Leuprolide
(RGLRXNKKBLIBQS-XNHQSDQCSA-N)
Structure
- SMILES
- CC(=O)O.CCNC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCC(=O)N1)CO)CC(C)C)CC(C)C)CCCN=C(N)N
- Molecular Formula:
- C61H88N16O14
- Molecular Weight:
- 1269.450
- Log P:
- 3.4473
- Hydrogen Bond Acceptor:
- 28
- Hydrogen Bond Donor:
- 16
- TPSA:
- 468.84
- CAS Number(s):
- 74381-53-6
Synonym(s)
1.
Leuprolide
2.
Leuprorelin
3.
A-43818
4.
Enantone
5.
Leuprolide Acetate
6.
Leuprolide Monoacetate
7.
Leuprolide, (DL-Leu)-Isomer
8.
Leuprolide, (L-Leu)-Isomer
9.
Lupron
10.
TAP-144
11.
A 43818
12.
A43818
13.
Acetate, Leuprolide
14.
Monoacetate, Leuprolide
15.
TAP 144
16.
TAP144
External Link(s)
| MeSH | D016729 |
| PubChem Compound | 657180 |
| BindingDB | 50247891 |
| ChEBI | 63597 |
| CHEMBL | CHEMBL1200775 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 168 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Arthralgia | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Fatigue | FAERS: 102 | OFFSIDES US FAERS | |
| 4 | Pain | FAERS: 94 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Nausea | FAERS: 58 | US FAERS | |
| 6 | Drug ineffective | FAERS: 57 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 7 | Mood swings | FAERS: 53 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 51 | US FAERS | |
| 9 | Dizziness | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Asthenia | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 11 | Bone pain | FAERS: 45 | OFFSIDES US FAERS | |
| 12 | Myalgia | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Back Pain | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Endometriosis | FAERS: 37 | OFFSIDES US FAERS | |
| 15 | Memory impairment | FAERS: 37 | US FAERS | |
| 16 | Pneumonia | FAERS: 37 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Malaise | FAERS: 36 | US FAERS | |
| 18 | Amnesia | FAERS: 35 | OFFSIDES US FAERS | |
| 19 | Anxiety | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 20 | Injection site pain | FAERS: 33 | US FAERS | |
| 21 | Night sweats | FAERS: 31 | US FAERS | |
| 22 | Vomiting | FAERS: 30 | US FAERS | |
| 23 | Alopecia | FAERS: 29 | US FAERS | |
| 24 | Abdominal Pain | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Hysterectomy | FAERS: 27 | US FAERS | |
| 26 | Myocardial Infarction | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Menorrhagia | FAERS: 24 | US FAERS | |
| 28 | Impaired work ability | FAERS: 23 | US FAERS | |
| 29 | Crying | FAERS: 22 | US FAERS | |
| 30 | Chest Pain | FAERS: 19 | US FAERS | |
| 31 | Pelvic Pain | FAERS: 19 | US FAERS | |
| 32 | Unevaluable event | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Musculoskeletal stiffness | FAERS: 18 | US FAERS | |
| 34 | Osteoporosis | FAERS: 18 | OFFSIDES US FAERS | |
| 35 | Constipation | FAERS: 17 | US FAERS | |
| 36 | Emotional disorder | FAERS: 17 | US FAERS | |
| 37 | Injection site erythema | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 38 | Pruritus | FAERS: 17 | US FAERS | |
| 39 | Weight decreased | FAERS: 17 | US FAERS | |
| 40 | Ascites | FAERS: 16 | US FAERS | |
| 41 | Cerebral Infarction | FAERS: 15 | US FAERS | |
| 42 | Cerebrovascular accident | FAERS: 15 | US FAERS | |
| 43 | Marasmus | FAERS: 15 | US FAERS | |
| 44 | Respiratory Failure | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Chills | FAERS: 14 | US FAERS | |
| 46 | Diabetes Mellitus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Hormone level abnormal | FAERS: 14 | US FAERS | |
| 48 | Fracture | FAERS: 13 | US FAERS | |
| 49 | Injection Site Reaction | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Medication Error | FAERS: 13 | US FAERS | |
| 51 | Visual Impairment | FAERS: 13 | US FAERS | |
| 52 | Injection site abscess | FAERS: 12 | US FAERS | |
| 53 | Menopause | FAERS: 12 | US FAERS | |
| 54 | Palpitations | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 55 | Depressed mood | FAERS: 11 | US FAERS | |
| 56 | Hypersensitivity | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Incorrect route of drug administration | FAERS: 11 | US FAERS | |
| 58 | Injection site nodule | FAERS: 11 | OFFSIDES US FAERS | |
| 59 | Somnolence | FAERS: 11 | US FAERS | |
| 60 | Swelling | FAERS: 11 | US FAERS | |
| 61 | Syncope | FAERS: 11 | US FAERS | |
| 62 | Anger | FAERS: 10 | US FAERS | |
| 63 | Disease Progression | FAERS: 10 | OFFSIDES US FAERS | |
| 64 | General physical health deterioration | FAERS: 10 | OFFSIDES US FAERS | |
| 65 | Joint swelling | FAERS: 10 | US FAERS | |
| 66 | Pulmonary Embolism | FAERS: 10 | US FAERS | |
| 67 | Drug exposure during pregnancy | FAERS: 9 | US FAERS | |
| 68 | Erectile dysfunction | FAERS: 9 | OFFSIDES US FAERS | |
| 69 | Erythema | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Metrorrhagia | FAERS: 9 | US FAERS | |
| 71 | Musculoskeletal Pain | FAERS: 9 | OFFSIDES US FAERS | |
| 72 | Thrombosis | FAERS: 9 | US FAERS | |
| 73 | Abasia | FAERS: 8 | US FAERS | |
| 74 | Abscess | FAERS: 8 | OFFSIDES US FAERS | |
| 75 | Acne | FAERS: 8 | US FAERS | |
| 76 | Blood creatine phosphokinase increased | FAERS: 8 | US FAERS | |
| 77 | Deep Vein Thrombosis | FAERS: 8 | US FAERS | |
| 78 | Hunger | FAERS: 8 | US FAERS | |
| 79 | Hyperthyroidism | FAERS: 8 | US FAERS | |
| 80 | Hypotension | FAERS: 8 | US FAERS | |
| 81 | Urinary Incontinence | FAERS: 8 | US FAERS | |
| 82 | Urinary tract infection | FAERS: 8 | US FAERS | |
| 83 | Activities of daily living impaired | FAERS: 7 | OFFSIDES US FAERS | |
| 84 | Adverse event | FAERS: 7 | US FAERS | |
| 85 | Cholecystitis | FAERS: 7 | US FAERS | |
| 86 | Cyst | FAERS: 7 | OFFSIDES US FAERS | |
| 87 | Hernia | FAERS: 7 | US FAERS | |
| 88 | Neck Pain | FAERS: 7 | US FAERS | |
| 89 | Pancreatic carcinoma | FAERS: 7 | US FAERS | |
| 90 | Tachycardia | FAERS: 7 | US FAERS | |
| 91 | Tremor | FAERS: 7 | US FAERS | |
| 92 | Aphasia | FAERS: 6 | US FAERS | |
| 93 | Blood testosterone increased | FAERS: 6 | US FAERS | |
| 94 | Cataract | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Cyanosis | FAERS: 6 | US FAERS | |
| 96 | Dry skin | FAERS: 6 | US FAERS | |
| 97 | Emotional distress | FAERS: 6 | OFFSIDES US FAERS | |
| 98 | Epistaxis | FAERS: 6 | US FAERS | |
| 99 | Flatulence | FAERS: 6 | US FAERS | |
| 100 | Injury associated with device | FAERS: 6 | US FAERS | |
| 101 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 102 | Pregnancy | FAERS: 6 | US FAERS | |
| 103 | Rhabdomyolysis | FAERS: 6 | US FAERS | |
| 104 | Arthritis | FAERS: 5 | US FAERS | |
| 105 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 106 | Blindness | FAERS: 5 | US FAERS | |
| 107 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 108 | Bone density decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 109 | Breast tenderness | FAERS: 5 | US FAERS | |
| 110 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 111 | Chest discomfort | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Diplopia | FAERS: 5 | US FAERS | |
| 113 | Disorientation | FAERS: 5 | US FAERS | |
| 114 | Gout | FAERS: 5 | US FAERS | |
| 115 | Granuloma | FAERS: 5 | US FAERS | |
| 116 | Grip strength decreased | FAERS: 5 | US FAERS | |
| 117 | Injection site pruritus | FAERS: 5 | US FAERS | |
| 118 | Metastasis | FAERS: 5 | US FAERS | |
| 119 | Metastatic Neoplasm | FAERS: 5 | OFFSIDES US FAERS | |
| 120 | Myomectomy | FAERS: 5 | US FAERS | |
| 121 | Osteopenia | FAERS: 5 | OFFSIDES US FAERS | |
| 122 | Peritonitis | FAERS: 5 | US FAERS | |
| 123 | Quality of life decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 124 | Sepsis | FAERS: 5 | US FAERS | |
| 125 | Stress | FAERS: 5 | US FAERS | |
| 126 | Tinnitus | FAERS: 5 | US FAERS | |
| 127 | Urticaria | FAERS: 5 | US FAERS | |
| 128 | Vulvovaginal dryness | FAERS: 5 | US FAERS | |
| 129 | Abdominal discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 130 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 131 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 132 | Anorexia | FAERS: 4 | US FAERS | |
| 133 | Arteriosclerosis | FAERS: 4 | OFFSIDES US FAERS | |
| 134 | Arthropathy | FAERS: 4 | OFFSIDES US FAERS | |
| 135 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 136 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 137 | Deafness | FAERS: 4 | OFFSIDES US FAERS | |
| 138 | Dehydration | FAERS: 4 | US FAERS | |
| 139 | Delirium | FAERS: 4 | US FAERS | |
| 140 | Dysarthria | FAERS: 4 | US FAERS | |
| 141 | Dysuria | FAERS: 4 | US FAERS | |
| 142 | Epilepsy | FAERS: 4 | US FAERS | |
| 143 | Feeling Cold | FAERS: 4 | US FAERS | |
| 144 | Fibromyalgia | FAERS: 4 | US FAERS | |
| 145 | Flushing | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Formication | FAERS: 4 | OFFSIDES US FAERS | |
| 147 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 148 | Guillain-Barre Syndrome | FAERS: 4 | US FAERS | |
| 149 | Hemiplegia | FAERS: 4 | US FAERS | |
| 150 | Hepatitis | FAERS: 4 | US FAERS | |
| 151 | Hypoxia | FAERS: 4 | US FAERS | |
| 152 | Impaired quality of life | FAERS: 4 | US FAERS | |
| 153 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 154 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 155 | Injection site bruising | FAERS: 4 | US FAERS | |
| 156 | Injection site inflammation | FAERS: 4 | US FAERS | |
| 157 | Lethargy | FAERS: 4 | OFFSIDES US FAERS | |
| 158 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 159 | Metastatic pain | FAERS: 4 | US FAERS | |
| 160 | Muscle tightness | FAERS: 4 | US FAERS | |
| 161 | Myopathy | FAERS: 4 | US FAERS | |
| 162 | Nocturia | FAERS: 4 | OFFSIDES US FAERS | |
| 163 | Post procedural complication | FAERS: 4 | US FAERS | |
| 164 | Purulence | FAERS: 4 | US FAERS | |
| 165 | Retinal Vein Occlusion | FAERS: 4 | US FAERS | |
| 166 | Thirst | FAERS: 4 | US FAERS | |
| 167 | Urinary Retention | FAERS: 4 | US FAERS | |
| 168 | Vertigo | FAERS: 4 | US FAERS | |
| 169 | Visual disturbance | FAERS: 4 | US FAERS | |
| 170 | Wheelchair user | FAERS: 4 | US FAERS | |
| 171 | Abdominal adhesions | FAERS: 3 | US FAERS | |
| 172 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 173 | Adnexa uteri pain | FAERS: 3 | OFFSIDES US FAERS | |
| 174 | Anhedonia | FAERS: 3 | OFFSIDES US FAERS | |
| 175 | Aortic Aneurysm | FAERS: 3 | OFFSIDES US FAERS | |
| 176 | Asthma | FAERS: 3 | US FAERS | |
| 177 | Bedridden | FAERS: 3 | US FAERS | |
| 178 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 179 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 180 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 181 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 182 | Blood urine present | FAERS: 3 | US FAERS | |
| 183 | Bradycardia | FAERS: 3 | US FAERS | |
| 184 | Burning sensation | FAERS: 3 | US FAERS | |
| 185 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 186 | Dementia | FAERS: 3 | US FAERS | |
| 187 | Diabetes Insipidus | FAERS: 3 | US FAERS | |
| 188 | Disability | FAERS: 3 | US FAERS | |
| 189 | Discomfort | FAERS: 3 | US FAERS | |
| 190 | Disease recurrence | FAERS: 3 | US FAERS | |
| 191 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 192 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 193 | Dysgeusia | FAERS: 3 | US FAERS | |
| 194 | Food craving | FAERS: 3 | US FAERS | |
| 195 | Gingivitis | FAERS: 3 | US FAERS | |
| 196 | Hypothalamo-pituitary disorder | FAERS: 3 | US FAERS | |
| 197 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 198 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 199 | Infection | FAERS: 3 | OFFSIDES US FAERS | |
| 200 | Injection site discharge | FAERS: 3 | US FAERS | |
| 201 | Injection site necrosis | FAERS: 3 | US FAERS | |
| 202 | Injection site warmth | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 203 | Joint Range of Motion Decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 204 | Joint stiffness | FAERS: 3 | US FAERS | |
| 205 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 206 | Leukopenia | FAERS: 3 | US FAERS | |
| 207 | Meningioma | FAERS: 3 | US FAERS | |
| 208 | Meningitis | FAERS: 3 | US FAERS | |
| 209 | Mycosis Fungoides | FAERS: 3 | US FAERS | |
| 210 | Necrosis | FAERS: 3 | US FAERS | |
| 211 | Nervousness | FAERS: 3 | US FAERS | |
| 212 | Neuralgia | FAERS: 3 | OFFSIDES US FAERS | |
| 213 | Ovarian Hyperstimulation Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 214 | Ovarian failure | FAERS: 3 | US FAERS | |
| 215 | Paraplegia | FAERS: 3 | US FAERS | |
| 216 | Personality Change | FAERS: 3 | US FAERS | |
| 217 | Photophobia | FAERS: 3 | US FAERS | |
| 218 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 219 | Posterior reversible encephalopathy syndrome | FAERS: 3 | US FAERS | |
| 220 | Product quality issue | FAERS: 3 | US FAERS | |
| 221 | Product storage error | FAERS: 3 | US FAERS | |
| 222 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 223 | Recall phenomenon | FAERS: 3 | US FAERS | |
| 224 | Sciatica | FAERS: 3 | US FAERS | |
| 225 | Shock | FAERS: 3 | US FAERS | |
| 226 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 227 | Suicide attempt | FAERS: 3 | US FAERS | |
| 228 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 229 | Tooth Loss | FAERS: 3 | US FAERS | |
| 230 | Venous Thrombosis | FAERS: 3 | US FAERS | |
| 231 | Vitamin D Deficiency | FAERS: 3 | US FAERS | |
| 232 | nervous system disorder | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 233 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 234 | Accidental overdose | FAERS: 2 | US FAERS | |
| 235 | Ageusia | FAERS: 2 | US FAERS | |
| 236 | Agitation | FAERS: 2 | US FAERS | |
| 237 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 238 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 239 | Anuria | FAERS: 2 | US FAERS | |
| 240 | Aphonia | FAERS: 2 | US FAERS | |
| 241 | Atelectasis | FAERS: 2 | US FAERS | |
| 242 | Basal cell carcinoma | FAERS: 2 | OFFSIDES US FAERS | |
| 243 | Benign Prostatic Hyperplasia | FAERS: 2 | OFFSIDES US FAERS | |
| 244 | Bladder pain | FAERS: 2 | US FAERS | |
| 245 | Blepharospasm | FAERS: 2 | US FAERS | |
| 246 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 247 | Blood growth hormone increased | FAERS: 2 | US FAERS | |
| 248 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 249 | Blood prolactin increased | FAERS: 2 | US FAERS | |
| 250 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 251 | Blood testosterone normal | FAERS: 2 | US FAERS | |
| 252 | Blood urea increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 253 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 254 | Bulbospinal muscular atrophy congenital | FAERS: 2 | US FAERS | |
| 255 | Chorioamnionitis | FAERS: 2 | US FAERS | |
| 256 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 257 | Cold sweat | FAERS: 2 | US FAERS | |
| 258 | Completed Suicide | FAERS: 2 | US FAERS | |
| 259 | Dental caries | FAERS: 2 | OFFSIDES US FAERS | |
| 260 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 261 | Drug dose omission | FAERS: 2 | US FAERS | |
| 262 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 263 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 264 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 265 | Dysphemia | FAERS: 2 | US FAERS | |
| 266 | Dysphonia | FAERS: 2 | OFFSIDES US FAERS | |
| 267 | Ectopic Pregnancy | FAERS: 2 | US FAERS | |
| 268 | Elevated mood | FAERS: 2 | US FAERS | |
| 269 | Embolism | FAERS: 2 | US FAERS | |
| 270 | Endocarditis | FAERS: 2 | US FAERS | |
| 271 | Eructation | FAERS: 2 | US FAERS | |
| 272 | Essential Hypertension | FAERS: 2 | US FAERS | |
| 273 | Expired product administered | FAERS: 2 | US FAERS | |
| 274 | Facial Pain | FAERS: 2 | US FAERS | |
| 275 | Feeling of body temperature change | FAERS: 2 | OFFSIDES US FAERS | |
| 276 | Frustration | FAERS: 2 | US FAERS | |
| 277 | Gastritis | FAERS: 2 | US FAERS | |
| 278 | General symptom | FAERS: 2 | US FAERS | |
| 279 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 280 | Hydrothorax | FAERS: 2 | US FAERS | |
| 281 | Hypophagia | FAERS: 2 | US FAERS | |
| 282 | Hypopituitarism | FAERS: 2 | US FAERS | |
| 283 | Impatience | FAERS: 2 | US FAERS | |
| 284 | Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 285 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 286 | Induration | FAERS: 2 | US FAERS | |
| 287 | Inflammation | FAERS: 2 | US FAERS | |
| 288 | Injection site granuloma | FAERS: 2 | US FAERS | |
| 289 | Injection site papule | FAERS: 2 | US FAERS | |
| 290 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 291 | Intervertebral disc disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 292 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 293 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 294 | Ketoacidosis | FAERS: 2 | US FAERS | |
| 295 | Laparoscopy | FAERS: 2 | US FAERS | |
| 296 | Live Birth | FAERS: 2 | US FAERS | |
| 297 | Liver Abscess | FAERS: 2 | US FAERS | |
| 298 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 299 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 300 | Macular degeneration | FAERS: 2 | US FAERS | |
| 301 | Mediastinal mass | FAERS: 2 | US FAERS | |
| 302 | Mental status changes | FAERS: 2 | US FAERS | |
| 303 | Myositis | FAERS: 2 | US FAERS | |
| 304 | Needle issue | FAERS: 2 | US FAERS | |
| 305 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 306 | Nerve injury | FAERS: 2 | US FAERS | |
| 307 | Neuropathy | FAERS: 2 | US FAERS | |
| 308 | Nipple pain | FAERS: 2 | US FAERS | |
| 309 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 310 | Oropharyngeal pain | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Ovarian enlargement | FAERS: 2 | US FAERS | |
| 312 | Overdose | FAERS: 2 | US FAERS | |
| 313 | Overweight | FAERS: 2 | US FAERS | |
| 314 | Paranoia | FAERS: 2 | US FAERS | |
| 315 | Pelvic adhesions | FAERS: 2 | US FAERS | |
| 316 | Pelvic discomfort | FAERS: 2 | US FAERS | |
| 317 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 318 | Physical disability | FAERS: 2 | OFFSIDES US FAERS | |
| 319 | Pneumonitis | FAERS: 2 | US FAERS | |
| 320 | Pneumothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 321 | Postoperative adhesion | FAERS: 2 | US FAERS | |
| 322 | Postoperative fever | FAERS: 2 | US FAERS | |
| 323 | Premature Menopause | FAERS: 2 | US FAERS | |
| 324 | Prostatic specific antigen decreased | FAERS: 2 | US FAERS | |
| 325 | Rash erythematous | FAERS: 2 | US FAERS | |
| 326 | Renal cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 327 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 328 | Rhinoscleroma | FAERS: 2 | US FAERS | |
| 329 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 330 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 331 | Secretion discharge | FAERS: 2 | OFFSIDES US FAERS | |
| 332 | Serotonin Syndrome | FAERS: 2 | US FAERS | |
| 333 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 334 | Skin Induration | FAERS: 2 | OFFSIDES US FAERS | |
| 335 | Skin lesion | FAERS: 2 | US FAERS | |
| 336 | Sluggishness | FAERS: 2 | US FAERS | |
| 337 | Somnambulism | FAERS: 2 | US FAERS | |
| 338 | Spinal column stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 339 | Spinal cord paralysis | FAERS: 2 | US FAERS | |
| 340 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 341 | Subcutaneous nodule | FAERS: 2 | OFFSIDES US FAERS | |
| 342 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 343 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 344 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 345 | Therapy cessation | FAERS: 2 | US FAERS | |
| 346 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 347 | Tonsillectomy | FAERS: 2 | US FAERS | |
| 348 | Urethrotomy | FAERS: 2 | US FAERS | |
| 349 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 350 | Urine output increased | FAERS: 2 | US FAERS | |
| 351 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 352 | Uterine spasm | FAERS: 2 | US FAERS | |
| 353 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 354 | Vocal cord cyst | FAERS: 2 | US FAERS | |
| 355 | Vulvovaginal pain | FAERS: 2 | OFFSIDES US FAERS | |
| 356 | Walking aid user | FAERS: 2 | US FAERS | |
| 357 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 358 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 359 | colonoscopy | FAERS: 2 | US FAERS | |
| 360 | liposarcoma | FAERS: 2 | US FAERS | |
| 361 | treatment failure | FAERS: 2 | US FAERS | |
| 362 | Abulia | FAERS: 1 | US FAERS | |
| 363 | Acanthosis Nigricans | FAERS: 1 | US FAERS | |
| 364 | Accidental exposure | FAERS: 1 | US FAERS | |
| 365 | Accidental needle stick | FAERS: 1 | US FAERS | |
| 366 | Acute kidney injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 367 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 368 | Administration site pruritus | FAERS: 1 | US FAERS | |
| 369 | Administration site swelling | FAERS: 1 | US FAERS | |
| 370 | Administration site ulcer | FAERS: 1 | US FAERS | |
| 371 | Adnexa uteri mass | FAERS: 1 | US FAERS | |
| 372 | Akathisia | FAERS: 1 | US FAERS | |
| 373 | Allergic respiratory symptom | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 374 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 375 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 376 | Aneurysm | FAERS: 1 | US FAERS | |
| 377 | Angioedema | FAERS: 1 | US FAERS | |
| 378 | Aortic valve sclerosis | FAERS: 1 | US FAERS | |
| 379 | Apathy | FAERS: 1 | US FAERS | |
| 380 | Arthropod bite | FAERS: 1 | US FAERS | |
| 381 | Asbestosis | FAERS: 1 | US FAERS | |
| 382 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 383 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 384 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 385 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 386 | Back disorder | FAERS: 1 | US FAERS | |
| 387 | Bankruptcy | FAERS: 1 | US FAERS | |
| 388 | Biopsy prostate abnormal | FAERS: 1 | US FAERS | |
| 389 | Bladder spasm | FAERS: 1 | US FAERS | |
| 390 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 391 | Blood calcitonin increased | FAERS: 1 | US FAERS | |
| 392 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 393 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 394 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 395 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 396 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 397 | Body height below normal | FAERS: 1 | US FAERS | |
| 398 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 399 | Bone lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 400 | Brachytherapy | FAERS: 1 | US FAERS | |
| 401 | Brain Contusion | FAERS: 1 | US FAERS | |
| 402 | Breakthrough Pain | FAERS: 1 | US FAERS | |
| 403 | Breast Cyst | FAERS: 1 | US FAERS | |
| 404 | Bronchitis | FAERS: 1 | US FAERS | |
| 405 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 406 | C-reactive protein decreased | FAERS: 1 | US FAERS | |
| 407 | CD30 expression | FAERS: 1 | US FAERS | |
| 408 | Cachexia | FAERS: 1 | US FAERS | |
| 409 | Calcinosis | FAERS: 1 | US FAERS | |
| 410 | Cancer Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 411 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 412 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 413 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 414 | Cellulitis | FAERS: 1 | US FAERS | |
| 415 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 416 | Central venous catheter removal | FAERS: 1 | US FAERS | |
| 417 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 418 | Cervical polyp | FAERS: 1 | US FAERS | |
| 419 | Choking | FAERS: 1 | OFFSIDES US FAERS | |
| 420 | Cholestasis | FAERS: 1 | US FAERS | |
| 421 | Chronic left ventricular failure | FAERS: 1 | US FAERS | |
| 422 | Cluster Headache | FAERS: 1 | US FAERS | |
| 423 | Colitis | FAERS: 1 | US FAERS | |
| 424 | Colon adenoma | FAERS: 1 | US FAERS | |
| 425 | Colonic Pseudo-Obstruction | FAERS: 1 | US FAERS | |
| 426 | Complication associated with device | FAERS: 1 | US FAERS | |
| 427 | Compulsive sexual behaviour | FAERS: 1 | US FAERS | |
| 428 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 429 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 430 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 431 | Cystitis | FAERS: 1 | US FAERS | |
| 432 | Cystoscopy | FAERS: 1 | US FAERS | |
| 433 | Cytopenia | FAERS: 1 | US FAERS | |
| 434 | Decompressive Craniectomy | FAERS: 1 | US FAERS | |
| 435 | Dependence | FAERS: 1 | US FAERS | |
| 436 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 437 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 438 | Device malfunction | FAERS: 1 | US FAERS | |
| 439 | Disease complication | FAERS: 1 | US FAERS | |
| 440 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 441 | Drug implantation | FAERS: 1 | US FAERS | |
| 442 | Dyschezia | FAERS: 1 | US FAERS | |
| 443 | Dyspepsia | FAERS: 1 | US FAERS | |
| 444 | Ecchymosis | FAERS: 1 | US FAERS | |
| 445 | Economic problem | FAERS: 1 | US FAERS | |
| 446 | Embolic stroke | FAERS: 1 | US FAERS | |
| 447 | Empty Sella Syndrome | FAERS: 1 | US FAERS | |
| 448 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 449 | Endometrial metaplasia | FAERS: 1 | US FAERS | |
| 450 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 451 | Eschar | FAERS: 1 | US FAERS | |
| 452 | Euphoric mood | FAERS: 1 | US FAERS | |
| 453 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 454 | Eye pain | FAERS: 1 | US FAERS | |
| 455 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 456 | Facial paralysis | FAERS: 1 | US FAERS | |
| 457 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 458 | Fibromatosis | FAERS: 1 | US FAERS | |
| 459 | Gait inability | FAERS: 1 | US FAERS | |
| 460 | Gastroenteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 461 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 462 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 463 | Genital atrophy | FAERS: 1 | US FAERS | |
| 464 | Genital swelling | FAERS: 1 | US FAERS | |
| 465 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 466 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 467 | Head discomfort | FAERS: 1 | US FAERS | |
| 468 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 469 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 470 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 471 | Hirsutism | FAERS: 1 | US FAERS | |
| 472 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 473 | Hodgkin's disease nodular sclerosis stage IV | FAERS: 1 | US FAERS | |
| 474 | Hospice Care | FAERS: 1 | US FAERS | |
| 475 | Hostility | FAERS: 1 | US FAERS | |
| 476 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 477 | Hydrometra | FAERS: 1 | US FAERS | |
| 478 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 479 | Hypersomnia | FAERS: 1 | US FAERS | |
| 480 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 481 | Hyperventilation | FAERS: 1 | US FAERS | |
| 482 | Ileus | FAERS: 1 | US FAERS | |
| 483 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 484 | Immunosuppression | FAERS: 1 | US FAERS | |
| 485 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 486 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 487 | Incision site infection | FAERS: 1 | US FAERS | |
| 488 | Incoherent | FAERS: 1 | US FAERS | |
| 489 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 490 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 491 | Infected lymphocele | FAERS: 1 | US FAERS | |
| 492 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 493 | Infertility | FAERS: 1 | US FAERS | |
| 494 | Influenza | FAERS: 1 | US FAERS | |
| 495 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 496 | Injection site cellulitis | FAERS: 1 | US FAERS | |
| 497 | Injection site discomfort | FAERS: 1 | US FAERS | |
| 498 | Injection site eczema | FAERS: 1 | US FAERS | |
| 499 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 500 | Injection site mass | FAERS: 1 | US FAERS | |
| 501 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 502 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 503 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 504 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 505 | Intestinal fibrosis | FAERS: 1 | US FAERS | |
| 506 | Intestinal resection | FAERS: 1 | US FAERS | |
| 507 | Intracranial artery dissection | FAERS: 1 | US FAERS | |
| 508 | Intracranial injury | FAERS: 1 | US FAERS | |
| 509 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 510 | Laparotomy | FAERS: 1 | US FAERS | |
| 511 | Late onset hypogonadism syndrome | FAERS: 1 | US FAERS | |
| 512 | Leukocytosis | FAERS: 1 | US FAERS | |
| 513 | Leukoplakia | FAERS: 1 | US FAERS | |
| 514 | Limb operation | FAERS: 1 | US FAERS | |
| 515 | Lip swelling | FAERS: 1 | US FAERS | |
| 516 | Lipase increased | FAERS: 1 | US FAERS | |
| 517 | Liver palpable subcostal | FAERS: 1 | US FAERS | |
| 518 | Loop electrosurgical excision procedure | FAERS: 1 | US FAERS | |
| 519 | Loose tooth | FAERS: 1 | OFFSIDES US FAERS | |
| 520 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 521 | Macroangiopathy | FAERS: 1 | US FAERS | |
| 522 | Malignant neoplasm progression | FAERS: 1 | OFFSIDES US FAERS | |
| 523 | Megacolon | FAERS: 1 | US FAERS | |
| 524 | Mental impairment | FAERS: 1 | US FAERS | |
| 525 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 526 | Metaplasia | FAERS: 1 | US FAERS | |
| 527 | Middle insomnia | FAERS: 1 | US FAERS | |
| 528 | Mitochondrial DNA mutation | FAERS: 1 | US FAERS | |
| 529 | Moaning | FAERS: 1 | US FAERS | |
| 530 | Monoplegia | FAERS: 1 | US FAERS | |
| 531 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 532 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 533 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 534 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 535 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 536 | Musculoskeletal discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 537 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 538 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 539 | Nephritis | FAERS: 1 | US FAERS | |
| 540 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 541 | Nicotine Dependence | FAERS: 1 | US FAERS | |
| 542 | No adverse event | FAERS: 1 | US FAERS | |
| 543 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 544 | Nodule | FAERS: 1 | US FAERS | |
| 545 | Nystagmus | FAERS: 1 | US FAERS | |
| 546 | Obesity | FAERS: 1 | US FAERS | |
| 547 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 548 | Oliguria | FAERS: 1 | US FAERS | |
| 549 | Onychoclasis | FAERS: 1 | US FAERS | |
| 550 | Osteoma cutis | FAERS: 1 | OFFSIDES US FAERS | |
| 551 | Ovarian adhesion | FAERS: 1 | US FAERS | |
| 552 | Ovulation disorder | FAERS: 1 | US FAERS | |
| 553 | PO2 decreased | FAERS: 1 | US FAERS | |
| 554 | Pachymeningitis | FAERS: 1 | US FAERS | |
| 555 | Pallor | FAERS: 1 | US FAERS | |
| 556 | Pancytopenia | FAERS: 1 | US FAERS | |
| 557 | Parakeratosis | FAERS: 1 | US FAERS | |
| 558 | Partner stress | FAERS: 1 | US FAERS | |
| 559 | Pathological fracture | FAERS: 1 | US FAERS | |
| 560 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 561 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 562 | Performance status decreased | FAERS: 1 | US FAERS | |
| 563 | Perineal pain | FAERS: 1 | US FAERS | |
| 564 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 565 | Petechiae | FAERS: 1 | US FAERS | |
| 566 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 567 | Pituitary enlargement | FAERS: 1 | US FAERS | |
| 568 | Polymyalgia | FAERS: 1 | US FAERS | |
| 569 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 570 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 571 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 572 | Pouchitis | FAERS: 1 | US FAERS | |
| 573 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 574 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 575 | Precocious Puberty | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 576 | Premenstrual pain | FAERS: 1 | US FAERS | |
| 577 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 578 | Presyncope | FAERS: 1 | US FAERS | |
| 579 | Product container seal issue | FAERS: 1 | US FAERS | |
| 580 | Product formulation issue | FAERS: 1 | US FAERS | |
| 581 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 582 | Product use complaint | FAERS: 1 | US FAERS | |
| 583 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 584 | Product use issue | FAERS: 1 | US FAERS | |
| 585 | Prostate cancer recurrent | FAERS: 1 | OFFSIDES US FAERS | |
| 586 | Prostatectomy | FAERS: 1 | US FAERS | |
| 587 | Protein urine present | FAERS: 1 | US FAERS | |
| 588 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 589 | Purpura | FAERS: 1 | US FAERS | |
| 590 | Radical hysterectomy | FAERS: 1 | US FAERS | |
| 591 | Radical prostatectomy | FAERS: 1 | US FAERS | |
| 592 | Renal Colic | FAERS: 1 | US FAERS | |
| 593 | Restlessness | FAERS: 1 | US FAERS | |
| 594 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 595 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 596 | Rosacea | FAERS: 1 | US FAERS | |
| 597 | Salpingectomy | FAERS: 1 | US FAERS | |
| 598 | Salpingo-oophorectomy unilateral | FAERS: 1 | US FAERS | |
| 599 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 600 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 601 | Schizophrenia | FAERS: 1 | US FAERS | |
| 602 | Screaming | FAERS: 1 | US FAERS | |
| 603 | Scrotal mass | FAERS: 1 | US FAERS | |
| 604 | Senile dementia | FAERS: 1 | US FAERS | |
| 605 | Serum Sickness | FAERS: 1 | US FAERS | |
| 606 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 607 | Skin Erosion | FAERS: 1 | US FAERS | |
| 608 | Skin necrosis | FAERS: 1 | US FAERS | |
| 609 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 610 | Splenomegaly | FAERS: 1 | US FAERS | |
| 611 | Spondylitis | FAERS: 1 | US FAERS | |
| 612 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 613 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 614 | Stillbirth | FAERS: 1 | US FAERS | |
| 615 | Strabismus | FAERS: 1 | US FAERS | |
| 616 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 617 | Subileus | FAERS: 1 | US FAERS | |
| 618 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 619 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 620 | Tension | FAERS: 1 | US FAERS | |
| 621 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 622 | Throat irritation | FAERS: 1 | US FAERS | |
| 623 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 624 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 625 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 626 | Tongue biting | FAERS: 1 | OFFSIDES US FAERS | |
| 627 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 628 | Toothache | FAERS: 1 | US FAERS | |
| 629 | Torticollis | FAERS: 1 | US FAERS | |
| 630 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 631 | Transient psychosis | FAERS: 1 | US FAERS | |
| 632 | Trismus | FAERS: 1 | US FAERS | |
| 633 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 634 | Unemployment | FAERS: 1 | US FAERS | |
| 635 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 636 | Urethral Stenosis | FAERS: 1 | US FAERS | |
| 637 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 638 | Uterine atrophy | FAERS: 1 | US FAERS | |
| 639 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 640 | Vaginal pain | FAERS: 1 | US FAERS | |
| 641 | Vascular compression | FAERS: 1 | US FAERS | |
| 642 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 643 | Vasculitis | FAERS: 1 | US FAERS | |
| 644 | Vasospasm | FAERS: 1 | US FAERS | |
| 645 | Venous occlusion | FAERS: 1 | US FAERS | |
| 646 | Verbigeration | FAERS: 1 | US FAERS | |
| 647 | Vestibulitis | FAERS: 1 | US FAERS | |
| 648 | Viral sinusitis | FAERS: 1 | US FAERS | |
| 649 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 650 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 651 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 652 | Weight | FAERS: 1 | US FAERS | |
| 653 | Wheezing | FAERS: 1 | US FAERS | |
| 654 | jaundice | FAERS: 1 | US FAERS | |
| 655 | leiomyosarcoma | FAERS: 1 | US FAERS | |
| 656 | skin abrasion | FAERS: 1 | US FAERS | |
| 657 | Abnormal vision | OFFSIDES | ||
| 658 | Allergy to chemicals | Canada Vigilance: 1 | Canada Vigilance | |
| 659 | Amenorrhea | OFFSIDES | ||
| 660 | Ammonia increased | OFFSIDES | ||
| 661 | Anal Fissure | OFFSIDES | ||
| 662 | Anal abscess | OFFSIDES | ||
| 663 | Anhidrosis | OFFSIDES | ||
| 664 | Arteriosclerosis Obliterans | OFFSIDES | ||
| 665 | Aspiration Pneumonia | OFFSIDES | ||
| 666 | Biopsy | OFFSIDES | ||
| 667 | Bladder neck obstruction | OFFSIDES | ||
| 668 | Blood brain barrier defect | OFFSIDES | ||
| 669 | Blood cholinesterase decreased | OFFSIDES | ||
| 670 | Blood count abnormal | OFFSIDES | ||
| 671 | Blood creatine abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 672 | Blood iron decreased | OFFSIDES | ||
| 673 | Blood iron increased | OFFSIDES | ||
| 674 | Body fat disorder | OFFSIDES | ||
| 675 | Bone fragmentation | OFFSIDES | ||
| 676 | Bone swelling | OFFSIDES | ||
| 677 | Bone trimming | OFFSIDES | ||
| 678 | Bursitis | OFFSIDES | ||
| 679 | Carcinoembryonic antigen increased | OFFSIDES | ||
| 680 | Cataract operation | OFFSIDES | ||
| 681 | Cerebral atrophy | OFFSIDES | ||
| 682 | Choking sensation | OFFSIDES | ||
| 683 | Choledocholithotomy | OFFSIDES | ||
| 684 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 685 | Compression fracture | OFFSIDES | ||
| 686 | Confabulation | OFFSIDES | ||
| 687 | Debridement | OFFSIDES | ||
| 688 | Decreased Libido | OFFSIDES | ||
| 689 | Demyelination | OFFSIDES | ||
| 690 | Denture wearer | OFFSIDES | ||
| 691 | Diverticulosis | OFFSIDES | ||
| 692 | Diverticulum | OFFSIDES | ||
| 693 | Ear tube insertion | OFFSIDES | ||
| 694 | Ejection Fraction Decreased | OFFSIDES | ||
| 695 | Endodontic procedure | OFFSIDES | ||
| 696 | Epiglottitis | OFFSIDES | ||
| 697 | Eustachian tube disorder | OFFSIDES | ||
| 698 | Exfoliative rash | OFFSIDES | ||
| 699 | Failure to Thrive | OFFSIDES | ||
| 700 | Fistula discharge | OFFSIDES | ||
| 701 | Food Allergy | Canada Vigilance: 1 | Canada Vigilance | |
| 702 | Gallbladder necrosis | OFFSIDES | ||
| 703 | Gastric ulcer | OFFSIDES | ||
| 704 | Gene Mutation | OFFSIDES | ||
| 705 | Gingival blister | OFFSIDES | ||
| 706 | Gingival erythema | OFFSIDES | ||
| 707 | Glaucoma | OFFSIDES | ||
| 708 | Hepatotoxicity | OFFSIDES | ||
| 709 | High frequency ablation | OFFSIDES | ||
| 710 | Hydronephrosis | OFFSIDES | ||
| 711 | Hyperkeratosis | OFFSIDES | ||
| 712 | Hyperpigmentation | OFFSIDES | ||
| 713 | Hypocoagulable state | OFFSIDES | ||
| 714 | Hyporeflexia | OFFSIDES | ||
| 715 | Impetigo | OFFSIDES | ||
| 716 | Injection site dermatitis | OFFSIDES | ||
| 717 | Injection site hypersensitivity | Canada Vigilance: 1 | Canada Vigilance | |
| 718 | Injection site infection | OFFSIDES | ||
| 719 | Injection site vesicles | OFFSIDES | ||
| 720 | Intermittent Claudication | OFFSIDES | ||
| 721 | Intestinal infarction | OFFSIDES | ||
| 722 | Joint injury | OFFSIDES | ||
| 723 | Laryngospasm | OFFSIDES | ||
| 724 | Life expectancy shortened | OFFSIDES | ||
| 725 | Lung Abscess | OFFSIDES | ||
| 726 | Lymphoma | OFFSIDES | ||
| 727 | Mastication disorder | OFFSIDES | ||
| 728 | Muscle Fatigue | OFFSIDES | ||
| 729 | Muscle Weakness | OFFSIDES | ||
| 730 | Narcotic intoxication | OFFSIDES | ||
| 731 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 732 | Neuroblastoma | OFFSIDES | ||
| 733 | Obstruction | OFFSIDES | ||
| 734 | Open wound | OFFSIDES | ||
| 735 | Oral Cavity Fistula | OFFSIDES | ||
| 736 | Oral polypectomy | OFFSIDES | ||
| 737 | Osteomyelitis | OFFSIDES | ||
| 738 | Osteotomy | OFFSIDES | ||
| 739 | Pain of skin | OFFSIDES | ||
| 740 | Pancreatic enzymes increased | OFFSIDES | ||
| 741 | Periodontitis | OFFSIDES | ||
| 742 | Polymyalgia Rheumatica | OFFSIDES | ||
| 743 | Poor personal hygiene | OFFSIDES | ||
| 744 | Priapism | OFFSIDES | ||
| 745 | Primary sequestrum | OFFSIDES | ||
| 746 | Prostatic Obstruction | OFFSIDES | ||
| 747 | Protein total increased | OFFSIDES | ||
| 748 | Psoriasis | Canada Vigilance: 1 | Canada Vigilance | |
| 749 | Pulmonary radiation injury | OFFSIDES | ||
| 750 | Purulent discharge | OFFSIDES | ||
| 751 | Rectal fissure | OFFSIDES | ||
| 752 | Residual urine | OFFSIDES | ||
| 753 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 754 | Sequestrectomy | OFFSIDES | ||
| 755 | Skin hypertrophy | OFFSIDES | ||
| 756 | Skin tightness | OFFSIDES | ||
| 757 | Snoring | OFFSIDES | ||
| 758 | Synovial Cyst | OFFSIDES | ||
| 759 | Tenosynovitis | OFFSIDES | ||
| 760 | Therapeutic procedure | OFFSIDES | ||
| 761 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 762 | Thrombophlebitis | OFFSIDES | ||
| 763 | Tolosa-Hunt Syndrome | OFFSIDES | ||
| 764 | Tooth Extraction | OFFSIDES | ||
| 765 | Tooth Infection | OFFSIDES | ||
| 766 | Ureteral stent insertion | OFFSIDES | ||
| 767 | Urethral fistula | OFFSIDES | ||
| 768 | Vitamin A Deficiency | OFFSIDES | ||
| 769 | Vitreous Detachment | OFFSIDES | ||
| 770 | Weight Gain | OFFSIDES | ||
| 771 | Wound Debridement | OFFSIDES | ||
| 772 | Wound closure | OFFSIDES | ||
| 773 | Wound dehiscence | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.