Acitretin
(IHUNBGSDBOWDMA-AQFIFDHZSA-N)
Structure
- SMILES
- COc1cc(C)c(c(c1C)C)/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C
- Type(s)
- Approved
- ATC code(s)
- D05BB02
- Molecular Formula:
- C21H26O3
- Molecular Weight:
- 326.429
- Log P:
- 5.1670
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.53
- CAS Number(s):
- 54757-46-9; 55079-83-9; 69427-46-9
Synonym(s)
1.
Acitretin
2.
13-cis-Acitretin
3.
Etretin
4.
Isoetretin
5.
Acitretin, (Z,E,E,E)-Isomer
6.
Isoacitretin
7.
Neotigason
8.
Ro 10-1670
9.
Ro 13-7652
10.
Ro-10-1670
11.
Ro-13-7652
12.
Soriatane
13.
Ro 101670
14.
Ro 137652
15.
Ro101670
16.
Ro137652
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pregnancy | FAERS: 102 | US FAERS | |
| 2 | Drug exposure during pregnancy | FAERS: 100 | OFFSIDES US FAERS | |
| 3 | Alopecia | FAERS: 57 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Drug ineffective | FAERS: 54 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Transmission of drug via semen | FAERS: 37 | OFFSIDES US FAERS | |
| 6 | Psoriasis | FAERS: 35 | CTD OFFSIDES SIDER US FAERS | |
| 7 | Pregnancy of partner | FAERS: 32 | OFFSIDES US FAERS | |
| 8 | Pruritus | FAERS: 31 Canada Vigilance: 1 | 11922592 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Drug dose omission | FAERS: 30 | US FAERS | |
| 10 | Headache | FAERS: 29 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 11 | Drug exposure before pregnancy | FAERS: 27 | OFFSIDES US FAERS | |
| 12 | Pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Arthralgia | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Malaise | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Product use in unapproved indication | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Erythema | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 17 | Drug administration error | FAERS: 16 | OFFSIDES US FAERS | |
| 18 | Therapeutic response unexpected | FAERS: 16 | OFFSIDES US FAERS | |
| 19 | Dry skin | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 20 | No adverse effect | FAERS: 14 | OFFSIDES US FAERS | |
| 21 | Epistaxis | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Live Birth | FAERS: 13 | OFFSIDES US FAERS | |
| 23 | Myalgia | FAERS: 13 | SIDER US FAERS | |
| 24 | Squamous cell carcinoma | FAERS: 13 | US FAERS | |
| 25 | Alanine Aminotransferase Increased | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 26 | Blood triglycerides increased | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 27 | Onychoclasis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 28 | Back Pain | FAERS: 11 | SIDER US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 11 | SIDER US FAERS | |
| 30 | Aspartate Aminotransferase Increased | FAERS: 10 | US FAERS | |
| 31 | Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Maternal exposure before pregnancy | FAERS: 9 | US FAERS | |
| 33 | Pneumonia | FAERS: 9 | US FAERS | |
| 34 | Product dose omission | FAERS: 9 | US FAERS | |
| 35 | Vomiting | FAERS: 9 | SIDER US FAERS | |
| 36 | Basal cell carcinoma | FAERS: 8 | US FAERS | |
| 37 | Blood cholesterol increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Blood creatinine increased | FAERS: 8 | SIDER US FAERS | |
| 39 | Drug prescribing error | FAERS: 8 | US FAERS | |
| 40 | Infection | FAERS: 8 | SIDER US FAERS | |
| 41 | Intentional product use issue | FAERS: 8 | US FAERS | |
| 42 | Product use issue | FAERS: 8 | US FAERS | |
| 43 | Skin Ulcer | FAERS: 8 | SIDER US FAERS | |
| 44 | Anxiety | FAERS: 7 | SIDER US FAERS | |
| 45 | Diabetes Mellitus | FAERS: 7 | SIDER US FAERS | |
| 46 | Exposure via father | FAERS: 7 | US FAERS | |
| 47 | Nasopharyngitis | FAERS: 7 | US FAERS | |
| 48 | Nausea | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 49 | Neutropenia | FAERS: 7 | US FAERS | |
| 50 | Weight decreased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 51 | Abdominal Pain | FAERS: 6 | SIDER US FAERS | |
| 52 | Arthritis | FAERS: 6 | SIDER US FAERS | |
| 53 | Bowen's Disease | FAERS: 6 | US FAERS | |
| 54 | Drug effect incomplete | FAERS: 6 | US FAERS | |
| 55 | Lip exfoliation | FAERS: 6 | OFFSIDES US FAERS | |
| 56 | Medication Error | FAERS: 6 | US FAERS | |
| 57 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 58 | Pancreatitis | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 59 | Pyogenic granuloma | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 60 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 61 | Blood lactate dehydrogenase increased | FAERS: 5 | OFFSIDES US FAERS | |
| 62 | Drug dispensing error | FAERS: 5 | OFFSIDES US FAERS | |
| 63 | Erectile dysfunction | FAERS: 5 | SIDER US FAERS | |
| 64 | Hyperthyroidism | FAERS: 5 | US FAERS | |
| 65 | Inability to afford medication | FAERS: 5 | US FAERS | |
| 66 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 67 | Joint swelling | FAERS: 5 | US FAERS | |
| 68 | Musculoskeletal stiffness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 69 | Osteoporosis | FAERS: 5 | OFFSIDES US FAERS | |
| 70 | Pain of skin | FAERS: 5 | OFFSIDES US FAERS | |
| 71 | Product supply issue | FAERS: 5 | US FAERS | |
| 72 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 73 | Skin Erosion | FAERS: 5 | US FAERS | |
| 74 | Skin lesion | FAERS: 5 | US FAERS | |
| 75 | Urticaria | FAERS: 5 | SIDER US FAERS | |
| 76 | Acute promyelocytic leukaemia differentiation syndrome | FAERS: 4 | US FAERS | |
| 77 | Arthropathy | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 78 | Blood creatine phosphokinase increased | FAERS: 4 | OFFSIDES US FAERS | |
| 79 | Cataract | FAERS: 4 | SIDER US FAERS | |
| 80 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 81 | Cholestasis | FAERS: 4 | 11922592 23384448 | CTD US FAERS |
| 82 | Cystitis | FAERS: 4 | US FAERS | |
| 83 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 84 | Depressed mood | FAERS: 4 | US FAERS | |
| 85 | Dizziness | FAERS: 4 | SIDER US FAERS | |
| 86 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 87 | Inflammation | FAERS: 4 | US FAERS | |
| 88 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 89 | Lymphocyte count increased | FAERS: 4 | US FAERS | |
| 90 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 91 | No adverse event | FAERS: 4 | US FAERS | |
| 92 | Osteopenia | FAERS: 4 | US FAERS | |
| 93 | Product availability issue | FAERS: 4 | US FAERS | |
| 94 | Pulmonary Fibrosis | FAERS: 4 | US FAERS | |
| 95 | Rhabdomyolysis | FAERS: 4 | OFFSIDES US FAERS | |
| 96 | Sepsis | FAERS: 4 | US FAERS | |
| 97 | Skin reaction | FAERS: 4 | US FAERS | |
| 98 | Suicide attempt | FAERS: 4 | US FAERS | |
| 99 | Therapy cessation | FAERS: 4 | US FAERS | |
| 100 | Thirst | FAERS: 4 | SIDER US FAERS | |
| 101 | Trisomy 21 | FAERS: 4 | OFFSIDES US FAERS | |
| 102 | Visual disturbance | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 103 | Vitamin D Deficiency | FAERS: 4 | US FAERS | |
| 104 | Vulvovaginal pruritus | FAERS: 4 | US FAERS | |
| 105 | Wrong patient received medication | FAERS: 4 | US FAERS | |
| 106 | Abasia | FAERS: 3 | OFFSIDES US FAERS | |
| 107 | Anorexia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 108 | Asthenia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 109 | Blindness | FAERS: 3 | US FAERS | |
| 110 | Blood alkaline phosphatase increased | FAERS: 3 | OFFSIDES US FAERS | |
| 111 | Blood glucose decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 112 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 113 | Blood immunoglobulin A increased | FAERS: 3 | OFFSIDES US FAERS | |
| 114 | Bone density decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 115 | Capillary Leak Syndrome | FAERS: 3 | 14746632 17097361 | CTD OFFSIDES SIDER US FAERS |
| 116 | Cerebral Thrombosis | FAERS: 3 | OFFSIDES US FAERS | |
| 117 | Cheilitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 118 | Cytolytic hepatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 119 | Deafness Neurosensory | FAERS: 3 | OFFSIDES US FAERS | |
| 120 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 121 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 122 | Electromyogram abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 123 | Expired product administered | FAERS: 3 | US FAERS | |
| 124 | Exposure via body fluid | FAERS: 3 | US FAERS | |
| 125 | Eyelids pruritus | FAERS: 3 | US FAERS | |
| 126 | Hepatitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 127 | Hypersensitivity | FAERS: 3 | SIDER US FAERS | |
| 128 | Hypotension | FAERS: 3 | US FAERS | |
| 129 | Hypoxia | FAERS: 3 | US FAERS | |
| 130 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 131 | Joint injury | FAERS: 3 | US FAERS | |
| 132 | Keratoconjunctivitis Sicca | FAERS: 3 | US FAERS | |
| 133 | Lip swelling | FAERS: 3 | US FAERS | |
| 134 | Musculoskeletal Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 135 | Myositis | FAERS: 3 | US FAERS | |
| 136 | Nasal pruritus | FAERS: 3 | US FAERS | |
| 137 | Neck Pain | FAERS: 3 | US FAERS | |
| 138 | Necrosis | FAERS: 3 | US FAERS | |
| 139 | Oral mucosal exfoliation | FAERS: 3 | US FAERS | |
| 140 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 141 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 142 | Pregnancy on contraceptive | FAERS: 3 | OFFSIDES US FAERS | |
| 143 | Product use complaint | FAERS: 3 | US FAERS | |
| 144 | Pyelonephritis | FAERS: 3 | OFFSIDES US FAERS | |
| 145 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 146 | Retinoic acid syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 147 | Rickets | FAERS: 3 | US FAERS | |
| 148 | Stevens-Johnson Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 149 | Swelling | FAERS: 3 | US FAERS | |
| 150 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 151 | Thrombosis | FAERS: 3 | 12452748 | CTD US FAERS |
| 152 | Tinnitus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 153 | Transaminases increased | FAERS: 3 | US FAERS | |
| 154 | Urinary Retention | FAERS: 3 | US FAERS | |
| 155 | Visual Impairment | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 156 | jaundice | FAERS: 3 Canada Vigilance: 1 | 11922592 | CTD SIDER Canada Vigilance US FAERS |
| 157 | nervous system disorder | FAERS: 3 | US FAERS | |
| 158 | treatment failure | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Accidental overdose | FAERS: 2 | US FAERS | |
| 160 | Agitation | FAERS: 2 | US FAERS | |
| 161 | Amnesia | FAERS: 2 | OFFSIDES US FAERS | |
| 162 | Anger | FAERS: 2 | US FAERS | |
| 163 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 164 | Apathy | FAERS: 2 | US FAERS | |
| 165 | Aphasia | FAERS: 2 | US FAERS | |
| 166 | Bacterial test positive | FAERS: 2 | US FAERS | |
| 167 | Bedridden | FAERS: 2 | OFFSIDES US FAERS | |
| 168 | Biliary Colic | FAERS: 2 | US FAERS | |
| 169 | Blood 25-hydroxycholecalciferol decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 170 | Blood urea increased | FAERS: 2 | US FAERS | |
| 171 | Bone callus excessive | FAERS: 2 | US FAERS | |
| 172 | Bone pain | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 173 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 174 | Cerebral cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 175 | Choking | FAERS: 2 | US FAERS | |
| 176 | Cholecystitis | FAERS: 2 | US FAERS | |
| 177 | Contraindicated drug prescribed | FAERS: 2 | US FAERS | |
| 178 | Contraindicated product administered | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 179 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 180 | Deafness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 181 | Disease recurrence | FAERS: 2 | OFFSIDES US FAERS | |
| 182 | Disorientation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Diverticulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 184 | Drug ineffective for unapproved indication | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Dysphonia | FAERS: 2 | 16274958 | CTD SIDER US FAERS |
| 186 | Dysuria | FAERS: 2 | SIDER US FAERS | |
| 187 | Ectropion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 188 | Flushing | FAERS: 2 | SIDER US FAERS | |
| 189 | Gamma-Glutamyltransferase Increased | FAERS: 2 | OFFSIDES US FAERS | |
| 190 | Gingival Hyperplasia | FAERS: 2 | SIDER US FAERS | |
| 191 | Hepatitis C | FAERS: 2 | OFFSIDES US FAERS | |
| 192 | Hypertensive Encephalopathy | FAERS: 2 | US FAERS | |
| 193 | Immune thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 194 | Inappropriate Prescribing | FAERS: 2 | US FAERS | |
| 195 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 196 | Inflammatory marker increased | FAERS: 2 | US FAERS | |
| 197 | Intellectual Disability | FAERS: 2 | US FAERS | |
| 198 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 199 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 200 | Laceration | FAERS: 2 | US FAERS | |
| 201 | Leukopenia | FAERS: 2 | US FAERS | |
| 202 | Limb injury | FAERS: 2 | US FAERS | |
| 203 | Limb operation | FAERS: 2 | US FAERS | |
| 204 | Macular degeneration | FAERS: 2 | US FAERS | |
| 205 | Memory impairment | FAERS: 2 | US FAERS | |
| 206 | Microcephaly | FAERS: 2 | 15470719 | CTD US FAERS |
| 207 | Mouth swelling | FAERS: 2 | US FAERS | |
| 208 | Musculoskeletal discomfort | FAERS: 2 | SIDER US FAERS | |
| 209 | Mycosis Fungoides | FAERS: 2 | OFFSIDES US FAERS | |
| 210 | Nail Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 211 | Nervousness | FAERS: 2 | SIDER US FAERS | |
| 212 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 213 | Osteocalcin decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 214 | Osteosclerosis | FAERS: 2 | US FAERS | |
| 215 | Post procedural complication | FAERS: 2 | US FAERS | |
| 216 | Product label confusion | FAERS: 2 | US FAERS | |
| 217 | Product lot number issue | FAERS: 2 | US FAERS | |
| 218 | Product quality issue | FAERS: 2 | OFFSIDES US FAERS | |
| 219 | Product substitution issue | FAERS: 2 | US FAERS | |
| 220 | Pubic pain | FAERS: 2 | US FAERS | |
| 221 | Pulmonary malformation | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 223 | Single umbilical artery | FAERS: 2 | OFFSIDES US FAERS | |
| 224 | Sinusitis | FAERS: 2 | SIDER US FAERS | |
| 225 | Skin hypertrophy | FAERS: 2 | SIDER US FAERS | |
| 226 | Sperm count decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 227 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 228 | Stress | FAERS: 2 | OFFSIDES US FAERS | |
| 229 | Supraventricular tachycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 230 | Syndactyly | FAERS: 2 | OFFSIDES US FAERS | |
| 231 | Therapeutic product effect incomplete | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Therapy non-responder | FAERS: 2 | OFFSIDES US FAERS | |
| 233 | Tremor | FAERS: 2 | US FAERS | |
| 234 | Urinary sediment present | FAERS: 2 | US FAERS | |
| 235 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 236 | Vascular rupture | FAERS: 2 | OFFSIDES US FAERS | |
| 237 | Vasculitis | FAERS: 2 | SIDER US FAERS | |
| 238 | Vasospasm | FAERS: 2 | OFFSIDES US FAERS | |
| 239 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 240 | Aborted pregnancy | FAERS: 1 | US FAERS | |
| 241 | Acanthoma | FAERS: 1 | US FAERS | |
| 242 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 243 | Accidental exposure | FAERS: 1 | US FAERS | |
| 244 | Achromotrichia acquired | FAERS: 1 | US FAERS | |
| 245 | Acne | FAERS: 1 | SIDER US FAERS | |
| 246 | Acoustic stimulation tests abnormal | FAERS: 1 | US FAERS | |
| 247 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 248 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 249 | Acute myocardial infarction | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 250 | Acute vestibular syndrome | FAERS: 1 | US FAERS | |
| 251 | Adenocarcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 252 | Adverse event | FAERS: 1 | OFFSIDES US FAERS | |
| 253 | Ageusia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 254 | Anosmia | FAERS: 1 | US FAERS | |
| 255 | Anticoagulation drug level abnormal | FAERS: 1 | US FAERS | |
| 256 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 257 | Aphonia | FAERS: 1 | US FAERS | |
| 258 | Ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 259 | Asthma | FAERS: 1 | US FAERS | |
| 260 | Azoospermia | FAERS: 1 | US FAERS | |
| 261 | Back disorder | FAERS: 1 | US FAERS | |
| 262 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 263 | Blood 1,25-dihydroxycholecalciferol decreased | FAERS: 1 | US FAERS | |
| 264 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 265 | Blood parathyroid hormone decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 266 | Blood parathyroid hormone increased | FAERS: 1 | OFFSIDES US FAERS | |
| 267 | Blood potassium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 268 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 269 | Blood urine present | FAERS: 1 | US FAERS | |
| 270 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 271 | Bradycardia | FAERS: 1 | US FAERS | |
| 272 | Breech Presentation | FAERS: 1 | US FAERS | |
| 273 | Bronchitis | FAERS: 1 | US FAERS | |
| 274 | Burning sensation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Calcinosis | FAERS: 1 | OFFSIDES US FAERS | |
| 276 | Cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 277 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 278 | Cerebrovascular stenosis | FAERS: 1 | US FAERS | |
| 279 | Chemotherapy | FAERS: 1 | US FAERS | |
| 280 | Chest Pain | FAERS: 1 | SIDER US FAERS | |
| 281 | Chills | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 282 | Cholangitis | FAERS: 1 | US FAERS | |
| 283 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 284 | Circumstance or information capable of leading to medication error | FAERS: 1 | OFFSIDES US FAERS | |
| 285 | Colectomy | FAERS: 1 | US FAERS | |
| 286 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 287 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 288 | Crying | FAERS: 1 | US FAERS | |
| 289 | Cyst | FAERS: 1 | SIDER US FAERS | |
| 290 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 291 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 292 | Device related infection | FAERS: 1 | US FAERS | |
| 293 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 294 | Diplopia | FAERS: 1 | 17894719 | CTD SIDER US FAERS |
| 295 | Discomfort | FAERS: 1 | SIDER US FAERS | |
| 296 | Disease Progression | FAERS: 1 | US FAERS | |
| 297 | Disease risk factor | FAERS: 1 | US FAERS | |
| 298 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 299 | Dyspepsia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 300 | Ecchymosis | FAERS: 1 | US FAERS | |
| 301 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 302 | Emotional disorder | FAERS: 1 | US FAERS | |
| 303 | Encephalocele | FAERS: 1 | US FAERS | |
| 304 | Essential Tremor | FAERS: 1 | OFFSIDES US FAERS | |
| 305 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 306 | Excoriation | FAERS: 1 | US FAERS | |
| 307 | Exposure via semen | FAERS: 1 | US FAERS | |
| 308 | Eye pain | FAERS: 1 | SIDER US FAERS | |
| 309 | Eye prosthesis insertion | FAERS: 1 | US FAERS | |
| 310 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 311 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 312 | Fracture | FAERS: 1 | US FAERS | |
| 313 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 314 | Glaucoma | FAERS: 1 | OFFSIDES US FAERS | |
| 315 | Graft loss | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Granuloma | FAERS: 1 | US FAERS | |
| 317 | Guttate psoriasis | FAERS: 1 | US FAERS | |
| 318 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 319 | Hepatic necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 320 | Hepatotoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 321 | Hernia | FAERS: 1 | US FAERS | |
| 322 | Hunger | FAERS: 1 | US FAERS | |
| 323 | Hyperkeratosis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 324 | Hyperplasia | FAERS: 1 | US FAERS | |
| 325 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 326 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 327 | Hysterectomy | FAERS: 1 | US FAERS | |
| 328 | Hysterosalpingo-oophorectomy | FAERS: 1 | US FAERS | |
| 329 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 330 | Impaired work ability | FAERS: 1 | US FAERS | |
| 331 | In-stent coronary artery restenosis | FAERS: 1 | US FAERS | |
| 332 | Infertility | FAERS: 1 | US FAERS | |
| 333 | Influenza | FAERS: 1 | US FAERS | |
| 334 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 335 | Keratitis | FAERS: 1 | US FAERS | |
| 336 | Keratoconus | FAERS: 1 | US FAERS | |
| 337 | Lethargy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 338 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 339 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 340 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 341 | Lung consolidation | FAERS: 1 | US FAERS | |
| 342 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 343 | Malignant melanoma in situ | FAERS: 1 | US FAERS | |
| 344 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 345 | Mastication disorder | FAERS: 1 | US FAERS | |
| 346 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 347 | Meningocele | FAERS: 1 | OFFSIDES US FAERS | |
| 348 | Mental impairment | FAERS: 1 | US FAERS | |
| 349 | Metabolic acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 350 | Metastasis | FAERS: 1 | US FAERS | |
| 351 | Microalbuminuria | FAERS: 1 | OFFSIDES US FAERS | |
| 352 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 353 | Mood swings | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 354 | Morose | FAERS: 1 | US FAERS | |
| 355 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 356 | Myocarditis | FAERS: 1 | US FAERS | |
| 357 | Myopathy | FAERS: 1 | SIDER US FAERS | |
| 358 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 359 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 360 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 361 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 362 | Neuroborreliosis | FAERS: 1 | US FAERS | |
| 363 | Ocular icterus | FAERS: 1 | US FAERS | |
| 364 | Oncologic complication | FAERS: 1 | US FAERS | |
| 365 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 366 | Pancytopenia | FAERS: 1 | SIDER US FAERS | |
| 367 | Penis carcinoma | FAERS: 1 | US FAERS | |
| 368 | Phlebitis | FAERS: 1 | OFFSIDES US FAERS | |
| 369 | Photophobia | FAERS: 1 | SIDER US FAERS | |
| 370 | Pityriasis | FAERS: 1 | US FAERS | |
| 371 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 372 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 373 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 374 | Postoperative thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 375 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 376 | Pregnancy on oral contraceptive | FAERS: 1 | OFFSIDES US FAERS | |
| 377 | Pregnancy test positive | FAERS: 1 | OFFSIDES US FAERS | |
| 378 | Pregnancy with contraceptive device | FAERS: 1 | US FAERS | |
| 379 | Premature Menopause | FAERS: 1 | US FAERS | |
| 380 | Presyncope | FAERS: 1 | US FAERS | |
| 381 | Procollagen type I C-terminal propeptide increased | FAERS: 1 | US FAERS | |
| 382 | Proctostomy | FAERS: 1 | US FAERS | |
| 383 | Product preparation error | FAERS: 1 | US FAERS | |
| 384 | Proteinuria | FAERS: 1 | SIDER US FAERS | |
| 385 | Pseudarthrosis | FAERS: 1 | US FAERS | |
| 386 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 387 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 388 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 389 | Rales | FAERS: 1 | US FAERS | |
| 390 | Rash follicular | FAERS: 1 | US FAERS | |
| 391 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 392 | Respiratory distress | FAERS: 1 | US FAERS | |
| 393 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 394 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 395 | Rhonchi | FAERS: 1 | US FAERS | |
| 396 | Rosacea | FAERS: 1 | US FAERS | |
| 397 | Salivary gland operation | FAERS: 1 | US FAERS | |
| 398 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 399 | Skin discomfort | FAERS: 1 | US FAERS | |
| 400 | Skin necrosis | FAERS: 1 | US FAERS | |
| 401 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 402 | Skin toxicity | FAERS: 1 | US FAERS | |
| 403 | Smoker | FAERS: 1 | US FAERS | |
| 404 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 405 | Spinal Muscular Atrophy | FAERS: 1 | US FAERS | |
| 406 | Stillbirth | FAERS: 1 | US FAERS | |
| 407 | Suture insertion | FAERS: 1 | US FAERS | |
| 408 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 409 | Tachycardia | FAERS: 1 | US FAERS | |
| 410 | Talipes | FAERS: 1 | OFFSIDES US FAERS | |
| 411 | Throat irritation | FAERS: 1 | US FAERS | |
| 412 | Tongue biting | FAERS: 1 | US FAERS | |
| 413 | Tooth Loss | FAERS: 1 | US FAERS | |
| 414 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 415 | Trismus | FAERS: 1 | US FAERS | |
| 416 | Unevaluable event | FAERS: 1 | US FAERS | |
| 417 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 418 | Urinary tract infection | FAERS: 1 | SIDER US FAERS | |
| 419 | Urine calcium decreased | FAERS: 1 | US FAERS | |
| 420 | Urine calcium increased | FAERS: 1 | US FAERS | |
| 421 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 422 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 423 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 424 | Vertigo | FAERS: 1 | US FAERS | |
| 425 | White blood cell count decreased | FAERS: 1 | SIDER US FAERS | |
| 426 | Wound Infection | FAERS: 1 | US FAERS | |
| 427 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 428 | Wound necrosis | FAERS: 1 | US FAERS | |
| 429 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 430 | Xerophthalmia | FAERS: 1 | SIDER US FAERS | |
| 431 | colonoscopy | FAERS: 1 | US FAERS | |
| 432 | Abdominal discomfort | OFFSIDES | ||
| 433 | Abducens Nerve Diseases | 17894719 | CTD | |
| 434 | Acitretin embryopathy | 15470719 | CTD | |
| 435 | Alcohol Intolerance | SIDER | ||
| 436 | Alcohol abuse | SIDER | ||
| 437 | Alcohol consumption | OFFSIDES | ||
| 438 | Altered bowel function | OFFSIDES | ||
| 439 | Amputation | OFFSIDES | ||
| 440 | Androgenetic Alopecia | OFFSIDES | ||
| 441 | Angina Pectoris | Canada Vigilance: 1 | Canada Vigilance | |
| 442 | Anhidrosis | OFFSIDES | ||
| 443 | Anorectal discomfort | SIDER | ||
| 444 | Antimicrobial susceptibility test resistant | OFFSIDES | ||
| 445 | Arthritis, Psoriatic | 14746632 | CTD | |
| 446 | Atrial Flutter | OFFSIDES | ||
| 447 | Atrophic vulvovaginitis | SIDER | ||
| 448 | Balanoposthitis | SIDER | ||
| 449 | Biliary dilatation | OFFSIDES | ||
| 450 | Blepharitis | OFFSIDES SIDER | ||
| 451 | Blood Glucose | OFFSIDES | ||
| 452 | Blood cholesterol | OFFSIDES | ||
| 453 | Blood magnesium decreased | OFFSIDES | ||
| 454 | Blood potassium decreased | OFFSIDES | ||
| 455 | Blood sodium increased | SIDER | ||
| 456 | Bone scan abnormal | OFFSIDES | ||
| 457 | Brain Infarction | 12452748 | CTD | |
| 458 | Bullous eruption | SIDER | ||
| 459 | Burning feet syndrome | Canada Vigilance: 2 | Canada Vigilance | |
| 460 | Bursitis | SIDER | ||
| 461 | CD4 Lymphocytes Decreased | OFFSIDES | ||
| 462 | Carcinoma of lung | SIDER | ||
| 463 | Catheter related complication | OFFSIDES | ||
| 464 | Catheter related infection | OFFSIDES | ||
| 465 | Cell Death | OFFSIDES | ||
| 466 | Ceruminosis | SIDER | ||
| 467 | Chemical and Drug Induced Liver Injury | 2147707 23384448 24085192 | CTD | |
| 468 | Chemical and Drug Induced Liver Injury, Chronic | 11922592 | CTD | |
| 469 | Chronic ulcerative colitis | OFFSIDES | ||
| 470 | Cold sweat | SIDER | ||
| 471 | Common wart | SIDER | ||
| 472 | Confabulation | OFFSIDES | ||
| 473 | Congenital cerebral cyst | OFFSIDES | ||
| 474 | Congenital heart disease | OFFSIDES | ||
| 475 | Conjunctival irritation | OFFSIDES | ||
| 476 | Conjunctivitis | SIDER | ||
| 477 | Constipation | SIDER | ||
| 478 | Corneal Ulcer | OFFSIDES | ||
| 479 | Cramps of lower extremities | SIDER | ||
| 480 | Craniofacial Abnormalities | 8838291 | CTD | |
| 481 | Creatinine increased | SIDER | ||
| 482 | Cyanosis | OFFSIDES SIDER | ||
| 483 | Cytopenia | SIDER | ||
| 484 | Decreased night vision | SIDER | ||
| 485 | Decreased tolerance | SIDER | ||
| 486 | Dehydration | OFFSIDES | ||
| 487 | Diabetes | OFFSIDES | ||
| 488 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 489 | Diabetic | SIDER | ||
| 490 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 491 | Disturbance in sexual arousal | SIDER | ||
| 492 | Drowsiness | OFFSIDES | ||
| 493 | Drug resistance | OFFSIDES | ||
| 494 | Drug toxicity | OFFSIDES | ||
| 495 | Dysgeusia | SIDER | ||
| 496 | Eczema | SIDER | ||
| 497 | Edema | 14746632 | CTD | |
| 498 | Electrocardiogram QT interval abnormal | OFFSIDES | ||
| 499 | Embolism | SIDER | ||
| 500 | Enthesopathy | OFFSIDES | ||
| 501 | Eosinophilic myocarditis | OFFSIDES | ||
| 502 | Epilepsy | OFFSIDES | ||
| 503 | Erythrodermic psoriasis | OFFSIDES | ||
| 504 | Eye irritation | SIDER | ||
| 505 | Fasting | SIDER | ||
| 506 | Febrile Neutropenia | SIDER | ||
| 507 | Feeling abnormal | SIDER | ||
| 508 | Fibrosis | 11922592 | CTD | |
| 509 | Fluid overload | OFFSIDES | ||
| 510 | Furunculosis | SIDER | ||
| 511 | Gallop rhythm present | OFFSIDES | ||
| 512 | Gastritis | SIDER | ||
| 513 | Gastroenteritis | SIDER | ||
| 514 | Gingivitis | SIDER | ||
| 515 | Glossitis | OFFSIDES SIDER | ||
| 516 | Glycosuria | SIDER | ||
| 517 | Granulocytosis | OFFSIDES | ||
| 518 | Grip strength decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 519 | Hair discoloration | SIDER | ||
| 520 | Hearing Loss | 16858938 | CTD | |
| 521 | Hemiparesis | OFFSIDES | ||
| 522 | Hemisensory Neglect | OFFSIDES | ||
| 523 | Hepatitis B positive | OFFSIDES | ||
| 524 | Hepatitis F | SIDER | ||
| 525 | Hordeolum | SIDER | ||
| 526 | Hydrocephalus | OFFSIDES | ||
| 527 | Hyperostosis | SIDER | ||
| 528 | Hypertrichosis | SIDER | ||
| 529 | Hypervitaminosis A | SIDER | ||
| 530 | Hypoplastic Left Heart Syndrome | OFFSIDES | ||
| 531 | Impaired driving ability | OFFSIDES | ||
| 532 | Impaired gastric emptying | OFFSIDES | ||
| 533 | Influenza-like symptoms | SIDER | ||
| 534 | Infusion site mobility decreased | OFFSIDES | ||
| 535 | Intentional self-injury | SIDER | ||
| 536 | Intermittent Claudication | SIDER | ||
| 537 | Iritis | SIDER | ||
| 538 | Joint stiffness | Canada Vigilance: 2 | Canada Vigilance | |
| 539 | Keratitis sicca | OFFSIDES | ||
| 540 | Ketonuria | SIDER | ||
| 541 | Kidney Failure | OFFSIDES | ||
| 542 | Lacrimation abnormal NOS | SIDER | ||
| 543 | Large cell carcinoma of the respiratory tract stage unspecified | OFFSIDES | ||
| 544 | Laryngitis | SIDER | ||
| 545 | Leukorrhea | SIDER | ||
| 546 | Limb Deformities, Congenital | 8838291 | CTD | |
| 547 | Liver Cirrhosis | 2147707 11922592 | CTD | |
| 548 | Lymph Node Tuberculosis | OFFSIDES | ||
| 549 | Lymphocytosis | OFFSIDES | ||
| 550 | Mental status changes | OFFSIDES | ||
| 551 | Monocyte count decreased | SIDER | ||
| 552 | Multiple drug overdose | OFFSIDES | ||
| 553 | Muscle Weakness | OFFSIDES | ||
| 554 | Muscle necrosis | OFFSIDES | ||
| 555 | Myelodysplasia | OFFSIDES | ||
| 556 | Nail bed infection | OFFSIDES | ||
| 557 | Neuritis | SIDER | ||
| 558 | Obesity | SIDER | ||
| 559 | Olecranon bursitis | SIDER | ||
| 560 | Optic Neuritis | SIDER | ||
| 561 | Orthostatic hypertension | OFFSIDES | ||
| 562 | Osteolysis | OFFSIDES | ||
| 563 | Otitis Externa | SIDER | ||
| 564 | Otitis Media | SIDER | ||
| 565 | Overdose | OFFSIDES | ||
| 566 | Palpitations | Canada Vigilance: 1 | Canada Vigilance | |
| 567 | Papillon-Lefevre Disease | 16008657 | CTD | |
| 568 | Periarthritis | OFFSIDES | ||
| 569 | Peripheral Nervous System Diseases | 11859946 12566828 | CTD | |
| 570 | Pharyngitis | SIDER | ||
| 571 | Pityriasis Rubra Pilaris | OFFSIDES | ||
| 572 | Plasmacytoma | OFFSIDES | ||
| 573 | Posterior subcapsular cataract | SIDER | ||
| 574 | Postoperative ileus | OFFSIDES | ||
| 575 | Potentiating drug interaction | OFFSIDES | ||
| 576 | Pregnancy with injectable contraceptive | OFFSIDES | ||
| 577 | Presbyopia | OFFSIDES | ||
| 578 | Protein urine present | SIDER | ||
| 579 | Psoriasis flare-up | SIDER | ||
| 580 | Pulmonary thrombosis | OFFSIDES | ||
| 581 | Purpura | SIDER | ||
| 582 | Purulence | OFFSIDES | ||
| 583 | Rash erythematous | SIDER | ||
| 584 | Rectal tenesmus | SIDER | ||
| 585 | Redness | SIDER | ||
| 586 | Renal cyst | OFFSIDES | ||
| 587 | Rhinitis | SIDER | ||
| 588 | Rhinorrhea | OFFSIDES | ||
| 589 | Saliva altered | SIDER | ||
| 590 | Scab | SIDER | ||
| 591 | Schizoaffective Disorder | OFFSIDES | ||
| 592 | Schizophrenia | OFFSIDES | ||
| 593 | Scleroderma | SIDER | ||
| 594 | Scotoma | SIDER | ||
| 595 | Sinus bradycardia | OFFSIDES | ||
| 596 | Skin Neoplasms | 17894719 | CTD | |
| 597 | Skin Papilloma | SIDER | ||
| 598 | Skin graft infection | Canada Vigilance: 1 | Canada Vigilance | |
| 599 | Skin irritation | SIDER | ||
| 600 | Skin nodule | SIDER | ||
| 601 | Sodium high | SIDER | ||
| 602 | Somnolence | SIDER | ||
| 603 | Spina Bifida | OFFSIDES | ||
| 604 | Stomatitis | SIDER | ||
| 605 | Sudden death | OFFSIDES | ||
| 606 | Sunburn | SIDER | ||
| 607 | Syndesmophyte | OFFSIDES | ||
| 608 | Synovitis | OFFSIDES | ||
| 609 | T-Cell Lymphoma | OFFSIDES | ||
| 610 | Tendinitis | OFFSIDES | ||
| 611 | Tension | SIDER | ||
| 612 | Thromboembolism | SIDER | ||
| 613 | Tongue Neoplasms | 16196285 | CTD | |
| 614 | Tooth repair | OFFSIDES | ||
| 615 | Ulcerative stomatitis | SIDER | ||
| 616 | Ultrasound uterus abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 617 | Umbilical cord vascular disorder | OFFSIDES | ||
| 618 | Vaginal Discharge | SIDER | ||
| 619 | Vascular graft complication | OFFSIDES | ||
| 620 | Vascular purpura | SIDER | ||
| 621 | Venous occlusion | OFFSIDES | ||
| 622 | Ventricular hypokinesia | OFFSIDES | ||
| 623 | Ventricular hypoplasia | OFFSIDES | ||
| 624 | Virus serology test positive | OFFSIDES | ||
| 625 | Vitreous Detachment | OFFSIDES | ||
| 626 | Vulvovaginitis | SIDER | ||
| 627 | Weight Gain | OFFSIDES | ||
| 628 | Wound infection staphylococcal | OFFSIDES | ||
| 629 | Xerosis | Canada Vigilance: 1 | Canada Vigilance | |
| 630 | furuncle | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 631 | melanoma | 16109552 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.