MetaADEDB: Drug

MetaADEDB 2.0 @ LMMD

Haloperidol

(LNEPOXFFQSENCJ-UHFFFAOYSA-N)

Structure

SMILES: Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)(O)c1ccc(cc1)Cl
Type(s): Approved
ATC code(s): N05AD01
Molecular Formula:: C21H23ClFNO2
Molecular Weight:: 375.864
Log P:: 4.3635
Hydrogen Bond Acceptor:: 3
Hydrogen Bond Donor:: 1
TPSA:: 40.54
CAS Number(s):: 52-86-8; 61788-97-4; 177716-59-5

Synonym(s)

Haloperidol

Haldol

External Link(s)

MeSH	D006220
PubChem Compound	3559
BindingDB	21398
ChEBI	5613
CHEMBL	CHEMBL54
DrugBank	DB00502
DrugCentral	1353
IUPHAR/BPS Guide to PHARMACOLOGY	86
KEGG	cpd:C01814 dr:D00136
Therapeutic Target Database	D0D1AL
ZINC	537822

Adverse Drug Event(s)

	Name	Number of Reports	Reference(s)	Data Source
1	Dystonia	FAERS: 174 Canada Vigilance: 16	View details 36644 87799 115074 441236 589060 826968 914115 1119613 1249696 1322069 1974747 2568376 2827216 2872206 2898212 3193583 3470140 3597801 6106123 6428371 7270747 7420718 7468850 7953053 7977894 8018801 8599412 8644096 8919580 9013402 9374198 9483263 10350027 10435384 10713387 10847307 11164078 11476129 12037164 12927004 12974990 15168934 15534454 16001412 17713320 18652109 19192477 21029743	CTD Canada Vigilance US FAERS
2	Somnolence	FAERS: 156 Canada Vigilance: 19		Canada Vigilance SIDER US FAERS
3	Tremor	FAERS: 146 Canada Vigilance: 47	View details 391328 1260604 2036482 2354039 5526730 7021451 7597122 9681765 9699709 9716319 10389620 10847307 11434401 11874220 12223254 17042884 17224721 18508458	CTD SIDER Canada Vigilance US FAERS
4	Neuroleptic Malignant Syndrome	FAERS: 99 Canada Vigilance: 1	View details 1590507 1891487 1973548 2213055 2562951 2720007 6121542 6130277 6134661 6146918 6238132 6407647 6407706 6662980 6703834 6732389 6824251 6836380 6844982 6864584 7569118 7999444 8107921 8683067 8828352 8956674 8961772 9128030 9637888 10628507 11282706 12152854 12195138 12397878 12872187 12883457 15684854 15830831 16669738 17214072 19820435 19857430 20587766	CTD OFFSIDES SIDER Canada Vigilance US FAERS
5	Drug ineffective	FAERS: 95 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
6	Agitation	FAERS: 84 Canada Vigilance: 7		Canada Vigilance SIDER US FAERS
7	Akathisia	FAERS: 82 Canada Vigilance: 20		Canada Vigilance SIDER US FAERS
8	Tardive Dyskinesia	FAERS: 80 Canada Vigilance: 4		Canada Vigilance OFFSIDES SIDER US FAERS
9	Toxicity to various agents	FAERS: 70 Canada Vigilance: 1		Canada Vigilance US FAERS
10	Suicide attempt	FAERS: 64		US FAERS
11	Hypersensitivity	FAERS: 60 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
12	Overdose	FAERS: 59 Canada Vigilance: 1		Canada Vigilance US FAERS
13	Incorrect route of drug administration	FAERS: 57		OFFSIDES US FAERS
14	Musculoskeletal stiffness	FAERS: 57 Canada Vigilance: 5		Canada Vigilance OFFSIDES SIDER US FAERS
15	Feeling abnormal	FAERS: 56		SIDER US FAERS
16	Malaise	FAERS: 52 Canada Vigilance: 1		Canada Vigilance US FAERS
17	Adverse event	FAERS: 51		US FAERS
18	Accidental exposure	FAERS: 49		US FAERS
19	Anxiety	FAERS: 48 Canada Vigilance: 2		Canada Vigilance OFFSIDES SIDER US FAERS
20	Medication Error	FAERS: 45		US FAERS
21	Tachycardia	FAERS: 44 Canada Vigilance: 5	8956674	CTD SIDER Canada Vigilance US FAERS
22	Muscle Rigidity	FAERS: 42 Canada Vigilance: 19	View details 762029 2036482 2998546 3538105 3600821 3654715 3711363 3780846 7856468 8573063 8961772 9017254 9112661 9166335 9286616 9630698 9716319 9826074 9871435 10353425 10594343 11026478 11382401 11400182 11543761 12231232 12373537 14614949 15919101 16407246	CTD SIDER Canada Vigilance US FAERS
23	Restlessness	FAERS: 41 Canada Vigilance: 1		Canada Vigilance US FAERS
24	Product use issue	FAERS: 38		US FAERS
25	Accidental drug intake by child	FAERS: 36		US FAERS
26	Drooling	FAERS: 36		US FAERS
27	Drug abuse	FAERS: 35		US FAERS
28	Fatigue	FAERS: 35 Canada Vigilance: 3	3711028 11476129 12721815	CTD Canada Vigilance US FAERS
29	Headache	FAERS: 34 Canada Vigilance: 4	9035996	CTD SIDER Canada Vigilance US FAERS
30	Cardiac Arrest	FAERS: 33 Canada Vigilance: 3		Canada Vigilance SIDER US FAERS
31	Asthenia	FAERS: 32 Canada Vigilance: 4		Canada Vigilance US FAERS
32	Dizziness	FAERS: 32 Canada Vigilance: 9		Canada Vigilance SIDER US FAERS
33	Pain	FAERS: 32 Canada Vigilance: 1	16563475	CTD Canada Vigilance US FAERS
34	Incorrect dose administered	FAERS: 31		US FAERS
35	Delirium	FAERS: 29	View details 233713 2896642 3805341 4003613 8561204 9326840 9819955 14685663 15534454 16946100 18442876 20413252	CTD US FAERS
36	Sopor	FAERS: 29		US FAERS
37	Trismus	FAERS: 29 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
38	Drug dose omission	FAERS: 27		US FAERS
39	Nausea	FAERS: 27 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
40	Vomiting	FAERS: 26 Canada Vigilance: 10	2947255 12593651 16764227	CTD SIDER Canada Vigilance US FAERS
41	Depressed Level of Consciousness	FAERS: 24 Canada Vigilance: 1		Canada Vigilance US FAERS
42	Myalgia	FAERS: 24		US FAERS
43	Dysarthria	FAERS: 23 Canada Vigilance: 1	6806252	CTD Canada Vigilance US FAERS
44	Hypersomnia	FAERS: 23		US FAERS
45	Torticollis	FAERS: 23 Canada Vigilance: 8	2878216 14519055 15065752	CTD SIDER Canada Vigilance US FAERS
46	Altered state of consciousness	FAERS: 21		OFFSIDES US FAERS
47	Sluggishness	FAERS: 21		US FAERS
48	Unresponsive to stimuli	FAERS: 21		OFFSIDES US FAERS
49	Pneumonia	FAERS: 20		US FAERS
50	Rhabdomyolysis	FAERS: 20	7569118 8828352 9637888	CTD OFFSIDES US FAERS
51	Unevaluable event	FAERS: 20		OFFSIDES US FAERS
52	Weight decreased	FAERS: 20		SIDER US FAERS
53	Accidental exposure to product by child	FAERS: 18		US FAERS
54	Aphasia	FAERS: 18 Canada Vigilance: 1		Canada Vigilance US FAERS
55	Lethargy	FAERS: 18		SIDER US FAERS
56	Visual Impairment	FAERS: 18		SIDER US FAERS
57	Cerebrovascular accident	FAERS: 17		US FAERS
58	Constipation	FAERS: 17 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
59	Hypotension	FAERS: 17 Canada Vigilance: 6	View details 2161850 2632409 6727013 8577817 10847307	CTD SIDER Canada Vigilance US FAERS
60	Intentional self-injury	FAERS: 17		US FAERS
61	Blood creatine phosphokinase increased	FAERS: 16 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
62	Diabetes Mellitus	FAERS: 16 Canada Vigilance: 1		Canada Vigilance US FAERS
63	Mental status changes	FAERS: 16		OFFSIDES US FAERS
64	Abasia	FAERS: 15		US FAERS
65	Dehydration	FAERS: 15		US FAERS
66	Disorientation	FAERS: 15 Canada Vigilance: 2		Canada Vigilance US FAERS
67	Drug exposure during pregnancy	FAERS: 15		US FAERS
68	Restless Legs Syndrome	FAERS: 15		US FAERS
69	Accidental overdose	FAERS: 14		US FAERS
70	Catatonia	FAERS: 14 Canada Vigilance: 1	View details 696912 889419 985694 2593980 2861619 3197020 6134661 6139391 6889747 7122807 15273762 17484951	CTD SIDER Canada Vigilance US FAERS
71	Oculogyric crisis	FAERS: 14 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
72	Activities of daily living impaired	FAERS: 13		US FAERS
73	Amnesia	FAERS: 13 Canada Vigilance: 1	12596523	CTD Canada Vigilance US FAERS
74	Angioedema	FAERS: 13		US FAERS
75	Joint stiffness	FAERS: 13 Canada Vigilance: 1		Canada Vigilance US FAERS
76	Paranoia	FAERS: 13 Canada Vigilance: 1		Canada Vigilance OFFSIDES US FAERS
77	Blood prolactin increased	FAERS: 12		US FAERS
78	Crying	FAERS: 12		US FAERS
79	Drug administration error	FAERS: 12		OFFSIDES US FAERS
80	Hypokinesia	FAERS: 12	View details 2422327 2880435 3711363 7597122 9416775 9716319 10847307 12223254 12938655 15958736 16237164 16564428 17224721 18495311 19429072	CTD OFFSIDES SIDER US FAERS
81	Memory impairment	FAERS: 12 Canada Vigilance: 1		Canada Vigilance US FAERS
82	Myocardial Infarction	FAERS: 12		US FAERS
83	Palpitations	FAERS: 12		US FAERS
84	Product quality issue	FAERS: 12		US FAERS
85	Schizophrenia	FAERS: 12	View details 103114 369395 391328 788001 1103205 1119614 1291253 1304992 1322069 1459885 1830565 1883257 2378546 2568094 2782476 3205888 3377643 3711363 4076529 4605009 6123407 6148118 7037757 7214106 7521534 7540426 7578666 7694306 7806697 7831996 7841134 8018801 8048341 8301292 8379567 8526975 8852864 9109178 9184614 9247978 9265916 9463841 9488926 9522104 9564201 9592806 9659857 9827620 9988841 10200746 10379522 10468314 10484947 10527233 10693159 10847307 10868556 11207340 11291531 11483480 11576036 11793611 12095078 12223254 12271828 12490774 12505132 12721815 12974990 14733451 15065752 15096069 15289996 15920378 16953381 17024549 17542047 17644313 17875112 18204364 18513383 18577931 18583682 18996465 19118983 19369910 19683614 19698552 19742187 20107430 20520283 21422766 24739405 25085534	CTD OFFSIDES US FAERS
86	Urinary Retention	FAERS: 12 Canada Vigilance: 7	8946091 9065967 9868574	CTD SIDER Canada Vigilance US FAERS
87	Wrong drug administered	FAERS: 12		OFFSIDES US FAERS
88	Anger	FAERS: 11		US FAERS
89	Back Pain	FAERS: 11		US FAERS
90	Myoclonus	FAERS: 11 Canada Vigilance: 1	19526195	CTD Canada Vigilance US FAERS
91	Opisthotonus	FAERS: 11 Canada Vigilance: 4		Canada Vigilance SIDER US FAERS
92	Blindness	FAERS: 10		US FAERS
93	Erythema	FAERS: 10		US FAERS
94	Intentional drug misuse	FAERS: 10		OFFSIDES US FAERS
95	Sinus Tachycardia	FAERS: 10		US FAERS
96	Vertigo	FAERS: 10 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
97	Wrong technique in drug usage process	FAERS: 10		US FAERS
98	Abdominal Pain	FAERS: 9 Canada Vigilance: 1		Canada Vigilance US FAERS
99	Bradycardia	FAERS: 9 Canada Vigilance: 2	7391987 8577817 22744888	CTD OFFSIDES Canada Vigilance US FAERS
100	Cogwheel Rigidity	FAERS: 9		SIDER US FAERS
101	Dementia	FAERS: 9	View details 1264138 9469697 11575062 16886695 19724997	CTD US FAERS
102	Drug dispensing error	FAERS: 9		OFFSIDES US FAERS
103	Drug prescribing error	FAERS: 9		US FAERS
104	Hyperreflexia	FAERS: 9 Canada Vigilance: 2		Canada Vigilance US FAERS
105	No adverse event	FAERS: 9		US FAERS
106	Poisoning	FAERS: 9		US FAERS
107	Pulmonary Embolism	FAERS: 9		US FAERS
108	Wheezing	FAERS: 9		US FAERS
109	Apathy	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
110	Arthralgia	FAERS: 8		US FAERS
111	Ataxia	FAERS: 8 Canada Vigilance: 2	18239784	CTD OFFSIDES Canada Vigilance US FAERS
112	Colonic Pseudo-Obstruction	FAERS: 8		US FAERS
113	Cyanosis	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
114	Drug diversion	FAERS: 8		US FAERS
115	Emotional disorder	FAERS: 8		US FAERS
116	General physical health deterioration	FAERS: 8		OFFSIDES US FAERS
117	Incoherent	FAERS: 8		OFFSIDES US FAERS
118	Irritable Bowel Syndrome	FAERS: 8		US FAERS
119	Leukocytosis	FAERS: 8		SIDER US FAERS
120	Mental impairment	FAERS: 8 Canada Vigilance: 1		Canada Vigilance US FAERS
121	Muscle tightness	FAERS: 8 Canada Vigilance: 3		Canada Vigilance US FAERS
122	Product availability issue	FAERS: 8		US FAERS
123	Respiratory distress	FAERS: 8		US FAERS
124	Stress	FAERS: 8		US FAERS
125	Urinary tract infection	FAERS: 8		US FAERS
126	Bruxism	FAERS: 7 Canada Vigilance: 2		Canada Vigilance US FAERS
127	Chest Pain	FAERS: 7		US FAERS
128	Chills	FAERS: 7 Canada Vigilance: 3		Canada Vigilance US FAERS
129	Drug toxicity	FAERS: 7		OFFSIDES US FAERS
130	Epilepsy	FAERS: 7	3751418 7715822	CTD US FAERS
131	Inappropriate schedule of drug administration	FAERS: 7		US FAERS
132	Injection site pain	FAERS: 7		US FAERS
133	Nystagmus	FAERS: 7		SIDER US FAERS
134	Pallor	FAERS: 7 Canada Vigilance: 2		Canada Vigilance US FAERS
135	Pruritus	FAERS: 7 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
136	Rash erythematous	FAERS: 7		US FAERS
137	Therapeutic response unexpected	FAERS: 7		US FAERS
138	Atrial Fibrillation	FAERS: 6 Canada Vigilance: 1		Canada Vigilance US FAERS
139	Bradykinesia	FAERS: 6		SIDER US FAERS
140	Discomfort	FAERS: 6		US FAERS
141	Drug screen positive	FAERS: 6		US FAERS
142	Dysphonia	FAERS: 6 Canada Vigilance: 4		Canada Vigilance US FAERS
143	Emotional distress	FAERS: 6		US FAERS
144	Infection	FAERS: 6		OFFSIDES US FAERS
145	Maternal exposure during pregnancy	FAERS: 6		US FAERS
146	Nervousness	FAERS: 6		US FAERS
147	Neutropenia	FAERS: 6		SIDER US FAERS
148	Pharmaceutical product complaint	FAERS: 6		US FAERS
149	Respiratory Failure	FAERS: 6		OFFSIDES US FAERS
150	Respiratory arrest	FAERS: 6 Canada Vigilance: 2		Canada Vigilance US FAERS
151	Sexual Dysfunction	FAERS: 6		SIDER US FAERS
152	Stupor	FAERS: 6 Canada Vigilance: 3	2945998	CTD Canada Vigilance US FAERS
153	Sudden death	FAERS: 6		OFFSIDES SIDER US FAERS
154	nervous system disorder	FAERS: 6		SIDER US FAERS
155	Accidental exposure to product	FAERS: 5		US FAERS
156	Alopecia	FAERS: 5		SIDER US FAERS
157	Blepharospasm	FAERS: 5	9827620	CTD US FAERS
158	Blood creatinine increased	FAERS: 5		OFFSIDES US FAERS
159	Cerebral disorder	FAERS: 5		US FAERS
160	Clonus	FAERS: 5		US FAERS
161	Contraindicated product administered	FAERS: 5		US FAERS
162	Deep Vein Thrombosis	FAERS: 5		US FAERS
163	Incorrect route of product administration	FAERS: 5		US FAERS
164	Intention tremor	FAERS: 5		US FAERS
165	Intentional product misuse	FAERS: 5		US FAERS
166	Multiple allergies	FAERS: 5		US FAERS
167	Nephrogenic Diabetes Insipidus	FAERS: 5		OFFSIDES US FAERS
168	Nonspecific reaction	FAERS: 5		US FAERS
169	Obesity	FAERS: 5		US FAERS
170	Oromandibular dystonia	FAERS: 5		US FAERS
171	Product use in unapproved indication	FAERS: 5		US FAERS
172	Retching	FAERS: 5		US FAERS
173	Screaming	FAERS: 5		US FAERS
174	Therapy non-responder	FAERS: 5		US FAERS
175	Thirst	FAERS: 5		US FAERS
176	Thrombosis	FAERS: 5		US FAERS
177	Urinary Incontinence	FAERS: 5 Canada Vigilance: 2		Canada Vigilance US FAERS
178	Acute psychosis	FAERS: 4		OFFSIDES US FAERS
179	Anticholinergic Syndrome	FAERS: 4		US FAERS
180	Aspartate Aminotransferase Increased	FAERS: 4		US FAERS
181	Bedridden	FAERS: 4		US FAERS
182	Blunted affect	FAERS: 4		US FAERS
183	Bradyphrenia	FAERS: 4		US FAERS
184	Cerebral Infarction	FAERS: 4		US FAERS
185	Cholestasis	FAERS: 4		SIDER US FAERS
186	Chorea	FAERS: 4	3382897 8026137	CTD US FAERS
187	Completed Suicide	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
188	Depressed mood	FAERS: 4		US FAERS
189	Drug Dependence	FAERS: 4		US FAERS
190	Dyspepsia	FAERS: 4		SIDER US FAERS
191	Electrocardiogram abnormal	FAERS: 4		US FAERS
192	Erectile dysfunction	FAERS: 4 Canada Vigilance: 1	View details 10546163 11097980 11203037 12084416	CTD SIDER Canada Vigilance US FAERS
193	Incorrect drug administration rate	FAERS: 4		US FAERS
194	Intestinal Obstruction	FAERS: 4		OFFSIDES US FAERS
195	Mouth swelling	FAERS: 4		US FAERS
196	Neck Pain	FAERS: 4		US FAERS
197	Nuchal Rigidity	FAERS: 4		US FAERS
198	Obsessive-Compulsive Disorder	FAERS: 4		US FAERS
199	Ophthalmoplegia	FAERS: 4		US FAERS
200	Panic Disorder	FAERS: 4		US FAERS
201	Product label issue	FAERS: 4		US FAERS
202	Product packaging issue	FAERS: 4		US FAERS
203	Respiratory Depression	FAERS: 4		US FAERS
204	Resting Tremor	FAERS: 4		US FAERS
205	Staring	FAERS: 4		US FAERS
206	Swelling	FAERS: 4 Canada Vigilance: 1		Canada Vigilance US FAERS
207	Tongue movement disturbance	FAERS: 4		US FAERS
208	Urticaria	FAERS: 4		SIDER US FAERS
209	Ventricular Fibrillation	FAERS: 4 Canada Vigilance: 1	6501720	CTD SIDER Canada Vigilance US FAERS
210	Wrong technique in product usage process	FAERS: 4		US FAERS
211	Akinesia	FAERS: 3 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
212	Alanine Aminotransferase Increased	FAERS: 3		US FAERS
213	Angina Pectoris	FAERS: 3		US FAERS
214	Anhedonia	FAERS: 3		US FAERS
215	Antipsychotic drug level above therapeutic	FAERS: 3		OFFSIDES US FAERS
216	Aphagia	FAERS: 3		US FAERS
217	Blood cortisol increased	FAERS: 3		US FAERS
218	Bone pain	FAERS: 3		US FAERS
219	Bronchopneumonia	FAERS: 3		US FAERS
220	Circumstance or information capable of leading to medication error	FAERS: 3		US FAERS
221	Disability	FAERS: 3		US FAERS
222	Drug abuser	FAERS: 3		US FAERS
223	Drug level increased	FAERS: 3		US FAERS
224	Drug withdrawal syndrome	FAERS: 3		US FAERS
225	Dysgeusia	FAERS: 3		US FAERS
226	Dysuria	FAERS: 3		US FAERS
227	Euphoric mood	FAERS: 3		SIDER US FAERS
228	Exposure during breast feeding	FAERS: 3		US FAERS
229	Flat affect	FAERS: 3		US FAERS
230	Flushing	FAERS: 3 Canada Vigilance: 4		Canada Vigilance US FAERS
231	Foaming at mouth	FAERS: 3		US FAERS
232	Gamma-Glutamyltransferase Increased	FAERS: 3		US FAERS
233	General physical condition abnormal	FAERS: 3		US FAERS
234	Hallucinations, mixed	FAERS: 3		US FAERS
235	Head discomfort	FAERS: 3		US FAERS
236	Hepatitis	FAERS: 3 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
237	Hunger	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
238	Hypophagia	FAERS: 3		OFFSIDES US FAERS
239	Ileus	FAERS: 3		US FAERS
240	Impatience	FAERS: 3		US FAERS
241	Incontinence	FAERS: 3		US FAERS
242	Leukopenia	FAERS: 3 Canada Vigilance: 3	4556089	CTD SIDER Canada Vigilance US FAERS
243	Lip swelling	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
244	Malnutrition	FAERS: 3		SIDER US FAERS
245	Mood swings	FAERS: 3		US FAERS
246	Negativism	FAERS: 3		US FAERS
247	Pancreatitis	FAERS: 3		OFFSIDES US FAERS
248	Parotitis	FAERS: 3		US FAERS
249	Personality Change	FAERS: 3		US FAERS
250	Posturing	FAERS: 3		US FAERS
251	Priapism	FAERS: 3		SIDER US FAERS
252	Product substitution issue	FAERS: 3		US FAERS
253	Psychiatric symptom	FAERS: 3		US FAERS
254	Sepsis	FAERS: 3		US FAERS
255	Septic Shock	FAERS: 3		OFFSIDES US FAERS
256	Sperm count abnormal	FAERS: 3		US FAERS
257	Spermatozoa morphology abnormal	FAERS: 3		US FAERS
258	Stridor	FAERS: 3		US FAERS
259	Syncope	FAERS: 3 Canada Vigilance: 2	9120531	CTD Canada Vigilance US FAERS
260	Tension	FAERS: 3 Canada Vigilance: 1		Canada Vigilance US FAERS
261	Toothache	FAERS: 3		US FAERS
262	White blood cell count decreased	FAERS: 3		US FAERS
263	kyphosis	FAERS: 3		US FAERS
264	treatment failure	FAERS: 3		US FAERS
265	Abdominal discomfort	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
266	Alcohol withdrawal syndrome	FAERS: 2		OFFSIDES US FAERS
267	Anaphylactic shock	FAERS: 2		SIDER US FAERS
268	Anorexia	FAERS: 2		SIDER US FAERS
269	Antiphospholipid antibodies positive	FAERS: 2		US FAERS
270	Apallic syndrome	FAERS: 2		US FAERS
271	Aphonia	FAERS: 2		US FAERS
272	Arthritis	FAERS: 2		US FAERS
273	Atrioventricular Block	FAERS: 2		US FAERS
274	Autonomic nervous system imbalance	FAERS: 2		US FAERS
275	Blood albumin decreased	FAERS: 2		OFFSIDES US FAERS
276	Blood glucose decreased	FAERS: 2		OFFSIDES US FAERS
277	Blood glucose increased	FAERS: 2		US FAERS
278	Blood osmolarity decreased	FAERS: 2		US FAERS
279	Blood potassium decreased	FAERS: 2		OFFSIDES US FAERS
280	Blood pressure fluctuation	FAERS: 2		US FAERS
281	Blood urea increased	FAERS: 2		OFFSIDES US FAERS
282	Body temperature fluctuation	FAERS: 2		US FAERS
283	Breast tenderness	FAERS: 2		US FAERS
284	Bronchospasm	FAERS: 2		SIDER US FAERS
285	Camptocormia	FAERS: 2		US FAERS
286	Cellulitis	FAERS: 2		US FAERS
287	Choking	FAERS: 2 Canada Vigilance: 2		Canada Vigilance OFFSIDES US FAERS
288	Cholelithiasis	FAERS: 2		US FAERS
289	Counterfeit drug administered	FAERS: 2		US FAERS
290	Cyst	FAERS: 2		US FAERS
291	Deafness	FAERS: 2		US FAERS
292	Deja Vu	FAERS: 2		US FAERS
293	Dependence	FAERS: 2		US FAERS
294	Disseminated Intravascular Coagulation	FAERS: 2	6732389 9637888	CTD OFFSIDES US FAERS
295	Documented hypersensitivity to administered drug	FAERS: 2		US FAERS
296	Dysgraphia	FAERS: 2		US FAERS
297	Eye pain	FAERS: 2		US FAERS
298	Facial Pain	FAERS: 2		US FAERS
299	Facial paralysis	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
300	Feeding disorder neonatal	FAERS: 2		US FAERS
301	Floppy iris syndrome	FAERS: 2		US FAERS
302	Fracture	FAERS: 2		US FAERS
303	Frustration	FAERS: 2		US FAERS
304	Gastroschisis	FAERS: 2		US FAERS
305	Gestational Diabetes	FAERS: 2		US FAERS
306	Haemoconcentration	FAERS: 2		US FAERS
307	Hemiplegia	FAERS: 2	3683725	CTD US FAERS
308	Hepatitis A antibody positive	FAERS: 2		US FAERS
309	Homicide	FAERS: 2		OFFSIDES US FAERS
310	Hostility	FAERS: 2		US FAERS
311	Hyperpyrexia	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
312	Hyperventilation	FAERS: 2		OFFSIDES US FAERS
313	Hyporeflexia	FAERS: 2		US FAERS
314	Impaired work ability	FAERS: 2		US FAERS
315	Infertility	FAERS: 2		US FAERS
316	Inflammation	FAERS: 2		US FAERS
317	Initial insomnia	FAERS: 2		US FAERS
318	Injection site erythema	FAERS: 2		US FAERS
319	Laceration	FAERS: 2		US FAERS
320	Laryngospasm	FAERS: 2 Canada Vigilance: 1		Canada Vigilance SIDER US FAERS
321	Limb discomfort	FAERS: 2		US FAERS
322	Mechanical ventilation	FAERS: 2		US FAERS
323	Metabolic acidosis	FAERS: 2		US FAERS
324	Microphthalmos	FAERS: 2		US FAERS
325	Muscle Spasticity	FAERS: 2 Canada Vigilance: 1		Canada Vigilance US FAERS
326	Mutism	FAERS: 2		OFFSIDES US FAERS
327	Nerve injury	FAERS: 2		US FAERS
328	Oliguria	FAERS: 2		US FAERS
329	Oropharyngeal pain	FAERS: 2		OFFSIDES US FAERS
330	Oropharyngeal spasm	FAERS: 2		US FAERS
331	Pancytopenia	FAERS: 2		SIDER US FAERS
332	Paradoxical drug reaction	FAERS: 2		US FAERS
333	Patient restraint	FAERS: 2		US FAERS
334	Periarthritis	FAERS: 2		US FAERS
335	Photophobia	FAERS: 2		US FAERS
336	Physical assault	FAERS: 2		OFFSIDES US FAERS
337	Pleurothotonus	FAERS: 2		US FAERS
338	Pneumonitis	FAERS: 2		US FAERS
339	Poor peripheral circulation	FAERS: 2		US FAERS
340	Post procedural complication	FAERS: 2		US FAERS
341	Post-Traumatic Stress Disorder	FAERS: 2		US FAERS
342	Pregnancy	FAERS: 2		SIDER US FAERS
343	Prescribed overdose	FAERS: 2		US FAERS
344	Prescription drug used without a prescription	FAERS: 2		US FAERS
345	Presyncope	FAERS: 2		US FAERS
346	Product dose omission	FAERS: 2		US FAERS
347	Product leakage	FAERS: 2		US FAERS
348	Product outer packaging issue	FAERS: 2		US FAERS
349	Product packaging quantity issue	FAERS: 2		US FAERS
350	Protein total decreased	FAERS: 2		OFFSIDES US FAERS
351	Psoriasis	FAERS: 2		US FAERS
352	Quality of life decreased	FAERS: 2		US FAERS
353	Regurgitation	FAERS: 2		US FAERS
354	Renal dysplasia	FAERS: 2		US FAERS
355	Respiratory tract congestion	FAERS: 2		US FAERS
356	Skin irritation	FAERS: 2		US FAERS
357	Skin tightness	FAERS: 2		US FAERS
358	Slow speech	FAERS: 2		US FAERS
359	Stevens-Johnson Syndrome	FAERS: 2		OFFSIDES US FAERS
360	Stomatitis	FAERS: 2		US FAERS
361	Talipes	FAERS: 2		US FAERS
362	Therapy change	FAERS: 2		US FAERS
363	Thrombocytopenia	FAERS: 2	9637888	CTD SIDER US FAERS
364	Tinnitus	FAERS: 2		US FAERS
365	VIIth nerve paralysis	FAERS: 2		US FAERS
366	Visual disturbance	FAERS: 2		SIDER US FAERS
367	Walking aid user	FAERS: 2		US FAERS
368	Abscess	FAERS: 1		US FAERS
369	Acidosis	FAERS: 1		OFFSIDES US FAERS
370	Acute kidney injury	FAERS: 1	6121542 7569118 8828352	CTD US FAERS
371	Acute myocardial infarction	FAERS: 1		US FAERS
372	Agranulocytosis	FAERS: 1		SIDER US FAERS
373	Albuminuria	FAERS: 1		US FAERS
374	Alcohol abuse	FAERS: 1		US FAERS
375	Amblyopia	FAERS: 1		US FAERS
376	Amimia	FAERS: 1		US FAERS
377	Anaphylactoid Reaction	FAERS: 1		US FAERS
378	Aneurysm	FAERS: 1		US FAERS
379	Anosognosia	FAERS: 1		US FAERS
380	Anoxia	FAERS: 1		US FAERS
381	Anticonvulsant drug level decreased	FAERS: 1		US FAERS
382	Anuria	FAERS: 1		US FAERS
383	Apparent death	FAERS: 1		US FAERS
384	Apparent life threatening event	FAERS: 1		US FAERS
385	Application site inflammation	FAERS: 1		US FAERS
386	Arthropathy	FAERS: 1		US FAERS
387	Asthma	FAERS: 1		US FAERS
388	Athetosis	FAERS: 1		US FAERS
389	Belligerence	FAERS: 1		US FAERS
390	Binge Drinking	FAERS: 1		US FAERS
391	Blood alcohol increased	FAERS: 1		US FAERS
392	Blood electrolytes abnormal	FAERS: 1		US FAERS
393	Blood gases abnormal	FAERS: 1		US FAERS
394	Blood lactate dehydrogenase increased	FAERS: 1		US FAERS
395	Blood testosterone decreased	FAERS: 1		US FAERS
396	Cardiomegaly	FAERS: 1		US FAERS
397	Cataract	FAERS: 1		SIDER US FAERS
398	Central Nervous System Infection	FAERS: 1		US FAERS
399	Cerebellar Ataxia	FAERS: 1		US FAERS
400	Chest discomfort	FAERS: 1		US FAERS
401	Cholangitis	FAERS: 1		US FAERS
402	Coma scale abnormal	FAERS: 1		US FAERS
403	Conduct Disorder	FAERS: 1	6428371	CTD US FAERS
404	Consciousness fluctuating	FAERS: 1		US FAERS
405	Contraindicated drug administered	FAERS: 1		US FAERS
406	Contrast media reaction	FAERS: 1		US FAERS
407	Death of relative	FAERS: 1		US FAERS
408	Deformity	FAERS: 1		US FAERS
409	Delayed Puberty	FAERS: 1		US FAERS
410	Dengue Fever	FAERS: 1		US FAERS
411	Dental caries	FAERS: 1		US FAERS
412	Dental discomfort	FAERS: 1		US FAERS
413	Diet refusal	FAERS: 1		US FAERS
414	Dissociation	FAERS: 1		US FAERS
415	Drug Tolerance	FAERS: 1		US FAERS
416	Drug administered at inappropriate site	FAERS: 1		US FAERS
417	Drug administered to patient of inappropriate age	FAERS: 1		US FAERS
418	Drug ineffective for unapproved indication	FAERS: 1		US FAERS
419	Drug resistance	FAERS: 1		US FAERS
420	Dysplasia	FAERS: 1		US FAERS
421	Eczema	FAERS: 1		US FAERS
422	Electrocardiogram PQ interval prolonged	FAERS: 1		US FAERS
423	Electrocardiogram QT interval abnormal	FAERS: 1		US FAERS
424	Electrocardiogram ST-T change	FAERS: 1		US FAERS
425	Electrocardiogram change	FAERS: 1		US FAERS
426	Electroconvulsive Therapy	FAERS: 1		US FAERS
427	Electrolyte imbalance	FAERS: 1		US FAERS
428	Emotional poverty	FAERS: 1		US FAERS
429	Encephalitis	FAERS: 1		US FAERS
430	Epileptic encephalopathy	FAERS: 1		US FAERS
431	Epistaxis	FAERS: 1		US FAERS
432	Erection increased	FAERS: 1		US FAERS
433	Exophthalmos	FAERS: 1		US FAERS
434	Facial Paresis	FAERS: 1		US FAERS
435	Facial asymmetry	FAERS: 1		US FAERS
436	Feeling Cold	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
437	Fibromyalgia	FAERS: 1		US FAERS
438	Fixed eruption	FAERS: 1		US FAERS
439	Formication	FAERS: 1		US FAERS
440	Frustration tolerance decreased	FAERS: 1		US FAERS
441	Gambling	FAERS: 1		US FAERS
442	Gastric mucosal lesion	FAERS: 1		US FAERS
443	Gastritis	FAERS: 1		US FAERS
444	Gastrointestinal infection	FAERS: 1		US FAERS
445	Gastrointestinal motility disorder	FAERS: 1		US FAERS
446	Gaze palsy	FAERS: 1		US FAERS
447	General symptom	FAERS: 1		US FAERS
448	Glabellar reflex abnormal	FAERS: 1		US FAERS
449	Glasgow coma scale abnormal	FAERS: 1		US FAERS
450	Hemiparesis	FAERS: 1 Canada Vigilance: 1		Canada Vigilance US FAERS
451	Hepatic Encephalopathy	FAERS: 1		US FAERS
452	Hepatic congestion	FAERS: 1		US FAERS
453	Hepatotoxicity	FAERS: 1		US FAERS
454	Hernia	FAERS: 1		US FAERS
455	High density lipoprotein abnormal	FAERS: 1		US FAERS
456	Hypercapnia	FAERS: 1		OFFSIDES US FAERS
457	Hyperkinesia	FAERS: 1 Canada Vigilance: 2		Canada Vigilance SIDER US FAERS
458	Hyperosmolar state	FAERS: 1		US FAERS
459	Hyperphagia	FAERS: 1		US FAERS
460	Hypometabolism	FAERS: 1		US FAERS
461	Hypothalamo-pituitary disorder	FAERS: 1		US FAERS
462	Hypoxia	FAERS: 1		US FAERS
463	Immobile	FAERS: 1		US FAERS
464	Impaired driving ability	FAERS: 1		US FAERS
465	Impaired self-care	FAERS: 1		US FAERS
466	Inappropriate affect	FAERS: 1		US FAERS
467	Incorrect drug administration duration	FAERS: 1		US FAERS
468	Infectious Mononucleosis	FAERS: 1		US FAERS
469	Inferiority complex	FAERS: 1		US FAERS
470	Influenza	FAERS: 1		US FAERS
471	Injection related reaction	FAERS: 1		US FAERS
472	Injection site necrosis	FAERS: 1		US FAERS
473	Injection site nodule	FAERS: 1		US FAERS
474	Injury associated with device	FAERS: 1		US FAERS
475	Insulin Resistance	FAERS: 1		US FAERS
476	Intentional misuse	FAERS: 1		OFFSIDES US FAERS
477	Intentional product use issue	FAERS: 1		US FAERS
478	Intercepted drug administration error	FAERS: 1		US FAERS
479	Intercepted drug dispensing error	FAERS: 1		US FAERS
480	Intervertebral disc disorder	FAERS: 1		US FAERS
481	Intestinal Pseudo-Obstruction	FAERS: 1		US FAERS
482	Joint Range of Motion Decreased	FAERS: 1		US FAERS
483	Joint injury	FAERS: 1		US FAERS
484	Joint swelling	FAERS: 1		US FAERS
485	Klebsiella sepsis	FAERS: 1		US FAERS
486	Labile hypertension	FAERS: 1		US FAERS
487	Laryngeal neoplasm	FAERS: 1		US FAERS
488	Laziness	FAERS: 1		US FAERS
489	Leprosy	FAERS: 1		US FAERS
490	Leukocyte alkaline phosphatase increased	FAERS: 1		US FAERS
491	Libido disorder	FAERS: 1		US FAERS
492	Life expectancy shortened	FAERS: 1		US FAERS
493	Limb injury	FAERS: 1		US FAERS
494	Liquid product physical issue	FAERS: 1		US FAERS
495	Long QT Syndrome	FAERS: 1	View details 8726546 10875735 14597690 15342619 16178046 16290300 17265420 17643323 17875038 18363460 19020191 19054204 20029538 20636881 25822712	CTD US FAERS
496	Low birth weight baby	FAERS: 1		US FAERS
497	Lower respiratory tract infection fungal	FAERS: 1		US FAERS
498	Lung consolidation	FAERS: 1		US FAERS
499	Lymphadenopathy	FAERS: 1		US FAERS
500	Lymphocytosis	FAERS: 1		US FAERS
501	Macroglossia	FAERS: 1		US FAERS
502	Markedly reduced dietary intake	FAERS: 1		US FAERS
503	Mastication disorder	FAERS: 1		US FAERS
504	Medical device complication	FAERS: 1		US FAERS
505	Menorrhagia	FAERS: 1		SIDER US FAERS
506	Microcephaly	FAERS: 1		US FAERS
507	Mitochondrial DNA mutation	FAERS: 1		US FAERS
508	Monoplegia	FAERS: 1		US FAERS
509	Multi-organ disorder	FAERS: 1		US FAERS
510	Multiple Sclerosis	FAERS: 1		US FAERS
511	Multiple drug overdose intentional	FAERS: 1		US FAERS
512	Muscle Fatigue	FAERS: 1		US FAERS
513	Muscle strain	FAERS: 1		US FAERS
514	Musculoskeletal Pain	FAERS: 1		US FAERS
515	Myasthenia Gravis	FAERS: 1		US FAERS
516	Mydriasis	FAERS: 1		US FAERS
517	Neuralgia	FAERS: 1		US FAERS
518	Neutrophil count decreased	FAERS: 1		US FAERS
519	Nipple pain	FAERS: 1		US FAERS
520	Nodule	FAERS: 1		US FAERS
521	Ocular icterus	FAERS: 1		US FAERS
522	Oculogyration	FAERS: 1		OFFSIDES US FAERS
523	Oral pain	FAERS: 1		US FAERS
524	Osmotic demyelination syndrome	FAERS: 1		US FAERS
525	Osteoporosis	FAERS: 1		US FAERS
526	Pancreatic duct obstruction	FAERS: 1		US FAERS
527	Paresis	FAERS: 1		US FAERS
528	Peripheral artery thrombosis	FAERS: 1		US FAERS
529	Peripheral swelling	FAERS: 1		US FAERS
530	Phantom shocks	FAERS: 1		US FAERS
531	Pharyngitis	FAERS: 1 Canada Vigilance: 2		Canada Vigilance US FAERS
532	Pharyngolaryngeal Pain	FAERS: 1		US FAERS
533	Phlebitis	FAERS: 1		US FAERS
534	Physical abuse	FAERS: 1		US FAERS
535	Physical disability	FAERS: 1		US FAERS
536	Physical product label issue	FAERS: 1		US FAERS
537	Pneumothorax	FAERS: 1		US FAERS
538	Polydipsia	FAERS: 1		US FAERS
539	Polyuria	FAERS: 1		OFFSIDES US FAERS
540	Poor feeding infant	FAERS: 1		US FAERS
541	Poor quality sleep	FAERS: 1		US FAERS
542	Postural Orthostatic Tachycardia Syndrome	FAERS: 1		US FAERS
543	Potentiating drug interaction	FAERS: 1		US FAERS
544	Precocious Puberty	FAERS: 1		US FAERS
545	Pressure of speech	FAERS: 1		US FAERS
546	Procalcitonin increased	FAERS: 1		US FAERS
547	Product commingling	FAERS: 1		US FAERS
548	Product container issue	FAERS: 1		US FAERS
549	Product dispensing error	FAERS: 1		US FAERS
550	Product formulation issue	FAERS: 1		US FAERS
551	Product label confusion	FAERS: 1		US FAERS
552	Product label on wrong product	FAERS: 1		US FAERS
553	Product lot number issue	FAERS: 1		US FAERS
554	Product package associated injury	FAERS: 1		US FAERS
555	Product physical consistency issue	FAERS: 1		US FAERS
556	Product prescribing error	FAERS: 1		US FAERS
557	Product taste abnormal	FAERS: 1		US FAERS
558	Product use complaint	FAERS: 1		US FAERS
559	Product used for unknown indication	FAERS: 1		US FAERS
560	Productive Cough	FAERS: 1		OFFSIDES US FAERS
561	Proteinuria	FAERS: 1		US FAERS
562	Psychomotor skills impaired	FAERS: 1		US FAERS
563	Pulmonary Fibrosis	FAERS: 1		US FAERS
564	Purpura	FAERS: 1		US FAERS
565	Quadriparesis	FAERS: 1		US FAERS
566	Rales	FAERS: 1		US FAERS
567	Reduced facial expression	FAERS: 1 Canada Vigilance: 2		Canada Vigilance US FAERS
568	Remission not achieved	FAERS: 1		US FAERS
569	Renal pain	FAERS: 1		US FAERS
570	Respiratory Paralysis	FAERS: 1		US FAERS
571	Risus sardonicus	FAERS: 1		OFFSIDES US FAERS
572	Sciatica	FAERS: 1		US FAERS
573	Sedation complication	FAERS: 1		US FAERS
574	Self-induced vomiting	FAERS: 1		US FAERS
575	Serotonin Syndrome	FAERS: 1		US FAERS
576	Shock	FAERS: 1		US FAERS
577	Sinus bradycardia	FAERS: 1		US FAERS
578	Sinusitis	FAERS: 1		US FAERS
579	Skin laceration	FAERS: 1		US FAERS
580	Skin lesion	FAERS: 1		US FAERS
581	Skin reaction	FAERS: 1		US FAERS
582	Sleep disorder therapy	FAERS: 1		US FAERS
583	Slow response to stimuli	FAERS: 1		US FAERS
584	Status Epilepticus	FAERS: 1	9413831	CTD US FAERS
585	Stent malapposition	FAERS: 1		US FAERS
586	Sudden Cardiac Death	FAERS: 1		US FAERS
587	Supraventricular tachycardia	FAERS: 1		OFFSIDES US FAERS
588	Syringe issue	FAERS: 1		US FAERS
589	Systemic Inflammatory Response Syndrome	FAERS: 1		US FAERS
590	Systolic hypertension	FAERS: 1		US FAERS
591	Temperature intolerance	FAERS: 1		US FAERS
592	Temperature regulation disorder	FAERS: 1		US FAERS
593	Tetany	FAERS: 1		US FAERS
594	Therapeutic product ineffective	FAERS: 1		US FAERS
595	Thrombocytosis	FAERS: 1		US FAERS
596	Tongue spasm	FAERS: 1		US FAERS
597	Tooth Loss	FAERS: 1		US FAERS
598	Toxic Epidermal Necrolysis	FAERS: 1		US FAERS
599	Toxicologic test abnormal	FAERS: 1		US FAERS
600	Transaminases increased	FAERS: 1		US FAERS
601	Transcription medication error	FAERS: 1		US FAERS
602	Tuberculosis	FAERS: 1		US FAERS
603	Urethral Stenosis	FAERS: 1		US FAERS
604	Urge Incontinence	FAERS: 1		US FAERS
605	Vascular rupture	FAERS: 1		US FAERS
606	Vasculitis	FAERS: 1		US FAERS
607	Venous occlusion	FAERS: 1		US FAERS
608	Verbigeration	FAERS: 1		US FAERS
609	Victim of elder abuse	FAERS: 1		US FAERS
610	Victim of spousal abuse	FAERS: 1		US FAERS
611	Waist circumference increased	FAERS: 1		OFFSIDES US FAERS
612	Wolff-Parkinson-White Syndrome	FAERS: 1		US FAERS
613	Wound sepsis	FAERS: 1		US FAERS
614	Wrong patient received medication	FAERS: 1		US FAERS
615	muscle injury	FAERS: 1		US FAERS
616	skin abrasion	FAERS: 1		US FAERS
617	Abdominal sepsis			OFFSIDES
618	Abnormalities, Drug-Induced		29458080	CTD
619	Abuse			OFFSIDES
620	Acute left ventricular failure			OFFSIDES
621	Affective Disorders, Psychotic		8109663	CTD
622	Airway Obstruction		2568376	CTD
623	Akathisia, Drug-Induced		View details 2378546 2878216 6470196 6497564 6666375 6691455 7021451 7540798 7597122 8573063 8829716 9090331 10350027 10389620 10459715 11156818 11434401 12107616 12223254 12900300 12927004 12974990 14733451 14961937 17042884 17875112 19040345 19192477	CTD
624	Akinetic Mutism		17484951	CTD
625	Alcohol Withdrawal Delirium		98722 7220787	CTD
626	Alcohol poisoning			OFFSIDES
627	Alcoholic Intoxication			OFFSIDES
628	Alpha-2 macroglobulin increased	Canada Vigilance: 1		Canada Vigilance
629	Alveolitis			OFFSIDES
630	Amphetamine-Related Disorders		16858942	CTD
631	Amphetamines			OFFSIDES
632	Amyloidosis			OFFSIDES
633	Anticonvulsant drug level increased			OFFSIDES
634	Antipsychotic drug level increased			OFFSIDES
635	Anxiety Disorders		1201456 11478934 14638603	CTD
636	Apnea			OFFSIDES
637	Apraxias		6806252	CTD
638	Ascites infection			OFFSIDES
639	Ascites	Canada Vigilance: 1		Canada Vigilance OFFSIDES
640	Aspiration Pneumonia			OFFSIDES
641	Aura			OFFSIDES
642	Autistic Disorder		View details 11476129 15068403 18080171 19368416	CTD
643	Automatism			OFFSIDES
644	Bacteria stool identified			OFFSIDES
645	Basal Ganglia Diseases		View details 337756 347884 383097 559400 788001 908924 981320 1260604 1304992 1393566 1883257 2567351 2594870 2775969 2782476 2784039 2896642 3054982 3089336 3565961 3597329 3711028 4144552 4671924 4692693 6117295 6148118 6844372 7202232 7348089 7540798 7694306 7862923 8275889 8301292 8379567 8573063 8601548 8826559 8915564 9097896 9109178 9169965 9179395 9184614 9247389 9247978 9265911 9265916 9536454 9564201 9716319 9754845 9812111 9888616 9892301 9988841 10468313 10484947 10847307 10868556 10928308 11549212 11793611 12107616 12490774 12721815 12766931 14685663 14870961 15138894 15863797 15920378 16697060 16886695 16953381 17042884 17135384 17224721 17351421 17542047 17900775 18488526 18594798 19118983 20520283	CTD
646	Biliary dilatation			OFFSIDES
647	Bipolar Disorder		View details 369395 869044 1260604 1888972 2293776 2340328 3148640 3381938 4402472 4605009 6142659 6470196 6494401 6512011 6864584 7568661 8018801 8042916 8284344 8601548 9812131 10766557 12773089 14731313 15830831 17042886 17224721 17414256 17591516 17888816 19829091	CTD
648	Bipolar I disorder			OFFSIDES
649	Bladder prolapse			OFFSIDES
650	Blepharoptosis		1973109 5526730	CTD
651	Blood Glucose			OFFSIDES
652	Blood amylase increased			OFFSIDES
653	Blood and lymphatic system disorders			SIDER
654	Blood brain barrier defect			OFFSIDES
655	Blood calcitonin increased			OFFSIDES
656	Blood cholesterol			OFFSIDES
657	Blood creatine phosphokinase decreased			OFFSIDES
658	Blood lactic acid decreased			OFFSIDES
659	Blood magnesium decreased			OFFSIDES
660	Blood parathyroid hormone increased			OFFSIDES
661	Blood sodium increased			OFFSIDES
662	Blood sodium			OFFSIDES
663	Blood triglycerides increased			OFFSIDES
664	Borderline Personality Disorder			OFFSIDES
665	Brain Abscess			OFFSIDES
666	Brain Diseases		View details 651542 2392778 4479505 5572070 6121213 6415823	CTD
667	Brain Edema		20324	CTD
668	Breast discomfort			SIDER
669	Breast engorgement			SIDER
670	Bronchial Obstruction			OFFSIDES
671	Bullous impetigo			OFFSIDES
672	Catalepsy		View details 10058 28412 33340 35783 97712 100809 108749 558529 559310 560634 560684 567284 572056 572550 574045 574959 575732 707139 1033561 1034924 1168577 1172421 1240830 1312053 1323183 1342840 1351265 1365866 1378633 1378634 1393566 1470561 1513862 1653619 1685250 1685312 1686859 1718290 1775613 1786838 1795522 1814544 1819906 1827527 1865993 1904531 1963345 1973109 1977408 1980731 2018630 2045013 2055429 2098751 2153885 2159831 2163861 2217518 2250574 2263656 2298391 2331230 2335961 2342229 2345754 2379797 2530142 2544900 2547386 2569989 2587420 2587613 2851915 2862602 2874569 2879054 2883335 2889162 2907585 2960778 2969083 2972934 2998546 2999739 3004539 3031535 3088632 3088660 3094062 3100770 3100965 3135503 3167148 3191399 3250915 3252688 3352868 3362928 3374771 3384045 3417209 3463941 3513907 3575168 3609270 3695557 3703914 3925479 3942822 4040614 4058245 4075104 5065892 6105775 6117919 6141553 6141998 6152346 6200179 6208949 6293644 6303368 6315179 6425907 6440863 6442955 6540616 6541070 6541951 6542903 6682781 6684770 6686863 6752913 6771794 6819600 6890252 6891807 6912580 7036117 7178196 7189827 7193183 7193623 7197982 7199508 7199630 7200429 7201540 7336983 7477442 7581034 7617729 7637876 7675867 7710668 7740066 7754695 7813388 7845605 7863789 7865167 7875555 7894525 7902980 7903225 7910107 7912135 7913894 7917035 7953768 7957769 7965819 8005645 8045270 8114947 8123230 8177909 8216760 8265684 8359205 8364622 8386235 8399811 8474623 8529528 8547448 8577887 8588288 8616504 8627512 8720578 8755063 8794996 8808155 8811507 8829461 8868372 8901004 8957251 8968368 8984818 8996184 9025114 9085054 9137910 9142555 9175906 9181636 9185829 9201797 9218695 9264077 9286616 9335068 9374198 9399376 9416775 9437767 9437770 9498732 9564629 9566031 9567763 9571656 9610935 9618422 9723970 9798264 9808703 9854621 9884085 10087029 10188965 10192275 10193902 10193906 10199625 10347616 10353425 10368871 10412490 10435392 10454512 10477133 10499368 10510854 10528146 10589449 10591873 10651103 10669905 10672628 10693278 10720636 10762690 10765558 10780307 10869885 10871703 10888308 10893700 11100936 11103884 11143713 11166067 11223221 11489455 11525773 11543761 11589099 11699343 11711046 11876023 11881572 11888554 11927170 11981591 12097518 12185404 12191584 12191819 12369252 12373537 12398907 12596525 12644843 12727308 12729838 12762595 12834887 12860477 12902993 12907310 12925021 12970091 14499944 14513187 14552778 14603264 14714212 14729119 15083255 15099920 15111244 15135968 15140647 15165840 15196505 15215559 15310863 15319809 15341057 15448976 15482935 15588759 15614572 15840400 15857625 15881857 15910772 15919101 15996562 16027844 16047547 16052248 16258634 16408663 16430090 16431394 16507184 16564428 16643965 16867021 17224239 17236762 17519387 17581957 17602546 17628535 17684118 17696997 17877148 17886228 17913375 18021764 18160755 18239784 18278042 18329269 18408917 18457824 18548231 18552135 18585397 18594798 18638477 18666714 18703024 18789920 18814488 18846462 19041390 19107466 19109019 19145297 19309549 19352073 19374163 19403167 19418355 19429052 19429072 19444377 19447524 19464324 19644727 19654037 19759529 19940105 20046767 20181611 20226214 20227500 20398719 20429782 20504471 20531975 20558148 20638279 20682746 20713114 20882060 20973483 21269601 21966889 22088953 24459701 24739405	CTD
673	Cataplexy		12754853	CTD
674	Cerebellar Diseases		3054982 9296146	CTD
675	Cerebral Atherosclerosis			OFFSIDES
676	Cerebral artery occlusion			OFFSIDES
677	Cerebral atrophy			OFFSIDES
678	Chemical and Drug Induced Liver Injury		6886037 9035996 9265911	CTD
679	Child Behavior Disorders		2340455	CTD
680	Chronic Obstructive Airway Disease			OFFSIDES
681	Chronic left ventricular failure			OFFSIDES
682	Clostridium difficile colitis			OFFSIDES
683	Cocaine-Related Disorders		15837586 16052248 18721669	CTD
684	Cognition Disorders		View details 2544823 8617710 10350027 11806303 15169686 16146185 17875112	CTD
685	Colitis			OFFSIDES
686	Complex partial seizures			OFFSIDES
687	Confabulation			OFFSIDES
688	Confusion		6132175 11064842	CTD
689	Conjunctival deposit			OFFSIDES
690	Consciousness Disorders		6146154	CTD
691	Contracture			OFFSIDES
692	Conversion disorder	Canada Vigilance: 1		Canada Vigilance
693	Deglutition Disorders		View details 8919580 17024549 17484951 19047493	CTD
694	Depressive disorder		View details 1201456 2247245 8659626 9247978 12721815	CTD
695	Dermatitis			SIDER
696	Device related infection			OFFSIDES
697	Diabetes			OFFSIDES
698	Diabetes Insipidus		5511121	CTD
699	Diabetes mellitus inadequate control			OFFSIDES
700	Diabetic Foot			OFFSIDES
701	Diabetic Retinopathy			OFFSIDES
702	Diabetic ulcer			OFFSIDES
703	Diarrhea			OFFSIDES
704	Diastolic dysfunction			OFFSIDES
705	Diplopia	Canada Vigilance: 1		Canada Vigilance
706	Disease Progression			OFFSIDES
707	Disorders of Excessive Somnolence		6117919	CTD
708	Disturbance in sexual arousal			SIDER
709	Drowsiness			OFFSIDES SIDER
710	Drug addict			OFFSIDES
711	Dyskinesia, Drug-Induced		View details 115074 945166 1555638 2036482 2422327 3908866 4116875 4479505 4718286 6117919 6415823 6420826 6627044 7845605 7871047 9629996 10719094 11711046 11779040 12223254 12224042 12543230 12661802 12669184 12763102 12935321 12938022 14519411 14642644 15450789 15649445 15953628 16648343 16960862 17377417 17868205 17967741 17988775 18193111 18363098 18554768 18590723 18707801 20645751 20671610	CTD
712	Dyspnea		10653217	CTD
713	Dyssomnias		6132175	CTD
714	Dysthymic Disorder			OFFSIDES
715	Dystonia Musculorum Deformans		4752335	CTD
716	Electromechanical dissociation			OFFSIDES
717	Enterococcal infection			OFFSIDES
718	Eosinophilic myocarditis			OFFSIDES
719	Escherichia infection			OFFSIDES
720	Exfoliative rash	Canada Vigilance: 1		Canada Vigilance
721	Fever		762029 9035996 15534454	CTD
722	Fluid replacement			OFFSIDES
723	Galactorrhea		2136057	CTD
724	Granulocytosis			OFFSIDES
725	Gum neoplasm malignant stage unspecified			OFFSIDES
726	Hallucinations		991797 10362445 14770062	CTD
727	Heart failure		8726546	CTD
728	Heat Stroke			SIDER
729	Hemothorax			OFFSIDES
730	Heparin-induced thrombocytopenia			OFFSIDES
731	Hyperemesis Gravidarum			OFFSIDES
732	Hyperprolactinemia		View details 564936 1681002 3019639 3158510 3748306 3883215 3906589 7018927 8613910 9128918 9192542 9572212 10661492 11048906 15289996 15638391 16282852	CTD
733	Hypertransaminasaemia			OFFSIDES
734	Hypokalemia		2735214	CTD
735	Hypomania			OFFSIDES
736	Hyponatremia		487691	CTD
737	Injection Site Reaction			SIDER
738	Insulin-requiring type 2 diabetes mellitus			OFFSIDES
739	Intestinal infarction			OFFSIDES
740	Kidney Diseases		19839853	CTD
741	Kidney Failure			OFFSIDES
742	Large intestine perforation			OFFSIDES
743	Laryngeal Diseases		7270747 16001412	CTD
744	Leukocytoclastic vasculitis			SIDER
745	Lip erosion			OFFSIDES
746	Lipase			OFFSIDES
747	Liver diseases		595591	CTD
748	Lymphocyte count decreased			OFFSIDES
749	Malignant lymphoid neoplasm			OFFSIDES
750	Malignant neoplasm progression			OFFSIDES
751	Meige Syndrome		2894781	CTD
752	Memory Disorders		16697060 17967741 19644727	CTD
753	Meningioma			OFFSIDES
754	Mental disorder due to a general medical condition			OFFSIDES
755	Mental disorders		2568639 11476129 16856516	CTD
756	Mood Disorders		2895987 8894211	CTD
757	Movement Disorders		View details 39307 284201 408858 874471 984060 1096218 1971459 2880362 3657380 4058245 6934716 7570355 7578666 7857587 8103465 8676147 8904651 9095340 9175906 9631956 9714272 10670778 11383552 12010767 14674056 15728856 15965227 17069804 17513028 17530160 18022680 19444377 22153973	CTD
758	Mucosal erosion			OFFSIDES
759	Multiple Myeloma			OFFSIDES
760	Muscle Cramp		8599412	CTD
761	Muscle Hypertonia		5526730 10847307	CTD
762	Myocarditis		17965989	CTD
763	Myoglobinuria		6121542	CTD
764	Necrosis		8742488	CTD
765	Neonatal Abstinence Syndrome		2738729	CTD
766	Neural Tube Defects		2392778	CTD
767	Neurobehavioral Manifestations		8445981	CTD
768	Obsessive thoughts			OFFSIDES
769	Ocular Motility Disorders		14519055 19412963	CTD
770	Pancreatic Insufficiency			OFFSIDES
771	Parkinsonian Disorders		View details 2861619 3946663 3989243 6321374 8098931 9693747 12724469 12974990 16764227 25085534	CTD
772	Pelvic fluid collection			OFFSIDES
773	Penile Diseases		44457	CTD
774	Perceptual Disorders		14638603	CTD
775	Pericardial effusion		22744888	CTD
776	Peripheral embolism			OFFSIDES
777	Personality Disorders		View details 988593 7197574 7630427 11124399	CTD
778	Pharyngeal Diseases		7270747	CTD
779	Poriomania			OFFSIDES
780	Post procedural myocardial infarction			OFFSIDES
781	Postoperative ileus			OFFSIDES
782	Prenatal Exposure Delayed Effects		3988167	CTD
783	Proctitis			OFFSIDES
784	Product administration error	Canada Vigilance: 2		Canada Vigilance
785	Psychomotor Agitation		View details 8888546 8894211 9265911 9812111 10847307 10928308 11575062 12724469 16244481 16946100 18451200	CTD
786	Psychomotor Disorders		7914050	CTD
787	Psychoses, Substance-Induced		View details 1137031 6115741 7425170 9247414 10362445 11064842 16858942 16960862 17414256 18794663	CTD
788	Psychotic Disorders		View details 31480 337756 347877 849701 981321 2036482 2056136 3946663 4556089 6627044 6844372 6938996 7021451 7977894 9179395 9888616 10459715 10546163 11120421 11575062 11769818 11910276 12766931 14961937 15863797 15965227 16648343 16905684 17135384 17180133 17900775 18488526	CTD
789	Purulence			OFFSIDES
790	Pyelonephritis			OFFSIDES
791	Renal Insufficiency		9637888	CTD
792	Renal tubular necrosis			OFFSIDES
793	Respiratory Distress Syndrome, Adult		18652109	CTD
794	Schizoaffective Disorder			OFFSIDES
795	Schizophrenia Spectrum and Other Psychotic Disorders		View details 347884 469146 981320 9090331 9892301 12900300 14696024 15169686 16140282	CTD
796	Schizophrenia, Disorganized		6367362	CTD
797	Seizures		View details 1803 1829682 1977176 2625524 2895987 3121163 3183711 6175290 6265841 7875556 8471829 10698007 10744342 12623218 17011127	CTD
798	Sialorrhea		11434401 12223254 17224721	CTD
799	Sleep Disorders, Circadian Rhythm		9463841 12405556	CTD
800	Sleep Disorders, Intrinsic		16886695 16905684	CTD
801	Sleep Initiation and Maintenance Disorders		8956674	CTD
802	Stereotypic Movement Disorder		View details 1686815 6539708 7846194 8627534 15985714 19298320	CTD
803	Stomach Diseases		11292068	CTD
804	Strabismus	Canada Vigilance: 1		Canada Vigilance
805	Substance Withdrawal Syndrome		View details 559400 1930612 6321374 7195265 7435695 8109663 8750706 10495006 10744342 16005579	CTD
806	Substance-Related Disorders		View details 2900472 2947255 3359231 11325400	CTD
807	Tachycardia, Ventricular		6501720 20210726	CTD
808	Torsades de Pointes		View details 2376181 3805334 7501784 7628136 8338292 8463445 9591913 10534216 10730737 15040655 15342619 16178046 17253907 19326637	CTD
809	Urination Disorders		3205888	CTD
810	Vasculitis, Leukocytoclastic, Cutaneous		10564343	CTD
811	Vasospasm, Intracranial		8138965	CTD
812	Ventricular Dysfunction, Left		8726546	CTD
813	Ventricular arrhythmia			SIDER
814	Xerostomia		11576036	CTD
815	Yawning	Canada Vigilance: 1		Canada Vigilance
816	jaundice	Canada Vigilance: 2		Canada Vigilance SIDER

Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234