Hydroxychloroquine
(XXSMGPRMXLTPCZ-UHFFFAOYSA-N)
Structure
- SMILES
- OCCN(CCCC(Nc1ccnc2c1ccc(c2)Cl)C)CC
- Type(s)
- Approved
- ATC code(s)
- P01BA02
- Molecular Formula:
- C18H26ClN3O
- Molecular Weight:
- 335.872
- Log P:
- 3.8560
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 48.39
- CAS Number(s):
- 118-42-3
Synonym(s)
1.
Hydroxychloroquine
2.
Hydroxychlorochin
3.
Oxychlorochin
4.
Oxychloroquine
5.
Hydroxychloroquine Sulfate
6.
Hydroxychloroquine Sulfate (1:1) Salt
7.
Plaquenil
External Link(s)
| MeSH | D006886 |
| PubChem Compound | 3652 |
| ChEBI | 5801 |
| CHEMBL | CHEMBL1535 |
| DrugBank | DB01611 |
| DrugCentral | 1395 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7198 |
| KEGG | cpd:C07043 dr:D08050 |
| Therapeutic Target Database | D0OJ4L |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hypersensitivity | FAERS: 73 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 2 | Toxicity to various agents | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Retinal toxicity | FAERS: 51 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 45 Canada Vigilance: 97 | Canada Vigilance US FAERS | |
| 5 | Nausea | FAERS: 38 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 6 | Visual Impairment | FAERS: 38 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 7 | Pruritus | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Abdominal discomfort | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 9 | Product substitution issue | FAERS: 29 Canada Vigilance: 61 | Canada Vigilance US FAERS | |
| 10 | Dizziness | FAERS: 28 Canada Vigilance: 2 | 8219437 10229401 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 11 | Headache | FAERS: 26 Canada Vigilance: 3 | 10229401 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Pain | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Urticaria | FAERS: 24 Canada Vigilance: 2 | 17162415 | CTD SIDER Canada Vigilance US FAERS |
| 14 | Vomiting | FAERS: 22 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 15 | Overdose | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Alopecia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Fatigue | FAERS: 19 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Hypotension | FAERS: 18 Canada Vigilance: 1 | 15582773 | CTD Canada Vigilance US FAERS |
| 19 | Erythema | FAERS: 17 | OFFSIDES US FAERS | |
| 20 | Product use in unapproved indication | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Somnolence | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Stevens-Johnson Syndrome | FAERS: 15 Canada Vigilance: 3 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 23 | Atrial Fibrillation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Ejection Fraction Decreased | FAERS: 14 | US FAERS | |
| 25 | Asthenia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 26 | Erythema Multiforme | FAERS: 13 | SIDER US FAERS | |
| 27 | Macular degeneration | FAERS: 13 | 4875645 | CTD SIDER US FAERS |
| 28 | Myopathy | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 29 | Palpitations | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Retinal Degeneration | FAERS: 13 | US FAERS | |
| 31 | Rheumatoid Arthritis | FAERS: 13 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 32 | Suicide attempt | FAERS: 13 | US FAERS | |
| 33 | Abdominal Pain | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 34 | Eosinophilia | FAERS: 12 | SIDER US FAERS | |
| 35 | Malaise | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 36 | Tinnitus | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 37 | Weight decreased | FAERS: 12 | SIDER US FAERS | |
| 38 | Drug exposure during pregnancy | FAERS: 11 | US FAERS | |
| 39 | Left Ventricular Hypertrophy | FAERS: 11 | US FAERS | |
| 40 | Pharmaceutical product complaint | FAERS: 11 | US FAERS | |
| 41 | Rash erythematous | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Retinal Detachment | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | treatment failure | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Arthralgia | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 45 | Blood creatine phosphokinase increased | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Cardiotoxicity | FAERS: 10 | US FAERS | |
| 47 | Cataract | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 48 | Chest Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 49 | Product quality issue | FAERS: 10 | US FAERS | |
| 50 | Retinal depigmentation | FAERS: 10 | US FAERS | |
| 51 | Septic Shock | FAERS: 10 | US FAERS | |
| 52 | Swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Anxiety | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 54 | Cardiac septal hypertrophy | FAERS: 9 | US FAERS | |
| 55 | Chills | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Photophobia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 57 | Blindness | FAERS: 8 | US FAERS | |
| 58 | Brain natriuretic peptide abnormal | FAERS: 8 | US FAERS | |
| 59 | Burning sensation | FAERS: 8 | OFFSIDES US FAERS | |
| 60 | Diastolic dysfunction | FAERS: 8 | US FAERS | |
| 61 | Disease Progression | FAERS: 8 | US FAERS | |
| 62 | Disease recurrence | FAERS: 8 | US FAERS | |
| 63 | Dyspepsia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Feeling abnormal | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 65 | Tachycardia | FAERS: 8 | US FAERS | |
| 66 | Endocarditis | FAERS: 7 | US FAERS | |
| 67 | Myasthenia Gravis | FAERS: 7 | US FAERS | |
| 68 | Posterior reversible encephalopathy syndrome | FAERS: 7 | US FAERS | |
| 69 | Retinal pigment epitheliopathy | FAERS: 7 | US FAERS | |
| 70 | Right Ventricular Hypertrophy | FAERS: 7 | US FAERS | |
| 71 | Sick Sinus Syndrome | FAERS: 7 | US FAERS | |
| 72 | Toxic Epidermal Necrolysis | FAERS: 7 | SIDER US FAERS | |
| 73 | Arthritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 74 | Dysgeusia | FAERS: 6 | OFFSIDES US FAERS | |
| 75 | Flatulence | FAERS: 6 | OFFSIDES US FAERS | |
| 76 | Mental status changes | FAERS: 6 | US FAERS | |
| 77 | Neutropenia | FAERS: 6 | US FAERS | |
| 78 | Ocular Toxicity | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Psoriasis | FAERS: 6 Canada Vigilance: 1 | 12852373 | CTD SIDER Canada Vigilance US FAERS |
| 80 | Respiratory Failure | FAERS: 6 | OFFSIDES US FAERS | |
| 81 | Restrictive cardiomyopathy | FAERS: 6 | US FAERS | |
| 82 | Skin lesion | FAERS: 6 | OFFSIDES US FAERS | |
| 83 | Visual disturbance | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 84 | Alanine Aminotransferase Increased | FAERS: 5 | OFFSIDES US FAERS | |
| 85 | Ataxia | FAERS: 5 | SIDER US FAERS | |
| 86 | Atrioventricular Block | FAERS: 5 | US FAERS | |
| 87 | Cardiomegaly | FAERS: 5 | US FAERS | |
| 88 | Cellulitis | FAERS: 5 | US FAERS | |
| 89 | Deafness | FAERS: 5 | SIDER US FAERS | |
| 90 | Drug toxicity | FAERS: 5 | OFFSIDES US FAERS | |
| 91 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 92 | Hypoxia | FAERS: 5 | US FAERS | |
| 93 | Inflammation | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Left atrial dilatation | FAERS: 5 | US FAERS | |
| 95 | Low birth weight baby | FAERS: 5 | US FAERS | |
| 96 | Ototoxicity | FAERS: 5 | US FAERS | |
| 97 | Pancytopenia | FAERS: 5 | SIDER US FAERS | |
| 98 | Pityriasis Lichenoides et Varioliformis Acuta | FAERS: 5 | US FAERS | |
| 99 | Pneumonia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Polyneuropathy | FAERS: 5 | US FAERS | |
| 101 | Syncope | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Transaminases increased | FAERS: 5 | US FAERS | |
| 103 | Tremor | FAERS: 5 | 8219437 | CTD US FAERS |
| 104 | Troponin I increased | FAERS: 5 | US FAERS | |
| 105 | Unevaluable event | FAERS: 5 | US FAERS | |
| 106 | Vasculitis | FAERS: 5 | US FAERS | |
| 107 | Adverse event | FAERS: 4 | OFFSIDES US FAERS | |
| 108 | Amnesia | FAERS: 4 | US FAERS | |
| 109 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 110 | Back Pain | FAERS: 4 | US FAERS | |
| 111 | Eye pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 112 | Febrile Neutropenia | FAERS: 4 | US FAERS | |
| 113 | Feeling Cold | FAERS: 4 | US FAERS | |
| 114 | Flushing | FAERS: 4 | US FAERS | |
| 115 | Infection | FAERS: 4 | US FAERS | |
| 116 | Lip swelling | FAERS: 4 | US FAERS | |
| 117 | Memory impairment | FAERS: 4 | US FAERS | |
| 118 | Myalgia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Myocardial necrosis marker increased | FAERS: 4 | US FAERS | |
| 120 | Nervousness | FAERS: 4 | SIDER US FAERS | |
| 121 | Pancreatitis | FAERS: 4 | OFFSIDES US FAERS | |
| 122 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 123 | Retinogram abnormal | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 124 | Sinus bradycardia | FAERS: 4 | OFFSIDES US FAERS | |
| 125 | Splenic Infarction | FAERS: 4 | US FAERS | |
| 126 | Status Epilepticus | FAERS: 4 | US FAERS | |
| 127 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 128 | Vertigo | FAERS: 4 Canada Vigilance: 1 | 1173923 | CTD SIDER Canada Vigilance US FAERS |
| 129 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 130 | Blood potassium decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 131 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 132 | Cheilitis | FAERS: 3 | US FAERS | |
| 133 | Complex partial seizures | FAERS: 3 | US FAERS | |
| 134 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 135 | Cytopenia | FAERS: 3 | US FAERS | |
| 136 | Deafness Neurosensory | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 137 | Deposit eye | FAERS: 3 | US FAERS | |
| 138 | Disorientation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Dysarthria | FAERS: 3 | US FAERS | |
| 140 | Enterococcus test positive | FAERS: 3 | US FAERS | |
| 141 | Epiglottitis | FAERS: 3 | US FAERS | |
| 142 | Fluid overload | FAERS: 3 | US FAERS | |
| 143 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 144 | Hepatitis B | FAERS: 3 | US FAERS | |
| 145 | Hepatitis | FAERS: 3 | US FAERS | |
| 146 | Impaired work ability | FAERS: 3 | US FAERS | |
| 147 | Joint swelling | FAERS: 3 | US FAERS | |
| 148 | Lethargy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Lyme Disease | FAERS: 3 | US FAERS | |
| 150 | Macular pigmentation | FAERS: 3 | SIDER US FAERS | |
| 151 | Myocarditis | FAERS: 3 | 16040888 | CTD US FAERS |
| 152 | Nail pigmentation | FAERS: 3 | US FAERS | |
| 153 | Night sweats | FAERS: 3 | US FAERS | |
| 154 | Optic Atrophy | FAERS: 3 | SIDER US FAERS | |
| 155 | Pericardial effusion | FAERS: 3 | OFFSIDES US FAERS | |
| 156 | Product use issue | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 157 | Proteinuria | FAERS: 3 | US FAERS | |
| 158 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 159 | Purpura | FAERS: 3 | US FAERS | |
| 160 | Pustular psoriasis | FAERS: 3 | US FAERS | |
| 161 | QRS axis abnormal | FAERS: 3 | US FAERS | |
| 162 | Reaction to excipient | FAERS: 3 | US FAERS | |
| 163 | Restlessness | FAERS: 3 | US FAERS | |
| 164 | Retinitis | FAERS: 3 | US FAERS | |
| 165 | Right atrial dilatation | FAERS: 3 | US FAERS | |
| 166 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 167 | Staphylococcus test positive | FAERS: 3 | US FAERS | |
| 168 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 169 | Thrombocytopenia | FAERS: 3 | SIDER US FAERS | |
| 170 | Vitreous floaters | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 172 | Abasia | FAERS: 2 | OFFSIDES US FAERS | |
| 173 | Acne | FAERS: 2 | US FAERS | |
| 174 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 175 | Acute respiratory failure | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Anger | FAERS: 2 | OFFSIDES US FAERS | |
| 177 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 178 | Asthma | FAERS: 2 | OFFSIDES US FAERS | |
| 179 | Atelectasis | FAERS: 2 | US FAERS | |
| 180 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 181 | Blighted ovum | FAERS: 2 | US FAERS | |
| 182 | Blood alkaline phosphatase increased | FAERS: 2 | OFFSIDES US FAERS | |
| 183 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 184 | Blood immunoglobulin A decreased | FAERS: 2 | US FAERS | |
| 185 | Blood immunoglobulin A increased | FAERS: 2 | US FAERS | |
| 186 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 187 | Bradycardia | FAERS: 2 | US FAERS | |
| 188 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 189 | Chorioretinal atrophy | FAERS: 2 | US FAERS | |
| 190 | Chromaturia | FAERS: 2 | US FAERS | |
| 191 | Coma scale abnormal | FAERS: 2 | US FAERS | |
| 192 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 193 | Crying | FAERS: 2 | US FAERS | |
| 194 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 195 | Depressed mood | FAERS: 2 | OFFSIDES US FAERS | |
| 196 | Detachment of retinal pigment epithelium | FAERS: 2 | US FAERS | |
| 197 | Discomfort | FAERS: 2 | US FAERS | |
| 198 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 199 | Dyschromatopsia | FAERS: 2 | US FAERS | |
| 200 | Dysphonia | FAERS: 2 | US FAERS | |
| 201 | Dysuria | FAERS: 2 | US FAERS | |
| 202 | Eczema | FAERS: 2 | US FAERS | |
| 203 | Electrolyte imbalance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 205 | Epistaxis | FAERS: 2 | US FAERS | |
| 206 | Extraocular Muscle Paresis | FAERS: 2 | US FAERS | |
| 207 | Fundoscopy abnormal | FAERS: 2 | US FAERS | |
| 208 | Gastritis | FAERS: 2 | US FAERS | |
| 209 | Gingival Hypertrophy | FAERS: 2 | US FAERS | |
| 210 | Glaucoma | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 211 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 212 | Incorrect dose administered | FAERS: 2 | OFFSIDES US FAERS | |
| 213 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 214 | Leukopenia | FAERS: 2 | SIDER US FAERS | |
| 215 | Lupus enteritis | FAERS: 2 | US FAERS | |
| 216 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 217 | Macular fibrosis | FAERS: 2 | US FAERS | |
| 218 | Macule | FAERS: 2 | US FAERS | |
| 219 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 220 | Medication Error | FAERS: 2 | US FAERS | |
| 221 | Mental impairment | FAERS: 2 | US FAERS | |
| 222 | Metabolic acidosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 223 | Muscle tightness | FAERS: 2 | US FAERS | |
| 224 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 225 | Musculoskeletal stiffness | FAERS: 2 | OFFSIDES US FAERS | |
| 226 | Mydriasis | FAERS: 2 | US FAERS | |
| 227 | Myelofibrosis | FAERS: 2 | US FAERS | |
| 228 | Nephritis | FAERS: 2 | US FAERS | |
| 229 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 230 | No adverse event | FAERS: 2 | US FAERS | |
| 231 | Oral mucosal erythema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Personality Change | FAERS: 2 | US FAERS | |
| 233 | Petechiae | FAERS: 2 | US FAERS | |
| 234 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 235 | Poisoning | FAERS: 2 | US FAERS | |
| 236 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 237 | Post procedural complication | FAERS: 2 | US FAERS | |
| 238 | Pregnancy | FAERS: 2 | US FAERS | |
| 239 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 240 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 241 | Retinal deposits | FAERS: 2 | US FAERS | |
| 242 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 243 | Rheumatoid Nodule | FAERS: 2 | US FAERS | |
| 244 | Scotoma | FAERS: 2 | 11992862 15834087 18215798 | CTD SIDER US FAERS |
| 245 | Sepsis | FAERS: 2 | US FAERS | |
| 246 | Shock | FAERS: 2 | US FAERS | |
| 247 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 248 | Skin tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 249 | Stomatitis | FAERS: 2 | US FAERS | |
| 250 | Swelling of eyelid | FAERS: 2 | US FAERS | |
| 251 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 252 | Therapeutic response changed | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 253 | Tonic clonic movements | FAERS: 2 | US FAERS | |
| 254 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 255 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 256 | Zygomycosis | FAERS: 2 | US FAERS | |
| 257 | jaundice | FAERS: 2 | US FAERS | |
| 258 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 259 | Accidental death | FAERS: 1 | US FAERS | |
| 260 | Accidental exposure | FAERS: 1 | OFFSIDES US FAERS | |
| 261 | Accidental overdose | FAERS: 1 | US FAERS | |
| 262 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 263 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 264 | Acute vestibular syndrome | FAERS: 1 | US FAERS | |
| 265 | Acute zonal occult outer retinopathy | FAERS: 1 | US FAERS | |
| 266 | Adenocarcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 267 | Agitation | FAERS: 1 | SIDER US FAERS | |
| 268 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 269 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 270 | Amylase increased | FAERS: 1 | US FAERS | |
| 271 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 272 | Angioedema | FAERS: 1 | SIDER US FAERS | |
| 273 | Angiogram abnormal | FAERS: 1 | US FAERS | |
| 274 | Anorexia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 275 | Anosmia | FAERS: 1 | US FAERS | |
| 276 | Antiacetylcholine receptor antibody positive | FAERS: 1 | US FAERS | |
| 277 | Antibody test positive | FAERS: 1 | US FAERS | |
| 278 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 279 | Anuria | FAERS: 1 | US FAERS | |
| 280 | Aphonia | FAERS: 1 | US FAERS | |
| 281 | Arthropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 282 | Ascites | FAERS: 1 | US FAERS | |
| 283 | Asphyxia | FAERS: 1 | US FAERS | |
| 284 | Autoimmune retinopathy | FAERS: 1 | US FAERS | |
| 285 | Bedridden | FAERS: 1 | US FAERS | |
| 286 | Blepharospasm | FAERS: 1 | US FAERS | |
| 287 | Blood albumin decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 288 | Blood chloride decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Blood creatine phosphokinase abnormal | FAERS: 1 | US FAERS | |
| 290 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 291 | Blood osmolarity increased | FAERS: 1 | US FAERS | |
| 292 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 293 | Blood sodium decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 295 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 296 | Butterfly rash | FAERS: 1 | US FAERS | |
| 297 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 298 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 299 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 300 | Chest discomfort | FAERS: 1 | US FAERS | |
| 301 | Choking | FAERS: 1 | US FAERS | |
| 302 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 303 | Cold sweat | FAERS: 1 | OFFSIDES US FAERS | |
| 304 | Colitis | FAERS: 1 | US FAERS | |
| 305 | Completed Suicide | FAERS: 1 | US FAERS | |
| 306 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 307 | Compression fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 308 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 309 | Congenital cerebral cyst | FAERS: 1 | US FAERS | |
| 310 | Congenital intestinal malformation | FAERS: 1 | US FAERS | |
| 311 | Cornea verticillata | FAERS: 1 | US FAERS | |
| 312 | Cyanosis | FAERS: 1 | US FAERS | |
| 313 | Cyst | FAERS: 1 | US FAERS | |
| 314 | Cytolytic hepatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 315 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 316 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 317 | Deformity | FAERS: 1 | US FAERS | |
| 318 | Dehydration | FAERS: 1 | US FAERS | |
| 319 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 320 | Dermatomyositis | FAERS: 1 | 2483176 | CTD US FAERS |
| 321 | Detachment of macular retinal pigment epithelium | FAERS: 1 | US FAERS | |
| 322 | Device Failure | FAERS: 1 | US FAERS | |
| 323 | Differential white blood cell count abnormal | FAERS: 1 | US FAERS | |
| 324 | Diplopia | FAERS: 1 | 9051865 | CTD US FAERS |
| 325 | Disability | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 326 | Dissociation | FAERS: 1 | US FAERS | |
| 327 | Drug level increased | FAERS: 1 | US FAERS | |
| 328 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 329 | Drug screen positive | FAERS: 1 | US FAERS | |
| 330 | Dry skin | FAERS: 1 | US FAERS | |
| 331 | Dysacusis | FAERS: 1 | US FAERS | |
| 332 | Dysmetropsia | FAERS: 1 | US FAERS | |
| 333 | Dysmorphism | FAERS: 1 | US FAERS | |
| 334 | Dysplasia | FAERS: 1 | US FAERS | |
| 335 | Economic problem | FAERS: 1 | US FAERS | |
| 336 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 337 | Embolic stroke | FAERS: 1 | US FAERS | |
| 338 | Encephalitis | FAERS: 1 | US FAERS | |
| 339 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 340 | Enterocolitis | FAERS: 1 | US FAERS | |
| 341 | Entropion | FAERS: 1 | US FAERS | |
| 342 | Epidermolysis | FAERS: 1 | US FAERS | |
| 343 | Epilepsy | FAERS: 1 | US FAERS | |
| 344 | Erythema dyschromicum perstans | FAERS: 1 | US FAERS | |
| 345 | Euphoric mood | FAERS: 1 | US FAERS | |
| 346 | Exfoliative rash | FAERS: 1 | OFFSIDES US FAERS | |
| 347 | Expired product administered | FAERS: 1 | US FAERS | |
| 348 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 349 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 350 | Eye Infection | FAERS: 1 | US FAERS | |
| 351 | Eye irritation | FAERS: 1 | US FAERS | |
| 352 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 353 | Fracture | FAERS: 1 | US FAERS | |
| 354 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 355 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 356 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 357 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 358 | General symptom | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Genital Herpes | FAERS: 1 | US FAERS | |
| 360 | Gingival Recession | FAERS: 1 | US FAERS | |
| 361 | Glossitis | FAERS: 1 | US FAERS | |
| 362 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 363 | Hallucination, synaesthetic | FAERS: 1 | US FAERS | |
| 364 | Head discomfort | FAERS: 1 | US FAERS | |
| 365 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 366 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 367 | Hemiparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 368 | Hepatitis B surface antibody positive | FAERS: 1 | US FAERS | |
| 369 | Hepatitis C | FAERS: 1 | US FAERS | |
| 370 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 371 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 372 | Hypertensive cardiomyopathy | FAERS: 1 | US FAERS | |
| 373 | Hypophagia | FAERS: 1 | US FAERS | |
| 374 | Hypoventilation | FAERS: 1 | US FAERS | |
| 375 | Immobile | FAERS: 1 | US FAERS | |
| 376 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 377 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 378 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 379 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 380 | Intention tremor | FAERS: 1 | US FAERS | |
| 381 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 382 | Intestinal Atresia | FAERS: 1 | US FAERS | |
| 383 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 384 | Joint stiffness | FAERS: 1 | US FAERS | |
| 385 | Keratopathy | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 386 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 387 | Left ventricular end-diastolic pressure increased | FAERS: 1 | US FAERS | |
| 388 | Leukocytosis | FAERS: 1 | US FAERS | |
| 389 | Lichen Planus | FAERS: 1 | OFFSIDES US FAERS | |
| 390 | Limb discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 391 | Lymphoma | FAERS: 1 | US FAERS | |
| 392 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 393 | Macular detachment | FAERS: 1 | US FAERS | |
| 394 | Macular reflex abnormal | FAERS: 1 | US FAERS | |
| 395 | Malabsorption | FAERS: 1 | US FAERS | |
| 396 | Manufacturing production issue | FAERS: 1 | US FAERS | |
| 397 | Mastectomy | FAERS: 1 | US FAERS | |
| 398 | Meningitis | FAERS: 1 | US FAERS | |
| 399 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 400 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 401 | Musculoskeletal Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 402 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 403 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 404 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 405 | Neck Pain | FAERS: 1 | US FAERS | |
| 406 | Neonatal gastrointestinal disorder | FAERS: 1 | US FAERS | |
| 407 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 408 | Nephrotic Syndrome | FAERS: 1 | 7071645 | CTD US FAERS |
| 409 | Nerve injury | FAERS: 1 | US FAERS | |
| 410 | Neuropathic pain | FAERS: 1 | US FAERS | |
| 411 | Nystagmus | FAERS: 1 | SIDER US FAERS | |
| 412 | Ocular vasculitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 413 | Oligospermia | FAERS: 1 | US FAERS | |
| 414 | Onycholysis | FAERS: 1 | US FAERS | |
| 415 | Ophthalmic vein thrombosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 416 | Ophthalmological examination abnormal | FAERS: 1 | US FAERS | |
| 417 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 418 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 419 | Oral pruritus | FAERS: 1 | US FAERS | |
| 420 | Oropharyngeal pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 421 | Pain of skin | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 422 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 423 | Papule | FAERS: 1 | US FAERS | |
| 424 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 425 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 426 | Performance status decreased | FAERS: 1 | US FAERS | |
| 427 | Pericarditis | FAERS: 1 | US FAERS | |
| 428 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 429 | Persistent corneal epithelial defect | FAERS: 1 | US FAERS | |
| 430 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 431 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 432 | Placental hypertrophy | FAERS: 1 | US FAERS | |
| 433 | Pleocytosis | FAERS: 1 | US FAERS | |
| 434 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 435 | Polymerase chain reaction positive | FAERS: 1 | US FAERS | |
| 436 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 437 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 438 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 439 | Pressure of speech | FAERS: 1 | US FAERS | |
| 440 | Product coating issue | FAERS: 1 | US FAERS | |
| 441 | Product counterfeit | FAERS: 1 | US FAERS | |
| 442 | Product formulation issue | FAERS: 1 | US FAERS | |
| 443 | Product shape issue | FAERS: 1 | US FAERS | |
| 444 | Productive Cough | FAERS: 1 | OFFSIDES US FAERS | |
| 445 | Quadriparesis | FAERS: 1 | US FAERS | |
| 446 | Rales | FAERS: 1 | US FAERS | |
| 447 | Rash papulosquamous | FAERS: 1 | US FAERS | |
| 448 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 449 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 450 | Retching | FAERS: 1 | US FAERS | |
| 451 | Retinal cyst | FAERS: 1 | US FAERS | |
| 452 | Retinal phototoxicity | FAERS: 1 | US FAERS | |
| 453 | Retinal pigmentation | FAERS: 1 | US FAERS | |
| 454 | Retinal telangiectasia | FAERS: 1 | US FAERS | |
| 455 | Retro-orbital neoplasm | FAERS: 1 | US FAERS | |
| 456 | Right atrial enlargement | FAERS: 1 | US FAERS | |
| 457 | Right atrial pressure increased | FAERS: 1 | US FAERS | |
| 458 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 459 | Scab | FAERS: 1 | US FAERS | |
| 460 | Scleritis | FAERS: 1 | US FAERS | |
| 461 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 462 | Serum Sickness | FAERS: 1 | US FAERS | |
| 463 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 464 | Sinusitis | FAERS: 1 | US FAERS | |
| 465 | Skeletal dysplasia | FAERS: 1 | US FAERS | |
| 466 | Skin Ulcer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 467 | Skin irritation | FAERS: 1 | US FAERS | |
| 468 | Skin reaction | FAERS: 1 | US FAERS | |
| 469 | Skin toxicity | FAERS: 1 | US FAERS | |
| 470 | Solar lentigo | FAERS: 1 | US FAERS | |
| 471 | Splenomegaly | FAERS: 1 | US FAERS | |
| 472 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 473 | Stillbirth | FAERS: 1 | US FAERS | |
| 474 | Stress | FAERS: 1 | US FAERS | |
| 475 | Sunburn | FAERS: 1 | US FAERS | |
| 476 | Synovitis | FAERS: 1 | OFFSIDES US FAERS | |
| 477 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 478 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 479 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 480 | Talipes | FAERS: 1 | US FAERS | |
| 481 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 482 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 483 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 484 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 485 | Therapy cessation | FAERS: 1 | OFFSIDES US FAERS | |
| 486 | Throat cancer | FAERS: 1 | US FAERS | |
| 487 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 488 | Total bile acids increased | FAERS: 1 | US FAERS | |
| 489 | Toxic Optic Neuropathy | FAERS: 1 | US FAERS | |
| 490 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 491 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 492 | Tuberculosis | FAERS: 1 | US FAERS | |
| 493 | Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 494 | Unresponsive to stimuli | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 495 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 496 | Vascular calcification | FAERS: 1 | US FAERS | |
| 497 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 498 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 499 | Wheezing | FAERS: 1 | US FAERS | |
| 500 | Withdrawal arrhythmia | FAERS: 1 | US FAERS | |
| 501 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 502 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 503 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 504 | muscle injury | FAERS: 1 | US FAERS | |
| 505 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 506 | Abdominal Cramps | SIDER | ||
| 507 | Abdominal bruit | OFFSIDES | ||
| 508 | Abdominal tenderness | OFFSIDES | ||
| 509 | Abnormal clotting factor | OFFSIDES | ||
| 510 | Abnormal pigmentation | SIDER | ||
| 511 | Abnormal vision | OFFSIDES | ||
| 512 | Accidental needle stick | OFFSIDES | ||
| 513 | Acid reflux | OFFSIDES | ||
| 514 | Actinic keratosis | OFFSIDES | ||
| 515 | Acute otitis media | OFFSIDES | ||
| 516 | Acute prerenal failure | OFFSIDES | ||
| 517 | Adrenal mass | OFFSIDES | ||
| 518 | Ageusia | 18721220 | CTD | |
| 519 | Agranulocytosis | SIDER | ||
| 520 | Altered bowel function | OFFSIDES | ||
| 521 | Alveolitis | OFFSIDES | ||
| 522 | Anhedonia | OFFSIDES | ||
| 523 | Anxiety Disorders | 8219437 | CTD | |
| 524 | Aphthous Stomatitis | OFFSIDES | ||
| 525 | Appendicitis | OFFSIDES | ||
| 526 | Application site pain | OFFSIDES | ||
| 527 | Application site perspiration | OFFSIDES | ||
| 528 | Application site vesicles | OFFSIDES | ||
| 529 | Arthritis, Psoriatic | 3030337 | CTD | |
| 530 | Arthrodesis | OFFSIDES | ||
| 531 | Asterixis | OFFSIDES | ||
| 532 | Back disorder | OFFSIDES | ||
| 533 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 534 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 535 | Blood creatine phosphokinase MB increased | OFFSIDES | ||
| 536 | Blood immunoglobulin M decreased | OFFSIDES | ||
| 537 | Blood iron increased | OFFSIDES | ||
| 538 | Blood magnesium decreased | OFFSIDES | ||
| 539 | Blood sodium | OFFSIDES | ||
| 540 | Blurred vision | OFFSIDES | ||
| 541 | Bone marrow depression | SIDER | ||
| 542 | Breast necrosis | OFFSIDES | ||
| 543 | Bronchitis | OFFSIDES | ||
| 544 | Bronchospasm | SIDER | ||
| 545 | Bullous eruption | SIDER | ||
| 546 | Bunion | OFFSIDES | ||
| 547 | Bursitis | OFFSIDES | ||
| 548 | Calcinosis | OFFSIDES | ||
| 549 | Cardiomyopathies | CTD | ||
| 550 | Cervicobrachial syndrome | OFFSIDES | ||
| 551 | Chest wall pain | OFFSIDES | ||
| 552 | Cholecystitis infective | OFFSIDES | ||
| 553 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 554 | Chronic sinusitis | OFFSIDES | ||
| 555 | Cirrhosis | OFFSIDES | ||
| 556 | Claustrophobia | OFFSIDES | ||
| 557 | Colonic Diseases | 10220819 | CTD | |
| 558 | Color blindness | OFFSIDES | ||
| 559 | Congenital cystic kidney disease | OFFSIDES | ||
| 560 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 561 | Connective Tissue Diseases | CTD | ||
| 562 | Cystic Fibrosis | 19747007 | CTD | |
| 563 | Cytomegalovirus chorioretinitis | OFFSIDES | ||
| 564 | Deglutition Disorders | 17803043 | CTD | |
| 565 | Dental abscess | OFFSIDES | ||
| 566 | Dermatitis | 7452649 | CTD SIDER | |
| 567 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 568 | Diaphragmatic Hernia | OFFSIDES | ||
| 569 | Diarrhea | OFFSIDES | ||
| 570 | Dieulafoy's vascular malformation | OFFSIDES | ||
| 571 | Diverticulitis | OFFSIDES | ||
| 572 | Diverticulum | OFFSIDES | ||
| 573 | Drowsiness | SIDER | ||
| 574 | Drug delivery system malfunction | OFFSIDES | ||
| 575 | Drug dose omission | OFFSIDES | ||
| 576 | Drug withdrawal headache | OFFSIDES | ||
| 577 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 578 | Emotional disorder | OFFSIDES | ||
| 579 | Eosinophilic myocarditis | OFFSIDES | ||
| 580 | Erosive gastritis | OFFSIDES | ||
| 581 | Erythema Infectiosum | OFFSIDES | ||
| 582 | Erythema annulare centrifugum | SIDER | ||
| 583 | Eustachian tube disorder | OFFSIDES | ||
| 584 | Exanthema | 10229401 | CTD | |
| 585 | Excitability | SIDER | ||
| 586 | Excoriation | OFFSIDES | ||
| 587 | Extremity contracture | OFFSIDES | ||
| 588 | Eye Redness | OFFSIDES | ||
| 589 | Formication | OFFSIDES | ||
| 590 | Frustration | OFFSIDES | ||
| 591 | Gambling | OFFSIDES | ||
| 592 | Gangrene | OFFSIDES | ||
| 593 | Gastric infection | OFFSIDES | ||
| 594 | Gastrointestinal Diseases | 10229401 | CTD | |
| 595 | Globulinuria | OFFSIDES | ||
| 596 | Goiter | 14723259 | CTD | |
| 597 | Hearing Loss | 10229401 | CTD | |
| 598 | Heart Block | 8378663 | CTD | |
| 599 | Heart failure | 3796692 | CTD | |
| 600 | Hemicephalalgia | OFFSIDES | ||
| 601 | Hemiplegia | OFFSIDES | ||
| 602 | Hepatic congestion | OFFSIDES | ||
| 603 | Hip surgery | OFFSIDES | ||
| 604 | Hyperpigmentation | OFFSIDES | ||
| 605 | Hypertensive heart disease | OFFSIDES | ||
| 606 | Hypokalemia | 15582773 16142151 | CTD | |
| 607 | Hypokinesia | SIDER | ||
| 608 | Hysterectomy | OFFSIDES | ||
| 609 | Idiosyncratic drug reaction | OFFSIDES | ||
| 610 | Inappropriate schedule of drug administration | OFFSIDES | ||
| 611 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 612 | Injection site dermatitis | OFFSIDES | ||
| 613 | Injection site erythema | OFFSIDES | ||
| 614 | Injection site irritation | OFFSIDES | ||
| 615 | Injection site pruritus | OFFSIDES | ||
| 616 | Intermittent headache | SIDER | ||
| 617 | Intraocular pressure test abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 618 | Joint Range of Motion Decreased | OFFSIDES | ||
| 619 | Joint sprain | OFFSIDES | ||
| 620 | Kidney Failure | OFFSIDES | ||
| 621 | Lassitude | SIDER | ||
| 622 | Leukoderma | SIDER | ||
| 623 | Leukoencephalopathy | OFFSIDES | ||
| 624 | Lightheadedness | SIDER | ||
| 625 | Limb injury | OFFSIDES | ||
| 626 | Limb operation | OFFSIDES | ||
| 627 | Liver Failure, Acute | 8175002 | CTD | |
| 628 | Lividity | SIDER | ||
| 629 | Long QT Syndrome | 16615675 | CTD | |
| 630 | Lupus Erythematosus, Cutaneous | 20109393 | CTD | |
| 631 | Lupus Erythematosus, Discoid | 3796692 8949524 19076781 | CTD | |
| 632 | Lupus Erythematosus, Systemic | CTD | ||
| 633 | Lupus Nephritis | OFFSIDES | ||
| 634 | Lymphocyte count decreased | OFFSIDES | ||
| 635 | Malaria | 17202178 18061791 | CTD | |
| 636 | Malnutrition | SIDER | ||
| 637 | Medical device complication | OFFSIDES | ||
| 638 | Metamorphopsia | OFFSIDES | ||
| 639 | Mixed Connective Tissue Disease | 12427911 | CTD | |
| 640 | Mononucleosis syndrome | OFFSIDES | ||
| 641 | Mood swings | SIDER | ||
| 642 | Mucosal pigmentation | SIDER | ||
| 643 | Multiple allergies | OFFSIDES | ||
| 644 | Murphy's sign positive | OFFSIDES | ||
| 645 | Muscle Fatigue | OFFSIDES | ||
| 646 | Muscle Weakness | 19076781 | CTD | |
| 647 | Myelodysplasia | OFFSIDES | ||
| 648 | Nasopharyngitis | OFFSIDES | ||
| 649 | Nephritis, Interstitial | 15751825 | CTD | |
| 650 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 651 | Nephrolithiasis | OFFSIDES | ||
| 652 | Nervous tension | OFFSIDES | ||
| 653 | Neural hearing loss | SIDER | ||
| 654 | Neutropenic sepsis | OFFSIDES | ||
| 655 | Nodule | OFFSIDES | ||
| 656 | Ocular icterus | OFFSIDES | ||
| 657 | Open reduction of fracture | OFFSIDES | ||
| 658 | Optic Neuritis | OFFSIDES | ||
| 659 | Oral fungal infection | OFFSIDES | ||
| 660 | Oropharyngeal discomfort | SIDER | ||
| 661 | Osteoma | OFFSIDES | ||
| 662 | Osteomyelitis | OFFSIDES | ||
| 663 | Osteopenia | OFFSIDES | ||
| 664 | Osteoporosis | OFFSIDES | ||
| 665 | Pallor | SIDER | ||
| 666 | Panic Disorder | OFFSIDES | ||
| 667 | Patent ductus arteriosus | Canada Vigilance: 1 | Canada Vigilance | |
| 668 | Periarthritis | OFFSIDES | ||
| 669 | Periodontitis | OFFSIDES | ||
| 670 | Peripheral Nervous System Diseases | 8219437 10219755 | CTD | |
| 671 | Peripheral occlusive disease | OFFSIDES | ||
| 672 | Polymyositis | OFFSIDES | ||
| 673 | Post procedural nausea | OFFSIDES | ||
| 674 | Postmenopausal bleeding | OFFSIDES | ||
| 675 | Procedural hypotension | OFFSIDES | ||
| 676 | Protein total decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 677 | Prothrombin level decreased | OFFSIDES | ||
| 678 | Pruritus allergic | OFFSIDES | ||
| 679 | Psoas Abscess | OFFSIDES | ||
| 680 | Psychiatric symptom | OFFSIDES | ||
| 681 | Reaction gastrointestinal | SIDER | ||
| 682 | Renal cyst | OFFSIDES | ||
| 683 | Respiratory Insufficiency | 7671986 | CTD | |
| 684 | Retinal Diseases | CTD | ||
| 685 | Seizures | 11149659 | CTD | |
| 686 | Seroma | OFFSIDES | ||
| 687 | Skeletal injury | OFFSIDES | ||
| 688 | Skin Induration | OFFSIDES | ||
| 689 | Skin hypertrophy | OFFSIDES | ||
| 690 | Soft Tissue Injuries | OFFSIDES | ||
| 691 | Spinal fusion surgery | OFFSIDES | ||
| 692 | Spinal rod insertion | OFFSIDES | ||
| 693 | Subcutaneous nodule | OFFSIDES | ||
| 694 | Supraventricular tachycardia | OFFSIDES | ||
| 695 | Temperature intolerance | OFFSIDES | ||
| 696 | Tendinitis | OFFSIDES | ||
| 697 | Tension | SIDER | ||
| 698 | Tonsillitis | OFFSIDES | ||
| 699 | Torsades de Pointes | 16615675 | CTD | |
| 700 | Toxoplasmosis | 5120183 | CTD | |
| 701 | Tracheitis | OFFSIDES | ||
| 702 | Vasculitic rash | OFFSIDES | ||
| 703 | Vasculitis, Leukocytoclastic, Cutaneous | 17162415 | CTD | |
| 704 | Ventricular Fibrillation | 16142151 | CTD | |
| 705 | Viral labyrinthitis | OFFSIDES | ||
| 706 | Vision Disorders | CTD | ||
| 707 | Weight Gain | OFFSIDES | ||
| 708 | Wound dehiscence | OFFSIDES | ||
| 709 | bone marrow fibrosis | OFFSIDES | ||
| 710 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.