Ortho Evra
(ISHXLNHNDMZNMC-VTKCIJPMSA-N)
Structure
- SMILES
- O/N=C/1\CC[C@H]2C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@]2(O)C#C)CC
- Molecular Formula:
- C21H29NO2
- Molecular Weight:
- 327.460
- Log P:
- 4.1437
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 52.82
- CAS Number(s):
- 53016-31-2
Synonym(s)
1.
Ortho Evra
2.
Evra
3.
norelgestromin-ethinyl estradiol combination patch
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Metrorrhagia | FAERS: 2453 | US FAERS | |
| 2 | Pulmonary Embolism | FAERS: 1259 | US FAERS | |
| 3 | Nausea | FAERS: 1013 | US FAERS | |
| 4 | Application site reaction | FAERS: 980 | US FAERS | |
| 5 | Deep Vein Thrombosis | FAERS: 907 | US FAERS | |
| 6 | Drug exposure during pregnancy | FAERS: 799 | US FAERS | |
| 7 | Headache | FAERS: 571 | US FAERS | |
| 8 | Product quality issue | FAERS: 571 | US FAERS | |
| 9 | Inappropriate schedule of drug administration | FAERS: 540 | US FAERS | |
| 10 | Thrombosis | FAERS: 517 | US FAERS | |
| 11 | Drug dose omission | FAERS: 436 | US FAERS | |
| 12 | Vomiting | FAERS: 364 | US FAERS | |
| 13 | Breast tenderness | FAERS: 343 | US FAERS | |
| 14 | Menorrhagia | FAERS: 340 | US FAERS | |
| 15 | Wrong technique in drug usage process | FAERS: 319 | US FAERS | |
| 16 | Abdominal Pain | FAERS: 285 | US FAERS | |
| 17 | Cerebrovascular accident | FAERS: 248 | US FAERS | |
| 18 | Dizziness | FAERS: 244 | US FAERS | |
| 19 | Product adhesion issue | FAERS: 172 | US FAERS | |
| 20 | Chest Pain | FAERS: 159 | US FAERS | |
| 21 | Fatigue | FAERS: 153 | US FAERS | |
| 22 | Unevaluable event | FAERS: 151 | US FAERS | |
| 23 | Product use issue | FAERS: 148 | US FAERS | |
| 24 | Uterine spasm | FAERS: 137 | US FAERS | |
| 25 | Alopecia | FAERS: 133 | US FAERS | |
| 26 | Pregnancy with contraceptive patch | FAERS: 107 | US FAERS | |
| 27 | Myocardial Infarction | FAERS: 104 | US FAERS | |
| 28 | Application site pruritus | FAERS: 100 | US FAERS | |
| 29 | Vaginal Discharge | FAERS: 94 | US FAERS | |
| 30 | Back Pain | FAERS: 91 | US FAERS | |
| 31 | Adverse event | FAERS: 82 | US FAERS | |
| 32 | Acne | FAERS: 80 | US FAERS | |
| 33 | Pneumonia | FAERS: 80 | US FAERS | |
| 34 | Urinary tract infection | FAERS: 75 | US FAERS | |
| 35 | Asthenia | FAERS: 68 | US FAERS | |
| 36 | Mood swings | FAERS: 68 | US FAERS | |
| 37 | Pruritus | FAERS: 65 | US FAERS | |
| 38 | Palpitations | FAERS: 63 | US FAERS | |
| 39 | Application site irritation | FAERS: 62 | US FAERS | |
| 40 | Pain | FAERS: 62 | US FAERS | |
| 41 | Muscle Cramp | FAERS: 55 | US FAERS | |
| 42 | Skin irritation | FAERS: 55 | US FAERS | |
| 43 | Malaise | FAERS: 53 | US FAERS | |
| 44 | Anxiety | FAERS: 48 | US FAERS | |
| 45 | Application site pain | FAERS: 47 | US FAERS | |
| 46 | Syncope | FAERS: 47 | US FAERS | |
| 47 | Application site erythema | FAERS: 46 | US FAERS | |
| 48 | Drug administered at inappropriate site | FAERS: 46 | US FAERS | |
| 49 | Tachycardia | FAERS: 46 | US FAERS | |
| 50 | Medication Error | FAERS: 43 | US FAERS | |
| 51 | Pulmonary thrombosis | FAERS: 43 | US FAERS | |
| 52 | Cardiac Arrest | FAERS: 42 | US FAERS | |
| 53 | Pharmaceutical product complaint | FAERS: 42 | US FAERS | |
| 54 | Cerebral Infarction | FAERS: 37 | US FAERS | |
| 55 | Cerebral Thrombosis | FAERS: 37 | US FAERS | |
| 56 | Weight decreased | FAERS: 37 | US FAERS | |
| 57 | Application site rash | FAERS: 35 | US FAERS | |
| 58 | Chloasma | FAERS: 35 | US FAERS | |
| 59 | Feeling abnormal | FAERS: 35 | US FAERS | |
| 60 | Arthralgia | FAERS: 34 | US FAERS | |
| 61 | Pregnancy | FAERS: 33 | US FAERS | |
| 62 | Drug administration error | FAERS: 32 | US FAERS | |
| 63 | Myalgia | FAERS: 31 | US FAERS | |
| 64 | Urticaria | FAERS: 30 | US FAERS | |
| 65 | Hypersensitivity | FAERS: 29 | US FAERS | |
| 66 | Drug ineffective | FAERS: 27 | US FAERS | |
| 67 | Dehydration | FAERS: 26 | US FAERS | |
| 68 | Visual disturbance | FAERS: 26 | US FAERS | |
| 69 | Breast engorgement | FAERS: 25 | US FAERS | |
| 70 | Constipation | FAERS: 25 | US FAERS | |
| 71 | Asthma | FAERS: 24 | US FAERS | |
| 72 | Chest discomfort | FAERS: 24 | US FAERS | |
| 73 | Therapeutic response unexpected | FAERS: 24 | US FAERS | |
| 74 | Pulmonary Infarction | FAERS: 23 | US FAERS | |
| 75 | Acute myocardial infarction | FAERS: 22 | US FAERS | |
| 76 | Emotional disorder | FAERS: 22 | US FAERS | |
| 77 | Hypotension | FAERS: 22 | US FAERS | |
| 78 | Retinal Vein Occlusion | FAERS: 22 | US FAERS | |
| 79 | Bronchitis | FAERS: 21 | US FAERS | |
| 80 | Depressed mood | FAERS: 21 | US FAERS | |
| 81 | Drug prescribing error | FAERS: 21 | US FAERS | |
| 82 | Incorrect drug administration duration | FAERS: 21 | US FAERS | |
| 83 | Pancreatitis | FAERS: 21 | US FAERS | |
| 84 | Product packaging quantity issue | FAERS: 21 | US FAERS | |
| 85 | Premenstrual syndrome | FAERS: 20 | US FAERS | |
| 86 | Dyspepsia | FAERS: 19 | US FAERS | |
| 87 | Anorexia | FAERS: 18 | US FAERS | |
| 88 | Expired product administered | FAERS: 18 | US FAERS | |
| 89 | Sinusitis | FAERS: 18 | US FAERS | |
| 90 | Ectopic Pregnancy | FAERS: 17 | US FAERS | |
| 91 | Embolism | FAERS: 17 | US FAERS | |
| 92 | Pericardial effusion | FAERS: 16 | US FAERS | |
| 93 | Vertigo | FAERS: 16 | US FAERS | |
| 94 | Wrong technique in product usage process | FAERS: 16 | US FAERS | |
| 95 | Aphasia | FAERS: 15 | US FAERS | |
| 96 | Contact lens intolerance | FAERS: 15 | US FAERS | |
| 97 | Nasopharyngitis | FAERS: 15 | US FAERS | |
| 98 | Portal Vein Thrombosis | FAERS: 15 | US FAERS | |
| 99 | Respiratory Failure | FAERS: 15 | US FAERS | |
| 100 | Venous Thrombosis | FAERS: 15 | US FAERS | |
| 101 | Ventricular Fibrillation | FAERS: 15 | US FAERS | |
| 102 | Application site scar | FAERS: 14 | US FAERS | |
| 103 | Atelectasis | FAERS: 14 | US FAERS | |
| 104 | Influenza | FAERS: 14 | US FAERS | |
| 105 | Tremor | FAERS: 14 | US FAERS | |
| 106 | Application site burn | FAERS: 13 | US FAERS | |
| 107 | Chills | FAERS: 13 | US FAERS | |
| 108 | Cholelithiasis | FAERS: 13 | US FAERS | |
| 109 | Dysuria | FAERS: 13 | US FAERS | |
| 110 | Erythema | FAERS: 13 | US FAERS | |
| 111 | Impaired work ability | FAERS: 13 | US FAERS | |
| 112 | Infection | FAERS: 13 | US FAERS | |
| 113 | Infertility | FAERS: 13 | US FAERS | |
| 114 | Intentional product use issue | FAERS: 13 | US FAERS | |
| 115 | Nipple pain | FAERS: 13 | US FAERS | |
| 116 | Optic Neuritis | FAERS: 13 | US FAERS | |
| 117 | Pulmonary Hypertension | FAERS: 13 | US FAERS | |
| 118 | Sarcoidosis | FAERS: 13 | US FAERS | |
| 119 | Suppressed lactation | FAERS: 13 | US FAERS | |
| 120 | Vaginal mycosis | FAERS: 13 | US FAERS | |
| 121 | Abdominal discomfort | FAERS: 12 | US FAERS | |
| 122 | Blood cholesterol increased | FAERS: 12 | US FAERS | |
| 123 | Cystitis | FAERS: 12 | US FAERS | |
| 124 | Dry skin | FAERS: 12 | US FAERS | |
| 125 | Fibrin D dimer increased | FAERS: 12 | US FAERS | |
| 126 | Hypertensive heart disease | FAERS: 12 | US FAERS | |
| 127 | Retinal Artery Occlusion | FAERS: 12 | US FAERS | |
| 128 | Somnolence | FAERS: 12 | US FAERS | |
| 129 | Sudden death | FAERS: 12 | US FAERS | |
| 130 | Application site erosion | FAERS: 11 | US FAERS | |
| 131 | Crying | FAERS: 11 | US FAERS | |
| 132 | Endometriosis | FAERS: 11 | US FAERS | |
| 133 | Hypertensive crisis | FAERS: 11 | US FAERS | |
| 134 | Nephrolithiasis | FAERS: 11 | US FAERS | |
| 135 | Pelvic Pain | FAERS: 11 | US FAERS | |
| 136 | Pharyngitis | FAERS: 11 | US FAERS | |
| 137 | Retching | FAERS: 11 | US FAERS | |
| 138 | Septic embolus | FAERS: 11 | US FAERS | |
| 139 | Supraventricular tachycardia | FAERS: 11 | US FAERS | |
| 140 | Application site discomfort | FAERS: 10 | US FAERS | |
| 141 | Blighted ovum | FAERS: 10 | US FAERS | |
| 142 | Blindness | FAERS: 10 | US FAERS | |
| 143 | Breast Cyst | FAERS: 10 | US FAERS | |
| 144 | Burning sensation | FAERS: 10 | US FAERS | |
| 145 | Carotid artery aneurysm | FAERS: 10 | US FAERS | |
| 146 | Hyperventilation | FAERS: 10 | US FAERS | |
| 147 | Incorrect product storage | FAERS: 10 | US FAERS | |
| 148 | Joint swelling | FAERS: 10 | US FAERS | |
| 149 | Lethargy | FAERS: 10 | US FAERS | |
| 150 | Neck Pain | FAERS: 10 | US FAERS | |
| 151 | Nervousness | FAERS: 10 | US FAERS | |
| 152 | Pelvic Inflammatory Disease | FAERS: 10 | US FAERS | |
| 153 | Product packaging issue | FAERS: 10 | US FAERS | |
| 154 | Unexpected therapeutic drug effect | FAERS: 10 | US FAERS | |
| 155 | Vulvovaginal dryness | FAERS: 10 | US FAERS | |
| 156 | Adnexa uteri pain | FAERS: 9 | US FAERS | |
| 157 | Application site pigmentation changes | FAERS: 9 | US FAERS | |
| 158 | Application site swelling | FAERS: 9 | US FAERS | |
| 159 | Arterial thrombosis | FAERS: 9 | US FAERS | |
| 160 | Blood urine present | FAERS: 9 | US FAERS | |
| 161 | Breast discomfort | FAERS: 9 | US FAERS | |
| 162 | Cellulitis | FAERS: 9 | US FAERS | |
| 163 | Drug exposure before pregnancy | FAERS: 9 | US FAERS | |
| 164 | Dystonia | FAERS: 9 | US FAERS | |
| 165 | Feeling Cold | FAERS: 9 | US FAERS | |
| 166 | Gastroenteritis | FAERS: 9 | US FAERS | |
| 167 | Night sweats | FAERS: 9 | US FAERS | |
| 168 | Splenic Infarction | FAERS: 9 | US FAERS | |
| 169 | Swelling | FAERS: 9 | US FAERS | |
| 170 | Vulvovaginal discomfort | FAERS: 9 | US FAERS | |
| 171 | Abasia | FAERS: 8 | US FAERS | |
| 172 | Aneurysm | FAERS: 8 | US FAERS | |
| 173 | Application site photosensitivity reaction | FAERS: 8 | US FAERS | |
| 174 | Arteriosclerosis | FAERS: 8 | US FAERS | |
| 175 | Cerebral artery occlusion | FAERS: 8 | US FAERS | |
| 176 | Hypoaesthesia facial | FAERS: 8 | US FAERS | |
| 177 | Lymphadenopathy | FAERS: 8 | US FAERS | |
| 178 | Pelvic venous thrombosis | FAERS: 8 | US FAERS | |
| 179 | Poor quality drug administered | FAERS: 8 | US FAERS | |
| 180 | Stress | FAERS: 8 | US FAERS | |
| 181 | Thyroid Neoplasm | FAERS: 8 | US FAERS | |
| 182 | Transaminases increased | FAERS: 8 | US FAERS | |
| 183 | Anoxic Encephalopathy | FAERS: 7 | US FAERS | |
| 184 | Application site hypersensitivity | FAERS: 7 | US FAERS | |
| 185 | Application site vesicles | FAERS: 7 | US FAERS | |
| 186 | Chromaturia | FAERS: 7 | US FAERS | |
| 187 | Complications of maternal exposure to therapeutic drugs | FAERS: 7 | US FAERS | |
| 188 | Depressed Level of Consciousness | FAERS: 7 | US FAERS | |
| 189 | Dysgeusia | FAERS: 7 | US FAERS | |
| 190 | Dyspareunia | FAERS: 7 | US FAERS | |
| 191 | Epilepsy | FAERS: 7 | US FAERS | |
| 192 | Flatulence | FAERS: 7 | US FAERS | |
| 193 | Hypothyroidism | FAERS: 7 | US FAERS | |
| 194 | Osteomyelitis | FAERS: 7 | US FAERS | |
| 195 | Peripheral embolism | FAERS: 7 | US FAERS | |
| 196 | Pleurisy | FAERS: 7 | US FAERS | |
| 197 | Presyncope | FAERS: 7 | US FAERS | |
| 198 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 199 | Sepsis | FAERS: 7 | US FAERS | |
| 200 | Skin reaction | FAERS: 7 | US FAERS | |
| 201 | Torticollis | FAERS: 7 | US FAERS | |
| 202 | Venous stenosis | FAERS: 7 | US FAERS | |
| 203 | Visual Impairment | FAERS: 7 | US FAERS | |
| 204 | furuncle | FAERS: 7 | US FAERS | |
| 205 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 206 | Amnesia | FAERS: 6 | US FAERS | |
| 207 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 208 | Brain Death | FAERS: 6 | US FAERS | |
| 209 | Central nervous system lesion | FAERS: 6 | US FAERS | |
| 210 | Cold sweat | FAERS: 6 | US FAERS | |
| 211 | Cyst | FAERS: 6 | US FAERS | |
| 212 | Embolic stroke | FAERS: 6 | US FAERS | |
| 213 | Eye pain | FAERS: 6 | US FAERS | |
| 214 | Gestational Diabetes | FAERS: 6 | US FAERS | |
| 215 | Hormone level abnormal | FAERS: 6 | US FAERS | |
| 216 | Hydrocephalus | FAERS: 6 | US FAERS | |
| 217 | Inflammation | FAERS: 6 | US FAERS | |
| 218 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 219 | Multiple Sclerosis | FAERS: 6 | US FAERS | |
| 220 | Muscle abscess | FAERS: 6 | US FAERS | |
| 221 | Muscle strain | FAERS: 6 | US FAERS | |
| 222 | Muscle tightness | FAERS: 6 | US FAERS | |
| 223 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 224 | Musculoskeletal chest pain | FAERS: 6 | US FAERS | |
| 225 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 226 | Perirectal abscess | FAERS: 6 | US FAERS | |
| 227 | Phlebitis | FAERS: 6 | US FAERS | |
| 228 | Photophobia | FAERS: 6 | US FAERS | |
| 229 | Post procedural complication | FAERS: 6 | US FAERS | |
| 230 | Pregnancy on oral contraceptive | FAERS: 6 | US FAERS | |
| 231 | Pyomyositis | FAERS: 6 | US FAERS | |
| 232 | Rash erythematous | FAERS: 6 | US FAERS | |
| 233 | Respiratory distress | FAERS: 6 | US FAERS | |
| 234 | Right ventricular failure | FAERS: 6 | US FAERS | |
| 235 | Salpingectomy | FAERS: 6 | US FAERS | |
| 236 | Secretion discharge | FAERS: 6 | US FAERS | |
| 237 | Systemic Inflammatory Response Syndrome | FAERS: 6 | US FAERS | |
| 238 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 239 | Vaginal lesion | FAERS: 6 | US FAERS | |
| 240 | Venous thrombosis limb | FAERS: 6 | US FAERS | |
| 241 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 242 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 243 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 244 | Bone pain | FAERS: 5 | US FAERS | |
| 245 | Bradycardia | FAERS: 5 | US FAERS | |
| 246 | Cardiac enzymes increased | FAERS: 5 | US FAERS | |
| 247 | Cervical dysplasia | FAERS: 5 | US FAERS | |
| 248 | Cervix carcinoma | FAERS: 5 | US FAERS | |
| 249 | Cholecystitis | FAERS: 5 | US FAERS | |
| 250 | Disease recurrence | FAERS: 5 | US FAERS | |
| 251 | Eye irritation | FAERS: 5 | US FAERS | |
| 252 | Gastritis | FAERS: 5 | US FAERS | |
| 253 | Hypoxia | FAERS: 5 | US FAERS | |
| 254 | Intracranial Aneurysm | FAERS: 5 | US FAERS | |
| 255 | Leukopenia | FAERS: 5 | US FAERS | |
| 256 | Malignant Hypertension | FAERS: 5 | US FAERS | |
| 257 | Musculoskeletal discomfort | FAERS: 5 | US FAERS | |
| 258 | Myocarditis | FAERS: 5 | US FAERS | |
| 259 | Peritonitis | FAERS: 5 | US FAERS | |
| 260 | Pregnancy test positive | FAERS: 5 | US FAERS | |
| 261 | Product outer packaging issue | FAERS: 5 | US FAERS | |
| 262 | Ruptured ectopic pregnancy | FAERS: 5 | US FAERS | |
| 263 | Septic phlebitis | FAERS: 5 | US FAERS | |
| 264 | Therapy cessation | FAERS: 5 | US FAERS | |
| 265 | Thrombophlebitis | FAERS: 5 | US FAERS | |
| 266 | Vaginitis | FAERS: 5 | US FAERS | |
| 267 | Abnormal withdrawal bleeding | FAERS: 4 | US FAERS | |
| 268 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 269 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 270 | Agitation | FAERS: 4 | US FAERS | |
| 271 | Appendicitis | FAERS: 4 | US FAERS | |
| 272 | Application site dryness | FAERS: 4 | US FAERS | |
| 273 | Arthritis | FAERS: 4 | US FAERS | |
| 274 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 275 | Cardiac valve replacement complication | FAERS: 4 | US FAERS | |
| 276 | Dermatitis | FAERS: 4 | US FAERS | |
| 277 | Discomfort | FAERS: 4 | US FAERS | |
| 278 | Encephalitis | FAERS: 4 | US FAERS | |
| 279 | Erythema Nodosum | FAERS: 4 | US FAERS | |
| 280 | Frustration | FAERS: 4 | US FAERS | |
| 281 | Glaucoma | FAERS: 4 | US FAERS | |
| 282 | Hemiparesis | FAERS: 4 | US FAERS | |
| 283 | Hepatitis | FAERS: 4 | US FAERS | |
| 284 | Hunger | FAERS: 4 | US FAERS | |
| 285 | Hyperthyroidism | FAERS: 4 | US FAERS | |
| 286 | Hypotrichosis | FAERS: 4 | US FAERS | |
| 287 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 288 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 289 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 290 | Lactation Disorder | FAERS: 4 | US FAERS | |
| 291 | Lymphostasis | FAERS: 4 | US FAERS | |
| 292 | Mediastinal mass | FAERS: 4 | US FAERS | |
| 293 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 294 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 295 | Pre-Eclampsia | FAERS: 4 | US FAERS | |
| 296 | Protein S decreased | FAERS: 4 | US FAERS | |
| 297 | Pulmonary Eosinophilia | FAERS: 4 | US FAERS | |
| 298 | Retropharyngeal Abscess | FAERS: 4 | US FAERS | |
| 299 | Sneezing | FAERS: 4 | US FAERS | |
| 300 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 301 | Thromboembolic stroke | FAERS: 4 | US FAERS | |
| 302 | Tinnitus | FAERS: 4 | US FAERS | |
| 303 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 304 | Vaginal pain | FAERS: 4 | US FAERS | |
| 305 | Vasculitis | FAERS: 4 | US FAERS | |
| 306 | jaundice | FAERS: 4 | US FAERS | |
| 307 | nervous system disorder | FAERS: 4 | US FAERS | |
| 308 | Abscess | FAERS: 3 | US FAERS | |
| 309 | Accidental exposure | FAERS: 3 | US FAERS | |
| 310 | Application site exfoliation | FAERS: 3 | US FAERS | |
| 311 | Application site inflammation | FAERS: 3 | US FAERS | |
| 312 | Application site scab | FAERS: 3 | US FAERS | |
| 313 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 314 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 315 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 316 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 317 | Caustic injury | FAERS: 3 | US FAERS | |
| 318 | Cerebellar infarction | FAERS: 3 | US FAERS | |
| 319 | Cerebral ventricle dilatation | FAERS: 3 | US FAERS | |
| 320 | Coagulation factor VIII level increased | FAERS: 3 | US FAERS | |
| 321 | Complex partial seizures | FAERS: 3 | US FAERS | |
| 322 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 323 | Conversion disorder | FAERS: 3 | US FAERS | |
| 324 | Cyanosis | FAERS: 3 | US FAERS | |
| 325 | Device Failure | FAERS: 3 | US FAERS | |
| 326 | Diplopia | FAERS: 3 | US FAERS | |
| 327 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 328 | Dysarthria | FAERS: 3 | US FAERS | |
| 329 | Electromechanical dissociation | FAERS: 3 | US FAERS | |
| 330 | Endometrial hypertrophy | FAERS: 3 | US FAERS | |
| 331 | Escherichia urinary tract infection | FAERS: 3 | US FAERS | |
| 332 | Feeling jittery | FAERS: 3 | US FAERS | |
| 333 | Flank Pain | FAERS: 3 | US FAERS | |
| 334 | Flushing | FAERS: 3 | US FAERS | |
| 335 | Focal Nodular Hyperplasia | FAERS: 3 | US FAERS | |
| 336 | Genital Herpes | FAERS: 3 | US FAERS | |
| 337 | Hemiplegia | FAERS: 3 | US FAERS | |
| 338 | Hypersomnia | FAERS: 3 | US FAERS | |
| 339 | Hysterectomy | FAERS: 3 | US FAERS | |
| 340 | Intentional misuse | FAERS: 3 | US FAERS | |
| 341 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 342 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 343 | Keratoconjunctivitis Sicca | FAERS: 3 | US FAERS | |
| 344 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 345 | Lung consolidation | FAERS: 3 | US FAERS | |
| 346 | Memory impairment | FAERS: 3 | US FAERS | |
| 347 | Mental status changes | FAERS: 3 | US FAERS | |
| 348 | Metaplasia | FAERS: 3 | US FAERS | |
| 349 | Migraine with Aura | FAERS: 3 | US FAERS | |
| 350 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 351 | Mydriasis | FAERS: 3 | US FAERS | |
| 352 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 353 | Pallor | FAERS: 3 | US FAERS | |
| 354 | Pneumothorax | FAERS: 3 | US FAERS | |
| 355 | Renal Colic | FAERS: 3 | US FAERS | |
| 356 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 357 | Rosacea | FAERS: 3 | US FAERS | |
| 358 | Shock | FAERS: 3 | US FAERS | |
| 359 | Splenic vein thrombosis | FAERS: 3 | US FAERS | |
| 360 | Strabismus | FAERS: 3 | US FAERS | |
| 361 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 362 | Thermal burn | FAERS: 3 | US FAERS | |
| 363 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 364 | Vaginal burning sensation | FAERS: 3 | US FAERS | |
| 365 | Vein pain | FAERS: 3 | US FAERS | |
| 366 | Vulvovaginal pruritus | FAERS: 3 | US FAERS | |
| 367 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 368 | ovarian neoplasm | FAERS: 3 | US FAERS | |
| 369 | Acute psychosis | FAERS: 2 | US FAERS | |
| 370 | Adnexa uteri mass | FAERS: 2 | US FAERS | |
| 371 | Amphetamines positive | FAERS: 2 | US FAERS | |
| 372 | Anger | FAERS: 2 | US FAERS | |
| 373 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 374 | Anti-SS-A antibody positive | FAERS: 2 | US FAERS | |
| 375 | Anti-thyroid antibody positive | FAERS: 2 | US FAERS | |
| 376 | Antiphospholipid Syndrome | FAERS: 2 | US FAERS | |
| 377 | Antithrombin III decreased | FAERS: 2 | US FAERS | |
| 378 | Aphagia | FAERS: 2 | US FAERS | |
| 379 | Application site papules | FAERS: 2 | US FAERS | |
| 380 | Application site ulcer | FAERS: 2 | US FAERS | |
| 381 | Application site warmth | FAERS: 2 | US FAERS | |
| 382 | Arthropathy | FAERS: 2 | US FAERS | |
| 383 | Arthropod bite | FAERS: 2 | US FAERS | |
| 384 | Autoimmune thrombocytopenia | FAERS: 2 | US FAERS | |
| 385 | Basilar artery thrombosis | FAERS: 2 | US FAERS | |
| 386 | Bladder pain | FAERS: 2 | US FAERS | |
| 387 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 388 | Blood catecholamines abnormal | FAERS: 2 | US FAERS | |
| 389 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 390 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 391 | Blood homocysteine decreased | FAERS: 2 | US FAERS | |
| 392 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 393 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 394 | Calcinosis | FAERS: 2 | US FAERS | |
| 395 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 396 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 397 | Cerebral Palsy | FAERS: 2 | US FAERS | |
| 398 | Cholestasis | FAERS: 2 | US FAERS | |
| 399 | Coagulation factor XII level increased | FAERS: 2 | US FAERS | |
| 400 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 401 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 402 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 403 | Drug toxicity | FAERS: 2 | US FAERS | |
| 404 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 405 | Ear discomfort | FAERS: 2 | US FAERS | |
| 406 | Ecchymosis | FAERS: 2 | US FAERS | |
| 407 | Economic problem | FAERS: 2 | US FAERS | |
| 408 | Eczema | FAERS: 2 | US FAERS | |
| 409 | Encephalomalacia | FAERS: 2 | US FAERS | |
| 410 | Endocarditis | FAERS: 2 | US FAERS | |
| 411 | Eructation | FAERS: 2 | US FAERS | |
| 412 | Excoriation | FAERS: 2 | US FAERS | |
| 413 | Eye inflammation | FAERS: 2 | US FAERS | |
| 414 | Facial Paresis | FAERS: 2 | US FAERS | |
| 415 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 416 | Fibroadenoma of breast | FAERS: 2 | US FAERS | |
| 417 | Fluid overload | FAERS: 2 | US FAERS | |
| 418 | Food Allergy | FAERS: 2 | US FAERS | |
| 419 | Formication | FAERS: 2 | US FAERS | |
| 420 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 421 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 422 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 423 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 424 | Hilar lymphadenopathy | FAERS: 2 | US FAERS | |
| 425 | Hoarseness | FAERS: 2 | US FAERS | |
| 426 | Hyperacusis | FAERS: 2 | US FAERS | |
| 427 | Hyperplastic cholecystopathy | FAERS: 2 | US FAERS | |
| 428 | Inadequate lubrication | FAERS: 2 | US FAERS | |
| 429 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 430 | Infarction | FAERS: 2 | US FAERS | |
| 431 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 432 | Joint injury | FAERS: 2 | US FAERS | |
| 433 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 434 | Leukocytosis | FAERS: 2 | US FAERS | |
| 435 | Limb discomfort | FAERS: 2 | US FAERS | |
| 436 | Limb injury | FAERS: 2 | US FAERS | |
| 437 | Lipase increased | FAERS: 2 | US FAERS | |
| 438 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 439 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 440 | Lymphangioleiomyomatosis | FAERS: 2 | US FAERS | |
| 441 | Neutrophil percentage decreased | FAERS: 2 | US FAERS | |
| 442 | No adverse effect | FAERS: 2 | US FAERS | |
| 443 | Nocturia | FAERS: 2 | US FAERS | |
| 444 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 445 | Nystagmus | FAERS: 2 | US FAERS | |
| 446 | Obesity surgery | FAERS: 2 | US FAERS | |
| 447 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 448 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 449 | Otitis Media | FAERS: 2 | US FAERS | |
| 450 | Ovarian enlargement | FAERS: 2 | US FAERS | |
| 451 | Pancreatic enzymes increased | FAERS: 2 | US FAERS | |
| 452 | Personality Change | FAERS: 2 | US FAERS | |
| 453 | Petechiae | FAERS: 2 | US FAERS | |
| 454 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 455 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 456 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 457 | Pregnancy with contraceptive device | FAERS: 2 | US FAERS | |
| 458 | Product counterfeit | FAERS: 2 | US FAERS | |
| 459 | Product formulation issue | FAERS: 2 | US FAERS | |
| 460 | Product label issue | FAERS: 2 | US FAERS | |
| 461 | Pseudomyxoma Peritonei | FAERS: 2 | US FAERS | |
| 462 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 463 | Schizophrenia | FAERS: 2 | US FAERS | |
| 464 | Scleroderma | FAERS: 2 | US FAERS | |
| 465 | Shoulder Pain | FAERS: 2 | US FAERS | |
| 466 | Simple Partial Seizures | FAERS: 2 | US FAERS | |
| 467 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 468 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 469 | Skin laceration | FAERS: 2 | US FAERS | |
| 470 | Somatoform Disorder | FAERS: 2 | US FAERS | |
| 471 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 472 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 473 | Sunburn | FAERS: 2 | US FAERS | |
| 474 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 475 | Sympathectomy | FAERS: 2 | US FAERS | |
| 476 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 477 | Throat irritation | FAERS: 2 | US FAERS | |
| 478 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 479 | Thrombotic stroke | FAERS: 2 | US FAERS | |
| 480 | Tooth Infection | FAERS: 2 | US FAERS | |
| 481 | Total cholesterol/HDL ratio decreased | FAERS: 2 | US FAERS | |
| 482 | Toxic Shock Syndrome | FAERS: 2 | US FAERS | |
| 483 | Tracheobronchitis | FAERS: 2 | US FAERS | |
| 484 | Unwanted pregnancy | FAERS: 2 | US FAERS | |
| 485 | Urethral cyst | FAERS: 2 | US FAERS | |
| 486 | Vaginal hysterectomy | FAERS: 2 | US FAERS | |
| 487 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 488 | Vascular rupture | FAERS: 2 | US FAERS | |
| 489 | Venous occlusion | FAERS: 2 | US FAERS | |
| 490 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 491 | Vitreous Detachment | FAERS: 2 | US FAERS | |
| 492 | Abdominal mass | FAERS: 1 | US FAERS | |
| 493 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 494 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 495 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 496 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 497 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 498 | Activated protein C resistance test positive | FAERS: 1 | US FAERS | |
| 499 | Administration site rash | FAERS: 1 | US FAERS | |
| 500 | Adrenal mass | FAERS: 1 | US FAERS | |
| 501 | Ageusia | FAERS: 1 | US FAERS | |
| 502 | Agonal death struggle | FAERS: 1 | US FAERS | |
| 503 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 504 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 505 | Anhedonia | FAERS: 1 | US FAERS | |
| 506 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 507 | Anorectal operation | FAERS: 1 | US FAERS | |
| 508 | Anosmia | FAERS: 1 | US FAERS | |
| 509 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 510 | Antithrombin III increased | FAERS: 1 | US FAERS | |
| 511 | Aphonia | FAERS: 1 | US FAERS | |
| 512 | Application site acne | FAERS: 1 | US FAERS | |
| 513 | Application site discharge | FAERS: 1 | US FAERS | |
| 514 | Application site excoriation | FAERS: 1 | US FAERS | |
| 515 | Application site laceration | FAERS: 1 | US FAERS | |
| 516 | Application site mass | FAERS: 1 | US FAERS | |
| 517 | Application site nodule | FAERS: 1 | US FAERS | |
| 518 | Application site pustules | FAERS: 1 | US FAERS | |
| 519 | Application site urticaria | FAERS: 1 | US FAERS | |
| 520 | Ascites | FAERS: 1 | US FAERS | |
| 521 | Asthenopia | FAERS: 1 | US FAERS | |
| 522 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 523 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 524 | Aura | FAERS: 1 | US FAERS | |
| 525 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 526 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 527 | Back disorder | FAERS: 1 | US FAERS | |
| 528 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 529 | Balanitis | FAERS: 1 | US FAERS | |
| 530 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 531 | Bedridden | FAERS: 1 | US FAERS | |
| 532 | Biliary Colic | FAERS: 1 | US FAERS | |
| 533 | Biliary Dyskinesia | FAERS: 1 | US FAERS | |
| 534 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 535 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 536 | Bladder spasm | FAERS: 1 | US FAERS | |
| 537 | Blood Pressure | FAERS: 1 | US FAERS | |
| 538 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 539 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 540 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 541 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 542 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 543 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 544 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 545 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 546 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 547 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 548 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 549 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 550 | Body fat disorder | FAERS: 1 | US FAERS | |
| 551 | Brachial plexus lesion | FAERS: 1 | US FAERS | |
| 552 | Breast fibroma | FAERS: 1 | US FAERS | |
| 553 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 554 | Bronchospasm | FAERS: 1 | US FAERS | |
| 555 | Bunion operation | FAERS: 1 | US FAERS | |
| 556 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 557 | Candidiasis | FAERS: 1 | US FAERS | |
| 558 | Carcinoma | FAERS: 1 | US FAERS | |
| 559 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 560 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 561 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 562 | Cavernous Sinus Thrombosis | FAERS: 1 | US FAERS | |
| 563 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 564 | Cervical polyp | FAERS: 1 | US FAERS | |
| 565 | Chest wall pain | FAERS: 1 | US FAERS | |
| 566 | Choking | FAERS: 1 | US FAERS | |
| 567 | Cholangitis | FAERS: 1 | US FAERS | |
| 568 | Cleft Palate | FAERS: 1 | US FAERS | |
| 569 | Coagulation factor IX level increased | FAERS: 1 | US FAERS | |
| 570 | Coagulation factor XIII level decreased | FAERS: 1 | US FAERS | |
| 571 | Coital bleeding | FAERS: 1 | US FAERS | |
| 572 | Colonic Stenosis | FAERS: 1 | US FAERS | |
| 573 | Completed Suicide | FAERS: 1 | US FAERS | |
| 574 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 575 | Contact lens complication | FAERS: 1 | US FAERS | |
| 576 | Cyst removal | FAERS: 1 | US FAERS | |
| 577 | Demyelination | FAERS: 1 | US FAERS | |
| 578 | Dengue Fever | FAERS: 1 | US FAERS | |
| 579 | Dental caries | FAERS: 1 | US FAERS | |
| 580 | Depression suicidal | FAERS: 1 | US FAERS | |
| 581 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 582 | Disease Progression | FAERS: 1 | US FAERS | |
| 583 | Disorientation | FAERS: 1 | US FAERS | |
| 584 | Drug Dependence | FAERS: 1 | US FAERS | |
| 585 | Drug screen positive | FAERS: 1 | US FAERS | |
| 586 | Dysphasia | FAERS: 1 | US FAERS | |
| 587 | Dysphonia | FAERS: 1 | US FAERS | |
| 588 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 589 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 590 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 591 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 592 | Emotional distress | FAERS: 1 | US FAERS | |
| 593 | Empyema | FAERS: 1 | US FAERS | |
| 594 | Epistaxis | FAERS: 1 | US FAERS | |
| 595 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 596 | Expired drug administered | FAERS: 1 | US FAERS | |
| 597 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 598 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 599 | Eye Redness | FAERS: 1 | US FAERS | |
| 600 | Facial Pain | FAERS: 1 | US FAERS | |
| 601 | Fallopian tube obstruction | FAERS: 1 | US FAERS | |
| 602 | Fasciitis | FAERS: 1 | US FAERS | |
| 603 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 604 | Fibromatosis | FAERS: 1 | US FAERS | |
| 605 | Flight of ideas | FAERS: 1 | US FAERS | |
| 606 | Food Poisoning | FAERS: 1 | US FAERS | |
| 607 | Gardnerella test positive | FAERS: 1 | US FAERS | |
| 608 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 609 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 610 | Genital discharge | FAERS: 1 | US FAERS | |
| 611 | Genital pain | FAERS: 1 | US FAERS | |
| 612 | Gliosis | FAERS: 1 | US FAERS | |
| 613 | Glossitis | FAERS: 1 | US FAERS | |
| 614 | Granuloma | FAERS: 1 | US FAERS | |
| 615 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 616 | Haematinuria | FAERS: 1 | US FAERS | |
| 617 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 618 | Heat Stroke | FAERS: 1 | US FAERS | |
| 619 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 620 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 621 | Hirsutism | FAERS: 1 | US FAERS | |
| 622 | Human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 623 | Hydropneumothorax | FAERS: 1 | US FAERS | |
| 624 | Hyperplasia | FAERS: 1 | US FAERS | |
| 625 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 626 | Hypokinesia | FAERS: 1 | US FAERS | |
| 627 | Hypospadias | FAERS: 1 | US FAERS | |
| 628 | Hypoventilation | FAERS: 1 | US FAERS | |
| 629 | Ileus | FAERS: 1 | US FAERS | |
| 630 | Immobile | FAERS: 1 | US FAERS | |
| 631 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 632 | Incision site infection | FAERS: 1 | US FAERS | |
| 633 | Incontinence | FAERS: 1 | US FAERS | |
| 634 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 635 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 636 | Infusion site pain | FAERS: 1 | US FAERS | |
| 637 | Initial insomnia | FAERS: 1 | US FAERS | |
| 638 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 639 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 640 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 641 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 642 | Iritis | FAERS: 1 | US FAERS | |
| 643 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 644 | Joint sprain | FAERS: 1 | US FAERS | |
| 645 | Keratitis | FAERS: 1 | US FAERS | |
| 646 | Laceration | FAERS: 1 | US FAERS | |
| 647 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 648 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 649 | Latex allergy | FAERS: 1 | US FAERS | |
| 650 | Laziness | FAERS: 1 | US FAERS | |
| 651 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 652 | Lentigo | FAERS: 1 | US FAERS | |
| 653 | Lip swelling | FAERS: 1 | US FAERS | |
| 654 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 655 | Localised skin reaction | FAERS: 1 | US FAERS | |
| 656 | Lung Abscess | FAERS: 1 | US FAERS | |
| 657 | Lung Injury | FAERS: 1 | US FAERS | |
| 658 | Lyme Disease | FAERS: 1 | US FAERS | |
| 659 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 660 | Mastitis | FAERS: 1 | US FAERS | |
| 661 | Medical device removal | FAERS: 1 | US FAERS | |
| 662 | Meningitis | FAERS: 1 | US FAERS | |
| 663 | Mental impairment | FAERS: 1 | US FAERS | |
| 664 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 665 | Miliaria | FAERS: 1 | US FAERS | |
| 666 | Monocytosis | FAERS: 1 | US FAERS | |
| 667 | Monoparesis | FAERS: 1 | US FAERS | |
| 668 | Motion Sickness | FAERS: 1 | US FAERS | |
| 669 | Multiple allergies | FAERS: 1 | US FAERS | |
| 670 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 671 | Murphy's sign positive | FAERS: 1 | US FAERS | |
| 672 | Myomectomy | FAERS: 1 | US FAERS | |
| 673 | Narcolepsy | FAERS: 1 | US FAERS | |
| 674 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 675 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 676 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 677 | No adverse reaction | FAERS: 1 | US FAERS | |
| 678 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 679 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 680 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 681 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 682 | Onychoclasis | FAERS: 1 | US FAERS | |
| 683 | Onychomycosis | FAERS: 1 | US FAERS | |
| 684 | Open wound | FAERS: 1 | US FAERS | |
| 685 | Oral pain | FAERS: 1 | US FAERS | |
| 686 | Orgasmic sensation decreased | FAERS: 1 | US FAERS | |
| 687 | Osteitis | FAERS: 1 | US FAERS | |
| 688 | Otitis Externa | FAERS: 1 | US FAERS | |
| 689 | Otosclerosis | FAERS: 1 | US FAERS | |
| 690 | Ovarian Hyperstimulation Syndrome | FAERS: 1 | US FAERS | |
| 691 | Ovarian vein thrombosis | FAERS: 1 | US FAERS | |
| 692 | Overdose | FAERS: 1 | US FAERS | |
| 693 | Ovulation disorder | FAERS: 1 | US FAERS | |
| 694 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 695 | Pain of skin | FAERS: 1 | US FAERS | |
| 696 | Panic Disorder | FAERS: 1 | US FAERS | |
| 697 | Paranoia | FAERS: 1 | US FAERS | |
| 698 | Parasitic gastroenteritis | FAERS: 1 | US FAERS | |
| 699 | Performance status decreased | FAERS: 1 | US FAERS | |
| 700 | Peripartum cardiomyopathy | FAERS: 1 | US FAERS | |
| 701 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 702 | Peritonsillar Abscess | FAERS: 1 | US FAERS | |
| 703 | Phantom pain | FAERS: 1 | US FAERS | |
| 704 | Phonophobia | FAERS: 1 | US FAERS | |
| 705 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 706 | Pneumocephalus | FAERS: 1 | US FAERS | |
| 707 | Pneumonitis | FAERS: 1 | US FAERS | |
| 708 | Poisoning | FAERS: 1 | US FAERS | |
| 709 | Polyarthritis | FAERS: 1 | US FAERS | |
| 710 | Polydactyly | FAERS: 1 | US FAERS | |
| 711 | Polydipsia | FAERS: 1 | US FAERS | |
| 712 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 713 | Polyuria | FAERS: 1 | US FAERS | |
| 714 | Post lumbar puncture syndrome | FAERS: 1 | US FAERS | |
| 715 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 716 | Pregnancy with injectable contraceptive | FAERS: 1 | US FAERS | |
| 717 | Premenstrual cramps | FAERS: 1 | US FAERS | |
| 718 | Procedural complication | FAERS: 1 | US FAERS | |
| 719 | Product complaint | FAERS: 1 | US FAERS | |
| 720 | Product label confusion | FAERS: 1 | US FAERS | |
| 721 | Product lot number issue | FAERS: 1 | US FAERS | |
| 722 | Product physical issue | FAERS: 1 | US FAERS | |
| 723 | Product size issue | FAERS: 1 | US FAERS | |
| 724 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 725 | Protein C increased | FAERS: 1 | US FAERS | |
| 726 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 727 | Protein total decreased | FAERS: 1 | US FAERS | |
| 728 | Protein total increased | FAERS: 1 | US FAERS | |
| 729 | Protein urine present | FAERS: 1 | US FAERS | |
| 730 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 731 | Psoriasis | FAERS: 1 | US FAERS | |
| 732 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 733 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 734 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 735 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 736 | Rectal polyp | FAERS: 1 | US FAERS | |
| 737 | Renal cyst | FAERS: 1 | US FAERS | |
| 738 | Respiratory fremitus | FAERS: 1 | US FAERS | |
| 739 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 740 | Restlessness | FAERS: 1 | US FAERS | |
| 741 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 742 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 743 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 744 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 745 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 746 | Salpingitis | FAERS: 1 | US FAERS | |
| 747 | Salpingo-oophorectomy | FAERS: 1 | US FAERS | |
| 748 | Scotoma | FAERS: 1 | US FAERS | |
| 749 | Septic Shock | FAERS: 1 | US FAERS | |
| 750 | Septoplasty | FAERS: 1 | US FAERS | |
| 751 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 752 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 753 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 754 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 755 | Skin Erosion | FAERS: 1 | US FAERS | |
| 756 | Skin discomfort | FAERS: 1 | US FAERS | |
| 757 | Sluggishness | FAERS: 1 | US FAERS | |
| 758 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 759 | Stillbirth | FAERS: 1 | US FAERS | |
| 760 | Subclavian artery thrombosis | FAERS: 1 | US FAERS | |
| 761 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 762 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 763 | Superovulation | FAERS: 1 | US FAERS | |
| 764 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 765 | Tension Headache | FAERS: 1 | US FAERS | |
| 766 | Teratoma | FAERS: 1 | US FAERS | |
| 767 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 768 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 769 | Thirst | FAERS: 1 | US FAERS | |
| 770 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 771 | Tongue biting | FAERS: 1 | US FAERS | |
| 772 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 773 | Toothache | FAERS: 1 | US FAERS | |
| 774 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 775 | Transdermal contraception | FAERS: 1 | US FAERS | |
| 776 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 777 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 778 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 779 | Tuberculosis | FAERS: 1 | US FAERS | |
| 780 | Ubiquinone decreased | FAERS: 1 | US FAERS | |
| 781 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 782 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 783 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 784 | Uveitis | FAERS: 1 | US FAERS | |
| 785 | Vaginal Prolapse | FAERS: 1 | US FAERS | |
| 786 | Vascular compression | FAERS: 1 | US FAERS | |
| 787 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 788 | Venous angioma of brain | FAERS: 1 | US FAERS | |
| 789 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 790 | Vitiligo | FAERS: 1 | US FAERS | |
| 791 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 792 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 793 | Walking aid user | FAERS: 1 | US FAERS | |
| 794 | Withdrawal bleeding irregular | FAERS: 1 | US FAERS | |
| 795 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 796 | Wound Infection | FAERS: 1 | US FAERS | |
| 797 | Dysmenorrhea | 20931801 | CTD | |
| 798 | Venous Thromboembolism | 17586129 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.