Metoprolol
(IUBSYMUCCVWXPE-UHFFFAOYSA-N)
Structure
- SMILES
- COCCc1ccc(cc1)OCC(CNC(C)C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- C07AB02; C07BB02; C07BB52; C07CB02; C07FB02; C07FB13; C07FX03; C07FX05
- Molecular Formula:
- C15H25NO3
- Molecular Weight:
- 267.364
- Log P:
- 2.0041
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 50.72
- CAS Number(s):
- 37350-58-6; 51384-51-1
Synonym(s)
1.
Metoprolol
2.
Beloc-Duriles
3.
Betaloc
4.
Betaloc-Astra
5.
Betalok
6.
CGP-2175
7.
H 93-26
8.
Lopressor
9.
Metoprolol CR-XL
10.
Metoprolol Succinate
11.
Metoprolol Tartrate
12.
Seloken
13.
Spesicor
14.
Spesikor
15.
Toprol
16.
Toprol-XL
17.
Beloc Duriles
18.
Betaloc Astra
19.
CGP 2175
20.
CGP2175
21.
H 93 26
22.
H 9326
23.
Metoprolol CR XL
24.
Toprol XL
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 207 | OFFSIDES US FAERS | |
| 2 | Bradycardia | FAERS: 187 Canada Vigilance: 3 |
32359
241887 755652 2656541 2913594 8992519 9726695 12090909 15367832 16144878 16513452 17323786 18043911 24894748 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Malaise | FAERS: 180 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Dizziness | FAERS: 176 Canada Vigilance: 4 | 7040924 10944070 16198657 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 5 | Drug ineffective | FAERS: 138 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Myocardial Infarction | FAERS: 122 |
1900011
2656541 2878675 6372839 10147474 10790354 11181074 15914518 16598518 18043911 18072171 18648788 19930840 | CTD US FAERS |
| 7 | Hypotension | FAERS: 116 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 8 | Fatigue | FAERS: 106 Canada Vigilance: 4 | 12090909 16198657 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 9 | Palpitations | FAERS: 101 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 10 | Cerebrovascular accident | FAERS: 98 | SIDER US FAERS | |
| 11 | Headache | FAERS: 95 Canada Vigilance: 5 | 10944070 16198657 16967357 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Syncope | FAERS: 88 Canada Vigilance: 1 | 8985804 19353679 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Chest Pain | FAERS: 81 | 11320466 | CTD OFFSIDES SIDER US FAERS |
| 14 | Atrial Fibrillation | FAERS: 80 Canada Vigilance: 5 | CTD Canada Vigilance US FAERS | |
| 15 | Asthenia | FAERS: 66 | OFFSIDES SIDER US FAERS | |
| 16 | Nausea | FAERS: 64 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Feeling abnormal | FAERS: 60 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 18 | Medication Error | FAERS: 50 | US FAERS | |
| 19 | Toxicity to various agents | FAERS: 50 | US FAERS | |
| 20 | Anxiety | FAERS: 48 | OFFSIDES SIDER US FAERS | |
| 21 | Diabetes Mellitus | FAERS: 45 | SIDER US FAERS | |
| 22 | Adverse event | FAERS: 43 | US FAERS | |
| 23 | Product substitution issue | FAERS: 42 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 24 | Cardiac Arrest | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Tachycardia | FAERS: 37 | CTD SIDER US FAERS | |
| 26 | Pain | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 27 | Nasopharyngitis | FAERS: 34 | US FAERS | |
| 28 | Somnolence | FAERS: 32 | SIDER US FAERS | |
| 29 | Alopecia | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Memory impairment | FAERS: 31 | SIDER US FAERS | |
| 31 | Blood pressure inadequately controlled | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 32 | Vomiting | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 33 | Abdominal discomfort | FAERS: 28 | OFFSIDES US FAERS | |
| 34 | Incorrect dose administered | FAERS: 28 | US FAERS | |
| 35 | Overdose | FAERS: 28 | US FAERS | |
| 36 | Weight decreased | FAERS: 28 | US FAERS | |
| 37 | Chest discomfort | FAERS: 27 | US FAERS | |
| 38 | Visual Impairment | FAERS: 27 | SIDER US FAERS | |
| 39 | Tremor | FAERS: 26 | 6405633 6584937 | CTD US FAERS |
| 40 | Wrong technique in drug usage process | FAERS: 26 | OFFSIDES US FAERS | |
| 41 | Amnesia | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 42 | Completed Suicide | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Intentional drug misuse | FAERS: 25 | US FAERS | |
| 44 | Product quality issue | FAERS: 25 | US FAERS | |
| 45 | Pruritus | FAERS: 24 Canada Vigilance: 1 | 11724083 | CTD SIDER Canada Vigilance US FAERS |
| 46 | Sinus bradycardia | FAERS: 24 | US FAERS | |
| 47 | Drug dispensing error | FAERS: 22 | OFFSIDES US FAERS | |
| 48 | Arthritis | FAERS: 21 | OFFSIDES SIDER US FAERS | |
| 49 | Bronchitis | FAERS: 21 | OFFSIDES US FAERS | |
| 50 | Arthralgia | FAERS: 20 | SIDER US FAERS | |
| 51 | Nervousness | FAERS: 20 | SIDER US FAERS | |
| 52 | Pharmaceutical product complaint | FAERS: 20 | US FAERS | |
| 53 | Suicide attempt | FAERS: 20 | US FAERS | |
| 54 | Asthma | FAERS: 19 | US FAERS | |
| 55 | Blood pressure fluctuation | FAERS: 18 | OFFSIDES US FAERS | |
| 56 | Dyspepsia | FAERS: 18 | SIDER US FAERS | |
| 57 | Activities of daily living impaired | FAERS: 17 | US FAERS | |
| 58 | Atrioventricular Block | FAERS: 17 | 3437726 6494097 18452693 | CTD SIDER US FAERS |
| 59 | Myalgia | FAERS: 17 | US FAERS | |
| 60 | Thrombosis | FAERS: 17 | US FAERS | |
| 61 | Dementia | FAERS: 16 | US FAERS | |
| 62 | Drug exposure during pregnancy | FAERS: 16 | US FAERS | |
| 63 | Hypersensitivity | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 64 | Angina Pectoris | FAERS: 15 | CTD SIDER US FAERS | |
| 65 | Blood cholesterol increased | FAERS: 15 | US FAERS | |
| 66 | Fibromyalgia | FAERS: 15 | OFFSIDES US FAERS | |
| 67 | Pneumonia | FAERS: 15 | SIDER US FAERS | |
| 68 | Tinnitus | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 69 | Blindness | FAERS: 14 | US FAERS | |
| 70 | Influenza | FAERS: 14 | US FAERS | |
| 71 | Paranoia | FAERS: 14 | US FAERS | |
| 72 | Stress | FAERS: 14 | US FAERS | |
| 73 | Vertigo | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Back Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Depressed Level of Consciousness | FAERS: 13 | SIDER US FAERS | |
| 76 | Lethargy | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 77 | Low birth weight baby | FAERS: 13 | US FAERS | |
| 78 | Sinusitis | FAERS: 13 | US FAERS | |
| 79 | Urticaria | FAERS: 13 | SIDER US FAERS | |
| 80 | Abasia | FAERS: 12 | US FAERS | |
| 81 | Constipation | FAERS: 12 | SIDER US FAERS | |
| 82 | Neck Pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Respiratory Depression | FAERS: 12 | US FAERS | |
| 84 | Therapeutic response unexpected with drug substitution | FAERS: 12 | US FAERS | |
| 85 | Impaired work ability | FAERS: 11 | US FAERS | |
| 86 | Maternal exposure during pregnancy | FAERS: 11 | US FAERS | |
| 87 | Presyncope | FAERS: 11 | US FAERS | |
| 88 | Wrong technique in product usage process | FAERS: 11 | US FAERS | |
| 89 | Agitation | FAERS: 10 | US FAERS | |
| 90 | Cataract | FAERS: 10 | OFFSIDES US FAERS | |
| 91 | Deafness | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 92 | Erythema | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Flatulence | FAERS: 10 | SIDER US FAERS | |
| 94 | Joint swelling | FAERS: 10 | US FAERS | |
| 95 | Oropharyngeal pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 96 | Aneurysm | FAERS: 9 | OFFSIDES US FAERS | |
| 97 | Angioedema | FAERS: 9 | 7988234 12671332 | CTD US FAERS |
| 98 | Ankle Fracture | FAERS: 9 | US FAERS | |
| 99 | Bronchospasm | FAERS: 9 | SIDER US FAERS | |
| 100 | Burning sensation | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 101 | Cardiac Flutter | FAERS: 9 | US FAERS | |
| 102 | Drug prescribing error | FAERS: 9 | US FAERS | |
| 103 | Dysgeusia | FAERS: 9 | SIDER US FAERS | |
| 104 | Dysphonia | FAERS: 9 | US FAERS | |
| 105 | Erectile dysfunction | FAERS: 9 | 17324145 | CTD SIDER US FAERS |
| 106 | General physical health deterioration | FAERS: 9 | US FAERS | |
| 107 | Arthropathy | FAERS: 8 | US FAERS | |
| 108 | Blood glucose increased | FAERS: 8 | US FAERS | |
| 109 | Dehydration | FAERS: 8 | OFFSIDES US FAERS | |
| 110 | Ejection Fraction Decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 111 | Glaucoma | FAERS: 8 | 7010891 | CTD US FAERS |
| 112 | Macular degeneration | FAERS: 8 | US FAERS | |
| 113 | Psoriasis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 114 | Supraventricular tachycardia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 115 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 116 | Wheezing | FAERS: 8 | SIDER US FAERS | |
| 117 | Aphasia | FAERS: 7 | US FAERS | |
| 118 | Crying | FAERS: 7 | US FAERS | |
| 119 | Cyanosis | FAERS: 7 | SIDER US FAERS | |
| 120 | Feeling Cold | FAERS: 7 | US FAERS | |
| 121 | Hypersomnia | FAERS: 7 | US FAERS | |
| 122 | Limb injury | FAERS: 7 | OFFSIDES US FAERS | |
| 123 | Multiple Sclerosis | FAERS: 7 | US FAERS | |
| 124 | Nephrolithiasis | FAERS: 7 | US FAERS | |
| 125 | Respiratory distress | FAERS: 7 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 126 | Restlessness | FAERS: 7 | US FAERS | |
| 127 | Wrong drug administered | FAERS: 7 | US FAERS | |
| 128 | Abdominal Pain | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 129 | Cardiotoxicity | FAERS: 6 | US FAERS | |
| 130 | Cold sweat | FAERS: 6 | US FAERS | |
| 131 | Disability | FAERS: 6 | US FAERS | |
| 132 | Disorientation | FAERS: 6 | SIDER US FAERS | |
| 133 | Feeling jittery | FAERS: 6 | US FAERS | |
| 134 | Head discomfort | FAERS: 6 | US FAERS | |
| 135 | Hypokinesia | FAERS: 6 | US FAERS | |
| 136 | Hypoxia | FAERS: 6 | US FAERS | |
| 137 | Inappropriate schedule of drug administration | FAERS: 6 | OFFSIDES US FAERS | |
| 138 | Medication residue | FAERS: 6 | US FAERS | |
| 139 | Multiple allergies | FAERS: 6 | US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 6 | OFFSIDES US FAERS | |
| 141 | Photophobia | FAERS: 6 | US FAERS | |
| 142 | Respiratory arrest | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Swelling | FAERS: 6 | US FAERS | |
| 144 | Unevaluable event | FAERS: 6 | US FAERS | |
| 145 | Aphonia | FAERS: 5 | OFFSIDES US FAERS | |
| 146 | Apparent death | FAERS: 5 | US FAERS | |
| 147 | Atrial Flutter | FAERS: 5 | 1880230 | CTD OFFSIDES US FAERS |
| 148 | Back disorder | FAERS: 5 | US FAERS | |
| 149 | Blood triglycerides increased | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 150 | Bone pain | FAERS: 5 | US FAERS | |
| 151 | Chills | FAERS: 5 | US FAERS | |
| 152 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 153 | Drug administration error | FAERS: 5 | US FAERS | |
| 154 | Electrocardiogram abnormal | FAERS: 5 | US FAERS | |
| 155 | Epistaxis | FAERS: 5 | OFFSIDES US FAERS | |
| 156 | Extra dose administered | FAERS: 5 | US FAERS | |
| 157 | Gout | FAERS: 5 | OFFSIDES US FAERS | |
| 158 | Hepatitis C | FAERS: 5 | US FAERS | |
| 159 | Limb discomfort | FAERS: 5 | US FAERS | |
| 160 | Lip swelling | FAERS: 5 | US FAERS | |
| 161 | Mental status changes | FAERS: 5 | OFFSIDES US FAERS | |
| 162 | Musculoskeletal Pain | FAERS: 5 | SIDER US FAERS | |
| 163 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 164 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 165 | Pulmonary congestion | FAERS: 5 | OFFSIDES US FAERS | |
| 166 | Rash erythematous | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Respiratory Failure | FAERS: 5 | OFFSIDES US FAERS | |
| 168 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 169 | Shock | FAERS: 5 | SIDER US FAERS | |
| 170 | Temperature intolerance | FAERS: 5 | US FAERS | |
| 171 | Therapy change | FAERS: 5 | US FAERS | |
| 172 | Transaminases increased | FAERS: 5 | US FAERS | |
| 173 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 174 | Ventricular arrhythmia | FAERS: 5 | US FAERS | |
| 175 | jaundice | FAERS: 5 | SIDER US FAERS | |
| 176 | treatment failure | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 177 | Accidental overdose | FAERS: 4 | US FAERS | |
| 178 | Actinic keratosis | FAERS: 4 | US FAERS | |
| 179 | Acute kidney injury | FAERS: 4 | 12243603 | CTD US FAERS |
| 180 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 181 | Aphagia | FAERS: 4 | US FAERS | |
| 182 | Basal cell carcinoma | FAERS: 4 | OFFSIDES US FAERS | |
| 183 | Blood cholesterol abnormal | FAERS: 4 | US FAERS | |
| 184 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 185 | Coronary Artery Disease | FAERS: 4 | 4076202 7717013 24894748 | CTD SIDER US FAERS |
| 186 | Diplopia | FAERS: 4 | 6236452 | CTD US FAERS |
| 187 | Discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Diverticulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 189 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 190 | Ear discomfort | FAERS: 4 | US FAERS | |
| 191 | Exposure via ingestion | FAERS: 4 | US FAERS | |
| 192 | Flushing | FAERS: 4 | US FAERS | |
| 193 | Intracranial Aneurysm | FAERS: 4 | US FAERS | |
| 194 | Mental impairment | FAERS: 4 | US FAERS | |
| 195 | Pain of skin | FAERS: 4 | US FAERS | |
| 196 | Pancreatitis | FAERS: 4 | US FAERS | |
| 197 | Poor peripheral circulation | FAERS: 4 | US FAERS | |
| 198 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 199 | Product formulation issue | FAERS: 4 | US FAERS | |
| 200 | Product use in unapproved indication | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 201 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 202 | Throat irritation | FAERS: 4 | US FAERS | |
| 203 | Tongue blistering | FAERS: 4 | US FAERS | |
| 204 | Apathy | FAERS: 3 | US FAERS | |
| 205 | Bedridden | FAERS: 3 | US FAERS | |
| 206 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 207 | Cardiac ablation | FAERS: 3 | US FAERS | |
| 208 | Carpal Tunnel Syndrome | FAERS: 3 | 3140228 | CTD US FAERS |
| 209 | Catatonia | FAERS: 3 | SIDER US FAERS | |
| 210 | Cellulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 211 | Delirium | FAERS: 3 | CTD US FAERS | |
| 212 | Drug screen positive | FAERS: 3 | US FAERS | |
| 213 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 214 | Eye irritation | FAERS: 3 | SIDER US FAERS | |
| 215 | Eye pain | FAERS: 3 | US FAERS | |
| 216 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 217 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 218 | Hypospadias | FAERS: 3 | US FAERS | |
| 219 | Hysterectomy | FAERS: 3 | OFFSIDES US FAERS | |
| 220 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 221 | Implantable defibrillator insertion | FAERS: 3 | US FAERS | |
| 222 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 223 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 224 | Infection | FAERS: 3 | US FAERS | |
| 225 | Initial insomnia | FAERS: 3 | US FAERS | |
| 226 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 227 | Joint injury | FAERS: 3 | US FAERS | |
| 228 | Laryngitis | FAERS: 3 | US FAERS | |
| 229 | Middle insomnia | FAERS: 3 | US FAERS | |
| 230 | Musculoskeletal discomfort | FAERS: 3 | SIDER US FAERS | |
| 231 | Nerve injury | FAERS: 3 | US FAERS | |
| 232 | Night sweats | FAERS: 3 | US FAERS | |
| 233 | No adverse event | FAERS: 3 | US FAERS | |
| 234 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 235 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 236 | Poisoning | FAERS: 3 | US FAERS | |
| 237 | Polyarthritis | FAERS: 3 | US FAERS | |
| 238 | Precancerous skin lesion | FAERS: 3 | US FAERS | |
| 239 | Pregnancy | FAERS: 3 | US FAERS | |
| 240 | Product use issue | FAERS: 3 | US FAERS | |
| 241 | Proteinuria | FAERS: 3 | 3513563 | CTD US FAERS |
| 242 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 243 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 244 | Sinus headache | FAERS: 3 | US FAERS | |
| 245 | Sneezing | FAERS: 3 | US FAERS | |
| 246 | Somnambulism | FAERS: 3 | 18670251 | CTD US FAERS |
| 247 | Tachyarrhythmia | FAERS: 3 | US FAERS | |
| 248 | Tension | FAERS: 3 | SIDER US FAERS | |
| 249 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 250 | Tooth Loss | FAERS: 3 | US FAERS | |
| 251 | Accidental exposure | FAERS: 2 | US FAERS | |
| 252 | Alveolitis | FAERS: 2 | US FAERS | |
| 253 | Anger | FAERS: 2 | US FAERS | |
| 254 | Anorexia | FAERS: 2 | OFFSIDES US FAERS | |
| 255 | Anosmia | FAERS: 2 | US FAERS | |
| 256 | Aortic Aneurysm | FAERS: 2 | OFFSIDES US FAERS | |
| 257 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 258 | Blood creatine increased | FAERS: 2 | OFFSIDES US FAERS | |
| 259 | Blood potassium increased | FAERS: 2 | OFFSIDES US FAERS | |
| 260 | Blood urea increased | FAERS: 2 | OFFSIDES US FAERS | |
| 261 | Blood urine present | FAERS: 2 | US FAERS | |
| 262 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 263 | Chemotherapy | FAERS: 2 | US FAERS | |
| 264 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 265 | Choking | FAERS: 2 | US FAERS | |
| 266 | Cluster Headache | FAERS: 2 | US FAERS | |
| 267 | Congenital cystic kidney disease | FAERS: 2 | US FAERS | |
| 268 | Delusional disorder, unspecified type | FAERS: 2 | US FAERS | |
| 269 | Dental caries | FAERS: 2 | US FAERS | |
| 270 | Depressed mood | FAERS: 2 | US FAERS | |
| 271 | Depression suicidal | FAERS: 2 | US FAERS | |
| 272 | Drug abuse | FAERS: 2 | US FAERS | |
| 273 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 274 | Drug level increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Dry skin | FAERS: 2 | US FAERS | |
| 276 | Dysarthria | FAERS: 2 | US FAERS | |
| 277 | Dysuria | FAERS: 2 | US FAERS | |
| 278 | Ejection fraction abnormal | FAERS: 2 | US FAERS | |
| 279 | Emotional distress | FAERS: 2 | SIDER US FAERS | |
| 280 | False positive investigation result | FAERS: 2 | US FAERS | |
| 281 | Fluid overload | FAERS: 2 | OFFSIDES US FAERS | |
| 282 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 283 | Gastritis | FAERS: 2 | US FAERS | |
| 284 | Gastrointestinal tract adenoma | FAERS: 2 | US FAERS | |
| 285 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 286 | Heart sounds abnormal | FAERS: 2 | US FAERS | |
| 287 | Hemiparesis | FAERS: 2 | US FAERS | |
| 288 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 289 | Hernia | FAERS: 2 | US FAERS | |
| 290 | Hypophagia | FAERS: 2 | US FAERS | |
| 291 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 292 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 293 | Joint sprain | FAERS: 2 | US FAERS | |
| 294 | Laceration | FAERS: 2 | US FAERS | |
| 295 | Loose tooth | FAERS: 2 | US FAERS | |
| 296 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 297 | Lymphocyte stimulation test positive | FAERS: 2 | US FAERS | |
| 298 | Malignant tumour excision | FAERS: 2 | US FAERS | |
| 299 | Metabolic acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 300 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 301 | Misophonia | FAERS: 2 | US FAERS | |
| 302 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 303 | Onychoclasis | FAERS: 2 | US FAERS | |
| 304 | Oral pain | FAERS: 2 | US FAERS | |
| 305 | Osteoporosis | FAERS: 2 | US FAERS | |
| 306 | Pacemaker generated arrhythmia | FAERS: 2 | US FAERS | |
| 307 | Pallor | FAERS: 2 | US FAERS | |
| 308 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 309 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 310 | Product size issue | FAERS: 2 | US FAERS | |
| 311 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 312 | Renal pain | FAERS: 2 | US FAERS | |
| 313 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 314 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 315 | Sepsis | FAERS: 2 | US FAERS | |
| 316 | Sexual Dysfunction | FAERS: 2 | SIDER US FAERS | |
| 317 | Splenomegaly | FAERS: 2 | US FAERS | |
| 318 | Stupor | FAERS: 2 | US FAERS | |
| 319 | Sudden death | FAERS: 2 | OFFSIDES US FAERS | |
| 320 | Sudden infant death syndrome | FAERS: 2 | US FAERS | |
| 321 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 322 | Therapy cessation | FAERS: 2 | US FAERS | |
| 323 | Thirst | FAERS: 2 | US FAERS | |
| 324 | Toothache | FAERS: 2 | US FAERS | |
| 325 | Ulcer | FAERS: 2 | OFFSIDES US FAERS | |
| 326 | Underweight | FAERS: 2 | US FAERS | |
| 327 | Unresponsive to stimuli | FAERS: 2 | OFFSIDES US FAERS | |
| 328 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 329 | Urinary Retention | FAERS: 2 | US FAERS | |
| 330 | Vascular stenosis | FAERS: 2 | US FAERS | |
| 331 | Visual disturbance | FAERS: 2 | SIDER US FAERS | |
| 332 | colonoscopy | FAERS: 2 | US FAERS | |
| 333 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 334 | Accidental death | FAERS: 1 | US FAERS | |
| 335 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 336 | Adrenal cortex necrosis | FAERS: 1 | US FAERS | |
| 337 | Agoraphobia | FAERS: 1 | US FAERS | |
| 338 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 339 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 340 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 341 | Altered state of consciousness | FAERS: 1 | SIDER US FAERS | |
| 342 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 343 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 344 | Animal bite | FAERS: 1 | US FAERS | |
| 345 | Antibiotic therapy | FAERS: 1 | US FAERS | |
| 346 | Arterial Injury | FAERS: 1 | US FAERS | |
| 347 | Arthropod bite | FAERS: 1 | US FAERS | |
| 348 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 349 | Asthenopia | FAERS: 1 | US FAERS | |
| 350 | Atrial thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 351 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 352 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 353 | Bladder spasm | FAERS: 1 | US FAERS | |
| 354 | Blepharospasm | FAERS: 1 | US FAERS | |
| 355 | Blood Pressure | FAERS: 1 | US FAERS | |
| 356 | Blood aldosterone decreased | FAERS: 1 | US FAERS | |
| 357 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 358 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 359 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 360 | Blood creatinine increased | FAERS: 1 | OFFSIDES US FAERS | |
| 361 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 362 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 363 | Blood immunoglobulin G abnormal | FAERS: 1 | US FAERS | |
| 364 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 365 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 366 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 367 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 368 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 369 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 370 | Carcinoma in situ of skin | FAERS: 1 | US FAERS | |
| 371 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 372 | Cardiac monitoring | FAERS: 1 | US FAERS | |
| 373 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 374 | Cardioactive drug level increased | FAERS: 1 | US FAERS | |
| 375 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 376 | Cardiomyopathy neonatal | FAERS: 1 | US FAERS | |
| 377 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 378 | Carotid pulse increased | FAERS: 1 | US FAERS | |
| 379 | Cartilage injury | FAERS: 1 | US FAERS | |
| 380 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 381 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 382 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 383 | Chromaturia | FAERS: 1 | OFFSIDES US FAERS | |
| 384 | Chronotropic incompetence | FAERS: 1 | US FAERS | |
| 385 | Colitis | FAERS: 1 | US FAERS | |
| 386 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 387 | Cyst | FAERS: 1 | US FAERS | |
| 388 | Decorticate posture | FAERS: 1 | US FAERS | |
| 389 | Delusional perception | FAERS: 1 | US FAERS | |
| 390 | Device dislocation | FAERS: 1 | US FAERS | |
| 391 | Device malfunction | FAERS: 1 | US FAERS | |
| 392 | Disease recurrence | FAERS: 1 | US FAERS | |
| 393 | Dissociation | FAERS: 1 | US FAERS | |
| 394 | Dreamy state | FAERS: 1 | US FAERS | |
| 395 | Drug Dependence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 396 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 397 | Drug label confusion | FAERS: 1 | US FAERS | |
| 398 | Drug name confusion | FAERS: 1 | US FAERS | |
| 399 | Dysphemia | FAERS: 1 | US FAERS | |
| 400 | Ear congestion | FAERS: 1 | US FAERS | |
| 401 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 402 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 403 | Embolic stroke | FAERS: 1 | US FAERS | |
| 404 | Emotional disorder | FAERS: 1 | US FAERS | |
| 405 | Eosinophilia | FAERS: 1 | US FAERS | |
| 406 | Escherichia infection | FAERS: 1 | US FAERS | |
| 407 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 408 | Ex-tobacco user | FAERS: 1 | US FAERS | |
| 409 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 410 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 411 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 412 | Facial Pain | FAERS: 1 | US FAERS | |
| 413 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 414 | Fibrosis | FAERS: 1 | 22888001 30809271 | CTD US FAERS |
| 415 | Food Allergy | FAERS: 1 | US FAERS | |
| 416 | Gangrene | FAERS: 1 | 77987 | CTD SIDER US FAERS |
| 417 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 418 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 419 | Gene Mutation | FAERS: 1 | US FAERS | |
| 420 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 421 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 422 | Hemiplegic migraine | FAERS: 1 | US FAERS | |
| 423 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 424 | Hip surgery | FAERS: 1 | OFFSIDES US FAERS | |
| 425 | Hypercapnia | FAERS: 1 | US FAERS | |
| 426 | Hyperkeratosis lenticularis perstans | FAERS: 1 | US FAERS | |
| 427 | Hypertensive emergency | FAERS: 1 | OFFSIDES US FAERS | |
| 428 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 429 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 430 | Hypocalciuria | FAERS: 1 | US FAERS | |
| 431 | Hypocalvaria | FAERS: 1 | US FAERS | |
| 432 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 433 | Hypoventilation | FAERS: 1 | US FAERS | |
| 434 | Immobile | FAERS: 1 | US FAERS | |
| 435 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 436 | Impaired self-care | FAERS: 1 | US FAERS | |
| 437 | Incontinence | FAERS: 1 | US FAERS | |
| 438 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 439 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 440 | Infarction | FAERS: 1 | US FAERS | |
| 441 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 442 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 443 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 444 | Intermittent Claudication | FAERS: 1 | 77987 | CTD SIDER US FAERS |
| 445 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 446 | Iron deficiency | FAERS: 1 | US FAERS | |
| 447 | Joint Instability | FAERS: 1 | US FAERS | |
| 448 | Joint stiffness | FAERS: 1 | US FAERS | |
| 449 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 450 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 451 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 452 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 453 | Laryngospasm | FAERS: 1 | SIDER US FAERS | |
| 454 | Leukocytosis | FAERS: 1 | US FAERS | |
| 455 | Lichen Planus | FAERS: 1 | US FAERS | |
| 456 | Lichenification | FAERS: 1 | US FAERS | |
| 457 | Ligament rupture | FAERS: 1 | US FAERS | |
| 458 | Limb operation | FAERS: 1 | US FAERS | |
| 459 | Limb prosthesis user | FAERS: 1 | US FAERS | |
| 460 | Lyme Disease | FAERS: 1 | US FAERS | |
| 461 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 462 | Lymphoma | FAERS: 1 | OFFSIDES US FAERS | |
| 463 | Lymphopenia | FAERS: 1 | US FAERS | |
| 464 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 465 | Malabsorption | FAERS: 1 | US FAERS | |
| 466 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 467 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 468 | Mastectomy | FAERS: 1 | US FAERS | |
| 469 | Mastitis | FAERS: 1 | US FAERS | |
| 470 | Medication tampering | FAERS: 1 | US FAERS | |
| 471 | Mental Retardation | FAERS: 1 | US FAERS | |
| 472 | Microcephaly | FAERS: 1 | US FAERS | |
| 473 | Mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 474 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 475 | Monocytosis | FAERS: 1 | US FAERS | |
| 476 | Monoparesis | FAERS: 1 | US FAERS | |
| 477 | Mouth swelling | FAERS: 1 | US FAERS | |
| 478 | Muscle tightness | FAERS: 1 | US FAERS | |
| 479 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 480 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 481 | Myocarditis | FAERS: 1 | 17593350 | CTD US FAERS |
| 482 | Myositis | FAERS: 1 | US FAERS | |
| 483 | Neonatal tachycardia | FAERS: 1 | US FAERS | |
| 484 | Neuralgia | FAERS: 1 | US FAERS | |
| 485 | No adverse reaction | FAERS: 1 | US FAERS | |
| 486 | Nocturia | FAERS: 1 | OFFSIDES US FAERS | |
| 487 | Obesity | FAERS: 1 | US FAERS | |
| 488 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 489 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 490 | Onychalgia | FAERS: 1 | US FAERS | |
| 491 | Onycholysis | FAERS: 1 | US FAERS | |
| 492 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 493 | Oral infection | FAERS: 1 | US FAERS | |
| 494 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 495 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 496 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 497 | Osteomyelitis | FAERS: 1 | OFFSIDES US FAERS | |
| 498 | Overweight | FAERS: 1 | US FAERS | |
| 499 | Pacemaker generated rhythm | FAERS: 1 | US FAERS | |
| 500 | Panic Disorder | FAERS: 1 | US FAERS | |
| 501 | Paresis | FAERS: 1 | US FAERS | |
| 502 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 503 | Periarthritis | FAERS: 1 | US FAERS | |
| 504 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 505 | Peripartum cardiomyopathy | FAERS: 1 | US FAERS | |
| 506 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 507 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 508 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 509 | Procedural complication | FAERS: 1 | US FAERS | |
| 510 | Product impurity | FAERS: 1 | US FAERS | |
| 511 | Product lot number issue | FAERS: 1 | US FAERS | |
| 512 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 513 | Product name confusion | FAERS: 1 | US FAERS | |
| 514 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 515 | Product physical issue | FAERS: 1 | US FAERS | |
| 516 | Product prescribing error | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 517 | Product storage error | FAERS: 1 | US FAERS | |
| 518 | Productive Cough | FAERS: 1 | US FAERS | |
| 519 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 520 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 521 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 522 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 523 | Purpura | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 524 | Purulent discharge | FAERS: 1 | US FAERS | |
| 525 | Pyuria | FAERS: 1 | US FAERS | |
| 526 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 527 | Radial pulse decreased | FAERS: 1 | US FAERS | |
| 528 | Radiofrequency Ablation | FAERS: 1 | US FAERS | |
| 529 | Rales | FAERS: 1 | SIDER US FAERS | |
| 530 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 531 | Renal cyst | FAERS: 1 | US FAERS | |
| 532 | Renal hypertension | FAERS: 1 | US FAERS | |
| 533 | Renin decreased | FAERS: 1 | US FAERS | |
| 534 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 535 | Retroperitoneal fibrosis | FAERS: 1 | 8554013 | CTD SIDER US FAERS |
| 536 | Rhabdomyolysis | FAERS: 1 | 12243603 | CTD US FAERS |
| 537 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 538 | Sacroiliitis | FAERS: 1 | US FAERS | |
| 539 | Saliva altered | FAERS: 1 | US FAERS | |
| 540 | Sciatica | FAERS: 1 | US FAERS | |
| 541 | Scleroderma | FAERS: 1 | US FAERS | |
| 542 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 543 | Sinus operation | FAERS: 1 | US FAERS | |
| 544 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 545 | Sluggishness | FAERS: 1 | US FAERS | |
| 546 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 547 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 548 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 549 | Stomatitis | FAERS: 1 | US FAERS | |
| 550 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 551 | Supraventricular tachyarrhythmia | FAERS: 1 | US FAERS | |
| 552 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 553 | Terminal state | FAERS: 1 | OFFSIDES US FAERS | |
| 554 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 555 | Thirst decreased | FAERS: 1 | US FAERS | |
| 556 | Transcription medication error | FAERS: 1 | US FAERS | |
| 557 | Transplant | FAERS: 1 | US FAERS | |
| 558 | Up and down phenomenon | FAERS: 1 | US FAERS | |
| 559 | Upper respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 560 | Urine potassium decreased | FAERS: 1 | US FAERS | |
| 561 | Vascular pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 562 | Vascular stent insertion | FAERS: 1 | US FAERS | |
| 563 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 564 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 565 | Ventricular Dysfunction | FAERS: 1 | 3437726 4028383 16162791 | CTD US FAERS |
| 566 | Ventricular Fibrillation | FAERS: 1 | 2726785 6655564 8649751 | CTD US FAERS |
| 567 | Ventricular hyperkinesia | FAERS: 1 | US FAERS | |
| 568 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 569 | Vitreous Detachment | FAERS: 1 | OFFSIDES US FAERS | |
| 570 | Vulvovaginal injury | FAERS: 1 | US FAERS | |
| 571 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 572 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 573 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 574 | Wrong product administered | FAERS: 1 | US FAERS | |
| 575 | pH urine decreased | FAERS: 1 | US FAERS | |
| 576 | Abdominal Abscess | OFFSIDES | ||
| 577 | Abdominal mass | OFFSIDES | ||
| 578 | Abnormal clotting factor | OFFSIDES | ||
| 579 | Abscess | OFFSIDES | ||
| 580 | Ache | SIDER | ||
| 581 | Acid reflux | OFFSIDES | ||
| 582 | Acidosis | OFFSIDES | ||
| 583 | Actinomycosis | OFFSIDES | ||
| 584 | Acute Coronary Syndrome | 18987767 | CTD | |
| 585 | Acute graft versus host disease in intestine | OFFSIDES | ||
| 586 | Acute myocardial infarction | SIDER | ||
| 587 | Agranulocytosis | SIDER | ||
| 588 | Akathisia, Drug-Induced | 1681561 | CTD | |
| 589 | Akinetic Mutism | 7635387 | CTD | |
| 590 | Albuminuria | 11576345 16286578 | CTD | |
| 591 | Alcoholic Intoxication | OFFSIDES | ||
| 592 | Alertness decreased | SIDER | ||
| 593 | Alopecia reversible | SIDER | ||
| 594 | Ammonia increased | OFFSIDES | ||
| 595 | Analgesia | OFFSIDES | ||
| 596 | Anhidrosis | OFFSIDES | ||
| 597 | Anuria | OFFSIDES | ||
| 598 | Anxiety Disorders | 21112460 | CTD | |
| 599 | Arterial insufficiency | SIDER | ||
| 600 | Asbestosis | OFFSIDES | ||
| 601 | Ascites | OFFSIDES | ||
| 602 | Aspergillosis | OFFSIDES | ||
| 603 | Asterixis | OFFSIDES | ||
| 604 | Atelectasis | OFFSIDES | ||
| 605 | Atherosclerosis | 19356726 | CTD | |
| 606 | Atrial tachycardia | OFFSIDES | ||
| 607 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 608 | Bilirubin conjugated increased | OFFSIDES | ||
| 609 | Biopsy lymph gland abnormal | OFFSIDES | ||
| 610 | Blepharoptosis | OFFSIDES | ||
| 611 | Blood Glucose | OFFSIDES | ||
| 612 | Blood cholesterol | OFFSIDES | ||
| 613 | Blood creatinine decreased | OFFSIDES | ||
| 614 | Blood lactate dehydrogenase decreased | OFFSIDES | ||
| 615 | Blood pH decreased | OFFSIDES | ||
| 616 | Blood sodium increased | OFFSIDES | ||
| 617 | Blood sodium | OFFSIDES | ||
| 618 | Blood uric acid | OFFSIDES | ||
| 619 | Brachydactyly with hypertension | 12811651 | CTD | |
| 620 | Brain Concussion | OFFSIDES | ||
| 621 | Brain natriuretic peptide increased | OFFSIDES | ||
| 622 | Bronchoalveolar Lavage | OFFSIDES | ||
| 623 | Bulbar palsy | OFFSIDES | ||
| 624 | Cachexia | 14966787 | CTD | |
| 625 | Cardiomyopathies | CTD | ||
| 626 | Cardiomyopathy, Dilated | CTD | ||
| 627 | Cardiovascular Diseases | 19556521 | CTD | |
| 628 | Catheter placement | OFFSIDES | ||
| 629 | Catheter related complication | OFFSIDES | ||
| 630 | Cerebral disorder | OFFSIDES | ||
| 631 | Cheilitis | OFFSIDES | ||
| 632 | Chemical burn of skin | OFFSIDES | ||
| 633 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 634 | Clostridium difficile colitis | OFFSIDES | ||
| 635 | Cold hands & feet | SIDER | ||
| 636 | Colonic Stenosis | OFFSIDES | ||
| 637 | Confabulation | OFFSIDES | ||
| 638 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 639 | Conjunctivitis | SIDER | ||
| 640 | Cor pulmonale | OFFSIDES | ||
| 641 | Deafness Neurosensory | OFFSIDES | ||
| 642 | Debridement | OFFSIDES | ||
| 643 | Demyelination | OFFSIDES | ||
| 644 | Depressive disorder | 6130226 21112460 | CTD | |
| 645 | Dermatitis | SIDER | ||
| 646 | Device related infection | OFFSIDES | ||
| 647 | Diabetes | OFFSIDES | ||
| 648 | Diabetes Insipidus | OFFSIDES | ||
| 649 | Diabetes mellitus exacerbated | SIDER | ||
| 650 | Diabetic Cardiomyopathies | 18203848 18703049 | CTD | |
| 651 | Diarrhea | OFFSIDES | ||
| 652 | Diastolic dysfunction | OFFSIDES | ||
| 653 | Diffuse Large B-Cell Lymphoma | OFFSIDES | ||
| 654 | Disturbance in sexual arousal | SIDER | ||
| 655 | Drowsiness | OFFSIDES | ||
| 656 | Drug addict | OFFSIDES | ||
| 657 | Drug toxicity | OFFSIDES | ||
| 658 | Dyslipidemias | 8761899 | CTD | |
| 659 | Dyspnea | 16198657 | CTD | |
| 660 | Ear and labyrinth disorders | SIDER | ||
| 661 | Eczema | Canada Vigilance: 1 | Canada Vigilance | |
| 662 | Edema | 8554013 | CTD | |
| 663 | Electrocardiogram QT interval abnormal | OFFSIDES | ||
| 664 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 665 | Endometrial hypertrophy | OFFSIDES | ||
| 666 | Endomyocardial Fibrosis | 18820026 | CTD | |
| 667 | Exanthema | 8554013 12090909 | CTD | |
| 668 | Excoriation | OFFSIDES | ||
| 669 | Exophthalmos | OFFSIDES | ||
| 670 | Fatty Liver | OFFSIDES | ||
| 671 | Febrile Neutropenia | OFFSIDES | ||
| 672 | Full blood count decreased | OFFSIDES | ||
| 673 | Gastroenteritis | OFFSIDES | ||
| 674 | Gastrointestinal Pain | SIDER | ||
| 675 | Glycosuria | 3513563 | CTD | |
| 676 | Goiter | OFFSIDES | ||
| 677 | Granuloma | OFFSIDES | ||
| 678 | Hallucinations, mixed | Canada Vigilance: 1 | Canada Vigilance | |
| 679 | Hallucinations | CTD | ||
| 680 | Hearing Loss, Mixed Conductive-Sensorineural | 6439285 | CTD | |
| 681 | Heart Block | 7785794 | CTD | |
| 682 | Heart Diseases | 1711635 22888001 | CTD | |
| 683 | Heart failure |
8364004
9415001 10551702 11192362 11336626 12167389 12748215 15816327 15864115 15880336 16624680 17440824 17496726 17531662 17961425 19103992 20562496 21395649 23066222 | CTD | |
| 684 | Heartburn | SIDER | ||
| 685 | Hematuria | 8554013 | CTD | |
| 686 | Hemicephalalgia | OFFSIDES | ||
| 687 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 688 | Hepatic Encephalopathy | 10470702 | CTD | |
| 689 | Hepatic Vein Thrombosis | OFFSIDES | ||
| 690 | Hepatic cancer metastatic | OFFSIDES | ||
| 691 | Hepatic congestion | OFFSIDES | ||
| 692 | Hepatitis | 12243603 | CTD SIDER | |
| 693 | Hilar lymphadenopathy | OFFSIDES | ||
| 694 | Hydronephrosis | 8554013 | CTD | |
| 695 | Hyperalgesia | 20601862 | CTD | |
| 696 | Hyperemia | 9074535 12900738 | CTD | |
| 697 | Hyperglycemia | 3513563 | CTD | |
| 698 | Hyperkalemia | 12671332 | CTD | |
| 699 | Hypotension, Orthostatic | 18043911 | CTD | |
| 700 | Increased upper airway secretion | OFFSIDES | ||
| 701 | Injection site erythema | OFFSIDES | ||
| 702 | Insulin Resistance | 8761899 | CTD | |
| 703 | Intestinal Obstruction | OFFSIDES | ||
| 704 | Intestinal Perforation | OFFSIDES | ||
| 705 | Ischemia | 2878675 | CTD | |
| 706 | Kidney Diseases | 11576345 | CTD | |
| 707 | Kidney Failure | OFFSIDES | ||
| 708 | Language Disorders | 12090909 | CTD | |
| 709 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 710 | Left atrial dilatation | OFFSIDES | ||
| 711 | Leukoencephalopathy | OFFSIDES | ||
| 712 | Leukopenia | SIDER | ||
| 713 | Libido disorder | SIDER | ||
| 714 | Lightheadedness | SIDER | ||
| 715 | Listeriosis | OFFSIDES | ||
| 716 | Long QT Syndrome | 16144878 18294935 19353679 | CTD | |
| 717 | Lupus Erythematosus, Systemic | 1747706 | CTD | |
| 718 | Macrocytosis | OFFSIDES | ||
| 719 | Malignant mesenteric neoplasm | OFFSIDES | ||
| 720 | Metaplasia | OFFSIDES | ||
| 721 | Metastases to stomach | OFFSIDES | ||
| 722 | Micrographic skin surgery | OFFSIDES | ||
| 723 | Migraine Disorders | 15282848 16198657 19708964 | CTD | |
| 724 | Mononeuritis | OFFSIDES | ||
| 725 | Mood swings | SIDER | ||
| 726 | Muscle Weakness | OFFSIDES | ||
| 727 | Mycosis Fungoides | OFFSIDES | ||
| 728 | Myelodysplasia | OFFSIDES | ||
| 729 | Myocardial Ischemia | 11079278 19623992 | CTD | |
| 730 | Myocardial Reperfusion Injury | 20590644 | CTD | |
| 731 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 732 | Non-cardiac chest pain | OFFSIDES | ||
| 733 | Ocular Hypertension | 7010891 | CTD | |
| 734 | Ocular icterus | OFFSIDES | ||
| 735 | Oral discharge | OFFSIDES | ||
| 736 | Oral mucosal erythema | OFFSIDES | ||
| 737 | Oropharyngeal discomfort | SIDER | ||
| 738 | Paraganglioma | 21318381 | CTD | |
| 739 | Parasystole | 8649751 | CTD | |
| 740 | Paresthesia | 293566 | CTD | |
| 741 | Peripheral Vascular Diseases | 6961757 | CTD | |
| 742 | Peripheral embolism | OFFSIDES | ||
| 743 | Pleocytosis | OFFSIDES | ||
| 744 | Pneumonitis | Canada Vigilance: 1 | Canada Vigilance | |
| 745 | Polyuria | 293566 | CTD | |
| 746 | Pre-Eclampsia | 15804228 | CTD | |
| 747 | Precordial pain | SIDER | ||
| 748 | Progesterone receptor assay | OFFSIDES | ||
| 749 | Prostate cancer recurrent | OFFSIDES | ||
| 750 | Psoriasis flare-up | SIDER | ||
| 751 | Psychoses, Substance-Induced | 16223079 | CTD | |
| 752 | Pulmonary Edema | 7988234 18566202 19556521 | CTD | |
| 753 | Pulmonary arterial pressure increased | OFFSIDES | ||
| 754 | Raynaud Disease | 12090909 | CTD | |
| 755 | Red blood cell agglutination present | OFFSIDES | ||
| 756 | Reflux gastritis | OFFSIDES | ||
| 757 | Reflux laryngitis | OFFSIDES | ||
| 758 | Renal Colic | 8554013 | CTD | |
| 759 | Renal tubular necrosis | OFFSIDES | ||
| 760 | Respiratory Insufficiency | 18566202 | CTD | |
| 761 | Rhinitis | SIDER | ||
| 762 | Sensation Disorders | 14506449 | CTD | |
| 763 | Seroma | OFFSIDES | ||
| 764 | Shock, Cardiogenic | 3156367 8649751 18566202 | CTD | |
| 765 | Signs and Symptoms, Digestive | 7040924 | CTD | |
| 766 | Skin hypertrophy | OFFSIDES | ||
| 767 | Skin lesion | OFFSIDES SIDER | ||
| 768 | Skin test positive | OFFSIDES | ||
| 769 | Sleep Wake Disorders | CTD | ||
| 770 | Splenic abscess | OFFSIDES | ||
| 771 | Status Asthmaticus | SIDER | ||
| 772 | Stenotrophomonas infection | OFFSIDES | ||
| 773 | Stomach ache | SIDER | ||
| 774 | Substance Withdrawal Syndrome | 17949833 | CTD | |
| 775 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 776 | Sweating | SIDER | ||
| 777 | Tachycardia, Ventricular | 4028383 8649751 | CTD | |
| 778 | Takotsubo Cardiomyopathy | 19300450 | CTD | |
| 779 | Thrombocytopenia | SIDER | ||
| 780 | Thrombocytopenic purpura | SIDER | ||
| 781 | Torsades de Pointes | 19353679 | CTD | |
| 782 | Troponin I increased | OFFSIDES | ||
| 783 | Unresponsive to pain stimuli | OFFSIDES | ||
| 784 | Upper respiratory tract inflammation | OFFSIDES | ||
| 785 | Ureteral obstruction | 8554013 | CTD | |
| 786 | Ureterostomy site discomfort | OFFSIDES | ||
| 787 | Vascular Diseases | 8554013 | CTD | |
| 788 | Ventricular Dysfunction, Left | CTD | ||
| 789 | Ventricular Remodeling | CTD | ||
| 790 | Ventricular hypokinesia | OFFSIDES | ||
| 791 | Wound Debridement | OFFSIDES | ||
| 792 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.