Spironolactone
(LXMSZDCAJNLERA-ZHYRCANASA-N)
Structure
- SMILES
- CC(=O)S[C@@H]1CC2=CC(=O)CC[C@@]2([C@@H]2[C@@H]1[C@@H]1CC[C@]3([C@]1(CC2)C)CCC(=O)O3)C
- Type(s)
- Approved
- ATC code(s)
- C03DA01
- Molecular Formula:
- C24H32O4S
- Molecular Weight:
- 416.573
- Log P:
- 4.8523
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 0
- TPSA:
- 85.74
- CAS Number(s):
- 52-01-7; 19000
Synonym(s)
1.
Spironolactone
2.
Spirolactone
3.
Aldactone
4.
Aldactone A
5.
Aquareduct
6.
Duraspiron
7.
Espironolactona Alter
8.
Espironolactona Mundogen
9.
Flumach
10.
Frumikal
11.
Jenaspiron
12.
Novo-Spiroton
13.
Practon
14.
SC-9420
15.
Spiractin
16.
Spiro L.U.T.
17.
Spiro Von Ct
18.
Spirobeta
19.
Spirogamma
20.
Spirolang
21.
Spirono-Isis
22.
Spironone
23.
Spirospare
24.
Veroshpiron
25.
Verospiron
26.
Verospirone
27.
Ct, Spiro Von
28.
Novo Spiroton
29.
NovoSpiroton
30.
SC 9420
31.
SC9420
32.
Spirono Isis
33.
Von Ct, Spiro
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 68 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Nausea | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Blood potassium increased | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Headache | FAERS: 38 | 15949161 | CTD SIDER US FAERS |
| 6 | Fatigue | FAERS: 34 | OFFSIDES US FAERS | |
| 7 | Alopecia | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 8 | Product substitution issue | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Malaise | FAERS: 24 | SIDER US FAERS | |
| 10 | Product use in unapproved indication | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 11 | Hypotension | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Pruritus | FAERS: 23 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 13 | Asthenia | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 14 | Breast tenderness | FAERS: 22 | US FAERS | |
| 15 | Vomiting | FAERS: 22 | SIDER US FAERS | |
| 16 | Drug ineffective for unapproved indication | FAERS: 21 | US FAERS | |
| 17 | Urticaria | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 18 | Hypersensitivity | FAERS: 18 | SIDER US FAERS | |
| 19 | Abdominal discomfort | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 20 | Chest Pain | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 21 | Feeling abnormal | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 22 | Somnolence | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Acute kidney injury | FAERS: 15 | US FAERS | |
| 24 | Nipple pain | FAERS: 15 | OFFSIDES US FAERS | |
| 25 | Product use issue | FAERS: 13 | US FAERS | |
| 26 | Dehydration | FAERS: 12 Canada Vigilance: 1 | 4740303 | CTD OFFSIDES Canada Vigilance US FAERS |
| 27 | Drug dispensing error | FAERS: 12 | US FAERS | |
| 28 | Swelling | FAERS: 12 | US FAERS | |
| 29 | Blood creatinine increased | FAERS: 10 | OFFSIDES US FAERS | |
| 30 | Dyspepsia | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Product taste abnormal | FAERS: 10 | US FAERS | |
| 32 | Tachycardia | FAERS: 10 | US FAERS | |
| 33 | Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Palpitations | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Product quality issue | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Syncope | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Tremor | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Abdominal Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 39 | Acne | FAERS: 8 | OFFSIDES US FAERS | |
| 40 | Anxiety | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 41 | Back Pain | FAERS: 8 | US FAERS | |
| 42 | Bradycardia | FAERS: 8 | 2126792 | CTD OFFSIDES US FAERS |
| 43 | Dysgeusia | FAERS: 8 | US FAERS | |
| 44 | Erectile dysfunction | FAERS: 8 | 4739107 22074142 | CTD SIDER US FAERS |
| 45 | Medication Error | FAERS: 8 | US FAERS | |
| 46 | Retching | FAERS: 8 | US FAERS | |
| 47 | Unevaluable event | FAERS: 8 | US FAERS | |
| 48 | Arthralgia | FAERS: 7 | US FAERS | |
| 49 | Blood potassium decreased | FAERS: 7 | OFFSIDES US FAERS | |
| 50 | Blood sodium decreased | FAERS: 7 | US FAERS | |
| 51 | Chest discomfort | FAERS: 7 | US FAERS | |
| 52 | Electrolyte imbalance | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Hepatic Encephalopathy | FAERS: 7 | 600713 | CTD US FAERS |
| 54 | Nervousness | FAERS: 7 | US FAERS | |
| 55 | Burning sensation | FAERS: 6 | US FAERS | |
| 56 | Erythema | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Pancreatitis | FAERS: 6 | OFFSIDES US FAERS | |
| 58 | Polyuria | FAERS: 6 | US FAERS | |
| 59 | Thrombocytopenia | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 60 | Vulvovaginal pain | FAERS: 6 | US FAERS | |
| 61 | Weight decreased | FAERS: 6 | US FAERS | |
| 62 | Acute cutaneous lupus erythematosus | FAERS: 5 | US FAERS | |
| 63 | Ascites | FAERS: 5 | 4951338 11356442 | CTD OFFSIDES US FAERS |
| 64 | Atrioventricular Block | FAERS: 5 | OFFSIDES US FAERS | |
| 65 | Blood alkaline phosphatase increased | FAERS: 5 | OFFSIDES US FAERS | |
| 66 | Chills | FAERS: 5 | US FAERS | |
| 67 | Constipation | FAERS: 5 | US FAERS | |
| 68 | Deafness | FAERS: 5 | US FAERS | |
| 69 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 70 | Dyspareunia | FAERS: 5 | US FAERS | |
| 71 | Dysphonia | FAERS: 5 | US FAERS | |
| 72 | Dysuria | FAERS: 5 | US FAERS | |
| 73 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 74 | Infarction | FAERS: 5 | US FAERS | |
| 75 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 76 | Lethargy | FAERS: 5 | SIDER US FAERS | |
| 77 | Myalgia | FAERS: 5 | US FAERS | |
| 78 | Pancytopenia | FAERS: 5 | US FAERS | |
| 79 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 80 | Thirst | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Urinary Retention | FAERS: 5 | US FAERS | |
| 82 | Vertigo | FAERS: 5 | US FAERS | |
| 83 | Agitation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 84 | Agranulocytosis | FAERS: 4 | SIDER US FAERS | |
| 85 | Alanine Aminotransferase Increased | FAERS: 4 | OFFSIDES US FAERS | |
| 86 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 87 | Blood aldosterone increased | FAERS: 4 | US FAERS | |
| 88 | Blood lactate dehydrogenase increased | FAERS: 4 | OFFSIDES US FAERS | |
| 89 | Blood testosterone decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 90 | Bulbospinal muscular atrophy congenital | FAERS: 4 | US FAERS | |
| 91 | Cellulitis | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 92 | Cholestasis | FAERS: 4 | US FAERS | |
| 93 | Crying | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Drug effective for unapproved indication | FAERS: 4 | US FAERS | |
| 95 | Flushing | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Hepatitis | FAERS: 4 | 7305153 11488711 | CTD OFFSIDES US FAERS |
| 97 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 98 | Mastitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 100 | Myocardial Infarction | FAERS: 4 | 17587755 | CTD US FAERS |
| 101 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 102 | Neutropenia | FAERS: 4 | US FAERS | |
| 103 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 104 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 105 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 106 | Product formulation issue | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 107 | Product physical issue | FAERS: 4 | US FAERS | |
| 108 | Urine output increased | FAERS: 4 | US FAERS | |
| 109 | Acidosis | FAERS: 3 | OFFSIDES US FAERS | |
| 110 | Anger | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 111 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 112 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 113 | Blood pressure inadequately controlled | FAERS: 3 | US FAERS | |
| 114 | Blood thyroid stimulating hormone increased | FAERS: 3 | US FAERS | |
| 115 | Blood urea increased | FAERS: 3 | OFFSIDES US FAERS | |
| 116 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 117 | Chromaturia | FAERS: 3 | OFFSIDES US FAERS | |
| 118 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 119 | Disease Progression | FAERS: 3 | OFFSIDES US FAERS | |
| 120 | Disorientation | FAERS: 3 | US FAERS | |
| 121 | Electrocardiogram T wave peaked | FAERS: 3 | US FAERS | |
| 122 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 123 | Epistaxis | FAERS: 3 | OFFSIDES US FAERS | |
| 124 | Hepatic congestion | FAERS: 3 | US FAERS | |
| 125 | Hypophagia | FAERS: 3 | US FAERS | |
| 126 | Impaired work ability | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 127 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 128 | Joint swelling | FAERS: 3 | US FAERS | |
| 129 | Leukocytosis | FAERS: 3 | US FAERS | |
| 130 | Limb discomfort | FAERS: 3 | US FAERS | |
| 131 | Lupus-like syndrome | FAERS: 3 | US FAERS | |
| 132 | Mental status changes | FAERS: 3 | OFFSIDES US FAERS | |
| 133 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 134 | Osteoporosis | FAERS: 3 | US FAERS | |
| 135 | Pre-existing condition improved | FAERS: 3 | US FAERS | |
| 136 | Product dispensing error | FAERS: 3 | US FAERS | |
| 137 | Rash erythematous | FAERS: 3 | SIDER US FAERS | |
| 138 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 139 | Renin increased | FAERS: 3 | US FAERS | |
| 140 | Skin lesion | FAERS: 3 | OFFSIDES US FAERS | |
| 141 | Stevens-Johnson Syndrome | FAERS: 3 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 142 | Throat irritation | FAERS: 3 | US FAERS | |
| 143 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 144 | nervous system disorder | FAERS: 3 | US FAERS | |
| 145 | Abasia | FAERS: 2 | US FAERS | |
| 146 | Accidental overdose | FAERS: 2 | US FAERS | |
| 147 | Activities of daily living impaired | FAERS: 2 | OFFSIDES US FAERS | |
| 148 | Amnesia | FAERS: 2 | US FAERS | |
| 149 | Angioedema | FAERS: 2 | US FAERS | |
| 150 | Aphonia | FAERS: 2 | US FAERS | |
| 151 | Atrial Fibrillation | FAERS: 2 | 20082611 | CTD US FAERS |
| 152 | Blood cortisol increased | FAERS: 2 | US FAERS | |
| 153 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 154 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 155 | Blood testosterone increased | FAERS: 2 | US FAERS | |
| 156 | Breast discomfort | FAERS: 2 | US FAERS | |
| 157 | Bronchitis | FAERS: 2 | OFFSIDES US FAERS | |
| 158 | Cataract | FAERS: 2 | OFFSIDES US FAERS | |
| 159 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 160 | Cyst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 161 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 162 | Diverticulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 163 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 164 | Dry skin | FAERS: 2 | OFFSIDES US FAERS | |
| 165 | Ear discomfort | FAERS: 2 | US FAERS | |
| 166 | Embolic stroke | FAERS: 2 | OFFSIDES US FAERS | |
| 167 | Emotional distress | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 168 | Eye pain | FAERS: 2 | US FAERS | |
| 169 | Feeling Cold | FAERS: 2 | US FAERS | |
| 170 | Female sexual arousal disorder | FAERS: 2 | US FAERS | |
| 171 | Flatulence | FAERS: 2 | US FAERS | |
| 172 | Gamma-Glutamyltransferase Increased | FAERS: 2 | OFFSIDES US FAERS | |
| 173 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 174 | Gonadal Dysgenesis | FAERS: 2 | US FAERS | |
| 175 | Gout | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Hyperaldosteronism | FAERS: 2 | CTD US FAERS | |
| 177 | Hypokinesia | FAERS: 2 | US FAERS | |
| 178 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 179 | Lip swelling | FAERS: 2 | US FAERS | |
| 180 | Medication residue present | FAERS: 2 | US FAERS | |
| 181 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 182 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 183 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 184 | Oral pain | FAERS: 2 | US FAERS | |
| 185 | Overdose | FAERS: 2 | US FAERS | |
| 186 | Pemphigus | FAERS: 2 | US FAERS | |
| 187 | Pericardial effusion | FAERS: 2 | OFFSIDES US FAERS | |
| 188 | Pneumonia | FAERS: 2 | US FAERS | |
| 189 | Post-Traumatic Stress Disorder | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 190 | Presyncope | FAERS: 2 | US FAERS | |
| 191 | Pulmonary Hypertension | FAERS: 2 | OFFSIDES US FAERS | |
| 192 | Renal pain | FAERS: 2 | US FAERS | |
| 193 | Restlessness | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 194 | Rhabdomyolysis | FAERS: 2 | OFFSIDES US FAERS | |
| 195 | Sinusitis | FAERS: 2 | US FAERS | |
| 196 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 197 | Sneezing | FAERS: 2 | US FAERS | |
| 198 | Suicide attempt | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 199 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 200 | Terminal state | FAERS: 2 | US FAERS | |
| 201 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 202 | Tinnitus | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 203 | Toxic Epidermal Necrolysis | FAERS: 2 | SIDER US FAERS | |
| 204 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 205 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 206 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 207 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 208 | Vascular purpura | FAERS: 2 | US FAERS | |
| 209 | Visual Impairment | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 211 | Wheezing | FAERS: 2 | US FAERS | |
| 212 | jaundice | FAERS: 2 | US FAERS | |
| 213 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 214 | Abscess | FAERS: 1 | US FAERS | |
| 215 | Accidental exposure | FAERS: 1 | US FAERS | |
| 216 | Adverse event | FAERS: 1 | OFFSIDES US FAERS | |
| 217 | Altered state of consciousness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 218 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 219 | Anal abscess | FAERS: 1 | US FAERS | |
| 220 | Androgen receptor gene overexpression | FAERS: 1 | US FAERS | |
| 221 | Androgenetic Alopecia | FAERS: 1 | US FAERS | |
| 222 | Anorexia | FAERS: 1 | OFFSIDES US FAERS | |
| 223 | Anuria | FAERS: 1 | OFFSIDES US FAERS | |
| 224 | Aphagia | FAERS: 1 | US FAERS | |
| 225 | Apparent death | FAERS: 1 | OFFSIDES US FAERS | |
| 226 | Arterial Injury | FAERS: 1 | US FAERS | |
| 227 | Asthma | FAERS: 1 | OFFSIDES US FAERS | |
| 228 | Ataxia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 229 | Azoospermia | FAERS: 1 | US FAERS | |
| 230 | B-cell lymphoma stage I | FAERS: 1 | US FAERS | |
| 231 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 232 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 233 | Blepharospasm | FAERS: 1 | US FAERS | |
| 234 | Blindness | FAERS: 1 | US FAERS | |
| 235 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 236 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 237 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 238 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 239 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 240 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 241 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 242 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 243 | Breast Cyst | FAERS: 1 | US FAERS | |
| 244 | Breast engorgement | FAERS: 1 | US FAERS | |
| 245 | Bunion operation | FAERS: 1 | US FAERS | |
| 246 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 247 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 248 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 249 | Cervical myelopathy | FAERS: 1 | US FAERS | |
| 250 | Cervical polyp | FAERS: 1 | US FAERS | |
| 251 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 252 | Colitis | FAERS: 1 | US FAERS | |
| 253 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 254 | Counterfeit product administered | FAERS: 1 | US FAERS | |
| 255 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 256 | Deformity | FAERS: 1 | US FAERS | |
| 257 | Delirium | FAERS: 1 | US FAERS | |
| 258 | Dementia | FAERS: 1 | US FAERS | |
| 259 | Depressed mood | FAERS: 1 | US FAERS | |
| 260 | Depression suicidal | FAERS: 1 | US FAERS | |
| 261 | Device malfunction | FAERS: 1 | US FAERS | |
| 262 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 263 | Diplopia | FAERS: 1 | US FAERS | |
| 264 | Disability | FAERS: 1 | US FAERS | |
| 265 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 266 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 267 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 268 | Drug administration error | FAERS: 1 | US FAERS | |
| 269 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 270 | Drug dose omission | FAERS: 1 | US FAERS | |
| 271 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 272 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 273 | Drug withdrawal headache | FAERS: 1 | US FAERS | |
| 274 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 275 | Dysarthria | FAERS: 1 | US FAERS | |
| 276 | Eclampsia | FAERS: 1 | US FAERS | |
| 277 | Eczema | FAERS: 1 | OFFSIDES US FAERS | |
| 278 | Electrocardiogram change | FAERS: 1 | OFFSIDES US FAERS | |
| 279 | Embolism | FAERS: 1 | OFFSIDES US FAERS | |
| 280 | Endometrial hypertrophy | FAERS: 1 | US FAERS | |
| 281 | Endometriosis male | FAERS: 1 | US FAERS | |
| 282 | Eosinophilia | FAERS: 1 | SIDER US FAERS | |
| 283 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 284 | Epilepsy | FAERS: 1 | US FAERS | |
| 285 | Erysipelas | FAERS: 1 | US FAERS | |
| 286 | Erythema Multiforme | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 287 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 288 | Eye irritation | FAERS: 1 | US FAERS | |
| 289 | Facial Paresis | FAERS: 1 | US FAERS | |
| 290 | Familial Periodic Paralysis | FAERS: 1 | US FAERS | |
| 291 | Fat redistribution | FAERS: 1 | US FAERS | |
| 292 | Feeling jittery | FAERS: 1 | US FAERS | |
| 293 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 294 | Flank Pain | FAERS: 1 | US FAERS | |
| 295 | Food Allergy | FAERS: 1 | US FAERS | |
| 296 | Formication | FAERS: 1 | US FAERS | |
| 297 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 298 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 299 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 300 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 301 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 302 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 303 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 304 | Head titubation | FAERS: 1 | US FAERS | |
| 305 | Hepatotoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 306 | Hip surgery | FAERS: 1 | US FAERS | |
| 307 | Hirsutism | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 308 | Hostility | FAERS: 1 | US FAERS | |
| 309 | Hunger | FAERS: 1 | US FAERS | |
| 310 | Hypercalciuria | FAERS: 1 | 3411401 4558012 | CTD US FAERS |
| 311 | Hypersomnia | FAERS: 1 | US FAERS | |
| 312 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 313 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 314 | Hysterectomy | FAERS: 1 | US FAERS | |
| 315 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 316 | Idiopathic angioedema | FAERS: 1 | US FAERS | |
| 317 | Idiopathic urticaria | FAERS: 1 | US FAERS | |
| 318 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 319 | Incontinence | FAERS: 1 | US FAERS | |
| 320 | Inflammation | FAERS: 1 | US FAERS | |
| 321 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 322 | Laryngitis | FAERS: 1 | US FAERS | |
| 323 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 324 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 325 | Limb injury | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Limb operation | FAERS: 1 | US FAERS | |
| 327 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 328 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 329 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 330 | Medication residue | FAERS: 1 | US FAERS | |
| 331 | Memory impairment | FAERS: 1 | US FAERS | |
| 332 | Meningioma | FAERS: 1 | US FAERS | |
| 333 | Menopause | FAERS: 1 | US FAERS | |
| 334 | Menorrhagia | FAERS: 1 | US FAERS | |
| 335 | Menstrual discomfort | FAERS: 1 | US FAERS | |
| 336 | Mental impairment | FAERS: 1 | US FAERS | |
| 337 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 338 | Microvascular Angina | FAERS: 1 | US FAERS | |
| 339 | Middle insomnia | FAERS: 1 | US FAERS | |
| 340 | Mixed Connective Tissue Disease | FAERS: 1 | US FAERS | |
| 341 | Mood swings | FAERS: 1 | US FAERS | |
| 342 | Muscle Fatigue | FAERS: 1 | OFFSIDES US FAERS | |
| 343 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 344 | Musculoskeletal Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 345 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 346 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 347 | Myocarditis | FAERS: 1 | US FAERS | |
| 348 | Myotonia | FAERS: 1 | US FAERS | |
| 349 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 350 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 351 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 352 | No adverse effect | FAERS: 1 | US FAERS | |
| 353 | No adverse event | FAERS: 1 | US FAERS | |
| 354 | Nocturia | FAERS: 1 | US FAERS | |
| 355 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 356 | Oral pruritus | FAERS: 1 | US FAERS | |
| 357 | Osteomalacia | FAERS: 1 | US FAERS | |
| 358 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Pain of skin | FAERS: 1 | US FAERS | |
| 360 | Papule | FAERS: 1 | US FAERS | |
| 361 | Paranoia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 362 | Penile size reduced | FAERS: 1 | US FAERS | |
| 363 | Penoscrotal fusion | FAERS: 1 | US FAERS | |
| 364 | Pericarditis | FAERS: 1 | US FAERS | |
| 365 | Personality Change | FAERS: 1 | US FAERS | |
| 366 | Petechiae | FAERS: 1 | US FAERS | |
| 367 | Polydipsia | FAERS: 1 | US FAERS | |
| 368 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 369 | Post procedural complication | FAERS: 1 | US FAERS | |
| 370 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 371 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 372 | Premature Menopause | FAERS: 1 | US FAERS | |
| 373 | Prescribed overdose | FAERS: 1 | OFFSIDES US FAERS | |
| 374 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 375 | Product coating issue | FAERS: 1 | US FAERS | |
| 376 | Product dose omission | FAERS: 1 | US FAERS | |
| 377 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 378 | Product substitution | FAERS: 1 | US FAERS | |
| 379 | Product use complaint | FAERS: 1 | US FAERS | |
| 380 | Protein total decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 381 | Protein-losing gastroenteropathy | FAERS: 1 | US FAERS | |
| 382 | Prurigo | FAERS: 1 | US FAERS | |
| 383 | Pulmonary congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 384 | Purpura | FAERS: 1 | US FAERS | |
| 385 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 386 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 387 | Respiratory distress | FAERS: 1 | US FAERS | |
| 388 | Secondary sexual characteristics absence | FAERS: 1 | US FAERS | |
| 389 | Sepsis | FAERS: 1 | US FAERS | |
| 390 | Serum sickness-like reaction | FAERS: 1 | US FAERS | |
| 391 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 392 | Shock | FAERS: 1 | US FAERS | |
| 393 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 394 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 395 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 396 | Skin irritation | FAERS: 1 | US FAERS | |
| 397 | Skin reaction | FAERS: 1 | US FAERS | |
| 398 | Sluggishness | FAERS: 1 | US FAERS | |
| 399 | Spinal Muscular Atrophy | FAERS: 1 | US FAERS | |
| 400 | Stomatitis | FAERS: 1 | US FAERS | |
| 401 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 402 | Sudden death | FAERS: 1 | US FAERS | |
| 403 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 404 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 405 | Tetany | FAERS: 1 | US FAERS | |
| 406 | Thrombosis | FAERS: 1 | US FAERS | |
| 407 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 408 | Tongue eruption | FAERS: 1 | US FAERS | |
| 409 | Ubiquinone decreased | FAERS: 1 | US FAERS | |
| 410 | Ulcer | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 411 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 412 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 413 | Vaginal hyperplasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 414 | Venous occlusion | FAERS: 1 | US FAERS | |
| 415 | Vestibulitis | FAERS: 1 | US FAERS | |
| 416 | Visual disturbance | FAERS: 1 | US FAERS | |
| 417 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 418 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 419 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 420 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 421 | treatment failure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 422 | Abnormal cervical smear | OFFSIDES | ||
| 423 | Acanthosis | OFFSIDES | ||
| 424 | Acid reflux | OFFSIDES | ||
| 425 | Acne Vulgaris | 15752283 | CTD | |
| 426 | Acute bronchitis | OFFSIDES | ||
| 427 | Acute myocardial infarction | OFFSIDES | ||
| 428 | Acute respiratory failure | OFFSIDES | ||
| 429 | Adrenal mass | OFFSIDES | ||
| 430 | Agoraphobia | OFFSIDES | ||
| 431 | Alopecia totalis | OFFSIDES | ||
| 432 | Amblyopia | OFFSIDES | ||
| 433 | Ammonia increased | OFFSIDES | ||
| 434 | Anaphylactic shock | SIDER | ||
| 435 | Andropause | OFFSIDES | ||
| 436 | Angiolipoma | OFFSIDES | ||
| 437 | Anoxic Encephalopathy | OFFSIDES | ||
| 438 | Application site erythema | OFFSIDES | ||
| 439 | Application site inflammation | OFFSIDES | ||
| 440 | Arteriosclerosis | OFFSIDES | ||
| 441 | Arthritis | OFFSIDES | ||
| 442 | Aspiration Pneumonia | OFFSIDES | ||
| 443 | Atelectasis | OFFSIDES | ||
| 444 | Atrial Flutter | OFFSIDES | ||
| 445 | Atrophic vulvovaginitis | Canada Vigilance: 1 | Canada Vigilance | |
| 446 | Autistic Disorder | 17150311 | CTD | |
| 447 | Autoimmune thyroiditis | OFFSIDES | ||
| 448 | Automatism | OFFSIDES | ||
| 449 | Bacteria sputum identified | OFFSIDES | ||
| 450 | Bacteria tissue specimen identified | OFFSIDES | ||
| 451 | Bacterial test positive | OFFSIDES | ||
| 452 | Basal cell carcinoma | OFFSIDES | ||
| 453 | Bilirubin conjugated increased | OFFSIDES | ||
| 454 | Biopsy bone abnormal | OFFSIDES | ||
| 455 | Biopsy mucosa abnormal | OFFSIDES | ||
| 456 | Blood Glucose | OFFSIDES | ||
| 457 | Blood albumin abnormal | OFFSIDES | ||
| 458 | Blood bicarbonate abnormal | OFFSIDES | ||
| 459 | Blood count abnormal | OFFSIDES | ||
| 460 | Blood creatine phosphokinase increased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 461 | Blood glucose decreased | OFFSIDES | ||
| 462 | Blood iron decreased | OFFSIDES | ||
| 463 | Blood iron increased | OFFSIDES | ||
| 464 | Blood osmolarity increased | OFFSIDES | ||
| 465 | Blood phosphorus increased | OFFSIDES | ||
| 466 | Blood potassium | OFFSIDES | ||
| 467 | Blood sodium abnormal | OFFSIDES | ||
| 468 | Blood sodium | OFFSIDES | ||
| 469 | Blood thyroid stimulating hormone abnormal | OFFSIDES | ||
| 470 | Blood trypsin increased | OFFSIDES | ||
| 471 | Blood urea abnormal | OFFSIDES | ||
| 472 | Blood uric acid decreased | OFFSIDES | ||
| 473 | Blood uric acid | OFFSIDES | ||
| 474 | Blood urine present | OFFSIDES | ||
| 475 | Blurred vision | OFFSIDES | ||
| 476 | Body Temperature | OFFSIDES | ||
| 477 | Body temperature fluctuation | OFFSIDES | ||
| 478 | Bone Sarcoma | OFFSIDES | ||
| 479 | Bone density decreased | OFFSIDES | ||
| 480 | Bone trimming | OFFSIDES | ||
| 481 | Brain natriuretic peptide increased | OFFSIDES | ||
| 482 | Breakthrough Pain | OFFSIDES | ||
| 483 | Bronchoalveolar Lavage | OFFSIDES | ||
| 484 | Bronchopneumonia | OFFSIDES | ||
| 485 | Calciphylaxis | OFFSIDES | ||
| 486 | Cardiac Tamponade | OFFSIDES | ||
| 487 | Cardiac valve vegetation | OFFSIDES | ||
| 488 | Cardiomegaly | 11592866 | CTD | |
| 489 | Cardiomyopathies | 4909201 15741423 | CTD | |
| 490 | Cardiomyopathy, Dilated | 16275882 18628775 | CTD | |
| 491 | Cardiovascular Diseases | 11230374 | CTD | |
| 492 | Catheter related complication | OFFSIDES | ||
| 493 | Causalgia | OFFSIDES | ||
| 494 | Cheilitis | OFFSIDES | ||
| 495 | Chemical and Drug Induced Liver Injury | 11488711 | CTD | |
| 496 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 497 | Choking sensation | OFFSIDES | ||
| 498 | Choking | OFFSIDES | ||
| 499 | Cholangiolitis | OFFSIDES | ||
| 500 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 501 | Chronic active hepatitis | OFFSIDES | ||
| 502 | Cirrhosis | OFFSIDES | ||
| 503 | Clostridium difficile colitis | OFFSIDES | ||
| 504 | Coagulation factor VIII level increased | OFFSIDES | ||
| 505 | Cocaine-Related Disorders | 19799583 | CTD | |
| 506 | Cognition Disorders | 9130285 | CTD | |
| 507 | Confabulation | OFFSIDES | ||
| 508 | Congenital hypertrichosis | OFFSIDES | ||
| 509 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 510 | Contralateral breast cancer | OFFSIDES | ||
| 511 | Cramps of lower extremities | SIDER | ||
| 512 | Crossmatch incompatible | OFFSIDES | ||
| 513 | Cytolytic hepatitis | OFFSIDES | ||
| 514 | Deafness Neurosensory | Canada Vigilance: 2 | Canada Vigilance OFFSIDES | |
| 515 | Depressive disorder | 15949161 | CTD | |
| 516 | Dermatitis | SIDER | ||
| 517 | Device related infection | OFFSIDES | ||
| 518 | Diabetes | OFFSIDES | ||
| 519 | Diabetic Nephropathy | OFFSIDES | ||
| 520 | Diabetic Retinopathy | OFFSIDES | ||
| 521 | Diarrhea | 11250985 24101390 | CTD | |
| 522 | Diastolic dysfunction | OFFSIDES | ||
| 523 | Disease recurrence | OFFSIDES | ||
| 524 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 525 | Diverticulosis | OFFSIDES | ||
| 526 | Drowsiness | OFFSIDES SIDER | ||
| 527 | Drug diversion | OFFSIDES | ||
| 528 | Drug toxicity | OFFSIDES | ||
| 529 | Dry gangrene | OFFSIDES | ||
| 530 | Duodenitis | OFFSIDES | ||
| 531 | Dyslipidemias | 31295448 | CTD | |
| 532 | Edema | 2126792 | CTD | |
| 533 | Electrocardiogram QT corrected interval shortened | OFFSIDES | ||
| 534 | Electromechanical dissociation | OFFSIDES | ||
| 535 | Encephalomalacia | OFFSIDES | ||
| 536 | Endocarditis | OFFSIDES | ||
| 537 | Enterocutaneous Fistula | OFFSIDES | ||
| 538 | Epidermolysis | OFFSIDES | ||
| 539 | Erosive gastritis | OFFSIDES | ||
| 540 | Escherichia urinary tract infection | OFFSIDES | ||
| 541 | Factor V Leiden mutation | OFFSIDES | ||
| 542 | Fat necrosis | OFFSIDES | ||
| 543 | Fatty Liver | OFFSIDES | ||
| 544 | Feelings of worthlessness | OFFSIDES | ||
| 545 | Fibrosis | 11592866 | CTD | |
| 546 | Flight of ideas | OFFSIDES | ||
| 547 | Gallop rhythm present | OFFSIDES | ||
| 548 | Gangrene | OFFSIDES | ||
| 549 | Gastric Antral Vascular Ectasia | OFFSIDES | ||
| 550 | Gastroenteritis | OFFSIDES | ||
| 551 | Gastrointestinal Diseases | 4740303 | CTD | |
| 552 | Genital swelling | OFFSIDES | ||
| 553 | Globulinuria | OFFSIDES | ||
| 554 | Glomerulonephritis, Membranoproliferative | 16928621 | CTD | |
| 555 | Goiter | OFFSIDES | ||
| 556 | Granulocytosis | OFFSIDES | ||
| 557 | Gynecomastia | CTD | ||
| 558 | Haptoglobin Decreased | OFFSIDES | ||
| 559 | Heart Diseases | 10888242 17984673 19913415 | CTD | |
| 560 | Heart failure | CTD | ||
| 561 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 562 | Hyperammonemia | 600713 | CTD | |
| 563 | Hyperkalemia |
1103606
2849806 2993981 4740303 4814187 4951338 7433326 11250985 12869459 15632880 15811903 16286062 17309946 20859899 21130975 | CTD | |
| 564 | Hypernatremia | 10100081 | CTD | |
| 565 | Hyperparathyroidism | OFFSIDES | ||
| 566 | Hypertensive heart disease | OFFSIDES | ||
| 567 | Hypertrichosis | SIDER | ||
| 568 | Hypokalemia | CTD | ||
| 569 | Hypokalemic periodic paralysis | 19822448 | CTD | |
| 570 | Hyponatremia | 4740303 | CTD | |
| 571 | Hypoxia | 20228418 21263376 | CTD OFFSIDES | |
| 572 | Impaired gastric emptying | OFFSIDES | ||
| 573 | Incorrect route of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 574 | Infection | OFFSIDES | ||
| 575 | Insulin Resistance | 31295448 | CTD | |
| 576 | Intervertebral disc disorder | OFFSIDES | ||
| 577 | Intraocular pressure test | OFFSIDES | ||
| 578 | Joint sprain | OFFSIDES | ||
| 579 | Joint stiffness | OFFSIDES | ||
| 580 | Kidney Cortex Necrosis | 15245572 | CTD | |
| 581 | Kidney Diseases | 1064790 11776407 17984673 | CTD | |
| 582 | Kidney Failure | OFFSIDES | ||
| 583 | Leukopenia neonatal | OFFSIDES | ||
| 584 | Ligament rupture | OFFSIDES | ||
| 585 | Liver Cirrhosis | 25204689 | CTD | |
| 586 | Liver neoplasms | 25058030 | CTD | |
| 587 | Lumbar radiculopathy | OFFSIDES | ||
| 588 | Lung Abscess | OFFSIDES | ||
| 589 | Lung Injury | OFFSIDES | ||
| 590 | Lymph nodes scan abnormal | OFFSIDES | ||
| 591 | Lymphangiosis carcinomatosa | OFFSIDES | ||
| 592 | Lymphangitis | OFFSIDES | ||
| 593 | Lymphedema | OFFSIDES | ||
| 594 | Lymphocyte stimulation test positive | OFFSIDES | ||
| 595 | Mastication disorder | OFFSIDES | ||
| 596 | Menstruation Disturbances | 22074142 | CTD | |
| 597 | Mesenteric arteriosclerosis | OFFSIDES | ||
| 598 | Metamorphopsia | OFFSIDES | ||
| 599 | Metrorrhagia | Canada Vigilance: 1 | Canada Vigilance | |
| 600 | Moaning | OFFSIDES | ||
| 601 | Monoplegia | OFFSIDES | ||
| 602 | Mouth Breathing | OFFSIDES | ||
| 603 | Multiple Myeloma | OFFSIDES | ||
| 604 | Myelodysplasia | OFFSIDES | ||
| 605 | Neuralgia | 20846523 | CTD | |
| 606 | Neuroleptic Malignant Syndrome | OFFSIDES | ||
| 607 | Neurologic Manifestations | 4740303 | CTD | |
| 608 | Nodal osteoarthritis | OFFSIDES | ||
| 609 | Nodule on extremity | OFFSIDES | ||
| 610 | Nodule | OFFSIDES | ||
| 611 | Obesity, Abdominal | 31295448 | CTD | |
| 612 | Ocular icterus | OFFSIDES | ||
| 613 | Oliguria | OFFSIDES | ||
| 614 | Oral torus | OFFSIDES | ||
| 615 | Oropharyngeal blistering | OFFSIDES | ||
| 616 | Orthopnea | OFFSIDES | ||
| 617 | Osteomyelitis | OFFSIDES | ||
| 618 | PROTHROMBIN TIME | OFFSIDES | ||
| 619 | Pallor | OFFSIDES | ||
| 620 | Pancreatic Insufficiency | OFFSIDES | ||
| 621 | Peptic Ulcer | 5569832 | CTD | |
| 622 | Phlebitis | OFFSIDES | ||
| 623 | Phonophobia | OFFSIDES | ||
| 624 | Platelet count abnormal | OFFSIDES | ||
| 625 | Polycystic Ovary Syndrome | 31295448 | CTD | |
| 626 | Portal Vein Thrombosis | OFFSIDES | ||
| 627 | Portal hypertensive gastropathy | OFFSIDES | ||
| 628 | Positron emission tomogram abnormal | OFFSIDES | ||
| 629 | Postoperative wound complication | OFFSIDES | ||
| 630 | Preventive surgery | OFFSIDES | ||
| 631 | Primary sequestrum | OFFSIDES | ||
| 632 | Propofol Infusion Syndrome | OFFSIDES | ||
| 633 | Protein total abnormal | OFFSIDES | ||
| 634 | Proteinuria | 15983956 18382267 21135038 | CTD | |
| 635 | Prothrombin level decreased | OFFSIDES | ||
| 636 | Quadriplegia | 2993981 | CTD | |
| 637 | Rectal Prolapse | OFFSIDES | ||
| 638 | Refusal of treatment by relative | OFFSIDES | ||
| 639 | Renal Insufficiency | 15632880 | CTD | |
| 640 | Renal tubular disorder | OFFSIDES | ||
| 641 | Renal tubular necrosis | OFFSIDES | ||
| 642 | Respiratory Failure | OFFSIDES | ||
| 643 | Retinal Vascular Disorder | OFFSIDES | ||
| 644 | Retroperitoneal infection | OFFSIDES | ||
| 645 | Rheumatoid Nodule | OFFSIDES | ||
| 646 | Screaming | OFFSIDES | ||
| 647 | Seizures | 5569832 | CTD | |
| 648 | Semen abnormal | SIDER | ||
| 649 | Semen analysis abnormal | SIDER | ||
| 650 | Septic embolus | OFFSIDES | ||
| 651 | Serratia sepsis | OFFSIDES | ||
| 652 | Shunt occlusion | OFFSIDES | ||
| 653 | Sick Sinus Syndrome | OFFSIDES | ||
| 654 | Sinus headache | OFFSIDES | ||
| 655 | Sleep Apnea, Obstructive | 20016520 | CTD | |
| 656 | Spleen scan abnormal | OFFSIDES | ||
| 657 | Spondylolisthesis | OFFSIDES | ||
| 658 | Subcutaneous Abscess | OFFSIDES | ||
| 659 | Subcutaneous nodule | OFFSIDES | ||
| 660 | Subileus | OFFSIDES | ||
| 661 | Substance Withdrawal Syndrome | 25308750 | CTD | |
| 662 | Superficial Thrombophlebitis | OFFSIDES | ||
| 663 | Synovial Cyst | OFFSIDES | ||
| 664 | Temperature intolerance | OFFSIDES | ||
| 665 | Therapy regimen changed | OFFSIDES | ||
| 666 | Thoracic Outlet Syndrome | OFFSIDES | ||
| 667 | Thrombophlebitis | OFFSIDES | ||
| 668 | Tooth Extraction | OFFSIDES | ||
| 669 | Tooth Loss | OFFSIDES | ||
| 670 | Tracheobronchitis | OFFSIDES | ||
| 671 | Transfusion Reaction | OFFSIDES | ||
| 672 | Vaginal Discharge | Canada Vigilance: 1 | Canada Vigilance | |
| 673 | Vascular Diseases | 15496307 | CTD | |
| 674 | Vasculitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 675 | Venoocclusive disease | OFFSIDES | ||
| 676 | Venous Insufficiency | OFFSIDES | ||
| 677 | Venous stasis | OFFSIDES | ||
| 678 | Venous thrombosis limb | OFFSIDES | ||
| 679 | Ventricular Dysfunction, Left | 11300427 14725033 | CTD | |
| 680 | Ventricular Fibrillation | OFFSIDES | ||
| 681 | Ventricular Remodeling | 17079761 | CTD | |
| 682 | Ventriculoperitoneal shunt malfunction | OFFSIDES | ||
| 683 | Von Willebrand's factor antigen increased | OFFSIDES | ||
| 684 | Weight Gain | 31295448 | CTD OFFSIDES | |
| 685 | Wound Complication | OFFSIDES | ||
| 686 | colonoscopy | OFFSIDES | ||
| 687 | keratoacanthoma | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.