ziprasidone
(MVWVFYHBGMAFLY-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1Nc2c(C1)cc(c(c2)Cl)CCN1CCN(CC1)c1nsc2c1cccc2
- Type(s)
- Approved
- ATC code(s)
- N05AE04
- Molecular Formula:
- C21H21ClN4OS
- Molecular Weight:
- 412.936
- Log P:
- 3.9499
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 76.71
- CAS Number(s):
- 146939-27-7
Synonym(s)
1.
ziprasidone
2.
5-(2-(4-(3-benzisothiazolyl)piperazinyl)ethyl)-6-chloro-1,3-dihydro-2H-indol-2-one
3.
CP 88059
4.
CP 88059-01
5.
CP-88,059
6.
CP-88,059-01
7.
CP-88,059-1
8.
Geodon
9.
ziprasidone hydrochloride
10.
ziprasidone hydrochloride, monohydrate
11.
ziprazidone
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Tardive Dyskinesia | FAERS: 268 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 2 | Dystonia | FAERS: 168 Canada Vigilance: 4 | 17484950 18433661 18597910 | CTD OFFSIDES Canada Vigilance US FAERS |
| 3 | Somnolence | FAERS: 164 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 4 | Drug ineffective | FAERS: 157 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Tremor | FAERS: 157 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Feeling abnormal | FAERS: 126 | OFFSIDES SIDER US FAERS | |
| 7 | Anxiety | FAERS: 121 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Dizziness | FAERS: 108 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 9 | Malaise | FAERS: 108 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 10 | Agitation | FAERS: 94 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 11 | Fatigue | FAERS: 92 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Nausea | FAERS: 89 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 13 | Headache | FAERS: 82 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Akathisia | FAERS: 79 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 15 | Neuroleptic Malignant Syndrome | FAERS: 78 | 16352776 16669738 17366349 | CTD OFFSIDES SIDER US FAERS |
| 16 | Vomiting | FAERS: 70 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 17 | Weight decreased | FAERS: 62 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 18 | Musculoskeletal stiffness | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Hypersensitivity | FAERS: 52 | SIDER US FAERS | |
| 20 | Palpitations | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 21 | Drug withdrawal syndrome | FAERS: 48 | US FAERS | |
| 22 | Pain | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Drug Dependence | FAERS: 47 | SIDER US FAERS | |
| 24 | Paranoia | FAERS: 47 | OFFSIDES US FAERS | |
| 25 | Suicide attempt | FAERS: 47 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 26 | Myocardial Infarction | FAERS: 44 | US FAERS | |
| 27 | Chest Pain | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 28 | Memory impairment | FAERS: 43 | US FAERS | |
| 29 | Activities of daily living impaired | FAERS: 42 | OFFSIDES US FAERS | |
| 30 | Restlessness | FAERS: 42 | US FAERS | |
| 31 | Nervousness | FAERS: 39 | US FAERS | |
| 32 | Visual Impairment | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Overdose | FAERS: 38 | OFFSIDES US FAERS | |
| 34 | Syncope | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Asthenia | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 36 | Bipolar Disorder | FAERS: 35 | CTD OFFSIDES US FAERS | |
| 37 | Alopecia | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Completed Suicide | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Diabetes Mellitus | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Incorrect dose administered | FAERS: 31 | US FAERS | |
| 41 | Blood creatine phosphokinase increased | FAERS: 29 | OFFSIDES SIDER US FAERS | |
| 42 | Cardiac Arrest | FAERS: 29 | US FAERS | |
| 43 | Priapism | FAERS: 27 | SIDER US FAERS | |
| 44 | Dysarthria | FAERS: 26 | SIDER US FAERS | |
| 45 | Muscle Rigidity | FAERS: 26 | 16352776 | CTD SIDER US FAERS |
| 46 | Pruritus | FAERS: 26 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 47 | Unevaluable event | FAERS: 25 | OFFSIDES US FAERS | |
| 48 | Blood glucose increased | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Incorrect route of drug administration | FAERS: 24 | OFFSIDES US FAERS | |
| 50 | Lethargy | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 51 | Tachycardia | FAERS: 24 | SIDER US FAERS | |
| 52 | Blood prolactin increased | FAERS: 23 | OFFSIDES SIDER US FAERS | |
| 53 | Bruxism | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 54 | Crying | FAERS: 23 | US FAERS | |
| 55 | Restless Legs Syndrome | FAERS: 23 | SIDER US FAERS | |
| 56 | Trismus | FAERS: 23 | SIDER US FAERS | |
| 57 | Hypersomnia | FAERS: 22 | SIDER US FAERS | |
| 58 | Muscle tightness | FAERS: 22 | US FAERS | |
| 59 | Sudden death | FAERS: 22 | US FAERS | |
| 60 | Cerebrovascular accident | FAERS: 21 | SIDER US FAERS | |
| 61 | Medication Error | FAERS: 21 | US FAERS | |
| 62 | Myalgia | FAERS: 21 | SIDER US FAERS | |
| 63 | Anger | FAERS: 20 | OFFSIDES US FAERS | |
| 64 | Hypotension | FAERS: 20 | 16352776 | CTD SIDER US FAERS |
| 65 | Obsessive-Compulsive Disorder | FAERS: 20 Canada Vigilance: 1 | 19644229 | CTD Canada Vigilance US FAERS |
| 66 | Chills | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 67 | Erectile dysfunction | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 68 | Product substitution issue | FAERS: 19 | US FAERS | |
| 69 | Schizophrenia | FAERS: 19 Canada Vigilance: 1 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 70 | Bradycardia | FAERS: 18 | 20215494 | CTD SIDER US FAERS |
| 71 | Impaired work ability | FAERS: 18 | US FAERS | |
| 72 | Urinary Retention | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 73 | Constipation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Dehydration | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 75 | Depressed Level of Consciousness | FAERS: 17 | US FAERS | |
| 76 | Disorientation | FAERS: 17 | US FAERS | |
| 77 | Drug exposure during pregnancy | FAERS: 17 | US FAERS | |
| 78 | Product quality issue | FAERS: 17 | US FAERS | |
| 79 | Product use issue | FAERS: 17 | US FAERS | |
| 80 | Amnesia | FAERS: 16 | SIDER US FAERS | |
| 81 | Arthralgia | FAERS: 16 | SIDER US FAERS | |
| 82 | Stress | FAERS: 16 | OFFSIDES US FAERS | |
| 83 | Urticaria | FAERS: 16 Canada Vigilance: 1 | 17446198 | CTD SIDER Canada Vigilance US FAERS |
| 84 | Abdominal discomfort | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 85 | Burning sensation | FAERS: 14 | US FAERS | |
| 86 | Depressed mood | FAERS: 14 | US FAERS | |
| 87 | Drooling | FAERS: 14 | SIDER US FAERS | |
| 88 | Electrocardiogram abnormal | FAERS: 14 | US FAERS | |
| 89 | Chest discomfort | FAERS: 13 | US FAERS | |
| 90 | Discomfort | FAERS: 13 | US FAERS | |
| 91 | Intentional drug misuse | FAERS: 13 | US FAERS | |
| 92 | Mood swings | FAERS: 13 | US FAERS | |
| 93 | No adverse event | FAERS: 13 | US FAERS | |
| 94 | Pancreatitis | FAERS: 13 | OFFSIDES US FAERS | |
| 95 | Somnambulism | FAERS: 13 | SIDER US FAERS | |
| 96 | Swelling | FAERS: 13 | US FAERS | |
| 97 | Therapeutic response unexpected | FAERS: 13 | US FAERS | |
| 98 | nervous system disorder | FAERS: 13 | SIDER US FAERS | |
| 99 | Drug dose omission | FAERS: 12 | US FAERS | |
| 100 | Dyspepsia | FAERS: 12 | SIDER US FAERS | |
| 101 | Oculogyration | FAERS: 12 | US FAERS | |
| 102 | Thirst | FAERS: 12 | SIDER US FAERS | |
| 103 | Unresponsive to stimuli | FAERS: 12 | US FAERS | |
| 104 | Abasia | FAERS: 11 | OFFSIDES US FAERS | |
| 105 | Catatonia | FAERS: 11 | OFFSIDES US FAERS | |
| 106 | Dysuria | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 107 | Formication | FAERS: 11 | US FAERS | |
| 108 | Hostility | FAERS: 11 | SIDER US FAERS | |
| 109 | Nasopharyngitis | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 110 | Psychiatric symptom | FAERS: 11 | US FAERS | |
| 111 | Respiratory arrest | FAERS: 11 | US FAERS | |
| 112 | Sexual Dysfunction | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Abdominal Pain | FAERS: 10 | SIDER US FAERS | |
| 114 | Bedridden | FAERS: 10 | US FAERS | |
| 115 | Blood potassium decreased | FAERS: 10 | US FAERS | |
| 116 | Delirium | FAERS: 10 | SIDER US FAERS | |
| 117 | Dementia | FAERS: 10 | US FAERS | |
| 118 | Emotional disorder | FAERS: 10 | OFFSIDES US FAERS | |
| 119 | General physical health deterioration | FAERS: 10 | US FAERS | |
| 120 | Joint stiffness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 121 | Mental impairment | FAERS: 10 | OFFSIDES US FAERS | |
| 122 | Mental status changes | FAERS: 10 | US FAERS | |
| 123 | Oculogyric crisis | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 124 | Respiratory Failure | FAERS: 10 | US FAERS | |
| 125 | Aphasia | FAERS: 9 | US FAERS | |
| 126 | Atrial Fibrillation | FAERS: 9 | SIDER US FAERS | |
| 127 | Blepharospasm | FAERS: 9 | OFFSIDES US FAERS | |
| 128 | Bone pain | FAERS: 9 | US FAERS | |
| 129 | Intentional product misuse | FAERS: 9 | US FAERS | |
| 130 | Obesity | FAERS: 9 | US FAERS | |
| 131 | Personality Change | FAERS: 9 | US FAERS | |
| 132 | Tachyphrenia | FAERS: 9 | OFFSIDES US FAERS | |
| 133 | Urinary Incontinence | FAERS: 9 | SIDER US FAERS | |
| 134 | Blindness | FAERS: 8 | US FAERS | |
| 135 | Blood triglycerides increased | FAERS: 8 | OFFSIDES US FAERS | |
| 136 | Circumstance or information capable of leading to medication error | FAERS: 8 | US FAERS | |
| 137 | Drug administration error | FAERS: 8 | US FAERS | |
| 138 | Drug ineffective for unapproved indication | FAERS: 8 | US FAERS | |
| 139 | Impaired driving ability | FAERS: 8 | OFFSIDES US FAERS | |
| 140 | Mydriasis | FAERS: 8 | US FAERS | |
| 141 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 142 | Pneumonia | FAERS: 8 | SIDER US FAERS | |
| 143 | Polydipsia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 144 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 145 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 146 | Anaphylactic shock | FAERS: 7 | US FAERS | |
| 147 | Blood cholesterol increased | FAERS: 7 | US FAERS | |
| 148 | Cogwheel Rigidity | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 149 | Disease recurrence | FAERS: 7 | US FAERS | |
| 150 | Dysgeusia | FAERS: 7 | OFFSIDES US FAERS | |
| 151 | Eye pain | FAERS: 7 | US FAERS | |
| 152 | Gastric Bypass | FAERS: 7 | US FAERS | |
| 153 | Gastritis | FAERS: 7 | SIDER US FAERS | |
| 154 | Glaucoma | FAERS: 7 | US FAERS | |
| 155 | Inappropriate schedule of drug administration | FAERS: 7 | US FAERS | |
| 156 | Infection | FAERS: 7 | SIDER US FAERS | |
| 157 | Oropharyngeal pain | FAERS: 7 | SIDER US FAERS | |
| 158 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 159 | Tinnitus | FAERS: 7 | SIDER US FAERS | |
| 160 | Torticollis | FAERS: 7 | 15349021 21152153 | CTD SIDER US FAERS |
| 161 | Vertigo | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 162 | Acne | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 163 | Activation syndrome | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 165 | Angina Pectoris | FAERS: 6 | SIDER US FAERS | |
| 166 | Anorexia | FAERS: 6 | SIDER US FAERS | |
| 167 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 168 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 169 | Cardiomegaly | FAERS: 6 | SIDER US FAERS | |
| 170 | Dependence | FAERS: 6 | SIDER US FAERS | |
| 171 | Drug screen false positive | FAERS: 6 | US FAERS | |
| 172 | Dysphonia | FAERS: 6 | 18305296 | CTD US FAERS |
| 173 | Enuresis | FAERS: 6 | SIDER US FAERS | |
| 174 | Homicide | FAERS: 6 | US FAERS | |
| 175 | Hunger | FAERS: 6 | US FAERS | |
| 176 | Influenza | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 177 | Intentional self-injury | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 178 | Neck Pain | FAERS: 6 | US FAERS | |
| 179 | Nerve injury | FAERS: 6 | US FAERS | |
| 180 | Obesity surgery | FAERS: 6 | US FAERS | |
| 181 | Physical assault | FAERS: 6 | US FAERS | |
| 182 | Pre-existing condition improved | FAERS: 6 | US FAERS | |
| 183 | Presyncope | FAERS: 6 | US FAERS | |
| 184 | Pulmonary Embolism | FAERS: 6 | SIDER US FAERS | |
| 185 | Respiratory distress | FAERS: 6 | US FAERS | |
| 186 | Sinus bradycardia | FAERS: 6 | US FAERS | |
| 187 | Toothache | FAERS: 6 | US FAERS | |
| 188 | Toxic Shock Syndrome | FAERS: 6 | US FAERS | |
| 189 | Ventricular Fibrillation | FAERS: 6 | US FAERS | |
| 190 | Arthropathy | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 191 | Atrioventricular Block | FAERS: 5 | SIDER US FAERS | |
| 192 | Back Pain | FAERS: 5 | SIDER US FAERS | |
| 193 | Cerebral disorder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Cold sweat | FAERS: 5 | US FAERS | |
| 195 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 196 | Economic problem | FAERS: 5 | OFFSIDES US FAERS | |
| 197 | Feeling jittery | FAERS: 5 | US FAERS | |
| 198 | Flushing | FAERS: 5 | US FAERS | |
| 199 | Infertility | FAERS: 5 | US FAERS | |
| 200 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 201 | Malnutrition | FAERS: 5 | SIDER US FAERS | |
| 202 | Mastication disorder | FAERS: 5 | US FAERS | |
| 203 | Mutism | FAERS: 5 | US FAERS | |
| 204 | Narcolepsy | FAERS: 5 | US FAERS | |
| 205 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 206 | Schizoaffective Disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 207 | Thrombosis | FAERS: 5 | US FAERS | |
| 208 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 209 | Angioedema | FAERS: 4 Canada Vigilance: 1 | 17446198 19653983 | CTD SIDER Canada Vigilance US FAERS |
| 210 | Apathy | FAERS: 4 | OFFSIDES US FAERS | |
| 211 | Aphagia | FAERS: 4 | OFFSIDES US FAERS | |
| 212 | Bipolar I disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 213 | Blood creatinine increased | FAERS: 4 | SIDER US FAERS | |
| 214 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 215 | Blood urea increased | FAERS: 4 | SIDER US FAERS | |
| 216 | Bronchospasm | FAERS: 4 | US FAERS | |
| 217 | Diplopia | FAERS: 4 | SIDER US FAERS | |
| 218 | Disability | FAERS: 4 | US FAERS | |
| 219 | Dissociation | FAERS: 4 | US FAERS | |
| 220 | Dysgraphia | FAERS: 4 | US FAERS | |
| 221 | Emotional distress | FAERS: 4 | OFFSIDES US FAERS | |
| 222 | Erythema | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 223 | Excessive eye blinking | FAERS: 4 | US FAERS | |
| 224 | Fibromyalgia | FAERS: 4 | OFFSIDES US FAERS | |
| 225 | Food Allergy | FAERS: 4 | US FAERS | |
| 226 | Hypomania | FAERS: 4 | SIDER US FAERS | |
| 227 | Immobile | FAERS: 4 | US FAERS | |
| 228 | Incontinence | FAERS: 4 | OFFSIDES US FAERS | |
| 229 | Initial insomnia | FAERS: 4 | US FAERS | |
| 230 | Joint injury | FAERS: 4 | US FAERS | |
| 231 | Kounis Syndrome | FAERS: 4 | US FAERS | |
| 232 | Lactation Disorder | FAERS: 4 | OFFSIDES US FAERS | |
| 233 | Leukopenia | FAERS: 4 | SIDER US FAERS | |
| 234 | Lip swelling | FAERS: 4 | US FAERS | |
| 235 | Long QT Syndrome | FAERS: 4 | CTD US FAERS | |
| 236 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 237 | Obsessive thoughts | FAERS: 4 | US FAERS | |
| 238 | Photophobia | FAERS: 4 | SIDER US FAERS | |
| 239 | Poisoning | FAERS: 4 | US FAERS | |
| 240 | Polyuria | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 241 | Post procedural complication | FAERS: 4 | US FAERS | |
| 242 | Rhabdomyolysis | FAERS: 4 | SIDER US FAERS | |
| 243 | Screaming | FAERS: 4 | US FAERS | |
| 244 | Septic Shock | FAERS: 4 | US FAERS | |
| 245 | Shock | FAERS: 4 | SIDER US FAERS | |
| 246 | Skin laceration | FAERS: 4 | US FAERS | |
| 247 | Sluggishness | FAERS: 4 | SIDER US FAERS | |
| 248 | Tension | FAERS: 4 | US FAERS | |
| 249 | Wolff-Parkinson-White Syndrome | FAERS: 4 | US FAERS | |
| 250 | Accidental overdose | FAERS: 3 | US FAERS | |
| 251 | Anhedonia | FAERS: 3 | OFFSIDES US FAERS | |
| 252 | Anorgasmia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 253 | Apparent death | FAERS: 3 | OFFSIDES US FAERS | |
| 254 | Arthritis | FAERS: 3 | US FAERS | |
| 255 | Asthma | FAERS: 3 | OFFSIDES US FAERS | |
| 256 | Ataxia | FAERS: 3 | SIDER US FAERS | |
| 257 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 258 | Blood glucose decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 259 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 260 | Bronchitis | FAERS: 3 | OFFSIDES US FAERS | |
| 261 | Burning Mouth Syndrome | FAERS: 3 | US FAERS | |
| 262 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 263 | Cataplexy | FAERS: 3 | US FAERS | |
| 264 | Cataract | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 265 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 266 | Dental caries | FAERS: 3 | US FAERS | |
| 267 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 268 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 269 | Drug dispensing error | FAERS: 3 | OFFSIDES US FAERS | |
| 270 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 271 | Drug resistance | FAERS: 3 | US FAERS | |
| 272 | Drug toxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 273 | Dry skin | FAERS: 3 | US FAERS | |
| 274 | Electrocardiogram QT interval abnormal | FAERS: 3 | US FAERS | |
| 275 | Electrocardiogram change | FAERS: 3 | US FAERS | |
| 276 | Elevated mood | FAERS: 3 | US FAERS | |
| 277 | Epilepsy | FAERS: 3 | US FAERS | |
| 278 | Erection increased | FAERS: 3 | SIDER US FAERS | |
| 279 | Euphoric mood | FAERS: 3 | US FAERS | |
| 280 | Flat affect | FAERS: 3 | SIDER US FAERS | |
| 281 | General symptom | FAERS: 3 | US FAERS | |
| 282 | Hepatic cancer metastatic | FAERS: 3 | OFFSIDES US FAERS | |
| 283 | Hyperphagia | FAERS: 3 | SIDER US FAERS | |
| 284 | Hyperventilation | FAERS: 3 | US FAERS | |
| 285 | Hypoventilation | FAERS: 3 | US FAERS | |
| 286 | Infarction | FAERS: 3 | US FAERS | |
| 287 | Inflammation | FAERS: 3 | US FAERS | |
| 288 | Lipase increased | FAERS: 3 | US FAERS | |
| 289 | Macular degeneration | FAERS: 3 | US FAERS | |
| 290 | Malabsorption | FAERS: 3 | US FAERS | |
| 291 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 292 | Middle insomnia | FAERS: 3 | US FAERS | |
| 293 | Monoplegia | FAERS: 3 | US FAERS | |
| 294 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 295 | Musculoskeletal Pain | FAERS: 3 | OFFSIDES US FAERS | |
| 296 | No adverse effect | FAERS: 3 | US FAERS | |
| 297 | Oromandibular dystonia | FAERS: 3 | US FAERS | |
| 298 | Pallor | FAERS: 3 | US FAERS | |
| 299 | Panic Disorder | FAERS: 3 | US FAERS | |
| 300 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 301 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 302 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 303 | Renal pain | FAERS: 3 | US FAERS | |
| 304 | Saliva altered | FAERS: 3 | US FAERS | |
| 305 | Semen volume decreased | FAERS: 3 | US FAERS | |
| 306 | Sneezing | FAERS: 3 | US FAERS | |
| 307 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 308 | Tobacco user | FAERS: 3 | US FAERS | |
| 309 | Violence-related symptom | FAERS: 3 | OFFSIDES US FAERS | |
| 310 | Visual disturbance | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 311 | Wheezing | FAERS: 3 | US FAERS | |
| 312 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 313 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 314 | Accidental exposure | FAERS: 2 | US FAERS | |
| 315 | Akinesia | FAERS: 2 | SIDER US FAERS | |
| 316 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 317 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 318 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 319 | Ascites | FAERS: 2 | US FAERS | |
| 320 | Asthenopia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 321 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 322 | Blood lactate dehydrogenase increased | FAERS: 2 | SIDER US FAERS | |
| 323 | Blood magnesium decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 324 | Blood testosterone abnormal | FAERS: 2 | US FAERS | |
| 325 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 326 | Bone density decreased | FAERS: 2 | US FAERS | |
| 327 | Carbon Monoxide Poisoning | FAERS: 2 | US FAERS | |
| 328 | Chorea | FAERS: 2 | US FAERS | |
| 329 | Deformity | FAERS: 2 | US FAERS | |
| 330 | Delusional disorder, unspecified type | FAERS: 2 | US FAERS | |
| 331 | Diplegia | FAERS: 2 | US FAERS | |
| 332 | Disturbance in sexual arousal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 333 | Diverticulitis | FAERS: 2 | US FAERS | |
| 334 | Drug level decreased | FAERS: 2 | US FAERS | |
| 335 | Dysphemia | FAERS: 2 | US FAERS | |
| 336 | Dysplasia | FAERS: 2 | US FAERS | |
| 337 | Educational problem | FAERS: 2 | US FAERS | |
| 338 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 339 | Excessive masturbation | FAERS: 2 | US FAERS | |
| 340 | Expired drug administered | FAERS: 2 | US FAERS | |
| 341 | Eye irritation | FAERS: 2 | US FAERS | |
| 342 | Feeling Cold | FAERS: 2 | US FAERS | |
| 343 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 344 | Flight of ideas | FAERS: 2 | US FAERS | |
| 345 | Gamma-Glutamyltransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 346 | Gaze palsy | FAERS: 2 | OFFSIDES US FAERS | |
| 347 | Gingivitis | FAERS: 2 | US FAERS | |
| 348 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 349 | Head Banging | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Head discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 351 | Head titubation | FAERS: 2 | US FAERS | |
| 352 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 353 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 354 | Hyperacusis | FAERS: 2 | US FAERS | |
| 355 | Hypophagia | FAERS: 2 | US FAERS | |
| 356 | Hypothyroidism | FAERS: 2 | SIDER US FAERS | |
| 357 | Hypoxia | FAERS: 2 | US FAERS | |
| 358 | Ileus | FAERS: 2 | US FAERS | |
| 359 | Impaired self-care | FAERS: 2 | US FAERS | |
| 360 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 361 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 362 | Ketoacidosis | FAERS: 2 | US FAERS | |
| 363 | Laryngospasm | FAERS: 2 | SIDER US FAERS | |
| 364 | Limb discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 365 | Lymphadenopathy | FAERS: 2 | SIDER US FAERS | |
| 366 | Markedly reduced dietary intake | FAERS: 2 | US FAERS | |
| 367 | Mental Retardation | FAERS: 2 | US FAERS | |
| 368 | Mental disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 369 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 370 | Morbid thoughts | FAERS: 2 | US FAERS | |
| 371 | Motion Sickness | FAERS: 2 | US FAERS | |
| 372 | Musculoskeletal discomfort | FAERS: 2 | SIDER US FAERS | |
| 373 | Myoclonus | FAERS: 2 | SIDER US FAERS | |
| 374 | Nephrogenic Diabetes Insipidus | FAERS: 2 | US FAERS | |
| 375 | Neuralgia | FAERS: 2 | US FAERS | |
| 376 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 377 | Night sweats | FAERS: 2 | US FAERS | |
| 378 | Orchitis | FAERS: 2 | US FAERS | |
| 379 | Oropharyngeal spasm | FAERS: 2 | US FAERS | |
| 380 | Osteoporosis | FAERS: 2 | US FAERS | |
| 381 | Pain of skin | FAERS: 2 | US FAERS | |
| 382 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 383 | Parkinsonian rest tremor | FAERS: 2 | US FAERS | |
| 384 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 385 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 386 | Physical disability | FAERS: 2 | US FAERS | |
| 387 | Pierre Robin Syndrome | FAERS: 2 | US FAERS | |
| 388 | Polyarthritis | FAERS: 2 | US FAERS | |
| 389 | Poor personal hygiene | FAERS: 2 | US FAERS | |
| 390 | Poor quality drug administered | FAERS: 2 | OFFSIDES US FAERS | |
| 391 | Post procedural fistula | FAERS: 2 | US FAERS | |
| 392 | Product use complaint | FAERS: 2 | US FAERS | |
| 393 | Protein total decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 394 | Psychiatric decompensation | FAERS: 2 | US FAERS | |
| 395 | Pulmonary thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 396 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 397 | Rash erythematous | FAERS: 2 | US FAERS | |
| 398 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 399 | Respiratory muscle weakness | FAERS: 2 | US FAERS | |
| 400 | Retching | FAERS: 2 | US FAERS | |
| 401 | Sciatica | FAERS: 2 | US FAERS | |
| 402 | Self Mutilation | FAERS: 2 | US FAERS | |
| 403 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 404 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 405 | Sleep-related eating disorder | FAERS: 2 | US FAERS | |
| 406 | Snoring | FAERS: 2 | OFFSIDES US FAERS | |
| 407 | Spontaneous penile erection | FAERS: 2 | US FAERS | |
| 408 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 409 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 410 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 411 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 412 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 413 | Thermal burn | FAERS: 2 | US FAERS | |
| 414 | Throat irritation | FAERS: 2 | US FAERS | |
| 415 | Thrombophlebitis | FAERS: 2 | SIDER US FAERS | |
| 416 | Tooth Infection | FAERS: 2 | US FAERS | |
| 417 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 418 | Type III immune complex mediated reaction | FAERS: 2 | US FAERS | |
| 419 | Underweight | FAERS: 2 | SIDER US FAERS | |
| 420 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 421 | Urine ketone body present | FAERS: 2 | US FAERS | |
| 422 | VIIth nerve paralysis | FAERS: 2 | SIDER US FAERS | |
| 423 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 424 | Waxy flexibility | FAERS: 2 | US FAERS | |
| 425 | Yawning | FAERS: 2 | US FAERS | |
| 426 | intensive care | FAERS: 2 | US FAERS | |
| 427 | Abnormal palmar/plantar creases | FAERS: 1 | US FAERS | |
| 428 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 429 | Accidental death | FAERS: 1 | US FAERS | |
| 430 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 431 | Accidental needle stick | FAERS: 1 | US FAERS | |
| 432 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 433 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 434 | Acute psychosis | FAERS: 1 | US FAERS | |
| 435 | Adverse event | FAERS: 1 | OFFSIDES US FAERS | |
| 436 | Ageusia | FAERS: 1 | OFFSIDES US FAERS | |
| 437 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 438 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 439 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 440 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 441 | Alopecia effluvium | FAERS: 1 | US FAERS | |
| 442 | Ammonia increased | FAERS: 1 | OFFSIDES US FAERS | |
| 443 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 444 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 445 | Animal bite | FAERS: 1 | US FAERS | |
| 446 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 447 | Antibody test positive | FAERS: 1 | US FAERS | |
| 448 | Anuria | FAERS: 1 | US FAERS | |
| 449 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 450 | Asphyxia | FAERS: 1 | US FAERS | |
| 451 | Bariatric gastric balloon insertion | FAERS: 1 | US FAERS | |
| 452 | Belligerence | FAERS: 1 | US FAERS | |
| 453 | Bipolar II disorder | FAERS: 1 | US FAERS | |
| 454 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 455 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 456 | Blood alcohol | FAERS: 1 | US FAERS | |
| 457 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 458 | Blood amylase decreased | FAERS: 1 | US FAERS | |
| 459 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 460 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 461 | Blood calcitonin increased | FAERS: 1 | US FAERS | |
| 462 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 463 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 464 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 465 | Blood creatine phosphokinase MB abnormal | FAERS: 1 | US FAERS | |
| 466 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 467 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 468 | Blood human chorionic gonadotropin increased | FAERS: 1 | US FAERS | |
| 469 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 470 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 471 | Blood urine present | FAERS: 1 | US FAERS | |
| 472 | Blunted affect | FAERS: 1 | US FAERS | |
| 473 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 474 | Borderline Personality Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 475 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 476 | Bradyphrenia | FAERS: 1 | SIDER US FAERS | |
| 477 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 478 | Breast engorgement | FAERS: 1 | US FAERS | |
| 479 | Breast tenderness | FAERS: 1 | US FAERS | |
| 480 | Cachexia | FAERS: 1 | US FAERS | |
| 481 | Cardiac function disturbance postoperative | FAERS: 1 | US FAERS | |
| 482 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 483 | Cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 484 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 485 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 486 | Cheilitis | FAERS: 1 | US FAERS | |
| 487 | Choking sensation | FAERS: 1 | US FAERS | |
| 488 | Choking | FAERS: 1 | OFFSIDES US FAERS | |
| 489 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 490 | Choreoathetosis | FAERS: 1 | SIDER US FAERS | |
| 491 | Chromatopsia | FAERS: 1 | OFFSIDES US FAERS | |
| 492 | Chromaturia | FAERS: 1 | US FAERS | |
| 493 | Colitis | FAERS: 1 | US FAERS | |
| 494 | Compression fracture | FAERS: 1 | US FAERS | |
| 495 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 496 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 497 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 498 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 499 | Corneal erosion | FAERS: 1 | US FAERS | |
| 500 | Corneal lesion | FAERS: 1 | US FAERS | |
| 501 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 502 | Creatinine urine abnormal | FAERS: 1 | US FAERS | |
| 503 | Cyanosis | FAERS: 1 | US FAERS | |
| 504 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 505 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 506 | Delayed Puberty | FAERS: 1 | US FAERS | |
| 507 | Delayed menarche | FAERS: 1 | US FAERS | |
| 508 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 509 | Delusional perception | FAERS: 1 | US FAERS | |
| 510 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 511 | Diabetes mellitus inadequate control | FAERS: 1 | OFFSIDES US FAERS | |
| 512 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 513 | Dissociative Identity Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 514 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 515 | Drug abuser | FAERS: 1 | US FAERS | |
| 516 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 517 | Drug screen positive | FAERS: 1 | US FAERS | |
| 518 | Dysphasia | FAERS: 1 | US FAERS | |
| 519 | Echolalia | FAERS: 1 | US FAERS | |
| 520 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 521 | Electrocardiogram QT corrected interval | FAERS: 1 | US FAERS | |
| 522 | Electrocardiogram QT corrected interval shortened | FAERS: 1 | US FAERS | |
| 523 | Emotional poverty | FAERS: 1 | US FAERS | |
| 524 | Epistaxis | FAERS: 1 | SIDER US FAERS | |
| 525 | Essential Tremor | FAERS: 1 | US FAERS | |
| 526 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 527 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 528 | Eyeball avulsion | FAERS: 1 | US FAERS | |
| 529 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 530 | Facial Pain | FAERS: 1 | US FAERS | |
| 531 | Facial Paresis | FAERS: 1 | SIDER US FAERS | |
| 532 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 533 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 534 | Flatulence | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 535 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 536 | Food Poisoning | FAERS: 1 | US FAERS | |
| 537 | Food craving | FAERS: 1 | US FAERS | |
| 538 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 539 | Frostbite | FAERS: 1 | US FAERS | |
| 540 | Frustration | FAERS: 1 | US FAERS | |
| 541 | Gastric hypomotility | FAERS: 1 | US FAERS | |
| 542 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 543 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 544 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 545 | Genital rash | FAERS: 1 | US FAERS | |
| 546 | Gingival blister | FAERS: 1 | US FAERS | |
| 547 | Globulinuria | FAERS: 1 | US FAERS | |
| 548 | Glossitis | FAERS: 1 | US FAERS | |
| 549 | Glutamate dehydrogenase level abnormal | FAERS: 1 | US FAERS | |
| 550 | Gout | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 551 | Heat Stroke | FAERS: 1 | SIDER US FAERS | |
| 552 | Hemiparesis | FAERS: 1 | US FAERS | |
| 553 | Hemiplegia | FAERS: 1 | US FAERS | |
| 554 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 555 | Hepatitis C | FAERS: 1 | US FAERS | |
| 556 | Hepatotoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 557 | Hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 558 | Histrionic Personality Disorder | FAERS: 1 | US FAERS | |
| 559 | Hyperkinesia | FAERS: 1 | SIDER US FAERS | |
| 560 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 561 | Hyperpyrexia | FAERS: 1 | SIDER US FAERS | |
| 562 | Hyperthyroidism | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 563 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 564 | Hypervigilance | FAERS: 1 | US FAERS | |
| 565 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 566 | Hypokinesia | FAERS: 1 | SIDER US FAERS | |
| 567 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 568 | Impatience | FAERS: 1 | US FAERS | |
| 569 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 570 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 571 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 572 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 573 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 574 | Injection site discomfort | FAERS: 1 | US FAERS | |
| 575 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 576 | Injection site pain | FAERS: 1 | SIDER US FAERS | |
| 577 | Insulin-requiring type 2 diabetes mellitus | FAERS: 1 | OFFSIDES US FAERS | |
| 578 | Intelligence test abnormal | FAERS: 1 | US FAERS | |
| 579 | Intentional misuse | FAERS: 1 | US FAERS | |
| 580 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 581 | Irregular breathing | FAERS: 1 | US FAERS | |
| 582 | Joint swelling | FAERS: 1 | US FAERS | |
| 583 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 584 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 585 | Lead dislodgement | FAERS: 1 | US FAERS | |
| 586 | Left ventricular end-diastolic pressure increased | FAERS: 1 | US FAERS | |
| 587 | Leukocytosis | FAERS: 1 | SIDER US FAERS | |
| 588 | Lichen Planus | FAERS: 1 | US FAERS | |
| 589 | Limb injury | FAERS: 1 | US FAERS | |
| 590 | Loose tooth | FAERS: 1 | US FAERS | |
| 591 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 592 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 593 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 594 | Lyme Disease | FAERS: 1 | US FAERS | |
| 595 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 596 | Male sexual dysfunction | FAERS: 1 | SIDER US FAERS | |
| 597 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 598 | Mastectomy | FAERS: 1 | US FAERS | |
| 599 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 600 | Medication residue present | FAERS: 1 | US FAERS | |
| 601 | Megacolon | FAERS: 1 | US FAERS | |
| 602 | Menorrhagia | FAERS: 1 | SIDER US FAERS | |
| 603 | Metabolic function test abnormal | FAERS: 1 | US FAERS | |
| 604 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 605 | Minor cognitive motor disorder | FAERS: 1 | US FAERS | |
| 606 | Multiple allergies | FAERS: 1 | US FAERS | |
| 607 | Multiple sclerosis relapse | FAERS: 1 | OFFSIDES US FAERS | |
| 608 | Muscle strain | FAERS: 1 | OFFSIDES US FAERS | |
| 609 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 610 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 611 | Myofascitis | FAERS: 1 | US FAERS | |
| 612 | Myopathy | FAERS: 1 | SIDER US FAERS | |
| 613 | Myopia | FAERS: 1 | US FAERS | |
| 614 | Myositis | FAERS: 1 | US FAERS | |
| 615 | Negative thoughts | FAERS: 1 | US FAERS | |
| 616 | Nephritis | FAERS: 1 | US FAERS | |
| 617 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 618 | Neutropenia | FAERS: 1 | US FAERS | |
| 619 | Non-cardiac chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 620 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 621 | Oral infection | FAERS: 1 | US FAERS | |
| 622 | Oral pain | FAERS: 1 | US FAERS | |
| 623 | Orthostatic heart rate response increased | FAERS: 1 | US FAERS | |
| 624 | Osteomalacia | FAERS: 1 | US FAERS | |
| 625 | Overweight | FAERS: 1 | US FAERS | |
| 626 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 627 | Paresis | FAERS: 1 | SIDER US FAERS | |
| 628 | Paternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 629 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 630 | Perseveration | FAERS: 1 | US FAERS | |
| 631 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 632 | Phlebitis | FAERS: 1 | SIDER US FAERS | |
| 633 | Pleurothotonus | FAERS: 1 | US FAERS | |
| 634 | Pneumonitis | FAERS: 1 | US FAERS | |
| 635 | Pneumothorax | FAERS: 1 | US FAERS | |
| 636 | Polyneuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 637 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 638 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 639 | Poverty of speech | FAERS: 1 | US FAERS | |
| 640 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 641 | Procedural nausea | FAERS: 1 | US FAERS | |
| 642 | Product label issue | FAERS: 1 | US FAERS | |
| 643 | Product size issue | FAERS: 1 | US FAERS | |
| 644 | Product tampering | FAERS: 1 | US FAERS | |
| 645 | Productive Cough | FAERS: 1 | US FAERS | |
| 646 | Protein urine present | FAERS: 1 | US FAERS | |
| 647 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 648 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 649 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 650 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 651 | Retinal cyst | FAERS: 1 | US FAERS | |
| 652 | Rhabdomyoma | FAERS: 1 | US FAERS | |
| 653 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 654 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 655 | Secretion discharge | FAERS: 1 | US FAERS | |
| 656 | Sepsis | FAERS: 1 | SIDER US FAERS | |
| 657 | Serotonin Syndrome | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 658 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 659 | Sick relative | FAERS: 1 | US FAERS | |
| 660 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 661 | Sinus headache | FAERS: 1 | US FAERS | |
| 662 | Sinus operation | FAERS: 1 | US FAERS | |
| 663 | Sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 664 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 665 | Skin irritation | FAERS: 1 | SIDER US FAERS | |
| 666 | Skin lesion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 667 | Skin reaction | FAERS: 1 | US FAERS | |
| 668 | Soliloquy | FAERS: 1 | US FAERS | |
| 669 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 670 | Spina Bifida | FAERS: 1 | US FAERS | |
| 671 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 672 | Stomatitis | FAERS: 1 | US FAERS | |
| 673 | Strabismus | FAERS: 1 | US FAERS | |
| 674 | Stridor | FAERS: 1 | US FAERS | |
| 675 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 676 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 677 | Testis discomfort | FAERS: 1 | US FAERS | |
| 678 | Therapy cessation | FAERS: 1 | US FAERS | |
| 679 | Therapy change | FAERS: 1 | US FAERS | |
| 680 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 681 | Tongue biting | FAERS: 1 | US FAERS | |
| 682 | Tongue spasm | FAERS: 1 | US FAERS | |
| 683 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 684 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 685 | Trichotillomania | FAERS: 1 | US FAERS | |
| 686 | Trigeminal Nerve Disorder | FAERS: 1 | US FAERS | |
| 687 | Troponin increased | FAERS: 1 | US FAERS | |
| 688 | Tuberculosis | FAERS: 1 | US FAERS | |
| 689 | Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 690 | Umbilical hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 691 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 692 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 693 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 694 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 695 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 696 | Victim of homicide | FAERS: 1 | US FAERS | |
| 697 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 698 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 699 | Water Intoxication | FAERS: 1 | US FAERS | |
| 700 | Withdrawal arrhythmia | FAERS: 1 | US FAERS | |
| 701 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 702 | muscle injury | FAERS: 1 | US FAERS | |
| 703 | treatment failure | FAERS: 1 | US FAERS | |
| 704 | Abnormal ejaculation | SIDER | ||
| 705 | Abnormal vision | SIDER | ||
| 706 | Acid reflux | OFFSIDES | ||
| 707 | Acute prerenal failure | OFFSIDES | ||
| 708 | Akathisia, Drug-Induced | 16240977 16513883 25085534 | CTD | |
| 709 | Albuminuria | SIDER | ||
| 710 | Alcoholic Intoxication | OFFSIDES | ||
| 711 | Amblyopia | SIDER | ||
| 712 | Amenorrhea | 15465997 18950388 | CTD OFFSIDES | |
| 713 | Amphetamines | OFFSIDES | ||
| 714 | Anaphylactoid Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 715 | Anosmia | OFFSIDES | ||
| 716 | Anticholinergic Syndrome | OFFSIDES | ||
| 717 | Antidepressant drug clearance decreased | OFFSIDES | ||
| 718 | Antipsychotic drug level below therapeutic | OFFSIDES | ||
| 719 | Aspiration Pneumonia | OFFSIDES | ||
| 720 | Atrioventricular Septal Defect | OFFSIDES | ||
| 721 | Aura | OFFSIDES | ||
| 722 | Autistic Disorder | 18315450 | CTD | |
| 723 | Autonomic nervous system imbalance | SIDER | ||
| 724 | Bacterial sepsis | OFFSIDES | ||
| 725 | Balanitis | OFFSIDES | ||
| 726 | Basal Ganglia Diseases | 15465997 | CTD | |
| 727 | Basophilia | SIDER | ||
| 728 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 729 | Blepharitis | SIDER | ||
| 730 | Blood Glucose | OFFSIDES | ||
| 731 | Blood alkaline phosphatase increased | SIDER | ||
| 732 | Blood and lymphatic system disorders | SIDER | ||
| 733 | Blood cholesterol | OFFSIDES | ||
| 734 | Blood creatinine decreased | OFFSIDES | ||
| 735 | Blood glucagon abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 736 | Blood magnesium increased | OFFSIDES | ||
| 737 | Blood sodium | OFFSIDES | ||
| 738 | Blurred vision | OFFSIDES | ||
| 739 | Bradykinesia | SIDER | ||
| 740 | Breast Feeding | SIDER | ||
| 741 | Buccoglossal syndrome | SIDER | ||
| 742 | Cardiac enzymes increased | OFFSIDES | ||
| 743 | Cardioactive drug level above therapeutic | OFFSIDES | ||
| 744 | Catalepsy | 15996562 | CTD | |
| 745 | Catheter site pain | OFFSIDES | ||
| 746 | Cerebral Infarction | SIDER | ||
| 747 | Cerebral artery stenosis | OFFSIDES | ||
| 748 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 749 | Circumoral paresthesia | SIDER | ||
| 750 | Cocaine-Related Disorders | 15860690 17576772 | CTD | |
| 751 | Cold symptoms | SIDER | ||
| 752 | Complex partial seizures | OFFSIDES | ||
| 753 | Confabulation | OFFSIDES | ||
| 754 | Conjunctivitis | SIDER | ||
| 755 | Creatine Phosphokinase Increased | SIDER | ||
| 756 | Creatinine increased | SIDER | ||
| 757 | Cubital Tunnel Syndrome | OFFSIDES | ||
| 758 | Cutaneous Candidiasis | OFFSIDES | ||
| 759 | Deglutition Disorders | 18305296 | CTD | |
| 760 | Demyelination | OFFSIDES | ||
| 761 | Dermatitis | SIDER | ||
| 762 | Diabetes | OFFSIDES | ||
| 763 | Diabetic Foot | OFFSIDES | ||
| 764 | Diabetic Nephropathy | OFFSIDES | ||
| 765 | Diabetic Retinopathy | OFFSIDES | ||
| 766 | Diabetic | SIDER | ||
| 767 | Diarrhea | OFFSIDES | ||
| 768 | Drowsiness | OFFSIDES | ||
| 769 | Drug Tolerance | SIDER | ||
| 770 | Drug abuse | SIDER | ||
| 771 | Drug addict | OFFSIDES | ||
| 772 | Drug level below therapeutic | OFFSIDES | ||
| 773 | Drug seeking behavior | SIDER | ||
| 774 | Dysmorphism | OFFSIDES | ||
| 775 | Dysthymic Disorder | OFFSIDES | ||
| 776 | Ear and labyrinth disorders | SIDER | ||
| 777 | Ecchymosis | SIDER | ||
| 778 | Ejection Fraction Decreased | OFFSIDES | ||
| 779 | Electrocardiogram T wave biphasic | OFFSIDES | ||
| 780 | Eosinophilia | SIDER | ||
| 781 | Eosinophilic myocarditis | OFFSIDES | ||
| 782 | Escherichia urinary tract infection | OFFSIDES | ||
| 783 | Female sexual dysfunction | SIDER | ||
| 784 | Flank Pain | OFFSIDES SIDER | ||
| 785 | Furunculosis | SIDER | ||
| 786 | Galactorrhea | 18950388 | CTD OFFSIDES | |
| 787 | Gastric ulcer | OFFSIDES | ||
| 788 | Gastrointestinal Pain | SIDER | ||
| 789 | Gastrointestinal discomfort | SIDER | ||
| 790 | Gestational Diabetes | OFFSIDES | ||
| 791 | Glycosuria | SIDER | ||
| 792 | Goiter | OFFSIDES | ||
| 793 | Hallucinations | 15349021 | CTD | |
| 794 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 795 | Hepatic impairment | SIDER | ||
| 796 | Hepatitis | SIDER | ||
| 797 | Hepatomegaly | SIDER | ||
| 798 | Hydronephrosis | OFFSIDES | ||
| 799 | Hyperkeratosis | OFFSIDES | ||
| 800 | Hyperosmolar state | Canada Vigilance: 2 | Canada Vigilance | |
| 801 | Hyperprolactinemia | 15243877 15465997 18950388 | CTD | |
| 802 | Hyperreflexia | SIDER | ||
| 803 | Hypoaesthesia facial | OFFSIDES | ||
| 804 | Hysterectomy | OFFSIDES | ||
| 805 | Incisional hernia | OFFSIDES | ||
| 806 | Incoherent | OFFSIDES | ||
| 807 | Increased prolactin level | SIDER | ||
| 808 | Infective exacerbation of chronic obstructive airways disease | OFFSIDES | ||
| 809 | Infestation | SIDER | ||
| 810 | Infusion site mobility decreased | OFFSIDES | ||
| 811 | Intention tremor | OFFSIDES | ||
| 812 | Intervertebral disc disorder | OFFSIDES | ||
| 813 | Jugular vein distension | OFFSIDES | ||
| 814 | Keratitis | SIDER | ||
| 815 | Keratoconjunctivitis | SIDER | ||
| 816 | Ketosis | SIDER | ||
| 817 | Kidney Failure | OFFSIDES | ||
| 818 | Laceration | OFFSIDES | ||
| 819 | Lactic dehydrogenase activity increased | SIDER | ||
| 820 | Laryngeal Diseases | 18433661 | CTD | |
| 821 | Laziness | OFFSIDES | ||
| 822 | Lightheadedness | SIDER | ||
| 823 | Liver fatty deposition | SIDER | ||
| 824 | Lupus Nephritis | OFFSIDES | ||
| 825 | Lymphocytosis | SIDER | ||
| 826 | Mental disorders | 16856516 | CTD | |
| 827 | Metrorrhagia | SIDER | ||
| 828 | Monocytosis | SIDER | ||
| 829 | Morose | OFFSIDES | ||
| 830 | Movement Disorders | 19673087 | CTD | |
| 831 | Muscle relaxant therapy | SIDER | ||
| 832 | Myocarditis | SIDER | ||
| 833 | Myoglobin urine present | SIDER | ||
| 834 | Myoglobinuria | SIDER | ||
| 835 | Negativism | OFFSIDES | ||
| 836 | Neonatal aspiration | OFFSIDES | ||
| 837 | Nephrolithiasis | OFFSIDES | ||
| 838 | Neuropathy | SIDER | ||
| 839 | Nicotine Dependence | OFFSIDES | ||
| 840 | Nocturia | OFFSIDES SIDER | ||
| 841 | Nuchal Rigidity | OFFSIDES | ||
| 842 | Nystagmus | SIDER | ||
| 843 | Oliguria | SIDER | ||
| 844 | Opisthotonus | SIDER | ||
| 845 | Oppositional Defiant Disorder | OFFSIDES | ||
| 846 | Orofacial oedema | SIDER | ||
| 847 | Oropharyngeal discomfort | SIDER | ||
| 848 | Periarthritis | OFFSIDES | ||
| 849 | Pharmaceutical product counterfeit | OFFSIDES | ||
| 850 | Polysubstance dependence | OFFSIDES | ||
| 851 | Post procedural myocardial infarction | OFFSIDES | ||
| 852 | Poverty | OFFSIDES | ||
| 853 | Pregnancy | SIDER | ||
| 854 | Prostatism | OFFSIDES | ||
| 855 | Psoriasis | SIDER | ||
| 856 | Psychomotor Agitation | 15517847 | CTD | |
| 857 | Psychoses, Substance-Induced | 16949733 | CTD | |
| 858 | Psychotic Disorders | 15138973 15517847 15641867 | CTD | |
| 859 | Pulse irregular | SIDER | ||
| 860 | Regurgitation | OFFSIDES | ||
| 861 | Respiratory Therapy | OFFSIDES | ||
| 862 | Rhinitis | OFFSIDES SIDER | ||
| 863 | Scotoma | SIDER | ||
| 864 | Seizures | 17576772 | CTD | |
| 865 | Senile dementia | OFFSIDES | ||
| 866 | Sense of oppression | OFFSIDES | ||
| 867 | Serum prolactin increased | SIDER | ||
| 868 | Staring | OFFSIDES | ||
| 869 | Substance Withdrawal Syndrome | 16513883 | CTD | |
| 870 | Suicide | SIDER | ||
| 871 | Sweating | SIDER | ||
| 872 | Tachycardia, Ventricular | 20210726 | CTD | |
| 873 | Tenosynovitis | SIDER | ||
| 874 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 875 | Therapeutic product ineffective | OFFSIDES | ||
| 876 | Thrombocytopenia | SIDER | ||
| 877 | Thrombocytosis | SIDER | ||
| 878 | Thyroiditis | SIDER | ||
| 879 | Tinea Pedis | OFFSIDES | ||
| 880 | Tolerance development | SIDER | ||
| 881 | Torsades de Pointes | 16178046 18072173 | CTD | |
| 882 | Urethral Stenosis | OFFSIDES | ||
| 883 | Urine output increased | SIDER | ||
| 884 | Uterine Polyp | OFFSIDES | ||
| 885 | Vasodilation procedure | SIDER | ||
| 886 | Vasodilation | SIDER | ||
| 887 | Venous Insufficiency | OFFSIDES | ||
| 888 | Venous Thromboembolism | SIDER | ||
| 889 | Vesiculobullous rash | SIDER | ||
| 890 | Viral upper respiratory tract infection | OFFSIDES | ||
| 891 | Vulvovaginal pruritus | OFFSIDES | ||
| 892 | Walking aid user | Canada Vigilance: 1 | Canada Vigilance | |
| 893 | Weight Gain | OFFSIDES | ||
| 894 | Xerosis | OFFSIDES | ||
| 895 | anaphylaxis | 19653983 | CTD | |
| 896 | furuncle | Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER | |
| 897 | jaundice | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.