Clonazepam
(DGBIGWXXNGSACT-UHFFFAOYSA-N)
Structure
- SMILES
- O=C1CN=C(c2c(N1)ccc(c2)[N+](=O)[O-])c1ccccc1Cl
- Type(s)
- Approved; Illicit
- ATC code(s)
- N03AE01
- Molecular Formula:
- C15H10ClN3O3
- Molecular Weight:
- 315.711
- Log P:
- 3.1345
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 87.28
- CAS Number(s):
- 1622-61-3; 106955-87-7
Synonym(s)
1.
Clonazepam
2.
Antelepsin
3.
Rivotril
4.
Ro 5-4023
5.
Ro 54023
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 850 Canada Vigilance: 19 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Anxiety | FAERS: 398 Canada Vigilance: 20 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Product substitution issue | FAERS: 268 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Dizziness | FAERS: 238 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Somnolence | FAERS: 223 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 6 | Headache | FAERS: 200 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 7 | Feeling abnormal | FAERS: 191 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Nausea | FAERS: 168 Canada Vigilance: 8 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Tremor | FAERS: 163 Canada Vigilance: 6 | 9278937 11096749 12588639 | CTD SIDER Canada Vigilance US FAERS |
| 10 | Malaise | FAERS: 156 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 11 | Drug withdrawal syndrome | FAERS: 150 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 12 | Fatigue | FAERS: 137 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Suicide attempt | FAERS: 135 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Wrong technique in product usage process | FAERS: 126 | US FAERS | |
| 15 | Overdose | FAERS: 123 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Palpitations | FAERS: 110 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 17 | Memory impairment | FAERS: 105 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 18 | Drug Dependence | FAERS: 101 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 19 | Product quality issue | FAERS: 99 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 20 | Agitation | FAERS: 96 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 21 | No adverse event | FAERS: 88 | US FAERS | |
| 22 | Asthenia | FAERS: 87 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 23 | Amnesia | FAERS: 84 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 24 | Pain | FAERS: 79 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Pharmaceutical product complaint | FAERS: 78 | OFFSIDES US FAERS | |
| 26 | Drug abuse | FAERS: 75 | SIDER US FAERS | |
| 27 | Nervousness | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Product use in unapproved indication | FAERS: 72 | US FAERS | |
| 29 | Weight decreased | FAERS: 68 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 30 | Completed Suicide | FAERS: 66 | SIDER US FAERS | |
| 31 | Medication Error | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Abdominal discomfort | FAERS: 64 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 33 | Drug screen negative | FAERS: 57 | US FAERS | |
| 34 | Toxicity to various agents | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Drug ineffective for unapproved indication | FAERS: 51 | US FAERS | |
| 36 | Therapeutic response unexpected with drug substitution | FAERS: 51 | US FAERS | |
| 37 | Myalgia | FAERS: 48 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 38 | Intentional product misuse | FAERS: 47 | US FAERS | |
| 39 | Intentional product use issue | FAERS: 47 | US FAERS | |
| 40 | Sopor | FAERS: 47 | US FAERS | |
| 41 | Vomiting | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Chest Pain | FAERS: 45 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 43 | Anger | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 44 | Vertigo | FAERS: 44 | SIDER US FAERS | |
| 45 | Alopecia | FAERS: 42 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 46 | Incorrect dose administered | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Tinnitus | FAERS: 42 | US FAERS | |
| 48 | Pruritus | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 49 | Syncope | FAERS: 36 Canada Vigilance: 1 | 11494931 | CTD Canada Vigilance US FAERS |
| 50 | Crying | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Product use issue | FAERS: 35 | US FAERS | |
| 52 | Tachycardia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 53 | Adverse event | FAERS: 34 | US FAERS | |
| 54 | Dysgeusia | FAERS: 34 | US FAERS | |
| 55 | Impaired work ability | FAERS: 34 | US FAERS | |
| 56 | Arthralgia | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 57 | Intentional self-injury | FAERS: 33 | US FAERS | |
| 58 | Constipation | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 59 | Restlessness | FAERS: 31 | US FAERS | |
| 60 | Dependence | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 61 | Disorientation | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Unevaluable event | FAERS: 30 | US FAERS | |
| 63 | Cerebrovascular accident | FAERS: 29 | US FAERS | |
| 64 | Poisoning | FAERS: 29 | US FAERS | |
| 65 | Back Pain | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 66 | Hypersensitivity | FAERS: 28 | SIDER US FAERS | |
| 67 | Pregnancy | FAERS: 27 | US FAERS | |
| 68 | Product physical issue | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Feeling jittery | FAERS: 26 | SIDER US FAERS | |
| 70 | Impaired driving ability | FAERS: 26 | OFFSIDES US FAERS | |
| 71 | Burning sensation | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Drug prescribing error | FAERS: 25 | US FAERS | |
| 73 | Product taste abnormal | FAERS: 25 | US FAERS | |
| 74 | Urticaria | FAERS: 25 | SIDER US FAERS | |
| 75 | Mental impairment | FAERS: 24 | US FAERS | |
| 76 | Abdominal Pain | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 77 | Ataxia | FAERS: 23 Canada Vigilance: 1 | 2162948 2903143 3832950 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 78 | Depressed Level of Consciousness | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 79 | Depressed mood | FAERS: 23 | US FAERS | |
| 80 | Dysarthria | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 81 | Lethargy | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 82 | Neuralgia | FAERS: 23 Canada Vigilance: 3 | 18306017 | CTD Canada Vigilance US FAERS |
| 83 | Visual Impairment | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 84 | Chest discomfort | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 85 | Drug Tolerance | FAERS: 22 | US FAERS | |
| 86 | Drug administration error | FAERS: 21 | US FAERS | |
| 87 | Paranoia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Stress | FAERS: 21 | OFFSIDES US FAERS | |
| 89 | Tension | FAERS: 21 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 90 | Drug dispensing error | FAERS: 20 | US FAERS | |
| 91 | Drug dose omission | FAERS: 20 | US FAERS | |
| 92 | Dyspepsia | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 93 | Hypotension | FAERS: 20 | SIDER US FAERS | |
| 94 | Therapeutic response unexpected | FAERS: 20 | US FAERS | |
| 95 | nervous system disorder | FAERS: 20 | SIDER US FAERS | |
| 96 | Agoraphobia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 97 | Drug exposure during pregnancy | FAERS: 19 | US FAERS | |
| 98 | Emotional disorder | FAERS: 19 | US FAERS | |
| 99 | Loss of personal independence in daily activities | FAERS: 18 | US FAERS | |
| 100 | Musculoskeletal stiffness | FAERS: 17 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 101 | Respiratory arrest | FAERS: 17 | US FAERS | |
| 102 | Cardiac Arrest | FAERS: 16 | SIDER US FAERS | |
| 103 | Hypersomnia | FAERS: 16 | US FAERS | |
| 104 | Panic Disorder | FAERS: 16 | CTD OFFSIDES US FAERS | |
| 105 | Product dropper issue | FAERS: 16 | US FAERS | |
| 106 | Restless Legs Syndrome | FAERS: 16 | US FAERS | |
| 107 | Accidental overdose | FAERS: 15 | US FAERS | |
| 108 | Bedridden | FAERS: 15 | US FAERS | |
| 109 | Catatonia | FAERS: 15 | 20159196 | CTD OFFSIDES US FAERS |
| 110 | False negative investigation result | FAERS: 15 | US FAERS | |
| 111 | Poor quality sleep | FAERS: 15 | US FAERS | |
| 112 | Delirium | FAERS: 14 | US FAERS | |
| 113 | Drug effect incomplete | FAERS: 14 | US FAERS | |
| 114 | Epilepsy | FAERS: 14 | 821787 1111773 | CTD OFFSIDES US FAERS |
| 115 | Hyperacusis | FAERS: 14 | US FAERS | |
| 116 | Mood swings | FAERS: 14 | SIDER US FAERS | |
| 117 | Product solubility abnormal | FAERS: 14 | US FAERS | |
| 118 | Unresponsive to stimuli | FAERS: 14 | US FAERS | |
| 119 | Activities of daily living impaired | FAERS: 13 | US FAERS | |
| 120 | Apathy | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 121 | Chills | FAERS: 13 | SIDER US FAERS | |
| 122 | Influenza | FAERS: 13 | SIDER US FAERS | |
| 123 | Maternal exposure timing unspecified | FAERS: 13 | US FAERS | |
| 124 | Personality Change | FAERS: 13 | US FAERS | |
| 125 | Photophobia | FAERS: 13 | US FAERS | |
| 126 | Diplopia | FAERS: 12 | SIDER US FAERS | |
| 127 | Feeling Cold | FAERS: 12 | US FAERS | |
| 128 | General physical health deterioration | FAERS: 12 | US FAERS | |
| 129 | Muscle tightness | FAERS: 12 | US FAERS | |
| 130 | Paradoxical drug reaction | FAERS: 12 | US FAERS | |
| 131 | Sinusitis | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 132 | Bradyphrenia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Erythema | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 134 | Maternal exposure during pregnancy | FAERS: 11 | US FAERS | |
| 135 | Mental status changes | FAERS: 11 | US FAERS | |
| 136 | Myocardial Infarction | FAERS: 11 | US FAERS | |
| 137 | Neck Pain | FAERS: 11 | US FAERS | |
| 138 | Toothache | FAERS: 11 | SIDER US FAERS | |
| 139 | Abasia | FAERS: 10 | US FAERS | |
| 140 | Anorexia | FAERS: 10 | 2471214 2565491 | CTD SIDER US FAERS |
| 141 | Drooling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Drug screen positive | FAERS: 10 | US FAERS | |
| 143 | Emotional distress | FAERS: 10 | US FAERS | |
| 144 | Formication | FAERS: 10 | OFFSIDES US FAERS | |
| 145 | Glaucoma | FAERS: 10 | US FAERS | |
| 146 | Head discomfort | FAERS: 10 | US FAERS | |
| 147 | Middle insomnia | FAERS: 10 | US FAERS | |
| 148 | Presyncope | FAERS: 10 | US FAERS | |
| 149 | Quality of life decreased | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 150 | Reaction to excipient | FAERS: 10 | US FAERS | |
| 151 | Tachyphrenia | FAERS: 10 | US FAERS | |
| 152 | Therapy cessation | FAERS: 10 | US FAERS | |
| 153 | Accidental exposure to product by child | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Aphasia | FAERS: 9 | US FAERS | |
| 155 | Bone pain | FAERS: 9 | OFFSIDES US FAERS | |
| 156 | Dementia | FAERS: 9 | US FAERS | |
| 157 | Diabetes Mellitus | FAERS: 9 | US FAERS | |
| 158 | Discomfort | FAERS: 9 | SIDER US FAERS | |
| 159 | Euphoric mood | FAERS: 9 | SIDER US FAERS | |
| 160 | Inappropriate schedule of drug administration | FAERS: 9 | US FAERS | |
| 161 | Lip swelling | FAERS: 9 | US FAERS | |
| 162 | Obsessive-Compulsive Disorder | FAERS: 9 Canada Vigilance: 3 | 1527234 | CTD Canada Vigilance US FAERS |
| 163 | Product counterfeit | FAERS: 9 | US FAERS | |
| 164 | Product formulation issue | FAERS: 9 | US FAERS | |
| 165 | Reaction to drug excipients | FAERS: 9 | US FAERS | |
| 166 | Retching | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 167 | Swelling | FAERS: 9 | SIDER US FAERS | |
| 168 | Urinary Retention | FAERS: 9 | 9868574 14980361 | CTD SIDER US FAERS |
| 169 | treatment failure | FAERS: 9 | US FAERS | |
| 170 | Altered state of consciousness | FAERS: 8 | OFFSIDES US FAERS | |
| 171 | Arthropathy | FAERS: 8 | US FAERS | |
| 172 | Bipolar Disorder | FAERS: 8 | CTD OFFSIDES US FAERS | |
| 173 | Cataract | FAERS: 8 | US FAERS | |
| 174 | Dysphonia | FAERS: 8 | SIDER US FAERS | |
| 175 | Dysuria | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 176 | Economic problem | FAERS: 8 | US FAERS | |
| 177 | Irritable Bowel Syndrome | FAERS: 8 | US FAERS | |
| 178 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 179 | Product measured potency issue | FAERS: 8 | US FAERS | |
| 180 | Product storage error | FAERS: 8 | US FAERS | |
| 181 | Psychiatric symptom | FAERS: 8 | US FAERS | |
| 182 | Respiratory Depression | FAERS: 8 | SIDER US FAERS | |
| 183 | Urinary Incontinence | FAERS: 8 | 507767 4032590 | CTD SIDER US FAERS |
| 184 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 185 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 186 | Aphonia | FAERS: 7 | SIDER US FAERS | |
| 187 | Apparent death | FAERS: 7 | US FAERS | |
| 188 | Bradycardia | FAERS: 7 | US FAERS | |
| 189 | Choking | FAERS: 7 | US FAERS | |
| 190 | Deafness | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Dysgraphia | FAERS: 7 | US FAERS | |
| 192 | Exposure during breast feeding | FAERS: 7 | US FAERS | |
| 193 | Eye pain | FAERS: 7 | US FAERS | |
| 194 | Fibromyalgia | FAERS: 7 | US FAERS | |
| 195 | Flushing | FAERS: 7 | SIDER US FAERS | |
| 196 | Incorrect drug administration duration | FAERS: 7 | US FAERS | |
| 197 | Mydriasis | FAERS: 7 | US FAERS | |
| 198 | Nephrolithiasis | FAERS: 7 | US FAERS | |
| 199 | Night sweats | FAERS: 7 | US FAERS | |
| 200 | Pancreatitis | FAERS: 7 | OFFSIDES US FAERS | |
| 201 | Product availability issue | FAERS: 7 | US FAERS | |
| 202 | Product prescribing error | FAERS: 7 | US FAERS | |
| 203 | Schizophrenia | FAERS: 7 | OFFSIDES US FAERS | |
| 204 | Screaming | FAERS: 7 | US FAERS | |
| 205 | Urinary tract infection | FAERS: 7 | SIDER US FAERS | |
| 206 | Ageusia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 207 | Alcohol interaction | FAERS: 6 | US FAERS | |
| 208 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 209 | Dehydration | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 210 | Dental caries | FAERS: 6 | OFFSIDES US FAERS | |
| 211 | Dry skin | FAERS: 6 | US FAERS | |
| 212 | Eructation | FAERS: 6 | US FAERS | |
| 213 | Expired product administered | FAERS: 6 | US FAERS | |
| 214 | Gastritis | FAERS: 6 | SIDER US FAERS | |
| 215 | Hallucinations, mixed | FAERS: 6 | US FAERS | |
| 216 | Hemiparesis | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 217 | Hostility | FAERS: 6 | SIDER US FAERS | |
| 218 | Hypokinesia | FAERS: 6 | OFFSIDES US FAERS | |
| 219 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 220 | Initial insomnia | FAERS: 6 | US FAERS | |
| 221 | Pancytopenia | FAERS: 6 | US FAERS | |
| 222 | Post-Traumatic Stress Disorder | FAERS: 6 | US FAERS | |
| 223 | Respiratory distress | FAERS: 6 | US FAERS | |
| 224 | Throat irritation | FAERS: 6 | US FAERS | |
| 225 | Thrombosis | FAERS: 6 | US FAERS | |
| 226 | Tongue discomfort | FAERS: 6 | US FAERS | |
| 227 | Alcohol poisoning | FAERS: 5 | SIDER US FAERS | |
| 228 | Anaphylactic shock | FAERS: 5 | SIDER US FAERS | |
| 229 | Angina Pectoris | FAERS: 5 | US FAERS | |
| 230 | Anhedonia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 231 | Blindness | FAERS: 5 | US FAERS | |
| 232 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 233 | Bradykinesia | FAERS: 5 | US FAERS | |
| 234 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 235 | Circumstance or information capable of leading to medication error | FAERS: 5 | US FAERS | |
| 236 | Dysphemia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Ear discomfort | FAERS: 5 | OFFSIDES US FAERS | |
| 238 | Extra dose administered | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Feeling of body temperature change | FAERS: 5 | US FAERS | |
| 240 | Food Allergy | FAERS: 5 | US FAERS | |
| 241 | Frustration tolerance decreased | FAERS: 5 | US FAERS | |
| 242 | Glucocorticoid deficiency | FAERS: 5 | US FAERS | |
| 243 | Incorrect product storage | FAERS: 5 | US FAERS | |
| 244 | Infarction | FAERS: 5 | US FAERS | |
| 245 | Intentional drug misuse | FAERS: 5 | OFFSIDES US FAERS | |
| 246 | Laceration | FAERS: 5 | US FAERS | |
| 247 | Lactose Intolerance | FAERS: 5 | US FAERS | |
| 248 | Myoclonus | FAERS: 5 |
520416
806277 1376887 1530086 2620967 2860211 3379031 6118280 8041377 8099687 8166329 9489553 12860512 15221158 19833162 20332743 | CTD US FAERS |
| 249 | Pallor | FAERS: 5 | US FAERS | |
| 250 | Physical assault | FAERS: 5 | US FAERS | |
| 251 | Pneumonia | FAERS: 5 | SIDER US FAERS | |
| 252 | Poor quality drug administered | FAERS: 5 | US FAERS | |
| 253 | Product label issue | FAERS: 5 | US FAERS | |
| 254 | Product packaging quantity issue | FAERS: 5 | US FAERS | |
| 255 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 256 | Sluggishness | FAERS: 5 | US FAERS | |
| 257 | Somnambulism | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 258 | Therapeutic product effect decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 259 | Thrombocytopenia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 260 | Tongue biting | FAERS: 5 | US FAERS | |
| 261 | Accidental exposure | FAERS: 4 | US FAERS | |
| 262 | Akathisia | FAERS: 4 | US FAERS | |
| 263 | Angioedema | FAERS: 4 | SIDER US FAERS | |
| 264 | Anosmia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 265 | Arthritis | FAERS: 4 | OFFSIDES US FAERS | |
| 266 | Blood glucose abnormal | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 267 | Blood potassium decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 268 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 269 | Bronchitis | FAERS: 4 | SIDER US FAERS | |
| 270 | Clumsiness | FAERS: 4 | OFFSIDES US FAERS | |
| 271 | Cold sweat | FAERS: 4 | US FAERS | |
| 272 | Disability | FAERS: 4 | US FAERS | |
| 273 | Dissociation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 274 | Drug abuser | FAERS: 4 | US FAERS | |
| 275 | Drug level below therapeutic | FAERS: 4 | US FAERS | |
| 276 | Drug level changed | FAERS: 4 | US FAERS | |
| 277 | Drug withdrawal convulsions | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 278 | Epistaxis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 279 | Eye irritation | FAERS: 4 | SIDER US FAERS | |
| 280 | Flatulence | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 281 | Gastrointestinal Pain | FAERS: 4 | SIDER US FAERS | |
| 282 | Hyperventilation | FAERS: 4 | US FAERS | |
| 283 | Hypophagia | FAERS: 4 | US FAERS | |
| 284 | Infection | FAERS: 4 | SIDER US FAERS | |
| 285 | Multiple Sclerosis | FAERS: 4 | US FAERS | |
| 286 | Nerve injury | FAERS: 4 | US FAERS | |
| 287 | Osteomyelitis | FAERS: 4 | US FAERS | |
| 288 | Osteoporosis | FAERS: 4 | OFFSIDES US FAERS | |
| 289 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 290 | Posterior reversible encephalopathy syndrome | FAERS: 4 | US FAERS | |
| 291 | Product blister packaging issue | FAERS: 4 | US FAERS | |
| 292 | Product use complaint | FAERS: 4 | US FAERS | |
| 293 | Productive Cough | FAERS: 4 | US FAERS | |
| 294 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 295 | Pulmonary congestion | FAERS: 4 | SIDER US FAERS | |
| 296 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 297 | Rhinitis | FAERS: 4 | SIDER US FAERS | |
| 298 | Stupor | FAERS: 4 | 2860211 | CTD US FAERS |
| 299 | Tardive Dyskinesia | FAERS: 4 | US FAERS | |
| 300 | Tension Headache | FAERS: 4 | US FAERS | |
| 301 | Therapy change | FAERS: 4 | US FAERS | |
| 302 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 303 | Trisomy 21 | FAERS: 4 | US FAERS | |
| 304 | Wrong technique in drug usage process | FAERS: 4 | OFFSIDES US FAERS | |
| 305 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 306 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 307 | Anticonvulsant drug level increased | FAERS: 3 | US FAERS | |
| 308 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 309 | Asphyxia | FAERS: 3 | US FAERS | |
| 310 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 311 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 312 | Back disorder | FAERS: 3 | US FAERS | |
| 313 | Bladder pain | FAERS: 3 | SIDER US FAERS | |
| 314 | Blepharospasm | FAERS: 3 | 7057171 17308236 | CTD US FAERS |
| 315 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 316 | Blood thyroid stimulating hormone decreased | FAERS: 3 | US FAERS | |
| 317 | Blood urine present | FAERS: 3 | US FAERS | |
| 318 | Bronchospasm | FAERS: 3 | US FAERS | |
| 319 | Bruxism | FAERS: 3 | OFFSIDES US FAERS | |
| 320 | Burning Mouth Syndrome | FAERS: 3 | US FAERS | |
| 321 | Conversion disorder | FAERS: 3 | SIDER US FAERS | |
| 322 | Depression suicidal | FAERS: 3 | US FAERS | |
| 323 | Diverticulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 324 | Drug effect delayed | FAERS: 3 | US FAERS | |
| 325 | Dystonia | FAERS: 3 | 2598534 | CTD US FAERS |
| 326 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 327 | Erectile dysfunction | FAERS: 3 | 9160580 | CTD SIDER US FAERS |
| 328 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 329 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 330 | Growth retardation | FAERS: 3 | US FAERS | |
| 331 | Head titubation | FAERS: 3 | US FAERS | |
| 332 | Hepatitis | FAERS: 3 | US FAERS | |
| 333 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 334 | Hypomania | FAERS: 3 | US FAERS | |
| 335 | Hyporeflexia | FAERS: 3 | US FAERS | |
| 336 | Incoherent | FAERS: 3 | US FAERS | |
| 337 | Intrusive thoughts | FAERS: 3 | US FAERS | |
| 338 | Multiple drug overdose | FAERS: 3 | US FAERS | |
| 339 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 340 | No adverse effect | FAERS: 3 | US FAERS | |
| 341 | Nystagmus | FAERS: 3 | SIDER US FAERS | |
| 342 | Obsessive thoughts | FAERS: 3 | US FAERS | |
| 343 | Performance status decreased | FAERS: 3 | US FAERS | |
| 344 | Precocious Puberty | FAERS: 3 | US FAERS | |
| 345 | Prescription drug used without a prescription | FAERS: 3 | US FAERS | |
| 346 | Product commingling | FAERS: 3 | US FAERS | |
| 347 | Product packaging issue | FAERS: 3 | US FAERS | |
| 348 | Product size issue | FAERS: 3 | US FAERS | |
| 349 | Rash erythematous | FAERS: 3 | US FAERS | |
| 350 | Renal pain | FAERS: 3 | US FAERS | |
| 351 | Skin Wrinkling | FAERS: 3 | US FAERS | |
| 352 | Slow response to stimuli | FAERS: 3 | US FAERS | |
| 353 | Suspected counterfeit product | FAERS: 3 | US FAERS | |
| 354 | Therapeutic product ineffective | FAERS: 3 | US FAERS | |
| 355 | Therapeutic response changed | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Thermal burn | FAERS: 3 | US FAERS | |
| 357 | Tobacco user | FAERS: 3 | OFFSIDES US FAERS | |
| 358 | Tooth malformation hereditary | FAERS: 3 | US FAERS | |
| 359 | Transaminases increased | FAERS: 3 | US FAERS | |
| 360 | Vasculitis | FAERS: 3 | US FAERS | |
| 361 | Victim of homicide | FAERS: 3 | US FAERS | |
| 362 | Abulia | FAERS: 2 | US FAERS | |
| 363 | Accidental drug intake by child | FAERS: 2 | OFFSIDES US FAERS | |
| 364 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 365 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 366 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 367 | Appendicitis | FAERS: 2 | US FAERS | |
| 368 | Asthma | FAERS: 2 | SIDER US FAERS | |
| 369 | Blood alcohol increased | FAERS: 2 | US FAERS | |
| 370 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 371 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 372 | Body fat disorder | FAERS: 2 | US FAERS | |
| 373 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 374 | Choking sensation | FAERS: 2 | US FAERS | |
| 375 | Cyanosis | FAERS: 2 | 4022513 | CTD US FAERS |
| 376 | Dermatitis Herpetiformis | FAERS: 2 | US FAERS | |
| 377 | Disease recurrence | FAERS: 2 | US FAERS | |
| 378 | Dreamy state | FAERS: 2 | US FAERS | |
| 379 | Drug diversion | FAERS: 2 | US FAERS | |
| 380 | Drug effect faster than expected | FAERS: 2 | US FAERS | |
| 381 | Drug effect variable | FAERS: 2 | US FAERS | |
| 382 | Drug level above therapeutic | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 383 | Drug level decreased | FAERS: 2 | US FAERS | |
| 384 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 385 | Drug toxicity | FAERS: 2 | US FAERS | |
| 386 | Ear congestion | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 387 | Encephalitis | FAERS: 2 | OFFSIDES US FAERS | |
| 388 | Enuresis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 389 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 390 | Facial Pain | FAERS: 2 | US FAERS | |
| 391 | Facial paralysis | FAERS: 2 | US FAERS | |
| 392 | Food craving | FAERS: 2 | US FAERS | |
| 393 | Gait inability | FAERS: 2 | US FAERS | |
| 394 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 395 | Hepatitis C | FAERS: 2 | US FAERS | |
| 396 | Hepatomegaly | FAERS: 2 | 17923349 | CTD SIDER US FAERS |
| 397 | Hip surgery | FAERS: 2 | US FAERS | |
| 398 | Hirsutism | FAERS: 2 | SIDER US FAERS | |
| 399 | Hunger | FAERS: 2 | US FAERS | |
| 400 | Hypervigilance | FAERS: 2 | US FAERS | |
| 401 | Hypogeusia | FAERS: 2 | US FAERS | |
| 402 | Hypoventilation | FAERS: 2 | US FAERS | |
| 403 | Hypoxia | FAERS: 2 | OFFSIDES US FAERS | |
| 404 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 405 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 406 | Impaired self-care | FAERS: 2 | US FAERS | |
| 407 | Incorrect dose administered by product | FAERS: 2 | US FAERS | |
| 408 | Intentional misuse | FAERS: 2 | US FAERS | |
| 409 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 410 | Joint stiffness | FAERS: 2 | US FAERS | |
| 411 | Joint swelling | FAERS: 2 | SIDER US FAERS | |
| 412 | Lack of spontaneous speech | FAERS: 2 | US FAERS | |
| 413 | Laziness | FAERS: 2 | US FAERS | |
| 414 | Limb injury | FAERS: 2 | US FAERS | |
| 415 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 416 | Mastitis | FAERS: 2 | US FAERS | |
| 417 | Meniscus injury | FAERS: 2 | US FAERS | |
| 418 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 419 | Monoplegia | FAERS: 2 | OFFSIDES US FAERS | |
| 420 | Motion Sickness | FAERS: 2 | SIDER US FAERS | |
| 421 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 422 | Narcolepsy | FAERS: 2 | US FAERS | |
| 423 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 424 | Neonatal respiratory arrest | FAERS: 2 | US FAERS | |
| 425 | Neuroleptic Malignant Syndrome | FAERS: 2 | 17214072 | CTD OFFSIDES US FAERS |
| 426 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 427 | Oculomucocutaneous syndrome | FAERS: 2 | US FAERS | |
| 428 | Osteopenia | FAERS: 2 | US FAERS | |
| 429 | Pain of skin | FAERS: 2 | US FAERS | |
| 430 | Pneumonitis | FAERS: 2 | US FAERS | |
| 431 | Poor sucking reflex | FAERS: 2 | US FAERS | |
| 432 | Product complaint | FAERS: 2 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 433 | Product dispensing error | FAERS: 2 | US FAERS | |
| 434 | Product tampering | FAERS: 2 | US FAERS | |
| 435 | Prosthesis Implantation | FAERS: 2 | US FAERS | |
| 436 | Pruritus allergic | FAERS: 2 | US FAERS | |
| 437 | Psoriasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Psychomotor skills impaired | FAERS: 2 | US FAERS | |
| 439 | Scab | FAERS: 2 | OFFSIDES US FAERS | |
| 440 | Secretion discharge | FAERS: 2 | US FAERS | |
| 441 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 442 | Senile dementia | FAERS: 2 | US FAERS | |
| 443 | Sexual abuse | FAERS: 2 | US FAERS | |
| 444 | Skin laceration | FAERS: 2 | US FAERS | |
| 445 | Sleep-related eating disorder | FAERS: 2 | US FAERS | |
| 446 | Slow speech | FAERS: 2 | US FAERS | |
| 447 | Sneezing | FAERS: 2 | SIDER US FAERS | |
| 448 | Snoring | FAERS: 2 | US FAERS | |
| 449 | Somatoform Disorder | FAERS: 2 | US FAERS | |
| 450 | Staring | FAERS: 2 | US FAERS | |
| 451 | Status Epilepticus | FAERS: 2 | CTD US FAERS | |
| 452 | Stillbirth | FAERS: 2 | US FAERS | |
| 453 | Stomatitis | FAERS: 2 | US FAERS | |
| 454 | Sudden onset of sleep | FAERS: 2 | US FAERS | |
| 455 | Therapeutic agent urine negative | FAERS: 2 | US FAERS | |
| 456 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 457 | Thirst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 458 | Tumour haemorrhage | FAERS: 2 | US FAERS | |
| 459 | Urethritis | FAERS: 2 | US FAERS | |
| 460 | Urine ketone body present | FAERS: 2 | US FAERS | |
| 461 | Venous occlusion | FAERS: 2 | US FAERS | |
| 462 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 463 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 464 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 465 | Weaning failure | FAERS: 2 | US FAERS | |
| 466 | Wheelchair user | FAERS: 2 | US FAERS | |
| 467 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 468 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 469 | Abscess | FAERS: 1 | US FAERS | |
| 470 | Achlorhydria | FAERS: 1 | US FAERS | |
| 471 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 472 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 473 | Amputation | FAERS: 1 | US FAERS | |
| 474 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 475 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 476 | Aneurysm | FAERS: 1 | US FAERS | |
| 477 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 478 | Anoxic Encephalopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 479 | Anticonvulsant drug level below therapeutic | FAERS: 1 | US FAERS | |
| 480 | Antigliadin antibody positive | FAERS: 1 | US FAERS | |
| 481 | Anuria | FAERS: 1 | US FAERS | |
| 482 | Aphagia | FAERS: 1 | US FAERS | |
| 483 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 484 | Arthropod bite | FAERS: 1 | US FAERS | |
| 485 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 486 | Asthenopia | FAERS: 1 | US FAERS | |
| 487 | Astigmatism | FAERS: 1 | US FAERS | |
| 488 | Automatism | FAERS: 1 | OFFSIDES US FAERS | |
| 489 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 490 | Autophobia | FAERS: 1 | US FAERS | |
| 491 | Aversion | FAERS: 1 | US FAERS | |
| 492 | Barbiturates positive | FAERS: 1 | US FAERS | |
| 493 | Behavioral addiction | FAERS: 1 | US FAERS | |
| 494 | Belligerence | FAERS: 1 | US FAERS | |
| 495 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 496 | Benzodiazepine drug level increased | FAERS: 1 | US FAERS | |
| 497 | Binge Drinking | FAERS: 1 | US FAERS | |
| 498 | Bipolar I disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 499 | Bladder sphincter atony | FAERS: 1 | US FAERS | |
| 500 | Blighted ovum | FAERS: 1 | US FAERS | |
| 501 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 502 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 503 | Blood creatinine increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 504 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 505 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 506 | Blood immunoglobulin M increased | FAERS: 1 | US FAERS | |
| 507 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 508 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 509 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 510 | Blood prolactin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 511 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 512 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 513 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 514 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 515 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 516 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 517 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 518 | Cell Death | FAERS: 1 | US FAERS | |
| 519 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 520 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 521 | Cheilitis | FAERS: 1 | US FAERS | |
| 522 | Choanal Atresia | FAERS: 1 | US FAERS | |
| 523 | Cholecystitis | FAERS: 1 | US FAERS | |
| 524 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 525 | Chorea | FAERS: 1 | SIDER US FAERS | |
| 526 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 527 | Chromaturia | FAERS: 1 | SIDER US FAERS | |
| 528 | Clonus | FAERS: 1 | US FAERS | |
| 529 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 530 | Colectomy | FAERS: 1 | US FAERS | |
| 531 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 532 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 533 | Congenital neoplasm | FAERS: 1 | US FAERS | |
| 534 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 535 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 536 | Cyst | FAERS: 1 | US FAERS | |
| 537 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 538 | Death of companion | FAERS: 1 | US FAERS | |
| 539 | Decreased eye contact | FAERS: 1 | US FAERS | |
| 540 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 541 | Demyelination | FAERS: 1 | US FAERS | |
| 542 | Dengue Fever | FAERS: 1 | US FAERS | |
| 543 | Device breakage | FAERS: 1 | US FAERS | |
| 544 | Device computer issue | FAERS: 1 | US FAERS | |
| 545 | Device defective | FAERS: 1 | US FAERS | |
| 546 | Device dislocation | FAERS: 1 | US FAERS | |
| 547 | Device occlusion | FAERS: 1 | US FAERS | |
| 548 | Device related infection | FAERS: 1 | US FAERS | |
| 549 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 550 | Diplegia | FAERS: 1 | US FAERS | |
| 551 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 552 | Drowning | FAERS: 1 | US FAERS | |
| 553 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 554 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 555 | Drug half-life reduced | FAERS: 1 | US FAERS | |
| 556 | Drug level increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | Drug monitoring procedure incorrectly performed | FAERS: 1 | US FAERS | |
| 558 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 559 | Echopraxia | FAERS: 1 | US FAERS | |
| 560 | Educational problem | FAERS: 1 | US FAERS | |
| 561 | Elder Abuse | FAERS: 1 | US FAERS | |
| 562 | Electrocardiogram RR interval prolonged | FAERS: 1 | US FAERS | |
| 563 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 564 | Emotional poverty | FAERS: 1 | US FAERS | |
| 565 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 566 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 567 | Epileptic aura | FAERS: 1 | US FAERS | |
| 568 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 569 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 570 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 571 | Executive dysfunction | FAERS: 1 | US FAERS | |
| 572 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 573 | Expired drug administered | FAERS: 1 | US FAERS | |
| 574 | Exposure to allergen | FAERS: 1 | US FAERS | |
| 575 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 576 | False positive investigation result | FAERS: 1 | US FAERS | |
| 577 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 578 | Fibroadenoma of breast | FAERS: 1 | US FAERS | |
| 579 | Flat affect | FAERS: 1 | SIDER US FAERS | |
| 580 | Flight of ideas | FAERS: 1 | US FAERS | |
| 581 | Folliculitis | FAERS: 1 | US FAERS | |
| 582 | Fracture | FAERS: 1 | SIDER US FAERS | |
| 583 | Frustration | FAERS: 1 | US FAERS | |
| 584 | Gamma-glutamyltransferase abnormal | FAERS: 1 | US FAERS | |
| 585 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 586 | Gastric infection | FAERS: 1 | US FAERS | |
| 587 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 588 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 589 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 590 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 591 | Gastrointestinal inflammation | FAERS: 1 | SIDER US FAERS | |
| 592 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 593 | Gastrostomy | FAERS: 1 | OFFSIDES US FAERS | |
| 594 | General symptom | FAERS: 1 | US FAERS | |
| 595 | Gingival Recession | FAERS: 1 | US FAERS | |
| 596 | Gingival erythema | FAERS: 1 | US FAERS | |
| 597 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 598 | Hair metal test abnormal | FAERS: 1 | US FAERS | |
| 599 | Head Banging | FAERS: 1 | US FAERS | |
| 600 | Hemiplegia | FAERS: 1 | US FAERS | |
| 601 | Hypercapnic coma | FAERS: 1 | US FAERS | |
| 602 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 603 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 604 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 605 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 606 | Hypotonic urinary bladder | FAERS: 1 | US FAERS | |
| 607 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 608 | Iliotibial Band Syndrome | FAERS: 1 | US FAERS | |
| 609 | Immobile | FAERS: 1 | US FAERS | |
| 610 | Immunosuppression | FAERS: 1 | US FAERS | |
| 611 | Impaired gastric emptying | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 612 | Inappropriate Prescribing | FAERS: 1 | US FAERS | |
| 613 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 614 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 615 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 616 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 617 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 618 | Increased upper airway secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 619 | Inflammation | FAERS: 1 | SIDER US FAERS | |
| 620 | Injection site erythema | FAERS: 1 | US FAERS | |
| 621 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 622 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 623 | Insurance issue | FAERS: 1 | US FAERS | |
| 624 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 625 | Intelligence test abnormal | FAERS: 1 | US FAERS | |
| 626 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 627 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 628 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 629 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 630 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 631 | Keratoconus | FAERS: 1 | US FAERS | |
| 632 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 633 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 634 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 635 | Laryngitis | FAERS: 1 | US FAERS | |
| 636 | Lentigo | FAERS: 1 | US FAERS | |
| 637 | Leukocytosis | FAERS: 1 | US FAERS | |
| 638 | Leukoencephalopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 639 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 640 | Limb discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 641 | Loose tooth | FAERS: 1 | US FAERS | |
| 642 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 643 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 644 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 645 | Meningitis | FAERS: 1 | US FAERS | |
| 646 | Mental Retardation | FAERS: 1 | US FAERS | |
| 647 | Mental disorder due to a general medical condition | FAERS: 1 | OFFSIDES US FAERS | |
| 648 | Mesenteric vascular insufficiency | FAERS: 1 | US FAERS | |
| 649 | Metastasis | FAERS: 1 | US FAERS | |
| 650 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 651 | Moaning | FAERS: 1 | US FAERS | |
| 652 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 653 | Multiple allergies | FAERS: 1 | US FAERS | |
| 654 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 655 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 656 | Muscle strain | FAERS: 1 | US FAERS | |
| 657 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 658 | Mutism | FAERS: 1 | US FAERS | |
| 659 | Myasthenia Gravis | FAERS: 1 | 18154484 | CTD US FAERS |
| 660 | Myoclonic Epilepsy | FAERS: 1 | OFFSIDES US FAERS | |
| 661 | Myosclerosis | FAERS: 1 | US FAERS | |
| 662 | Nail picking | FAERS: 1 | US FAERS | |
| 663 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 664 | Negative thoughts | FAERS: 1 | US FAERS | |
| 665 | Neonatal infection | FAERS: 1 | US FAERS | |
| 666 | Neuritis | FAERS: 1 | US FAERS | |
| 667 | Neutropenia | FAERS: 1 | US FAERS | |
| 668 | Nocturia | FAERS: 1 | SIDER US FAERS | |
| 669 | Nodule | FAERS: 1 | US FAERS | |
| 670 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 671 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 672 | Oral discharge | FAERS: 1 | US FAERS | |
| 673 | Oral pain | FAERS: 1 | US FAERS | |
| 674 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 675 | Osteosarcoma | FAERS: 1 | US FAERS | |
| 676 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 677 | Parasomnia | FAERS: 1 | US FAERS | |
| 678 | Patient dissatisfaction with treatment | FAERS: 1 | US FAERS | |
| 679 | Pericardial Cyst | FAERS: 1 | US FAERS | |
| 680 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 681 | Pertussis | FAERS: 1 | US FAERS | |
| 682 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 683 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 684 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 685 | Polyneuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 686 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 687 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 688 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 689 | Post procedural complication | FAERS: 1 | US FAERS | |
| 690 | Postural reflex impairment | FAERS: 1 | US FAERS | |
| 691 | Posturing | FAERS: 1 | US FAERS | |
| 692 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 693 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 694 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 695 | Procedural complication | FAERS: 1 | US FAERS | |
| 696 | Product administration error | FAERS: 1 | US FAERS | |
| 697 | Product closure issue | FAERS: 1 | US FAERS | |
| 698 | Product container issue | FAERS: 1 | US FAERS | |
| 699 | Product deposit | FAERS: 1 | US FAERS | |
| 700 | Product dose omission | FAERS: 1 | US FAERS | |
| 701 | Product friable | FAERS: 1 | US FAERS | |
| 702 | Product lot number issue | FAERS: 1 | US FAERS | |
| 703 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 704 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 705 | Product shape issue | FAERS: 1 | US FAERS | |
| 706 | Proteinuria | FAERS: 1 | US FAERS | |
| 707 | Psychological Trauma | FAERS: 1 | US FAERS | |
| 708 | Psychotic symptom | FAERS: 1 | US FAERS | |
| 709 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 710 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 711 | Purpura | FAERS: 1 | US FAERS | |
| 712 | Radiation injury | FAERS: 1 | US FAERS | |
| 713 | Rebound effect | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 714 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 715 | Rosacea | FAERS: 1 | US FAERS | |
| 716 | School refusal | FAERS: 1 | US FAERS | |
| 717 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 718 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 719 | Shock | FAERS: 1 | US FAERS | |
| 720 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 721 | Single umbilical artery | FAERS: 1 | US FAERS | |
| 722 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 723 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 724 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 725 | Skin lesion | FAERS: 1 | US FAERS | |
| 726 | Skin reaction | FAERS: 1 | US FAERS | |
| 727 | Sleep Talking | FAERS: 1 | OFFSIDES US FAERS | |
| 728 | Soliloquy | FAERS: 1 | US FAERS | |
| 729 | Somatic symptom disorder of pregnancy | FAERS: 1 | US FAERS | |
| 730 | Spinal column injury | FAERS: 1 | US FAERS | |
| 731 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 732 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 733 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 734 | Suture rupture | FAERS: 1 | US FAERS | |
| 735 | Tablet issue | FAERS: 1 | US FAERS | |
| 736 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 737 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 738 | Terminal state | FAERS: 1 | US FAERS | |
| 739 | Throat cancer | FAERS: 1 | US FAERS | |
| 740 | Tongue blistering | FAERS: 1 | US FAERS | |
| 741 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 742 | Tonsillitis | FAERS: 1 | US FAERS | |
| 743 | Tooth Loss | FAERS: 1 | US FAERS | |
| 744 | Torticollis | FAERS: 1 | US FAERS | |
| 745 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 746 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 747 | Transcription medication error | FAERS: 1 | US FAERS | |
| 748 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 749 | Trismus | FAERS: 1 | US FAERS | |
| 750 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 751 | Unemployment | FAERS: 1 | US FAERS | |
| 752 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 753 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 754 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 755 | Urine barbiturates increased | FAERS: 1 | US FAERS | |
| 756 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 757 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 758 | Vibration test abnormal | FAERS: 1 | US FAERS | |
| 759 | Vibratory sense increased | FAERS: 1 | US FAERS | |
| 760 | Victim of chemical submission | FAERS: 1 | US FAERS | |
| 761 | Victim of sexual abuse | FAERS: 1 | US FAERS | |
| 762 | Visual brightness | FAERS: 1 | US FAERS | |
| 763 | Visual disturbance | FAERS: 1 | SIDER US FAERS | |
| 764 | Vitiligo | FAERS: 1 | US FAERS | |
| 765 | Walking aid user | FAERS: 1 | OFFSIDES US FAERS | |
| 766 | Waxy flexibility | FAERS: 1 | US FAERS | |
| 767 | Wheezing | FAERS: 1 | US FAERS | |
| 768 | Withdrawal catatonia | FAERS: 1 | US FAERS | |
| 769 | Wrong drug | FAERS: 1 | US FAERS | |
| 770 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 771 | Yawning | FAERS: 1 | SIDER US FAERS | |
| 772 | jaundice | FAERS: 1 | 17923349 | CTD US FAERS |
| 773 | Abdominal Infection | OFFSIDES | ||
| 774 | Abuse | OFFSIDES | ||
| 775 | Acid reflux | OFFSIDES | ||
| 776 | Acromegaly | OFFSIDES | ||
| 777 | Acute sinusitis | OFFSIDES | ||
| 778 | Aggressive reaction | SIDER | ||
| 779 | Akathisia, Drug-Induced | 24568368 | CTD | |
| 780 | Akinesia | SIDER | ||
| 781 | Alcoholic Intoxication | OFFSIDES | ||
| 782 | Alien Hand Syndrome | 20220444 | CTD | |
| 783 | Allergy test positive | OFFSIDES | ||
| 784 | Altered bowel function | OFFSIDES | ||
| 785 | Ammonia increased | OFFSIDES | ||
| 786 | Analgesia | OFFSIDES | ||
| 787 | Anticonvulsant drug level decreased | OFFSIDES | ||
| 788 | Anxiety Disorders | CTD | ||
| 789 | Aortic bypass | OFFSIDES | ||
| 790 | Apnea | 4022513 | CTD | |
| 791 | Application site erythema | OFFSIDES | ||
| 792 | Application site rash | OFFSIDES | ||
| 793 | Application site scar | OFFSIDES | ||
| 794 | Application site vesicles | OFFSIDES | ||
| 795 | Aspiration Pneumonia | OFFSIDES | ||
| 796 | Attention Deficit and Disruptive Behavior Disorders | 1904374 | CTD | |
| 797 | Aura | OFFSIDES | ||
| 798 | Auricular swelling | OFFSIDES | ||
| 799 | Biliary Dyskinesia | OFFSIDES | ||
| 800 | Bladder dysfunction | SIDER | ||
| 801 | Blood Coagulation Disorders | 17923349 | CTD | |
| 802 | Blood Glucose | OFFSIDES | ||
| 803 | Blood chloride decreased | OFFSIDES | ||
| 804 | Blood potassium increased | OFFSIDES | ||
| 805 | Blood sodium | OFFSIDES | ||
| 806 | Blurred vision | OFFSIDES | ||
| 807 | Body Temperature | OFFSIDES | ||
| 808 | Brain Diseases | 17456340 | CTD | |
| 809 | Brain Injuries | 3607518 | CTD | |
| 810 | Breakthrough Pain | OFFSIDES | ||
| 811 | Bundle-Branch Block | 12547310 | CTD | |
| 812 | Bursitis | OFFSIDES | ||
| 813 | Causalgia | 2081681 | CTD | |
| 814 | Cellulitis | SIDER | ||
| 815 | Cerebellar Ataxia | 11096749 | CTD | |
| 816 | Cervicobrachial syndrome | OFFSIDES | ||
| 817 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 818 | Chronic respiratory failure | OFFSIDES | ||
| 819 | Conduct Disorder | 2565491 | CTD | |
| 820 | Confabulation | OFFSIDES | ||
| 821 | Confusion | 2860211 | CTD | |
| 822 | Contracture | OFFSIDES | ||
| 823 | Cramps of lower extremities | SIDER | ||
| 824 | Creatinine renal clearance decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 825 | Cystitis | SIDER | ||
| 826 | Dental prosthesis placement | OFFSIDES | ||
| 827 | Depressive disorder | 11511412 14742781 | CTD | |
| 828 | Dermatitis | SIDER | ||
| 829 | Diabetes | OFFSIDES | ||
| 830 | Diarrhea | OFFSIDES | ||
| 831 | Disorders of Excessive Somnolence | CTD | ||
| 832 | Disruptive, Impulse Control, and Conduct Disorders | 121707 | CTD | |
| 833 | Disturbance in sexual arousal | SIDER | ||
| 834 | Diverticulum | OFFSIDES | ||
| 835 | Dreaming excessive | SIDER | ||
| 836 | Drowsiness | OFFSIDES SIDER | ||
| 837 | Drug addict | OFFSIDES | ||
| 838 | Drug administered at inappropriate site | OFFSIDES | ||
| 839 | Drug withdrawal headache | OFFSIDES | ||
| 840 | Dysdiadochokinesis | SIDER | ||
| 841 | Dyskinesia, Drug-Induced | 1111773 8166329 | CTD | |
| 842 | Dysthymic Disorder | OFFSIDES | ||
| 843 | Eczema | OFFSIDES | ||
| 844 | Edema | 17923349 | CTD | |
| 845 | Ejaculation decreased | SIDER | ||
| 846 | Electrocardiogram ST-T change | OFFSIDES | ||
| 847 | Eosinophilia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 848 | Epilepsies, Partial | 11558140 | CTD | |
| 849 | Epilepsy, Complex Partial | 453362 806277 | CTD | |
| 850 | Epilepsy, Temporal Lobe | 4032590 | CTD | |
| 851 | Eustachian tube disorder | OFFSIDES | ||
| 852 | Excitability | SIDER | ||
| 853 | Exposure via breast milk | Canada Vigilance: 1 | Canada Vigilance | |
| 854 | Galactorrhea | OFFSIDES | ||
| 855 | Gambling | OFFSIDES | ||
| 856 | Gastrointestinal perforation | OFFSIDES | ||
| 857 | Glasgow coma scale | OFFSIDES | ||
| 858 | Gout | SIDER | ||
| 859 | Hallucinations | 7057171 12815661 | CTD | |
| 860 | Headache fullness | SIDER | ||
| 861 | Heartburn | SIDER | ||
| 862 | Hepatic Infection | OFFSIDES | ||
| 863 | Hoarseness | SIDER | ||
| 864 | Hordeolum | SIDER | ||
| 865 | Hunger abnormal | SIDER | ||
| 866 | Hyperkinesia | SIDER | ||
| 867 | Hyperphagia | SIDER | ||
| 868 | Hyperpigmentation | OFFSIDES | ||
| 869 | Hysteria | SIDER | ||
| 870 | Incomplete precocious puberty | SIDER | ||
| 871 | Incontinence | SIDER | ||
| 872 | Increased bronchial secretion | Canada Vigilance: 1 | Canada Vigilance | |
| 873 | Infectious Mononucleosis | SIDER | ||
| 874 | Infusion site mobility decreased | OFFSIDES | ||
| 875 | Infusion site pain | OFFSIDES | ||
| 876 | Intention tremor | OFFSIDES | ||
| 877 | Intervertebral disc disorder | OFFSIDES | ||
| 878 | Intracranial Aneurysm | OFFSIDES | ||
| 879 | Intraocular inflammation | OFFSIDES | ||
| 880 | Knee pain | SIDER | ||
| 881 | Labile blood pressure | OFFSIDES | ||
| 882 | Lassitude | SIDER | ||
| 883 | Leukoaraiosis | OFFSIDES | ||
| 884 | Leukoencephalomyelitis | OFFSIDES | ||
| 885 | Lightheadedness | SIDER | ||
| 886 | Livedo Reticularis | OFFSIDES | ||
| 887 | Liver Failure, Acute | 17923349 | CTD | |
| 888 | Low Back Pain | SIDER | ||
| 889 | Lymphadenopathy | SIDER | ||
| 890 | Lymphoid tissue hyperplasia | OFFSIDES | ||
| 891 | Malnutrition | SIDER | ||
| 892 | Medical device implantation | OFFSIDES | ||
| 893 | Meige Syndrome | 11555353 | CTD | |
| 894 | Menorrhagia | SIDER | ||
| 895 | Mononeuritis | OFFSIDES | ||
| 896 | Movement Disorders | 932745 | CTD | |
| 897 | Multiple sclerosis relapse | OFFSIDES | ||
| 898 | Muscle Weakness | OFFSIDES | ||
| 899 | Muscle relaxant therapy | SIDER | ||
| 900 | Myoglobin blood increased | OFFSIDES | ||
| 901 | Nervous tension | OFFSIDES | ||
| 902 | Neurobehavioral Manifestations | 1904374 2903143 3504409 | CTD | |
| 903 | Oral fungal infection | OFFSIDES | ||
| 904 | Orchitis | OFFSIDES | ||
| 905 | Pancreatic Insufficiency | OFFSIDES | ||
| 906 | Pancreatic Neoplasm | OFFSIDES | ||
| 907 | Paresis | SIDER | ||
| 908 | Parkinson Disease | 12588639 | CTD | |
| 909 | Parkinsonian Disorders | 1362592 | CTD | |
| 910 | Personality Disorders | 3569889 3785507 | CTD | |
| 911 | Platybasia | OFFSIDES | ||
| 912 | Pleurisy | SIDER | ||
| 913 | Polyuria | SIDER | ||
| 914 | Prenatal Exposure Delayed Effects | 4022513 | CTD | |
| 915 | Prolonged menses | SIDER | ||
| 916 | Pseudodementia | OFFSIDES | ||
| 917 | Psychomotor Agitation | 1362592 1949970 | CTD | |
| 918 | Psychoses, Substance-Induced | 7057171 10386162 20220444 | CTD | |
| 919 | Pulmonary function test decreased | SIDER | ||
| 920 | Pyelonephritis | OFFSIDES | ||
| 921 | REM Sleep Behavior Disorder | 12815661 | CTD | |
| 922 | Rage | SIDER | ||
| 923 | Renal mass | OFFSIDES | ||
| 924 | Respiratory Insufficiency | 3777263 | CTD | |
| 925 | Respiratory tract congestion | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 926 | Retinal Diseases | 14700107 | CTD | |
| 927 | Scotoma | SIDER | ||
| 928 | Seizures |
743650
1334454 1511512 1656808 1904374 2400986 2903143 2917546 2978064 3575358 3607518 3724361 3832950 7554689 8099687 9046859 9121607 10513564 10728915 10838112 12547310 14704468 15866510 17956996 20553923 20573177 | CTD | |
| 929 | Sensorimotor disorder | OFFSIDES | ||
| 930 | Shivering | SIDER | ||
| 931 | Sinus headache | OFFSIDES | ||
| 932 | Sinus pain | OFFSIDES | ||
| 933 | Skeletal injury | OFFSIDES | ||
| 934 | Skin hypertrophy | OFFSIDES | ||
| 935 | Sleep Apnea, Obstructive | 10646174 | CTD | |
| 936 | Sleep Initiation and Maintenance Disorders | 1949970 12530413 15341891 | CTD | |
| 937 | Sleep Wake Disorders | CTD | ||
| 938 | Slurred speech | SIDER | ||
| 939 | Sneezing excessive | SIDER | ||
| 940 | Speech Disorders | 1949970 | CTD | |
| 941 | Spinal fusion surgery | OFFSIDES | ||
| 942 | Sprain | SIDER | ||
| 943 | Substance Withdrawal Syndrome | CTD | ||
| 944 | Suicide | SIDER | ||
| 945 | Thalamic infarction | OFFSIDES | ||
| 946 | Thrombophlebitis of the leg | SIDER | ||
| 947 | Thrombophlebitis | SIDER | ||
| 948 | Tooth Infection | OFFSIDES | ||
| 949 | Trichorrhexis | Canada Vigilance: 1 | Canada Vigilance | |
| 950 | Upset stomach | SIDER | ||
| 951 | Urinary tract infection pseudomonal | OFFSIDES | ||
| 952 | Vena cava filter insertion | OFFSIDES | ||
| 953 | Ventricular hypokinesia | OFFSIDES | ||
| 954 | Weight Gain | OFFSIDES | ||
| 955 | Xeroderma | SIDER | ||
| 956 | Xerophthalmia | SIDER | ||
| 957 | effusion | OFFSIDES | ||
| 958 | muscle injury | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.