Injection site plaque | FAERS: 1 | US FAERS | |
| 842 | Instillation site pain | FAERS: 1 | US FAERS | |
| 843 | Insulin Resistance | FAERS: 1 | 19586609 28573460 | CTD US FAERS |
| 844 | Insulin-like growth factor decreased | FAERS: 1 | US FAERS | |
| 845 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | US FAERS | |
| 846 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 847 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 848 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 849 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 850 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 851 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 852 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 853 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 854 | Iritis | FAERS: 1 | US FAERS | |
| 855 | Joint sprain | FAERS: 1 | US FAERS | |
| 856 | Joint stiffness | FAERS: 1 | US FAERS | |
| 857 | Lack of injection site rotation | FAERS: 1 | US FAERS | |
| 858 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 859 | Latent Autoimmune Diabetes in Adults | FAERS: 1 | US FAERS | |
| 860 | Latex allergy | FAERS: 1 | US FAERS | |
| 861 | Lentigo | FAERS: 1 | US FAERS | |
| 862 | Leukopenia | FAERS: 1 | US FAERS | |
| 863 | Limb operation | FAERS: 1 | US FAERS | |
| 864 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 865 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 866 | Living in residential institution | FAERS: 1 | US FAERS | |
| 867 | Local reaction | FAERS: 1 | US FAERS | |
| 868 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 869 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 870 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 871 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 872 | Lymphangitis | FAERS: 1 | US FAERS | |
| 873 | Macule | FAERS: 1 | US FAERS | |
| 874 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 875 | Malabsorption from injection site | FAERS: 1 | US FAERS | |
| 876 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 877 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 878 | Malignant neoplasm of ampulla of Vater | FAERS: 1 | US FAERS | |
| 879 | Measles | FAERS: 1 | US FAERS | |
| 880 | Medication residue | FAERS: 1 | US FAERS | |
| 881 | Medication residue present | FAERS: 1 | US FAERS | |
| 882 | Meningioma | FAERS: 1 | US FAERS | |
| 883 | Meningitis | FAERS: 1 | US FAERS | |
| 884 | Menopause | FAERS: 1 | US FAERS | |
| 885 | Merycism | FAERS: 1 | US FAERS | |
| 886 | Metanephrine urine increased | FAERS: 1 | US FAERS | |
| 887 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 888 | Metastases to peripheral vascular system | FAERS: 1 | US FAERS | |
| 889 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 890 | Milk Allergy | FAERS: 1 | US FAERS | |
| 891 | Monoplegia | FAERS: 1 | US FAERS | |
| 892 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 893 | Mouth swelling | FAERS: 1 | US FAERS | |
| 894 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 895 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 896 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 897 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 898 | Myocarditis | FAERS: 1 | US FAERS | |
| 899 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 900 | Myopia | FAERS: 1 | US FAERS | |
| 901 | Necrosis | FAERS: 1 | 24534256 | CTD US FAERS |
| 902 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 903 | Neurilemmoma | FAERS: 1 | US FAERS | |
| 904 | Nodule on extremity | FAERS: 1 | US FAERS | |
| 905 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 906 | Oral pruritus | FAERS: 1 | US FAERS | |
| 907 | Orchitis | FAERS: 1 | US FAERS | |
| 908 | Osteitis | FAERS: 1 | US FAERS | |
| 909 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 910 | Osteopenia | FAERS: 1 | US FAERS | |
| 911 | Osteoporosis | FAERS: 1 | 19586609 | CTD US FAERS |
| 912 | Otitis Media | FAERS: 1 | US FAERS | |
| 913 | Ovarian germ cell teratoma benign | FAERS: 1 | US FAERS | |
| 914 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 915 | Pain of skin | FAERS: 1 | US FAERS | |
| 916 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 917 | Pancreatic Fistula | FAERS: 1 | US FAERS | |
| 918 | Pancreatic calcification | FAERS: 1 | US FAERS | |
| 919 | Pancreatic carcinoma stage III | FAERS: 1 | US FAERS | |
| 920 | Pancreatic duct dilatation | FAERS: 1 | US FAERS | |
| 921 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 922 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 923 | Papule | FAERS: 1 | US FAERS | |
| 924 | Pararenal pseudocyst | FAERS: 1 | US FAERS | |
| 925 | Parotitis | FAERS: 1 | US FAERS | |
| 926 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 927 | Pelvic mass | FAERS: 1 | US FAERS | |
| 928 | Penile burning sensation | FAERS: 1 | US FAERS | |
| 929 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 930 | Periarthritis | FAERS: 1 | US FAERS | |
| 931 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 932 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 933 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 934 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 935 | Petechiae | FAERS: 1 | US FAERS | |
| 936 | Phlebitis | FAERS: 1 | US FAERS | |
| 937 | Photosensitivity allergic reaction | FAERS: 1 | US FAERS | |
| 938 | Physical product label issue | FAERS: 1 | US FAERS | |
| 939 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 940 | Pneumonitis | FAERS: 1 | US FAERS | |
| 941 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 942 | Post procedural contusion | FAERS: 1 | US FAERS | |
| 943 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 944 | Post procedural nausea | FAERS: 1 | US FAERS | |
| 945 | Postoperative fever | FAERS: 1 | US FAERS | |
| 946 | Postoperative infection | FAERS: 1 | US FAERS | |
| 947 | Procedural complication | FAERS: 1 | US FAERS | |
| 948 | Procedural hypertension | FAERS: 1 | US FAERS | |
| 949 | Procedural nausea | FAERS: 1 | US FAERS | |
| 950 | Proctitis | FAERS: 1 | US FAERS | |
| 951 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 952 | Product contamination physical | FAERS: 1 | US FAERS | |
| 953 | Product dispensing error | FAERS: 1 | US FAERS | |
| 954 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 955 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 956 | Product formulation issue | FAERS: 1 | US FAERS | |
| 957 | Product impurity | FAERS: 1 | US FAERS | |
| 958 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 959 | Product reconstitution quality issue | FAERS: 1 | US FAERS | |
| 960 | Product size issue | FAERS: 1 | US FAERS | |
| 961 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 962 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 963 | Proteinuria | FAERS: 1 | US FAERS | |
| 964 | Prothrombin level abnormal | FAERS: 1 | US FAERS | |
| 965 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 966 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 967 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 968 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 969 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 970 | Puncture site pain | FAERS: 1 | US FAERS | |
| 971 | Purpura | FAERS: 1 | US FAERS | |
| 972 | Purulent discharge | FAERS: 1 | US FAERS | |
| 973 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 974 | Quadriplegia | FAERS: 1 | US FAERS | |
| 975 | Radiotherapy to thyroid | FAERS: 1 | US FAERS | |
| 976 | Rectal fissure | FAERS: 1 | US FAERS | |
| 977 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 978 | Refractory cytopenia with unilineage dysplasia | FAERS: 1 | US FAERS | |
| 979 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 980 | Renal cancer recurrent | FAERS: 1 | US FAERS | |
| 981 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 982 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 983 | Respiratory distress | FAERS: 1 | US FAERS | |
| 984 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 985 | Retinal scar | FAERS: 1 | US FAERS | |
| 986 | Rhinitis | FAERS: 1 | US FAERS | |
| 987 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 988 | Sarcopenia | FAERS: 1 | US FAERS | |
| 989 | Scleroderma | FAERS: 1 | US FAERS | |
| 990 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 991 | Septic Shock | FAERS: 1 | US FAERS | |
| 992 | Serum Sickness | FAERS: 1 | US FAERS | |
| 993 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 994 | Single functional kidney | FAERS: 1 | US FAERS | |
| 995 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 996 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 997 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 998 | Skin Induration | FAERS: 1 | US FAERS | |
| 999 | Skin discomfort | FAERS: 1 | US FAERS | |
| 1000 | Skin indentation | FAERS: 1 | US FAERS | |
| 1001 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 1002 | Slow speech | FAERS: 1 | US FAERS | |
| 1003 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 1004 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 1005 | Soliloquy | FAERS: 1 | US FAERS | |
| 1006 | Somogyi phenomenon | FAERS: 1 | US FAERS | |
| 1007 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 1008 | Spinal column injury | FAERS: 1 | US FAERS | |
| 1009 | Splenic cyst | FAERS: 1 | US FAERS | |
| 1010 | Splenic thrombosis | FAERS: 1 | US FAERS | |
| 1011 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 1012 | Splenitis | FAERS: 1 | US FAERS | |
| 1013 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 1014 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 1015 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 1016 | Stress at work | FAERS: 1 | US FAERS | |
| 1017 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 1018 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 1019 | Superinfection | FAERS: 1 | US FAERS | |
| 1020 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 1021 | Sweat test | FAERS: 1 | US FAERS | |
| 1022 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 1023 | Systemic Scleroderma | FAERS: 1 | US FAERS | |
| 1024 | Tachyphrenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 1025 | Teeth brittle | FAERS: 1 | US FAERS | |
| 1026 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 1027 | Thelitis | FAERS: 1 | US FAERS | |
| 1028 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 1029 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 1030 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 1031 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 1032 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 1033 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 1034 | Thyroid gland scan abnormal | FAERS: 1 | US FAERS | |
| 1035 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 1036 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 1037 | Thyroiditis | FAERS: 1 | US FAERS | |
| 1038 | Time perception altered | FAERS: 1 | US FAERS | |
| 1039 | Tongue biting | FAERS: 1 | US FAERS | |
| 1040 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 1041 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 1042 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 1043 | Transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 1044 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 1045 | Trismus | FAERS: 1 | US FAERS | |
| 1046 | Troponin increased | FAERS: 1 | US FAERS | |
| 1047 | Umbilical discharge | FAERS: 1 | US FAERS | |
| 1048 | Urethritis | FAERS: 1 | US FAERS | |
| 1049 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 1050 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 1051 | Urinary tract infection viral | FAERS: 1 | US FAERS | |
| 1052 | Urine bilirubin increased | FAERS: 1 | US FAERS | |
| 1053 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 1054 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 1055 | Vaginal Prolapse | FAERS: 1 | US FAERS | |
| 1056 | Vaginal burning sensation | FAERS: 1 | US FAERS | |
| 1057 | Vascular calcification | FAERS: 1 | US FAERS | |
| 1058 | Vascular purpura | FAERS: 1 | US FAERS | |
| 1059 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 1060 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 1061 | Viral sinusitis | FAERS: 1 | US FAERS | |
| 1062 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 1063 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 1064 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 1065 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 1066 | Waist circumference decreased | FAERS: 1 | US FAERS | |
| 1067 | Weaning failure | FAERS: 1 | US FAERS | |
| 1068 | Wheelchair user | FAERS: 1 | US FAERS | |
| 1069 | Wound Infection | FAERS: 1 | US FAERS | |
| 1070 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 1071 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 1072 | abdominal wall wound | FAERS: 1 | US FAERS | |
| 1073 | heart rate | FAERS: 1 | US FAERS | |
| 1074 | kyphosis | FAERS: 1 | US FAERS | |
| 1075 | prostatitis | FAERS: 1 | US FAERS | |
| 1076 | Diabetes Mellitus, Experimental | 19586609 19827752 19900495 | CTD | |
| 1077 | Diabetic | SIDER | ||
| 1078 | Edema | 24534256 | CTD | |
| 1079 | Fatty Liver | 30253173 | CTD | |
| 1080 | Feeding and Eating Disorders | 18420740 | CTD | |
| 1081 | Hyperglycemia | 28573460 | CTD | |
| 1082 | Hyperplasia | 28213092 | CTD | |
| 1083 | Hypertrophy | 24534256 | CTD | |
| 1084 | Infestation | SIDER | ||
| 1085 | Ischemia | 19171732 | CTD | |
| 1086 | Movement Disorders | 18492290 | CTD | |
| 1087 | Neuroglycopenia | SIDER | ||
| 1088 | Pancreatic Diseases | 24534256 | CTD | |
| 1089 | Renal Insufficiency | 19171732 | CTD | |
| 1090 | Vascular Diseases | 24534256 | CTD | |
| 1091 | Ventricular Dysfunction, Left | 30885636 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.