Pantoprazole
(IQPSEEYGBUAQFF-UHFFFAOYSA-N)
Structure
- SMILES
- COc1c(OC)ccnc1CS(=O)c1nc2c([nH]1)cc(cc2)OC(F)F
- Type(s)
- Approved
- ATC code(s)
- A02BC02; A02BD04; A02BD11
- Molecular Formula:
- C16H15F2N3O4S
- Molecular Weight:
- 383.370
- Log P:
- 3.7500
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 105.54
- CAS Number(s):
- 102625-70-7; 142706-18-1
Synonym(s)
1.
Pantoprazole
2.
BY 1023
3.
BY-1023
4.
Pantoprazole Sodium
5.
Protonix
6.
SK&F 96022
7.
SK&F-96022
8.
SKF-96022
9.
BY1023
10.
SK&F96022
11.
SKF 96022
12.
SKF96022
External Link(s)
| MeSH | D000077402 |
| PubChem Compound | 4679 |
| BindingDB | 50241342 |
| ChEBI | 7915 |
| CHEMBL | CHEMBL1502 |
| DrugBank | DB00213 |
| DrugCentral | 2054 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7260 |
| KEGG | cpd:C11806 dr:D05353 |
| Therapeutic Target Database | D0T6XX |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 467 Canada Vigilance: 137 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 167 Canada Vigilance: 27 | 11012560 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Malaise | FAERS: 142 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 4 | Dizziness | FAERS: 111 Canada Vigilance: 10 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Headache | FAERS: 107 Canada Vigilance: 7 | 11012560 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Drug screen false positive | FAERS: 96 | US FAERS | |
| 7 | Dyspepsia | FAERS: 93 Canada Vigilance: 37 | Canada Vigilance SIDER US FAERS | |
| 8 | Vomiting | FAERS: 93 Canada Vigilance: 12 | 11012560 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Product substitution issue | FAERS: 89 Canada Vigilance: 92 | Canada Vigilance US FAERS | |
| 10 | Pruritus | FAERS: 89 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 11 | Pain | FAERS: 81 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Drug screen positive | FAERS: 79 | US FAERS | |
| 13 | Hypersensitivity | FAERS: 79 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Urticaria | FAERS: 66 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 15 | Acute kidney injury | FAERS: 64 | 15372423 17014549 | CTD US FAERS |
| 16 | Fatigue | FAERS: 61 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Chest Pain | FAERS: 59 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Abdominal discomfort | FAERS: 56 Canada Vigilance: 18 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Abdominal Pain | FAERS: 55 Canada Vigilance: 18 | 11012560 17475611 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 20 | Arthralgia | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 21 | Weight decreased | FAERS: 51 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 22 | Asthenia | FAERS: 48 | OFFSIDES SIDER US FAERS | |
| 23 | Erythema | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 24 | Feeling abnormal | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Back Pain | FAERS: 46 | SIDER US FAERS | |
| 26 | Flatulence | FAERS: 45 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 27 | Anxiety | FAERS: 44 | SIDER US FAERS | |
| 28 | Myalgia | FAERS: 43 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 29 | Product quality issue | FAERS: 40 | US FAERS | |
| 30 | Hypotension | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 31 | Constipation | FAERS: 32 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 32 | Syncope | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 33 | Oropharyngeal pain | FAERS: 31 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 34 | Burning sensation | FAERS: 29 | US FAERS | |
| 35 | Palpitations | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 36 | Drug effect incomplete | FAERS: 28 | US FAERS | |
| 37 | Chest discomfort | FAERS: 26 | US FAERS | |
| 38 | Myocardial Infarction | FAERS: 26 | SIDER US FAERS | |
| 39 | Cerebrovascular accident | FAERS: 25 | US FAERS | |
| 40 | Drug ineffective for unapproved indication | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Eructation | FAERS: 25 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 42 | Pancreatitis | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 43 | Anaphylactic shock | FAERS: 24 | SIDER US FAERS | |
| 44 | Angioedema | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 45 | Gastrointestinal bacterial overgrowth | FAERS: 23 | US FAERS | |
| 46 | Pneumonia | FAERS: 23 | SIDER US FAERS | |
| 47 | Tremor | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 48 | No adverse event | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Dysphonia | FAERS: 21 | US FAERS | |
| 50 | Diabetes Mellitus | FAERS: 20 | SIDER US FAERS | |
| 51 | Dysgeusia | FAERS: 20 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 52 | Product use in unapproved indication | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Product use issue | FAERS: 19 | US FAERS | |
| 54 | Throat irritation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Thrombocytopenia | FAERS: 19 | SIDER US FAERS | |
| 56 | Gastritis | FAERS: 18 Canada Vigilance: 1 | 16080005 | CTD SIDER Canada Vigilance US FAERS |
| 57 | Chills | FAERS: 17 | SIDER US FAERS | |
| 58 | Vertigo | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 59 | Swelling | FAERS: 16 | US FAERS | |
| 60 | Neutropenia | FAERS: 15 | US FAERS | |
| 61 | Reaction to drug excipients | FAERS: 15 | US FAERS | |
| 62 | Somnolence | FAERS: 15 | SIDER US FAERS | |
| 63 | Arthritis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 64 | Bone pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 65 | Intentional product misuse | FAERS: 13 | US FAERS | |
| 66 | Tinnitus | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 67 | Intentional product use issue | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Blood magnesium decreased | FAERS: 11 | US FAERS | |
| 69 | Epistaxis | FAERS: 11 | SIDER US FAERS | |
| 70 | Intestinal Obstruction | FAERS: 11 | OFFSIDES US FAERS | |
| 71 | Medication residue | FAERS: 11 | US FAERS | |
| 72 | Tachycardia | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 73 | Hypophagia | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 74 | Influenza | FAERS: 10 | SIDER US FAERS | |
| 75 | Joint injury | FAERS: 10 | US FAERS | |
| 76 | Memory impairment | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Mood swings | FAERS: 10 | SIDER US FAERS | |
| 78 | Musculoskeletal Pain | FAERS: 10 | US FAERS | |
| 79 | Nephrolithiasis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 80 | Presyncope | FAERS: 10 | US FAERS | |
| 81 | Restlessness | FAERS: 10 | US FAERS | |
| 82 | Unevaluable event | FAERS: 10 | US FAERS | |
| 83 | jaundice | FAERS: 10 | SIDER US FAERS | |
| 84 | Alopecia | FAERS: 9 | SIDER US FAERS | |
| 85 | Amnesia | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 86 | Angina Pectoris | FAERS: 9 | SIDER US FAERS | |
| 87 | Arthropathy | FAERS: 9 | SIDER US FAERS | |
| 88 | Aspartate Aminotransferase Increased | FAERS: 9 | SIDER US FAERS | |
| 89 | Choking | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 90 | Feeling jittery | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Hypoparathyroidism | FAERS: 9 | US FAERS | |
| 92 | Impaired work ability | FAERS: 9 | US FAERS | |
| 93 | Laryngospasm | FAERS: 9 | US FAERS | |
| 94 | Nasopharyngitis | FAERS: 9 | SIDER US FAERS | |
| 95 | Pallor | FAERS: 9 | OFFSIDES US FAERS | |
| 96 | Thrombosis | FAERS: 9 | SIDER US FAERS | |
| 97 | Wrong technique in drug usage process | FAERS: 9 | US FAERS | |
| 98 | Asthma | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 99 | Auricular swelling | FAERS: 8 | US FAERS | |
| 100 | Blood cholesterol increased | FAERS: 8 | US FAERS | |
| 101 | Blood glucose increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 102 | Delirium | FAERS: 8 | US FAERS | |
| 103 | Discomfort | FAERS: 8 | SIDER US FAERS | |
| 104 | False positive investigation result | FAERS: 8 | US FAERS | |
| 105 | Flushing | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 106 | Injection site extravasation | FAERS: 8 | US FAERS | |
| 107 | Lip swelling | FAERS: 8 | US FAERS | |
| 108 | Malnutrition | FAERS: 8 | SIDER US FAERS | |
| 109 | Neck Pain | FAERS: 8 | SIDER US FAERS | |
| 110 | Nonspecific reaction | FAERS: 8 | OFFSIDES US FAERS | |
| 111 | Therapeutic response unexpected with drug substitution | FAERS: 8 | US FAERS | |
| 112 | Visual Impairment | FAERS: 8 | SIDER US FAERS | |
| 113 | Accidental exposure | FAERS: 7 | US FAERS | |
| 114 | Adverse event | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Clostridium difficile colitis | FAERS: 7 | OFFSIDES US FAERS | |
| 116 | Device occlusion | FAERS: 7 | US FAERS | |
| 117 | Extravasation | FAERS: 7 | US FAERS | |
| 118 | Foreign body in respiratory tract | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Intentional drug misuse | FAERS: 7 | US FAERS | |
| 120 | Irritable Bowel Syndrome | FAERS: 7 | US FAERS | |
| 121 | Musculoskeletal stiffness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 122 | Osteopenia | FAERS: 7 | US FAERS | |
| 123 | Stevens-Johnson Syndrome | FAERS: 7 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 124 | Stress | FAERS: 7 | US FAERS | |
| 125 | Suicide attempt | FAERS: 7 | US FAERS | |
| 126 | Supraventricular tachycardia | FAERS: 7 | OFFSIDES US FAERS | |
| 127 | treatment failure | FAERS: 7 | US FAERS | |
| 128 | Activities of daily living impaired | FAERS: 6 | OFFSIDES US FAERS | |
| 129 | Alanine Aminotransferase Increased | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 130 | Autoimmune hepatitis | FAERS: 6 | US FAERS | |
| 131 | Back disorder | FAERS: 6 | US FAERS | |
| 132 | Blood urine present | FAERS: 6 | US FAERS | |
| 133 | Cholestasis | FAERS: 6 | US FAERS | |
| 134 | Clostridium difficile infection | FAERS: 6 | US FAERS | |
| 135 | Cold sweat | FAERS: 6 | OFFSIDES US FAERS | |
| 136 | Drug withdrawal syndrome | FAERS: 6 | US FAERS | |
| 137 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 138 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 139 | Infection | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 140 | Lethargy | FAERS: 6 | US FAERS | |
| 141 | Medication Error | FAERS: 6 | US FAERS | |
| 142 | Oral pain | FAERS: 6 | US FAERS | |
| 143 | Osteoporosis | FAERS: 6 | US FAERS | |
| 144 | Pancytopenia | FAERS: 6 | SIDER US FAERS | |
| 145 | Pharmaceutical product complaint | FAERS: 6 | US FAERS | |
| 146 | Rash erythematous | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Skin Erosion | FAERS: 6 | US FAERS | |
| 148 | Skin reaction | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Throat cancer | FAERS: 6 | US FAERS | |
| 150 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 151 | Bone density decreased | FAERS: 5 | US FAERS | |
| 152 | Bronchospasm | FAERS: 5 | US FAERS | |
| 153 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 154 | Chromaturia | FAERS: 5 | OFFSIDES US FAERS | |
| 155 | Drug dose omission | FAERS: 5 | OFFSIDES US FAERS | |
| 156 | Eye pain | FAERS: 5 | US FAERS | |
| 157 | Hernia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 158 | Incorrect drug administration duration | FAERS: 5 | US FAERS | |
| 159 | Infusion Site Extravasation | FAERS: 5 | US FAERS | |
| 160 | Joint swelling | FAERS: 5 | US FAERS | |
| 161 | Leukopenia | FAERS: 5 | SIDER US FAERS | |
| 162 | Musculoskeletal discomfort | FAERS: 5 | SIDER US FAERS | |
| 163 | Product solubility abnormal | FAERS: 5 | US FAERS | |
| 164 | Respiratory distress | FAERS: 5 | US FAERS | |
| 165 | Sinusitis | FAERS: 5 | SIDER US FAERS | |
| 166 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 167 | Therapy non-responder | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Ulcer | FAERS: 5 | 12353402 | CTD OFFSIDES US FAERS |
| 169 | Urinary tract infection | FAERS: 5 | SIDER US FAERS | |
| 170 | nervous system disorder | FAERS: 5 | SIDER US FAERS | |
| 171 | Abdominal rigidity | FAERS: 4 | US FAERS | |
| 172 | Ageusia | FAERS: 4 | SIDER US FAERS | |
| 173 | Blindness | FAERS: 4 | US FAERS | |
| 174 | Blood iron decreased | FAERS: 4 | US FAERS | |
| 175 | Cellulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 176 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 177 | Colitis | FAERS: 4 | SIDER US FAERS | |
| 178 | Deafness | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 179 | Dehydration | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 180 | Disease recurrence | FAERS: 4 | OFFSIDES US FAERS | |
| 181 | Disorientation | FAERS: 4 | SIDER US FAERS | |
| 182 | Drug administration error | FAERS: 4 | US FAERS | |
| 183 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 184 | Dry skin | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 185 | Eosinophilia | FAERS: 4 | SIDER US FAERS | |
| 186 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 187 | Feeding tube complication | FAERS: 4 | US FAERS | |
| 188 | Fibromyalgia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 189 | Frustration | FAERS: 4 | US FAERS | |
| 190 | Gastric pH decreased | FAERS: 4 | US FAERS | |
| 191 | Gastric ulcer | FAERS: 4 | OFFSIDES US FAERS | |
| 192 | General physical health deterioration | FAERS: 4 | OFFSIDES US FAERS | |
| 193 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 194 | Kounis Syndrome | FAERS: 4 | US FAERS | |
| 195 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 196 | Mental impairment | FAERS: 4 | US FAERS | |
| 197 | Multiple Sclerosis | FAERS: 4 | US FAERS | |
| 198 | Night sweats | FAERS: 4 | US FAERS | |
| 199 | Nuchal Rigidity | FAERS: 4 | SIDER US FAERS | |
| 200 | Nystagmus | FAERS: 4 | US FAERS | |
| 201 | Overdose | FAERS: 4 | US FAERS | |
| 202 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 203 | Post procedural complication | FAERS: 4 | US FAERS | |
| 204 | Product physical issue | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Product size issue | FAERS: 4 | US FAERS | |
| 206 | Productive Cough | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 207 | Regurgitation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 208 | Retching | FAERS: 4 | SIDER US FAERS | |
| 209 | Rhabdomyolysis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 210 | Suspected counterfeit product | FAERS: 4 | US FAERS | |
| 211 | Toxic Epidermal Necrolysis | FAERS: 4 | SIDER US FAERS | |
| 212 | Wheezing | FAERS: 4 | US FAERS | |
| 213 | Acne | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Anosmia | FAERS: 3 | US FAERS | |
| 215 | Ataxia | FAERS: 3 | OFFSIDES US FAERS | |
| 216 | Blood creatine phosphokinase increased | FAERS: 3 | SIDER US FAERS | |
| 217 | Bronchitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 218 | Carbohydrate antigen 19-9 increased | FAERS: 3 | US FAERS | |
| 219 | Cholecystitis infective | FAERS: 3 | US FAERS | |
| 220 | Cholecystitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 221 | Clostridium test positive | FAERS: 3 | US FAERS | |
| 222 | Conjunctivitis | FAERS: 3 | SIDER US FAERS | |
| 223 | Corneal graft rejection | FAERS: 3 | US FAERS | |
| 224 | Diplopia | FAERS: 3 | SIDER US FAERS | |
| 225 | Disability | FAERS: 3 | US FAERS | |
| 226 | Drug Dependence | FAERS: 3 | US FAERS | |
| 227 | Eczema | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 228 | Erectile dysfunction | FAERS: 3 | SIDER US FAERS | |
| 229 | Eye irritation | FAERS: 3 | US FAERS | |
| 230 | Facial Pain | FAERS: 3 | US FAERS | |
| 231 | Fibroadenoma of breast | FAERS: 3 | US FAERS | |
| 232 | Food Allergy | FAERS: 3 | US FAERS | |
| 233 | Fracture | FAERS: 3 | SIDER US FAERS | |
| 234 | Gastrointestinal Pain | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 235 | Gout | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 236 | Granulomatous dermatitis | FAERS: 3 | US FAERS | |
| 237 | Hepatitis C | FAERS: 3 | US FAERS | |
| 238 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 239 | Hyperaldosteronism | FAERS: 3 | US FAERS | |
| 240 | Hyperchlorhydria | FAERS: 3 | US FAERS | |
| 241 | Hypokinesia | FAERS: 3 | SIDER US FAERS | |
| 242 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 243 | Inflammation | FAERS: 3 | SIDER US FAERS | |
| 244 | Injection site erythema | FAERS: 3 | OFFSIDES US FAERS | |
| 245 | Interventional procedure | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Laryngitis | FAERS: 3 | SIDER US FAERS | |
| 247 | Leukocytosis | FAERS: 3 | SIDER US FAERS | |
| 248 | Limb discomfort | FAERS: 3 | US FAERS | |
| 249 | Limb injury | FAERS: 3 | US FAERS | |
| 250 | Mental status changes | FAERS: 3 | OFFSIDES US FAERS | |
| 251 | Mineral supplementation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Muscle tightness | FAERS: 3 | OFFSIDES US FAERS | |
| 253 | Myositis | FAERS: 3 | US FAERS | |
| 254 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 255 | Nephritis | FAERS: 3 | US FAERS | |
| 256 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 257 | Occult blood positive | FAERS: 3 | US FAERS | |
| 258 | Oral mucosal erythema | FAERS: 3 | US FAERS | |
| 259 | Pulmonary congestion | FAERS: 3 | OFFSIDES US FAERS | |
| 260 | Renal cyst | FAERS: 3 | US FAERS | |
| 261 | Respiratory tract congestion | FAERS: 3 | OFFSIDES US FAERS | |
| 262 | Retinal vascular thrombosis | FAERS: 3 | US FAERS | |
| 263 | Sepsis | FAERS: 3 | SIDER US FAERS | |
| 264 | Skin lesion | FAERS: 3 | OFFSIDES US FAERS | |
| 265 | Subacute hepatic failure | FAERS: 3 | US FAERS | |
| 266 | Vitamin D Deficiency | FAERS: 3 | US FAERS | |
| 267 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 268 | Accidental overdose | FAERS: 2 | US FAERS | |
| 269 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 270 | Agitation | FAERS: 2 | SIDER US FAERS | |
| 271 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 272 | Anorexia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 273 | Aphasia | FAERS: 2 | US FAERS | |
| 274 | Asphyxia | FAERS: 2 | US FAERS | |
| 275 | Asthenopia | FAERS: 2 | US FAERS | |
| 276 | Blepharitis | FAERS: 2 | US FAERS | |
| 277 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 278 | Blood potassium decreased | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 279 | Breakthrough Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 280 | Cataract | FAERS: 2 | SIDER US FAERS | |
| 281 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 282 | Cholelithiasis | FAERS: 2 | SIDER US FAERS | |
| 283 | Completed Suicide | FAERS: 2 | US FAERS | |
| 284 | Complication associated with device | FAERS: 2 | US FAERS | |
| 285 | Cystitis | FAERS: 2 | SIDER US FAERS | |
| 286 | Dental caries | FAERS: 2 | US FAERS | |
| 287 | Depressed mood | FAERS: 2 | US FAERS | |
| 288 | Dermatitis Herpetiformis | FAERS: 2 | US FAERS | |
| 289 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 290 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 291 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 292 | Dysarthria | FAERS: 2 | SIDER US FAERS | |
| 293 | Dysuria | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 294 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 295 | Erythema Multiforme | FAERS: 2 | SIDER US FAERS | |
| 296 | Expired product administered | FAERS: 2 | US FAERS | |
| 297 | Feeling Cold | FAERS: 2 | OFFSIDES US FAERS | |
| 298 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 299 | Gamma-Glutamyltransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 300 | Hepatitis | FAERS: 2 | 12649798 | CTD OFFSIDES SIDER US FAERS |
| 301 | Hyperplasia | FAERS: 2 | US FAERS | |
| 302 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 303 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 304 | Increased upper airway secretion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 305 | Injection site vesicles | FAERS: 2 | US FAERS | |
| 306 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 307 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 308 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 309 | Lymphocytosis | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 310 | Malabsorption | FAERS: 2 | US FAERS | |
| 311 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 312 | Middle insomnia | FAERS: 2 | US FAERS | |
| 313 | Myopathy | FAERS: 2 | US FAERS | |
| 314 | Pancreatic Enzymes Decreased | FAERS: 2 | US FAERS | |
| 315 | Periorbital swelling | FAERS: 2 | US FAERS | |
| 316 | Periostitis | FAERS: 2 | US FAERS | |
| 317 | Photophobia | FAERS: 2 | SIDER US FAERS | |
| 318 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 319 | Proctitis | FAERS: 2 | US FAERS | |
| 320 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 321 | Product formulation issue | FAERS: 2 | US FAERS | |
| 322 | Product label issue | FAERS: 2 | US FAERS | |
| 323 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 324 | Protein urine present | FAERS: 2 | US FAERS | |
| 325 | Psoriasis | FAERS: 2 | US FAERS | |
| 326 | Rectal fissure | FAERS: 2 | US FAERS | |
| 327 | Rectal polyp | FAERS: 2 | US FAERS | |
| 328 | Renal pain | FAERS: 2 | SIDER US FAERS | |
| 329 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 330 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 331 | Saliva altered | FAERS: 2 | US FAERS | |
| 332 | Sciatica | FAERS: 2 | US FAERS | |
| 333 | Shock | FAERS: 2 | SIDER US FAERS | |
| 334 | Skin Ulcer | FAERS: 2 | SIDER US FAERS | |
| 335 | Stem cell transplant | FAERS: 2 | US FAERS | |
| 336 | Therapy cessation | FAERS: 2 | US FAERS | |
| 337 | Tongue blistering | FAERS: 2 | OFFSIDES US FAERS | |
| 338 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 339 | Toothache | FAERS: 2 | SIDER US FAERS | |
| 340 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 341 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 342 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 343 | Visual disturbance | FAERS: 2 | SIDER US FAERS | |
| 344 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 345 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 346 | Abasia | FAERS: 1 | OFFSIDES US FAERS | |
| 347 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 348 | Achlorhydria | FAERS: 1 | US FAERS | |
| 349 | Agranulocytosis | FAERS: 1 | SIDER US FAERS | |
| 350 | Alcohol test false positive | FAERS: 1 | US FAERS | |
| 351 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 352 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 353 | Anal Fissure | FAERS: 1 | US FAERS | |
| 354 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 355 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 356 | Aphagia | FAERS: 1 | US FAERS | |
| 357 | Aphthous Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 358 | Application site erythema | FAERS: 1 | US FAERS | |
| 359 | Application site pain | FAERS: 1 | US FAERS | |
| 360 | Ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 361 | Atrial Fibrillation | FAERS: 1 | SIDER US FAERS | |
| 362 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 363 | Bedridden | FAERS: 1 | US FAERS | |
| 364 | Blood 25-hydroxycholecalciferol decreased | FAERS: 1 | US FAERS | |
| 365 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 366 | Blood blister | FAERS: 1 | US FAERS | |
| 367 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 368 | Blood creatinine increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 369 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 370 | Blood ketone body decreased | FAERS: 1 | US FAERS | |
| 371 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 372 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 373 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 374 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 375 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 376 | Bowel movement irregularity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 377 | Bradycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 378 | Breast tenderness | FAERS: 1 | US FAERS | |
| 379 | Candidiasis | FAERS: 1 | US FAERS | |
| 380 | Carcinoma | FAERS: 1 | US FAERS | |
| 381 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 382 | Cardioactive drug level increased | FAERS: 1 | US FAERS | |
| 383 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 384 | Catheter site infection | FAERS: 1 | US FAERS | |
| 385 | Catheter site pain | FAERS: 1 | US FAERS | |
| 386 | Catheter site phlebitis | FAERS: 1 | US FAERS | |
| 387 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 388 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 389 | Cheilitis | FAERS: 1 | US FAERS | |
| 390 | Chemical burn of gastrointestinal tract | FAERS: 1 | US FAERS | |
| 391 | Colon adenoma | FAERS: 1 | US FAERS | |
| 392 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 393 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 394 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 395 | Cycloplegia | FAERS: 1 | US FAERS | |
| 396 | Dementia | FAERS: 1 | US FAERS | |
| 397 | Dermatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 398 | Device breakage | FAERS: 1 | US FAERS | |
| 399 | Device connection issue | FAERS: 1 | US FAERS | |
| 400 | Device related infection | FAERS: 1 | OFFSIDES US FAERS | |
| 401 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 402 | Disturbance in sexual arousal | FAERS: 1 | SIDER US FAERS | |
| 403 | Diverticulum | FAERS: 1 | US FAERS | |
| 404 | Drug abuser | FAERS: 1 | US FAERS | |
| 405 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 406 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 407 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 408 | Drug resistance | FAERS: 1 | US FAERS | |
| 409 | Dyschezia | FAERS: 1 | US FAERS | |
| 410 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 411 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 412 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 413 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 414 | Emotional disorder | FAERS: 1 | US FAERS | |
| 415 | Endometriosis | FAERS: 1 | US FAERS | |
| 416 | Enterobacter pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 417 | Epiglottitis | FAERS: 1 | US FAERS | |
| 418 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 419 | Erythropenia | FAERS: 1 | US FAERS | |
| 420 | Euphoric mood | FAERS: 1 | US FAERS | |
| 421 | Extra dose administered | FAERS: 1 | US FAERS | |
| 422 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 423 | Flank Pain | FAERS: 1 | US FAERS | |
| 424 | Formication | FAERS: 1 | US FAERS | |
| 425 | Full blood count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 426 | Full blood count increased | FAERS: 1 | US FAERS | |
| 427 | Gait inability | FAERS: 1 | US FAERS | |
| 428 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 429 | Gastric hypomotility | FAERS: 1 | US FAERS | |
| 430 | Gastroenteritis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 431 | Gastrointestinal carcinoma | FAERS: 1 | SIDER US FAERS | |
| 432 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 433 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 434 | Gastrointestinal wall abnormal | FAERS: 1 | US FAERS | |
| 435 | Genital Herpes | FAERS: 1 | US FAERS | |
| 436 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 437 | Head discomfort | FAERS: 1 | US FAERS | |
| 438 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 439 | Hordeolum | FAERS: 1 | US FAERS | |
| 440 | Hunger | FAERS: 1 | US FAERS | |
| 441 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 442 | Ileitis | FAERS: 1 | OFFSIDES US FAERS | |
| 443 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 444 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 445 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 446 | Infarction | FAERS: 1 | US FAERS | |
| 447 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 448 | Infusion site abscess | FAERS: 1 | US FAERS | |
| 449 | Infusion site cellulitis | FAERS: 1 | US FAERS | |
| 450 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 451 | Infusion site pain | FAERS: 1 | US FAERS | |
| 452 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 453 | Injection Site Reaction | FAERS: 1 | SIDER US FAERS | |
| 454 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 455 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 456 | Injection site pain | FAERS: 1 | US FAERS | |
| 457 | Injection site phlebitis | FAERS: 1 | US FAERS | |
| 458 | Injection site warmth | FAERS: 1 | US FAERS | |
| 459 | Intention tremor | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 461 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 462 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 463 | Iron deficiency | FAERS: 1 | US FAERS | |
| 464 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 465 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 466 | Latex allergy | FAERS: 1 | US FAERS | |
| 467 | Lichen Planus | FAERS: 1 | US FAERS | |
| 468 | Ligament rupture | FAERS: 1 | US FAERS | |
| 469 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 470 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 471 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 472 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 473 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 474 | Lymphoma | FAERS: 1 | OFFSIDES US FAERS | |
| 475 | Macular degeneration | FAERS: 1 | US FAERS | |
| 476 | Macule | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 477 | Malignant neoplasm progression | FAERS: 1 | OFFSIDES US FAERS | |
| 478 | Marasmus | FAERS: 1 | US FAERS | |
| 479 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 480 | Meconium abnormal | FAERS: 1 | US FAERS | |
| 481 | Medication residue present | FAERS: 1 | US FAERS | |
| 482 | Metabolic acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Metaplasia | FAERS: 1 | US FAERS | |
| 484 | Metastasis | FAERS: 1 | US FAERS | |
| 485 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 486 | Miliaria | FAERS: 1 | US FAERS | |
| 487 | Motion Sickness | FAERS: 1 | US FAERS | |
| 488 | Mouth swelling | FAERS: 1 | US FAERS | |
| 489 | Muscle strain | FAERS: 1 | US FAERS | |
| 490 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 491 | Mydriasis | FAERS: 1 | US FAERS | |
| 492 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 493 | Nasogastric output abnormal | FAERS: 1 | US FAERS | |
| 494 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 495 | Neuralgia | FAERS: 1 | SIDER US FAERS | |
| 496 | Neuritis | FAERS: 1 | SIDER US FAERS | |
| 497 | Nipple pain | FAERS: 1 | US FAERS | |
| 498 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 499 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 500 | Open wound | FAERS: 1 | US FAERS | |
| 501 | Opiates positive | FAERS: 1 | US FAERS | |
| 502 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 503 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 504 | Oral candidiasis | FAERS: 1 | SIDER US FAERS | |
| 505 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 506 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 507 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 508 | Osteolysis | FAERS: 1 | US FAERS | |
| 509 | Pain of skin | FAERS: 1 | OFFSIDES US FAERS | |
| 510 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 511 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 512 | Pancreaticoduodenectomy | FAERS: 1 | US FAERS | |
| 513 | Peptic Ulcer | FAERS: 1 Canada Vigilance: 1 | 7762175 19837071 | CTD Canada Vigilance US FAERS |
| 514 | Periarthritis | FAERS: 1 | US FAERS | |
| 515 | Pharyngeal polyp | FAERS: 1 | US FAERS | |
| 516 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 517 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 518 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 519 | Poisoning | FAERS: 1 | US FAERS | |
| 520 | Polydipsia | FAERS: 1 | US FAERS | |
| 521 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 522 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 523 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 524 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 525 | Predisposition to disease | FAERS: 1 | US FAERS | |
| 526 | Product administration error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 527 | Product complaint | FAERS: 1 | US FAERS | |
| 528 | Product contamination physical | FAERS: 1 | US FAERS | |
| 529 | Product lot number issue | FAERS: 1 | US FAERS | |
| 530 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 531 | Product preparation error | FAERS: 1 | US FAERS | |
| 532 | Product shape issue | FAERS: 1 | US FAERS | |
| 533 | Product storage error | FAERS: 1 | US FAERS | |
| 534 | Product tampering | FAERS: 1 | US FAERS | |
| 535 | Product use complaint | FAERS: 1 | US FAERS | |
| 536 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 537 | Protein total increased | FAERS: 1 | US FAERS | |
| 538 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 539 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 540 | Rebound effect | FAERS: 1 | US FAERS | |
| 541 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 542 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 543 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 544 | Scab | FAERS: 1 | US FAERS | |
| 545 | Secretion discharge | FAERS: 1 | US FAERS | |
| 546 | Septic Shock | FAERS: 1 | US FAERS | |
| 547 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 548 | Skeletal injury | FAERS: 1 | US FAERS | |
| 549 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 550 | Skin irritation | FAERS: 1 | US FAERS | |
| 551 | Sluggishness | FAERS: 1 | US FAERS | |
| 552 | Smoke sensitivity | FAERS: 1 | US FAERS | |
| 553 | Smoker | FAERS: 1 | US FAERS | |
| 554 | Spinal column injury | FAERS: 1 | US FAERS | |
| 555 | Splenectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 556 | Spondylitis | FAERS: 1 | US FAERS | |
| 557 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 558 | Stress ulcer | FAERS: 1 | US FAERS | |
| 559 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 560 | Therapeutic product cross-reactivity | FAERS: 1 | US FAERS | |
| 561 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 562 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 563 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 564 | Thrombophlebitis | FAERS: 1 | SIDER US FAERS | |
| 565 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 566 | Tongue biting | FAERS: 1 | US FAERS | |
| 567 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 568 | Transaminases increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 569 | Tri-iodothyronine uptake increased | FAERS: 1 | US FAERS | |
| 570 | Trismus | FAERS: 1 | US FAERS | |
| 571 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 572 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 573 | Urinary Retention | FAERS: 1 | US FAERS | |
| 574 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 575 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 576 | Urine output increased | FAERS: 1 | US FAERS | |
| 577 | Uterine Polyp | FAERS: 1 | OFFSIDES US FAERS | |
| 578 | Uveitis | FAERS: 1 | US FAERS | |
| 579 | Vasospasm | FAERS: 1 | US FAERS | |
| 580 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 581 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 582 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 583 | furuncle | FAERS: 1 | US FAERS | |
| 584 | Abdominal Abscess | OFFSIDES | ||
| 585 | Abdominal Infection | OFFSIDES | ||
| 586 | Abdominal bloating | SIDER | ||
| 587 | Abdominal sepsis | OFFSIDES | ||
| 588 | Abdominal tenderness | SIDER | ||
| 589 | Abdominal wall infection | OFFSIDES | ||
| 590 | Abnormal vision | SIDER | ||
| 591 | Abscess | OFFSIDES SIDER | ||
| 592 | Acid reflux | OFFSIDES | ||
| 593 | Acidosis | OFFSIDES | ||
| 594 | Acquired diaphragmatic eventration | OFFSIDES | ||
| 595 | Acute Coronary Syndrome | SIDER | ||
| 596 | Acute graft versus host disease in liver | OFFSIDES | ||
| 597 | Adenocarcinoma | OFFSIDES | ||
| 598 | Adenoma | OFFSIDES | ||
| 599 | Adjustment disorder with depressed mood | OFFSIDES | ||
| 600 | Agraphia | OFFSIDES | ||
| 601 | Alanine aminotransferase abnormal | OFFSIDES | ||
| 602 | Albuminuria | SIDER | ||
| 603 | Alveolitis | OFFSIDES | ||
| 604 | Amblyopia | SIDER | ||
| 605 | Anastomotic ulcer | OFFSIDES | ||
| 606 | Anhedonia | OFFSIDES | ||
| 607 | Anterior Ischemic Optic Neuropathy | SIDER | ||
| 608 | Antidepressant drug level above therapeutic | OFFSIDES | ||
| 609 | Apathy | OFFSIDES | ||
| 610 | Application site pruritus | OFFSIDES | ||
| 611 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 612 | Aspiration Pneumonia | OFFSIDES | ||
| 613 | Atelectasis | OFFSIDES | ||
| 614 | Atrial Flutter | OFFSIDES | ||
| 615 | Atrial tachycardia | OFFSIDES | ||
| 616 | Autonomic neuropathy | SIDER | ||
| 617 | Avascular necrosis | OFFSIDES | ||
| 618 | Balanitis | SIDER | ||
| 619 | Band neutrophil percentage increased | OFFSIDES | ||
| 620 | Barrett Esophagus | 12077038 | CTD | |
| 621 | Biliary Colic | SIDER | ||
| 622 | Biopsy liver abnormal | OFFSIDES | ||
| 623 | Bipolar Disorder | OFFSIDES | ||
| 624 | Bipolar I disorder | OFFSIDES | ||
| 625 | Bladder pain | SIDER | ||
| 626 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 627 | Blood Glucose | OFFSIDES | ||
| 628 | Blood alkaline phosphatase increased | OFFSIDES SIDER | ||
| 629 | Blood and lymphatic system disorders | SIDER | ||
| 630 | Blood cholesterol | OFFSIDES | ||
| 631 | Blood cholinesterase decreased | OFFSIDES | ||
| 632 | Blood glucose decreased | OFFSIDES | ||
| 633 | Blood iron increased | OFFSIDES | ||
| 634 | Blood potassium increased | SIDER | ||
| 635 | Blood sodium | OFFSIDES | ||
| 636 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 637 | Blood triglycerides increased | OFFSIDES SIDER | ||
| 638 | Blood urea increased | OFFSIDES | ||
| 639 | Blurred vision | OFFSIDES | ||
| 640 | Borderline Personality Disorder | OFFSIDES | ||
| 641 | Brain Death | OFFSIDES | ||
| 642 | Brain Hypoxia | OFFSIDES | ||
| 643 | Buccal inflammation | SIDER | ||
| 644 | Bursitis | SIDER | ||
| 645 | Calciphylaxis | OFFSIDES | ||
| 646 | Candiduria | OFFSIDES | ||
| 647 | Cardiac Flutter | SIDER | ||
| 648 | Carotid artery aneurysm | OFFSIDES | ||
| 649 | Cataract specified | SIDER | ||
| 650 | Catheter placement | OFFSIDES | ||
| 651 | Catheter related infection | OFFSIDES | ||
| 652 | Cauda Equina Syndrome | OFFSIDES | ||
| 653 | Cerebrovascular accident prophylaxis | OFFSIDES | ||
| 654 | Chemical and Drug Induced Liver Injury | 12649798 | CTD | |
| 655 | Choking sensation | OFFSIDES | ||
| 656 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 657 | Colectomy | OFFSIDES | ||
| 658 | Colonic Stenosis | OFFSIDES | ||
| 659 | Confabulation | OFFSIDES | ||
| 660 | Cramps of lower extremities | SIDER | ||
| 661 | Creatine Phosphokinase Increased | SIDER | ||
| 662 | Creatinine increased | SIDER | ||
| 663 | Creatinine renal clearance decreased | SIDER | ||
| 664 | Demyelination | OFFSIDES | ||
| 665 | Depression suicidal | OFFSIDES | ||
| 666 | Diabetes | OFFSIDES | ||
| 667 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 668 | Diaphragmatic Hernia | OFFSIDES | ||
| 669 | Diarrhea | 11012560 11173893 | CTD OFFSIDES | |
| 670 | Disease Progression | OFFSIDES | ||
| 671 | Disorders of Excessive Somnolence | 18656731 | CTD | |
| 672 | Diverticulitis | OFFSIDES | ||
| 673 | Drowsiness | OFFSIDES | ||
| 674 | Drug specific antibody absent | OFFSIDES | ||
| 675 | Duodenitis | SIDER | ||
| 676 | Dyspeptic signs and symptoms | SIDER | ||
| 677 | Ecchymosis | SIDER | ||
| 678 | Edema | 11341670 | CTD | |
| 679 | Electrocardiogram ST-T change | OFFSIDES | ||
| 680 | Electrocardiogram abnormal | SIDER | ||
| 681 | Enteritis | SIDER | ||
| 682 | Epididymitis | SIDER | ||
| 683 | Erosive gastritis | OFFSIDES | ||
| 684 | Escherichia infection | OFFSIDES | ||
| 685 | Esophageal Perforation | OFFSIDES | ||
| 686 | Esophagitis | 11519776 | CTD | |
| 687 | Excoriation | OFFSIDES | ||
| 688 | External Ophthalmoplegia | SIDER | ||
| 689 | Extremity contracture | OFFSIDES | ||
| 690 | Facial wasting | OFFSIDES | ||
| 691 | Fatty Liver | OFFSIDES | ||
| 692 | Febrile Neutropenia | OFFSIDES | ||
| 693 | Fluid overload | OFFSIDES | ||
| 694 | Gambling | OFFSIDES | ||
| 695 | Gastrointestinal Hemorrhage | 18162722 | CTD | |
| 696 | Gastrointestinal candidiasis | SIDER | ||
| 697 | Gastrointestinal motility disorder | OFFSIDES | ||
| 698 | Gingivitis | SIDER | ||
| 699 | Glaucoma | SIDER | ||
| 700 | Glossitis | SIDER | ||
| 701 | Glucose increased | SIDER | ||
| 702 | Glycosuria | SIDER | ||
| 703 | Granulocytosis | OFFSIDES | ||
| 704 | Headache dull | SIDER | ||
| 705 | Heat Stroke | SIDER | ||
| 706 | Helicobacter Infections | CTD | ||
| 707 | Hepatic necrosis | OFFSIDES | ||
| 708 | Hepatosplenic T-cell lymphoma | OFFSIDES | ||
| 709 | Hepatosplenomegaly | OFFSIDES | ||
| 710 | Hiccough | OFFSIDES | ||
| 711 | Histoplasmosis | OFFSIDES | ||
| 712 | Hyperkinesia | SIDER | ||
| 713 | Hyperpigmentation | OFFSIDES | ||
| 714 | Hyperreflexia | OFFSIDES | ||
| 715 | Hypertensive emergency | OFFSIDES | ||
| 716 | Hyporeflexia | SIDER | ||
| 717 | Hypoxia | OFFSIDES | ||
| 718 | Incoherent | OFFSIDES | ||
| 719 | Infestation | SIDER | ||
| 720 | Infusion site mobility decreased | OFFSIDES | ||
| 721 | Inguinal mass | OFFSIDES | ||
| 722 | Injection site irritation | OFFSIDES | ||
| 723 | Injection site macule | OFFSIDES | ||
| 724 | Injection site pruritus | OFFSIDES | ||
| 725 | Injection site thrombosis | SIDER | ||
| 726 | Injection site urticaria | OFFSIDES | ||
| 727 | Intestinal Fistula | OFFSIDES | ||
| 728 | Intestinal resection | OFFSIDES | ||
| 729 | Joint Instability | OFFSIDES | ||
| 730 | Joint Range of Motion Decreased | OFFSIDES | ||
| 731 | Kidney Failure | OFFSIDES | ||
| 732 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 733 | Legionella | OFFSIDES | ||
| 734 | Life expectancy shortened | OFFSIDES | ||
| 735 | Lip erosion | OFFSIDES | ||
| 736 | Liver neoplasms | 25058030 | CTD | |
| 737 | Lyme Disease | OFFSIDES | ||
| 738 | Mechanical ventilation | OFFSIDES | ||
| 739 | Medical device complication | OFFSIDES | ||
| 740 | Megacolon | OFFSIDES | ||
| 741 | Multi-organ disorder | OFFSIDES | ||
| 742 | Muscle Weakness | OFFSIDES | ||
| 743 | Myelofibrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 744 | Neck stiffness | SIDER | ||
| 745 | Nephritis, Interstitial | CTD | ||
| 746 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 747 | Neuropathy | SIDER | ||
| 748 | Nocturia | SIDER | ||
| 749 | Non-accidental injury | SIDER | ||
| 750 | Obstruction | OFFSIDES | ||
| 751 | Oesophageal reflux aggravated | SIDER | ||
| 752 | Ophthalmoplegia | SIDER | ||
| 753 | Oral infection | OFFSIDES | ||
| 754 | Osteochondrosis | OFFSIDES | ||
| 755 | Osteoradionecrosis | OFFSIDES | ||
| 756 | Otitis Externa | SIDER | ||
| 757 | Otosclerosis | OFFSIDES | ||
| 758 | PO2 decreased | OFFSIDES | ||
| 759 | Parotitis | OFFSIDES | ||
| 760 | Pericardial effusion | OFFSIDES | ||
| 761 | Periodontitis | SIDER | ||
| 762 | Peritonsillar Abscess | OFFSIDES | ||
| 763 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 764 | Physical disability | OFFSIDES | ||
| 765 | Pleurisy | OFFSIDES | ||
| 766 | Pneumobilia | OFFSIDES | ||
| 767 | Post procedural bile leak | OFFSIDES | ||
| 768 | Post procedural infection | OFFSIDES | ||
| 769 | Posterior capsule opacification | OFFSIDES | ||
| 770 | Postoperative Hemorrhage | 18162722 | CTD | |
| 771 | Potassium increased | SIDER | ||
| 772 | Potassium low | SIDER | ||
| 773 | Premature Ejaculation | Canada Vigilance: 1 | Canada Vigilance | |
| 774 | Prepyloric stenosis | OFFSIDES | ||
| 775 | Proctocolitis | SIDER | ||
| 776 | Protein total decreased | OFFSIDES | ||
| 777 | Pyelonephritis | SIDER | ||
| 778 | Quality of life decreased | OFFSIDES | ||
| 779 | Recurrence | 17230024 | CTD | |
| 780 | Renal Artery Stenosis | OFFSIDES | ||
| 781 | Reticulocyte count decreased | OFFSIDES | ||
| 782 | Retinal Vascular Disorder | SIDER | ||
| 783 | Retrosternal pain | SIDER | ||
| 784 | Rhinitis | SIDER | ||
| 785 | Rhinorrhea | OFFSIDES | ||
| 786 | Skin Induration | OFFSIDES | ||
| 787 | Skin Wrinkling | OFFSIDES | ||
| 788 | Skin hypertrophy | OFFSIDES | ||
| 789 | Skin tightness | OFFSIDES | ||
| 790 | Sleep disorder due to general medical condition, insomnia type | Canada Vigilance: 1 | Canada Vigilance | |
| 791 | Sneezing | Canada Vigilance: 1 | Canada Vigilance | |
| 792 | Sopor | OFFSIDES | ||
| 793 | Staphylococcal abscess | OFFSIDES | ||
| 794 | Stent occlusion | OFFSIDES | ||
| 795 | Subcutaneous nodule | OFFSIDES | ||
| 796 | Surgical vascular shunt | OFFSIDES | ||
| 797 | Sweating | SIDER | ||
| 798 | Taste Disorders | 11173893 | CTD SIDER | |
| 799 | Tenosynovitis | SIDER | ||
| 800 | Tension | SIDER | ||
| 801 | Therapeutic product effect decreased | Canada Vigilance: 5 | Canada Vigilance | |
| 802 | Therapeutic response changed | Canada Vigilance: 33 | Canada Vigilance | |
| 803 | Thirst | SIDER | ||
| 804 | Thrombophlebitis injection site | SIDER | ||
| 805 | Tinea Pedis | OFFSIDES | ||
| 806 | Tonic clonic movements | OFFSIDES | ||
| 807 | Tonsillitis | SIDER | ||
| 808 | Tracheal Stenosis | OFFSIDES | ||
| 809 | Tracheitis | OFFSIDES | ||
| 810 | Tracheobronchitis | OFFSIDES | ||
| 811 | Urethritis noninfective | SIDER | ||
| 812 | Urethritis | SIDER | ||
| 813 | Uterine spasm | OFFSIDES | ||
| 814 | Vanishing bile duct syndrome | OFFSIDES | ||
| 815 | Vasculitis, Leukocytoclastic, Cutaneous | 16482642 | CTD | |
| 816 | Vasodilation procedure | SIDER | ||
| 817 | Vasodilation | SIDER | ||
| 818 | Ventricular Fibrillation | OFFSIDES | ||
| 819 | Vitamin A Deficiency | OFFSIDES | ||
| 820 | Wound infection staphylococcal | OFFSIDES | ||
| 821 | Zollinger-Ellison syndrome | 11774936 | CTD | |
| 822 | muscle injury | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.