Amoxicillin-Potassium Clavulanate Combination
(DWHGNUUWCJZQHO-ZVDZYBSKSA-M)
Structure
- SMILES
- O=C([C@@H](c1ccc(cc1)O)N)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C.[O-]C(=O)[C@@H]1N2[C@H](O/C/1=C\CO)CC2=O.[K+]
- Molecular Formula:
- C24H27KN4O10S
- Molecular Weight:
- 602.655
- Log P:
- -1.4396
- Hydrogen Bond Acceptor:
- 15
- Hydrogen Bond Donor:
- 5
- TPSA:
- 248.16
- CAS Number(s):
- 74469-00-4
Synonym(s)
1.
Amoxicillin-Potassium Clavulanate Combination
2.
Amoxicillin-Clavulanic Acid
3.
Potassium Clavulanate-Amoxicillin Combination
4.
Amox-clav
5.
Amoxi-Clavulanate
6.
Amoxycillin-Clavulanic Acid
7.
Augmentin
8.
BRL-25000
9.
Clavulanate Potentiated Amoxycillin
10.
Clavulin
11.
Co-amoxiclav
12.
Coamoxiclav
13.
Spektramox
14.
Synulox
15.
Amox clav
16.
Amoxi Clavulanate
17.
Amoxicillin Clavulanic Acid
18.
Amoxicillin Potassium Clavulanate Combination
19.
Amoxycillin Clavulanic Acid
20.
Amoxycillin, Clavulanate Potentiated
21.
BRL 25000
22.
BRL25000
23.
Co amoxiclav
24.
Potassium Clavulanate Amoxicillin Combination
External Link(s)
| MeSH | D019980 |
| PubChem Compound | 23665637 |
| CHEMBL | CHEMBL1697738 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pruritus | FAERS: 248 Canada Vigilance: 7 | CTD Canada Vigilance US FAERS | |
| 2 | Vomiting | FAERS: 206 Canada Vigilance: 13 | 9802654 15678708 | CTD Canada Vigilance US FAERS |
| 3 | Urticaria | FAERS: 162 Canada Vigilance: 16 | 11792017 24329898 | CTD Canada Vigilance US FAERS |
| 4 | Nausea | FAERS: 147 Canada Vigilance: 11 | 7555652 9380177 15678708 | CTD Canada Vigilance US FAERS |
| 5 | Erythema | FAERS: 117 Canada Vigilance: 2 | 24329898 | CTD Canada Vigilance US FAERS |
| 6 | Malaise | FAERS: 108 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | jaundice | FAERS: 104 Canada Vigilance: 8 |
2289658
2290034 2925057 7555652 7819719 9380177 10369618 10548348 10750660 11309226 11894665 15678708 16083708 16205517 17162128 18028086 | CTD Canada Vigilance US FAERS |
| 8 | Abdominal Pain | FAERS: 92 Canada Vigilance: 7 | 9380177 9802654 | CTD Canada Vigilance US FAERS |
| 9 | Cardiac Arrest | FAERS: 90 | US FAERS | |
| 10 | Drug ineffective | FAERS: 87 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Anaphylactic shock | FAERS: 85 | US FAERS | |
| 12 | Hypersensitivity | FAERS: 80 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Hypotension | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Dizziness | FAERS: 67 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Angioedema | FAERS: 60 | US FAERS | |
| 16 | Chromaturia | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Fatigue | FAERS: 57 | 7555652 10369618 10750660 | CTD US FAERS |
| 18 | Headache | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Cholestasis | FAERS: 51 |
1482041
1728522 2289658 2290034 2326558 2809168 2925057 7555652 7712397 7819719 8328159 8550991 8570979 8651842 9090930 9707067 9741209 10369618 10548348 10636987 11309226 11422607 11894665 12809593 15678708 15789834 18023105 18028086 18218281 | CTD US FAERS |
| 20 | Product quality issue | FAERS: 48 | US FAERS | |
| 21 | Alanine Aminotransferase Increased | FAERS: 43 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 22 | Asthenia | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Aspartate Aminotransferase Increased | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 24 | Blood alkaline phosphatase increased | FAERS: 37 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 25 | Bronchospasm | FAERS: 35 | US FAERS | |
| 26 | Pharmaceutical product complaint | FAERS: 34 | US FAERS | |
| 27 | Chills | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Rash erythematous | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Chest Pain | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Gamma-Glutamyltransferase Increased | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Hepatitis | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 32 | Pain | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 33 | Tachycardia | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Medication Error | FAERS: 31 | US FAERS | |
| 35 | Weight decreased | FAERS: 30 | US FAERS | |
| 36 | Lip swelling | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Arthralgia | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 38 | Documented hypersensitivity to administered product | FAERS: 25 | US FAERS | |
| 39 | Stevens-Johnson Syndrome | FAERS: 25 Canada Vigilance: 1 | 10369618 | CTD Canada Vigilance US FAERS |
| 40 | Transaminases increased | FAERS: 25 | US FAERS | |
| 41 | Abdominal discomfort | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 42 | Erythema Multiforme | FAERS: 23 Canada Vigilance: 4 | 2326558 9802654 | CTD Canada Vigilance US FAERS |
| 43 | Drug exposure during pregnancy | FAERS: 22 | US FAERS | |
| 44 | Clostridium difficile colitis | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 45 | Hepatotoxicity | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Leukocytosis | FAERS: 21 | US FAERS | |
| 47 | Purpura | FAERS: 21 Canada Vigilance: 2 | 11422607 | CTD Canada Vigilance US FAERS |
| 48 | Hepatomegaly | FAERS: 20 | US FAERS | |
| 49 | Lymphadenopathy | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Presyncope | FAERS: 19 | US FAERS | |
| 51 | Chest discomfort | FAERS: 18 | US FAERS | |
| 52 | Cyanosis | FAERS: 18 | US FAERS | |
| 53 | Kounis Syndrome | FAERS: 18 | US FAERS | |
| 54 | Syncope | FAERS: 18 | US FAERS | |
| 55 | Burning sensation | FAERS: 17 | US FAERS | |
| 56 | Colitis | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Pneumonia | FAERS: 17 | CTD US FAERS | |
| 58 | Toxic Epidermal Necrolysis | FAERS: 17 | US FAERS | |
| 59 | Dehydration | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Dyspepsia | FAERS: 16 | US FAERS | |
| 61 | Eosinophilia | FAERS: 16 | 2925057 | CTD US FAERS |
| 62 | Swelling | FAERS: 16 | US FAERS | |
| 63 | Blood lactate dehydrogenase increased | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Drug dispensing error | FAERS: 15 | US FAERS | |
| 65 | Flushing | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Mixed liver injury | FAERS: 15 | US FAERS | |
| 67 | Overdose | FAERS: 15 | US FAERS | |
| 68 | Somnolence | FAERS: 15 | US FAERS | |
| 69 | Agitation | FAERS: 14 | US FAERS | |
| 70 | Cholestatic liver injury | FAERS: 14 | US FAERS | |
| 71 | Constipation | FAERS: 14 | US FAERS | |
| 72 | Feeling abnormal | FAERS: 14 | US FAERS | |
| 73 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 74 | Lethargy | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Tremor | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | pseudomembranous colitis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Drug administration error | FAERS: 13 | US FAERS | |
| 78 | Peripheral swelling | FAERS: 13 | US FAERS | |
| 79 | Respiratory arrest | FAERS: 13 | US FAERS | |
| 80 | Skin lesion | FAERS: 13 | US FAERS | |
| 81 | Anorexia | FAERS: 12 | US FAERS | |
| 82 | Ocular icterus | FAERS: 12 | US FAERS | |
| 83 | Pallor | FAERS: 12 | US FAERS | |
| 84 | Thrombocytopenia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Palpitations | FAERS: 11 | US FAERS | |
| 86 | Wheezing | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Back Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Infection | FAERS: 10 | US FAERS | |
| 89 | Inflammation | FAERS: 10 Canada Vigilance: 1 | 7751590 | CTD Canada Vigilance US FAERS |
| 90 | Respiratory distress | FAERS: 10 | US FAERS | |
| 91 | Serum Sickness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Anxiety | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Asthma | FAERS: 9 | US FAERS | |
| 94 | Clostridium colitis | FAERS: 9 | US FAERS | |
| 95 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 96 | Urinary tract infection | FAERS: 9 | US FAERS | |
| 97 | Bilirubin conjugated increased | FAERS: 8 | US FAERS | |
| 98 | Blindness | FAERS: 8 | US FAERS | |
| 99 | Blood creatinine increased | FAERS: 8 | US FAERS | |
| 100 | Cholelithiasis | FAERS: 8 | US FAERS | |
| 101 | Dysgeusia | FAERS: 8 | US FAERS | |
| 102 | Gastrointestinal Pain | FAERS: 8 | US FAERS | |
| 103 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 104 | Myalgia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Pancreatitis | FAERS: 8 Canada Vigilance: 2 | 10548348 16205517 | CTD Canada Vigilance US FAERS |
| 106 | Productive Cough | FAERS: 8 | US FAERS | |
| 107 | Retching | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Shock | FAERS: 8 | US FAERS | |
| 109 | Throat irritation | FAERS: 8 | US FAERS | |
| 110 | Crying | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Dysphonia | FAERS: 7 | US FAERS | |
| 112 | Flatulence | FAERS: 7 | US FAERS | |
| 113 | Hepatic necrosis | FAERS: 7 | US FAERS | |
| 114 | Joint swelling | FAERS: 7 | US FAERS | |
| 115 | Prurigo | FAERS: 7 | US FAERS | |
| 116 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 117 | Sinusitis | FAERS: 7 | 11309226 | CTD US FAERS |
| 118 | Skin reaction | FAERS: 7 | US FAERS | |
| 119 | Vasculitis | FAERS: 7 | US FAERS | |
| 120 | Vertigo | FAERS: 7 | US FAERS | |
| 121 | Visual Impairment | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Wrong technique in drug usage process | FAERS: 7 | US FAERS | |
| 123 | Acidosis | FAERS: 6 | US FAERS | |
| 124 | Adverse event | FAERS: 6 | US FAERS | |
| 125 | Anosmia | FAERS: 6 | US FAERS | |
| 126 | Anuria | FAERS: 6 | 12834178 | CTD US FAERS |
| 127 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 128 | Discomfort | FAERS: 6 | US FAERS | |
| 129 | Gastroenteritis | FAERS: 6 Canada Vigilance: 1 | 9802654 | CTD Canada Vigilance US FAERS |
| 130 | Metabolic acidosis | FAERS: 6 | US FAERS | |
| 131 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 132 | Neutropenia | FAERS: 6 | US FAERS | |
| 133 | Phlebitis | FAERS: 6 | US FAERS | |
| 134 | Product physical issue | FAERS: 6 | US FAERS | |
| 135 | Product storage error | FAERS: 6 | US FAERS | |
| 136 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 137 | Sepsis | FAERS: 6 | US FAERS | |
| 138 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 139 | Abasia | FAERS: 5 | US FAERS | |
| 140 | Acute kidney injury | FAERS: 5 | 12897111 | CTD US FAERS |
| 141 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 142 | Ageusia | FAERS: 5 | US FAERS | |
| 143 | Blood urea increased | FAERS: 5 | US FAERS | |
| 144 | Cheilitis | FAERS: 5 | US FAERS | |
| 145 | Choking | FAERS: 5 | US FAERS | |
| 146 | Dermatitis | FAERS: 5 | US FAERS | |
| 147 | Disorientation | FAERS: 5 | US FAERS | |
| 148 | Dysuria | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 149 | Gastritis | FAERS: 5 | US FAERS | |
| 150 | Hyperventilation | FAERS: 5 | US FAERS | |
| 151 | Keratoconjunctivitis Sicca | FAERS: 5 | US FAERS | |
| 152 | Memory impairment | FAERS: 5 | US FAERS | |
| 153 | Metrorrhagia | FAERS: 5 | US FAERS | |
| 154 | Multi-organ disorder | FAERS: 5 | US FAERS | |
| 155 | Ocular surface disease | FAERS: 5 | US FAERS | |
| 156 | Oropharyngeal discomfort | FAERS: 5 | US FAERS | |
| 157 | Skin test positive | FAERS: 5 | US FAERS | |
| 158 | Tonsillitis | FAERS: 5 | US FAERS | |
| 159 | Tryptase increased | FAERS: 5 | US FAERS | |
| 160 | Vitiligo | FAERS: 5 | US FAERS | |
| 161 | Wrong technique in product usage process | FAERS: 5 | US FAERS | |
| 162 | Accidental overdose | FAERS: 4 | US FAERS | |
| 163 | Anaphylactoid Reaction | FAERS: 4 | US FAERS | |
| 164 | Aphonia | FAERS: 4 | US FAERS | |
| 165 | Auricular swelling | FAERS: 4 | US FAERS | |
| 166 | Autoimmune hepatitis | FAERS: 4 | US FAERS | |
| 167 | Biliary dilatation | FAERS: 4 | US FAERS | |
| 168 | Blepharospasm | FAERS: 4 | US FAERS | |
| 169 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 170 | Blood immunoglobulin E increased | FAERS: 4 | US FAERS | |
| 171 | Candidiasis | FAERS: 4 | 9802654 | CTD US FAERS |
| 172 | Epistaxis | FAERS: 4 | US FAERS | |
| 173 | Extravasation | FAERS: 4 | US FAERS | |
| 174 | Eye pain | FAERS: 4 | US FAERS | |
| 175 | Hypoxia | FAERS: 4 | US FAERS | |
| 176 | Impaired work ability | FAERS: 4 | US FAERS | |
| 177 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 178 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 179 | Lymphocytosis | FAERS: 4 | US FAERS | |
| 180 | Paranoia | FAERS: 4 | US FAERS | |
| 181 | Personality Change | FAERS: 4 | US FAERS | |
| 182 | Photophobia | FAERS: 4 | US FAERS | |
| 183 | Poisoning | FAERS: 4 | US FAERS | |
| 184 | Psoriasis | FAERS: 4 | US FAERS | |
| 185 | Rales | FAERS: 4 | US FAERS | |
| 186 | Splenomegaly | FAERS: 4 | US FAERS | |
| 187 | Thirst | FAERS: 4 | US FAERS | |
| 188 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 189 | Vulvovaginal burning sensation | FAERS: 4 | US FAERS | |
| 190 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 191 | Acute psychosis | FAERS: 3 | US FAERS | |
| 192 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 193 | Angina Pectoris | FAERS: 3 | 2290034 | CTD US FAERS |
| 194 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 195 | Blood iron decreased | FAERS: 3 | US FAERS | |
| 196 | Blood pressure immeasurable | FAERS: 3 | US FAERS | |
| 197 | Blood urine present | FAERS: 3 | US FAERS | |
| 198 | Bone pain | FAERS: 3 | US FAERS | |
| 199 | Cardiac enzymes increased | FAERS: 3 | US FAERS | |
| 200 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 201 | Conjunctivitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | Depressed Level of Consciousness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 204 | Documented hypersensitivity to administered drug | FAERS: 3 | US FAERS | |
| 205 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 206 | Drug resistance | FAERS: 3 | US FAERS | |
| 207 | Drug toxicity | FAERS: 3 | US FAERS | |
| 208 | Dry skin | FAERS: 3 | US FAERS | |
| 209 | Epigastric discomfort | FAERS: 3 | US FAERS | |
| 210 | Epiglottitis | FAERS: 3 | US FAERS | |
| 211 | Epilepsy | FAERS: 3 | US FAERS | |
| 212 | Expired drug administered | FAERS: 3 | US FAERS | |
| 213 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 214 | Exposure via body fluid | FAERS: 3 | US FAERS | |
| 215 | Flank Pain | FAERS: 3 | US FAERS | |
| 216 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 217 | Gamma-glutamyltransferase decreased | FAERS: 3 | US FAERS | |
| 218 | Glossitis | FAERS: 3 | US FAERS | |
| 219 | Hepatitis E | FAERS: 3 | US FAERS | |
| 220 | Hepatorenal Syndrome | FAERS: 3 | US FAERS | |
| 221 | Hyperacusis | FAERS: 3 | US FAERS | |
| 222 | Hypervigilance | FAERS: 3 | US FAERS | |
| 223 | Hypophagia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Infectious Mononucleosis | FAERS: 3 | US FAERS | |
| 225 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 226 | Leukopenia | FAERS: 3 | US FAERS | |
| 227 | Local reaction | FAERS: 3 | US FAERS | |
| 228 | Lung consolidation | FAERS: 3 | US FAERS | |
| 229 | Lymphangitis | FAERS: 3 | US FAERS | |
| 230 | Lymphopenia | FAERS: 3 | US FAERS | |
| 231 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 232 | Megacolon | FAERS: 3 | US FAERS | |
| 233 | Mouth swelling | FAERS: 3 | US FAERS | |
| 234 | Muscle Cramp | FAERS: 3 | US FAERS | |
| 235 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 236 | Neck Pain | FAERS: 3 | US FAERS | |
| 237 | Negative thoughts | FAERS: 3 | US FAERS | |
| 238 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 239 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 240 | Oropharyngeal swelling | FAERS: 3 | US FAERS | |
| 241 | Pancytopenia | FAERS: 3 | US FAERS | |
| 242 | Penile swelling | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Petechiae | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 244 | Product substitution issue | FAERS: 3 | US FAERS | |
| 245 | Proteinuria | FAERS: 3 | US FAERS | |
| 246 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 247 | Reperfusion Injury | FAERS: 3 | US FAERS | |
| 248 | Reticulocyte count increased | FAERS: 3 | US FAERS | |
| 249 | Septic Shock | FAERS: 3 | US FAERS | |
| 250 | Serum sickness-like reaction | FAERS: 3 | US FAERS | |
| 251 | Soft tissue necrosis | FAERS: 3 | US FAERS | |
| 252 | Stool analysis abnormal | FAERS: 3 | US FAERS | |
| 253 | Synovitis | FAERS: 3 | US FAERS | |
| 254 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 255 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 256 | Thrombocytosis | FAERS: 3 | US FAERS | |
| 257 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 258 | Trismus | FAERS: 3 | US FAERS | |
| 259 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 260 | Acholia | FAERS: 2 | US FAERS | |
| 261 | Acute Coronary Syndrome | FAERS: 2 | 17360053 18632172 | CTD US FAERS |
| 262 | Alopecia | FAERS: 2 | US FAERS | |
| 263 | Amaurosis | FAERS: 2 | US FAERS | |
| 264 | Amnesia | FAERS: 2 | US FAERS | |
| 265 | Anger | FAERS: 2 | US FAERS | |
| 266 | Aphasia | FAERS: 2 | US FAERS | |
| 267 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 268 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 269 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 270 | Bacteria stool identified | FAERS: 2 | US FAERS | |
| 271 | Biopsy liver abnormal | FAERS: 2 | US FAERS | |
| 272 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 273 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 274 | Bradycardia | FAERS: 2 | US FAERS | |
| 275 | Bronchitis | FAERS: 2 | 15616290 | CTD US FAERS |
| 276 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 277 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 278 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 279 | Cystitis | FAERS: 2 | US FAERS | |
| 280 | Deafness | FAERS: 2 | US FAERS | |
| 281 | Deficiency of bile secretion | FAERS: 2 | US FAERS | |
| 282 | Delirium | FAERS: 2 | US FAERS | |
| 283 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 284 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 285 | Diplopia | FAERS: 2 | US FAERS | |
| 286 | Disability | FAERS: 2 | US FAERS | |
| 287 | Diverticulitis | FAERS: 2 | 19101108 | CTD US FAERS |
| 288 | Dysarthria | FAERS: 2 | US FAERS | |
| 289 | Eczema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 290 | Electrocardiogram ST-T change | FAERS: 2 | US FAERS | |
| 291 | Eructation | FAERS: 2 | US FAERS | |
| 292 | Exophthalmos | FAERS: 2 | US FAERS | |
| 293 | Eye irritation | FAERS: 2 | US FAERS | |
| 294 | Febrile Neutropenia | FAERS: 2 | US FAERS | |
| 295 | Feeling Cold | FAERS: 2 | US FAERS | |
| 296 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 297 | Fluid imbalance | FAERS: 2 | US FAERS | |
| 298 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 299 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 300 | Hypersomnia | FAERS: 2 | US FAERS | |
| 301 | Hypohidrosis | FAERS: 2 | US FAERS | |
| 302 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 303 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 304 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 305 | Laryngospasm | FAERS: 2 | US FAERS | |
| 306 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 307 | Macroglossia | FAERS: 2 | US FAERS | |
| 308 | Medication residue | FAERS: 2 | US FAERS | |
| 309 | Meningitis | FAERS: 2 | US FAERS | |
| 310 | Mental status changes | FAERS: 2 | US FAERS | |
| 311 | Mononucleosis syndrome | FAERS: 2 | US FAERS | |
| 312 | Monoplegia | FAERS: 2 | US FAERS | |
| 313 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 314 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 315 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 316 | Neurological decompensation | FAERS: 2 | US FAERS | |
| 317 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 318 | Night sweats | FAERS: 2 | US FAERS | |
| 319 | No adverse effect | FAERS: 2 | US FAERS | |
| 320 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 321 | Pain of skin | FAERS: 2 | US FAERS | |
| 322 | Pemphigus | FAERS: 2 | US FAERS | |
| 323 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 324 | Pleocytosis | FAERS: 2 | US FAERS | |
| 325 | Product counterfeit | FAERS: 2 | US FAERS | |
| 326 | Product packaging confusion | FAERS: 2 | US FAERS | |
| 327 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 328 | Product use complaint | FAERS: 2 | US FAERS | |
| 329 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 330 | Purulent discharge | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 332 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 333 | Restlessness | FAERS: 2 | US FAERS | |
| 334 | Reticulocytosis | FAERS: 2 | US FAERS | |
| 335 | Retinal exudates | FAERS: 2 | US FAERS | |
| 336 | Rhinitis | FAERS: 2 | US FAERS | |
| 337 | Screaming | FAERS: 2 | US FAERS | |
| 338 | Secretion discharge | FAERS: 2 | US FAERS | |
| 339 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 340 | Skin Erosion | FAERS: 2 | US FAERS | |
| 341 | Skin Induration | FAERS: 2 | US FAERS | |
| 342 | Skin irritation | FAERS: 2 | US FAERS | |
| 343 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 344 | Stillbirth | FAERS: 2 | US FAERS | |
| 345 | Suicide attempt | FAERS: 2 | US FAERS | |
| 346 | Tinnitus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 347 | Urinary Retention | FAERS: 2 | US FAERS | |
| 348 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 349 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 350 | Vulvovaginal discomfort | FAERS: 2 | US FAERS | |
| 351 | Vulvovaginal erythema | FAERS: 2 | US FAERS | |
| 352 | Vulvovaginal swelling | FAERS: 2 | US FAERS | |
| 353 | treatment failure | FAERS: 2 | US FAERS | |
| 354 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 355 | Acanthosis | FAERS: 1 | US FAERS | |
| 356 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 357 | Accidental exposure | FAERS: 1 | US FAERS | |
| 358 | Adenoidectomy | FAERS: 1 | US FAERS | |
| 359 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 360 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 361 | Aminoaciduria | FAERS: 1 | US FAERS | |
| 362 | Anal Fissure | FAERS: 1 | US FAERS | |
| 363 | Anal candidiasis | FAERS: 1 | US FAERS | |
| 364 | Apathy | FAERS: 1 | US FAERS | |
| 365 | Aphagia | FAERS: 1 | US FAERS | |
| 366 | Apparent death | FAERS: 1 | US FAERS | |
| 367 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 368 | Appendicitis | FAERS: 1 | US FAERS | |
| 369 | Arthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 370 | Arthropathy | FAERS: 1 | US FAERS | |
| 371 | Ascites | FAERS: 1 | US FAERS | |
| 372 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 373 | Asphyxia | FAERS: 1 | US FAERS | |
| 374 | Asthenopia | FAERS: 1 | US FAERS | |
| 375 | Atelectasis | FAERS: 1 | US FAERS | |
| 376 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 377 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 378 | Band neutrophil count increased | FAERS: 1 | US FAERS | |
| 379 | Bedridden | FAERS: 1 | US FAERS | |
| 380 | Bilirubin urine present | FAERS: 1 | US FAERS | |
| 381 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 382 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 383 | Blood Pressure | FAERS: 1 | US FAERS | |
| 384 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 385 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 386 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 387 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 388 | Blood blister | FAERS: 1 | US FAERS | |
| 389 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 390 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 391 | Blood creatine phosphokinase increased | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 392 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 393 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 394 | Blood immunoglobulin A increased | FAERS: 1 | US FAERS | |
| 395 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 396 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 397 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 398 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 399 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 400 | Body Temperature | FAERS: 1 | US FAERS | |
| 401 | Brain Abscess | FAERS: 1 | US FAERS | |
| 402 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 403 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 404 | Budd-Chiari Syndrome | FAERS: 1 | US FAERS | |
| 405 | Butterfly rash | FAERS: 1 | US FAERS | |
| 406 | Cataract operation | FAERS: 1 | US FAERS | |
| 407 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 408 | Chemical eye injury | FAERS: 1 | US FAERS | |
| 409 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 410 | Cold sweat | FAERS: 1 | US FAERS | |
| 411 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 412 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 413 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 414 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 415 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 416 | Depressed mood | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 417 | Depression suicidal | FAERS: 1 | US FAERS | |
| 418 | Device ineffective | FAERS: 1 | US FAERS | |
| 419 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 420 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 421 | Diet refusal | FAERS: 1 | US FAERS | |
| 422 | Disease recurrence | FAERS: 1 | US FAERS | |
| 423 | Dissociation | FAERS: 1 | US FAERS | |
| 424 | Diverticulum | FAERS: 1 | US FAERS | |
| 425 | Drug Dependence | FAERS: 1 | US FAERS | |
| 426 | Drug abuse | FAERS: 1 | US FAERS | |
| 427 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 428 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 429 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 430 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 431 | Dyschezia | FAERS: 1 | US FAERS | |
| 432 | Dysentery | FAERS: 1 | US FAERS | |
| 433 | Dyslexia | FAERS: 1 | US FAERS | |
| 434 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 435 | Dystonia | FAERS: 1 | US FAERS | |
| 436 | Ecchymosis | FAERS: 1 | 15678708 | CTD US FAERS |
| 437 | Economic problem | FAERS: 1 | US FAERS | |
| 438 | Ecthyma | FAERS: 1 | US FAERS | |
| 439 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 440 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 441 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 442 | Emotional disorder | FAERS: 1 | US FAERS | |
| 443 | Emphysematous Cholecystitis | FAERS: 1 | US FAERS | |
| 444 | Empyema | FAERS: 1 | US FAERS | |
| 445 | Enteritis | FAERS: 1 | US FAERS | |
| 446 | Enterocolitis | FAERS: 1 | US FAERS | |
| 447 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 448 | Epstein-Barr virus test positive | FAERS: 1 | US FAERS | |
| 449 | Euphoric mood | FAERS: 1 | US FAERS | |
| 450 | Expired product administered | FAERS: 1 | US FAERS | |
| 451 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 452 | Eye inflammation | FAERS: 1 | US FAERS | |
| 453 | Facial Pain | FAERS: 1 | US FAERS | |
| 454 | False negative investigation result | FAERS: 1 | US FAERS | |
| 455 | Fasciitis | FAERS: 1 | US FAERS | |
| 456 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 457 | Fibrosis | FAERS: 1 | 10636987 | CTD US FAERS |
| 458 | Fistula discharge | FAERS: 1 | US FAERS | |
| 459 | Fixed eruption | FAERS: 1 | US FAERS | |
| 460 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 461 | Folliculitis | FAERS: 1 | US FAERS | |
| 462 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 463 | Fulminant type 1 diabetes mellitus | FAERS: 1 | US FAERS | |
| 464 | Fungal test positive | FAERS: 1 | US FAERS | |
| 465 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 466 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 467 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 468 | Genital Herpes | FAERS: 1 | US FAERS | |
| 469 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 470 | Genital pain | FAERS: 1 | US FAERS | |
| 471 | Genital rash | FAERS: 1 | US FAERS | |
| 472 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 473 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 474 | Hepatic Encephalopathy | FAERS: 1 | 1738330 | CTD US FAERS |
| 475 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 476 | Hepatitis C | FAERS: 1 | US FAERS | |
| 477 | Histamine level increased | FAERS: 1 | US FAERS | |
| 478 | Hunger | FAERS: 1 | US FAERS | |
| 479 | Hypercapnia | FAERS: 1 | US FAERS | |
| 480 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 481 | Hypoventilation | FAERS: 1 | US FAERS | |
| 482 | Hysterectomy | FAERS: 1 | US FAERS | |
| 483 | Immobile | FAERS: 1 | US FAERS | |
| 484 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 485 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 486 | Impetigo | FAERS: 1 | US FAERS | |
| 487 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 488 | Influenza | FAERS: 1 | US FAERS | |
| 489 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 490 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 491 | Infusion site pain | FAERS: 1 | US FAERS | |
| 492 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 493 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 494 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 495 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 496 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 497 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 498 | Intussusception | FAERS: 1 | US FAERS | |
| 499 | Juvenile arthritis | FAERS: 1 | US FAERS | |
| 500 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 501 | Lung hyperinflation | FAERS: 1 | US FAERS | |
| 502 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 503 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 504 | Macrocytosis | FAERS: 1 | US FAERS | |
| 505 | Malabsorption | FAERS: 1 | US FAERS | |
| 506 | Medication residue present | FAERS: 1 | US FAERS | |
| 507 | Mental impairment | FAERS: 1 | US FAERS | |
| 508 | Monoparesis | FAERS: 1 | US FAERS | |
| 509 | Mood swings | FAERS: 1 | US FAERS | |
| 510 | Mucocutaneous rash | FAERS: 1 | US FAERS | |
| 511 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 512 | Multiple allergies | FAERS: 1 | US FAERS | |
| 513 | Muscle strain | FAERS: 1 | US FAERS | |
| 514 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 515 | Mydriasis | FAERS: 1 | US FAERS | |
| 516 | Myocarditis | FAERS: 1 | US FAERS | |
| 517 | Myoclonus | FAERS: 1 | US FAERS | |
| 518 | Nail bed infection fungal | FAERS: 1 | US FAERS | |
| 519 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 520 | Nephritis allergic | FAERS: 1 | US FAERS | |
| 521 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 522 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 523 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 524 | No adverse event | FAERS: 1 | US FAERS | |
| 525 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 526 | Nodular fasciitis | FAERS: 1 | US FAERS | |
| 527 | Obstruction | FAERS: 1 | US FAERS | |
| 528 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 529 | Ocular vasculitis | FAERS: 1 | US FAERS | |
| 530 | Open wound | FAERS: 1 | US FAERS | |
| 531 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 532 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 533 | Oral pain | FAERS: 1 | US FAERS | |
| 534 | Oral pruritus | FAERS: 1 | US FAERS | |
| 535 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 536 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 537 | Osteoporosis | FAERS: 1 | US FAERS | |
| 538 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 539 | PCO2 increased | FAERS: 1 | US FAERS | |
| 540 | Palatal swelling | FAERS: 1 | US FAERS | |
| 541 | Palmar erythema | FAERS: 1 | US FAERS | |
| 542 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 543 | Papule | FAERS: 1 | US FAERS | |
| 544 | Parakeratosis | FAERS: 1 | US FAERS | |
| 545 | Parophthalmia | FAERS: 1 | US FAERS | |
| 546 | Performance status decreased | FAERS: 1 | US FAERS | |
| 547 | Perianal fungal infection | FAERS: 1 | US FAERS | |
| 548 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 549 | Pericarditis | FAERS: 1 | US FAERS | |
| 550 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 551 | Pertussis | FAERS: 1 | US FAERS | |
| 552 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 553 | Pleuritic pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 554 | Polyarthritis | FAERS: 1 | US FAERS | |
| 555 | Polydipsia | FAERS: 1 | US FAERS | |
| 556 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 557 | Polyuria | FAERS: 1 | US FAERS | |
| 558 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 559 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 560 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 561 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 562 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 563 | Post procedural nausea | FAERS: 1 | US FAERS | |
| 564 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 565 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 566 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 567 | Product coating issue | FAERS: 1 | US FAERS | |
| 568 | Product commingling | FAERS: 1 | US FAERS | |
| 569 | Product contamination | FAERS: 1 | US FAERS | |
| 570 | Product contamination physical | FAERS: 1 | US FAERS | |
| 571 | Product dispensing error | FAERS: 1 | US FAERS | |
| 572 | Product label issue | FAERS: 1 | US FAERS | |
| 573 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 574 | Product prescribing error | FAERS: 1 | US FAERS | |
| 575 | Product size issue | FAERS: 1 | US FAERS | |
| 576 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 577 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 578 | Protein urine present | FAERS: 1 | US FAERS | |
| 579 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 580 | Pulmonary artery occlusion | FAERS: 1 | US FAERS | |
| 581 | Radioallergosorbent test positive | FAERS: 1 | US FAERS | |
| 582 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 583 | Rectocele | FAERS: 1 | US FAERS | |
| 584 | Renal pain | FAERS: 1 | US FAERS | |
| 585 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 586 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 587 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 588 | Saliva altered | FAERS: 1 | US FAERS | |
| 589 | Sense of oppression | FAERS: 1 | US FAERS | |
| 590 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 591 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 592 | Sinus headache | FAERS: 1 | US FAERS | |
| 593 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 594 | Skin necrosis | FAERS: 1 | US FAERS | |
| 595 | Skin toxicity | FAERS: 1 | US FAERS | |
| 596 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 597 | Stenosis | FAERS: 1 | US FAERS | |
| 598 | Stomatitis | FAERS: 1 | US FAERS | |
| 599 | Streptococcal impetigo | FAERS: 1 | US FAERS | |
| 600 | Stress | FAERS: 1 | US FAERS | |
| 601 | Subileus | FAERS: 1 | US FAERS | |
| 602 | Sudden death | FAERS: 1 | US FAERS | |
| 603 | Suspected transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 604 | T-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 605 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 606 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 607 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 608 | Thrombosis | FAERS: 1 | US FAERS | |
| 609 | Tongue blistering | FAERS: 1 | US FAERS | |
| 610 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 611 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 612 | Toothache | FAERS: 1 | US FAERS | |
| 613 | Trichiasis | FAERS: 1 | US FAERS | |
| 614 | Trichosporon infection | FAERS: 1 | US FAERS | |
| 615 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 616 | Ultrasound abdomen abnormal | FAERS: 1 | US FAERS | |
| 617 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 618 | Unevaluable event | FAERS: 1 | US FAERS | |
| 619 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 620 | Urticaria localised | FAERS: 1 | US FAERS | |
| 621 | Vaginal exfoliation | FAERS: 1 | US FAERS | |
| 622 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 623 | Vaginal mucosal blistering | FAERS: 1 | US FAERS | |
| 624 | Vaginal mycosis | FAERS: 1 | US FAERS | |
| 625 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 626 | Vascular purpura | FAERS: 1 | US FAERS | |
| 627 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 628 | Wound Infection | FAERS: 1 | US FAERS | |
| 629 | Wrong dose | FAERS: 1 | US FAERS | |
| 630 | nervous system disorder | FAERS: 1 | US FAERS | |
| 631 | Abscess | Canada Vigilance: 1 | Canada Vigilance | |
| 632 | Acute Lung Injury | 19078840 | CTD | |
| 633 | Amylase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 634 | Bacterial Vaginosis | Canada Vigilance: 1 | Canada Vigilance | |
| 635 | Bile Duct Diseases | 1738330 7751590 | CTD | |
| 636 | Bronchitis, Chronic | 15929954 | CTD | |
| 637 | Cellulitis | Canada Vigilance: 1 | Canada Vigilance | |
| 638 | Chemical and Drug Induced Liver Injury |
1482041
1728522 1738330 2289658 2290034 2326558 2809168 7751590 7819719 8052321 8328159 8570979 9090930 9380177 9707067 9741209 10028363 10369618 10535882 10548348 10636987 11309226 11422607 11894665 12481509 12505292 12809593 15678708 16083708 16187174 16205517 17162128 18023105 18028086 18218281 18666253 21570397 | CTD | |
| 639 | Chemical and Drug Induced Liver Injury, Chronic | 8550991 | CTD | |
| 640 | Cholangitis | 8746062 10548348 | CTD | |
| 641 | Community-Acquired Infections | CTD | ||
| 642 | Crystalluria | Canada Vigilance: 1 | Canada Vigilance | |
| 643 | Diaper Rash | 9802654 | CTD | |
| 644 | Diarrhea | 9802654 10638456 10638457 | CTD | |
| 645 | Drug Eruptions | 11792017 18632172 | CTD | |
| 646 | Exanthema | 10369618 11390425 24329898 | CTD | |
| 647 | Feeding and Eating Disorders | 7555652 | CTD | |
| 648 | Fever | 2925057 | CTD | |
| 649 | Gastrointestinal Diseases | 8354296 | CTD | |
| 650 | Gingival Hypertrophy | Canada Vigilance: 1 | Canada Vigilance | |
| 651 | Granuloma | 1728522 | CTD | |
| 652 | Haemophilus Infections | 10638457 12501879 | CTD | |
| 653 | Hematuria | 12639164 | CTD | |
| 654 | Intraoperative Complications | 12897111 | CTD | |
| 655 | Jaundice, Obstructive | CTD | ||
| 656 | Klebsiella Infections | 6912860 | CTD | |
| 657 | Lacrimal Apparatus Diseases | 7751590 | CTD | |
| 658 | Lithiasis | 2190975 | CTD | |
| 659 | Liver Failure, Acute | 8651842 12481509 16187174 | CTD | |
| 660 | Liver Failure | 11422607 18028086 | CTD | |
| 661 | Liver diseases | 14986274 | CTD | |
| 662 | Moraxellaceae Infections | 10638457 | CTD | |
| 663 | Myositis | Canada Vigilance: 1 | Canada Vigilance | |
| 664 | Neisseriaceae Infections | 20378725 | CTD | |
| 665 | Nephritis, Interstitial | 7751590 | CTD | |
| 666 | Olfaction Disorders | 14676161 | CTD | |
| 667 | Otitis Media | CTD | ||
| 668 | Perineal pain | Canada Vigilance: 1 | Canada Vigilance | |
| 669 | Personality Disorders | 3670959 | CTD | |
| 670 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 671 | Pharyngitis | Canada Vigilance: 1 | 12602712 | CTD Canada Vigilance |
| 672 | Pneumococcal Infections | CTD | ||
| 673 | Psychoses, Substance-Induced | 19585443 | CTD | |
| 674 | Renal Insufficiency | 10369618 | CTD | |
| 675 | Respiratory Insufficiency | 19078840 | CTD | |
| 676 | Respiratory Tract Infections | 9380177 11309226 16205517 | CTD | |
| 677 | Rhabdomyolysis | Canada Vigilance: 1 | Canada Vigilance | |
| 678 | Seizures | 1460954 | CTD | |
| 679 | Sialadenitis | 7751590 | CTD | |
| 680 | Sjogren's Syndrome | 10548348 | CTD | |
| 681 | Staphylococcal Infections | 2708846 7799055 8014483 | CTD | |
| 682 | Urethritis | 10494743 | CTD | |
| 683 | Urinary Calculi | 12480988 12834178 | CTD | |
| 684 | Xerostomia | 7751590 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.