Vemurafenib
(GPXBXXGIAQBQNI-UHFFFAOYSA-N)
Structure
- SMILES
- CCCS(=O)(=O)Nc1ccc(c(c1F)C(=O)c1c[nH]c2c1cc(cn2)c1ccc(cc1)Cl)F
- Type(s)
- Approved
- ATC code(s)
- L01XE15
- Molecular Formula:
- C23H18ClF2N3O3S
- Molecular Weight:
- 489.922
- Log P:
- 6.6980
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 100.3
- CAS Number(s):
- 918504-65-1; 1029872-54-5; 1415041-85-8
Synonym(s)
1.
Vemurafenib
2.
PLX 4032
3.
PLX4032
4.
R05185426
5.
RG-7204
6.
RG7204
7.
Zelboraf
8.
RG 7204
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Arthralgia | FAERS: 697 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 2 | Fatigue | FAERS: 639 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 3 | Disease Progression | FAERS: 489 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 443 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 5 | Alopecia | FAERS: 407 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Sunburn | FAERS: 270 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Myalgia | FAERS: 238 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Vomiting | FAERS: 213 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Pruritus | FAERS: 207 | SIDER US FAERS | |
| 10 | Headache | FAERS: 206 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Squamous cell carcinoma | FAERS: 170 | SIDER US FAERS | |
| 12 | Skin Papilloma | FAERS: 164 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Erythema | FAERS: 160 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Asthenia | FAERS: 133 | SIDER US FAERS | |
| 15 | Weight decreased | FAERS: 114 | SIDER US FAERS | |
| 16 | Hyperkeratosis | FAERS: 112 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Pain | FAERS: 104 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Constipation | FAERS: 100 | SIDER US FAERS | |
| 19 | Drug ineffective | FAERS: 94 | US FAERS | |
| 20 | Peripheral swelling | FAERS: 92 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Dysgeusia | FAERS: 88 | SIDER US FAERS | |
| 22 | Dehydration | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Dry skin | FAERS: 79 | SIDER US FAERS | |
| 24 | Swelling | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Blood lactate dehydrogenase increased | FAERS: 75 | US FAERS | |
| 26 | Joint swelling | FAERS: 74 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Visual Impairment | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Squamous cell carcinoma of skin | FAERS: 66 | SIDER US FAERS | |
| 29 | Acne | FAERS: 64 | US FAERS | |
| 30 | keratoacanthoma | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 31 | Blood creatinine increased | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Intentional product use issue | FAERS: 55 | US FAERS | |
| 33 | Chills | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Pneumonia | FAERS: 52 | US FAERS | |
| 35 | Rash erythematous | FAERS: 52 | US FAERS | |
| 36 | Poor quality sleep | FAERS: 50 | US FAERS | |
| 37 | Impaired work ability | FAERS: 46 | US FAERS | |
| 38 | General physical health deterioration | FAERS: 45 | US FAERS | |
| 39 | Malaise | FAERS: 42 | US FAERS | |
| 40 | Uveitis | FAERS: 42 | SIDER US FAERS | |
| 41 | No adverse event | FAERS: 41 | US FAERS | |
| 42 | Skin toxicity | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Dizziness | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 44 | Hepatotoxicity | FAERS: 36 | SIDER US FAERS | |
| 45 | Burning sensation | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Abdominal Pain | FAERS: 34 | US FAERS | |
| 47 | Chest Pain | FAERS: 34 | US FAERS | |
| 48 | Neutropenia | FAERS: 34 | US FAERS | |
| 49 | Urticaria | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Back Pain | FAERS: 32 | SIDER US FAERS | |
| 51 | Chest discomfort | FAERS: 31 | US FAERS | |
| 52 | Skin reaction | FAERS: 31 | US FAERS | |
| 53 | Atrial Fibrillation | FAERS: 29 | SIDER US FAERS | |
| 54 | Malignant neoplasm progression | FAERS: 29 | US FAERS | |
| 55 | Dermatitis acneiform | FAERS: 28 | US FAERS | |
| 56 | Oropharyngeal pain | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 57 | Skin lesion | FAERS: 27 | US FAERS | |
| 58 | White blood cell count decreased | FAERS: 27 | US FAERS | |
| 59 | Acute kidney injury | FAERS: 26 | US FAERS | |
| 60 | Sepsis | FAERS: 26 | US FAERS | |
| 61 | Dermatitis | FAERS: 25 | SIDER US FAERS | |
| 62 | Hypersensitivity | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Myocardial Infarction | FAERS: 25 | US FAERS | |
| 64 | Pericarditis | FAERS: 25 | US FAERS | |
| 65 | Skin Ulcer | FAERS: 24 | US FAERS | |
| 66 | Stomatitis | FAERS: 24 | US FAERS | |
| 67 | Aspartate Aminotransferase Increased | FAERS: 23 | US FAERS | |
| 68 | Keratosis pilaris | FAERS: 23 | SIDER US FAERS | |
| 69 | Leukopenia | FAERS: 23 | US FAERS | |
| 70 | Stevens-Johnson Syndrome | FAERS: 22 | 25811541 | CTD SIDER US FAERS |
| 71 | Flushing | FAERS: 21 | US FAERS | |
| 72 | Metastasis | FAERS: 21 | US FAERS | |
| 73 | Pancreatitis | FAERS: 21 | US FAERS | |
| 74 | Panniculitis | FAERS: 21 | US FAERS | |
| 75 | Somnolence | FAERS: 21 | US FAERS | |
| 76 | Alanine Aminotransferase Increased | FAERS: 20 | US FAERS | |
| 77 | Febrile Neutropenia | FAERS: 20 | US FAERS | |
| 78 | Hypotension | FAERS: 20 | SIDER US FAERS | |
| 79 | Eosinophilia | FAERS: 19 | SIDER US FAERS | |
| 80 | Infection | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 81 | Malignant melanoma in situ | FAERS: 19 | US FAERS | |
| 82 | Pericardial effusion | FAERS: 19 | US FAERS | |
| 83 | Thrombocytopenia | FAERS: 19 | US FAERS | |
| 84 | Eye pain | FAERS: 18 | US FAERS | |
| 85 | Musculoskeletal Pain | FAERS: 18 | SIDER US FAERS | |
| 86 | Pulmonary Embolism | FAERS: 18 | US FAERS | |
| 87 | Radiation skin injury | FAERS: 18 | US FAERS | |
| 88 | Cholestasis | FAERS: 17 | US FAERS | |
| 89 | Urinary tract infection | FAERS: 17 | US FAERS | |
| 90 | Basal cell carcinoma | FAERS: 16 | SIDER US FAERS | |
| 91 | Epilepsy | FAERS: 16 | US FAERS | |
| 92 | Gamma-Glutamyltransferase Increased | FAERS: 16 | SIDER US FAERS | |
| 93 | Palpitations | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Toxicity to various agents | FAERS: 16 | US FAERS | |
| 95 | Abdominal discomfort | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Actinic keratosis | FAERS: 15 | SIDER US FAERS | |
| 97 | Ageusia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 98 | Amnesia | FAERS: 15 | US FAERS | |
| 99 | Angioedema | FAERS: 15 | US FAERS | |
| 100 | Cerebrovascular accident | FAERS: 15 | US FAERS | |
| 101 | Lymphocyte count decreased | FAERS: 15 | US FAERS | |
| 102 | Tachycardia | FAERS: 15 | US FAERS | |
| 103 | Thermal burn | FAERS: 15 | US FAERS | |
| 104 | Toxic Epidermal Necrolysis | FAERS: 15 | SIDER US FAERS | |
| 105 | furuncle | FAERS: 15 | US FAERS | |
| 106 | Ascites | FAERS: 14 | US FAERS | |
| 107 | Blood alkaline phosphatase increased | FAERS: 14 | US FAERS | |
| 108 | Bone pain | FAERS: 14 | US FAERS | |
| 109 | Erythema Multiforme | FAERS: 14 | SIDER US FAERS | |
| 110 | Limb mass | FAERS: 14 | US FAERS | |
| 111 | Respiratory Failure | FAERS: 14 | US FAERS | |
| 112 | jaundice | FAERS: 14 | US FAERS | |
| 113 | Cellulitis | FAERS: 13 | US FAERS | |
| 114 | Conjunctivitis | FAERS: 13 | US FAERS | |
| 115 | Disseminated Intravascular Coagulation | FAERS: 13 | US FAERS | |
| 116 | Neutrophil count abnormal | FAERS: 13 | US FAERS | |
| 117 | Neutrophilic panniculitis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Transaminases increased | FAERS: 13 | US FAERS | |
| 119 | Tremor | FAERS: 13 | US FAERS | |
| 120 | Unevaluable event | FAERS: 13 | US FAERS | |
| 121 | Anxiety | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Atrial Flutter | FAERS: 12 | US FAERS | |
| 123 | Blindness | FAERS: 12 | US FAERS | |
| 124 | Dysphonia | FAERS: 12 | US FAERS | |
| 125 | Eye irritation | FAERS: 12 | US FAERS | |
| 126 | Lymphadenopathy | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Photophobia | FAERS: 12 | US FAERS | |
| 128 | Arthritis | FAERS: 11 | SIDER US FAERS | |
| 129 | Cyst | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 130 | Deafness | FAERS: 11 | US FAERS | |
| 131 | Diplopia | FAERS: 11 | US FAERS | |
| 132 | Inflammation | FAERS: 11 | US FAERS | |
| 133 | Lymphopenia | FAERS: 11 | US FAERS | |
| 134 | Neutrophil count decreased | FAERS: 11 | US FAERS | |
| 135 | Sarcoidosis | FAERS: 11 | US FAERS | |
| 136 | nervous system disorder | FAERS: 11 | SIDER US FAERS | |
| 137 | Chromaturia | FAERS: 10 | US FAERS | |
| 138 | Flatulence | FAERS: 10 | US FAERS | |
| 139 | Oral candidiasis | FAERS: 10 | US FAERS | |
| 140 | Papilloma | FAERS: 10 | US FAERS | |
| 141 | Pneumonitis | FAERS: 10 | US FAERS | |
| 142 | Abasia | FAERS: 9 | US FAERS | |
| 143 | Acanthosis | FAERS: 9 | US FAERS | |
| 144 | Drug administration error | FAERS: 9 | US FAERS | |
| 145 | Ejection Fraction Decreased | FAERS: 9 | US FAERS | |
| 146 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 147 | Hepatitis | FAERS: 9 | US FAERS | |
| 148 | Melanomatous meningitis | FAERS: 9 | US FAERS | |
| 149 | Memory impairment | FAERS: 9 | US FAERS | |
| 150 | Rash follicular | FAERS: 9 | US FAERS | |
| 151 | Scab | FAERS: 9 | US FAERS | |
| 152 | Tumour haemorrhage | FAERS: 9 | US FAERS | |
| 153 | Drug resistance | FAERS: 8 | US FAERS | |
| 154 | Dyspepsia | FAERS: 8 | US FAERS | |
| 155 | Gastritis | FAERS: 8 | US FAERS | |
| 156 | Hypophagia | FAERS: 8 | US FAERS | |
| 157 | Iridocyclitis | FAERS: 8 | US FAERS | |
| 158 | Lipase increased | FAERS: 8 | US FAERS | |
| 159 | Otitis Externa | FAERS: 8 | US FAERS | |
| 160 | Pain of skin | FAERS: 8 | US FAERS | |
| 161 | Papule | FAERS: 8 | US FAERS | |
| 162 | Proteinuria | FAERS: 8 | US FAERS | |
| 163 | Recall phenomenon | FAERS: 8 | US FAERS | |
| 164 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 165 | Blood cholesterol increased | FAERS: 7 | US FAERS | |
| 166 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 167 | Cholecystitis | FAERS: 7 | US FAERS | |
| 168 | Depressed Level of Consciousness | FAERS: 7 | US FAERS | |
| 169 | Drug dose omission | FAERS: 7 | US FAERS | |
| 170 | Electrocardiogram abnormal | FAERS: 7 | US FAERS | |
| 171 | Electrolyte imbalance | FAERS: 7 | US FAERS | |
| 172 | Erythema Nodosum | FAERS: 7 | SIDER US FAERS | |
| 173 | Influenza | FAERS: 7 | US FAERS | |
| 174 | Intestinal Perforation | FAERS: 7 | US FAERS | |
| 175 | Leukocytosis | FAERS: 7 | US FAERS | |
| 176 | Lip swelling | FAERS: 7 | US FAERS | |
| 177 | Metastatic Neoplasm | FAERS: 7 | US FAERS | |
| 178 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 179 | Pulmonary thrombosis | FAERS: 7 | US FAERS | |
| 180 | Sinus Tachycardia | FAERS: 7 | US FAERS | |
| 181 | Solar dermatitis | FAERS: 7 | US FAERS | |
| 182 | Thrombosis | FAERS: 7 | US FAERS | |
| 183 | Tinnitus | FAERS: 7 | US FAERS | |
| 184 | Vasculitis | FAERS: 7 | SIDER US FAERS | |
| 185 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 186 | Asthenopia | FAERS: 6 | US FAERS | |
| 187 | Bronchitis | FAERS: 6 | US FAERS | |
| 188 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 189 | Cardiac Tamponade | FAERS: 6 | US FAERS | |
| 190 | Cardiotoxicity | FAERS: 6 | US FAERS | |
| 191 | Deep Vein Thrombosis | FAERS: 6 | US FAERS | |
| 192 | Erysipelas | FAERS: 6 | US FAERS | |
| 193 | Facial paralysis | FAERS: 6 | US FAERS | |
| 194 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 195 | Mental status changes | FAERS: 6 | US FAERS | |
| 196 | Neck Pain | FAERS: 6 | US FAERS | |
| 197 | Night sweats | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Nipple pain | FAERS: 6 | US FAERS | |
| 199 | Pancytopenia | FAERS: 6 | US FAERS | |
| 200 | Skin hypertrophy | FAERS: 6 | US FAERS | |
| 201 | Ulcer | FAERS: 6 | US FAERS | |
| 202 | Vertigo | FAERS: 6 | US FAERS | |
| 203 | Xerosis | FAERS: 6 | US FAERS | |
| 204 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 205 | Bronchopneumonia | FAERS: 5 | US FAERS | |
| 206 | Colitis | FAERS: 5 | US FAERS | |
| 207 | Duodenal Ulcer | FAERS: 5 | US FAERS | |
| 208 | Exfoliative rash | FAERS: 5 | US FAERS | |
| 209 | Folliculitis | FAERS: 5 | SIDER US FAERS | |
| 210 | Hemiparesis | FAERS: 5 | US FAERS | |
| 211 | Hordeolum | FAERS: 5 | US FAERS | |
| 212 | Hyperpyrexia | FAERS: 5 | US FAERS | |
| 213 | Intercepted medication error | FAERS: 5 | US FAERS | |
| 214 | Joint stiffness | FAERS: 5 | US FAERS | |
| 215 | Lethargy | FAERS: 5 | US FAERS | |
| 216 | Medication Error | FAERS: 5 | US FAERS | |
| 217 | Melanosis | FAERS: 5 | US FAERS | |
| 218 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 219 | Nystagmus | FAERS: 5 | US FAERS | |
| 220 | Product quality issue | FAERS: 5 | US FAERS | |
| 221 | Pulmonary toxicity | FAERS: 5 | US FAERS | |
| 222 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 223 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 224 | Septic Shock | FAERS: 5 | US FAERS | |
| 225 | Synovitis | FAERS: 5 | US FAERS | |
| 226 | Tongue blistering | FAERS: 5 | US FAERS | |
| 227 | Acantholysis | FAERS: 4 | US FAERS | |
| 228 | Aphasia | FAERS: 4 | US FAERS | |
| 229 | Aphonia | FAERS: 4 | US FAERS | |
| 230 | Benign neoplasm of skin | FAERS: 4 | US FAERS | |
| 231 | Blood bilirubin abnormal | FAERS: 4 | US FAERS | |
| 232 | Blood bilirubin decreased | FAERS: 4 | US FAERS | |
| 233 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 234 | Blood creatinine abnormal | FAERS: 4 | US FAERS | |
| 235 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 236 | Bronchospasm | FAERS: 4 | US FAERS | |
| 237 | Colon adenoma | FAERS: 4 | US FAERS | |
| 238 | Crying | FAERS: 4 | US FAERS | |
| 239 | Cystitis | FAERS: 4 | US FAERS | |
| 240 | Delirium | FAERS: 4 | US FAERS | |
| 241 | Disorientation | FAERS: 4 | US FAERS | |
| 242 | Dysarthria | FAERS: 4 | US FAERS | |
| 243 | Eccrine squamous syringometaplasia | FAERS: 4 | US FAERS | |
| 244 | Electrocardiogram change | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 245 | Gastrointestinal toxicity | FAERS: 4 | US FAERS | |
| 246 | Guillain-Barre Syndrome | FAERS: 4 | US FAERS | |
| 247 | Hypersomnia | FAERS: 4 | US FAERS | |
| 248 | Impaired self-care | FAERS: 4 | US FAERS | |
| 249 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 250 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 251 | Iron deficiency | FAERS: 4 | US FAERS | |
| 252 | Macule | FAERS: 4 | US FAERS | |
| 253 | Melanoma recurrent | FAERS: 4 | US FAERS | |
| 254 | Neutrophilic dermatosis | FAERS: 4 | US FAERS | |
| 255 | Nodule | FAERS: 4 | US FAERS | |
| 256 | Purpura | FAERS: 4 | US FAERS | |
| 257 | Radiation injury | FAERS: 4 | US FAERS | |
| 258 | Radiation necrosis | FAERS: 4 | US FAERS | |
| 259 | Retinal Vein Occlusion | FAERS: 4 | SIDER US FAERS | |
| 260 | Skin neoplasm excision | FAERS: 4 | US FAERS | |
| 261 | Syncope | FAERS: 4 | US FAERS | |
| 262 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 263 | VIIth nerve paralysis | FAERS: 4 | SIDER US FAERS | |
| 264 | Wound Infection | FAERS: 4 | US FAERS | |
| 265 | Abscess | FAERS: 3 | US FAERS | |
| 266 | Acanthoma | FAERS: 3 | US FAERS | |
| 267 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 268 | Agitation | FAERS: 3 | US FAERS | |
| 269 | Anal abscess | FAERS: 3 | US FAERS | |
| 270 | Blood alkaline phosphatase abnormal | FAERS: 3 | US FAERS | |
| 271 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 272 | Blood immunoglobulin G decreased | FAERS: 3 | US FAERS | |
| 273 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 274 | Blood urea increased | FAERS: 3 | US FAERS | |
| 275 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 276 | Choking | FAERS: 3 | US FAERS | |
| 277 | Clostridium difficile infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Cyanosis | FAERS: 3 | US FAERS | |
| 279 | Disability | FAERS: 3 | US FAERS | |
| 280 | Diverticular perforation | FAERS: 3 | US FAERS | |
| 281 | Dysuria | FAERS: 3 | US FAERS | |
| 282 | Ear discomfort | FAERS: 3 | US FAERS | |
| 283 | Eczema | FAERS: 3 | US FAERS | |
| 284 | Emotional disorder | FAERS: 3 | US FAERS | |
| 285 | Enterocolitis bacterial | FAERS: 3 | US FAERS | |
| 286 | Eructation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 287 | Extremity necrosis | FAERS: 3 | US FAERS | |
| 288 | Eye inflammation | FAERS: 3 | US FAERS | |
| 289 | Facial Paresis | FAERS: 3 | US FAERS | |
| 290 | Gaze palsy | FAERS: 3 | US FAERS | |
| 291 | Head discomfort | FAERS: 3 | US FAERS | |
| 292 | Hypercreatinaemia | FAERS: 3 | US FAERS | |
| 293 | Hypertensive cardiomyopathy | FAERS: 3 | US FAERS | |
| 294 | Hypertransaminasaemia | FAERS: 3 | US FAERS | |
| 295 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 296 | Hypoxia | FAERS: 3 | US FAERS | |
| 297 | Incontinence | FAERS: 3 | US FAERS | |
| 298 | Iritis | FAERS: 3 | US FAERS | |
| 299 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 300 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 301 | Malnutrition | FAERS: 3 | SIDER US FAERS | |
| 302 | Mental impairment | FAERS: 3 | US FAERS | |
| 303 | Musculoskeletal chest pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Mycosis Fungoides | FAERS: 3 | US FAERS | |
| 305 | Nocturia | FAERS: 3 | US FAERS | |
| 306 | Ocular discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Optic Neuritis | FAERS: 3 | US FAERS | |
| 308 | Paresis | FAERS: 3 | US FAERS | |
| 309 | Performance status decreased | FAERS: 3 | US FAERS | |
| 310 | Piloerection | FAERS: 3 | US FAERS | |
| 311 | Pregnancy of partner | FAERS: 3 | US FAERS | |
| 312 | Presyncope | FAERS: 3 | US FAERS | |
| 313 | Product use issue | FAERS: 3 | US FAERS | |
| 314 | Radiosensitisation therapy | FAERS: 3 | US FAERS | |
| 315 | Septal panniculitis | FAERS: 3 | US FAERS | |
| 316 | Sinusitis | FAERS: 3 | US FAERS | |
| 317 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 318 | Therapy cessation | FAERS: 3 | US FAERS | |
| 319 | Therapy change | FAERS: 3 | US FAERS | |
| 320 | Throat irritation | FAERS: 3 | US FAERS | |
| 321 | Vitiligo | FAERS: 3 | US FAERS | |
| 322 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 323 | treatment failure | FAERS: 3 | US FAERS | |
| 324 | Accidental overdose | FAERS: 2 | US FAERS | |
| 325 | Aphagia | FAERS: 2 | US FAERS | |
| 326 | Appendicitis | FAERS: 2 | US FAERS | |
| 327 | Arthropathy | FAERS: 2 | US FAERS | |
| 328 | Asphyxia | FAERS: 2 | US FAERS | |
| 329 | Back disorder | FAERS: 2 | US FAERS | |
| 330 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 331 | Blood potassium abnormal | FAERS: 2 | US FAERS | |
| 332 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 333 | Cachexia | FAERS: 2 | US FAERS | |
| 334 | Candida sepsis | FAERS: 2 | US FAERS | |
| 335 | Candidiasis | FAERS: 2 | US FAERS | |
| 336 | Cataract | FAERS: 2 | US FAERS | |
| 337 | Cell Death | FAERS: 2 | US FAERS | |
| 338 | Central nervous system melanoma | FAERS: 2 | US FAERS | |
| 339 | Cheilitis | FAERS: 2 | US FAERS | |
| 340 | Cholangitis | FAERS: 2 | US FAERS | |
| 341 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 342 | Cutaneous sarcoidosis | FAERS: 2 | US FAERS | |
| 343 | Dementia | FAERS: 2 | US FAERS | |
| 344 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 345 | Diet refusal | FAERS: 2 | US FAERS | |
| 346 | Disease recurrence | FAERS: 2 | US FAERS | |
| 347 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 348 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 349 | Drug level increased | FAERS: 2 | US FAERS | |
| 350 | Drug physiologic incompatibility | FAERS: 2 | US FAERS | |
| 351 | Duodenitis | FAERS: 2 | US FAERS | |
| 352 | Echocardiogram abnormal | FAERS: 2 | US FAERS | |
| 353 | Encephalitis | FAERS: 2 | US FAERS | |
| 354 | Enteritis | FAERS: 2 | US FAERS | |
| 355 | Epistaxis | FAERS: 2 | US FAERS | |
| 356 | Expired product administered | FAERS: 2 | US FAERS | |
| 357 | Feeling Cold | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 358 | Frostbite | FAERS: 2 | US FAERS | |
| 359 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 360 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 361 | Genital Herpes | FAERS: 2 | US FAERS | |
| 362 | Glaucoma | FAERS: 2 | US FAERS | |
| 363 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 364 | Hidradenitis | FAERS: 2 | US FAERS | |
| 365 | Hydropneumothorax | FAERS: 2 | US FAERS | |
| 366 | Hyperkeratosis lenticularis perstans | FAERS: 2 | US FAERS | |
| 367 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 368 | Hypogeusia | FAERS: 2 | US FAERS | |
| 369 | Immunosuppression | FAERS: 2 | US FAERS | |
| 370 | Induration | FAERS: 2 | US FAERS | |
| 371 | Infected neoplasm | FAERS: 2 | US FAERS | |
| 372 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 373 | Intussusception | FAERS: 2 | US FAERS | |
| 374 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 375 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 376 | Macular degeneration | FAERS: 2 | US FAERS | |
| 377 | Malignant melanoma stage IV | FAERS: 2 | US FAERS | |
| 378 | Middle insomnia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 379 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 380 | Neuralgia | FAERS: 2 | US FAERS | |
| 381 | Oncologic complication | FAERS: 2 | US FAERS | |
| 382 | Oral fungal infection | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 383 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 384 | Osteosclerosis | FAERS: 2 | US FAERS | |
| 385 | Overdose | FAERS: 2 | US FAERS | |
| 386 | PCO2 decreased | FAERS: 2 | US FAERS | |
| 387 | Palmar erythema | FAERS: 2 | SIDER US FAERS | |
| 388 | Palpable purpura | FAERS: 2 | US FAERS | |
| 389 | Pelvic venous thrombosis | FAERS: 2 | US FAERS | |
| 390 | Periodontitis | FAERS: 2 | US FAERS | |
| 391 | Periorbital contusion | FAERS: 2 | US FAERS | |
| 392 | Peritonitis | FAERS: 2 | US FAERS | |
| 393 | Personality Change | FAERS: 2 | US FAERS | |
| 394 | Physical disability | FAERS: 2 | US FAERS | |
| 395 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 396 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 397 | Pregnancy | FAERS: 2 | US FAERS | |
| 398 | Prerenal failure | FAERS: 2 | US FAERS | |
| 399 | Product dose omission | FAERS: 2 | US FAERS | |
| 400 | Pseudolymphoma | FAERS: 2 | US FAERS | |
| 401 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 402 | Renal pain | FAERS: 2 | US FAERS | |
| 403 | Respiratory distress | FAERS: 2 | US FAERS | |
| 404 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 405 | Retching | FAERS: 2 | US FAERS | |
| 406 | Rheumatic Fever | FAERS: 2 | US FAERS | |
| 407 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 408 | Skin irritation | FAERS: 2 | US FAERS | |
| 409 | Squamous cell carcinoma of lung | FAERS: 2 | US FAERS | |
| 410 | Stasis dermatitis | FAERS: 2 | US FAERS | |
| 411 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 412 | Suicide attempt | FAERS: 2 | US FAERS | |
| 413 | Superficial spreading melanoma stage I | FAERS: 2 | US FAERS | |
| 414 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 415 | Tension Headache | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 416 | Terminal state | FAERS: 2 | US FAERS | |
| 417 | Tooth Loss | FAERS: 2 | US FAERS | |
| 418 | Treatment related secondary malignancy | FAERS: 2 | US FAERS | |
| 419 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 420 | Vascular Access Complication | FAERS: 2 | US FAERS | |
| 421 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 422 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 423 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 424 | Xeroderma | FAERS: 2 | US FAERS | |
| 425 | cancer surgery | FAERS: 2 | US FAERS | |
| 426 | ATRIAL ENLARGEMENT | FAERS: 1 | US FAERS | |
| 427 | Abdominal mass | FAERS: 1 | US FAERS | |
| 428 | Acidosis | FAERS: 1 | US FAERS | |
| 429 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 430 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 431 | Acute psychosis | FAERS: 1 | US FAERS | |
| 432 | Adverse event | FAERS: 1 | US FAERS | |
| 433 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 434 | Allodynia | FAERS: 1 | US FAERS | |
| 435 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 436 | Alveolitis | FAERS: 1 | US FAERS | |
| 437 | Amputation | FAERS: 1 | US FAERS | |
| 438 | Amylase increased | FAERS: 1 | US FAERS | |
| 439 | Amyloidosis | FAERS: 1 | US FAERS | |
| 440 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 441 | Aneurysm | FAERS: 1 | US FAERS | |
| 442 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 443 | Anosmia | FAERS: 1 | US FAERS | |
| 444 | Apathy | FAERS: 1 | US FAERS | |
| 445 | Asthma | FAERS: 1 | US FAERS | |
| 446 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 447 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 448 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 449 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 450 | Blood blister | FAERS: 1 | US FAERS | |
| 451 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 452 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 453 | Blood immunoglobulin A increased | FAERS: 1 | US FAERS | |
| 454 | Blood lactate dehydrogenase decreased | FAERS: 1 | US FAERS | |
| 455 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 456 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 457 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 458 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 459 | Blood urine present | FAERS: 1 | US FAERS | |
| 460 | Bone lesion | FAERS: 1 | US FAERS | |
| 461 | Bowen's Disease | FAERS: 1 | US FAERS | |
| 462 | Brain Abscess | FAERS: 1 | US FAERS | |
| 463 | Brain Death | FAERS: 1 | US FAERS | |
| 464 | Breast tenderness | FAERS: 1 | US FAERS | |
| 465 | Bursitis | FAERS: 1 | US FAERS | |
| 466 | C-reactive protein abnormal | FAERS: 1 | US FAERS | |
| 467 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 468 | Carcinoma in Situ | FAERS: 1 | US FAERS | |
| 469 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 470 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 471 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 472 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 473 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 474 | Choroiditis | FAERS: 1 | US FAERS | |
| 475 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 476 | Completed Suicide | FAERS: 1 | US FAERS | |
| 477 | Compression fracture | FAERS: 1 | US FAERS | |
| 478 | Craniotomy | FAERS: 1 | US FAERS | |
| 479 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 480 | Demyelination | FAERS: 1 | US FAERS | |
| 481 | Depressed mood | FAERS: 1 | US FAERS | |
| 482 | Depression suicidal | FAERS: 1 | US FAERS | |
| 483 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 484 | Device occlusion | FAERS: 1 | US FAERS | |
| 485 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 486 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 487 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 488 | Diffuse vasculitis | FAERS: 1 | US FAERS | |
| 489 | Discomfort | FAERS: 1 | US FAERS | |
| 490 | Dry gangrene | FAERS: 1 | US FAERS | |
| 491 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 492 | Dysgraphia | FAERS: 1 | US FAERS | |
| 493 | Early satiety | FAERS: 1 | US FAERS | |
| 494 | Embolism | FAERS: 1 | US FAERS | |
| 495 | Enterocolitis | FAERS: 1 | US FAERS | |
| 496 | Enthesopathy | FAERS: 1 | US FAERS | |
| 497 | Enuresis | FAERS: 1 | US FAERS | |
| 498 | Epidermolysis | FAERS: 1 | US FAERS | |
| 499 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 500 | Erythrosis | FAERS: 1 | US FAERS | |
| 501 | Exophthalmos | FAERS: 1 | US FAERS | |
| 502 | Expired drug administered | FAERS: 1 | US FAERS | |
| 503 | Extra dose administered | FAERS: 1 | US FAERS | |
| 504 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 505 | Eye Infection | FAERS: 1 | US FAERS | |
| 506 | Eye allergy | FAERS: 1 | US FAERS | |
| 507 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 508 | Eyelid pain | FAERS: 1 | US FAERS | |
| 509 | Eyelid rash | FAERS: 1 | US FAERS | |
| 510 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 511 | Fat necrosis | FAERS: 1 | US FAERS | |
| 512 | Febrile bone marrow aplasia | FAERS: 1 | US FAERS | |
| 513 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 514 | Food Poisoning | FAERS: 1 | US FAERS | |
| 515 | Formication | FAERS: 1 | US FAERS | |
| 516 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 517 | Fungal pharyngitis | FAERS: 1 | US FAERS | |
| 518 | Gangrene | FAERS: 1 | US FAERS | |
| 519 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 520 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 521 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 522 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 523 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 524 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 525 | Gastrointestinal tract adenoma | FAERS: 1 | US FAERS | |
| 526 | Genital erythema | FAERS: 1 | US FAERS | |
| 527 | Genital rash | FAERS: 1 | US FAERS | |
| 528 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 529 | Gingival Hypertrophy | FAERS: 1 | US FAERS | |
| 530 | Gingival Recession | FAERS: 1 | US FAERS | |
| 531 | Gingivitis | FAERS: 1 | US FAERS | |
| 532 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 533 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 534 | Head deformity | FAERS: 1 | US FAERS | |
| 535 | Hemiplegia | FAERS: 1 | US FAERS | |
| 536 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 537 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 538 | Hip surgery | FAERS: 1 | US FAERS | |
| 539 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 540 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 541 | Hospice Care | FAERS: 1 | US FAERS | |
| 542 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 543 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 544 | Hydrothorax | FAERS: 1 | US FAERS | |
| 545 | Hyperlipasaemia | FAERS: 1 | US FAERS | |
| 546 | Hyperplasia | FAERS: 1 | US FAERS | |
| 547 | Hyperventilation | FAERS: 1 | US FAERS | |
| 548 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 549 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 550 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 551 | Incarcerated inguinal hernia | FAERS: 1 | US FAERS | |
| 552 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 553 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 554 | Infected lymphocele | FAERS: 1 | US FAERS | |
| 555 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 556 | Intestinal metastasis | FAERS: 1 | US FAERS | |
| 557 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 558 | Koilonychia | FAERS: 1 | US FAERS | |
| 559 | Laceration | FAERS: 1 | US FAERS | |
| 560 | Lack of satiety | FAERS: 1 | US FAERS | |
| 561 | Limb discomfort | FAERS: 1 | US FAERS | |
| 562 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 563 | Lipase abnormal | FAERS: 1 | US FAERS | |
| 564 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 565 | Loose tooth | FAERS: 1 | US FAERS | |
| 566 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 567 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 568 | Lung Abscess | FAERS: 1 | US FAERS | |
| 569 | Lymph Node Tuberculosis | FAERS: 1 | US FAERS | |
| 570 | Lymphoma | FAERS: 1 | US FAERS | |
| 571 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 572 | Malabsorption | FAERS: 1 | US FAERS | |
| 573 | Malignant ascites | FAERS: 1 | US FAERS | |
| 574 | Malignant dysphagia | FAERS: 1 | US FAERS | |
| 575 | Malignant melanoma of sites other than skin | FAERS: 1 | US FAERS | |
| 576 | Malignant neoplasm of conjunctiva | FAERS: 1 | US FAERS | |
| 577 | Malignant tumour excision | FAERS: 1 | US FAERS | |
| 578 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 579 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 580 | Medication residue | FAERS: 1 | US FAERS | |
| 581 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 582 | Meningitis | FAERS: 1 | US FAERS | |
| 583 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 584 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 585 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 586 | Miliaria | FAERS: 1 | US FAERS | |
| 587 | Mole excision | FAERS: 1 | US FAERS | |
| 588 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 589 | Monoparesis | FAERS: 1 | US FAERS | |
| 590 | Mood swings | FAERS: 1 | US FAERS | |
| 591 | Mouth swelling | FAERS: 1 | US FAERS | |
| 592 | Mucoepidermoid Carcinoma | FAERS: 1 | US FAERS | |
| 593 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 594 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 595 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 596 | Myocarditis | FAERS: 1 | US FAERS | |
| 597 | Myopathy | FAERS: 1 | US FAERS | |
| 598 | Necrosis | FAERS: 1 | US FAERS | |
| 599 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 600 | Neuritis | FAERS: 1 | US FAERS | |
| 601 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 602 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 603 | Noninfectious myelitis | FAERS: 1 | US FAERS | |
| 604 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 605 | Ocular icterus | FAERS: 1 | US FAERS | |
| 606 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 607 | Oral pain | FAERS: 1 | US FAERS | |
| 608 | Orchitis | FAERS: 1 | US FAERS | |
| 609 | Osteolysis | FAERS: 1 | US FAERS | |
| 610 | Osteoporosis | FAERS: 1 | US FAERS | |
| 611 | Otitis Media | FAERS: 1 | US FAERS | |
| 612 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 613 | Pancreatic toxicity | FAERS: 1 | US FAERS | |
| 614 | Paranoia | FAERS: 1 | US FAERS | |
| 615 | Paraparesis | FAERS: 1 | US FAERS | |
| 616 | Paraplegia | FAERS: 1 | US FAERS | |
| 617 | Penile swelling | FAERS: 1 | US FAERS | |
| 618 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 619 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 620 | Petechiae | FAERS: 1 | US FAERS | |
| 621 | Pharyngitis | FAERS: 1 | US FAERS | |
| 622 | Photodermatosis | FAERS: 1 | US FAERS | |
| 623 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 624 | Pneumothorax | FAERS: 1 | US FAERS | |
| 625 | Polyarthritis | FAERS: 1 | US FAERS | |
| 626 | Polyneuropathy chronic | FAERS: 1 | US FAERS | |
| 627 | Polyuria | FAERS: 1 | US FAERS | |
| 628 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 629 | Post inflammatory pigmentation change | FAERS: 1 | US FAERS | |
| 630 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 631 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 632 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 633 | Product administration error | FAERS: 1 | US FAERS | |
| 634 | Product coating issue | FAERS: 1 | US FAERS | |
| 635 | Product storage error | FAERS: 1 | US FAERS | |
| 636 | Productive Cough | FAERS: 1 | US FAERS | |
| 637 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 638 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 639 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 640 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 641 | Radiation proctitis | FAERS: 1 | US FAERS | |
| 642 | Radicular pain | FAERS: 1 | US FAERS | |
| 643 | Radiotherapy to brain | FAERS: 1 | US FAERS | |
| 644 | Rectal abscess | FAERS: 1 | US FAERS | |
| 645 | Regurgitation | FAERS: 1 | US FAERS | |
| 646 | Relapsing Fever | FAERS: 1 | US FAERS | |
| 647 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 648 | Renal Colic | FAERS: 1 | US FAERS | |
| 649 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 650 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 651 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 652 | Retinal Vasculitis | FAERS: 1 | US FAERS | |
| 653 | Retinitis | FAERS: 1 | US FAERS | |
| 654 | Sarcopenia | FAERS: 1 | US FAERS | |
| 655 | Sciatica | FAERS: 1 | US FAERS | |
| 656 | Scleritis | FAERS: 1 | US FAERS | |
| 657 | Scleroderma | FAERS: 1 | US FAERS | |
| 658 | Scrotal erythema | FAERS: 1 | US FAERS | |
| 659 | Sebaceous hyperplasia | FAERS: 1 | US FAERS | |
| 660 | Shock | FAERS: 1 | US FAERS | |
| 661 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 662 | Sinus headache | FAERS: 1 | US FAERS | |
| 663 | Skin Angiosarcoma | FAERS: 1 | US FAERS | |
| 664 | Skin Induration | FAERS: 1 | US FAERS | |
| 665 | Solar lentigo | FAERS: 1 | US FAERS | |
| 666 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 667 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 668 | Starvation | FAERS: 1 | US FAERS | |
| 669 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 670 | Stress | FAERS: 1 | US FAERS | |
| 671 | Sudden death | FAERS: 1 | US FAERS | |
| 672 | Supraventricular tachyarrhythmia | FAERS: 1 | US FAERS | |
| 673 | Suture rupture | FAERS: 1 | US FAERS | |
| 674 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 675 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 676 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 677 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 678 | Therapy responder | FAERS: 1 | US FAERS | |
| 679 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 680 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 681 | Thyroiditis | FAERS: 1 | US FAERS | |
| 682 | Tonsillitis | FAERS: 1 | US FAERS | |
| 683 | Tooth Infection | FAERS: 1 | US FAERS | |
| 684 | Total bile acids increased | FAERS: 1 | US FAERS | |
| 685 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 686 | Unevaluable therapy | FAERS: 1 | US FAERS | |
| 687 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 688 | Urinary Retention | FAERS: 1 | US FAERS | |
| 689 | Vasospasm | FAERS: 1 | US FAERS | |
| 690 | Venous occlusion | FAERS: 1 | US FAERS | |
| 691 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 692 | Ventricular enlargement | FAERS: 1 | US FAERS | |
| 693 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 694 | Vitritis | FAERS: 1 | US FAERS | |
| 695 | Vulvovaginal warts | FAERS: 1 | US FAERS | |
| 696 | Wound decomposition | FAERS: 1 | US FAERS | |
| 697 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 698 | Common wart | SIDER | ||
| 699 | Dermatitis, Phototoxic | 24154489 | CTD | |
| 700 | Infestation | SIDER | ||
| 701 | Keratosis | SIDER | ||
| 702 | Kidney Diseases | 26930506 | CTD | |
| 703 | Metastatic melanoma | SIDER | ||
| 704 | Neoplasm Invasiveness | 26640592 | CTD | |
| 705 | melanoma | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.