Fluconazole
(RFHAOTPXVQNOHP-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1ccc(c(c1)F)C(Cn1cncn1)(Cn1cncn1)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- D01AC15; J01RA07; J02AC01
- Molecular Formula:
- C13H12F2N6O
- Molecular Weight:
- 306.271
- Log P:
- 0.7358
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 1
- TPSA:
- 81.65
- CAS Number(s):
- 86386-73-4; 123631-92-5; 340962-81-4
Synonym(s)
1.
Fluconazole
2.
Apo-Fluconazole
3.
Béagyne
4.
Diflucan
5.
Fluc Hexal
6.
FlucoLich
7.
Flucobeta
8.
Fluconazol AL
9.
Fluconazol AbZ
10.
Fluconazol Stada
11.
Fluconazol von ct
12.
Fluconazol-Isis
13.
Fluconazol-ratiopharm
14.
Flunazul
15.
Fungata
16.
Lavisa
17.
Loitin
18.
Neofomiral
19.
Oxifungol
20.
Solacap
21.
Triflucan
22.
UK-49858
23.
Zonal
24.
Apo Fluconazole
25.
Fluconazol Isis
26.
Fluconazol ratiopharm
27.
UK 49858
28.
UK49858
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 220 Canada Vigilance: 30 | Canada Vigilance US FAERS | |
| 2 | Pruritus | FAERS: 96 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 3 | Nausea | FAERS: 89 Canada Vigilance: 6 | 9762826 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Urticaria | FAERS: 78 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 5 | Headache | FAERS: 71 Canada Vigilance: 9 | 9309372 9762826 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Erythema | FAERS: 69 Canada Vigilance: 8 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Dizziness | FAERS: 51 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 8 | Hypersensitivity | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Pain | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Vomiting | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Lip swelling | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Malaise | FAERS: 41 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 13 | Alopecia | FAERS: 40 Canada Vigilance: 1 | 9309372 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 14 | Burning sensation | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Fatigue | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Drug exposure during pregnancy | FAERS: 33 | US FAERS | |
| 17 | Maternal exposure during pregnancy | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Stevens-Johnson Syndrome | FAERS: 32 Canada Vigilance: 5 | 25811541 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 19 | Feeling abnormal | FAERS: 31 | SIDER US FAERS | |
| 20 | Swelling | FAERS: 30 | US FAERS | |
| 21 | Abdominal Pain | FAERS: 27 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Intestinal Perforation | FAERS: 24 | US FAERS | |
| 23 | Drug resistance | FAERS: 23 | US FAERS | |
| 24 | Medication Error | FAERS: 23 | US FAERS | |
| 25 | Palpitations | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Abdominal discomfort | FAERS: 21 | OFFSIDES US FAERS | |
| 27 | Vulvovaginal pruritus | FAERS: 21 | US FAERS | |
| 28 | Asthenia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 29 | Rash erythematous | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Eczema | FAERS: 18 | US FAERS | |
| 31 | Myalgia | FAERS: 18 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 32 | Pathogen resistance | FAERS: 18 | SIDER US FAERS | |
| 33 | Pharmaceutical product complaint | FAERS: 18 | US FAERS | |
| 34 | treatment failure | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 35 | Pancytopenia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Thrombocytopenia | FAERS: 16 Canada Vigilance: 1 | 24459006 | CTD SIDER Canada Vigilance US FAERS |
| 37 | Tachycardia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Tinnitus | FAERS: 15 | US FAERS | |
| 39 | Chills | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Product substitution issue | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Erythema Multiforme | FAERS: 13 | SIDER US FAERS | |
| 42 | Skin irritation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Arthralgia | FAERS: 12 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 44 | Chest Pain | FAERS: 12 | OFFSIDES US FAERS | |
| 45 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 46 | Infection | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 47 | Kounis Syndrome | FAERS: 12 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 48 | Toxic Epidermal Necrolysis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Vertigo | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 50 | Vulvovaginal discomfort | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | jaundice | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 52 | Drug ineffective for unapproved indication | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Fixed eruption | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 54 | Hypotension | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Product quality issue | FAERS: 11 | US FAERS | |
| 56 | Therapeutic response unexpected | FAERS: 11 | US FAERS | |
| 57 | Anuria | FAERS: 10 | OFFSIDES US FAERS | |
| 58 | Anxiety | FAERS: 10 | OFFSIDES US FAERS | |
| 59 | Back Pain | FAERS: 10 | SIDER US FAERS | |
| 60 | Candidiasis | FAERS: 10 |
1291872
2101860 7901556 10991846 11709317 12019079 15673750 16283214 16538979 16940972 18627469 19223631 22863995 26648048 | CTD US FAERS |
| 61 | Chest discomfort | FAERS: 10 | US FAERS | |
| 62 | Constipation | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Discomfort | FAERS: 10 | SIDER US FAERS | |
| 64 | Dyspepsia | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 65 | No adverse event | FAERS: 10 | US FAERS | |
| 66 | Product use issue | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 67 | Septic Shock | FAERS: 10 | OFFSIDES US FAERS | |
| 68 | Drug effect incomplete | FAERS: 9 | US FAERS | |
| 69 | Mydriasis | FAERS: 9 | US FAERS | |
| 70 | Oropharyngeal pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 71 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 72 | Scotoma | FAERS: 9 | SIDER US FAERS | |
| 73 | Skin lesion | FAERS: 9 | OFFSIDES US FAERS | |
| 74 | Vulvovaginal burning sensation | FAERS: 9 | US FAERS | |
| 75 | Weight decreased | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Xanthopsia | FAERS: 9 | US FAERS | |
| 77 | Ageusia | FAERS: 8 | US FAERS | |
| 78 | Alanine Aminotransferase Increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 79 | Angioedema | FAERS: 8 | 1679171 | CTD SIDER US FAERS |
| 80 | Dehydration | FAERS: 8 | OFFSIDES US FAERS | |
| 81 | Flushing | FAERS: 8 | SIDER US FAERS | |
| 82 | Oral candidiasis | FAERS: 8 | US FAERS | |
| 83 | Overdose | FAERS: 8 | US FAERS | |
| 84 | Pneumonia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Sepsis | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 86 | Somnolence | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 87 | Tongue blistering | FAERS: 8 | US FAERS | |
| 88 | Tremor | FAERS: 8 Canada Vigilance: 6 | 1291872 2101860 | CTD SIDER Canada Vigilance US FAERS |
| 89 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 90 | Aspergillosis | FAERS: 7 | 18486603 20943191 | CTD SIDER US FAERS |
| 91 | Bradycardia | FAERS: 7 | US FAERS | |
| 92 | Cardiac Arrest | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Dysgeusia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 94 | Flatulence | FAERS: 7 | SIDER US FAERS | |
| 95 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 96 | Influenza | FAERS: 7 | US FAERS | |
| 97 | Intentional product misuse | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Oral pain | FAERS: 7 | US FAERS | |
| 99 | Pain of skin | FAERS: 7 | US FAERS | |
| 100 | Product solubility abnormal | FAERS: 7 | US FAERS | |
| 101 | Throat irritation | FAERS: 7 | US FAERS | |
| 102 | Vaginal mucosal blistering | FAERS: 7 | US FAERS | |
| 103 | Visual Impairment | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 104 | Vulvovaginal pain | FAERS: 7 | US FAERS | |
| 105 | Aspartate Aminotransferase Increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 106 | Blood corticosterone increased | FAERS: 6 | US FAERS | |
| 107 | Bone pain | FAERS: 6 | OFFSIDES US FAERS | |
| 108 | Cheilitis | FAERS: 6 | US FAERS | |
| 109 | Deafness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 110 | Delirium | FAERS: 6 | 12850665 18585543 | CTD US FAERS |
| 111 | Disease Progression | FAERS: 6 | US FAERS | |
| 112 | Disease recurrence | FAERS: 6 | OFFSIDES US FAERS | |
| 113 | Drug exposure via breast milk | FAERS: 6 | US FAERS | |
| 114 | Fixed drug eruption | FAERS: 6 | US FAERS | |
| 115 | Inflammation | FAERS: 6 | US FAERS | |
| 116 | Long QT Syndrome | FAERS: 6 | CTD US FAERS | |
| 117 | Stomatitis | FAERS: 6 | SIDER US FAERS | |
| 118 | Syncope | FAERS: 6 | 11144697 | CTD US FAERS |
| 119 | Transaminases increased | FAERS: 6 | US FAERS | |
| 120 | Troponin increased | FAERS: 6 | US FAERS | |
| 121 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 122 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 123 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 124 | Angina Pectoris | FAERS: 5 | US FAERS | |
| 125 | Eosinophilia | FAERS: 5 | 9309372 | CTD US FAERS |
| 126 | General physical health deterioration | FAERS: 5 | OFFSIDES US FAERS | |
| 127 | Hypoplastic Left Heart Syndrome | FAERS: 5 | US FAERS | |
| 128 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 129 | Lethargy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Nervousness | FAERS: 5 | SIDER US FAERS | |
| 131 | Neutropenia | FAERS: 5 | SIDER US FAERS | |
| 132 | Peripheral swelling | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 133 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 134 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 135 | Anaphylactic shock | FAERS: 4 | SIDER US FAERS | |
| 136 | Anterior displaced anus | FAERS: 4 | US FAERS | |
| 137 | Asthma | FAERS: 4 | US FAERS | |
| 138 | Blindness | FAERS: 4 | US FAERS | |
| 139 | Blood blister | FAERS: 4 | US FAERS | |
| 140 | Blood glucose decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 141 | Blood potassium decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 142 | Craniosynostosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Disability | FAERS: 4 | US FAERS | |
| 144 | Dry skin | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 145 | Epistaxis | FAERS: 4 | OFFSIDES US FAERS | |
| 146 | Eye irritation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 147 | Eye pain | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 148 | Gastrointestinal Pain | FAERS: 4 | SIDER US FAERS | |
| 149 | Miliaria | FAERS: 4 | US FAERS | |
| 150 | Neonatal disorder | FAERS: 4 | US FAERS | |
| 151 | Oropharyngeal blistering | FAERS: 4 | US FAERS | |
| 152 | Petechiae | FAERS: 4 | US FAERS | |
| 153 | Photophobia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 154 | Pregnancy | FAERS: 4 | SIDER US FAERS | |
| 155 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 156 | Reaction to excipient | FAERS: 4 | US FAERS | |
| 157 | Retching | FAERS: 4 | US FAERS | |
| 158 | Retinal toxicity | FAERS: 4 | US FAERS | |
| 159 | Retroperitoneal fibrosis | FAERS: 4 | US FAERS | |
| 160 | Scab | FAERS: 4 | US FAERS | |
| 161 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 162 | Ventricular Fibrillation | FAERS: 4 | OFFSIDES US FAERS | |
| 163 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 164 | Agitation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 165 | Amnesia | FAERS: 3 | US FAERS | |
| 166 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 167 | Burning Mouth Syndrome | FAERS: 3 | US FAERS | |
| 168 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 169 | Cholestasis | FAERS: 3 | SIDER US FAERS | |
| 170 | Cholestatic liver injury | FAERS: 3 | US FAERS | |
| 171 | Chromaturia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Clostridium colitis | FAERS: 3 | US FAERS | |
| 173 | Crying | FAERS: 3 | US FAERS | |
| 174 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 175 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 176 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 177 | Diffuse alopecia | FAERS: 3 | US FAERS | |
| 178 | Drug administration error | FAERS: 3 | US FAERS | |
| 179 | Drug toxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 180 | Dysphonia | FAERS: 3 | US FAERS | |
| 181 | Dysuria | FAERS: 3 | OFFSIDES US FAERS | |
| 182 | Ear congestion | FAERS: 3 | OFFSIDES US FAERS | |
| 183 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 184 | Eyelids pruritus | FAERS: 3 | US FAERS | |
| 185 | Gene Mutation | FAERS: 3 | US FAERS | |
| 186 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 187 | Hypophagia | FAERS: 3 | US FAERS | |
| 188 | Impaired work ability | FAERS: 3 | US FAERS | |
| 189 | Infectious disease carrier | FAERS: 3 | US FAERS | |
| 190 | Mental impairment | FAERS: 3 | US FAERS | |
| 191 | Mouth swelling | FAERS: 3 | US FAERS | |
| 192 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 193 | Oral pruritus | FAERS: 3 | US FAERS | |
| 194 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 195 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 196 | Procedural complication | FAERS: 3 | US FAERS | |
| 197 | Respiratory distress | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Restlessness | FAERS: 3 | US FAERS | |
| 199 | Sinusitis | FAERS: 3 | OFFSIDES US FAERS | |
| 200 | Skin reaction | FAERS: 3 | US FAERS | |
| 201 | Sneezing | FAERS: 3 | US FAERS | |
| 202 | Stillbirth | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 203 | Therapeutic response changed | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 205 | Troponin I increased | FAERS: 3 | US FAERS | |
| 206 | Urinary Retention | FAERS: 3 | US FAERS | |
| 207 | Vaginal Discharge | FAERS: 3 | SIDER US FAERS | |
| 208 | Vanishing bile duct syndrome | FAERS: 3 | US FAERS | |
| 209 | Ventricular arrhythmia | FAERS: 3 | US FAERS | |
| 210 | Wheezing | FAERS: 3 | US FAERS | |
| 211 | Acne | FAERS: 2 | SIDER US FAERS | |
| 212 | Acute sinusitis | FAERS: 2 | US FAERS | |
| 213 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 214 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 215 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 216 | Arthritis | FAERS: 2 | OFFSIDES US FAERS | |
| 217 | Bedridden | FAERS: 2 | US FAERS | |
| 218 | Blood alkaline phosphatase increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 219 | Blood amylase increased | FAERS: 2 | OFFSIDES US FAERS | |
| 220 | Blood creatinine increased | FAERS: 2 | OFFSIDES US FAERS | |
| 221 | Blood glucose fluctuation | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Blood urea increased | FAERS: 2 | OFFSIDES US FAERS | |
| 223 | Brachycephaly | FAERS: 2 | US FAERS | |
| 224 | Bronchiolitis | FAERS: 2 | US FAERS | |
| 225 | Cardiac valve vegetation | FAERS: 2 | US FAERS | |
| 226 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 227 | Cholangitis | FAERS: 2 | US FAERS | |
| 228 | Chorea | FAERS: 2 | US FAERS | |
| 229 | Choroiditis | FAERS: 2 | US FAERS | |
| 230 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 231 | Cleft Palate | FAERS: 2 Canada Vigilance: 2 | 16781842 | CTD Canada Vigilance US FAERS |
| 232 | Completed Suicide | FAERS: 2 | US FAERS | |
| 233 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 234 | Disorientation | FAERS: 2 | US FAERS | |
| 235 | Dysmorphism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 237 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 238 | Emotional disorder | FAERS: 2 | US FAERS | |
| 239 | Excessive eye blinking | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 240 | Expired drug administered | FAERS: 2 | US FAERS | |
| 241 | Exposure via breast milk | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Extra dose administered | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Extravasation | FAERS: 2 | US FAERS | |
| 244 | Feeling of body temperature change | FAERS: 2 | OFFSIDES US FAERS | |
| 245 | Food craving | FAERS: 2 | US FAERS | |
| 246 | Gamma-Glutamyltransferase Increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 247 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 248 | Genital Herpes | FAERS: 2 | US FAERS | |
| 249 | Genital swelling | FAERS: 2 | US FAERS | |
| 250 | Hepatitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 252 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 253 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 254 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 255 | Hyperventilation | FAERS: 2 | US FAERS | |
| 256 | Hypospadias | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 257 | Hypoxia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 258 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 259 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 260 | Leukopenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 261 | Macule | FAERS: 2 | US FAERS | |
| 262 | Mental status changes | FAERS: 2 | OFFSIDES US FAERS | |
| 263 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 264 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 265 | Nail pigmentation | FAERS: 2 | US FAERS | |
| 266 | Nasopharyngitis | FAERS: 2 | OFFSIDES US FAERS | |
| 267 | Neck Pain | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 268 | Neonatal pneumonia | FAERS: 2 | US FAERS | |
| 269 | Nephrolithiasis | FAERS: 2 | OFFSIDES US FAERS | |
| 270 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 271 | Ocular icterus | FAERS: 2 | US FAERS | |
| 272 | Oliguria | FAERS: 2 | OFFSIDES US FAERS | |
| 273 | Pancreatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 274 | Penile blister | FAERS: 2 | US FAERS | |
| 275 | Poisoning | FAERS: 2 | US FAERS | |
| 276 | Polyarthritis | FAERS: 2 | US FAERS | |
| 277 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 278 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 279 | Product physical issue | FAERS: 2 | US FAERS | |
| 280 | Product use complaint | FAERS: 2 | US FAERS | |
| 281 | Productive Cough | FAERS: 2 | OFFSIDES US FAERS | |
| 282 | Rebound effect | FAERS: 2 | US FAERS | |
| 283 | Regurgitation | FAERS: 2 | US FAERS | |
| 284 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 285 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 286 | Rhinitis | FAERS: 2 | US FAERS | |
| 287 | Similar reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 288 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 289 | Skin tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 290 | Synostosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 291 | Torticollis | FAERS: 2 | US FAERS | |
| 292 | Tracheomalacia | FAERS: 2 | US FAERS | |
| 293 | Trichophytosis | FAERS: 2 | US FAERS | |
| 294 | Trichosporon infection | FAERS: 2 | US FAERS | |
| 295 | Unevaluable event | FAERS: 2 | US FAERS | |
| 296 | Uveitis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 297 | Vanishing twin syndrome | FAERS: 2 | US FAERS | |
| 298 | Vascular purpura | FAERS: 2 | SIDER US FAERS | |
| 299 | Visual disturbance | FAERS: 2 | US FAERS | |
| 300 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 301 | kyphosis | FAERS: 2 | US FAERS | |
| 302 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 303 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 304 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 305 | Abortion complete | FAERS: 1 | US FAERS | |
| 306 | Abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 307 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 308 | Accidental overdose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Acoustic Neuroma | FAERS: 1 | US FAERS | |
| 310 | Acute graft versus host disease in intestine | FAERS: 1 | US FAERS | |
| 311 | Acute kidney injury | FAERS: 1 Canada Vigilance: 1 | 18363177 | CTD Canada Vigilance US FAERS |
| 312 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 313 | Agranulocytosis | FAERS: 1 | 24459006 | CTD SIDER US FAERS |
| 314 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 315 | Allergy test positive | FAERS: 1 | US FAERS | |
| 316 | Anencephaly | FAERS: 1 | US FAERS | |
| 317 | Anorexia | FAERS: 1 | 9309372 | CTD OFFSIDES SIDER US FAERS |
| 318 | Anosmia | FAERS: 1 | OFFSIDES US FAERS | |
| 319 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 320 | Antidepressant drug level above therapeutic | FAERS: 1 | US FAERS | |
| 321 | Antimicrobial susceptibility test resistant | FAERS: 1 | US FAERS | |
| 322 | Aphonia | FAERS: 1 | US FAERS | |
| 323 | Apoptosis | FAERS: 1 | US FAERS | |
| 324 | Apparent death | FAERS: 1 | US FAERS | |
| 325 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 326 | Arachnodactyly | FAERS: 1 | US FAERS | |
| 327 | Arthropathy | FAERS: 1 | US FAERS | |
| 328 | Ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 329 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 330 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 331 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 332 | Babesiosis | FAERS: 1 | US FAERS | |
| 333 | Bacterial test positive | FAERS: 1 | OFFSIDES US FAERS | |
| 334 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 335 | Bilateral hydronephrosis | FAERS: 1 | US FAERS | |
| 336 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 337 | Blood corticosterone abnormal | FAERS: 1 | US FAERS | |
| 338 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 339 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 340 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 341 | Blood insulin decreased | FAERS: 1 | US FAERS | |
| 342 | Blood magnesium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 343 | Blood potassium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 344 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 345 | Blood sodium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 346 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 347 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 348 | Blood triglycerides increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 349 | Bronchitis | FAERS: 1 | OFFSIDES US FAERS | |
| 350 | Bronchoalveolar lavage abnormal | FAERS: 1 | US FAERS | |
| 351 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 352 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 353 | Butterfly rash | FAERS: 1 | US FAERS | |
| 354 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 355 | Catheter related complication | FAERS: 1 | OFFSIDES US FAERS | |
| 356 | Catheter site infection | FAERS: 1 | US FAERS | |
| 357 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 358 | Cerebellar Hypoplasia | FAERS: 1 | US FAERS | |
| 359 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 360 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 361 | Choking sensation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 362 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 363 | Chorioretinal scar | FAERS: 1 | US FAERS | |
| 364 | Clonus | FAERS: 1 | US FAERS | |
| 365 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 366 | Coccidioidomycosis | FAERS: 1 | OFFSIDES US FAERS | |
| 367 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 368 | Congenital anomaly in offspring | FAERS: 1 | US FAERS | |
| 369 | Congenital epiglottal anomaly | FAERS: 1 | US FAERS | |
| 370 | Congenital neurological disorder | FAERS: 1 | US FAERS | |
| 371 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 372 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 373 | Culture positive | FAERS: 1 | OFFSIDES US FAERS | |
| 374 | Cyanosis | FAERS: 1 | SIDER US FAERS | |
| 375 | Cystitis | FAERS: 1 | US FAERS | |
| 376 | Cytolytic hepatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 377 | Cytopenia | FAERS: 1 | US FAERS | |
| 378 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 379 | Dementia | FAERS: 1 | US FAERS | |
| 380 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 381 | Diplopia | FAERS: 1 | US FAERS | |
| 382 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 383 | Dose calculation error | FAERS: 1 | US FAERS | |
| 384 | Double Outlet Right Ventricle | FAERS: 1 | US FAERS | |
| 385 | Drug dose omission | FAERS: 1 | US FAERS | |
| 386 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 387 | Drug level increased | FAERS: 1 | US FAERS | |
| 388 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 389 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 390 | Drug screen positive | FAERS: 1 | US FAERS | |
| 391 | Dyschezia | FAERS: 1 | US FAERS | |
| 392 | Dystonia | FAERS: 1 | US FAERS | |
| 393 | Economic problem | FAERS: 1 | OFFSIDES US FAERS | |
| 394 | Electrocardiogram R on T phenomenon | FAERS: 1 | US FAERS | |
| 395 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 396 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 397 | Enophthalmos | FAERS: 1 | US FAERS | |
| 398 | Enzyme Inhibition | FAERS: 1 | US FAERS | |
| 399 | Epidermal necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 400 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 401 | Epilepsy | FAERS: 1 | US FAERS | |
| 402 | Erosive balanitis | FAERS: 1 | US FAERS | |
| 403 | Eructation | FAERS: 1 | US FAERS | |
| 404 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 405 | Exophthalmos | FAERS: 1 | US FAERS | |
| 406 | Expired product administered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 407 | Exudative retinopathy | FAERS: 1 | US FAERS | |
| 408 | Eye Burns | FAERS: 1 | US FAERS | |
| 409 | Eye Redness | FAERS: 1 | US FAERS | |
| 410 | Eye allergy | FAERS: 1 | US FAERS | |
| 411 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 412 | Facial Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 413 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 414 | Febrile Neutropenia | FAERS: 1 | OFFSIDES US FAERS | |
| 415 | Feeling Cold | FAERS: 1 | US FAERS | |
| 416 | Feeling jittery | FAERS: 1 | US FAERS | |
| 417 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Finger hypoplasia | FAERS: 1 | US FAERS | |
| 419 | Flat affect | FAERS: 1 | US FAERS | |
| 420 | Focal Nodular Hyperplasia | FAERS: 1 | US FAERS | |
| 421 | Folliculitis | FAERS: 1 | US FAERS | |
| 422 | Food Allergy | FAERS: 1 | US FAERS | |
| 423 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 424 | Fracture | FAERS: 1 | US FAERS | |
| 425 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 426 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 427 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 428 | Genital erythema | FAERS: 1 | US FAERS | |
| 429 | Gingival blister | FAERS: 1 | US FAERS | |
| 430 | Glaucoma | FAERS: 1 | OFFSIDES US FAERS | |
| 431 | Glossitis | FAERS: 1 | US FAERS | |
| 432 | Granuloma | FAERS: 1 | US FAERS | |
| 433 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 434 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 435 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 436 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 437 | Hepatomegaly | FAERS: 1 | 23721867 25656644 | CTD US FAERS |
| 438 | Herpes dermatitis | FAERS: 1 | US FAERS | |
| 439 | Hydropneumothorax | FAERS: 1 | US FAERS | |
| 440 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 441 | Hypersomnia | FAERS: 1 | US FAERS | |
| 442 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 443 | Ileus | FAERS: 1 | SIDER US FAERS | |
| 444 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 445 | Immunosuppression | FAERS: 1 | OFFSIDES US FAERS | |
| 446 | Incoherent | FAERS: 1 | US FAERS | |
| 447 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 448 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 449 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 450 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 451 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 452 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 453 | Injection Site Reaction | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 454 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 455 | Injection site inflammation | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 456 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 457 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 458 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 459 | Joint Range of Motion Decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 460 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 461 | Joint swelling | FAERS: 1 | US FAERS | |
| 462 | Joint warmth | FAERS: 1 | US FAERS | |
| 463 | Lichen Planus | FAERS: 1 | US FAERS | |
| 464 | Lip erythema | FAERS: 1 | US FAERS | |
| 465 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 466 | Lip pruritus | FAERS: 1 | US FAERS | |
| 467 | Lipase increased | FAERS: 1 | US FAERS | |
| 468 | Livedo Reticularis | FAERS: 1 | OFFSIDES US FAERS | |
| 469 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 470 | Low Cardiac Output Syndrome | FAERS: 1 | US FAERS | |
| 471 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 472 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 473 | Lyme Disease | FAERS: 1 | US FAERS | |
| 474 | Lymphohistiocytosis | FAERS: 1 | US FAERS | |
| 475 | Lymphoma | FAERS: 1 | US FAERS | |
| 476 | Malignant neoplasm progression | FAERS: 1 | OFFSIDES US FAERS | |
| 477 | Medical device complication | FAERS: 1 | US FAERS | |
| 478 | Medication residue present | FAERS: 1 | US FAERS | |
| 479 | Memory impairment | FAERS: 1 | US FAERS | |
| 480 | Meningitis | FAERS: 1 | US FAERS | |
| 481 | Menorrhagia | FAERS: 1 | SIDER US FAERS | |
| 482 | Mesenteric vascular insufficiency | FAERS: 1 | US FAERS | |
| 483 | Middle insomnia | FAERS: 1 | US FAERS | |
| 484 | Mood swings | FAERS: 1 | US FAERS | |
| 485 | Mucormycosis | FAERS: 1 | US FAERS | |
| 486 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 487 | Muscle tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 488 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 489 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 490 | Myoglobinuria | FAERS: 1 | US FAERS | |
| 491 | Myopathy | FAERS: 1 | US FAERS | |
| 492 | Nasal discomfort | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 493 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 494 | Neuralgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 495 | Neuritis | FAERS: 1 | US FAERS | |
| 496 | Neuropathy | FAERS: 1 | US FAERS | |
| 497 | Night sweats | FAERS: 1 | US FAERS | |
| 498 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 499 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 500 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 501 | Osteoporosis | FAERS: 1 | OFFSIDES US FAERS | |
| 502 | PCO2 increased | FAERS: 1 | US FAERS | |
| 503 | PO2 decreased | FAERS: 1 | US FAERS | |
| 504 | Pallor | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 505 | Palmar erythema | FAERS: 1 | US FAERS | |
| 506 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 507 | Panic Disorder | FAERS: 1 | US FAERS | |
| 508 | Papule | FAERS: 1 | US FAERS | |
| 509 | Paranoia | FAERS: 1 | OFFSIDES US FAERS | |
| 510 | Paraparesis | FAERS: 1 | US FAERS | |
| 511 | Paraplegia | FAERS: 1 | US FAERS | |
| 512 | Paresis | FAERS: 1 | US FAERS | |
| 513 | Penile swelling | FAERS: 1 | US FAERS | |
| 514 | Pericarditis | FAERS: 1 | OFFSIDES US FAERS | |
| 515 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 516 | Peritoneal fluid analysis abnormal | FAERS: 1 | US FAERS | |
| 517 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 518 | Pilonidal cyst congenital | FAERS: 1 | US FAERS | |
| 519 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 520 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 521 | Post procedural infection | FAERS: 1 | US FAERS | |
| 522 | Post procedural inflammation | FAERS: 1 | US FAERS | |
| 523 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 524 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 525 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 526 | Presyncope | FAERS: 1 | US FAERS | |
| 527 | Product contamination | FAERS: 1 | US FAERS | |
| 528 | Product formulation issue | FAERS: 1 | US FAERS | |
| 529 | Product friable | FAERS: 1 | US FAERS | |
| 530 | Product label issue | FAERS: 1 | US FAERS | |
| 531 | Product packaging issue | FAERS: 1 | US FAERS | |
| 532 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 533 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 534 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 535 | Puerperal pyrexia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 536 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 537 | Pulmonary Valve Stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 538 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 539 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 540 | Pulse waveform | FAERS: 1 | US FAERS | |
| 541 | Pulse waveform abnormal | FAERS: 1 | US FAERS | |
| 542 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 543 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 544 | Quadriparesis | FAERS: 1 | US FAERS | |
| 545 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 546 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 547 | Renal hydrocele | FAERS: 1 | US FAERS | |
| 548 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 549 | Renal tubular necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 550 | Respiratory Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 551 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 552 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 553 | Reticulocytopenia | FAERS: 1 | US FAERS | |
| 554 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 555 | Sciatica | FAERS: 1 | US FAERS | |
| 556 | Scleroderma | FAERS: 1 | US FAERS | |
| 557 | Secretion discharge | FAERS: 1 | US FAERS | |
| 558 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 559 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 560 | Sinus headache | FAERS: 1 | US FAERS | |
| 561 | Skeletal injury | FAERS: 1 | US FAERS | |
| 562 | Skin Erosion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 563 | Skin hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 564 | Sleep Talking | FAERS: 1 | US FAERS | |
| 565 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 566 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 567 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 568 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 569 | Stress | FAERS: 1 | US FAERS | |
| 570 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 571 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 572 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 573 | Syndactyly | FAERS: 1 | US FAERS | |
| 574 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 575 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 576 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 577 | Thermal burn | FAERS: 1 | US FAERS | |
| 578 | Thirst | FAERS: 1 | SIDER US FAERS | |
| 579 | Thrombosis | FAERS: 1 | US FAERS | |
| 580 | Tongue eruption | FAERS: 1 | US FAERS | |
| 581 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 582 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 583 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 584 | Tuberculosis | FAERS: 1 | US FAERS | |
| 585 | Ultrasound abdomen abnormal | FAERS: 1 | US FAERS | |
| 586 | Underweight | FAERS: 1 | US FAERS | |
| 587 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 588 | Urinary tract infection fungal | FAERS: 1 | OFFSIDES US FAERS | |
| 589 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 590 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 591 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 592 | Vaginal pain | FAERS: 1 | US FAERS | |
| 593 | Vaginitis | FAERS: 1 | US FAERS | |
| 594 | Vasculitis | FAERS: 1 | US FAERS | |
| 595 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 596 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 597 | Vitritis | FAERS: 1 | US FAERS | |
| 598 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 599 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 600 | Wheelchair user | FAERS: 1 | OFFSIDES US FAERS | |
| 601 | Wrong drug administered | FAERS: 1 | OFFSIDES US FAERS | |
| 602 | furuncle | FAERS: 1 | OFFSIDES US FAERS | |
| 603 | Abdominal Infection | OFFSIDES | ||
| 604 | Abdominal wound dehiscence | OFFSIDES | ||
| 605 | Abnormal vision | OFFSIDES SIDER | ||
| 606 | Abnormalities, Drug-Induced | 8838193 | CTD | |
| 607 | Acanthoma | OFFSIDES | ||
| 608 | Acid reflux | OFFSIDES | ||
| 609 | Acidosis | OFFSIDES | ||
| 610 | Acute Coronary Syndrome | OFFSIDES | ||
| 611 | Acute bronchitis | OFFSIDES | ||
| 612 | Acute otitis media | OFFSIDES | ||
| 613 | Acute respiratory failure | OFFSIDES | ||
| 614 | Adenocarcinoma | OFFSIDES | ||
| 615 | Adenoma | OFFSIDES | ||
| 616 | Alcohol abuse | SIDER | ||
| 617 | Allogenic bone marrow transplantation therapy | OFFSIDES | ||
| 618 | Alveolitis | OFFSIDES | ||
| 619 | Amenorrhea | OFFSIDES | ||
| 620 | Ammonia increased | OFFSIDES | ||
| 621 | Anal erosion | OFFSIDES | ||
| 622 | Angular cheilitis | Canada Vigilance: 1 | Canada Vigilance | |
| 623 | Anhedonia | OFFSIDES | ||
| 624 | Anticonvulsant drug level increased | OFFSIDES | ||
| 625 | Antley-Bixler Syndrome Phenotype | 14758361 | CTD | |
| 626 | Arteriovenous fistula site complication | OFFSIDES | ||
| 627 | Arthropod bite | OFFSIDES | ||
| 628 | Asterixis | OFFSIDES | ||
| 629 | Astrocytoma | OFFSIDES | ||
| 630 | Ataxia | SIDER | ||
| 631 | Athetosis | OFFSIDES | ||
| 632 | Atrial Flutter | OFFSIDES | ||
| 633 | Atrial tachycardia | OFFSIDES | ||
| 634 | Atrioventricular Septal Defect | Canada Vigilance: 1 | Canada Vigilance | |
| 635 | Autoimmune hepatitis | OFFSIDES | ||
| 636 | Bacteria stool identified | OFFSIDES | ||
| 637 | Bacteria urine no organism observed | OFFSIDES | ||
| 638 | Basal cell carcinoma | OFFSIDES | ||
| 639 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 640 | Blastomycosis | 7792710 | CTD | |
| 641 | Blood Glucose | OFFSIDES | ||
| 642 | Blood and lymphatic system disorders | SIDER | ||
| 643 | Blood beta-D-glucan increased | OFFSIDES | ||
| 644 | Blood bilirubin abnormal | OFFSIDES | ||
| 645 | Blood bilirubin unconjugated increased | OFFSIDES | ||
| 646 | Blood chloride decreased | OFFSIDES | ||
| 647 | Blood cholesterol abnormal | OFFSIDES | ||
| 648 | Blood cholesterol | OFFSIDES | ||
| 649 | Blood copper increased | OFFSIDES | ||
| 650 | Blood cortisol abnormal | OFFSIDES | ||
| 651 | Blood immunoglobulin G increased | OFFSIDES | ||
| 652 | Blood lactate dehydrogenase increased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 653 | Blood magnesium increased | OFFSIDES | ||
| 654 | Blood pH decreased | OFFSIDES | ||
| 655 | Blood potassium | OFFSIDES | ||
| 656 | Blood sodium | OFFSIDES | ||
| 657 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 658 | Blood uric acid | OFFSIDES | ||
| 659 | Blood urine present | OFFSIDES | ||
| 660 | Bone lesion | OFFSIDES | ||
| 661 | Brain Death | OFFSIDES | ||
| 662 | Breast cancer recurrent | OFFSIDES | ||
| 663 | Bronchoalveolar Lavage | OFFSIDES | ||
| 664 | Bronchopneumonia | OFFSIDES | ||
| 665 | Bronchopulmonary Dysplasia | Canada Vigilance: 1 | Canada Vigilance | |
| 666 | Candidiasis, Vulvovaginal | 18498300 23546773 | CTD | |
| 667 | Candiduria | OFFSIDES | ||
| 668 | Cardiac Flutter | OFFSIDES | ||
| 669 | Cataract | OFFSIDES | ||
| 670 | Catheter placement | OFFSIDES | ||
| 671 | Catheter related infection | OFFSIDES | ||
| 672 | Cellulitis | OFFSIDES | ||
| 673 | Central line infection | OFFSIDES | ||
| 674 | Cerebral atrophy congenital | OFFSIDES | ||
| 675 | Ceruloplasmin increased | OFFSIDES | ||
| 676 | Chemical and Drug Induced Liver Injury | CTD | ||
| 677 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 678 | Choanal Atresia | Canada Vigilance: 1 | Canada Vigilance | |
| 679 | Cholangiolitis | OFFSIDES | ||
| 680 | Cholecystitis | OFFSIDES | ||
| 681 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 682 | Chronic sinusitis | OFFSIDES | ||
| 683 | Cirrhosis | OFFSIDES | ||
| 684 | Citrobacter infection | OFFSIDES | ||
| 685 | Clostridium difficile colitis | OFFSIDES | ||
| 686 | Cold sweat | Canada Vigilance: 1 | Canada Vigilance | |
| 687 | Colitis | OFFSIDES | ||
| 688 | Colorectal cancer recurrent | OFFSIDES | ||
| 689 | Confabulation | OFFSIDES | ||
| 690 | Congenital anomaly of adrenal gland | Canada Vigilance: 1 | Canada Vigilance | |
| 691 | Congenital cerebral cyst | OFFSIDES | ||
| 692 | Congenital cystic kidney disease | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 693 | Congenital hearing disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 694 | Congenital heart disease | OFFSIDES | ||
| 695 | Congenital hepatobiliary anomaly | Canada Vigilance: 1 | Canada Vigilance | |
| 696 | Congenital hydronephrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 697 | Congenital intestinal malformation | Canada Vigilance: 2 | Canada Vigilance OFFSIDES | |
| 698 | Congenital pyelocaliectasis | OFFSIDES | ||
| 699 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 700 | Congenital urinary tract obstruction | Canada Vigilance: 3 | Canada Vigilance | |
| 701 | Craniofacial Abnormalities | 8838193 | CTD | |
| 702 | Cross resistance | SIDER | ||
| 703 | Cryotherapy | OFFSIDES | ||
| 704 | Culture negative | SIDER | ||
| 705 | Culture wound positive | OFFSIDES | ||
| 706 | Cytomegalovirus chorioretinitis | OFFSIDES | ||
| 707 | Cytomegalovirus test positive | OFFSIDES | ||
| 708 | Dark circles under eyes | Canada Vigilance: 1 | Canada Vigilance | |
| 709 | Decreased Libido | OFFSIDES | ||
| 710 | Demyelination | OFFSIDES | ||
| 711 | Dental abscess | OFFSIDES | ||
| 712 | Depressed mood | OFFSIDES | ||
| 713 | Dermatomycoses | 18608918 | CTD | |
| 714 | Diabetes | OFFSIDES | ||
| 715 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 716 | Diabetic Retinopathy | OFFSIDES | ||
| 717 | Diabetic ulcer | OFFSIDES | ||
| 718 | Diarrhea | OFFSIDES | ||
| 719 | Diet refusal | Canada Vigilance: 1 | Canada Vigilance | |
| 720 | Differential white blood cell count abnormal | OFFSIDES | ||
| 721 | Diverticulum | OFFSIDES | ||
| 722 | Ear and labyrinth disorders | SIDER | ||
| 723 | Endocarditis | 16283214 | CTD | |
| 724 | Endodontic procedure | OFFSIDES | ||
| 725 | Endophthalmitis | OFFSIDES | ||
| 726 | Enterobacter pneumonia | OFFSIDES | ||
| 727 | Enterococcal infection | OFFSIDES | ||
| 728 | Enterocolitis viral | OFFSIDES | ||
| 729 | Enterocolitis | OFFSIDES | ||
| 730 | Eosinophilic myocarditis | OFFSIDES | ||
| 731 | Erosive gastritis | OFFSIDES | ||
| 732 | Erythema Infectiosum | OFFSIDES | ||
| 733 | Escherichia infection | OFFSIDES | ||
| 734 | Esophageal Stenosis | OFFSIDES | ||
| 735 | Eustachian tube disorder | OFFSIDES | ||
| 736 | Exanthema | 10466905 | CTD | |
| 737 | Facial asymmetry | Canada Vigilance: 1 | Canada Vigilance | |
| 738 | Facial wasting | OFFSIDES | ||
| 739 | Failure to Thrive | OFFSIDES | ||
| 740 | Fanconi Syndrome | OFFSIDES | ||
| 741 | Female sexual dysfunction | SIDER | ||
| 742 | Femoral artery occlusion | OFFSIDES | ||
| 743 | Fluid overload | OFFSIDES | ||
| 744 | Foreign body in respiratory tract | Canada Vigilance: 1 | Canada Vigilance | |
| 745 | Fungemia | 24366741 | CTD | |
| 746 | Fungus serology test positive | OFFSIDES | ||
| 747 | Gambling | OFFSIDES | ||
| 748 | Gangrene | OFFSIDES | ||
| 749 | Gastric ulcer | OFFSIDES | ||
| 750 | Genital erosion | OFFSIDES | ||
| 751 | Glioblastoma | 18398572 | CTD | |
| 752 | Globulinuria | OFFSIDES | ||
| 753 | Glycosuria | 8442906 | CTD | |
| 754 | Goiter | OFFSIDES | ||
| 755 | Granulocytosis | OFFSIDES | ||
| 756 | Granulomatous liver disease | OFFSIDES | ||
| 757 | Guillain-Barre Syndrome | Canada Vigilance: 2 | Canada Vigilance | |
| 758 | Haematotoxicity | OFFSIDES | ||
| 759 | Hallucinations, mixed | OFFSIDES | ||
| 760 | Hematoma, Epidural, Spinal | 12131644 | CTD | |
| 761 | Hemiparesis | OFFSIDES | ||
| 762 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 763 | Hepatic necrosis | SIDER | ||
| 764 | Hepatitis B positive | OFFSIDES | ||
| 765 | Hepatitis C | OFFSIDES | ||
| 766 | Hip surgery | OFFSIDES | ||
| 767 | Histoplasmosis | OFFSIDES | ||
| 768 | Hyperbilirubinemia | 16940972 | CTD | |
| 769 | Hypercalcemia | 9767873 | CTD | |
| 770 | Hyperkeratosis | OFFSIDES | ||
| 771 | Hyperkinesia | SIDER | ||
| 772 | Hyperparathyroidism | OFFSIDES | ||
| 773 | Hyperviscosity syndrome | OFFSIDES | ||
| 774 | Hypokinesia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 775 | Immune reconstitution syndrome | OFFSIDES | ||
| 776 | Impetigo | OFFSIDES | ||
| 777 | Incision site complication | OFFSIDES | ||
| 778 | Incontinence | OFFSIDES | ||
| 779 | Infected cyst | OFFSIDES | ||
| 780 | Infectious Mononucleosis | OFFSIDES | ||
| 781 | Infestation | SIDER | ||
| 782 | Injected limb mobility decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 783 | Injection site erythema | Canada Vigilance: 4 | Canada Vigilance | |
| 784 | Injection site mass | Canada Vigilance: 1 | Canada Vigilance | |
| 785 | Injection site pain | Canada Vigilance: 1 | Canada Vigilance | |
| 786 | Joint Instability | OFFSIDES | ||
| 787 | Joint injury | OFFSIDES | ||
| 788 | Joint sprain | OFFSIDES | ||
| 789 | Kidney Diseases | 17580253 | CTD | |
| 790 | Kidney Failure | OFFSIDES | ||
| 791 | Laceration | OFFSIDES | ||
| 792 | Lacrimation | SIDER | ||
| 793 | Laryngomalacia | Canada Vigilance: 3 | Canada Vigilance | |
| 794 | Laryngospasm | Canada Vigilance: 1 | Canada Vigilance | |
| 795 | Left atrial dilatation | OFFSIDES | ||
| 796 | Leukoencephalopathy | OFFSIDES | ||
| 797 | Leukopenia neonatal | OFFSIDES | ||
| 798 | Leukorrhea | SIDER | ||
| 799 | Limb injury | OFFSIDES | ||
| 800 | Lip erosion | OFFSIDES | ||
| 801 | Listeria sepsis | OFFSIDES | ||
| 802 | Live Birth | OFFSIDES | ||
| 803 | Liver Failure | 10631423 | CTD | |
| 804 | Liver Neoplasms, Experimental | 25656644 | CTD | |
| 805 | Liver diseases | 14966256 17580253 | CTD | |
| 806 | Liver neoplasms | 25058030 | CTD | |
| 807 | Lung cyst | OFFSIDES | ||
| 808 | Lung diseases | 14966256 | CTD | |
| 809 | Lupus Nephritis | OFFSIDES | ||
| 810 | Lymphocyte count decreased | OFFSIDES | ||
| 811 | Malnutrition | SIDER | ||
| 812 | Markedly reduced dietary intake | OFFSIDES | ||
| 813 | Mastication disorder | OFFSIDES | ||
| 814 | Meningitis, Cryptococcal | 16983622 | CTD | |
| 815 | Meniscus removal | OFFSIDES | ||
| 816 | Metabolic acidosis | OFFSIDES | ||
| 817 | Metastases to thorax | OFFSIDES | ||
| 818 | Metastatic Neoplasm | OFFSIDES | ||
| 819 | Metatarsalgia | OFFSIDES | ||
| 820 | Metrorrhagia | SIDER | ||
| 821 | Microcephaly | Canada Vigilance: 2 | Canada Vigilance | |
| 822 | Mouth Breathing | OFFSIDES | ||
| 823 | Multiple Myeloma | OFFSIDES | ||
| 824 | Multiple drug overdose | OFFSIDES | ||
| 825 | Muscle strain | OFFSIDES | ||
| 826 | Musculoskeletal Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 827 | Musculoskeletal discomfort | SIDER | ||
| 828 | Mycoses | CTD | ||
| 829 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 830 | Nodule | OFFSIDES | ||
| 831 | Non-cardiac chest pain | OFFSIDES | ||
| 832 | Onychomycosis | 14966256 | CTD | |
| 833 | Open reduction of fracture | OFFSIDES | ||
| 834 | Opisthotonus | OFFSIDES | ||
| 835 | Opportunistic mycosis | SIDER | ||
| 836 | Oropharyngitis fungal | OFFSIDES | ||
| 837 | Osteomalacia | Canada Vigilance: 1 | Canada Vigilance | |
| 838 | Osteomyelitis drainage | OFFSIDES | ||
| 839 | Osteomyelitis | OFFSIDES | ||
| 840 | Osteopenia | OFFSIDES | ||
| 841 | Otomycosis | 21895787 | CTD | |
| 842 | PCO2 decreased | OFFSIDES | ||
| 843 | Pancreatic Insufficiency | OFFSIDES | ||
| 844 | Pericardial effusion | OFFSIDES | ||
| 845 | Peritonitis | 7566587 | CTD | |
| 846 | Pharyngeal candidiasis | OFFSIDES | ||
| 847 | Pharyngitis | Canada Vigilance: 2 | Canada Vigilance SIDER | |
| 848 | Phonophobia | Canada Vigilance: 2 | Canada Vigilance | |
| 849 | Plagiocephaly | Canada Vigilance: 6 | Canada Vigilance | |
| 850 | Polydactyly | OFFSIDES | ||
| 851 | Polymyalgia Rheumatica | Canada Vigilance: 1 | Canada Vigilance | |
| 852 | Polyuria | OFFSIDES SIDER | ||
| 853 | Poor feeding infant | Canada Vigilance: 1 | Canada Vigilance | |
| 854 | Portal Hypertension | OFFSIDES | ||
| 855 | Post procedural complication | OFFSIDES | ||
| 856 | Prenatal Exposure Delayed Effects | 28637461 | CTD | |
| 857 | Protein total decreased | OFFSIDES | ||
| 858 | Protein total increased | OFFSIDES | ||
| 859 | Proteinuria | 8442906 | CTD | |
| 860 | Prothrombin level decreased | OFFSIDES | ||
| 861 | Psychiatric symptom | OFFSIDES | ||
| 862 | Pulmonary Hypertension | OFFSIDES | ||
| 863 | Pulmonary artery stenosis | Canada Vigilance: 2 | Canada Vigilance | |
| 864 | Pulmonary congestion | OFFSIDES | ||
| 865 | Pulmonary toxicity | OFFSIDES | ||
| 866 | Purulent discharge | OFFSIDES | ||
| 867 | Pyloric Stenosis | Canada Vigilance: 1 | Canada Vigilance | |
| 868 | Radiotherapy to brain | OFFSIDES | ||
| 869 | Relapsing Fever | OFFSIDES | ||
| 870 | Renal cyst | OFFSIDES | ||
| 871 | Renal pain | SIDER | ||
| 872 | Respiratory Depression | Canada Vigilance: 1 | Canada Vigilance | |
| 873 | Seizures | 11034273 | CTD | |
| 874 | Sequestrectomy | OFFSIDES | ||
| 875 | Serotonin Syndrome | 18585543 | CTD | |
| 876 | Shallow breathing | SIDER | ||
| 877 | Skin Induration | OFFSIDES | ||
| 878 | Splenic Infarction | OFFSIDES | ||
| 879 | Sputum culture positive | OFFSIDES | ||
| 880 | Stem cell transplant | OFFSIDES | ||
| 881 | Stupor | 10466905 | CTD | |
| 882 | Subcutaneous Abscess | OFFSIDES | ||
| 883 | Subcutaneous nodule | OFFSIDES | ||
| 884 | Swelling of eyelid | Canada Vigilance: 4 | Canada Vigilance | |
| 885 | Synovitis | OFFSIDES | ||
| 886 | Systemic candidiasis | 19141735 | CTD | |
| 887 | Talipes | Canada Vigilance: 1 | Canada Vigilance | |
| 888 | Tarsal Tunnel Syndrome | OFFSIDES | ||
| 889 | Tension | SIDER | ||
| 890 | Thrombophlebitis | OFFSIDES | ||
| 891 | Tinea Pedis | 9762826 | CTD | |
| 892 | Tinea Versicolor | 12060505 | CTD | |
| 893 | Tooth Extraction | OFFSIDES | ||
| 894 | Torsades de Pointes | CTD | ||
| 895 | Toxoplasmosis | OFFSIDES | ||
| 896 | Tracheitis | OFFSIDES | ||
| 897 | Ulcer | OFFSIDES | ||
| 898 | Urinary Incontinence | SIDER | ||
| 899 | Urine flow decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 900 | Urine output increased | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 901 | Uterine spasm | SIDER | ||
| 902 | Vaccination site rash | Canada Vigilance: 1 | Canada Vigilance | |
| 903 | Vascular anomaly | OFFSIDES | ||
| 904 | Venous Insufficiency | OFFSIDES | ||
| 905 | Vocal cord cyst | OFFSIDES | ||
| 906 | Vulvovaginal dryness | OFFSIDES | ||
| 907 | carbuncle | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.